From 64643a0ccd4c50332a4fbbb2af95d50ccefa6749 Mon Sep 17 00:00:00 2001 From: Shay Hadar Date: Tue, 1 Jun 2021 14:40:52 +0300 Subject: [PATCH 01/28] Update package.json --- package.json | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/package.json b/package.json index f84ecaa..1d74c8f 100644 --- a/package.json +++ b/package.json @@ -7,8 +7,8 @@ }, "dependencies": { "@angular/flex-layout": "^10.0.0-beta.32", - "@exlibris/exl-cloudapp-angular-lib": "^0.2.2", - "@exlibris/exl-cloudapp-base": "^0.2.2", + "@exlibris/exl-cloudapp-angular-lib": "^1.0.1", + "@exlibris/exl-cloudapp-base": "^1.0.1", "font-awesome": "^4.7.0", "sweetalert2": "^9.17.1" } From 7a3e196407472f973c0fe0f3e4b037a818b6ce83 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Tue, 15 Jun 2021 10:49:33 +0300 Subject: [PATCH 02/28] Adding main menu Rearrangement of the folders and files --- .vscode/settings.json | 7 +- cloudapp/src/app/app-routing.module.ts | 12 +- cloudapp/src/app/app.component.ts | 2 +- cloudapp/src/app/app.module.ts | 16 +- .../configuration/configuration.component.ts | 5 +- .../error-message.component.html | 11 - .../error-message.component.scss | 27 - .../error-message/error-message.component.ts | 20 - .../src/app/{ => holdings}/form/form-utils.ts | 0 .../{ => holdings}/form/form.component.html | 0 .../{ => holdings}/form/form.component.scss | 0 .../app/{ => holdings}/form/form.component.ts | 4 +- .../app/{ => holdings}/help/help.component.ts | 0 .../{ => holdings}/holdings.component.html | 2 +- .../{ => holdings}/holdings.component.scss | 0 .../{ => holdings}/holdings.component.ts | 6 +- .../{ => holdings}/main/main.component.html | 17 +- .../src/app/holdings/main/main.component.scss | 20 + .../app/{ => holdings}/main/main.component.ts | 4 +- .../app/main-menu/main-menu.component.html | 7 + .../app/main-menu/main-menu.component.scss | 3 + .../src/app/main-menu/main-menu.component.ts | 52 + cloudapp/src/app/main/main.component.scss | 10 - cloudapp/src/app/{ => service}/app.service.ts | 22 +- cloudapp/src/app/service/base.service.ts | 74 + .../src/app/service/configuration.service.ts | 21 + .../holdings.service.ts} | 74 +- cloudapp/src/i18n/en.json | 5 + cloudapp/src/i18n/jp.json | 21 +- cloudapp/src/main.scss | 2 +- ...n.component.theme.scss => main.theme.scss} | 0 manifest.json | 4 +- package-lock.json | 13260 +++++++++++++++- 33 files changed, 13508 insertions(+), 200 deletions(-) delete mode 100644 cloudapp/src/app/error-message/error-message.component.html delete mode 100644 cloudapp/src/app/error-message/error-message.component.scss delete mode 100644 cloudapp/src/app/error-message/error-message.component.ts rename cloudapp/src/app/{ => holdings}/form/form-utils.ts (100%) rename cloudapp/src/app/{ => holdings}/form/form.component.html (100%) rename cloudapp/src/app/{ => holdings}/form/form.component.scss (100%) rename cloudapp/src/app/{ => holdings}/form/form.component.ts (97%) rename cloudapp/src/app/{ => holdings}/help/help.component.ts (100%) rename cloudapp/src/app/holdings/{ => holdings}/holdings.component.html (98%) rename cloudapp/src/app/holdings/{ => holdings}/holdings.component.scss (100%) rename cloudapp/src/app/holdings/{ => holdings}/holdings.component.ts (96%) rename cloudapp/src/app/{ => holdings}/main/main.component.html (67%) create mode 100644 cloudapp/src/app/holdings/main/main.component.scss rename cloudapp/src/app/{ => holdings}/main/main.component.ts (95%) create mode 100644 cloudapp/src/app/main-menu/main-menu.component.html create mode 100644 cloudapp/src/app/main-menu/main-menu.component.scss create mode 100644 cloudapp/src/app/main-menu/main-menu.component.ts delete mode 100644 cloudapp/src/app/main/main.component.scss rename cloudapp/src/app/{ => service}/app.service.ts (95%) create mode 100644 cloudapp/src/app/service/base.service.ts create mode 100644 cloudapp/src/app/service/configuration.service.ts rename cloudapp/src/app/{nacsis.service.ts => service/holdings.service.ts} (75%) rename cloudapp/src/{app/main/main.component.theme.scss => main.theme.scss} (100%) diff --git a/.vscode/settings.json b/.vscode/settings.json index 68f08ab..bb42cea 100644 --- a/.vscode/settings.json +++ b/.vscode/settings.json @@ -15,6 +15,11 @@ ], "url": "/node_modules/@exlibris/exl-cloudapp-base/manifest.schema.json" } - ] + ], + "workbench.colorCustomizations": { + "activityBar.background": "#4E0E59", + "titleBar.activeBackground": "#6D147D", + "titleBar.activeForeground": "#FEFCFE" + } } \ No newline at end of file diff --git a/cloudapp/src/app/app-routing.module.ts b/cloudapp/src/app/app-routing.module.ts index 9bf367c..335553f 100644 --- a/cloudapp/src/app/app-routing.module.ts +++ b/cloudapp/src/app/app-routing.module.ts @@ -1,13 +1,15 @@ import { NgModule } from '@angular/core'; import { Routes, RouterModule } from '@angular/router'; -import { MainComponent } from './main/main.component'; -import { HoldingsComponent } from './holdings/holdings.component'; -import { FormComponent } from './form/form.component'; +import { MainComponent } from './holdings/main/main.component'; +import { HoldingsComponent } from './holdings/holdings/holdings.component'; +import { FormComponent } from './holdings/form/form.component'; import { ConfigurationComponent } from './configuration/configuration.component'; -import { HelpComponent } from './help/help.component'; +import { HelpComponent } from './holdings/help/help.component'; +import { MainMenuComponent } from './main-menu/main-menu.component'; const routes: Routes = [ - { path: '', component: MainComponent }, + { path: '', component: MainMenuComponent }, + { path: 'holdings', component: MainComponent }, { path: 'configuration', component: ConfigurationComponent }, { path: 'holdings/:mmsId/:mmsTitle', component: HoldingsComponent }, { path: 'holdings/:mmsId/edit/:holdingId/:mmsTitle', component: FormComponent }, diff --git a/cloudapp/src/app/app.component.ts b/cloudapp/src/app/app.component.ts index 32e4548..1de56d8 100644 --- a/cloudapp/src/app/app.component.ts +++ b/cloudapp/src/app/app.component.ts @@ -1,5 +1,5 @@ import { Component } from '@angular/core'; -import { AppService } from './app.service'; +import { AppService } from './service/app.service'; @Component({ selector: 'app-root', diff --git a/cloudapp/src/app/app.module.ts b/cloudapp/src/app/app.module.ts index e9d9bb5..3979ff6 100644 --- a/cloudapp/src/app/app.module.ts +++ b/cloudapp/src/app/app.module.ts @@ -2,16 +2,16 @@ import { NgModule } from '@angular/core'; import { HttpClientModule } from '@angular/common/http'; import { BrowserModule } from '@angular/platform-browser'; import { BrowserAnimationsModule } from '@angular/platform-browser/animations'; -import { MaterialModule, getTranslateModule, AlertModule } from '@exlibris/exl-cloudapp-angular-lib'; +import { MaterialModule, getTranslateModule, AlertModule, MenuModule } from '@exlibris/exl-cloudapp-angular-lib'; import { ToastrModule } from 'ngx-toastr'; import { FormsModule, ReactiveFormsModule } from '@angular/forms'; import { AppComponent } from './app.component'; import { AppRoutingModule } from './app-routing.module'; -import { MainComponent } from './main/main.component'; +import { MainComponent } from './holdings/main/main.component'; import { FooterComponent } from './footer/footer.component'; -import { HoldingsComponent } from './holdings/holdings.component'; -import { FormComponent } from './form/form.component'; +import { HoldingsComponent } from './holdings/holdings/holdings.component'; +import { FormComponent } from './holdings/form/form.component'; import { ConfigurationComponent } from './configuration/configuration.component'; import { FlexLayoutModule } from '@angular/flex-layout'; @@ -19,8 +19,9 @@ import { FlexLayoutModule } from '@angular/flex-layout'; import {MatDialogModule} from '@angular/material/dialog'; import {ConfirmationDialog} from './dialog/confirmation-dialog.component'; -import {ErrorMessageComponent} from './error-message/error-message.component'; -import { HelpComponent } from './help/help.component'; +import { HelpComponent } from './holdings/help/help.component'; +import { MainMenuComponent } from './main-menu/main-menu.component'; + export function getToastrModule() { return ToastrModule.forRoot({ @@ -38,8 +39,8 @@ export function getToastrModule() { FormComponent, ConfigurationComponent, ConfirmationDialog, - ErrorMessageComponent, HelpComponent, + MainMenuComponent, ], entryComponents: [ConfirmationDialog], imports: [ @@ -55,6 +56,7 @@ export function getToastrModule() { getToastrModule(), FlexLayoutModule, AlertModule, + MenuModule, ], providers: [], bootstrap: [ diff --git a/cloudapp/src/app/configuration/configuration.component.ts b/cloudapp/src/app/configuration/configuration.component.ts index df906ac..015e632 100644 --- a/cloudapp/src/app/configuration/configuration.component.ts +++ b/cloudapp/src/app/configuration/configuration.component.ts @@ -3,7 +3,8 @@ import { FormBuilder, FormGroup } from '@angular/forms'; import { CloudAppConfigService } from '@exlibris/exl-cloudapp-angular-lib'; //import { ToastrService } from 'ngx-toastr'; import { TranslateService } from '@ngx-translate/core'; -import { NacsisService } from '../nacsis.service'; +import { HoldingsService } from '../service/holdings.service'; +import { ConfigurationService } from '../service/configuration.service'; import { AlertService } from '@exlibris/exl-cloudapp-angular-lib'; @@ -21,7 +22,7 @@ export class ConfigurationComponent implements OnInit { private configService: CloudAppConfigService, //private toastr: ToastrService, private translate: TranslateService, - private nacsis: NacsisService, + private nacsis: ConfigurationService, private alert: AlertService ) { } diff --git a/cloudapp/src/app/error-message/error-message.component.html b/cloudapp/src/app/error-message/error-message.component.html deleted file mode 100644 index 9f4a973..0000000 --- a/cloudapp/src/app/error-message/error-message.component.html +++ /dev/null @@ -1,11 +0,0 @@ -
- -
-

{{title}}

- {{message}} -
-
\ No newline at end of file diff --git a/cloudapp/src/app/error-message/error-message.component.scss b/cloudapp/src/app/error-message/error-message.component.scss deleted file mode 100644 index d3d57c0..0000000 --- a/cloudapp/src/app/error-message/error-message.component.scss +++ /dev/null @@ -1,27 +0,0 @@ -.error-message { - //background-color: #e54746; // alma - border: 2px solid #bd362f; - border-radius: 5px; - margin-top: 5px; - margin-bottom: 15px; -} - -.close-icon{ - display: block; - color: white; -} - -.close-button { - background-color:#bd362f!important; - width: 35px!important; - min-width: unset!important; - margin-top: -2px!important; -} - -.message-area-all { - margin-left: 10px; -} - -.message-area { - margin-bottom: 15px; -} \ No newline at end of file diff --git a/cloudapp/src/app/error-message/error-message.component.ts b/cloudapp/src/app/error-message/error-message.component.ts deleted file mode 100644 index f446c5f..0000000 --- a/cloudapp/src/app/error-message/error-message.component.ts +++ /dev/null @@ -1,20 +0,0 @@ - -import { Component, Input, Output, EventEmitter } from '@angular/core'; // First, import Input - - -@Component({ - selector: 'error-message-inpu-output', - templateUrl: 'error-message.component.html', - styleUrls: ['error-message.component.scss'] - }) -export class ErrorMessageComponent { - @Input() title: string; - @Input() message: string; - - @Output() onCloseEvent = new EventEmitter(); - - onCloseClick() { - this.onCloseEvent.emit(); - } - -} \ No newline at end of file diff --git a/cloudapp/src/app/form/form-utils.ts b/cloudapp/src/app/holdings/form/form-utils.ts similarity index 100% rename from cloudapp/src/app/form/form-utils.ts rename to cloudapp/src/app/holdings/form/form-utils.ts diff --git a/cloudapp/src/app/form/form.component.html b/cloudapp/src/app/holdings/form/form.component.html similarity index 100% rename from cloudapp/src/app/form/form.component.html rename to cloudapp/src/app/holdings/form/form.component.html diff --git a/cloudapp/src/app/form/form.component.scss b/cloudapp/src/app/holdings/form/form.component.scss similarity index 100% rename from cloudapp/src/app/form/form.component.scss rename to cloudapp/src/app/holdings/form/form.component.scss diff --git a/cloudapp/src/app/form/form.component.ts b/cloudapp/src/app/holdings/form/form.component.ts similarity index 97% rename from cloudapp/src/app/form/form.component.ts rename to cloudapp/src/app/holdings/form/form.component.ts index d9d5647..84ac22e 100644 --- a/cloudapp/src/app/form/form.component.ts +++ b/cloudapp/src/app/holdings/form/form.component.ts @@ -2,7 +2,7 @@ import { Component, OnInit, ElementRef, ViewChild } from '@angular/core'; import { ActivatedRoute, Router } from '@angular/router'; import { FormGroup, FormControl } from '@angular/forms'; import { TranslateService } from '@ngx-translate/core'; -import { NacsisService, Holding, HoldingsBook, HoldingsSerial, Header } from '../nacsis.service'; +import { HoldingsService, Holding, HoldingsBook, HoldingsSerial, Header } from '../../service/holdings.service'; import { holdingFormGroup } from './form-utils'; import { AlertService } from '@exlibris/exl-cloudapp-angular-lib'; @@ -39,7 +39,7 @@ export class FormComponent implements OnInit { private route: ActivatedRoute, private router: Router, private translate: TranslateService, - private nacsis: NacsisService, + private nacsis: HoldingsService, private alert: AlertService ) { } diff --git a/cloudapp/src/app/help/help.component.ts b/cloudapp/src/app/holdings/help/help.component.ts similarity index 100% rename from cloudapp/src/app/help/help.component.ts rename to cloudapp/src/app/holdings/help/help.component.ts diff --git a/cloudapp/src/app/holdings/holdings.component.html b/cloudapp/src/app/holdings/holdings/holdings.component.html similarity index 98% rename from cloudapp/src/app/holdings/holdings.component.html rename to cloudapp/src/app/holdings/holdings/holdings.component.html index 885e14b..9a74707 100644 --- a/cloudapp/src/app/holdings/holdings.component.html +++ b/cloudapp/src/app/holdings/holdings/holdings.component.html @@ -1,7 +1,7 @@
- + + @@ -25,5 +32,13 @@
+

Main.NoRecords

\ No newline at end of file diff --git a/cloudapp/src/app/holdings/main/main.component.scss b/cloudapp/src/app/holdings/main/main.component.scss new file mode 100644 index 0000000..d488633 --- /dev/null +++ b/cloudapp/src/app/holdings/main/main.component.scss @@ -0,0 +1,20 @@ +.align-space-between { + justify-content: space-between; + margin-bottom: 20px; +} + +.align-to-left { + justify-content: flex-start; + margin-bottom: 15px; +} + +.align-to-right { + justify-content: flex-end; + margin-bottom: 15px; +} + +::ng-deep .cdk-overlay-pane +{ + min-width: auto !important; + width: 90%; +} \ No newline at end of file diff --git a/cloudapp/src/app/main/main.component.ts b/cloudapp/src/app/holdings/main/main.component.ts similarity index 95% rename from cloudapp/src/app/main/main.component.ts rename to cloudapp/src/app/holdings/main/main.component.ts index 4b168a8..f66964c 100644 --- a/cloudapp/src/app/main/main.component.ts +++ b/cloudapp/src/app/holdings/main/main.component.ts @@ -2,7 +2,7 @@ import { Subscription } from 'rxjs'; import { Component, OnInit, OnDestroy } from '@angular/core'; import { CloudAppEventsService, Entity, EntityType } from '@exlibris/exl-cloudapp-angular-lib'; import { Router } from '@angular/router'; -import { NacsisService} from '../nacsis.service'; +import { HoldingsService} from '../../service/holdings.service'; import { TranslateService } from '@ngx-translate/core'; import { AlertService } from '@exlibris/exl-cloudapp-angular-lib'; @@ -26,7 +26,7 @@ export class MainComponent implements OnInit, OnDestroy { constructor( private eventsService: CloudAppEventsService, private router: Router, - private nacsis: NacsisService, + private nacsis: HoldingsService, private translate: TranslateService, private alert: AlertService diff --git a/cloudapp/src/app/main-menu/main-menu.component.html b/cloudapp/src/app/main-menu/main-menu.component.html new file mode 100644 index 0000000..18622a9 --- /dev/null +++ b/cloudapp/src/app/main-menu/main-menu.component.html @@ -0,0 +1,7 @@ +
+

This app includes all functionalities within NACSIS-CAT/ILL

+ + {{item.text | translate}} + +
+ \ No newline at end of file diff --git a/cloudapp/src/app/main-menu/main-menu.component.scss b/cloudapp/src/app/main-menu/main-menu.component.scss new file mode 100644 index 0000000..69fc949 --- /dev/null +++ b/cloudapp/src/app/main-menu/main-menu.component.scss @@ -0,0 +1,3 @@ +p { + margin-bottom: 15px; + } \ No newline at end of file diff --git a/cloudapp/src/app/main-menu/main-menu.component.ts b/cloudapp/src/app/main-menu/main-menu.component.ts new file mode 100644 index 0000000..4b695c4 --- /dev/null +++ b/cloudapp/src/app/main-menu/main-menu.component.ts @@ -0,0 +1,52 @@ +import { Component, OnInit } from '@angular/core'; +import { AppService } from '../service/app.service'; +import { CloudAppEventsService } from '@exlibris/exl-cloudapp-angular-lib'; +import { TranslateService } from '@ngx-translate/core'; + + +@Component({ + selector: 'app-main-menu', + templateUrl: './main-menu.component.html', + styleUrls: ['./main-menu.component.scss'] + }) + + export class MainMenuComponent implements OnInit { + menu : Array<{title:string, text:string, icon:string, link:string}> = this.initMenu(); + + constructor( + private eventsService: CloudAppEventsService, + private translate: TranslateService, + ) { } + + ngOnInit() {} + + initMenu(): Array<{title:string, text:string, icon:string, link:string}>{ + return new Array( + { + title: 'MainMenu.Holdings.Title', + text: 'NACSIS holding information management', + icon: 'uxf-icon uxf-link', + link: 'holdings' + }, + { + title: 'Catalog', + text: 'Search and Copy cataloging NACSIS Bib/Auth records', + icon: 'uxf-icon uxf-background-color', + link: 'main' + }, + /*{ + title: 'Members', + text: 'NACSIS members information management', + icon: 'uxf-icon uxf-switch', + link: 'main' + }, + { + title: 'ILL Borrowing Requests', + text: 'NACSIS borrowing request creation', + icon: 'uxf-icon uxf-external-link', + link: 'main' + },*/ + ); + } + + } \ No newline at end of file diff --git a/cloudapp/src/app/main/main.component.scss b/cloudapp/src/app/main/main.component.scss deleted file mode 100644 index cd2932c..0000000 --- a/cloudapp/src/app/main/main.component.scss +++ /dev/null @@ -1,10 +0,0 @@ -.align-to-right { - justify-content: flex-end; - margin-bottom: 15px; -} - -::ng-deep .cdk-overlay-pane -{ - min-width: auto !important; - width: 90%; -} \ No newline at end of file diff --git a/cloudapp/src/app/app.service.ts b/cloudapp/src/app/service/app.service.ts similarity index 95% rename from cloudapp/src/app/app.service.ts rename to cloudapp/src/app/service/app.service.ts index 48b7707..e12c6e7 100644 --- a/cloudapp/src/app/app.service.ts +++ b/cloudapp/src/app/service/app.service.ts @@ -1,12 +1,12 @@ - -import { Injectable } from '@angular/core'; -import { InitService } from '@exlibris/exl-cloudapp-angular-lib'; - -@Injectable({ - providedIn: 'root' -}) -export class AppService { - - constructor(private initService: InitService) {} - + +import { Injectable } from '@angular/core'; +import { InitService } from '@exlibris/exl-cloudapp-angular-lib'; + +@Injectable({ + providedIn: 'root' +}) +export class AppService { + + constructor(private initService: InitService) {} + } \ No newline at end of file diff --git a/cloudapp/src/app/service/base.service.ts b/cloudapp/src/app/service/base.service.ts new file mode 100644 index 0000000..2b84167 --- /dev/null +++ b/cloudapp/src/app/service/base.service.ts @@ -0,0 +1,74 @@ + +import { Injectable } from '@angular/core'; +import { InitData, CloudAppEventsService } from '@exlibris/exl-cloudapp-angular-lib'; +import { Observable, of } from 'rxjs'; +import jwt_decode from "jwt-decode"; +import {JwtPayload} from "jwt-decode"; +import { HttpClient } from "@angular/common/http"; + + +// @Injectable({ +// providedIn: 'root' +// }) + +export abstract class BaseService { + protected http: HttpClient; + protected eventsService: CloudAppEventsService; + protected _url: string; + protected _initData: InitData; + protected _authToken: string; + protected _exp: number; + public OkStatus: string = 'OK'; + + constructor( + eventsService: CloudAppEventsService, + http: HttpClient + ) { + this.http = http; + this.eventsService = eventsService; + } + + isEmpty(val) { + return (val === undefined || val == null || val.length <= 0) ? true : false; + } + + setBaseUrl(initData: InitData) : string { + if(this.isEmpty(this._url)) { + console.log(initData); + this._initData = initData; + this._url = this._initData.urls['alma']; + this._url = this._url + 'view/nacsis/'; + this._url = this._url + this._initData.instCode + '/'; + console.log(this._url); + } + return this._url; + } + + getInitData(): Observable { + if(this.isEmpty(this._initData)) + return this.eventsService.getInitData(); + return of(this._initData); + } + + + // Token-based authentication menagment + + getAuthToken(): Observable { + const now = Date.now(); // Unix timestamp in milliseconds + if (this.isEmpty(this._exp) || now >= this._exp) { + return this.eventsService.getAuthToken(); + } + return of(this._authToken); + } + + setAuthHeader(authToken: string) { + if(this._authToken !== authToken) { + console.log("JWT = " + authToken); + this._authToken = authToken; + let decoded = jwt_decode(this._authToken) as JwtPayload; + console.log(decoded); + this._exp = decoded.exp; + } + return { 'Authorization': `Bearer ${this._authToken}` }; + } +} \ No newline at end of file diff --git a/cloudapp/src/app/service/configuration.service.ts b/cloudapp/src/app/service/configuration.service.ts new file mode 100644 index 0000000..466c7e6 --- /dev/null +++ b/cloudapp/src/app/service/configuration.service.ts @@ -0,0 +1,21 @@ +import { CloudAppConfigService } from "@exlibris/exl-cloudapp-angular-lib"; +import { Injectable } from '@angular/core'; + +@Injectable({ + providedIn: 'root' +}) + +export class ConfigurationService{ + private _config; + + constructor( + private configService: CloudAppConfigService + ) { + this.configService.get().subscribe(resp => this._config = resp); + } + + set config(config: any) { + this._config = config; + } + +} \ No newline at end of file diff --git a/cloudapp/src/app/nacsis.service.ts b/cloudapp/src/app/service/holdings.service.ts similarity index 75% rename from cloudapp/src/app/nacsis.service.ts rename to cloudapp/src/app/service/holdings.service.ts index 77e3ef5..432ced5 100644 --- a/cloudapp/src/app/nacsis.service.ts +++ b/cloudapp/src/app/service/holdings.service.ts @@ -1,37 +1,32 @@ import { HttpClient } from "@angular/common/http"; import { mergeMap } from 'rxjs/operators'; -import { Observable, of } from 'rxjs'; +import { of } from 'rxjs'; import { Injectable } from '@angular/core'; -import { CloudAppConfigService, CloudAppEventsService, InitData } from '@exlibris/exl-cloudapp-angular-lib'; -import jwt_decode from "jwt-decode"; -import {JwtPayload} from "jwt-decode"; +import { CloudAppEventsService, InitData } from '@exlibris/exl-cloudapp-angular-lib'; + + +import { BaseService } from "./base.service"; @Injectable({ providedIn: 'root' }) -export class NacsisService { +export class HoldingsService extends BaseService { private _holdings: Holding[]; private _header: Header; - private _config; - private _url: string; - private _initData: InitData; - private _authToken: string; - private _exp: number; - public OkStatus: string = 'OK'; public OwnerKey: string = 'OWNER_KEY'; private PREVIEW_MAX_LENGTH: number = 30; constructor( - private http: HttpClient, - private configService: CloudAppConfigService, - private eventsService: CloudAppEventsService - + protected http: HttpClient, + protected eventsService: CloudAppEventsService ) { - this.configService.get().subscribe(resp => this._config = resp); + super(eventsService, http); } - isEmpty(val) { - return (val === undefined || val == null || val.length <= 0) ? true : false; + setBaseUrl(initData: InitData) : string { + let baseUrl = super.setBaseUrl(initData); + // baseUrl = baseUrl + "holdings/"; + return baseUrl; } getHeader(): Header { @@ -105,45 +100,6 @@ export class NacsisService { }); } - getInitData(): Observable { - if(this.isEmpty(this._initData)) - return this.eventsService.getInitData(); - return of(this._initData); - } - - setBaseUrl(initData: InitData) : string { - if(this.isEmpty(this._url)) { - console.log(initData); - this._initData = initData; - this._url = this._initData.urls['alma']; - this._url = this._url + 'view/nacsis/'; - this._url = this._url + this._initData.instCode + '/'; - console.log(this._url); - } - return this._url; - } - - getAuthToken(): Observable { - - const now = Date.now(); // Unix timestamp in milliseconds - - if (this.isEmpty(this._exp) || now >= this._exp) { - return this.eventsService.getAuthToken(); - } - return of(this._authToken); - } - - setAuthHeader(authToken: string) { - if(this._authToken !== authToken) { - console.log("JWT = " + authToken); - this._authToken = authToken; - let decoded = jwt_decode(this._authToken) as JwtPayload; - console.log(decoded); - this._exp = decoded.exp; - } - return { 'Authorization': `Bearer ${this._authToken}` }; - } - deleteHoldingFromNacsis(mmsId: string, holdingsId: string) { let fullUrl: string; @@ -201,10 +157,6 @@ export class NacsisService { this.updateHoldingPreview(); } - set config(config: any) { - this._config = config; - } - clearSessionStorage() { sessionStorage.clear(); } diff --git a/cloudapp/src/i18n/en.json b/cloudapp/src/i18n/en.json index 24bf471..7347b08 100644 --- a/cloudapp/src/i18n/en.json +++ b/cloudapp/src/i18n/en.json @@ -1,4 +1,9 @@ { + "MainMenu": { + "Holdings": { + "Title": "Holdings" + } + }, "Main": { "Intro": "Select a record to retrieve NACSIS holdings:", "NoRecords": "To view NACSIS holdings, navigate to a bibliographic record.", diff --git a/cloudapp/src/i18n/jp.json b/cloudapp/src/i18n/jp.json index a1f80b8..30a356b 100644 --- a/cloudapp/src/i18n/jp.json +++ b/cloudapp/src/i18n/jp.json @@ -1,4 +1,9 @@ { + "MainMenu": { + "Holdings": { + "Title": "タイトル" + } + }, "Main": { "Intro": "NACSISから所蔵を取得するための書誌レコードを選択してください:", "NoRecords": "NACSISの所蔵を閲覧表示するため、該当の書誌レコードに移動します。", @@ -10,12 +15,12 @@ }, "Holdings": { "Owner": "所蔵館", - "All": "全館", - "Mine": "自館", + "All": "すべて", + "Mine": "自館所蔵", "ID": "所蔵データID", - "Title": "所蔵", - "Library": "参加組織略称", - "Location": "配置コード", + "Title": "タイトル", + "Library": "図書館", + "Location": "配置場所", "ConfirmDelete": "このレコードを本当に削除しますか?", "Deleted": "レコードが削除されました.", "Add": "所蔵レコードの追加", @@ -30,13 +35,13 @@ "Title": "タイトル", "EditTitle": "所蔵の編集", "AddTitle": "所蔵の追加", - "ViewTitle": "所蔵の表示", + "ViewTitle": "タイトルの表示", "Success": "所蔵が保存されました.", "Fields": { "Id": "データID", "Description": "記述", - "Library": "参加組織略称", - "Location": "配置コード", + "Library": "図書館", + "Location": "配置場所", "Ill": "ILL(リソース共有)可", "VOL": "巻冊次等", "CLN": "請求記号", diff --git a/cloudapp/src/main.scss b/cloudapp/src/main.scss index cc79a26..b35f6c2 100644 --- a/cloudapp/src/main.scss +++ b/cloudapp/src/main.scss @@ -1,5 +1,5 @@ -@import './app/main/main.component.theme'; +@import './main.theme'; @mixin themed-styles($theme, $typography) { /* Include themed component mixins or theme dependent styles here */ diff --git a/cloudapp/src/app/main/main.component.theme.scss b/cloudapp/src/main.theme.scss similarity index 100% rename from cloudapp/src/app/main/main.component.theme.scss rename to cloudapp/src/main.theme.scss diff --git a/manifest.json b/manifest.json index 848efdf..bbfea48 100644 --- a/manifest.json +++ b/manifest.json @@ -3,11 +3,11 @@ "title": [ { "lang": "jp", - "text": "NACSIS Holdings" + "text": "NACSIS-CAT/ILL" }, { "lang": "en", - "text": "NACSIS Holdings" + "text": "NACSIS-CAT/ILL" } ], "subtitle": [ diff --git a/package-lock.json b/package-lock.json index 9a49d56..98819e4 100644 --- a/package-lock.json +++ b/package-lock.json @@ -1,8 +1,13220 @@ { "name": "my-exl-cloudapp", "version": "1.0.0", - "lockfileVersion": 1, + "lockfileVersion": 2, "requires": true, + "packages": { + "": { + "name": "my-exl-cloudapp", + "version": "1.0.0", + "dependencies": { + "@angular/flex-layout": "^10.0.0-beta.32", + "@exlibris/exl-cloudapp-angular-lib": "^1.0.1", + "@exlibris/exl-cloudapp-base": "^1.0.1", + "font-awesome": "^4.7.0", + "jwt-decode": "^3.1.2", + "sweetalert2": "^9.17.1" + } + }, + "node_modules/@angular-devkit/architect": { + "version": "0.901.5", + "resolved": "https://registry.npmjs.org/@angular-devkit/architect/-/architect-0.901.5.tgz", + "integrity": "sha512-VO+8qBkaq54xAjdtvhEhQ86gZxS0V1wC9hGblw3O+XXri/euHky4811B2BbEylPy8/kRy5sUYcuwcyZrVxJ2TQ==", + "dependencies": { + "@angular-devkit/core": "9.1.5", + "rxjs": "6.5.4" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@angular-devkit/architect/node_modules/rxjs": { + "version": "6.5.4", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.5.4.tgz", + "integrity": "sha512-naMQXcgEo3csAEGvw/NydRA0fuS2nDZJiw1YUWFKU7aPPAPGZEsD4Iimit96qwCieH6y614MCLYwdkrWx7z/7Q==", + "dependencies": { + "tslib": "^1.9.0" + }, + "engines": { + "npm": ">=2.0.0" + } + }, + "node_modules/@angular-devkit/build-angular": { + "version": "0.901.5", + "resolved": "https://registry.npmjs.org/@angular-devkit/build-angular/-/build-angular-0.901.5.tgz", + "integrity": "sha512-XottEBXE7cmkx6LPu33lXJCSAlxFkIu2ErWvV1oy+La6aZEuoJVntxzIKLprJmTiiD/4IDDQLWwp4m+EC96kyg==", + "dependencies": { + "@angular-devkit/architect": "0.901.5", + "@angular-devkit/build-optimizer": "0.901.5", + "@angular-devkit/build-webpack": "0.901.5", + "@angular-devkit/core": "9.1.5", + "@babel/core": "7.9.0", + "@babel/generator": "7.9.3", + "@babel/preset-env": "7.9.0", + "@babel/template": "7.8.6", + "@jsdevtools/coverage-istanbul-loader": "3.0.3", + "@ngtools/webpack": "9.1.5", + "ajv": "6.12.0", + "autoprefixer": "9.7.4", + "babel-loader": "8.0.6", + "browserslist": "^4.9.1", + "cacache": "15.0.0", + "caniuse-lite": "^1.0.30001032", + "circular-dependency-plugin": "5.2.0", + "copy-webpack-plugin": "5.1.1", + "core-js": "3.6.4", + "css-loader": "3.5.1", + "cssnano": "4.1.10", + "file-loader": "6.0.0", + "find-cache-dir": "3.3.1", + "glob": "7.1.6", + "jest-worker": "25.1.0", + "karma-source-map-support": "1.4.0", + "less": "3.11.1", + "less-loader": "5.0.0", + "license-webpack-plugin": "2.1.4", + "loader-utils": "2.0.0", + "mini-css-extract-plugin": "0.9.0", + "minimatch": "3.0.4", + "open": "7.0.3", + "parse5": "4.0.0", + "postcss": "7.0.27", + "postcss-import": "12.0.1", + "postcss-loader": "3.0.0", + "raw-loader": "4.0.0", + "regenerator-runtime": "0.13.5", + "rimraf": "3.0.2", + "rollup": "2.1.0", + "rxjs": "6.5.4", + "sass": "1.26.3", + "sass-loader": "8.0.2", + "semver": "7.1.3", + "source-map": "0.7.3", + "source-map-loader": "0.2.4", + "speed-measure-webpack-plugin": "1.3.1", + "style-loader": "1.1.3", + "stylus": "0.54.7", + "stylus-loader": "3.0.2", + "terser": "4.6.10", + "terser-webpack-plugin": "2.3.5", + "tree-kill": "1.2.2", + "webpack": "4.42.0", + "webpack-dev-middleware": "3.7.2", + "webpack-dev-server": "3.10.3", + "webpack-merge": "4.2.2", + "webpack-sources": "1.4.3", + "webpack-subresource-integrity": "1.4.0", + "worker-plugin": "4.0.3" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@angular-devkit/build-angular/node_modules/rxjs": { + "version": "6.5.4", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.5.4.tgz", + "integrity": "sha512-naMQXcgEo3csAEGvw/NydRA0fuS2nDZJiw1YUWFKU7aPPAPGZEsD4Iimit96qwCieH6y614MCLYwdkrWx7z/7Q==", + "dependencies": { + "tslib": "^1.9.0" + }, + "engines": { + "npm": ">=2.0.0" + } + }, + "node_modules/@angular-devkit/build-optimizer": { + "version": "0.901.5", + "resolved": "https://registry.npmjs.org/@angular-devkit/build-optimizer/-/build-optimizer-0.901.5.tgz", + "integrity": "sha512-xmAMvLMSa8BvqlZ0wsC37Qop/7/pEaQRKLeowC3CCI3jiYDF10Tihar+Hjc04NVSal8ZBP9/+Gp3Yr0x61HcFA==", + "dependencies": { + "loader-utils": "2.0.0", + "source-map": "0.7.3", + "tslib": "1.11.1", + "typescript": "3.6.5", + "webpack-sources": "1.4.3" + }, + "bin": { + "build-optimizer": "src/build-optimizer/cli.js" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@angular-devkit/build-optimizer/node_modules/tslib": { + "version": "1.11.1", + "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.11.1.tgz", + "integrity": "sha512-aZW88SY8kQbU7gpV19lN24LtXh/yD4ZZg6qieAJDDg+YBsJcSmLGK9QpnUjAKVG/xefmvJGd1WUmfpT/g6AJGA==" + }, + "node_modules/@angular-devkit/build-optimizer/node_modules/typescript": { + "version": "3.6.5", + "resolved": "https://registry.npmjs.org/typescript/-/typescript-3.6.5.tgz", + "integrity": "sha512-BEjlc0Z06ORZKbtcxGrIvvwYs5hAnuo6TKdNFL55frVDlB+na3z5bsLhFaIxmT+dPWgBIjMo6aNnTOgHHmHgiQ==", + "bin": { + "tsc": "bin/tsc", + "tsserver": "bin/tsserver" + }, + "engines": { + "node": ">=4.2.0" + } + }, + "node_modules/@angular-devkit/build-webpack": { + "version": "0.901.5", + "resolved": "https://registry.npmjs.org/@angular-devkit/build-webpack/-/build-webpack-0.901.5.tgz", + "integrity": "sha512-4HHOFFRu3yUBe0otaDHh4PID99XvnBJj7hYzvbB5BvP0ULif4/W0aoU2STnern4lH4pJmrtqYawBZ84ETXN/Ag==", + "dependencies": { + "@angular-devkit/architect": "0.901.5", + "@angular-devkit/core": "9.1.5", + "rxjs": "6.5.4" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@angular-devkit/build-webpack/node_modules/rxjs": { + "version": "6.5.4", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.5.4.tgz", + "integrity": "sha512-naMQXcgEo3csAEGvw/NydRA0fuS2nDZJiw1YUWFKU7aPPAPGZEsD4Iimit96qwCieH6y614MCLYwdkrWx7z/7Q==", + "dependencies": { + "tslib": "^1.9.0" + }, + "engines": { + "npm": ">=2.0.0" + } + }, + "node_modules/@angular-devkit/core": { + "version": "9.1.5", + "resolved": "https://registry.npmjs.org/@angular-devkit/core/-/core-9.1.5.tgz", + "integrity": "sha512-i0BJ6Ad3bcDE6e4Ev9Flbw7P0bz9p94FDVfEOPGBTrbJQZSqOm3CqaH2y5LGfl7acSPUi54hK481h1QRUFBkTQ==", + "dependencies": { + "ajv": "6.12.0", + "fast-json-stable-stringify": "2.1.0", + "magic-string": "0.25.7", + "rxjs": "6.5.4", + "source-map": "0.7.3" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@angular-devkit/core/node_modules/rxjs": { + "version": "6.5.4", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.5.4.tgz", + "integrity": "sha512-naMQXcgEo3csAEGvw/NydRA0fuS2nDZJiw1YUWFKU7aPPAPGZEsD4Iimit96qwCieH6y614MCLYwdkrWx7z/7Q==", + "dependencies": { + "tslib": "^1.9.0" + }, + "engines": { + "npm": ">=2.0.0" + } + }, + "node_modules/@angular-devkit/schematics": { + "version": "9.1.5", + "resolved": "https://registry.npmjs.org/@angular-devkit/schematics/-/schematics-9.1.5.tgz", + "integrity": "sha512-nkNiGrVl7xLaYYj/oT1wOBowa4Driv2f4abn78AJI/pd/EXA45G/rI9gO/kEG8lHn+FAMQedaywX9N4JDOxCGg==", + "dependencies": { + "@angular-devkit/core": "9.1.5", + "ora": "4.0.3", + "rxjs": "6.5.4" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@angular-devkit/schematics/node_modules/rxjs": { + "version": "6.5.4", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.5.4.tgz", + "integrity": "sha512-naMQXcgEo3csAEGvw/NydRA0fuS2nDZJiw1YUWFKU7aPPAPGZEsD4Iimit96qwCieH6y614MCLYwdkrWx7z/7Q==", + "dependencies": { + "tslib": "^1.9.0" + }, + "engines": { + "npm": ">=2.0.0" + } + }, + "node_modules/@angular/animations": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/animations/-/animations-9.1.6.tgz", + "integrity": "sha512-7Pp7aqNNcH4fu1BnOVpvqJJHjE7RZ5K1oD396OWCh35pgpLowLSpFjhbVhzGrcAuxHyKnnHSX3etLn2hDaHxmQ==" + }, + "node_modules/@angular/cdk": { + "version": "9.2.3", + "resolved": "https://registry.npmjs.org/@angular/cdk/-/cdk-9.2.3.tgz", + "integrity": "sha512-tQr/yt8GNGsZ/DTT+PMq7XdRmL56hwVCyf8F12JQAawutSLfTfMb+S1lpN7L/0Pb/L5JBuCfG2HmXK7vHo02gw==", + "optionalDependencies": { + "parse5": "^5.0.0" + } + }, + "node_modules/@angular/cdk/node_modules/parse5": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/parse5/-/parse5-5.1.1.tgz", + "integrity": "sha512-ugq4DFI0Ptb+WWjAdOK16+u/nHfiIrcE+sh8kZMaM0WllQKLI9rOUq6c2b7cwPkXdzfQESqvoqK6ug7U/Yyzug==", + "optional": true + }, + "node_modules/@angular/cli": { + "version": "9.1.5", + "resolved": "https://registry.npmjs.org/@angular/cli/-/cli-9.1.5.tgz", + "integrity": "sha512-Decn0p+s0SLc5p2GN7k8dUrOY43hBuCz8PxueW0gEln7NjlpdmHk+6JQn0ZRl2/2Dbk+eTGzPXyCxGwqsW3jjw==", + "hasInstallScript": true, + "dependencies": { + "@angular-devkit/architect": "0.901.5", + "@angular-devkit/core": "9.1.5", + "@angular-devkit/schematics": "9.1.5", + "@schematics/angular": "9.1.5", + "@schematics/update": "0.901.5", + "@yarnpkg/lockfile": "1.1.0", + "ansi-colors": "4.1.1", + "debug": "4.1.1", + "ini": "1.3.5", + "inquirer": "7.1.0", + "npm-package-arg": "8.0.1", + "npm-pick-manifest": "6.0.0", + "open": "7.0.3", + "pacote": "9.5.12", + "read-package-tree": "5.3.1", + "rimraf": "3.0.2", + "semver": "7.1.3", + "symbol-observable": "1.2.0", + "universal-analytics": "0.4.20", + "uuid": "7.0.2" + }, + "bin": { + "ng": "bin/ng" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@angular/cli/node_modules/ansi-colors": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-4.1.1.tgz", + "integrity": "sha512-JoX0apGbHaUJBNl6yF+p6JAFYZ666/hhCGKN5t9QFjbJQKUU/g8MNbFDbvfrgKXvI1QpZplPOnwIo99lX/AAmA==", + "engines": { + "node": ">=6" + } + }, + "node_modules/@angular/cli/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/@angular/cli/node_modules/uuid": { + "version": "7.0.2", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-7.0.2.tgz", + "integrity": "sha512-vy9V/+pKG+5ZTYKf+VcphF5Oc6EFiu3W8Nv3P3zIh0EqVI80ZxOzuPfe9EHjkFNvf8+xuTHVeei4Drydlx4zjw==", + "bin": { + "uuid": "dist/bin/uuid" + } + }, + "node_modules/@angular/common": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/common/-/common-9.1.6.tgz", + "integrity": "sha512-L9vw//wE+8QcSArOA411uJ68znnszCiPrbzSBV0BRZeadc7X68MwANA9qjtiTWZx5Xh9pNfHHwsCUyv2lUeinQ==" + }, + "node_modules/@angular/compiler": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/compiler/-/compiler-9.1.6.tgz", + "integrity": "sha512-tHOQEjWuWqSkrk6/vI6BK7uJnpAyFajCXPW37rH5xspF/aMbetrpoOiGBNUQg/HLaFh04nOAnnFntjLkW0ooaA==" + }, + "node_modules/@angular/compiler-cli": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/compiler-cli/-/compiler-cli-9.1.6.tgz", + "integrity": "sha512-1b7m9tvSQJE4y95wNCdi34MORcsmXPC1vaylYlzChVM2et9Y2eKHYcRs+4g329j66irLBGpS/7cgTT2pgJ+IbA==", + "dependencies": { + "canonical-path": "1.0.0", + "chokidar": "^3.0.0", + "convert-source-map": "^1.5.1", + "dependency-graph": "^0.7.2", + "fs-extra": "4.0.2", + "magic-string": "^0.25.0", + "minimist": "^1.2.0", + "reflect-metadata": "^0.1.2", + "semver": "^6.3.0", + "source-map": "^0.6.1", + "sourcemap-codec": "^1.4.8", + "yargs": "15.3.0" + }, + "bin": { + "ivy-ngcc": "ngcc/main-ivy-ngcc.js", + "ng-xi18n": "src/extract_i18n.js", + "ngc": "src/main.js", + "ngcc": "ngcc/main-ngcc.js" + }, + "engines": { + "node": ">=10.0" + } + }, + "node_modules/@angular/compiler-cli/node_modules/ansi-regex": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", + "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/cliui": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-6.0.0.tgz", + "integrity": "sha512-t6wbgtoCXvAzst7QgXxJYqPt0usEfbgQdftEPbLL/cvv6HPE5VgvqCuAIDR0NgU52ds6rFwqrgakNLrHEjCbrQ==", + "dependencies": { + "string-width": "^4.2.0", + "strip-ansi": "^6.0.0", + "wrap-ansi": "^6.2.0" + } + }, + "node_modules/@angular/compiler-cli/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/@angular/compiler-cli/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" + }, + "node_modules/@angular/compiler-cli/node_modules/find-up": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", + "dependencies": { + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/get-caller-file": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", + "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", + "engines": { + "node": "6.* || 8.* || >= 10.*" + } + }, + "node_modules/@angular/compiler-cli/node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/locate-path": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", + "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", + "dependencies": { + "p-locate": "^4.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/p-locate": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", + "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", + "dependencies": { + "p-limit": "^2.2.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/require-main-filename": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", + "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==" + }, + "node_modules/@angular/compiler-cli/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/@angular/compiler-cli/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/@angular/compiler-cli/node_modules/string-width": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.0.tgz", + "integrity": "sha512-zUz5JD+tgqtuDjMhwIg5uFVV3dtqZ9yQJlZVfq4I01/K5Paj5UHj7VyrQOJvzawSVlKpObApbfD0Ed6yJc+1eg==", + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dependencies": { + "ansi-regex": "^5.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/wrap-ansi": { + "version": "6.2.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-6.2.0.tgz", + "integrity": "sha512-r6lPcBGxZXlIcymEu7InxDMhdW0KDxpLgoFLcguasxCaJ/SOIZwINatK9KY/tf+ZrlywOKU0UDj3ATXUBfxJXA==", + "dependencies": { + "ansi-styles": "^4.0.0", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/yargs": { + "version": "15.3.0", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.3.0.tgz", + "integrity": "sha512-g/QCnmjgOl1YJjGsnUg2SatC7NUYEiLXJqxNOQU9qSpjzGtGXda9b+OKccr1kLTy8BN9yqEyqfq5lxlwdc13TA==", + "dependencies": { + "cliui": "^6.0.0", + "decamelize": "^1.2.0", + "find-up": "^4.1.0", + "get-caller-file": "^2.0.1", + "require-directory": "^2.1.1", + "require-main-filename": "^2.0.0", + "set-blocking": "^2.0.0", + "string-width": "^4.2.0", + "which-module": "^2.0.0", + "y18n": "^4.0.0", + "yargs-parser": "^18.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@angular/compiler-cli/node_modules/yargs-parser": { + "version": "18.1.3", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.3.tgz", + "integrity": "sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ==", + "dependencies": { + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/@angular/core": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/core/-/core-9.1.6.tgz", + "integrity": "sha512-iXgPh5DebLwkMzLtQ6WKiv/mo4hpwMOwYex3O4F2CKToR2tKPnXbV5WC/ADGm0XYXiocSKQPiyL4ZrUjVeKEqA==" + }, + "node_modules/@angular/flex-layout": { + "version": "10.0.0-beta.32", + "resolved": "https://registry.npmjs.org/@angular/flex-layout/-/flex-layout-10.0.0-beta.32.tgz", + "integrity": "sha512-JvuY4dUoy5jyCTIrFiq7n30Znakh1pD3nbg0h0hs2r3t1OiDQb0ZSI1wcumosG/vYHsuJQTuNhbfaIZzA1x8nA==", + "dependencies": { + "tslib": "^2.0.0" + } + }, + "node_modules/@angular/flex-layout/node_modules/tslib": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.0.0.tgz", + "integrity": "sha512-lTqkx847PI7xEDYJntxZH89L2/aXInsyF2luSafe/+0fHOMjlBNXdH6th7f70qxLDhul7KZK0zC8V5ZIyHl0/g==" + }, + "node_modules/@angular/forms": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/forms/-/forms-9.1.6.tgz", + "integrity": "sha512-3KiFjLDipZVgS5rfnZ8EoKlkUokOR8dmuw2xdjKHgzflWFFeuaY9ZtQgjZGw9/jkwWlc9P38BOSEHbK8NakdDw==" + }, + "node_modules/@angular/language-service": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/language-service/-/language-service-9.1.6.tgz", + "integrity": "sha512-pB18hVoAbIuk1Wus8ur7yUxSukfPR4pCXiOfbxDQ94qlCzLAzIwXbaNV4erpBfL/fUKxMY3h8RrVt0dfm6M5RQ==" + }, + "node_modules/@angular/material": { + "version": "9.2.3", + "resolved": "https://registry.npmjs.org/@angular/material/-/material-9.2.3.tgz", + "integrity": "sha512-QJltLNp8a/eoozPgkFLISEWgdlX9q9+fZaLJ8c9tHEp2IT5sFYBFHf8dPl0pUyxgOXkS/0HD43I1qki71/T7Kw==" + }, + "node_modules/@angular/platform-browser": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/platform-browser/-/platform-browser-9.1.6.tgz", + "integrity": "sha512-ebQhbT0Z55vwlQwAY4+s3Bcf1Q4wEN5Yk43iCuVt4g2kFkg09UP0z8aYtbuh7VQDyv/W4TTIGX8smGBWstoedQ==" + }, + "node_modules/@angular/platform-browser-dynamic": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/platform-browser-dynamic/-/platform-browser-dynamic-9.1.6.tgz", + "integrity": "sha512-7AL3hWu4oY0LRiMS9ZEFXPW2uqybWcVNFDHjPp3UwsDIT4+sW3DIm8P+UvAOFkkRwaHpPDqm4chTTiAHygC/1Q==" + }, + "node_modules/@angular/router": { + "version": "9.1.6", + "resolved": "https://registry.npmjs.org/@angular/router/-/router-9.1.6.tgz", + "integrity": "sha512-Oz4nVQUR6t68DSzZuSrVaqrzmA7/0PIEi0sc85CE+UuOEoAqGMwN0NdQYizFT62WZ16DRI/1tZ+TTWvdmpEv8w==" + }, + "node_modules/@babel/code-frame": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.10.4.tgz", + "integrity": "sha512-vG6SvB6oYEhvgisZNFRmRCUkLz11c7rp+tbNTynGqc6mS1d5ATd/sGyV6W0KZZnXRKMTzZDRgQT3Ou9jhpAfUg==", + "dependencies": { + "@babel/highlight": "^7.10.4" + } + }, + "node_modules/@babel/compat-data": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.12.7.tgz", + "integrity": "sha512-YaxPMGs/XIWtYqrdEOZOCPsVWfEoriXopnsz3/i7apYPXQ3698UFhS6dVT1KN5qOsWmVgw/FOrmQgpRaZayGsw==" + }, + "node_modules/@babel/core": { + "version": "7.9.0", + "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.9.0.tgz", + "integrity": "sha512-kWc7L0fw1xwvI0zi8OKVBuxRVefwGOrKSQMvrQ3dW+bIIavBY3/NpXmpjMy7bQnLgwgzWQZ8TlM57YHpHNHz4w==", + "dependencies": { + "@babel/code-frame": "^7.8.3", + "@babel/generator": "^7.9.0", + "@babel/helper-module-transforms": "^7.9.0", + "@babel/helpers": "^7.9.0", + "@babel/parser": "^7.9.0", + "@babel/template": "^7.8.6", + "@babel/traverse": "^7.9.0", + "@babel/types": "^7.9.0", + "convert-source-map": "^1.7.0", + "debug": "^4.1.0", + "gensync": "^1.0.0-beta.1", + "json5": "^2.1.2", + "lodash": "^4.17.13", + "resolve": "^1.3.2", + "semver": "^5.4.1", + "source-map": "^0.5.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/core/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/@babel/core/node_modules/source-map": { + "version": "0.5.7", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", + "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/@babel/generator": { + "version": "7.9.3", + "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.9.3.tgz", + "integrity": "sha512-RpxM252EYsz9qLUIq6F7YJyK1sv0wWDBFuztfDGWaQKzHjqDHysxSiRUpA/X9jmfqo+WzkAVKFaUily5h+gDCQ==", + "dependencies": { + "@babel/types": "^7.9.0", + "jsesc": "^2.5.1", + "lodash": "^4.17.13", + "source-map": "^0.5.0" + } + }, + "node_modules/@babel/generator/node_modules/source-map": { + "version": "0.5.7", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", + "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/@babel/helper-annotate-as-pure": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.10.4.tgz", + "integrity": "sha512-XQlqKQP4vXFB7BN8fEEerrmYvHp3fK/rBkRFz9jaJbzK0B1DSfej9Kc7ZzE8Z/OnId1jpJdNAZ3BFQjWG68rcA==", + "dependencies": { + "@babel/types": "^7.10.4" + } + }, + "node_modules/@babel/helper-builder-binary-assignment-operator-visitor": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-builder-binary-assignment-operator-visitor/-/helper-builder-binary-assignment-operator-visitor-7.10.4.tgz", + "integrity": "sha512-L0zGlFrGWZK4PbT8AszSfLTM5sDU1+Az/En9VrdT8/LmEiJt4zXt+Jve9DCAnQcbqDhCI+29y/L93mrDzddCcg==", + "dependencies": { + "@babel/helper-explode-assignable-expression": "^7.10.4", + "@babel/types": "^7.10.4" + } + }, + "node_modules/@babel/helper-compilation-targets": { + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.12.5.tgz", + "integrity": "sha512-+qH6NrscMolUlzOYngSBMIOQpKUGPPsc61Bu5W10mg84LxZ7cmvnBHzARKbDoFxVvqqAbj6Tg6N7bSrWSPXMyw==", + "dependencies": { + "@babel/compat-data": "^7.12.5", + "@babel/helper-validator-option": "^7.12.1", + "browserslist": "^4.14.5", + "semver": "^5.5.0" + } + }, + "node_modules/@babel/helper-compilation-targets/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/@babel/helper-create-regexp-features-plugin": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/helper-create-regexp-features-plugin/-/helper-create-regexp-features-plugin-7.12.7.tgz", + "integrity": "sha512-idnutvQPdpbduutvi3JVfEgcVIHooQnhvhx0Nk9isOINOIGYkZea1Pk2JlJRiUnMefrlvr0vkByATBY/mB4vjQ==", + "dependencies": { + "@babel/helper-annotate-as-pure": "^7.10.4", + "regexpu-core": "^4.7.1" + } + }, + "node_modules/@babel/helper-define-map": { + "version": "7.10.5", + "resolved": "https://registry.npmjs.org/@babel/helper-define-map/-/helper-define-map-7.10.5.tgz", + "integrity": "sha512-fMw4kgFB720aQFXSVaXr79pjjcW5puTCM16+rECJ/plGS+zByelE8l9nCpV1GibxTnFVmUuYG9U8wYfQHdzOEQ==", + "dependencies": { + "@babel/helper-function-name": "^7.10.4", + "@babel/types": "^7.10.5", + "lodash": "^4.17.19" + } + }, + "node_modules/@babel/helper-define-map/node_modules/lodash": { + "version": "4.17.20", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", + "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==" + }, + "node_modules/@babel/helper-explode-assignable-expression": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/helper-explode-assignable-expression/-/helper-explode-assignable-expression-7.12.1.tgz", + "integrity": "sha512-dmUwH8XmlrUpVqgtZ737tK88v07l840z9j3OEhCLwKTkjlvKpfqXVIZ0wpK3aeOxspwGrf/5AP5qLx4rO3w5rA==", + "dependencies": { + "@babel/types": "^7.12.1" + } + }, + "node_modules/@babel/helper-function-name": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.10.4.tgz", + "integrity": "sha512-YdaSyz1n8gY44EmN7x44zBn9zQ1Ry2Y+3GTA+3vH6Mizke1Vw0aWDM66FOYEPw8//qKkmqOckrGgTYa+6sceqQ==", + "dependencies": { + "@babel/helper-get-function-arity": "^7.10.4", + "@babel/template": "^7.10.4", + "@babel/types": "^7.10.4" + } + }, + "node_modules/@babel/helper-function-name/node_modules/@babel/template": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.12.7.tgz", + "integrity": "sha512-GkDzmHS6GV7ZeXfJZ0tLRBhZcMcY0/Lnb+eEbXDBfCAcZCjrZKe6p3J4we/D24O9Y8enxWAg1cWwof59yLh2ow==", + "dependencies": { + "@babel/code-frame": "^7.10.4", + "@babel/parser": "^7.12.7", + "@babel/types": "^7.12.7" + } + }, + "node_modules/@babel/helper-get-function-arity": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.10.4.tgz", + "integrity": "sha512-EkN3YDB+SRDgiIUnNgcmiD361ti+AVbL3f3Henf6dqqUyr5dMsorno0lJWJuLhDhkI5sYEpgj6y9kB8AOU1I2A==", + "dependencies": { + "@babel/types": "^7.10.4" + } + }, + "node_modules/@babel/helper-hoist-variables": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-hoist-variables/-/helper-hoist-variables-7.10.4.tgz", + "integrity": "sha512-wljroF5PgCk2juF69kanHVs6vrLwIPNp6DLD+Lrl3hoQ3PpPPikaDRNFA+0t81NOoMt2DL6WW/mdU8k4k6ZzuA==", + "dependencies": { + "@babel/types": "^7.10.4" + } + }, + "node_modules/@babel/helper-member-expression-to-functions": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.12.7.tgz", + "integrity": "sha512-DCsuPyeWxeHgh1Dus7APn7iza42i/qXqiFPWyBDdOFtvS581JQePsc1F/nD+fHrcswhLlRc2UpYS1NwERxZhHw==", + "dependencies": { + "@babel/types": "^7.12.7" + } + }, + "node_modules/@babel/helper-module-imports": { + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.12.5.tgz", + "integrity": "sha512-SR713Ogqg6++uexFRORf/+nPXMmWIn80TALu0uaFb+iQIUoR7bOC7zBWyzBs5b3tBBJXuyD0cRu1F15GyzjOWA==", + "dependencies": { + "@babel/types": "^7.12.5" + } + }, + "node_modules/@babel/helper-module-transforms": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.12.1.tgz", + "integrity": "sha512-QQzehgFAZ2bbISiCpmVGfiGux8YVFXQ0abBic2Envhej22DVXV9nCFaS5hIQbkyo1AdGb+gNME2TSh3hYJVV/w==", + "dependencies": { + "@babel/helper-module-imports": "^7.12.1", + "@babel/helper-replace-supers": "^7.12.1", + "@babel/helper-simple-access": "^7.12.1", + "@babel/helper-split-export-declaration": "^7.11.0", + "@babel/helper-validator-identifier": "^7.10.4", + "@babel/template": "^7.10.4", + "@babel/traverse": "^7.12.1", + "@babel/types": "^7.12.1", + "lodash": "^4.17.19" + } + }, + "node_modules/@babel/helper-module-transforms/node_modules/@babel/template": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.12.7.tgz", + "integrity": "sha512-GkDzmHS6GV7ZeXfJZ0tLRBhZcMcY0/Lnb+eEbXDBfCAcZCjrZKe6p3J4we/D24O9Y8enxWAg1cWwof59yLh2ow==", + "dependencies": { + "@babel/code-frame": "^7.10.4", + "@babel/parser": "^7.12.7", + "@babel/types": "^7.12.7" + } + }, + "node_modules/@babel/helper-module-transforms/node_modules/lodash": { + "version": "4.17.20", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", + "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==" + }, + "node_modules/@babel/helper-optimise-call-expression": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.12.7.tgz", + "integrity": "sha512-I5xc9oSJ2h59OwyUqjv95HRyzxj53DAubUERgQMrpcCEYQyToeHA+NEcUEsVWB4j53RDeskeBJ0SgRAYHDBckw==", + "dependencies": { + "@babel/types": "^7.12.7" + } + }, + "node_modules/@babel/helper-plugin-utils": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.10.4.tgz", + "integrity": "sha512-O4KCvQA6lLiMU9l2eawBPMf1xPP8xPfB3iEQw150hOVTqj/rfXz0ThTb4HEzqQfs2Bmo5Ay8BzxfzVtBrr9dVg==" + }, + "node_modules/@babel/helper-remap-async-to-generator": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/helper-remap-async-to-generator/-/helper-remap-async-to-generator-7.12.1.tgz", + "integrity": "sha512-9d0KQCRM8clMPcDwo8SevNs+/9a8yWVVmaE80FGJcEP8N1qToREmWEGnBn8BUlJhYRFz6fqxeRL1sl5Ogsed7A==", + "dependencies": { + "@babel/helper-annotate-as-pure": "^7.10.4", + "@babel/helper-wrap-function": "^7.10.4", + "@babel/types": "^7.12.1" + } + }, + "node_modules/@babel/helper-replace-supers": { + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/helper-replace-supers/-/helper-replace-supers-7.12.5.tgz", + "integrity": "sha512-5YILoed0ZyIpF4gKcpZitEnXEJ9UoDRki1Ey6xz46rxOzfNMAhVIJMoune1hmPVxh40LRv1+oafz7UsWX+vyWA==", + "dependencies": { + "@babel/helper-member-expression-to-functions": "^7.12.1", + "@babel/helper-optimise-call-expression": "^7.10.4", + "@babel/traverse": "^7.12.5", + "@babel/types": "^7.12.5" + } + }, + "node_modules/@babel/helper-simple-access": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.12.1.tgz", + "integrity": "sha512-OxBp7pMrjVewSSC8fXDFrHrBcJATOOFssZwv16F3/6Xtc138GHybBfPbm9kfiqQHKhYQrlamWILwlDCeyMFEaA==", + "dependencies": { + "@babel/types": "^7.12.1" + } + }, + "node_modules/@babel/helper-skip-transparent-expression-wrappers": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/helper-skip-transparent-expression-wrappers/-/helper-skip-transparent-expression-wrappers-7.12.1.tgz", + "integrity": "sha512-Mf5AUuhG1/OCChOJ/HcADmvcHM42WJockombn8ATJG3OnyiSxBK/Mm5x78BQWvmtXZKHgbjdGL2kin/HOLlZGA==", + "dependencies": { + "@babel/types": "^7.12.1" + } + }, + "node_modules/@babel/helper-split-export-declaration": { + "version": "7.11.0", + "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz", + "integrity": "sha512-74Vejvp6mHkGE+m+k5vHY93FX2cAtrw1zXrZXRlG4l410Nm9PxfEiVTn1PjDPV5SnmieiueY4AFg2xqhNFuuZg==", + "dependencies": { + "@babel/types": "^7.11.0" + } + }, + "node_modules/@babel/helper-validator-identifier": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.10.4.tgz", + "integrity": "sha512-3U9y+43hz7ZM+rzG24Qe2mufW5KhvFg/NhnNph+i9mgCtdTCtMJuI1TMkrIUiK7Ix4PYlRF9I5dhqaLYA/ADXw==" + }, + "node_modules/@babel/helper-validator-option": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-option/-/helper-validator-option-7.12.1.tgz", + "integrity": "sha512-YpJabsXlJVWP0USHjnC/AQDTLlZERbON577YUVO/wLpqyj6HAtVYnWaQaN0iUN+1/tWn3c+uKKXjRut5115Y2A==" + }, + "node_modules/@babel/helper-wrap-function": { + "version": "7.12.3", + "resolved": "https://registry.npmjs.org/@babel/helper-wrap-function/-/helper-wrap-function-7.12.3.tgz", + "integrity": "sha512-Cvb8IuJDln3rs6tzjW3Y8UeelAOdnpB8xtQ4sme2MSZ9wOxrbThporC0y/EtE16VAtoyEfLM404Xr1e0OOp+ow==", + "dependencies": { + "@babel/helper-function-name": "^7.10.4", + "@babel/template": "^7.10.4", + "@babel/traverse": "^7.10.4", + "@babel/types": "^7.10.4" + } + }, + "node_modules/@babel/helper-wrap-function/node_modules/@babel/template": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.12.7.tgz", + "integrity": "sha512-GkDzmHS6GV7ZeXfJZ0tLRBhZcMcY0/Lnb+eEbXDBfCAcZCjrZKe6p3J4we/D24O9Y8enxWAg1cWwof59yLh2ow==", + "dependencies": { + "@babel/code-frame": "^7.10.4", + "@babel/parser": "^7.12.7", + "@babel/types": "^7.12.7" + } + }, + "node_modules/@babel/helpers": { + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.12.5.tgz", + "integrity": "sha512-lgKGMQlKqA8meJqKsW6rUnc4MdUk35Ln0ATDqdM1a/UpARODdI4j5Y5lVfUScnSNkJcdCRAaWkspykNoFg9sJA==", + "dependencies": { + "@babel/template": "^7.10.4", + "@babel/traverse": "^7.12.5", + "@babel/types": "^7.12.5" + } + }, + "node_modules/@babel/helpers/node_modules/@babel/template": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.12.7.tgz", + "integrity": "sha512-GkDzmHS6GV7ZeXfJZ0tLRBhZcMcY0/Lnb+eEbXDBfCAcZCjrZKe6p3J4we/D24O9Y8enxWAg1cWwof59yLh2ow==", + "dependencies": { + "@babel/code-frame": "^7.10.4", + "@babel/parser": "^7.12.7", + "@babel/types": "^7.12.7" + } + }, + "node_modules/@babel/highlight": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.10.4.tgz", + "integrity": "sha512-i6rgnR/YgPEQzZZnbTHHuZdlE8qyoBNalD6F+q4vAFlcMEcqmkoG+mPqJYJCo63qPf74+Y1UZsl3l6f7/RIkmA==", + "dependencies": { + "@babel/helper-validator-identifier": "^7.10.4", + "chalk": "^2.0.0", + "js-tokens": "^4.0.0" + } + }, + "node_modules/@babel/parser": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.12.7.tgz", + "integrity": "sha512-oWR02Ubp4xTLCAqPRiNIuMVgNO5Aif/xpXtabhzW2HWUD47XJsAB4Zd/Rg30+XeQA3juXigV7hlquOTmwqLiwg==", + "bin": { + "parser": "bin/babel-parser.js" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@babel/plugin-proposal-async-generator-functions": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-async-generator-functions/-/plugin-proposal-async-generator-functions-7.12.1.tgz", + "integrity": "sha512-d+/o30tJxFxrA1lhzJqiUcEJdI6jKlNregCv5bASeGf2Q4MXmnwH7viDo7nhx1/ohf09oaH8j1GVYG/e3Yqk6A==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/helper-remap-async-to-generator": "^7.12.1", + "@babel/plugin-syntax-async-generators": "^7.8.0" + } + }, + "node_modules/@babel/plugin-proposal-dynamic-import": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-dynamic-import/-/plugin-proposal-dynamic-import-7.12.1.tgz", + "integrity": "sha512-a4rhUSZFuq5W8/OO8H7BL5zspjnc1FLd9hlOxIK/f7qG4a0qsqk8uvF/ywgBA8/OmjsapjpvaEOYItfGG1qIvQ==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/plugin-syntax-dynamic-import": "^7.8.0" + } + }, + "node_modules/@babel/plugin-proposal-json-strings": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-json-strings/-/plugin-proposal-json-strings-7.12.1.tgz", + "integrity": "sha512-GoLDUi6U9ZLzlSda2Df++VSqDJg3CG+dR0+iWsv6XRw1rEq+zwt4DirM9yrxW6XWaTpmai1cWJLMfM8qQJf+yw==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/plugin-syntax-json-strings": "^7.8.0" + } + }, + "node_modules/@babel/plugin-proposal-nullish-coalescing-operator": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-nullish-coalescing-operator/-/plugin-proposal-nullish-coalescing-operator-7.12.1.tgz", + "integrity": "sha512-nZY0ESiaQDI1y96+jk6VxMOaL4LPo/QDHBqL+SF3/vl6dHkTwHlOI8L4ZwuRBHgakRBw5zsVylel7QPbbGuYgg==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0" + } + }, + "node_modules/@babel/plugin-proposal-numeric-separator": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-numeric-separator/-/plugin-proposal-numeric-separator-7.12.7.tgz", + "integrity": "sha512-8c+uy0qmnRTeukiGsjLGy6uVs/TFjJchGXUeBqlG4VWYOdJWkhhVPdQ3uHwbmalfJwv2JsV0qffXP4asRfL2SQ==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/plugin-syntax-numeric-separator": "^7.10.4" + } + }, + "node_modules/@babel/plugin-proposal-object-rest-spread": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-object-rest-spread/-/plugin-proposal-object-rest-spread-7.12.1.tgz", + "integrity": "sha512-s6SowJIjzlhx8o7lsFx5zmY4At6CTtDvgNQDdPzkBQucle58A6b/TTeEBYtyDgmcXjUTM+vE8YOGHZzzbc/ioA==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/plugin-syntax-object-rest-spread": "^7.8.0", + "@babel/plugin-transform-parameters": "^7.12.1" + } + }, + "node_modules/@babel/plugin-proposal-optional-catch-binding": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-catch-binding/-/plugin-proposal-optional-catch-binding-7.12.1.tgz", + "integrity": "sha512-hFvIjgprh9mMw5v42sJWLI1lzU5L2sznP805zeT6rySVRA0Y18StRhDqhSxlap0oVgItRsB6WSROp4YnJTJz0g==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/plugin-syntax-optional-catch-binding": "^7.8.0" + } + }, + "node_modules/@babel/plugin-proposal-optional-chaining": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-optional-chaining/-/plugin-proposal-optional-chaining-7.12.7.tgz", + "integrity": "sha512-4ovylXZ0PWmwoOvhU2vhnzVNnm88/Sm9nx7V8BPgMvAzn5zDou3/Awy0EjglyubVHasJj+XCEkr/r1X3P5elCA==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/helper-skip-transparent-expression-wrappers": "^7.12.1", + "@babel/plugin-syntax-optional-chaining": "^7.8.0" + } + }, + "node_modules/@babel/plugin-proposal-unicode-property-regex": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-unicode-property-regex/-/plugin-proposal-unicode-property-regex-7.12.1.tgz", + "integrity": "sha512-MYq+l+PvHuw/rKUz1at/vb6nCnQ2gmJBNaM62z0OgH7B2W1D9pvkpYtlti9bGtizNIU1K3zm4bZF9F91efVY0w==", + "dependencies": { + "@babel/helper-create-regexp-features-plugin": "^7.12.1", + "@babel/helper-plugin-utils": "^7.10.4" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/@babel/plugin-syntax-async-generators": { + "version": "7.8.4", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-async-generators/-/plugin-syntax-async-generators-7.8.4.tgz", + "integrity": "sha512-tycmZxkGfZaxhMRbXlPXuVFpdWlXpir2W4AMhSJgRKzk/eDlIXOhb2LHWoLpDF7TEHylV5zNhykX6KAgHJmTNw==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "node_modules/@babel/plugin-syntax-dynamic-import": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-dynamic-import/-/plugin-syntax-dynamic-import-7.8.3.tgz", + "integrity": "sha512-5gdGbFon+PszYzqs83S3E5mpi7/y/8M9eC90MRTZfduQOYW76ig6SOSPNe41IG5LoP3FGBn2N0RjVDSQiS94kQ==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "node_modules/@babel/plugin-syntax-json-strings": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-json-strings/-/plugin-syntax-json-strings-7.8.3.tgz", + "integrity": "sha512-lY6kdGpWHvjoe2vk4WrAapEuBR69EMxZl+RoGRhrFGNYVK8mOPAW8VfbT/ZgrFbXlDNiiaxQnAtgVCZ6jv30EA==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "node_modules/@babel/plugin-syntax-nullish-coalescing-operator": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-nullish-coalescing-operator/-/plugin-syntax-nullish-coalescing-operator-7.8.3.tgz", + "integrity": "sha512-aSff4zPII1u2QD7y+F8oDsz19ew4IGEJg9SVW+bqwpwtfFleiQDMdzA/R+UlWDzfnHFCxxleFT0PMIrR36XLNQ==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "node_modules/@babel/plugin-syntax-numeric-separator": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-numeric-separator/-/plugin-syntax-numeric-separator-7.10.4.tgz", + "integrity": "sha512-9H6YdfkcK/uOnY/K7/aA2xpzaAgkQn37yzWUMRK7OaPOqOpGS1+n0H5hxT9AUw9EsSjPW8SVyMJwYRtWs3X3ug==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-syntax-object-rest-spread": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-object-rest-spread/-/plugin-syntax-object-rest-spread-7.8.3.tgz", + "integrity": "sha512-XoqMijGZb9y3y2XskN+P1wUGiVwWZ5JmoDRwx5+3GmEplNyVM2s2Dg8ILFQm8rWM48orGy5YpI5Bl8U1y7ydlA==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "node_modules/@babel/plugin-syntax-optional-catch-binding": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-catch-binding/-/plugin-syntax-optional-catch-binding-7.8.3.tgz", + "integrity": "sha512-6VPD0Pc1lpTqw0aKoeRTMiB+kWhAoT24PA+ksWSBrFtl5SIRVpZlwN3NNPQjehA2E/91FV3RjLWoVTglWcSV3Q==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "node_modules/@babel/plugin-syntax-optional-chaining": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-optional-chaining/-/plugin-syntax-optional-chaining-7.8.3.tgz", + "integrity": "sha512-KoK9ErH1MBlCPxV0VANkXW2/dw4vlbGDrFgz8bmUsBGYkFRcbRwMh6cIJubdPrkxRwuGdtCk0v/wPTKbQgBjkg==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.8.0" + } + }, + "node_modules/@babel/plugin-syntax-top-level-await": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-top-level-await/-/plugin-syntax-top-level-await-7.12.1.tgz", + "integrity": "sha512-i7ooMZFS+a/Om0crxZodrTzNEPJHZrlMVGMTEpFAj6rYY/bKCddB0Dk/YxfPuYXOopuhKk/e1jV6h+WUU9XN3A==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-arrow-functions": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-arrow-functions/-/plugin-transform-arrow-functions-7.12.1.tgz", + "integrity": "sha512-5QB50qyN44fzzz4/qxDPQMBCTHgxg3n0xRBLJUmBlLoU/sFvxVWGZF/ZUfMVDQuJUKXaBhbupxIzIfZ6Fwk/0A==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-async-to-generator": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-async-to-generator/-/plugin-transform-async-to-generator-7.12.1.tgz", + "integrity": "sha512-SDtqoEcarK1DFlRJ1hHRY5HvJUj5kX4qmtpMAm2QnhOlyuMC4TMdCRgW6WXpv93rZeYNeLP22y8Aq2dbcDRM1A==", + "dependencies": { + "@babel/helper-module-imports": "^7.12.1", + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/helper-remap-async-to-generator": "^7.12.1" + } + }, + "node_modules/@babel/plugin-transform-block-scoped-functions": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoped-functions/-/plugin-transform-block-scoped-functions-7.12.1.tgz", + "integrity": "sha512-5OpxfuYnSgPalRpo8EWGPzIYf0lHBWORCkj5M0oLBwHdlux9Ri36QqGW3/LR13RSVOAoUUMzoPI/jpE4ABcHoA==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-block-scoping": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-block-scoping/-/plugin-transform-block-scoping-7.12.1.tgz", + "integrity": "sha512-zJyAC9sZdE60r1nVQHblcfCj29Dh2Y0DOvlMkcqSo0ckqjiCwNiUezUKw+RjOCwGfpLRwnAeQ2XlLpsnGkvv9w==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-classes": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-classes/-/plugin-transform-classes-7.12.1.tgz", + "integrity": "sha512-/74xkA7bVdzQTBeSUhLLJgYIcxw/dpEpCdRDiHgPJ3Mv6uC11UhjpOhl72CgqbBCmt1qtssCyB2xnJm1+PFjog==", + "dependencies": { + "@babel/helper-annotate-as-pure": "^7.10.4", + "@babel/helper-define-map": "^7.10.4", + "@babel/helper-function-name": "^7.10.4", + "@babel/helper-optimise-call-expression": "^7.10.4", + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/helper-replace-supers": "^7.12.1", + "@babel/helper-split-export-declaration": "^7.10.4", + "globals": "^11.1.0" + } + }, + "node_modules/@babel/plugin-transform-computed-properties": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-computed-properties/-/plugin-transform-computed-properties-7.12.1.tgz", + "integrity": "sha512-vVUOYpPWB7BkgUWPo4C44mUQHpTZXakEqFjbv8rQMg7TC6S6ZhGZ3otQcRH6u7+adSlE5i0sp63eMC/XGffrzg==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-destructuring": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-destructuring/-/plugin-transform-destructuring-7.12.1.tgz", + "integrity": "sha512-fRMYFKuzi/rSiYb2uRLiUENJOKq4Gnl+6qOv5f8z0TZXg3llUwUhsNNwrwaT/6dUhJTzNpBr+CUvEWBtfNY1cw==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-dotall-regex": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-dotall-regex/-/plugin-transform-dotall-regex-7.12.1.tgz", + "integrity": "sha512-B2pXeRKoLszfEW7J4Hg9LoFaWEbr/kzo3teWHmtFCszjRNa/b40f9mfeqZsIDLLt/FjwQ6pz/Gdlwy85xNckBA==", + "dependencies": { + "@babel/helper-create-regexp-features-plugin": "^7.12.1", + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-duplicate-keys": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-duplicate-keys/-/plugin-transform-duplicate-keys-7.12.1.tgz", + "integrity": "sha512-iRght0T0HztAb/CazveUpUQrZY+aGKKaWXMJ4uf9YJtqxSUe09j3wteztCUDRHs+SRAL7yMuFqUsLoAKKzgXjw==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-exponentiation-operator": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-exponentiation-operator/-/plugin-transform-exponentiation-operator-7.12.1.tgz", + "integrity": "sha512-7tqwy2bv48q+c1EHbXK0Zx3KXd2RVQp6OC7PbwFNt/dPTAV3Lu5sWtWuAj8owr5wqtWnqHfl2/mJlUmqkChKug==", + "dependencies": { + "@babel/helper-builder-binary-assignment-operator-visitor": "^7.10.4", + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-for-of": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-for-of/-/plugin-transform-for-of-7.12.1.tgz", + "integrity": "sha512-Zaeq10naAsuHo7heQvyV0ptj4dlZJwZgNAtBYBnu5nNKJoW62m0zKcIEyVECrUKErkUkg6ajMy4ZfnVZciSBhg==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-function-name": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-function-name/-/plugin-transform-function-name-7.12.1.tgz", + "integrity": "sha512-JF3UgJUILoFrFMEnOJLJkRHSk6LUSXLmEFsA23aR2O5CSLUxbeUX1IZ1YQ7Sn0aXb601Ncwjx73a+FVqgcljVw==", + "dependencies": { + "@babel/helper-function-name": "^7.10.4", + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-literals": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-literals/-/plugin-transform-literals-7.12.1.tgz", + "integrity": "sha512-+PxVGA+2Ag6uGgL0A5f+9rklOnnMccwEBzwYFL3EUaKuiyVnUipyXncFcfjSkbimLrODoqki1U9XxZzTvfN7IQ==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-member-expression-literals": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-member-expression-literals/-/plugin-transform-member-expression-literals-7.12.1.tgz", + "integrity": "sha512-1sxePl6z9ad0gFMB9KqmYofk34flq62aqMt9NqliS/7hPEpURUCMbyHXrMPlo282iY7nAvUB1aQd5mg79UD9Jg==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-modules-amd": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-amd/-/plugin-transform-modules-amd-7.12.1.tgz", + "integrity": "sha512-tDW8hMkzad5oDtzsB70HIQQRBiTKrhfgwC/KkJeGsaNFTdWhKNt/BiE8c5yj19XiGyrxpbkOfH87qkNg1YGlOQ==", + "dependencies": { + "@babel/helper-module-transforms": "^7.12.1", + "@babel/helper-plugin-utils": "^7.10.4", + "babel-plugin-dynamic-import-node": "^2.3.3" + } + }, + "node_modules/@babel/plugin-transform-modules-commonjs": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-commonjs/-/plugin-transform-modules-commonjs-7.12.1.tgz", + "integrity": "sha512-dY789wq6l0uLY8py9c1B48V8mVL5gZh/+PQ5ZPrylPYsnAvnEMjqsUXkuoDVPeVK+0VyGar+D08107LzDQ6pag==", + "dependencies": { + "@babel/helper-module-transforms": "^7.12.1", + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/helper-simple-access": "^7.12.1", + "babel-plugin-dynamic-import-node": "^2.3.3" + } + }, + "node_modules/@babel/plugin-transform-modules-systemjs": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-systemjs/-/plugin-transform-modules-systemjs-7.12.1.tgz", + "integrity": "sha512-Hn7cVvOavVh8yvW6fLwveFqSnd7rbQN3zJvoPNyNaQSvgfKmDBO9U1YL9+PCXGRlZD9tNdWTy5ACKqMuzyn32Q==", + "dependencies": { + "@babel/helper-hoist-variables": "^7.10.4", + "@babel/helper-module-transforms": "^7.12.1", + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/helper-validator-identifier": "^7.10.4", + "babel-plugin-dynamic-import-node": "^2.3.3" + } + }, + "node_modules/@babel/plugin-transform-modules-umd": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-modules-umd/-/plugin-transform-modules-umd-7.12.1.tgz", + "integrity": "sha512-aEIubCS0KHKM0zUos5fIoQm+AZUMt1ZvMpqz0/H5qAQ7vWylr9+PLYurT+Ic7ID/bKLd4q8hDovaG3Zch2uz5Q==", + "dependencies": { + "@babel/helper-module-transforms": "^7.12.1", + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-named-capturing-groups-regex": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-named-capturing-groups-regex/-/plugin-transform-named-capturing-groups-regex-7.12.1.tgz", + "integrity": "sha512-tB43uQ62RHcoDp9v2Nsf+dSM8sbNodbEicbQNA53zHz8pWUhsgHSJCGpt7daXxRydjb0KnfmB+ChXOv3oADp1Q==", + "dependencies": { + "@babel/helper-create-regexp-features-plugin": "^7.12.1" + } + }, + "node_modules/@babel/plugin-transform-new-target": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-new-target/-/plugin-transform-new-target-7.12.1.tgz", + "integrity": "sha512-+eW/VLcUL5L9IvJH7rT1sT0CzkdUTvPrXC2PXTn/7z7tXLBuKvezYbGdxD5WMRoyvyaujOq2fWoKl869heKjhw==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-object-super": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-object-super/-/plugin-transform-object-super-7.12.1.tgz", + "integrity": "sha512-AvypiGJH9hsquNUn+RXVcBdeE3KHPZexWRdimhuV59cSoOt5kFBmqlByorAeUlGG2CJWd0U+4ZtNKga/TB0cAw==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/helper-replace-supers": "^7.12.1" + } + }, + "node_modules/@babel/plugin-transform-parameters": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-parameters/-/plugin-transform-parameters-7.12.1.tgz", + "integrity": "sha512-xq9C5EQhdPK23ZeCdMxl8bbRnAgHFrw5EOC3KJUsSylZqdkCaFEXxGSBuTSObOpiiHHNyb82es8M1QYgfQGfNg==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-property-literals": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-property-literals/-/plugin-transform-property-literals-7.12.1.tgz", + "integrity": "sha512-6MTCR/mZ1MQS+AwZLplX4cEySjCpnIF26ToWo942nqn8hXSm7McaHQNeGx/pt7suI1TWOWMfa/NgBhiqSnX0cQ==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-regenerator": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-regenerator/-/plugin-transform-regenerator-7.12.1.tgz", + "integrity": "sha512-gYrHqs5itw6i4PflFX3OdBPMQdPbF4bj2REIUxlMRUFk0/ZOAIpDFuViuxPjUL7YC8UPnf+XG7/utJvqXdPKng==", + "dependencies": { + "regenerator-transform": "^0.14.2" + } + }, + "node_modules/@babel/plugin-transform-reserved-words": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-reserved-words/-/plugin-transform-reserved-words-7.12.1.tgz", + "integrity": "sha512-pOnUfhyPKvZpVyBHhSBoX8vfA09b7r00Pmm1sH+29ae2hMTKVmSp4Ztsr8KBKjLjx17H0eJqaRC3bR2iThM54A==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-shorthand-properties": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-shorthand-properties/-/plugin-transform-shorthand-properties-7.12.1.tgz", + "integrity": "sha512-GFZS3c/MhX1OusqB1MZ1ct2xRzX5ppQh2JU1h2Pnfk88HtFTM+TWQqJNfwkmxtPQtb/s1tk87oENfXJlx7rSDw==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-spread": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-spread/-/plugin-transform-spread-7.12.1.tgz", + "integrity": "sha512-vuLp8CP0BE18zVYjsEBZ5xoCecMK6LBMMxYzJnh01rxQRvhNhH1csMMmBfNo5tGpGO+NhdSNW2mzIvBu3K1fng==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4", + "@babel/helper-skip-transparent-expression-wrappers": "^7.12.1" + } + }, + "node_modules/@babel/plugin-transform-sticky-regex": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-sticky-regex/-/plugin-transform-sticky-regex-7.12.7.tgz", + "integrity": "sha512-VEiqZL5N/QvDbdjfYQBhruN0HYjSPjC4XkeqW4ny/jNtH9gcbgaqBIXYEZCNnESMAGs0/K/R7oFGMhOyu/eIxg==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-template-literals": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-template-literals/-/plugin-transform-template-literals-7.12.1.tgz", + "integrity": "sha512-b4Zx3KHi+taXB1dVRBhVJtEPi9h1THCeKmae2qP0YdUHIFhVjtpqqNfxeVAa1xeHVhAy4SbHxEwx5cltAu5apw==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-typeof-symbol": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-typeof-symbol/-/plugin-transform-typeof-symbol-7.12.1.tgz", + "integrity": "sha512-EPGgpGy+O5Kg5pJFNDKuxt9RdmTgj5sgrus2XVeMp/ZIbOESadgILUbm50SNpghOh3/6yrbsH+NB5+WJTmsA7Q==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/plugin-transform-unicode-regex": { + "version": "7.12.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-unicode-regex/-/plugin-transform-unicode-regex-7.12.1.tgz", + "integrity": "sha512-SqH4ClNngh/zGwHZOOQMTD+e8FGWexILV+ePMyiDJttAWRh5dhDL8rcl5lSgU3Huiq6Zn6pWTMvdPAb21Dwdyg==", + "dependencies": { + "@babel/helper-create-regexp-features-plugin": "^7.12.1", + "@babel/helper-plugin-utils": "^7.10.4" + } + }, + "node_modules/@babel/preset-env": { + "version": "7.9.0", + "resolved": "https://registry.npmjs.org/@babel/preset-env/-/preset-env-7.9.0.tgz", + "integrity": "sha512-712DeRXT6dyKAM/FMbQTV/FvRCms2hPCx+3weRjZ8iQVQWZejWWk1wwG6ViWMyqb/ouBbGOl5b6aCk0+j1NmsQ==", + "dependencies": { + "@babel/compat-data": "^7.9.0", + "@babel/helper-compilation-targets": "^7.8.7", + "@babel/helper-module-imports": "^7.8.3", + "@babel/helper-plugin-utils": "^7.8.3", + "@babel/plugin-proposal-async-generator-functions": "^7.8.3", + "@babel/plugin-proposal-dynamic-import": "^7.8.3", + "@babel/plugin-proposal-json-strings": "^7.8.3", + "@babel/plugin-proposal-nullish-coalescing-operator": "^7.8.3", + "@babel/plugin-proposal-numeric-separator": "^7.8.3", + "@babel/plugin-proposal-object-rest-spread": "^7.9.0", + "@babel/plugin-proposal-optional-catch-binding": "^7.8.3", + "@babel/plugin-proposal-optional-chaining": "^7.9.0", + "@babel/plugin-proposal-unicode-property-regex": "^7.8.3", + "@babel/plugin-syntax-async-generators": "^7.8.0", + "@babel/plugin-syntax-dynamic-import": "^7.8.0", + "@babel/plugin-syntax-json-strings": "^7.8.0", + "@babel/plugin-syntax-nullish-coalescing-operator": "^7.8.0", + "@babel/plugin-syntax-numeric-separator": "^7.8.0", + "@babel/plugin-syntax-object-rest-spread": "^7.8.0", + "@babel/plugin-syntax-optional-catch-binding": "^7.8.0", + "@babel/plugin-syntax-optional-chaining": "^7.8.0", + "@babel/plugin-syntax-top-level-await": "^7.8.3", + "@babel/plugin-transform-arrow-functions": "^7.8.3", + "@babel/plugin-transform-async-to-generator": "^7.8.3", + "@babel/plugin-transform-block-scoped-functions": "^7.8.3", + "@babel/plugin-transform-block-scoping": "^7.8.3", + "@babel/plugin-transform-classes": "^7.9.0", + "@babel/plugin-transform-computed-properties": "^7.8.3", + "@babel/plugin-transform-destructuring": "^7.8.3", + "@babel/plugin-transform-dotall-regex": "^7.8.3", + "@babel/plugin-transform-duplicate-keys": "^7.8.3", + "@babel/plugin-transform-exponentiation-operator": "^7.8.3", + "@babel/plugin-transform-for-of": "^7.9.0", + "@babel/plugin-transform-function-name": "^7.8.3", + "@babel/plugin-transform-literals": "^7.8.3", + "@babel/plugin-transform-member-expression-literals": "^7.8.3", + "@babel/plugin-transform-modules-amd": "^7.9.0", + "@babel/plugin-transform-modules-commonjs": "^7.9.0", + "@babel/plugin-transform-modules-systemjs": "^7.9.0", + "@babel/plugin-transform-modules-umd": "^7.9.0", + "@babel/plugin-transform-named-capturing-groups-regex": "^7.8.3", + "@babel/plugin-transform-new-target": "^7.8.3", + "@babel/plugin-transform-object-super": "^7.8.3", + "@babel/plugin-transform-parameters": "^7.8.7", + "@babel/plugin-transform-property-literals": "^7.8.3", + "@babel/plugin-transform-regenerator": "^7.8.7", + "@babel/plugin-transform-reserved-words": "^7.8.3", + "@babel/plugin-transform-shorthand-properties": "^7.8.3", + "@babel/plugin-transform-spread": "^7.8.3", + "@babel/plugin-transform-sticky-regex": "^7.8.3", + "@babel/plugin-transform-template-literals": "^7.8.3", + "@babel/plugin-transform-typeof-symbol": "^7.8.4", + "@babel/plugin-transform-unicode-regex": "^7.8.3", + "@babel/preset-modules": "^0.1.3", + "@babel/types": "^7.9.0", + "browserslist": "^4.9.1", + "core-js-compat": "^3.6.2", + "invariant": "^2.2.2", + "levenary": "^1.1.1", + "semver": "^5.5.0" + } + }, + "node_modules/@babel/preset-env/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/@babel/preset-modules": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/@babel/preset-modules/-/preset-modules-0.1.4.tgz", + "integrity": "sha512-J36NhwnfdzpmH41M1DrnkkgAqhZaqr/NBdPfQ677mLzlaXo+oDiv1deyCDtgAhz8p328otdob0Du7+xgHGZbKg==", + "dependencies": { + "@babel/helper-plugin-utils": "^7.0.0", + "@babel/plugin-proposal-unicode-property-regex": "^7.4.4", + "@babel/plugin-transform-dotall-regex": "^7.4.4", + "@babel/types": "^7.4.4", + "esutils": "^2.0.2" + } + }, + "node_modules/@babel/runtime": { + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.12.5.tgz", + "integrity": "sha512-plcc+hbExy3McchJCEQG3knOsuh3HH+Prx1P6cLIkET/0dLuQDEnrT+s27Axgc9bqfsmNUNHfscgMUdBpC9xfg==", + "dependencies": { + "regenerator-runtime": "^0.13.4" + } + }, + "node_modules/@babel/template": { + "version": "7.8.6", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.8.6.tgz", + "integrity": "sha512-zbMsPMy/v0PWFZEhQJ66bqjhH+z0JgMoBWuikXybgG3Gkd/3t5oQ1Rw2WQhnSrsOmsKXnZOx15tkC4qON/+JPg==", + "dependencies": { + "@babel/code-frame": "^7.8.3", + "@babel/parser": "^7.8.6", + "@babel/types": "^7.8.6" + } + }, + "node_modules/@babel/traverse": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.12.7.tgz", + "integrity": "sha512-nMWaqsQEeSvMNypswUDzjqQ+0rR6pqCtoQpsqGJC4/Khm9cISwPTSpai57F6/jDaOoEGz8yE/WxcO3PV6tKSmQ==", + "dependencies": { + "@babel/code-frame": "^7.10.4", + "@babel/generator": "^7.12.5", + "@babel/helper-function-name": "^7.10.4", + "@babel/helper-split-export-declaration": "^7.11.0", + "@babel/parser": "^7.12.7", + "@babel/types": "^7.12.7", + "debug": "^4.1.0", + "globals": "^11.1.0", + "lodash": "^4.17.19" + } + }, + "node_modules/@babel/traverse/node_modules/@babel/generator": { + "version": "7.12.5", + "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.12.5.tgz", + "integrity": "sha512-m16TQQJ8hPt7E+OS/XVQg/7U184MLXtvuGbCdA7na61vha+ImkyyNM/9DDA0unYCVZn3ZOhng+qz48/KBOT96A==", + "dependencies": { + "@babel/types": "^7.12.5", + "jsesc": "^2.5.1", + "source-map": "^0.5.0" + } + }, + "node_modules/@babel/traverse/node_modules/lodash": { + "version": "4.17.20", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", + "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==" + }, + "node_modules/@babel/traverse/node_modules/source-map": { + "version": "0.5.7", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", + "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/@babel/types": { + "version": "7.12.7", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.12.7.tgz", + "integrity": "sha512-MNyI92qZq6jrQkXvtIiykvl4WtoRrVV9MPn+ZfsoEENjiWcBQ3ZSHrkxnJWgWtLX3XXqX5hrSQ+X69wkmesXuQ==", + "dependencies": { + "@babel/helper-validator-identifier": "^7.10.4", + "lodash": "^4.17.19", + "to-fast-properties": "^2.0.0" + } + }, + "node_modules/@babel/types/node_modules/lodash": { + "version": "4.17.20", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.20.tgz", + "integrity": "sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA==" + }, + "node_modules/@biesbjerg/ngx-translate-extract": { + "version": "6.0.4", + "resolved": "https://registry.npmjs.org/@biesbjerg/ngx-translate-extract/-/ngx-translate-extract-6.0.4.tgz", + "integrity": "sha512-loaQc0ZNpGClW6D4nDslEOZ0OQJnqWWWDkRnPqmv8BlbMHNH1M7hpoQdxa/8utZ6DiWr9D3/rbTK/YlB4V3bHA==", + "dependencies": { + "@phenomnomnominal/tsquery": "^4.0.0", + "boxen": "^4.2.0", + "colorette": "^1.1.0", + "flat": "^5.0.0", + "gettext-parser": "^4.0.3", + "glob": "^7.1.6", + "mkdirp": "^1.0.3", + "path": "^0.12.7", + "terminal-link": "^2.1.1", + "yargs": "^15.3.1" + }, + "bin": { + "ngx-translate-extract": "bin/cli.js" + }, + "engines": { + "node": ">=11.15.0" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract-marker": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/@biesbjerg/ngx-translate-extract-marker/-/ngx-translate-extract-marker-1.0.0.tgz", + "integrity": "sha512-GlCBQKmFE+b+qfIO0aGvuRc4LJVSfK27K2QQFXZLP55/w28iiq/q2CnBS8ya+4l+hapm7U3QPtFoZu9lmbUuew==", + "dependencies": { + "tslib": "^1.9.0" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/ansi-regex": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", + "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/cliui": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-6.0.0.tgz", + "integrity": "sha512-t6wbgtoCXvAzst7QgXxJYqPt0usEfbgQdftEPbLL/cvv6HPE5VgvqCuAIDR0NgU52ds6rFwqrgakNLrHEjCbrQ==", + "dependencies": { + "string-width": "^4.2.0", + "strip-ansi": "^6.0.0", + "wrap-ansi": "^6.2.0" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/find-up": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", + "dependencies": { + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/get-caller-file": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", + "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", + "engines": { + "node": "6.* || 8.* || >= 10.*" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/locate-path": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", + "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", + "dependencies": { + "p-locate": "^4.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/mkdirp": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-1.0.4.tgz", + "integrity": "sha512-vVqVZQyf3WLx2Shd0qJ9xuvqgAyKPLAiqITEtqW0oIUjzo3PePDd6fW9iFz30ef7Ysp/oiWqbhszeGWW2T6Gzw==", + "bin": { + "mkdirp": "bin/cmd.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/p-locate": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", + "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", + "dependencies": { + "p-limit": "^2.2.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/require-main-filename": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", + "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==" + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/string-width": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.0.tgz", + "integrity": "sha512-zUz5JD+tgqtuDjMhwIg5uFVV3dtqZ9yQJlZVfq4I01/K5Paj5UHj7VyrQOJvzawSVlKpObApbfD0Ed6yJc+1eg==", + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dependencies": { + "ansi-regex": "^5.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/wrap-ansi": { + "version": "6.2.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-6.2.0.tgz", + "integrity": "sha512-r6lPcBGxZXlIcymEu7InxDMhdW0KDxpLgoFLcguasxCaJ/SOIZwINatK9KY/tf+ZrlywOKU0UDj3ATXUBfxJXA==", + "dependencies": { + "ansi-styles": "^4.0.0", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/yargs": { + "version": "15.4.1", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.4.1.tgz", + "integrity": "sha512-aePbxDmcYW++PaqBsJ+HYUFwCdv4LVvdnhBy78E57PIor8/OVvhMrADFFEDh8DHDFRv/O9i3lPhsENjO7QX0+A==", + "dependencies": { + "cliui": "^6.0.0", + "decamelize": "^1.2.0", + "find-up": "^4.1.0", + "get-caller-file": "^2.0.1", + "require-directory": "^2.1.1", + "require-main-filename": "^2.0.0", + "set-blocking": "^2.0.0", + "string-width": "^4.2.0", + "which-module": "^2.0.0", + "y18n": "^4.0.0", + "yargs-parser": "^18.1.2" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/@biesbjerg/ngx-translate-extract/node_modules/yargs-parser": { + "version": "18.1.3", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.3.tgz", + "integrity": "sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ==", + "dependencies": { + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/@exlibris/exl-cloudapp-angular-lib": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@exlibris/exl-cloudapp-angular-lib/-/exl-cloudapp-angular-lib-1.0.1.tgz", + "integrity": "sha512-84ASbbHqqUHPLEFiOt01vmRTAkJgOzBRPSoMRYK6ESZTZ7aUffU0fCdn52Y1CvQyaHswhiF5t2mSAQPMnecuSQ==" + }, + "node_modules/@exlibris/exl-cloudapp-base": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@exlibris/exl-cloudapp-base/-/exl-cloudapp-base-1.0.1.tgz", + "integrity": "sha512-Fmtbo8TX5bBReSL8v3Jqj7UI85vlRmnF0IcaISlUBcKwiApz/cbl/waRGalcYQimkREO1Y9Or9tTAjMAEl/geg==", + "hasInstallScript": true, + "dependencies": { + "@angular-devkit/build-angular": "0.901.5", + "@angular/animations": "9.1.6", + "@angular/cdk": "9.2.3", + "@angular/cli": "9.1.5", + "@angular/common": "9.1.6", + "@angular/compiler": "9.1.6", + "@angular/compiler-cli": "9.1.6", + "@angular/core": "9.1.6", + "@angular/forms": "9.1.6", + "@angular/language-service": "9.1.6", + "@angular/material": "9.2.3", + "@angular/platform-browser": "9.1.6", + "@angular/platform-browser-dynamic": "9.1.6", + "@angular/router": "9.1.6", + "@biesbjerg/ngx-translate-extract": "6.0.4", + "@biesbjerg/ngx-translate-extract-marker": "1.0.0", + "@exlibris/exl-cloudapp-angular-lib": "^1.0.1", + "@ngx-translate/core": "12.1.2", + "@ngx-translate/http-loader": "4.0.0", + "@types/node": "13.13.5", + "lodash": "4.17.15", + "loglevel": "1.6.8", + "ngx-toastr": "12.0.1", + "rxjs": "6.5.5", + "ste-core": "1.6.11", + "ste-events": "1.6.11", + "ste-signals": "1.6.11", + "ste-simple-events": "1.6.11", + "strongly-typed-events": "1.6.11", + "ts-node": "8.10.1", + "tslib": "1.12.0", + "tslint": "6.1.2", + "typescript": "3.8.3", + "uuid": "8.0.0", + "zone.js": "0.10.3" + } + }, + "node_modules/@istanbuljs/schema": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/@istanbuljs/schema/-/schema-0.1.2.tgz", + "integrity": "sha512-tsAQNx32a8CoFhjhijUIhI4kccIAgmGhy8LZMZgGfmXcpMbPRUqn5LWmgRttILi6yeGmBJd2xsPkFMs0PzgPCw==", + "engines": { + "node": ">=8" + } + }, + "node_modules/@jsdevtools/coverage-istanbul-loader": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@jsdevtools/coverage-istanbul-loader/-/coverage-istanbul-loader-3.0.3.tgz", + "integrity": "sha512-TAdNkeGB5Fe4Og+ZkAr1Kvn9by2sfL44IAHFtxlh1BA1XJ5cLpO9iSNki5opWESv3l3vSHsZ9BNKuqFKbEbFaA==", + "dependencies": { + "convert-source-map": "^1.7.0", + "istanbul-lib-instrument": "^4.0.1", + "loader-utils": "^1.4.0", + "merge-source-map": "^1.1.0", + "schema-utils": "^2.6.4" + } + }, + "node_modules/@jsdevtools/coverage-istanbul-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/@jsdevtools/coverage-istanbul-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/@ngtools/webpack": { + "version": "9.1.5", + "resolved": "https://registry.npmjs.org/@ngtools/webpack/-/webpack-9.1.5.tgz", + "integrity": "sha512-6VzmlXRnf7phwLOiy0WrxHFHD5TuNQgVVpD/VFkZjtCTOsZyGQYGVPfaqxvn13M4Mm8bjrN4mk06VowCFm2oHw==", + "dependencies": { + "@angular-devkit/core": "9.1.5", + "enhanced-resolve": "4.1.1", + "rxjs": "6.5.4", + "webpack-sources": "1.4.3" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@ngtools/webpack/node_modules/rxjs": { + "version": "6.5.4", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.5.4.tgz", + "integrity": "sha512-naMQXcgEo3csAEGvw/NydRA0fuS2nDZJiw1YUWFKU7aPPAPGZEsD4Iimit96qwCieH6y614MCLYwdkrWx7z/7Q==", + "dependencies": { + "tslib": "^1.9.0" + }, + "engines": { + "npm": ">=2.0.0" + } + }, + "node_modules/@ngx-translate/core": { + "version": "12.1.2", + "resolved": "https://registry.npmjs.org/@ngx-translate/core/-/core-12.1.2.tgz", + "integrity": "sha512-ZudJsqIxTKlLmPoqK8gJY3UpMGujR0Xm7HfXL6AR79yGRS23QqpjAhMfx4v5qUCcHMmQ9/78bW8QJLfp31c7vQ==" + }, + "node_modules/@ngx-translate/http-loader": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/@ngx-translate/http-loader/-/http-loader-4.0.0.tgz", + "integrity": "sha512-x8LumqydWD7eX9yQTAVeoCM9gFUIGVTUjZqbxdAUavAA3qVnk9wCQux7iHLPXpydl8vyQmLoPQR+fFU+DUDOMA==", + "dependencies": { + "tslib": "^1.9.0" + } + }, + "node_modules/@phenomnomnominal/tsquery": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/@phenomnomnominal/tsquery/-/tsquery-4.1.1.tgz", + "integrity": "sha512-jjMmK1tnZbm1Jq5a7fBliM4gQwjxMU7TFoRNwIyzwlO+eHPRCFv/Nv+H/Gi1jc3WR7QURG8D5d0Tn12YGrUqBQ==", + "dependencies": { + "esquery": "^1.0.1" + } + }, + "node_modules/@schematics/angular": { + "version": "9.1.5", + "resolved": "https://registry.npmjs.org/@schematics/angular/-/angular-9.1.5.tgz", + "integrity": "sha512-kMscfnwd9TGLo8V+dE/Pzu4wNxZej/6F6z5XzMOQVFTbL+RqMDvtkHf9CarhiKBd5ogm4npfKV8ToNTUecFJkA==", + "dependencies": { + "@angular-devkit/core": "9.1.5", + "@angular-devkit/schematics": "9.1.5" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@schematics/update": { + "version": "0.901.5", + "resolved": "https://registry.npmjs.org/@schematics/update/-/update-0.901.5.tgz", + "integrity": "sha512-JmB+AuU6C9eM8x/CxeBEDigRuypzuWx7gnloK9D5i2gP9r39clFNtWT7eM3YW3kl4uyEMzrQHx6esMWNUScVBw==", + "dependencies": { + "@angular-devkit/core": "9.1.5", + "@angular-devkit/schematics": "9.1.5", + "@yarnpkg/lockfile": "1.1.0", + "ini": "1.3.5", + "npm-package-arg": "^8.0.0", + "pacote": "9.5.12", + "rxjs": "6.5.4", + "semver": "7.1.3", + "semver-intersect": "1.4.0" + }, + "engines": { + "node": ">= 10.13.0", + "npm": ">= 6.11.0", + "yarn": ">= 1.13.0" + } + }, + "node_modules/@schematics/update/node_modules/rxjs": { + "version": "6.5.4", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.5.4.tgz", + "integrity": "sha512-naMQXcgEo3csAEGvw/NydRA0fuS2nDZJiw1YUWFKU7aPPAPGZEsD4Iimit96qwCieH6y614MCLYwdkrWx7z/7Q==", + "dependencies": { + "tslib": "^1.9.0" + }, + "engines": { + "npm": ">=2.0.0" + } + }, + "node_modules/@types/glob": { + "version": "7.1.3", + "resolved": "https://registry.npmjs.org/@types/glob/-/glob-7.1.3.tgz", + "integrity": "sha512-SEYeGAIQIQX8NN6LDKprLjbrd5dARM5EXsd8GI/A5l0apYI1fGMWgPHSe4ZKL4eozlAyI+doUE9XbYS4xCkQ1w==", + "dependencies": { + "@types/minimatch": "*", + "@types/node": "*" + } + }, + "node_modules/@types/json-schema": { + "version": "7.0.6", + "resolved": "https://registry.npmjs.org/@types/json-schema/-/json-schema-7.0.6.tgz", + "integrity": "sha512-3c+yGKvVP5Y9TYBEibGNR+kLtijnj7mYrXRg+WpFb2X9xm04g/DXYkfg4hmzJQosc9snFNUPkbYIhu+KAm6jJw==" + }, + "node_modules/@types/minimatch": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@types/minimatch/-/minimatch-3.0.3.tgz", + "integrity": "sha512-tHq6qdbT9U1IRSGf14CL0pUlULksvY9OZ+5eEgl1N7t+OA3tGvNpxJCzuKQlsNgCVwbAs670L1vcVQi8j9HjnA==" + }, + "node_modules/@types/node": { + "version": "13.13.5", + "resolved": "https://registry.npmjs.org/@types/node/-/node-13.13.5.tgz", + "integrity": "sha512-3ySmiBYJPqgjiHA7oEaIo2Rzz0HrOZ7yrNO5HWyaE5q0lQ3BppDZ3N53Miz8bw2I7gh1/zir2MGVZBvpb1zq9g==" + }, + "node_modules/@types/q": { + "version": "1.5.4", + "resolved": "https://registry.npmjs.org/@types/q/-/q-1.5.4.tgz", + "integrity": "sha512-1HcDas8SEj4z1Wc696tH56G8OlRaH/sqZOynNNB+HF0WOeXPaxTtbYzJY2oEfiUxjSKjhCKr+MvR7dCHcEelug==" + }, + "node_modules/@types/source-list-map": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/@types/source-list-map/-/source-list-map-0.1.2.tgz", + "integrity": "sha512-K5K+yml8LTo9bWJI/rECfIPrGgxdpeNbj+d53lwN4QjW1MCwlkhUms+gtdzigTeUyBr09+u8BwOIY3MXvHdcsA==" + }, + "node_modules/@types/webpack-sources": { + "version": "0.1.8", + "resolved": "https://registry.npmjs.org/@types/webpack-sources/-/webpack-sources-0.1.8.tgz", + "integrity": "sha512-JHB2/xZlXOjzjBB6fMOpH1eQAfsrpqVVIbneE0Rok16WXwFaznaI5vfg75U5WgGJm7V9W1c4xeRQDjX/zwvghA==", + "dependencies": { + "@types/node": "*", + "@types/source-list-map": "*", + "source-map": "^0.6.1" + } + }, + "node_modules/@types/webpack-sources/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/@webassemblyjs/ast": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.8.5.tgz", + "integrity": "sha512-aJMfngIZ65+t71C3y2nBBg5FFG0Okt9m0XEgWZ7Ywgn1oMAT8cNwx00Uv1cQyHtidq0Xn94R4TAywO+LCQ+ZAQ==", + "dependencies": { + "@webassemblyjs/helper-module-context": "1.8.5", + "@webassemblyjs/helper-wasm-bytecode": "1.8.5", + "@webassemblyjs/wast-parser": "1.8.5" + } + }, + "node_modules/@webassemblyjs/floating-point-hex-parser": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.8.5.tgz", + "integrity": "sha512-9p+79WHru1oqBh9ewP9zW95E3XAo+90oth7S5Re3eQnECGq59ly1Ri5tsIipKGpiStHsUYmY3zMLqtk3gTcOtQ==" + }, + "node_modules/@webassemblyjs/helper-api-error": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-api-error/-/helper-api-error-1.8.5.tgz", + "integrity": "sha512-Za/tnzsvnqdaSPOUXHyKJ2XI7PDX64kWtURyGiJJZKVEdFOsdKUCPTNEVFZq3zJ2R0G5wc2PZ5gvdTRFgm81zA==" + }, + "node_modules/@webassemblyjs/helper-buffer": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.8.5.tgz", + "integrity": "sha512-Ri2R8nOS0U6G49Q86goFIPNgjyl6+oE1abW1pS84BuhP1Qcr5JqMwRFT3Ah3ADDDYGEgGs1iyb1DGX+kAi/c/Q==" + }, + "node_modules/@webassemblyjs/helper-code-frame": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.8.5.tgz", + "integrity": "sha512-VQAadSubZIhNpH46IR3yWO4kZZjMxN1opDrzePLdVKAZ+DFjkGD/rf4v1jap744uPVU6yjL/smZbRIIJTOUnKQ==", + "dependencies": { + "@webassemblyjs/wast-printer": "1.8.5" + } + }, + "node_modules/@webassemblyjs/helper-fsm": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.8.5.tgz", + "integrity": "sha512-kRuX/saORcg8se/ft6Q2UbRpZwP4y7YrWsLXPbbmtepKr22i8Z4O3V5QE9DbZK908dh5Xya4Un57SDIKwB9eow==" + }, + "node_modules/@webassemblyjs/helper-module-context": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-module-context/-/helper-module-context-1.8.5.tgz", + "integrity": "sha512-/O1B236mN7UNEU4t9X7Pj38i4VoU8CcMHyy3l2cV/kIF4U5KoHXDVqcDuOs1ltkac90IM4vZdHc52t1x8Yfs3g==", + "dependencies": { + "@webassemblyjs/ast": "1.8.5", + "mamacro": "^0.0.3" + } + }, + "node_modules/@webassemblyjs/helper-wasm-bytecode": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.8.5.tgz", + "integrity": "sha512-Cu4YMYG3Ddl72CbmpjU/wbP6SACcOPVbHN1dI4VJNJVgFwaKf1ppeFJrwydOG3NDHxVGuCfPlLZNyEdIYlQ6QQ==" + }, + "node_modules/@webassemblyjs/helper-wasm-section": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.8.5.tgz", + "integrity": "sha512-VV083zwR+VTrIWWtgIUpqfvVdK4ff38loRmrdDBgBT8ADXYsEZ5mPQ4Nde90N3UYatHdYoDIFb7oHzMncI02tA==", + "dependencies": { + "@webassemblyjs/ast": "1.8.5", + "@webassemblyjs/helper-buffer": "1.8.5", + "@webassemblyjs/helper-wasm-bytecode": "1.8.5", + "@webassemblyjs/wasm-gen": "1.8.5" + } + }, + "node_modules/@webassemblyjs/ieee754": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/ieee754/-/ieee754-1.8.5.tgz", + "integrity": "sha512-aaCvQYrvKbY/n6wKHb/ylAJr27GglahUO89CcGXMItrOBqRarUMxWLJgxm9PJNuKULwN5n1csT9bYoMeZOGF3g==", + "dependencies": { + "@xtuc/ieee754": "^1.2.0" + } + }, + "node_modules/@webassemblyjs/leb128": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.8.5.tgz", + "integrity": "sha512-plYUuUwleLIziknvlP8VpTgO4kqNaH57Y3JnNa6DLpu/sGcP6hbVdfdX5aHAV716pQBKrfuU26BJK29qY37J7A==", + "dependencies": { + "@xtuc/long": "4.2.2" + } + }, + "node_modules/@webassemblyjs/utf8": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/utf8/-/utf8-1.8.5.tgz", + "integrity": "sha512-U7zgftmQriw37tfD934UNInokz6yTmn29inT2cAetAsaU9YeVCveWEwhKL1Mg4yS7q//NGdzy79nlXh3bT8Kjw==" + }, + "node_modules/@webassemblyjs/wasm-edit": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.8.5.tgz", + "integrity": "sha512-A41EMy8MWw5yvqj7MQzkDjU29K7UJq1VrX2vWLzfpRHt3ISftOXqrtojn7nlPsZ9Ijhp5NwuODuycSvfAO/26Q==", + "dependencies": { + "@webassemblyjs/ast": "1.8.5", + "@webassemblyjs/helper-buffer": "1.8.5", + "@webassemblyjs/helper-wasm-bytecode": "1.8.5", + "@webassemblyjs/helper-wasm-section": "1.8.5", + "@webassemblyjs/wasm-gen": "1.8.5", + "@webassemblyjs/wasm-opt": "1.8.5", + "@webassemblyjs/wasm-parser": "1.8.5", + "@webassemblyjs/wast-printer": "1.8.5" + } + }, + "node_modules/@webassemblyjs/wasm-gen": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.8.5.tgz", + "integrity": "sha512-BCZBT0LURC0CXDzj5FXSc2FPTsxwp3nWcqXQdOZE4U7h7i8FqtFK5Egia6f9raQLpEKT1VL7zr4r3+QX6zArWg==", + "dependencies": { + "@webassemblyjs/ast": "1.8.5", + "@webassemblyjs/helper-wasm-bytecode": "1.8.5", + "@webassemblyjs/ieee754": "1.8.5", + "@webassemblyjs/leb128": "1.8.5", + "@webassemblyjs/utf8": "1.8.5" + } + }, + "node_modules/@webassemblyjs/wasm-opt": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.8.5.tgz", + "integrity": "sha512-HKo2mO/Uh9A6ojzu7cjslGaHaUU14LdLbGEKqTR7PBKwT6LdPtLLh9fPY33rmr5wcOMrsWDbbdCHq4hQUdd37Q==", + "dependencies": { + "@webassemblyjs/ast": "1.8.5", + "@webassemblyjs/helper-buffer": "1.8.5", + "@webassemblyjs/wasm-gen": "1.8.5", + "@webassemblyjs/wasm-parser": "1.8.5" + } + }, + "node_modules/@webassemblyjs/wasm-parser": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.8.5.tgz", + "integrity": "sha512-pi0SYE9T6tfcMkthwcgCpL0cM9nRYr6/6fjgDtL6q/ZqKHdMWvxitRi5JcZ7RI4SNJJYnYNaWy5UUrHQy998lw==", + "dependencies": { + "@webassemblyjs/ast": "1.8.5", + "@webassemblyjs/helper-api-error": "1.8.5", + "@webassemblyjs/helper-wasm-bytecode": "1.8.5", + "@webassemblyjs/ieee754": "1.8.5", + "@webassemblyjs/leb128": "1.8.5", + "@webassemblyjs/utf8": "1.8.5" + } + }, + "node_modules/@webassemblyjs/wast-parser": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.8.5.tgz", + "integrity": "sha512-daXC1FyKWHF1i11obK086QRlsMsY4+tIOKgBqI1lxAnkp9xe9YMcgOxm9kLe+ttjs5aWV2KKE1TWJCN57/Btsg==", + "dependencies": { + "@webassemblyjs/ast": "1.8.5", + "@webassemblyjs/floating-point-hex-parser": "1.8.5", + "@webassemblyjs/helper-api-error": "1.8.5", + "@webassemblyjs/helper-code-frame": "1.8.5", + "@webassemblyjs/helper-fsm": "1.8.5", + "@xtuc/long": "4.2.2" + } + }, + "node_modules/@webassemblyjs/wast-printer": { + "version": "1.8.5", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.8.5.tgz", + "integrity": "sha512-w0U0pD4EhlnvRyeJzBqaVSJAo9w/ce7/WPogeXLzGkO6hzhr4GnQIZ4W4uUt5b9ooAaXPtnXlj0gzsXEOUNYMg==", + "dependencies": { + "@webassemblyjs/ast": "1.8.5", + "@webassemblyjs/wast-parser": "1.8.5", + "@xtuc/long": "4.2.2" + } + }, + "node_modules/@xtuc/ieee754": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/@xtuc/ieee754/-/ieee754-1.2.0.tgz", + "integrity": "sha512-DX8nKgqcGwsc0eJSqYt5lwP4DH5FlHnmuWWBRy7X0NcaGR0ZtuyeESgMwTYVEtxmsNGY+qit4QYT/MIYTOTPeA==" + }, + "node_modules/@xtuc/long": { + "version": "4.2.2", + "resolved": "https://registry.npmjs.org/@xtuc/long/-/long-4.2.2.tgz", + "integrity": "sha512-NuHqBY1PB/D8xU6s/thBgOAiAP7HOYDQ32+BFZILJ8ivkUkAHQnWfn6WhL79Owj1qmUnoN/YPhktdIoucipkAQ==" + }, + "node_modules/@yarnpkg/lockfile": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/@yarnpkg/lockfile/-/lockfile-1.1.0.tgz", + "integrity": "sha512-GpSwvyXOcOOlV70vbnzjj4fW5xW/FdUF6nQEt1ENy7m4ZCczi1+/buVUPAqmGfqznsORNFzUMjctTIp8a9tuCQ==" + }, + "node_modules/accepts": { + "version": "1.3.7", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.7.tgz", + "integrity": "sha512-Il80Qs2WjYlJIBNzNkK6KYqlVMTbZLXgHx2oT0pU/fjRHyEp+PEfEPY0R3WCwAGVOtauxh1hOxNgIf5bv7dQpA==", + "dependencies": { + "mime-types": "~2.1.24", + "negotiator": "0.6.2" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/acorn": { + "version": "6.4.2", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.2.tgz", + "integrity": "sha512-XtGIhXwF8YM8bJhGxG5kXgjkEuNGLTkoYqVE+KMR+aspr4KGYmKYg7yUe3KghyQ9yheNwLnjmzh/7+gfDBmHCQ==", + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/agent-base": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-4.3.0.tgz", + "integrity": "sha512-salcGninV0nPrwpGNn4VTXBb1SOuXQBiqbrNXoeizJsHrsL6ERFM2Ne3JUSBWRE6aeNJI2ROP/WEEIDUiDe3cg==", + "dependencies": { + "es6-promisify": "^5.0.0" + }, + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/agentkeepalive": { + "version": "3.5.2", + "resolved": "https://registry.npmjs.org/agentkeepalive/-/agentkeepalive-3.5.2.tgz", + "integrity": "sha512-e0L/HNe6qkQ7H19kTlRRqUibEAwDK5AFk6y3PtMsuut2VAH6+Q4xZml1tNDJD7kSAyqmbG/K08K5WEJYtUrSlQ==", + "dependencies": { + "humanize-ms": "^1.2.1" + }, + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/aggregate-error": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/aggregate-error/-/aggregate-error-3.1.0.tgz", + "integrity": "sha512-4I7Td01quW/RpocfNayFdFVk1qSuoh0E7JrbRJ16nH01HhKFQ88INq9Sd+nd72zqRySlr9BmDA8xlEJ6vJMrYA==", + "dependencies": { + "clean-stack": "^2.0.0", + "indent-string": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ajv": { + "version": "6.12.0", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.0.tgz", + "integrity": "sha512-D6gFiFA0RRLyUbvijN74DWAjXSFxWKaWP7mldxkVhyhAV3+SWA9HEJPHQ2c9soIeTFJqcSdFDGFgdqs1iUU2Hw==", + "dependencies": { + "fast-deep-equal": "^3.1.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" + } + }, + "node_modules/ajv-errors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/ajv-errors/-/ajv-errors-1.0.1.tgz", + "integrity": "sha512-DCRfO/4nQ+89p/RK43i8Ezd41EqdGIU4ld7nGF8OQ14oc/we5rEntLCUa7+jrn3nn83BosfwZA0wb4pon2o8iQ==" + }, + "node_modules/ajv-keywords": { + "version": "3.5.2", + "resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.5.2.tgz", + "integrity": "sha512-5p6WTN0DdTGVQk6VjcEju19IgaHudalcfabD7yhDGeA6bcQnmL+CpveLJq/3hvfwd1aof6L386Ougkx6RfyMIQ==" + }, + "node_modules/alphanum-sort": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/alphanum-sort/-/alphanum-sort-1.0.2.tgz", + "integrity": "sha1-l6ERlkmyEa0zaR2fn0hqjsn74KM=" + }, + "node_modules/ansi-align": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/ansi-align/-/ansi-align-3.0.0.tgz", + "integrity": "sha512-ZpClVKqXN3RGBmKibdfWzqCY4lnjEuoNzU5T0oEFpfd/z5qJHVarukridD4juLO2FXMiwUQxr9WqQtaYa8XRYw==", + "dependencies": { + "string-width": "^3.0.0" + } + }, + "node_modules/ansi-align/node_modules/ansi-regex": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/ansi-align/node_modules/emoji-regex": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", + "integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==" + }, + "node_modules/ansi-align/node_modules/string-width": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", + "integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", + "dependencies": { + "emoji-regex": "^7.0.1", + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^5.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/ansi-align/node_modules/strip-ansi": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", + "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", + "dependencies": { + "ansi-regex": "^4.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/ansi-colors": { + "version": "3.2.4", + "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-3.2.4.tgz", + "integrity": "sha512-hHUXGagefjN2iRrID63xckIvotOXOojhQKWIPUZ4mNUZ9nLZW+7FMNoE1lOkEhNWYsx/7ysGIuJYCiMAA9FnrA==", + "engines": { + "node": ">=6" + } + }, + "node_modules/ansi-escapes": { + "version": "4.3.1", + "resolved": "https://registry.npmjs.org/ansi-escapes/-/ansi-escapes-4.3.1.tgz", + "integrity": "sha512-JWF7ocqNrp8u9oqpgV+wH5ftbt+cfvv+PTjOvKLT3AdYly/LmORARfEVT1iyjwN+4MqE5UmVKoAdIBqeoCHgLA==", + "dependencies": { + "type-fest": "^0.11.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ansi-html": { + "version": "0.0.7", + "resolved": "https://registry.npmjs.org/ansi-html/-/ansi-html-0.0.7.tgz", + "integrity": "sha1-gTWEAhliqenm/QOflA0S9WynhZ4=", + "engines": [ + "node >= 0.8.0" + ], + "bin": { + "ansi-html": "bin/ansi-html" + } + }, + "node_modules/ansi-regex": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", + "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/ansi-styles": { + "version": "3.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", + "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", + "dependencies": { + "color-convert": "^1.9.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/anymatch": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.1.tgz", + "integrity": "sha512-mM8522psRCqzV+6LhomX5wgp25YVibjh8Wj23I5RPkPppSVSjyKD2A2mBJmWGa+KN7f2D6LNh9jkBCeyLktzjg==", + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/aproba": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz", + "integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==" + }, + "node_modules/arg": { + "version": "4.1.3", + "resolved": "https://registry.npmjs.org/arg/-/arg-4.1.3.tgz", + "integrity": "sha512-58S9QDqG0Xx27YwPSt9fJxivjYl432YCwfDMfZ+71RAqUrZef7LrKQZ3LHLOwCS4FLNBplP533Zx895SeOCHvA==" + }, + "node_modules/argparse": { + "version": "1.0.10", + "resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz", + "integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==", + "dependencies": { + "sprintf-js": "~1.0.2" + } + }, + "node_modules/arr-diff": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-4.0.0.tgz", + "integrity": "sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/arr-flatten": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/arr-flatten/-/arr-flatten-1.1.0.tgz", + "integrity": "sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/arr-union": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/arr-union/-/arr-union-3.1.0.tgz", + "integrity": "sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/array-flatten": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-2.1.2.tgz", + "integrity": "sha512-hNfzcOV8W4NdualtqBFPyVO+54DSJuZGY9qT4pRroB6S9e3iiido2ISIC5h9R2sPJ8H3FHCIiEnsv1lPXO3KtQ==" + }, + "node_modules/array-union": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/array-union/-/array-union-1.0.2.tgz", + "integrity": "sha1-mjRBDk9OPaI96jdb5b5w8kd47Dk=", + "dependencies": { + "array-uniq": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/array-uniq": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/array-uniq/-/array-uniq-1.0.3.tgz", + "integrity": "sha1-r2rId6Jcx/dOBYiUdThY39sk/bY=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/array-unique": { + "version": "0.3.2", + "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.3.2.tgz", + "integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/asap": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/asap/-/asap-2.0.6.tgz", + "integrity": "sha1-5QNHYR1+aQlDIIu9r+vLwvuGbUY=" + }, + "node_modules/asn1": { + "version": "0.2.4", + "resolved": "https://registry.npmjs.org/asn1/-/asn1-0.2.4.tgz", + "integrity": "sha512-jxwzQpLQjSmWXgwaCZE9Nz+glAG01yF1QnWgbhGwHI5A6FRIEY6IVqtHhIepHqI7/kyEyQEagBC5mBEFlIYvdg==", + "dependencies": { + "safer-buffer": "~2.1.0" + } + }, + "node_modules/asn1.js": { + "version": "5.4.1", + "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-5.4.1.tgz", + "integrity": "sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA==", + "dependencies": { + "bn.js": "^4.0.0", + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0", + "safer-buffer": "^2.1.0" + } + }, + "node_modules/asn1.js/node_modules/bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==" + }, + "node_modules/assert": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/assert/-/assert-1.5.0.tgz", + "integrity": "sha512-EDsgawzwoun2CZkCgtxJbv392v4nbk9XDD06zI+kQYoBM/3RBWLlEyJARDOmhAAosBjWACEkKL6S+lIZtcAubA==", + "dependencies": { + "object-assign": "^4.1.1", + "util": "0.10.3" + } + }, + "node_modules/assert-plus": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/assert-plus/-/assert-plus-1.0.0.tgz", + "integrity": "sha1-8S4PPF13sLHN2RRpQuTpbB5N1SU=", + "engines": { + "node": ">=0.8" + } + }, + "node_modules/assert/node_modules/inherits": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz", + "integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE=" + }, + "node_modules/assert/node_modules/util": { + "version": "0.10.3", + "resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz", + "integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=", + "dependencies": { + "inherits": "2.0.1" + } + }, + "node_modules/assign-symbols": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/assign-symbols/-/assign-symbols-1.0.0.tgz", + "integrity": "sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/async": { + "version": "2.6.3", + "resolved": "https://registry.npmjs.org/async/-/async-2.6.3.tgz", + "integrity": "sha512-zflvls11DCy+dQWzTW2dzuilv8Z5X/pjfmZOWba6TNIVDm+2UDaJmXSOXlasHKfNBs8oo3M0aT50fDEWfKZjXg==", + "dependencies": { + "lodash": "^4.17.14" + } + }, + "node_modules/async-each": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/async-each/-/async-each-1.0.3.tgz", + "integrity": "sha512-z/WhQ5FPySLdvREByI2vZiTWwCnF0moMJ1hK9YQwDTHKh6I7/uSckMetoRGb5UBZPC1z0jlw+n/XCgjeH7y1AQ==" + }, + "node_modules/async-limiter": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/async-limiter/-/async-limiter-1.0.1.tgz", + "integrity": "sha512-csOlWGAcRFJaI6m+F2WKdnMKr4HhdhFVBk0H/QbJFMCr+uO2kwohwXQPxw/9OCxp05r5ghVBFSyioixx3gfkNQ==" + }, + "node_modules/asynckit": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz", + "integrity": "sha1-x57Zf380y48robyXkLzDZkdLS3k=" + }, + "node_modules/atob": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/atob/-/atob-2.1.2.tgz", + "integrity": "sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg==", + "bin": { + "atob": "bin/atob.js" + }, + "engines": { + "node": ">= 4.5.0" + } + }, + "node_modules/autoprefixer": { + "version": "9.7.4", + "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-9.7.4.tgz", + "integrity": "sha512-g0Ya30YrMBAEZk60lp+qfX5YQllG+S5W3GYCFvyHTvhOki0AEQJLPEcIuGRsqVwLi8FvXPVtwTGhfr38hVpm0g==", + "dependencies": { + "browserslist": "^4.8.3", + "caniuse-lite": "^1.0.30001020", + "chalk": "^2.4.2", + "normalize-range": "^0.1.2", + "num2fraction": "^1.2.2", + "postcss": "^7.0.26", + "postcss-value-parser": "^4.0.2" + }, + "bin": { + "autoprefixer": "bin/autoprefixer" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/aws-sign2": { + "version": "0.7.0", + "resolved": "https://registry.npmjs.org/aws-sign2/-/aws-sign2-0.7.0.tgz", + "integrity": "sha1-tG6JCTSpWR8tL2+G1+ap8bP+dqg=", + "engines": { + "node": "*" + } + }, + "node_modules/aws4": { + "version": "1.11.0", + "resolved": "https://registry.npmjs.org/aws4/-/aws4-1.11.0.tgz", + "integrity": "sha512-xh1Rl34h6Fi1DC2WWKfxUTVqRsNnr6LsKz2+hfwDxQJWmrx8+c7ylaqBMcHfl1U1r2dsifOvKX3LQuLNZ+XSvA==" + }, + "node_modules/babel-loader": { + "version": "8.0.6", + "resolved": "https://registry.npmjs.org/babel-loader/-/babel-loader-8.0.6.tgz", + "integrity": "sha512-4BmWKtBOBm13uoUwd08UwjZlaw3O9GWf456R9j+5YykFZ6LUIjIKLc0zEZf+hauxPOJs96C8k6FvYD09vWzhYw==", + "dependencies": { + "find-cache-dir": "^2.0.0", + "loader-utils": "^1.0.2", + "mkdirp": "^0.5.1", + "pify": "^4.0.1" + }, + "engines": { + "node": ">= 6.9" + } + }, + "node_modules/babel-loader/node_modules/find-cache-dir": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-2.1.0.tgz", + "integrity": "sha512-Tq6PixE0w/VMFfCgbONnkiQIVol/JJL7nRMi20fqzA4NRs9AfeqMGeRdPi3wIhYkxjeBaWh2rxwapn5Tu3IqOQ==", + "dependencies": { + "commondir": "^1.0.1", + "make-dir": "^2.0.0", + "pkg-dir": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/babel-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/babel-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/babel-plugin-dynamic-import-node": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/babel-plugin-dynamic-import-node/-/babel-plugin-dynamic-import-node-2.3.3.tgz", + "integrity": "sha512-jZVI+s9Zg3IqA/kdi0i6UDCybUI3aSBLnglhYbSSjKlV7yF1F/5LWv8MakQmvYpnbJDS6fcBL2KzHSxNCMtWSQ==", + "dependencies": { + "object.assign": "^4.1.0" + } + }, + "node_modules/balanced-match": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz", + "integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=" + }, + "node_modules/base": { + "version": "0.11.2", + "resolved": "https://registry.npmjs.org/base/-/base-0.11.2.tgz", + "integrity": "sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==", + "dependencies": { + "cache-base": "^1.0.1", + "class-utils": "^0.3.5", + "component-emitter": "^1.2.1", + "define-property": "^1.0.0", + "isobject": "^3.0.1", + "mixin-deep": "^1.2.0", + "pascalcase": "^0.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base/node_modules/define-property": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", + "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", + "dependencies": { + "is-descriptor": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base/node_modules/is-accessor-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", + "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base/node_modules/is-data-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", + "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base/node_modules/is-descriptor": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", + "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", + "dependencies": { + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base64-js": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.5.1.tgz", + "integrity": "sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==" + }, + "node_modules/batch": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/batch/-/batch-0.6.1.tgz", + "integrity": "sha1-3DQxT05nkxgJP8dgJyUl+UvyXBY=" + }, + "node_modules/bcrypt-pbkdf": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.2.tgz", + "integrity": "sha1-pDAdOJtqQ/m2f/PKEaP2Y342Dp4=", + "dependencies": { + "tweetnacl": "^0.14.3" + } + }, + "node_modules/big.js": { + "version": "5.2.2", + "resolved": "https://registry.npmjs.org/big.js/-/big.js-5.2.2.tgz", + "integrity": "sha512-vyL2OymJxmarO8gxMr0mhChsO9QGwhynfuu4+MHTAW6czfq9humCB7rKpUjDd9YUiDPU4mzpyupFSvOClAwbmQ==", + "engines": { + "node": "*" + } + }, + "node_modules/binary-extensions": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.1.0.tgz", + "integrity": "sha512-1Yj8h9Q+QDF5FzhMs/c9+6UntbD5MkRfRwac8DoEm9ZfUBZ7tZ55YcGVAzEe4bXsdQHEk+s9S5wsOKVdZrw0tQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/bluebird": { + "version": "3.7.2", + "resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.7.2.tgz", + "integrity": "sha512-XpNj6GDQzdfW+r2Wnn7xiSAd7TM3jzkxGXBGTtWKuSXv1xUV+azxAm8jdWZN06QTQk+2N2XB9jRDkvbmQmcRtg==" + }, + "node_modules/bn.js": { + "version": "5.1.3", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-5.1.3.tgz", + "integrity": "sha512-GkTiFpjFtUzU9CbMeJ5iazkCzGL3jrhzerzZIuqLABjbwRaFt33I9tUdSNryIptM+RxDet6OKm2WnLXzW51KsQ==" + }, + "node_modules/body-parser": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.19.0.tgz", + "integrity": "sha512-dhEPs72UPbDnAQJ9ZKMNTP6ptJaionhP5cBb541nXPlW60Jepo9RV/a4fX4XWW9CuFNK22krhrj1+rgzifNCsw==", + "dependencies": { + "bytes": "3.1.0", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "~1.1.2", + "http-errors": "1.7.2", + "iconv-lite": "0.4.24", + "on-finished": "~2.3.0", + "qs": "6.7.0", + "raw-body": "2.4.0", + "type-is": "~1.6.17" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/body-parser/node_modules/bytes": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.0.tgz", + "integrity": "sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/body-parser/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/body-parser/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/body-parser/node_modules/qs": { + "version": "6.7.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.7.0.tgz", + "integrity": "sha512-VCdBRNFTX1fyE7Nb6FYoURo/SPe62QCaAyzJvUjwRaIsc+NePBEniHlvxFmmX56+HZphIGtV0XeCirBtpDrTyQ==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/bonjour": { + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/bonjour/-/bonjour-3.5.0.tgz", + "integrity": "sha1-jokKGD2O6aI5OzhExpGkK897yfU=", + "dependencies": { + "array-flatten": "^2.1.0", + "deep-equal": "^1.0.1", + "dns-equal": "^1.0.0", + "dns-txt": "^2.0.2", + "multicast-dns": "^6.0.1", + "multicast-dns-service-types": "^1.1.0" + } + }, + "node_modules/boolbase": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/boolbase/-/boolbase-1.0.0.tgz", + "integrity": "sha1-aN/1++YMUes3cl6p4+0xDcwed24=" + }, + "node_modules/boxen": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/boxen/-/boxen-4.2.0.tgz", + "integrity": "sha512-eB4uT9RGzg2odpER62bBwSLvUeGC+WbRjjyyFhGsKnc8wp/m0+hQsMUvUe3H2V0D5vw0nBdO1hCJoZo5mKeuIQ==", + "dependencies": { + "ansi-align": "^3.0.0", + "camelcase": "^5.3.1", + "chalk": "^3.0.0", + "cli-boxes": "^2.2.0", + "string-width": "^4.1.0", + "term-size": "^2.1.0", + "type-fest": "^0.8.1", + "widest-line": "^3.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/boxen/node_modules/ansi-regex": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", + "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/boxen/node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/boxen/node_modules/chalk": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", + "integrity": "sha512-4D3B6Wf41KOYRFdszmDqMCGq5VV/uMAB273JILmO+3jAlh8X4qDtdtgCR3fxtbLEMzSx22QdhnDcJvu2u1fVwg==", + "dependencies": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/boxen/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/boxen/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" + }, + "node_modules/boxen/node_modules/has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/boxen/node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/boxen/node_modules/string-width": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.0.tgz", + "integrity": "sha512-zUz5JD+tgqtuDjMhwIg5uFVV3dtqZ9yQJlZVfq4I01/K5Paj5UHj7VyrQOJvzawSVlKpObApbfD0Ed6yJc+1eg==", + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/boxen/node_modules/strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dependencies": { + "ansi-regex": "^5.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/boxen/node_modules/supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dependencies": { + "has-flag": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/boxen/node_modules/type-fest": { + "version": "0.8.1", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.8.1.tgz", + "integrity": "sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==", + "engines": { + "node": ">=8" + } + }, + "node_modules/brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/braces": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "dependencies": { + "fill-range": "^7.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/brorand": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz", + "integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8=" + }, + "node_modules/browserify-aes": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz", + "integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==", + "dependencies": { + "buffer-xor": "^1.0.3", + "cipher-base": "^1.0.0", + "create-hash": "^1.1.0", + "evp_bytestokey": "^1.0.3", + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/browserify-cipher": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz", + "integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==", + "dependencies": { + "browserify-aes": "^1.0.4", + "browserify-des": "^1.0.0", + "evp_bytestokey": "^1.0.0" + } + }, + "node_modules/browserify-des": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz", + "integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==", + "dependencies": { + "cipher-base": "^1.0.1", + "des.js": "^1.0.0", + "inherits": "^2.0.1", + "safe-buffer": "^5.1.2" + } + }, + "node_modules/browserify-rsa": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.1.0.tgz", + "integrity": "sha512-AdEER0Hkspgno2aR97SAf6vi0y0k8NuOpGnVH3O99rcA5Q6sh8QxcngtHuJ6uXwnfAXNM4Gn1Gb7/MV1+Ymbog==", + "dependencies": { + "bn.js": "^5.0.0", + "randombytes": "^2.0.1" + } + }, + "node_modules/browserify-sign": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.2.1.tgz", + "integrity": "sha512-/vrA5fguVAKKAVTNJjgSm1tRQDHUU6DbwO9IROu/0WAzC8PKhucDSh18J0RMvVeHAn5puMd+QHC2erPRNf8lmg==", + "dependencies": { + "bn.js": "^5.1.1", + "browserify-rsa": "^4.0.1", + "create-hash": "^1.2.0", + "create-hmac": "^1.1.7", + "elliptic": "^6.5.3", + "inherits": "^2.0.4", + "parse-asn1": "^5.1.5", + "readable-stream": "^3.6.0", + "safe-buffer": "^5.2.0" + } + }, + "node_modules/browserify-sign/node_modules/readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dependencies": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/browserify-sign/node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==" + }, + "node_modules/browserify-zlib": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz", + "integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==", + "dependencies": { + "pako": "~1.0.5" + } + }, + "node_modules/browserslist": { + "version": "4.14.7", + "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.14.7.tgz", + "integrity": "sha512-BSVRLCeG3Xt/j/1cCGj1019Wbty0H+Yvu2AOuZSuoaUWn3RatbL33Cxk+Q4jRMRAbOm0p7SLravLjpnT6s0vzQ==", + "dependencies": { + "caniuse-lite": "^1.0.30001157", + "colorette": "^1.2.1", + "electron-to-chromium": "^1.3.591", + "escalade": "^3.1.1", + "node-releases": "^1.1.66" + }, + "bin": { + "browserslist": "cli.js" + }, + "engines": { + "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" + } + }, + "node_modules/buffer": { + "version": "4.9.2", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz", + "integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==", + "dependencies": { + "base64-js": "^1.0.2", + "ieee754": "^1.1.4", + "isarray": "^1.0.0" + } + }, + "node_modules/buffer-from": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz", + "integrity": "sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==" + }, + "node_modules/buffer-indexof": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/buffer-indexof/-/buffer-indexof-1.1.1.tgz", + "integrity": "sha512-4/rOEg86jivtPTeOUUT61jJO1Ya1TrR/OkqCSZDyq84WJh3LuuiphBYJN+fm5xufIk4XAFcEwte/8WzC8If/1g==" + }, + "node_modules/buffer-xor": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz", + "integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk=" + }, + "node_modules/builtin-modules": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/builtin-modules/-/builtin-modules-1.1.1.tgz", + "integrity": "sha1-Jw8HbFpywC9bZaR9+Uxf46J4iS8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/builtin-status-codes": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz", + "integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug=" + }, + "node_modules/builtins": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/builtins/-/builtins-1.0.3.tgz", + "integrity": "sha1-y5T662HIaWRR2zZTThQi+U8K7og=" + }, + "node_modules/bytes": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.0.0.tgz", + "integrity": "sha1-0ygVQE1olpn4Wk6k+odV3ROpYEg=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/cacache": { + "version": "15.0.0", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-15.0.0.tgz", + "integrity": "sha512-L0JpXHhplbJSiDGzyJJnJCTL7er7NzbBgxzVqLswEb4bO91Zbv17OUMuUeu/q0ZwKn3V+1HM4wb9tO4eVE/K8g==", + "dependencies": { + "chownr": "^1.1.2", + "fs-minipass": "^2.0.0", + "glob": "^7.1.4", + "infer-owner": "^1.0.4", + "lru-cache": "^5.1.1", + "minipass": "^3.1.1", + "minipass-collect": "^1.0.2", + "minipass-flush": "^1.0.5", + "minipass-pipeline": "^1.2.2", + "mkdirp": "^1.0.3", + "move-concurrently": "^1.0.1", + "p-map": "^3.0.0", + "promise-inflight": "^1.0.1", + "rimraf": "^2.7.1", + "ssri": "^8.0.0", + "tar": "^6.0.1", + "unique-filename": "^1.1.1" + }, + "engines": { + "node": ">= 10" + } + }, + "node_modules/cacache/node_modules/mkdirp": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-1.0.4.tgz", + "integrity": "sha512-vVqVZQyf3WLx2Shd0qJ9xuvqgAyKPLAiqITEtqW0oIUjzo3PePDd6fW9iFz30ef7Ysp/oiWqbhszeGWW2T6Gzw==", + "bin": { + "mkdirp": "bin/cmd.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/cacache/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/cache-base": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/cache-base/-/cache-base-1.0.1.tgz", + "integrity": "sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==", + "dependencies": { + "collection-visit": "^1.0.0", + "component-emitter": "^1.2.1", + "get-value": "^2.0.6", + "has-value": "^1.0.0", + "isobject": "^3.0.1", + "set-value": "^2.0.0", + "to-object-path": "^0.3.0", + "union-value": "^1.0.0", + "unset-value": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/call-bind": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.0.tgz", + "integrity": "sha512-AEXsYIyyDY3MCzbwdhzG3Jx1R0J2wetQyUynn6dYHAO+bg8l1k7jwZtRv4ryryFs7EP+NDlikJlVe59jr0cM2w==", + "dependencies": { + "function-bind": "^1.1.1", + "get-intrinsic": "^1.0.0" + } + }, + "node_modules/caller-callsite": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/caller-callsite/-/caller-callsite-2.0.0.tgz", + "integrity": "sha1-hH4PzgoiN1CpoCfFSzNzGtMVQTQ=", + "dependencies": { + "callsites": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/caller-path": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/caller-path/-/caller-path-2.0.0.tgz", + "integrity": "sha1-Ro+DBE42mrIBD6xfBs7uFbsssfQ=", + "dependencies": { + "caller-callsite": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/callsites": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/callsites/-/callsites-2.0.0.tgz", + "integrity": "sha1-BuuE8A7qQT2oav/vrL/7Ngk7PFA=", + "engines": { + "node": ">=4" + } + }, + "node_modules/camelcase": { + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/caniuse-api": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/caniuse-api/-/caniuse-api-3.0.0.tgz", + "integrity": "sha512-bsTwuIg/BZZK/vreVTYYbSWoe2F+71P7K5QGEX+pT250DZbfU1MQ5prOKpPR+LL6uWKK3KMwMCAS74QB3Um1uw==", + "dependencies": { + "browserslist": "^4.0.0", + "caniuse-lite": "^1.0.0", + "lodash.memoize": "^4.1.2", + "lodash.uniq": "^4.5.0" + } + }, + "node_modules/caniuse-lite": { + "version": "1.0.30001159", + "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001159.tgz", + "integrity": "sha512-w9Ph56jOsS8RL20K9cLND3u/+5WASWdhC/PPrf+V3/HsM3uHOavWOR1Xzakbv4Puo/srmPHudkmCRWM7Aq+/UA==" + }, + "node_modules/canonical-path": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/canonical-path/-/canonical-path-1.0.0.tgz", + "integrity": "sha512-feylzsbDxi1gPZ1IjystzIQZagYYLvfKrSuygUCgf7z6x790VEzze5QEkdSV1U58RA7Hi0+v6fv4K54atOzATg==" + }, + "node_modules/caseless": { + "version": "0.12.0", + "resolved": "https://registry.npmjs.org/caseless/-/caseless-0.12.0.tgz", + "integrity": "sha1-G2gcIf+EAzyCZUMJBolCDRhxUdw=" + }, + "node_modules/chalk": { + "version": "2.4.2", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", + "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", + "dependencies": { + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/chardet": { + "version": "0.7.0", + "resolved": "https://registry.npmjs.org/chardet/-/chardet-0.7.0.tgz", + "integrity": "sha512-mT8iDcrh03qDGRRmoA2hmBJnxpllMR+0/0qlzjqZES6NdiWDcZkCNAk4rPFZ9Q85r27unkiNNg8ZOiwZXBHwcA==" + }, + "node_modules/chokidar": { + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.4.3.tgz", + "integrity": "sha512-DtM3g7juCXQxFVSNPNByEC2+NImtBuxQQvWlHunpJIS5Ocr0lG306cC7FCi7cEA0fzmybPUIl4txBIobk1gGOQ==", + "dependencies": { + "anymatch": "~3.1.1", + "braces": "~3.0.2", + "glob-parent": "~5.1.0", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.5.0" + }, + "engines": { + "node": ">= 8.10.0" + }, + "optionalDependencies": { + "fsevents": "~2.1.2" + } + }, + "node_modules/chokidar/node_modules/glob-parent": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.1.tgz", + "integrity": "sha512-FnI+VGOpnlGHWZxthPGR+QhR78fuiK0sNLkHQv+bL9fQi57lNNdquIbna/WrfROrolq8GK5Ek6BiMwqL/voRYQ==", + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/chownr": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.4.tgz", + "integrity": "sha512-jJ0bqzaylmJtVnNgzTeSOs8DPavpbYgEr/b0YL8/2GO3xJEhInFmhKMUnEJQjZumK7KXGFhUy89PrsJWlakBVg==" + }, + "node_modules/chrome-trace-event": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/chrome-trace-event/-/chrome-trace-event-1.0.2.tgz", + "integrity": "sha512-9e/zx1jw7B4CO+c/RXoCsfg/x1AfUBioy4owYH0bJprEYAx5hRFLRhWBqHAG57D0ZM4H7vxbP7bPe0VwhQRYDQ==", + "dependencies": { + "tslib": "^1.9.0" + }, + "engines": { + "node": ">=6.0" + } + }, + "node_modules/cipher-base": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz", + "integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==", + "dependencies": { + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/circular-dependency-plugin": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/circular-dependency-plugin/-/circular-dependency-plugin-5.2.0.tgz", + "integrity": "sha512-7p4Kn/gffhQaavNfyDFg7LS5S/UT1JAjyGd4UqR2+jzoYF02eDkj0Ec3+48TsIa4zghjLY87nQHIh/ecK9qLdw==", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/class-utils": { + "version": "0.3.6", + "resolved": "https://registry.npmjs.org/class-utils/-/class-utils-0.3.6.tgz", + "integrity": "sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==", + "dependencies": { + "arr-union": "^3.1.0", + "define-property": "^0.2.5", + "isobject": "^3.0.0", + "static-extend": "^0.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/class-utils/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/clean-stack": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/clean-stack/-/clean-stack-2.2.0.tgz", + "integrity": "sha512-4diC9HaTE+KRAMWhDhrGOECgWZxoevMc5TlkObMqNSsVU62PYzXZ/SMTjzyGAFF1YusgxGcSWTEXBhp0CPwQ1A==", + "engines": { + "node": ">=6" + } + }, + "node_modules/cli-boxes": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/cli-boxes/-/cli-boxes-2.2.1.tgz", + "integrity": "sha512-y4coMcylgSCdVinjiDBuR8PCC2bLjyGTwEmPb9NHR/QaNU6EUOXcTY/s6VjGMD6ENSEaeQYHCY0GNGS5jfMwPw==", + "engines": { + "node": ">=6" + } + }, + "node_modules/cli-cursor": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/cli-cursor/-/cli-cursor-3.1.0.tgz", + "integrity": "sha512-I/zHAwsKf9FqGoXM4WWRACob9+SNukZTd94DWF57E4toouRulbCxcUh6RKUEOQlYTHJnzkPMySvPNaaSLNfLZw==", + "dependencies": { + "restore-cursor": "^3.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/cli-spinners": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/cli-spinners/-/cli-spinners-2.5.0.tgz", + "integrity": "sha512-PC+AmIuK04E6aeSs/pUccSujsTzBhu4HzC2dL+CfJB/Jcc2qTRbEwZQDfIUpt2Xl8BodYBEq8w4fc0kU2I9DjQ==", + "engines": { + "node": ">=6" + } + }, + "node_modules/cli-width": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/cli-width/-/cli-width-2.2.1.tgz", + "integrity": "sha512-GRMWDxpOB6Dgk2E5Uo+3eEBvtOOlimMmpbFiKuLFnQzYDavtLFY3K5ona41jgN/WdRZtG7utuVSVTL4HbZHGkw==" + }, + "node_modules/cliui": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-4.1.0.tgz", + "integrity": "sha512-4FG+RSG9DL7uEwRUZXZn3SS34DiDPfzP0VOiEwtUWlE+AR2EIg+hSyvrIgUUfhdgR/UkAeW2QHgeP+hWrXs7jQ==", + "dependencies": { + "string-width": "^2.1.1", + "strip-ansi": "^4.0.0", + "wrap-ansi": "^2.0.0" + } + }, + "node_modules/cliui/node_modules/ansi-regex": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz", + "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=", + "engines": { + "node": ">=4" + } + }, + "node_modules/cliui/node_modules/strip-ansi": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz", + "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", + "dependencies": { + "ansi-regex": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/clone": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/clone/-/clone-2.1.2.tgz", + "integrity": "sha1-G39Ln1kfHo+DZwQBYANFoCiHQ18=", + "engines": { + "node": ">=0.8" + } + }, + "node_modules/clone-deep": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/clone-deep/-/clone-deep-4.0.1.tgz", + "integrity": "sha512-neHB9xuzh/wk0dIHweyAXv2aPGZIVk3pLMe+/RNzINf17fe0OG96QroktYAUm7SM1PBnzTabaLboqqxDyMU+SQ==", + "dependencies": { + "is-plain-object": "^2.0.4", + "kind-of": "^6.0.2", + "shallow-clone": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/coa": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/coa/-/coa-2.0.2.tgz", + "integrity": "sha512-q5/jG+YQnSy4nRTV4F7lPepBJZ8qBNJJDBuJdoejDyLXgmL7IEo+Le2JDZudFTFt7mrCqIRaSjws4ygRCTCAXA==", + "dependencies": { + "@types/q": "^1.5.1", + "chalk": "^2.4.1", + "q": "^1.1.2" + }, + "engines": { + "node": ">= 4.0" + } + }, + "node_modules/code-point-at": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz", + "integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/collection-visit": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz", + "integrity": "sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=", + "dependencies": { + "map-visit": "^1.0.0", + "object-visit": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/color": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/color/-/color-3.1.3.tgz", + "integrity": "sha512-xgXAcTHa2HeFCGLE9Xs/R82hujGtu9Jd9x4NW3T34+OMs7VoPsjwzRczKHvTAHeJwWFwX5j15+MgAppE8ztObQ==", + "dependencies": { + "color-convert": "^1.9.1", + "color-string": "^1.5.4" + } + }, + "node_modules/color-convert": { + "version": "1.9.3", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", + "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", + "dependencies": { + "color-name": "1.1.3" + } + }, + "node_modules/color-name": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", + "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=" + }, + "node_modules/color-string": { + "version": "1.5.4", + "resolved": "https://registry.npmjs.org/color-string/-/color-string-1.5.4.tgz", + "integrity": "sha512-57yF5yt8Xa3czSEW1jfQDE79Idk0+AkN/4KWad6tbdxUmAs3MvjxlWSWD4deYytcRfoZ9nhKyFl1kj5tBvidbw==", + "dependencies": { + "color-name": "^1.0.0", + "simple-swizzle": "^0.2.2" + } + }, + "node_modules/colorette": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/colorette/-/colorette-1.2.1.tgz", + "integrity": "sha512-puCDz0CzydiSYOrnXpz/PKd69zRrribezjtE9yd4zvytoRc8+RY/KJPvtPFKZS3E3wP6neGyMe0vOTlHO5L3Pw==" + }, + "node_modules/combined-stream": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz", + "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==", + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/commander": { + "version": "2.20.3", + "resolved": "https://registry.npmjs.org/commander/-/commander-2.20.3.tgz", + "integrity": "sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==" + }, + "node_modules/commondir": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz", + "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=" + }, + "node_modules/component-emitter": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.3.0.tgz", + "integrity": "sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg==" + }, + "node_modules/compressible": { + "version": "2.0.18", + "resolved": "https://registry.npmjs.org/compressible/-/compressible-2.0.18.tgz", + "integrity": "sha512-AF3r7P5dWxL8MxyITRMlORQNaOA2IkAFaTr4k7BUumjPtRpGDTZpl0Pb1XCO6JeDCBdp126Cgs9sMxqSjgYyRg==", + "dependencies": { + "mime-db": ">= 1.43.0 < 2" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/compression": { + "version": "1.7.4", + "resolved": "https://registry.npmjs.org/compression/-/compression-1.7.4.tgz", + "integrity": "sha512-jaSIDzP9pZVS4ZfQ+TzvtiWhdpFhE2RDHz8QJkpX9SIpLq88VueF5jJw6t+6CUQcAoA6t+x89MLrWAqpfDE8iQ==", + "dependencies": { + "accepts": "~1.3.5", + "bytes": "3.0.0", + "compressible": "~2.0.16", + "debug": "2.6.9", + "on-headers": "~1.0.2", + "safe-buffer": "5.1.2", + "vary": "~1.1.2" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/compression/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/compression/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=" + }, + "node_modules/concat-stream": { + "version": "1.6.2", + "resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-1.6.2.tgz", + "integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==", + "engines": [ + "node >= 0.8" + ], + "dependencies": { + "buffer-from": "^1.0.0", + "inherits": "^2.0.3", + "readable-stream": "^2.2.2", + "typedarray": "^0.0.6" + } + }, + "node_modules/connect-history-api-fallback": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/connect-history-api-fallback/-/connect-history-api-fallback-1.6.0.tgz", + "integrity": "sha512-e54B99q/OUoH64zYYRf3HBP5z24G38h5D3qXu23JGRoigpX5Ss4r9ZnDk3g0Z8uQC2x2lPaJ+UlWBc1ZWBWdLg==", + "engines": { + "node": ">=0.8" + } + }, + "node_modules/console-browserify": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.2.0.tgz", + "integrity": "sha512-ZMkYO/LkF17QvCPqM0gxw8yUzigAOZOSWSHg91FH6orS7vcEj5dVZTidN2fQ14yBSdg97RqhSNwLUXInd52OTA==" + }, + "node_modules/constants-browserify": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz", + "integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U=" + }, + "node_modules/content-disposition": { + "version": "0.5.3", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.3.tgz", + "integrity": "sha512-ExO0774ikEObIAEV9kDo50o+79VCUdEB6n6lzKgGwupcVeRlhrj3qGAfwq8G6uBJjkqLrhT0qEYFcWng8z1z0g==", + "dependencies": { + "safe-buffer": "5.1.2" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/content-type": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz", + "integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/convert-source-map": { + "version": "1.7.0", + "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz", + "integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==", + "dependencies": { + "safe-buffer": "~5.1.1" + } + }, + "node_modules/cookie": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.4.0.tgz", + "integrity": "sha512-+Hp8fLp57wnUSt0tY0tHEXh4voZRDnoIrZPqlo3DPiI4y9lwg/jqx+1Om94/W6ZaPDOUbnjOt/99w66zk+l1Xg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=" + }, + "node_modules/copy-concurrently": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/copy-concurrently/-/copy-concurrently-1.0.5.tgz", + "integrity": "sha512-f2domd9fsVDFtaFcbaRZuYXwtdmnzqbADSwhSWYxYB/Q8zsdUUFMXVRwXGDMWmbEzAn1kdRrtI1T/KTFOL4X2A==", + "dependencies": { + "aproba": "^1.1.1", + "fs-write-stream-atomic": "^1.0.8", + "iferr": "^0.1.5", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.0" + } + }, + "node_modules/copy-concurrently/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/copy-descriptor": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/copy-descriptor/-/copy-descriptor-0.1.1.tgz", + "integrity": "sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/copy-webpack-plugin": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/copy-webpack-plugin/-/copy-webpack-plugin-5.1.1.tgz", + "integrity": "sha512-P15M5ZC8dyCjQHWwd4Ia/dm0SgVvZJMYeykVIVYXbGyqO4dWB5oyPHp9i7wjwo5LhtlhKbiBCdS2NvM07Wlybg==", + "dependencies": { + "cacache": "^12.0.3", + "find-cache-dir": "^2.1.0", + "glob-parent": "^3.1.0", + "globby": "^7.1.1", + "is-glob": "^4.0.1", + "loader-utils": "^1.2.3", + "minimatch": "^3.0.4", + "normalize-path": "^3.0.0", + "p-limit": "^2.2.1", + "schema-utils": "^1.0.0", + "serialize-javascript": "^2.1.2", + "webpack-log": "^2.0.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/copy-webpack-plugin/node_modules/cacache": { + "version": "12.0.4", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.4.tgz", + "integrity": "sha512-a0tMB40oefvuInr4Cwb3GerbL9xTj1D5yg0T5xrjGCGyfvbxseIXX7BAO/u/hIXdafzOI5JC3wDwHyf24buOAQ==", + "dependencies": { + "bluebird": "^3.5.5", + "chownr": "^1.1.1", + "figgy-pudding": "^3.5.1", + "glob": "^7.1.4", + "graceful-fs": "^4.1.15", + "infer-owner": "^1.0.3", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.3", + "ssri": "^6.0.1", + "unique-filename": "^1.1.1", + "y18n": "^4.0.0" + } + }, + "node_modules/copy-webpack-plugin/node_modules/find-cache-dir": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-2.1.0.tgz", + "integrity": "sha512-Tq6PixE0w/VMFfCgbONnkiQIVol/JJL7nRMi20fqzA4NRs9AfeqMGeRdPi3wIhYkxjeBaWh2rxwapn5Tu3IqOQ==", + "dependencies": { + "commondir": "^1.0.1", + "make-dir": "^2.0.0", + "pkg-dir": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/copy-webpack-plugin/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/copy-webpack-plugin/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/copy-webpack-plugin/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/copy-webpack-plugin/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/copy-webpack-plugin/node_modules/ssri": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/ssri/-/ssri-6.0.1.tgz", + "integrity": "sha512-3Wge10hNcT1Kur4PDFwEieXSCMCJs/7WvSACcrMYrNp+b8kDL1/0wJch5Ni2WrtwEa2IO8OsVfeKIciKCDx/QA==", + "dependencies": { + "figgy-pudding": "^3.5.1" + } + }, + "node_modules/core-js": { + "version": "3.6.4", + "resolved": "https://registry.npmjs.org/core-js/-/core-js-3.6.4.tgz", + "integrity": "sha512-4paDGScNgZP2IXXilaffL9X7968RuvwlkK3xWtZRVqgd8SYNiVKRJvkFd1aqqEuPfN7E68ZHEp9hDj6lHj4Hyw==", + "hasInstallScript": true + }, + "node_modules/core-js-compat": { + "version": "3.7.0", + "resolved": "https://registry.npmjs.org/core-js-compat/-/core-js-compat-3.7.0.tgz", + "integrity": "sha512-V8yBI3+ZLDVomoWICO6kq/CD28Y4r1M7CWeO4AGpMdMfseu8bkSubBmUPySMGKRTS+su4XQ07zUkAsiu9FCWTg==", + "dependencies": { + "browserslist": "^4.14.6", + "semver": "7.0.0" + } + }, + "node_modules/core-js-compat/node_modules/semver": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.0.0.tgz", + "integrity": "sha512-+GB6zVA9LWh6zovYQLALHwv5rb2PHGlJi3lfiqIHxR0uuwCgefcOJc59v9fv1w8GbStwxuuqqAjI9NMAOOgq1A==", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/core-util-is": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", + "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=" + }, + "node_modules/cosmiconfig": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/cosmiconfig/-/cosmiconfig-5.2.1.tgz", + "integrity": "sha512-H65gsXo1SKjf8zmrJ67eJk8aIRKV5ff2D4uKZIBZShbhGSpEmsQOPW/SKMKYhSTrqR7ufy6RP69rPogdaPh/kA==", + "dependencies": { + "import-fresh": "^2.0.0", + "is-directory": "^0.3.1", + "js-yaml": "^3.13.1", + "parse-json": "^4.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/create-ecdh": { + "version": "4.0.4", + "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.4.tgz", + "integrity": "sha512-mf+TCx8wWc9VpuxfP2ht0iSISLZnt0JgWlrOKZiNqyUZWnjIaCIVNQArMHnCZKfEYRg6IM7A+NeJoN8gf/Ws0A==", + "dependencies": { + "bn.js": "^4.1.0", + "elliptic": "^6.5.3" + } + }, + "node_modules/create-ecdh/node_modules/bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==" + }, + "node_modules/create-hash": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz", + "integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==", + "dependencies": { + "cipher-base": "^1.0.1", + "inherits": "^2.0.1", + "md5.js": "^1.3.4", + "ripemd160": "^2.0.1", + "sha.js": "^2.4.0" + } + }, + "node_modules/create-hmac": { + "version": "1.1.7", + "resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz", + "integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==", + "dependencies": { + "cipher-base": "^1.0.3", + "create-hash": "^1.1.0", + "inherits": "^2.0.1", + "ripemd160": "^2.0.0", + "safe-buffer": "^5.0.1", + "sha.js": "^2.4.8" + } + }, + "node_modules/cross-spawn": { + "version": "6.0.5", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz", + "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==", + "dependencies": { + "nice-try": "^1.0.4", + "path-key": "^2.0.1", + "semver": "^5.5.0", + "shebang-command": "^1.2.0", + "which": "^1.2.9" + }, + "engines": { + "node": ">=4.8" + } + }, + "node_modules/cross-spawn/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/crypto-browserify": { + "version": "3.12.0", + "resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz", + "integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==", + "dependencies": { + "browserify-cipher": "^1.0.0", + "browserify-sign": "^4.0.0", + "create-ecdh": "^4.0.0", + "create-hash": "^1.1.0", + "create-hmac": "^1.1.0", + "diffie-hellman": "^5.0.0", + "inherits": "^2.0.1", + "pbkdf2": "^3.0.3", + "public-encrypt": "^4.0.0", + "randombytes": "^2.0.0", + "randomfill": "^1.0.3" + }, + "engines": { + "node": "*" + } + }, + "node_modules/css": { + "version": "2.2.4", + "resolved": "https://registry.npmjs.org/css/-/css-2.2.4.tgz", + "integrity": "sha512-oUnjmWpy0niI3x/mPL8dVEI1l7MnG3+HHyRPHf+YFSbK+svOhXpmSOcDURUh2aOCgl2grzrOPt1nHLuCVFULLw==", + "dependencies": { + "inherits": "^2.0.3", + "source-map": "^0.6.1", + "source-map-resolve": "^0.5.2", + "urix": "^0.1.0" + } + }, + "node_modules/css-color-names": { + "version": "0.0.4", + "resolved": "https://registry.npmjs.org/css-color-names/-/css-color-names-0.0.4.tgz", + "integrity": "sha1-gIrcLnnPhHOAabZGyyDsJ762KeA=", + "engines": { + "node": "*" + } + }, + "node_modules/css-declaration-sorter": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/css-declaration-sorter/-/css-declaration-sorter-4.0.1.tgz", + "integrity": "sha512-BcxQSKTSEEQUftYpBVnsH4SF05NTuBokb19/sBt6asXGKZ/6VP7PLG1CBCkFDYOnhXhPh0jMhO6xZ71oYHXHBA==", + "dependencies": { + "postcss": "^7.0.1", + "timsort": "^0.3.0" + }, + "engines": { + "node": ">4" + } + }, + "node_modules/css-loader": { + "version": "3.5.1", + "resolved": "https://registry.npmjs.org/css-loader/-/css-loader-3.5.1.tgz", + "integrity": "sha512-0G4CbcZzQ9D1Q6ndOfjFuMDo8uLYMu5vc9Abs5ztyHcKvmil6GJrMiNjzzi3tQvUF+mVRuDg7bE6Oc0Prolgig==", + "dependencies": { + "camelcase": "^5.3.1", + "cssesc": "^3.0.0", + "icss-utils": "^4.1.1", + "loader-utils": "^1.2.3", + "normalize-path": "^3.0.0", + "postcss": "^7.0.27", + "postcss-modules-extract-imports": "^2.0.0", + "postcss-modules-local-by-default": "^3.0.2", + "postcss-modules-scope": "^2.2.0", + "postcss-modules-values": "^3.0.0", + "postcss-value-parser": "^4.0.3", + "schema-utils": "^2.6.5", + "semver": "^6.3.0" + }, + "engines": { + "node": ">= 8.9.0" + } + }, + "node_modules/css-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/css-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/css-loader/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/css-parse": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/css-parse/-/css-parse-2.0.0.tgz", + "integrity": "sha1-pGjuZnwW2BzPBcWMONKpfHgNv9Q=", + "dependencies": { + "css": "^2.0.0" + } + }, + "node_modules/css-select": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/css-select/-/css-select-2.1.0.tgz", + "integrity": "sha512-Dqk7LQKpwLoH3VovzZnkzegqNSuAziQyNZUcrdDM401iY+R5NkGBXGmtO05/yaXQziALuPogeG0b7UAgjnTJTQ==", + "dependencies": { + "boolbase": "^1.0.0", + "css-what": "^3.2.1", + "domutils": "^1.7.0", + "nth-check": "^1.0.2" + } + }, + "node_modules/css-select-base-adapter": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/css-select-base-adapter/-/css-select-base-adapter-0.1.1.tgz", + "integrity": "sha512-jQVeeRG70QI08vSTwf1jHxp74JoZsr2XSgETae8/xC8ovSnL2WF87GTLO86Sbwdt2lK4Umg4HnnwMO4YF3Ce7w==" + }, + "node_modules/css-tree": { + "version": "1.0.0-alpha.37", + "resolved": "https://registry.npmjs.org/css-tree/-/css-tree-1.0.0-alpha.37.tgz", + "integrity": "sha512-DMxWJg0rnz7UgxKT0Q1HU/L9BeJI0M6ksor0OgqOnF+aRCDWg/N2641HmVyU9KVIu0OVVWOb2IpC9A+BJRnejg==", + "dependencies": { + "mdn-data": "2.0.4", + "source-map": "^0.6.1" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/css-tree/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/css-what": { + "version": "3.4.2", + "resolved": "https://registry.npmjs.org/css-what/-/css-what-3.4.2.tgz", + "integrity": "sha512-ACUm3L0/jiZTqfzRM3Hi9Q8eZqd6IK37mMWPLz9PJxkLWllYeRf+EHUSHYEtFop2Eqytaq1FizFVh7XfBnXCDQ==", + "engines": { + "node": ">= 6" + } + }, + "node_modules/css/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/cssesc": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz", + "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==", + "bin": { + "cssesc": "bin/cssesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/cssnano": { + "version": "4.1.10", + "resolved": "https://registry.npmjs.org/cssnano/-/cssnano-4.1.10.tgz", + "integrity": "sha512-5wny+F6H4/8RgNlaqab4ktc3e0/blKutmq8yNlBFXA//nSFFAqAngjNVRzUvCgYROULmZZUoosL/KSoZo5aUaQ==", + "dependencies": { + "cosmiconfig": "^5.0.0", + "cssnano-preset-default": "^4.0.7", + "is-resolvable": "^1.0.0", + "postcss": "^7.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/cssnano-preset-default": { + "version": "4.0.7", + "resolved": "https://registry.npmjs.org/cssnano-preset-default/-/cssnano-preset-default-4.0.7.tgz", + "integrity": "sha512-x0YHHx2h6p0fCl1zY9L9roD7rnlltugGu7zXSKQx6k2rYw0Hi3IqxcoAGF7u9Q5w1nt7vK0ulxV8Lo+EvllGsA==", + "dependencies": { + "css-declaration-sorter": "^4.0.1", + "cssnano-util-raw-cache": "^4.0.1", + "postcss": "^7.0.0", + "postcss-calc": "^7.0.1", + "postcss-colormin": "^4.0.3", + "postcss-convert-values": "^4.0.1", + "postcss-discard-comments": "^4.0.2", + "postcss-discard-duplicates": "^4.0.2", + "postcss-discard-empty": "^4.0.1", + "postcss-discard-overridden": "^4.0.1", + "postcss-merge-longhand": "^4.0.11", + "postcss-merge-rules": "^4.0.3", + "postcss-minify-font-values": "^4.0.2", + "postcss-minify-gradients": "^4.0.2", + "postcss-minify-params": "^4.0.2", + "postcss-minify-selectors": "^4.0.2", + "postcss-normalize-charset": "^4.0.1", + "postcss-normalize-display-values": "^4.0.2", + "postcss-normalize-positions": "^4.0.2", + "postcss-normalize-repeat-style": "^4.0.2", + "postcss-normalize-string": "^4.0.2", + "postcss-normalize-timing-functions": "^4.0.2", + "postcss-normalize-unicode": "^4.0.1", + "postcss-normalize-url": "^4.0.1", + "postcss-normalize-whitespace": "^4.0.2", + "postcss-ordered-values": "^4.1.2", + "postcss-reduce-initial": "^4.0.3", + "postcss-reduce-transforms": "^4.0.2", + "postcss-svgo": "^4.0.2", + "postcss-unique-selectors": "^4.0.1" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/cssnano-util-get-arguments": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/cssnano-util-get-arguments/-/cssnano-util-get-arguments-4.0.0.tgz", + "integrity": "sha1-7ToIKZ8h11dBsg87gfGU7UnMFQ8=", + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/cssnano-util-get-match": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/cssnano-util-get-match/-/cssnano-util-get-match-4.0.0.tgz", + "integrity": "sha1-wOTKB/U4a7F+xeUiULT1lhNlFW0=", + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/cssnano-util-raw-cache": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/cssnano-util-raw-cache/-/cssnano-util-raw-cache-4.0.1.tgz", + "integrity": "sha512-qLuYtWK2b2Dy55I8ZX3ky1Z16WYsx544Q0UWViebptpwn/xDBmog2TLg4f+DBMg1rJ6JDWtn96WHbOKDWt1WQA==", + "dependencies": { + "postcss": "^7.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/cssnano-util-same-parent": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/cssnano-util-same-parent/-/cssnano-util-same-parent-4.0.1.tgz", + "integrity": "sha512-WcKx5OY+KoSIAxBW6UBBRay1U6vkYheCdjyVNDm85zt5K9mHoGOfsOsqIszfAqrQQFIIKgjh2+FDgIj/zsl21Q==", + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/csso": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/csso/-/csso-4.1.1.tgz", + "integrity": "sha512-Rvq+e1e0TFB8E8X+8MQjHSY6vtol45s5gxtLI/018UsAn2IBMmwNEZRM/h+HVnAJRHjasLIKKUO3uvoMM28LvA==", + "dependencies": { + "css-tree": "^1.0.0" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/csso/node_modules/css-tree": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/css-tree/-/css-tree-1.1.1.tgz", + "integrity": "sha512-NVN42M2fjszcUNpDbdkvutgQSlFYsr1z7kqeuCagHnNLBfYor6uP1WL1KrkmdYZ5Y1vTBCIOI/C/+8T98fJ71w==", + "dependencies": { + "mdn-data": "2.0.14", + "source-map": "^0.6.1" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/csso/node_modules/mdn-data": { + "version": "2.0.14", + "resolved": "https://registry.npmjs.org/mdn-data/-/mdn-data-2.0.14.tgz", + "integrity": "sha512-dn6wd0uw5GsdswPFfsgMp5NSB0/aDe6fK94YJV/AJDYXL6HVLWBsxeq7js7Ad+mU2K9LAlwpk6kN2D5mwCPVow==" + }, + "node_modules/csso/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/cyclist": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/cyclist/-/cyclist-1.0.1.tgz", + "integrity": "sha1-WW6WmP0MgOEgOMK4LW6xs1tiJNk=" + }, + "node_modules/dashdash": { + "version": "1.14.1", + "resolved": "https://registry.npmjs.org/dashdash/-/dashdash-1.14.1.tgz", + "integrity": "sha1-hTz6D3y+L+1d4gMmuN1YEDX24vA=", + "dependencies": { + "assert-plus": "^1.0.0" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/debug": { + "version": "4.3.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.1.tgz", + "integrity": "sha512-doEwdvm4PCeK4K3RQN2ZC2BYUBaxwLARCqZmMjtF8a51J2Rb0xpVloFRnCODwqjpwnAoao4pelN8l3RJdv3gRQ==", + "dependencies": { + "ms": "2.1.2" + }, + "engines": { + "node": ">=6.0" + } + }, + "node_modules/debuglog": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/debuglog/-/debuglog-1.0.1.tgz", + "integrity": "sha1-qiT/uaw9+aI1GDfPstJ5NgzXhJI=", + "engines": { + "node": "*" + } + }, + "node_modules/decamelize": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz", + "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/decode-uri-component": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz", + "integrity": "sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU=", + "engines": { + "node": ">=0.10" + } + }, + "node_modules/deep-equal": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/deep-equal/-/deep-equal-1.1.1.tgz", + "integrity": "sha512-yd9c5AdiqVcR+JjcwUQb9DkhJc8ngNr0MahEBGvDiJw8puWab2yZlh+nkasOnZP+EGTAP6rRp2JzJhJZzvNF8g==", + "dependencies": { + "is-arguments": "^1.0.4", + "is-date-object": "^1.0.1", + "is-regex": "^1.0.4", + "object-is": "^1.0.1", + "object-keys": "^1.1.1", + "regexp.prototype.flags": "^1.2.0" + } + }, + "node_modules/default-gateway": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/default-gateway/-/default-gateway-4.2.0.tgz", + "integrity": "sha512-h6sMrVB1VMWVrW13mSc6ia/DwYYw5MN6+exNu1OaJeFac5aSAvwM7lZ0NVfTABuSkQelr4h5oebg3KB1XPdjgA==", + "dependencies": { + "execa": "^1.0.0", + "ip-regex": "^2.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/defaults": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/defaults/-/defaults-1.0.3.tgz", + "integrity": "sha1-xlYFHpgX2f8I7YgUd/P+QBnz730=", + "dependencies": { + "clone": "^1.0.2" + } + }, + "node_modules/defaults/node_modules/clone": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/clone/-/clone-1.0.4.tgz", + "integrity": "sha1-2jCcwmPfFZlMaIypAheco8fNfH4=", + "engines": { + "node": ">=0.8" + } + }, + "node_modules/define-properties": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz", + "integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==", + "dependencies": { + "object-keys": "^1.0.12" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/define-property": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-2.0.2.tgz", + "integrity": "sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==", + "dependencies": { + "is-descriptor": "^1.0.2", + "isobject": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/define-property/node_modules/is-accessor-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", + "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/define-property/node_modules/is-data-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", + "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/define-property/node_modules/is-descriptor": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", + "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", + "dependencies": { + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/del": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/del/-/del-4.1.1.tgz", + "integrity": "sha512-QwGuEUouP2kVwQenAsOof5Fv8K9t3D8Ca8NxcXKrIpEHjTXK5J2nXLdP+ALI1cgv8wj7KuwBhTwBkOZSJKM5XQ==", + "dependencies": { + "@types/glob": "^7.1.1", + "globby": "^6.1.0", + "is-path-cwd": "^2.0.0", + "is-path-in-cwd": "^2.0.0", + "p-map": "^2.0.0", + "pify": "^4.0.1", + "rimraf": "^2.6.3" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/del/node_modules/globby": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/globby/-/globby-6.1.0.tgz", + "integrity": "sha1-9abXDoOV4hyFj7BInWTfAkJNUGw=", + "dependencies": { + "array-union": "^1.0.1", + "glob": "^7.0.3", + "object-assign": "^4.0.1", + "pify": "^2.0.0", + "pinkie-promise": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/del/node_modules/globby/node_modules/pify": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", + "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/del/node_modules/p-map": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/p-map/-/p-map-2.1.0.tgz", + "integrity": "sha512-y3b8Kpd8OAN444hxfBbFfj1FY/RjtTd8tzYwhUqNYXx0fXx2iX4maP4Qr6qhIKbQXI02wTLAda4fYUbDagTUFw==", + "engines": { + "node": ">=6" + } + }, + "node_modules/del/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/delayed-stream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz", + "integrity": "sha1-3zrhmayt+31ECqrgsp4icrJOxhk=", + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/depd": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz", + "integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/dependency-graph": { + "version": "0.7.2", + "resolved": "https://registry.npmjs.org/dependency-graph/-/dependency-graph-0.7.2.tgz", + "integrity": "sha512-KqtH4/EZdtdfWX0p6MGP9jljvxSY6msy/pRUD4jgNwVpv3v1QmNLlsB3LDSSUg79BRVSn7jI1QPRtArGABovAQ==", + "engines": { + "node": ">= 0.6.0" + } + }, + "node_modules/des.js": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.1.tgz", + "integrity": "sha512-Q0I4pfFrv2VPd34/vfLrFOoRmlYj3OV50i7fskps1jZWK1kApMWWT9G6RRUeYedLcBDIhnSDaUvJMb3AhUlaEA==", + "dependencies": { + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0" + } + }, + "node_modules/destroy": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz", + "integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=" + }, + "node_modules/detect-node": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/detect-node/-/detect-node-2.0.4.tgz", + "integrity": "sha512-ZIzRpLJrOj7jjP2miAtgqIfmzbxa4ZOr5jJc601zklsfEx9oTzmmj2nVpIPRpNlRTIh8lc1kyViIY7BWSGNmKw==" + }, + "node_modules/dezalgo": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/dezalgo/-/dezalgo-1.0.3.tgz", + "integrity": "sha1-f3Qt4Gb8dIvI24IFad3c5Jvw1FY=", + "dependencies": { + "asap": "^2.0.0", + "wrappy": "1" + } + }, + "node_modules/diff": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/diff/-/diff-4.0.2.tgz", + "integrity": "sha512-58lmxKSA4BNyLz+HHMUzlOEpg09FV+ev6ZMe3vJihgdxzgcwZ8VoEEPmALCZG9LmqfVoNMMKpttIYTVG6uDY7A==", + "engines": { + "node": ">=0.3.1" + } + }, + "node_modules/diffie-hellman": { + "version": "5.0.3", + "resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz", + "integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==", + "dependencies": { + "bn.js": "^4.1.0", + "miller-rabin": "^4.0.0", + "randombytes": "^2.0.0" + } + }, + "node_modules/diffie-hellman/node_modules/bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==" + }, + "node_modules/dir-glob": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/dir-glob/-/dir-glob-2.2.2.tgz", + "integrity": "sha512-f9LBi5QWzIW3I6e//uxZoLBlUt9kcp66qo0sSCxL6YZKc75R1c4MFCoe/LaZiBGmgujvQdxc5Bn3QhfyvK5Hsw==", + "dependencies": { + "path-type": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/dns-equal": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/dns-equal/-/dns-equal-1.0.0.tgz", + "integrity": "sha1-s55/HabrCnW6nBcySzR1PEfgZU0=" + }, + "node_modules/dns-packet": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/dns-packet/-/dns-packet-1.3.1.tgz", + "integrity": "sha512-0UxfQkMhYAUaZI+xrNZOz/as5KgDU0M/fQ9b6SpkyLbk3GEswDi6PADJVaYJradtRVsRIlF1zLyOodbcTCDzUg==", + "dependencies": { + "ip": "^1.1.0", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/dns-txt": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/dns-txt/-/dns-txt-2.0.2.tgz", + "integrity": "sha1-uR2Ab10nGI5Ks+fRB9iBocxGQrY=", + "dependencies": { + "buffer-indexof": "^1.0.0" + } + }, + "node_modules/dom-serializer": { + "version": "0.2.2", + "resolved": "https://registry.npmjs.org/dom-serializer/-/dom-serializer-0.2.2.tgz", + "integrity": "sha512-2/xPb3ORsQ42nHYiSunXkDjPLBaEj/xTwUO4B7XCZQTRk7EBtTOPaygh10YAAh2OI1Qrp6NWfpAhzswj0ydt9g==", + "dependencies": { + "domelementtype": "^2.0.1", + "entities": "^2.0.0" + } + }, + "node_modules/dom-serializer/node_modules/domelementtype": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/domelementtype/-/domelementtype-2.0.2.tgz", + "integrity": "sha512-wFwTwCVebUrMgGeAwRL/NhZtHAUyT9n9yg4IMDwf10+6iCMxSkVq9MGCVEH+QZWo1nNidy8kNvwmv4zWHDTqvA==" + }, + "node_modules/domain-browser": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz", + "integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA==", + "engines": { + "node": ">=0.4", + "npm": ">=1.2" + } + }, + "node_modules/domelementtype": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/domelementtype/-/domelementtype-1.3.1.tgz", + "integrity": "sha512-BSKB+TSpMpFI/HOxCNr1O8aMOTZ8hT3pM3GQ0w/mWRmkhEDSFJkkyzz4XQsBV44BChwGkrDfMyjVD0eA2aFV3w==" + }, + "node_modules/domutils": { + "version": "1.7.0", + "resolved": "https://registry.npmjs.org/domutils/-/domutils-1.7.0.tgz", + "integrity": "sha512-Lgd2XcJ/NjEw+7tFvfKxOzCYKZsdct5lczQ2ZaQY8Djz7pfAD3Gbp8ySJWtreII/vDlMVmxwa6pHmdxIYgttDg==", + "dependencies": { + "dom-serializer": "0", + "domelementtype": "1" + } + }, + "node_modules/dot-prop": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-5.3.0.tgz", + "integrity": "sha512-QM8q3zDe58hqUqjraQOmzZ1LIH9SWQJTlEKCH4kJ2oQvLZk7RbQXvtDM2XEq3fwkV9CCvvH4LA0AV+ogFsBM2Q==", + "dependencies": { + "is-obj": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/duplexify": { + "version": "3.7.1", + "resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.7.1.tgz", + "integrity": "sha512-07z8uv2wMyS51kKhD1KsdXJg5WQ6t93RneqRxUHnskXVtlYYkLqM0gqStQZ3pj073g687jPCHrqNfCzawLYh5g==", + "dependencies": { + "end-of-stream": "^1.0.0", + "inherits": "^2.0.1", + "readable-stream": "^2.0.0", + "stream-shift": "^1.0.0" + } + }, + "node_modules/ecc-jsbn": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/ecc-jsbn/-/ecc-jsbn-0.1.2.tgz", + "integrity": "sha1-OoOpBOVDUyh4dMVkt1SThoSamMk=", + "dependencies": { + "jsbn": "~0.1.0", + "safer-buffer": "^2.1.0" + } + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=" + }, + "node_modules/electron-to-chromium": { + "version": "1.3.603", + "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.3.603.tgz", + "integrity": "sha512-J8OHxOeJkoSLgBXfV9BHgKccgfLMHh+CoeRo6wJsi6m0k3otaxS/5vrHpMNSEYY4MISwewqanPOuhAtuE8riQQ==" + }, + "node_modules/elliptic": { + "version": "6.5.3", + "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.3.tgz", + "integrity": "sha512-IMqzv5wNQf+E6aHeIqATs0tOLeOTwj1QKbRcS3jBbYkl5oLAserA8yJTT7/VyHUYG91PRmPyeQDObKLPpeS4dw==", + "dependencies": { + "bn.js": "^4.4.0", + "brorand": "^1.0.1", + "hash.js": "^1.0.0", + "hmac-drbg": "^1.0.0", + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0", + "minimalistic-crypto-utils": "^1.0.0" + } + }, + "node_modules/elliptic/node_modules/bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==" + }, + "node_modules/emoji-regex": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==" + }, + "node_modules/emojis-list": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-3.0.0.tgz", + "integrity": "sha512-/kyM18EfinwXZbno9FyUGeFh87KC8HRQBQGildHZbEuRyWFOmv1U10o9BBp8XVZDVNNuQKyIGIu5ZYAAXJ0V2Q==", + "engines": { + "node": ">= 4" + } + }, + "node_modules/encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/encoding": { + "version": "0.1.13", + "resolved": "https://registry.npmjs.org/encoding/-/encoding-0.1.13.tgz", + "integrity": "sha512-ETBauow1T35Y/WZMkio9jiM0Z5xjHHmJ4XmjZOq1l/dXz3lr2sRn87nJy20RupqSh1F2m3HHPSp8ShIPQJrJ3A==", + "dependencies": { + "iconv-lite": "^0.6.2" + } + }, + "node_modules/encoding/node_modules/iconv-lite": { + "version": "0.6.2", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.6.2.tgz", + "integrity": "sha512-2y91h5OpQlolefMPmUlivelittSWy0rP+oYVpn6A7GwVHNE8AWzoYOBNmlwks3LobaJxgHCYZAnyNo2GgpNRNQ==", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/end-of-stream": { + "version": "1.4.4", + "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.4.tgz", + "integrity": "sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q==", + "dependencies": { + "once": "^1.4.0" + } + }, + "node_modules/enhanced-resolve": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.1.tgz", + "integrity": "sha512-98p2zE+rL7/g/DzMHMTF4zZlCgeVdJ7yr6xzEpJRYwFYrGi9ANdn5DnJURg6RpBkyk60XYDnWIv51VfIhfNGuA==", + "dependencies": { + "graceful-fs": "^4.1.2", + "memory-fs": "^0.5.0", + "tapable": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/entities": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/entities/-/entities-2.1.0.tgz", + "integrity": "sha512-hCx1oky9PFrJ611mf0ifBLBRW8lUUVRlFolb5gWRfIELabBlbp9xZvrqZLZAs+NxFnbfQoeGd8wDkygjg7U85w==" + }, + "node_modules/err-code": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/err-code/-/err-code-1.1.2.tgz", + "integrity": "sha1-BuARbTAo9q70gGhJ6w6mp0iuaWA=" + }, + "node_modules/errno": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/errno/-/errno-0.1.7.tgz", + "integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==", + "dependencies": { + "prr": "~1.0.1" + }, + "bin": { + "errno": "cli.js" + } + }, + "node_modules/error-ex": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/error-ex/-/error-ex-1.3.2.tgz", + "integrity": "sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g==", + "dependencies": { + "is-arrayish": "^0.2.1" + } + }, + "node_modules/es-abstract": { + "version": "1.17.7", + "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.17.7.tgz", + "integrity": "sha512-VBl/gnfcJ7OercKA9MVaegWsBHFjV492syMudcnQZvt/Dw8ezpcOHYZXa/J96O8vx+g4x65YKhxOwDUh63aS5g==", + "dependencies": { + "es-to-primitive": "^1.2.1", + "function-bind": "^1.1.1", + "has": "^1.0.3", + "has-symbols": "^1.0.1", + "is-callable": "^1.2.2", + "is-regex": "^1.1.1", + "object-inspect": "^1.8.0", + "object-keys": "^1.1.1", + "object.assign": "^4.1.1", + "string.prototype.trimend": "^1.0.1", + "string.prototype.trimstart": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-to-primitive": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.2.1.tgz", + "integrity": "sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==", + "dependencies": { + "is-callable": "^1.1.4", + "is-date-object": "^1.0.1", + "is-symbol": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es6-promise": { + "version": "4.2.8", + "resolved": "https://registry.npmjs.org/es6-promise/-/es6-promise-4.2.8.tgz", + "integrity": "sha512-HJDGx5daxeIvxdBxvG2cb9g4tEvwIk3i8+nhX0yGrYmZUzbkdg8QbDevheDB8gd0//uPj4c1EQua8Q+MViT0/w==" + }, + "node_modules/es6-promisify": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/es6-promisify/-/es6-promisify-5.0.0.tgz", + "integrity": "sha1-UQnWLz5W6pZ8S2NQWu8IKRyKUgM=", + "dependencies": { + "es6-promise": "^4.0.3" + } + }, + "node_modules/escalade": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.1.tgz", + "integrity": "sha512-k0er2gUkLf8O0zKJiAhmkTnJlTvINGv7ygDNPbeIsX/TJjGJZHuh9B2UxbsaEkmlEo9MfhrSzmhIlhRlI2GXnw==", + "engines": { + "node": ">=6" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=" + }, + "node_modules/escape-string-regexp": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", + "integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=", + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/eslint-scope": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-4.0.3.tgz", + "integrity": "sha512-p7VutNr1O/QrxysMo3E45FjYDTeXBy0iTltPFNSqKAIfjDSXC+4dj+qfyuD8bfAXrW/y6lW3O76VaYNPKfpKrg==", + "dependencies": { + "esrecurse": "^4.1.0", + "estraverse": "^4.1.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/esprima": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/esprima/-/esprima-4.0.1.tgz", + "integrity": "sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==", + "bin": { + "esparse": "bin/esparse.js", + "esvalidate": "bin/esvalidate.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/esquery": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.3.1.tgz", + "integrity": "sha512-olpvt9QG0vniUBZspVRN6lwB7hOZoTRtT+jzR+tS4ffYx2mzbw+z0XCOk44aaLYKApNX5nMm+E+P6o25ip/DHQ==", + "dependencies": { + "estraverse": "^5.1.0" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/esquery/node_modules/estraverse": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.2.0.tgz", + "integrity": "sha512-BxbNGGNm0RyRYvUdHpIwv9IWzeM9XClbOxwoATuFdOE7ZE6wHL+HQ5T8hoPM+zHvmKzzsEqhgy0GrQ5X13afiQ==", + "engines": { + "node": ">=4.0" + } + }, + "node_modules/esrecurse": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.3.0.tgz", + "integrity": "sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==", + "dependencies": { + "estraverse": "^5.2.0" + }, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/esrecurse/node_modules/estraverse": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.2.0.tgz", + "integrity": "sha512-BxbNGGNm0RyRYvUdHpIwv9IWzeM9XClbOxwoATuFdOE7ZE6wHL+HQ5T8hoPM+zHvmKzzsEqhgy0GrQ5X13afiQ==", + "engines": { + "node": ">=4.0" + } + }, + "node_modules/estraverse": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.3.0.tgz", + "integrity": "sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw==", + "engines": { + "node": ">=4.0" + } + }, + "node_modules/esutils": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", + "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/eventemitter3": { + "version": "4.0.7", + "resolved": "https://registry.npmjs.org/eventemitter3/-/eventemitter3-4.0.7.tgz", + "integrity": "sha512-8guHBZCwKnFhYdHr2ysuRWErTwhoN2X8XELRlrRwpmfeY2jjuUN4taQMsULKUVo1K4DvZl+0pgfyoysHxvmvEw==" + }, + "node_modules/events": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/events/-/events-3.2.0.tgz", + "integrity": "sha512-/46HWwbfCX2xTawVfkKLGxMifJYQBWMwY1mjywRtb4c9x8l5NP3KoJtnIOiL1hfdRkIuYhETxQlo62IF8tcnlg==", + "engines": { + "node": ">=0.8.x" + } + }, + "node_modules/eventsource": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/eventsource/-/eventsource-1.0.7.tgz", + "integrity": "sha512-4Ln17+vVT0k8aWq+t/bF5arcS3EpT9gYtW66EPacdj/mAFevznsnyoHLPy2BA8gbIQeIHoPsvwmfBftfcG//BQ==", + "dependencies": { + "original": "^1.0.0" + }, + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/evp_bytestokey": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz", + "integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==", + "dependencies": { + "md5.js": "^1.3.4", + "safe-buffer": "^5.1.1" + } + }, + "node_modules/execa": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/execa/-/execa-1.0.0.tgz", + "integrity": "sha512-adbxcyWV46qiHyvSp50TKt05tB4tK3HcmF7/nxfAdhnox83seTDbwnaqKO4sXRy7roHAIFqJP/Rw/AuEbX61LA==", + "dependencies": { + "cross-spawn": "^6.0.0", + "get-stream": "^4.0.0", + "is-stream": "^1.1.0", + "npm-run-path": "^2.0.0", + "p-finally": "^1.0.0", + "signal-exit": "^3.0.0", + "strip-eof": "^1.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/expand-brackets": { + "version": "2.1.4", + "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-2.1.4.tgz", + "integrity": "sha1-t3c14xXOMPa27/D4OwQVGiJEliI=", + "dependencies": { + "debug": "^2.3.3", + "define-property": "^0.2.5", + "extend-shallow": "^2.0.1", + "posix-character-classes": "^0.1.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/expand-brackets/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/expand-brackets/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/expand-brackets/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/expand-brackets/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/express": { + "version": "4.17.1", + "resolved": "https://registry.npmjs.org/express/-/express-4.17.1.tgz", + "integrity": "sha512-mHJ9O79RqluphRrcw2X/GTh3k9tVv8YcoyY4Kkh4WDMUYKRZUq0h1o0w2rrrxBqM7VoeUVqgb27xlEMXTnYt4g==", + "dependencies": { + "accepts": "~1.3.7", + "array-flatten": "1.1.1", + "body-parser": "1.19.0", + "content-disposition": "0.5.3", + "content-type": "~1.0.4", + "cookie": "0.4.0", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "~1.1.2", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "~1.1.2", + "fresh": "0.5.2", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.7", + "proxy-addr": "~2.0.5", + "qs": "6.7.0", + "range-parser": "~1.2.1", + "safe-buffer": "5.1.2", + "send": "0.17.1", + "serve-static": "1.14.1", + "setprototypeof": "1.1.1", + "statuses": "~1.5.0", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + }, + "engines": { + "node": ">= 0.10.0" + } + }, + "node_modules/express/node_modules/array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=" + }, + "node_modules/express/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/express/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/express/node_modules/qs": { + "version": "6.7.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.7.0.tgz", + "integrity": "sha512-VCdBRNFTX1fyE7Nb6FYoURo/SPe62QCaAyzJvUjwRaIsc+NePBEniHlvxFmmX56+HZphIGtV0XeCirBtpDrTyQ==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/extend": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/extend/-/extend-3.0.2.tgz", + "integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==" + }, + "node_modules/extend-shallow": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-3.0.2.tgz", + "integrity": "sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=", + "dependencies": { + "assign-symbols": "^1.0.0", + "is-extendable": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extend-shallow/node_modules/is-extendable": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz", + "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==", + "dependencies": { + "is-plain-object": "^2.0.4" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/external-editor": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/external-editor/-/external-editor-3.1.0.tgz", + "integrity": "sha512-hMQ4CX1p1izmuLYyZqLMO/qGNw10wSv9QDCPfzXfyFrOaCSSoRfqE1Kf1s5an66J5JZC62NewG+mK49jOCtQew==", + "dependencies": { + "chardet": "^0.7.0", + "iconv-lite": "^0.4.24", + "tmp": "^0.0.33" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/extglob": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/extglob/-/extglob-2.0.4.tgz", + "integrity": "sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==", + "dependencies": { + "array-unique": "^0.3.2", + "define-property": "^1.0.0", + "expand-brackets": "^2.1.4", + "extend-shallow": "^2.0.1", + "fragment-cache": "^0.2.1", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/define-property": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", + "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", + "dependencies": { + "is-descriptor": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/is-accessor-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", + "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/is-data-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", + "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/is-descriptor": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", + "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", + "dependencies": { + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extsprintf": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/extsprintf/-/extsprintf-1.3.0.tgz", + "integrity": "sha1-lpGEQOMEGnpBT4xS48V06zw+HgU=", + "engines": [ + "node >=0.6.0" + ] + }, + "node_modules/fast-deep-equal": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", + "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==" + }, + "node_modules/fast-json-stable-stringify": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", + "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==" + }, + "node_modules/faye-websocket": { + "version": "0.10.0", + "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.10.0.tgz", + "integrity": "sha1-TkkvjQTftviQA1B/btvy1QHnxvQ=", + "dependencies": { + "websocket-driver": ">=0.5.1" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/figgy-pudding": { + "version": "3.5.2", + "resolved": "https://registry.npmjs.org/figgy-pudding/-/figgy-pudding-3.5.2.tgz", + "integrity": "sha512-0btnI/H8f2pavGMN8w40mlSKOfTK2SVJmBfBeVIj3kNw0swwgzyRq0d5TJVOwodFmtvpPeWPN/MCcfuWF0Ezbw==" + }, + "node_modules/figures": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/figures/-/figures-3.2.0.tgz", + "integrity": "sha512-yaduQFRKLXYOGgEn6AZau90j3ggSOyiqXU0F9JZfeXYhNa+Jk4X+s45A2zg5jns87GAFa34BBm2kXw4XpNcbdg==", + "dependencies": { + "escape-string-regexp": "^1.0.5" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/file-loader": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/file-loader/-/file-loader-6.0.0.tgz", + "integrity": "sha512-/aMOAYEFXDdjG0wytpTL5YQLfZnnTmLNjn+AIrJ/6HVnTfDqLsVKUUwkDf4I4kgex36BvjuXEn/TX9B/1ESyqQ==", + "dependencies": { + "loader-utils": "^2.0.0", + "schema-utils": "^2.6.5" + }, + "engines": { + "node": ">= 10.13.0" + } + }, + "node_modules/fill-range": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/finalhandler": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.2.tgz", + "integrity": "sha512-aAWcW57uxVNrQZqFXjITpW3sIUQmHGG3qSb9mUah9MgMC4NeWhNOlNjXEYq3HjRAvL6arUviZGGJsBg6z0zsWA==", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "statuses": "~1.5.0", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/finalhandler/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/finalhandler/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/find-cache-dir": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-3.3.1.tgz", + "integrity": "sha512-t2GDMt3oGC/v+BMwzmllWDuJF/xcDtE5j/fCGbqDD7OLuJkj0cfh1YSA5VKPvwMeLFLNDBkwOKZ2X85jGLVftQ==", + "dependencies": { + "commondir": "^1.0.1", + "make-dir": "^3.0.2", + "pkg-dir": "^4.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/find-cache-dir/node_modules/find-up": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", + "dependencies": { + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/find-cache-dir/node_modules/locate-path": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", + "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", + "dependencies": { + "p-locate": "^4.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/find-cache-dir/node_modules/make-dir": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", + "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", + "dependencies": { + "semver": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/find-cache-dir/node_modules/p-locate": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", + "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", + "dependencies": { + "p-limit": "^2.2.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/find-cache-dir/node_modules/path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "engines": { + "node": ">=8" + } + }, + "node_modules/find-cache-dir/node_modules/pkg-dir": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-4.2.0.tgz", + "integrity": "sha512-HRDzbaKjC+AOWVXxAU/x54COGeIv9eb+6CkDSQoNTt4XyWoIJvuPsXizxu/Fr23EiekbtZwmh1IcIG/l/a10GQ==", + "dependencies": { + "find-up": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/find-cache-dir/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/find-up": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", + "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", + "dependencies": { + "locate-path": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/flat": { + "version": "5.0.2", + "resolved": "https://registry.npmjs.org/flat/-/flat-5.0.2.tgz", + "integrity": "sha512-b6suED+5/3rTpUBdG1gupIl8MPFCAMA0QXwmljLhvCUKcUvdE4gWky9zpuGCcXHOsz4J9wPGNWq6OKpmIzz3hQ==", + "bin": { + "flat": "cli.js" + } + }, + "node_modules/flush-write-stream": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/flush-write-stream/-/flush-write-stream-1.1.1.tgz", + "integrity": "sha512-3Z4XhFZ3992uIq0XOqb9AreonueSYphE6oYbpt5+3u06JWklbsPkNv3ZKkP9Bz/r+1MWCaMoSQ28P85+1Yc77w==", + "dependencies": { + "inherits": "^2.0.3", + "readable-stream": "^2.3.6" + } + }, + "node_modules/follow-redirects": { + "version": "1.13.0", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.13.0.tgz", + "integrity": "sha512-aq6gF1BEKje4a9i9+5jimNFIpq4Q1WiwBToeRK5NvZBd/TRsmW8BsJfOEGkr76TbOyPVD3OVDN910EcUNtRYEA==", + "engines": { + "node": ">=4.0" + } + }, + "node_modules/font-awesome": { + "version": "4.7.0", + "resolved": "https://registry.npmjs.org/font-awesome/-/font-awesome-4.7.0.tgz", + "integrity": "sha1-j6jPBBGhoxr9B7BtKQK7n8gVoTM=", + "engines": { + "node": ">=0.10.3" + } + }, + "node_modules/for-in": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/for-in/-/for-in-1.0.2.tgz", + "integrity": "sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/forever-agent": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/forever-agent/-/forever-agent-0.6.1.tgz", + "integrity": "sha1-+8cfDEGt6zf5bFd60e1C2P2sypE=", + "engines": { + "node": "*" + } + }, + "node_modules/form-data": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/form-data/-/form-data-2.3.3.tgz", + "integrity": "sha512-1lLKB2Mu3aGP1Q/2eCOx0fNbRMe7XdwktwOruhfqqd0rIJWwN4Dh+E3hrPSlDCXnSR7UtZ1N38rVXm+6+MEhJQ==", + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "^1.0.6", + "mime-types": "^2.1.12" + }, + "engines": { + "node": ">= 0.12" + } + }, + "node_modules/forwarded": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.2.tgz", + "integrity": "sha1-mMI9qxF1ZXuMBXPozszZGw/xjIQ=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/fragment-cache": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/fragment-cache/-/fragment-cache-0.2.1.tgz", + "integrity": "sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=", + "dependencies": { + "map-cache": "^0.2.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/fresh": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "integrity": "sha1-PYyt2Q2XZWn6g1qx+OSyOhBWBac=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/from2": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/from2/-/from2-2.3.0.tgz", + "integrity": "sha1-i/tVAr3kpNNs/e6gB/zKIdfjgq8=", + "dependencies": { + "inherits": "^2.0.1", + "readable-stream": "^2.0.0" + } + }, + "node_modules/fs-extra": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-4.0.2.tgz", + "integrity": "sha1-+RcExT0bRh+JNFKwwwfZmXZHq2s=", + "dependencies": { + "graceful-fs": "^4.1.2", + "jsonfile": "^4.0.0", + "universalify": "^0.1.0" + } + }, + "node_modules/fs-minipass": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-2.1.0.tgz", + "integrity": "sha512-V/JgOLFCS+R6Vcq0slCuaeWEdNC3ouDlJMNIsacH2VtALiu9mV4LPrHc5cDl8k5aw6J8jwgWWpiTo5RYhmIzvg==", + "dependencies": { + "minipass": "^3.0.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/fs-write-stream-atomic": { + "version": "1.0.10", + "resolved": "https://registry.npmjs.org/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz", + "integrity": "sha1-tH31NJPvkR33VzHnCp3tAYnbQMk=", + "dependencies": { + "graceful-fs": "^4.1.2", + "iferr": "^0.1.5", + "imurmurhash": "^0.1.4", + "readable-stream": "1 || 2" + } + }, + "node_modules/fs.realpath": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", + "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=" + }, + "node_modules/fsevents": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.1.3.tgz", + "integrity": "sha512-Auw9a4AxqWpa9GUfj370BMPzzyncfBABW8Mab7BGWBYDj4Isgq+cDKtx0i6u9jcX9pQDnswsaaOTgTmA5pEjuQ==", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/function-bind": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", + "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==" + }, + "node_modules/genfun": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/genfun/-/genfun-5.0.0.tgz", + "integrity": "sha512-KGDOARWVga7+rnB3z9Sd2Letx515owfk0hSxHGuqjANb1M+x2bGZGqHLiozPsYMdM2OubeMni/Hpwmjq6qIUhA==" + }, + "node_modules/gensync": { + "version": "1.0.0-beta.2", + "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.2.tgz", + "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==", + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/get-caller-file": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-1.0.3.tgz", + "integrity": "sha512-3t6rVToeoZfYSGd8YoLFR2DJkiQrIiUrGcjvFX2mDw3bn6k2OtwHN0TNCLbBO+w8qTvimhDkv+LSscbJY1vE6w==" + }, + "node_modules/get-intrinsic": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.0.1.tgz", + "integrity": "sha512-ZnWP+AmS1VUaLgTRy47+zKtjTxz+0xMpx3I52i+aalBK1QP19ggLF3Db89KJX7kjfOfP2eoa01qc++GwPgufPg==", + "dependencies": { + "function-bind": "^1.1.1", + "has": "^1.0.3", + "has-symbols": "^1.0.1" + } + }, + "node_modules/get-stream": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-4.1.0.tgz", + "integrity": "sha512-GMat4EJ5161kIy2HevLlr4luNjBgvmj413KaQA7jt4V8B4RDsfpHk7WQ9GVqfYyyx8OS/L66Kox+rJRNklLK7w==", + "dependencies": { + "pump": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/get-value": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/get-value/-/get-value-2.0.6.tgz", + "integrity": "sha1-3BXKHGcjh8p2vTesCjlbogQqLCg=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/getpass": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/getpass/-/getpass-0.1.7.tgz", + "integrity": "sha1-Xv+OPmhNVprkyysSgmBOi6YhSfo=", + "dependencies": { + "assert-plus": "^1.0.0" + } + }, + "node_modules/gettext-parser": { + "version": "4.0.4", + "resolved": "https://registry.npmjs.org/gettext-parser/-/gettext-parser-4.0.4.tgz", + "integrity": "sha512-VDZEeOIYd0veZXt5iAn0SS3I0Fz14fJw+59avRNa7VIslEDriRLxcfrBd/xeQyOcm6nyS4uuufxm2iw88qirAg==", + "dependencies": { + "content-type": "^1.0.4", + "encoding": "^0.1.13", + "readable-stream": "^3.6.0", + "safe-buffer": "^5.2.1" + } + }, + "node_modules/gettext-parser/node_modules/readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dependencies": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/gettext-parser/node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==" + }, + "node_modules/glob": { + "version": "7.1.6", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz", + "integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==", + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + } + }, + "node_modules/glob-parent": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz", + "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=", + "dependencies": { + "is-glob": "^3.1.0", + "path-dirname": "^1.0.0" + } + }, + "node_modules/glob-parent/node_modules/is-glob": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", + "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", + "dependencies": { + "is-extglob": "^2.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/globals": { + "version": "11.12.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", + "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", + "engines": { + "node": ">=4" + } + }, + "node_modules/globby": { + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/globby/-/globby-7.1.1.tgz", + "integrity": "sha1-+yzP+UAfhgCUXfral0QMypcrhoA=", + "dependencies": { + "array-union": "^1.0.1", + "dir-glob": "^2.0.0", + "glob": "^7.1.2", + "ignore": "^3.3.5", + "pify": "^3.0.0", + "slash": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/globby/node_modules/pify": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", + "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "engines": { + "node": ">=4" + } + }, + "node_modules/graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==" + }, + "node_modules/handle-thing": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/handle-thing/-/handle-thing-2.0.1.tgz", + "integrity": "sha512-9Qn4yBxelxoh2Ow62nP+Ka/kMnOXRi8BXnRaUwezLNhqelnN49xKz4F/dPP8OYLxLxq6JDtZb2i9XznUQbNPTg==" + }, + "node_modules/har-schema": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/har-schema/-/har-schema-2.0.0.tgz", + "integrity": "sha1-qUwiJOvKwEeCoNkDVSHyRzW37JI=", + "engines": { + "node": ">=4" + } + }, + "node_modules/har-validator": { + "version": "5.1.5", + "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.1.5.tgz", + "integrity": "sha512-nmT2T0lljbxdQZfspsno9hgrG3Uir6Ks5afism62poxqBM6sDnMEuPmzTq8XN0OEwqKLLdh1jQI3qyE66Nzb3w==", + "dependencies": { + "ajv": "^6.12.3", + "har-schema": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/har-validator/node_modules/ajv": { + "version": "6.12.6", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", + "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", + "dependencies": { + "fast-deep-equal": "^3.1.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" + } + }, + "node_modules/has": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", + "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==", + "dependencies": { + "function-bind": "^1.1.1" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/has-flag": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", + "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=", + "engines": { + "node": ">=4" + } + }, + "node_modules/has-symbols": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", + "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/has-value": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz", + "integrity": "sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=", + "dependencies": { + "get-value": "^2.0.6", + "has-values": "^1.0.0", + "isobject": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/has-values": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/has-values/-/has-values-1.0.0.tgz", + "integrity": "sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=", + "dependencies": { + "is-number": "^3.0.0", + "kind-of": "^4.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/has-values/node_modules/is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/has-values/node_modules/is-number/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/has-values/node_modules/kind-of": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz", + "integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/hash-base": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.1.0.tgz", + "integrity": "sha512-1nmYp/rhMDiE7AYkDw+lLwlAzz0AntGIe51F3RfFfEqyQ3feY2eI/NcwC6umIQVOASPMsWJLJScWKSSvzL9IVA==", + "dependencies": { + "inherits": "^2.0.4", + "readable-stream": "^3.6.0", + "safe-buffer": "^5.2.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/hash-base/node_modules/readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dependencies": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/hash-base/node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==" + }, + "node_modules/hash.js": { + "version": "1.1.7", + "resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.7.tgz", + "integrity": "sha512-taOaskGt4z4SOANNseOviYDvjEJinIkRgmp7LbKP2YTTmVxWBl87s/uzK9r+44BclBSp2X7K1hqeNfz9JbBeXA==", + "dependencies": { + "inherits": "^2.0.3", + "minimalistic-assert": "^1.0.1" + } + }, + "node_modules/hex-color-regex": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/hex-color-regex/-/hex-color-regex-1.1.0.tgz", + "integrity": "sha512-l9sfDFsuqtOqKDsQdqrMRk0U85RZc0RtOR9yPI7mRVOa4FsR/BVnZ0shmQRM96Ji99kYZP/7hn1cedc1+ApsTQ==" + }, + "node_modules/hmac-drbg": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz", + "integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=", + "dependencies": { + "hash.js": "^1.0.3", + "minimalistic-assert": "^1.0.0", + "minimalistic-crypto-utils": "^1.0.1" + } + }, + "node_modules/hosted-git-info": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-3.0.7.tgz", + "integrity": "sha512-fWqc0IcuXs+BmE9orLDyVykAG9GJtGLGuZAAqgcckPgv5xad4AcXGIv8galtQvlwutxSlaMcdw7BUtq2EIvqCQ==", + "dependencies": { + "lru-cache": "^6.0.0" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/hosted-git-info/node_modules/lru-cache": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-6.0.0.tgz", + "integrity": "sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA==", + "dependencies": { + "yallist": "^4.0.0" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/hpack.js": { + "version": "2.1.6", + "resolved": "https://registry.npmjs.org/hpack.js/-/hpack.js-2.1.6.tgz", + "integrity": "sha1-h3dMCUnlE/QuhFdbPEVoH63ioLI=", + "dependencies": { + "inherits": "^2.0.1", + "obuf": "^1.0.0", + "readable-stream": "^2.0.1", + "wbuf": "^1.1.0" + } + }, + "node_modules/hsl-regex": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/hsl-regex/-/hsl-regex-1.0.0.tgz", + "integrity": "sha1-1JMwx4ntgZ4nakwNJy3/owsY/m4=" + }, + "node_modules/hsla-regex": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/hsla-regex/-/hsla-regex-1.0.0.tgz", + "integrity": "sha1-wc56MWjIxmFAM6S194d/OyJfnDg=" + }, + "node_modules/html-comment-regex": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/html-comment-regex/-/html-comment-regex-1.1.2.tgz", + "integrity": "sha512-P+M65QY2JQ5Y0G9KKdlDpo0zK+/OHptU5AaBwUfAIDJZk1MYf32Frm84EcOytfJE0t5JvkAnKlmjsXDnWzCJmQ==" + }, + "node_modules/html-entities": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-1.3.1.tgz", + "integrity": "sha512-rhE/4Z3hIhzHAUKbW8jVcCyuT5oJCXXqhN/6mXXVCpzTmvJnoH2HL/bt3EZ6p55jbFJBeAe1ZNpL5BugLujxNA==" + }, + "node_modules/http-cache-semantics": { + "version": "3.8.1", + "resolved": "https://registry.npmjs.org/http-cache-semantics/-/http-cache-semantics-3.8.1.tgz", + "integrity": "sha512-5ai2iksyV8ZXmnZhHH4rWPoxxistEexSi5936zIQ1bnNTW5VnA85B6P/VpXiRM017IgRvb2kKo1a//y+0wSp3w==" + }, + "node_modules/http-deceiver": { + "version": "1.2.7", + "resolved": "https://registry.npmjs.org/http-deceiver/-/http-deceiver-1.2.7.tgz", + "integrity": "sha1-+nFolEq5pRnTN8sL7HKE3D5yPYc=" + }, + "node_modules/http-errors": { + "version": "1.7.2", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.7.2.tgz", + "integrity": "sha512-uUQBt3H/cSIVfch6i1EuPNy/YsRSOUBXTVfZ+yR7Zjez3qjBz6i9+i4zjNaoqcoFVI4lQJ5plg63TvGfRSDCRg==", + "dependencies": { + "depd": "~1.1.2", + "inherits": "2.0.3", + "setprototypeof": "1.1.1", + "statuses": ">= 1.5.0 < 2", + "toidentifier": "1.0.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/http-errors/node_modules/inherits": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" + }, + "node_modules/http-parser-js": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/http-parser-js/-/http-parser-js-0.5.2.tgz", + "integrity": "sha512-opCO9ASqg5Wy2FNo7A0sxy71yGbbkJJXLdgMK04Tcypw9jr2MgWbyubb0+WdmDmGnFflO7fRbqbaihh/ENDlRQ==" + }, + "node_modules/http-proxy": { + "version": "1.18.1", + "resolved": "https://registry.npmjs.org/http-proxy/-/http-proxy-1.18.1.tgz", + "integrity": "sha512-7mz/721AbnJwIVbnaSv1Cz3Am0ZLT/UBwkC92VlxhXv/k/BBQfM2fXElQNC27BVGr0uwUpplYPQM9LnaBMR5NQ==", + "dependencies": { + "eventemitter3": "^4.0.0", + "follow-redirects": "^1.0.0", + "requires-port": "^1.0.0" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/http-proxy-agent": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/http-proxy-agent/-/http-proxy-agent-2.1.0.tgz", + "integrity": "sha512-qwHbBLV7WviBl0rQsOzH6o5lwyOIvwp/BdFnvVxXORldu5TmjFfjzBcWUWS5kWAZhmv+JtiDhSuQCp4sBfbIgg==", + "dependencies": { + "agent-base": "4", + "debug": "3.1.0" + }, + "engines": { + "node": ">= 4.5.0" + } + }, + "node_modules/http-proxy-agent/node_modules/debug": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/http-proxy-agent/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/http-proxy-middleware": { + "version": "0.19.1", + "resolved": "https://registry.npmjs.org/http-proxy-middleware/-/http-proxy-middleware-0.19.1.tgz", + "integrity": "sha512-yHYTgWMQO8VvwNS22eLLloAkvungsKdKTLO8AJlftYIKNfJr3GK3zK0ZCfzDDGUBttdGc8xFy1mCitvNKQtC3Q==", + "dependencies": { + "http-proxy": "^1.17.0", + "is-glob": "^4.0.0", + "lodash": "^4.17.11", + "micromatch": "^3.1.10" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/http-signature": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/http-signature/-/http-signature-1.2.0.tgz", + "integrity": "sha1-muzZJRFHcvPZW2WmCruPfBj7rOE=", + "dependencies": { + "assert-plus": "^1.0.0", + "jsprim": "^1.2.2", + "sshpk": "^1.7.0" + }, + "engines": { + "node": ">=0.8", + "npm": ">=1.3.7" + } + }, + "node_modules/https-browserify": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz", + "integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM=" + }, + "node_modules/https-proxy-agent": { + "version": "2.2.4", + "resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-2.2.4.tgz", + "integrity": "sha512-OmvfoQ53WLjtA9HeYP9RNrWMJzzAz1JGaSFr1nijg0PVR1JaD/xbJq1mdEIIlxGpXp9eSe/O2LgU9DJmTPd0Eg==", + "dependencies": { + "agent-base": "^4.3.0", + "debug": "^3.1.0" + }, + "engines": { + "node": ">= 4.5.0" + } + }, + "node_modules/https-proxy-agent/node_modules/debug": { + "version": "3.2.7", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz", + "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/humanize-ms": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/humanize-ms/-/humanize-ms-1.2.1.tgz", + "integrity": "sha1-xG4xWaKT9riW2ikxbYtv6Lt5u+0=", + "dependencies": { + "ms": "^2.0.0" + } + }, + "node_modules/iconv-lite": { + "version": "0.4.24", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/icss-utils": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/icss-utils/-/icss-utils-4.1.1.tgz", + "integrity": "sha512-4aFq7wvWyMHKgxsH8QQtGpvbASCf+eM3wPRLI6R+MgAnTCZ6STYsRvttLvRWK0Nfif5piF394St3HeJDaljGPA==", + "dependencies": { + "postcss": "^7.0.14" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/ieee754": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.2.1.tgz", + "integrity": "sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==" + }, + "node_modules/iferr": { + "version": "0.1.5", + "resolved": "https://registry.npmjs.org/iferr/-/iferr-0.1.5.tgz", + "integrity": "sha1-xg7taebY/bazEEofy8ocGS3FtQE=" + }, + "node_modules/ignore": { + "version": "3.3.10", + "resolved": "https://registry.npmjs.org/ignore/-/ignore-3.3.10.tgz", + "integrity": "sha512-Pgs951kaMm5GXP7MOvxERINe3gsaVjUWFm+UZPSq9xYriQAksyhg0csnS0KXSNRD5NmNdapXEpjxG49+AKh/ug==" + }, + "node_modules/ignore-walk": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/ignore-walk/-/ignore-walk-3.0.3.tgz", + "integrity": "sha512-m7o6xuOaT1aqheYHKf8W6J5pYH85ZI9w077erOzLje3JsB1gkafkAhHHY19dqjulgIZHFm32Cp5uNZgcQqdJKw==", + "dependencies": { + "minimatch": "^3.0.4" + } + }, + "node_modules/image-size": { + "version": "0.5.5", + "resolved": "https://registry.npmjs.org/image-size/-/image-size-0.5.5.tgz", + "integrity": "sha1-Cd/Uq50g4p6xw+gLiZA3jfnjy5w=", + "optional": true, + "bin": { + "image-size": "bin/image-size.js" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/import-cwd": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/import-cwd/-/import-cwd-2.1.0.tgz", + "integrity": "sha1-qmzzbnInYShcs3HsZRn1PiQ1sKk=", + "dependencies": { + "import-from": "^2.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/import-fresh": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-2.0.0.tgz", + "integrity": "sha1-2BNVwVYS04bGH53dOSLUMEgipUY=", + "dependencies": { + "caller-path": "^2.0.0", + "resolve-from": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/import-from": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/import-from/-/import-from-2.1.0.tgz", + "integrity": "sha1-M1238qev/VOqpHHUuAId7ja387E=", + "dependencies": { + "resolve-from": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/import-local": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/import-local/-/import-local-2.0.0.tgz", + "integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==", + "dependencies": { + "pkg-dir": "^3.0.0", + "resolve-cwd": "^2.0.0" + }, + "bin": { + "import-local-fixture": "fixtures/cli.js" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/imurmurhash": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", + "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=", + "engines": { + "node": ">=0.8.19" + } + }, + "node_modules/indent-string": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-4.0.0.tgz", + "integrity": "sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/indexes-of": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/indexes-of/-/indexes-of-1.0.1.tgz", + "integrity": "sha1-8w9xbI4r00bHtn0985FVZqfAVgc=" + }, + "node_modules/infer-owner": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/infer-owner/-/infer-owner-1.0.4.tgz", + "integrity": "sha512-IClj+Xz94+d7irH5qRyfJonOdfTzuDaifE6ZPWfx0N0+/ATZCbuTPq2prFl526urkQd90WyUKIh1DfBQ2hMz9A==" + }, + "node_modules/inflight": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", + "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=", + "dependencies": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" + }, + "node_modules/ini": { + "version": "1.3.5", + "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz", + "integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==", + "engines": { + "node": "*" + } + }, + "node_modules/inquirer": { + "version": "7.1.0", + "resolved": "https://registry.npmjs.org/inquirer/-/inquirer-7.1.0.tgz", + "integrity": "sha512-5fJMWEmikSYu0nv/flMc475MhGbB7TSPd/2IpFV4I4rMklboCH2rQjYY5kKiYGHqUF9gvaambupcJFFG9dvReg==", + "dependencies": { + "ansi-escapes": "^4.2.1", + "chalk": "^3.0.0", + "cli-cursor": "^3.1.0", + "cli-width": "^2.0.0", + "external-editor": "^3.0.3", + "figures": "^3.0.0", + "lodash": "^4.17.15", + "mute-stream": "0.0.8", + "run-async": "^2.4.0", + "rxjs": "^6.5.3", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0", + "through": "^2.3.6" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/inquirer/node_modules/ansi-regex": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", + "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/inquirer/node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/inquirer/node_modules/chalk": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", + "integrity": "sha512-4D3B6Wf41KOYRFdszmDqMCGq5VV/uMAB273JILmO+3jAlh8X4qDtdtgCR3fxtbLEMzSx22QdhnDcJvu2u1fVwg==", + "dependencies": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/inquirer/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/inquirer/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" + }, + "node_modules/inquirer/node_modules/has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/inquirer/node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/inquirer/node_modules/string-width": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.0.tgz", + "integrity": "sha512-zUz5JD+tgqtuDjMhwIg5uFVV3dtqZ9yQJlZVfq4I01/K5Paj5UHj7VyrQOJvzawSVlKpObApbfD0Ed6yJc+1eg==", + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/inquirer/node_modules/strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dependencies": { + "ansi-regex": "^5.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/inquirer/node_modules/supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dependencies": { + "has-flag": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/internal-ip": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/internal-ip/-/internal-ip-4.3.0.tgz", + "integrity": "sha512-S1zBo1D6zcsyuC6PMmY5+55YMILQ9av8lotMx447Bq6SAgo/sDK6y6uUKmuYhW7eacnIhFfsPmCNYdDzsnnDCg==", + "dependencies": { + "default-gateway": "^4.2.0", + "ipaddr.js": "^1.9.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/invariant": { + "version": "2.2.4", + "resolved": "https://registry.npmjs.org/invariant/-/invariant-2.2.4.tgz", + "integrity": "sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==", + "dependencies": { + "loose-envify": "^1.0.0" + } + }, + "node_modules/invert-kv": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-2.0.0.tgz", + "integrity": "sha512-wPVv/y/QQ/Uiirj/vh3oP+1Ww+AWehmi1g5fFWGPF6IpCBCDVrhgHRMvrLfdYcwDh3QJbGXDW4JAuzxElLSqKA==", + "engines": { + "node": ">=4" + } + }, + "node_modules/ip": { + "version": "1.1.5", + "resolved": "https://registry.npmjs.org/ip/-/ip-1.1.5.tgz", + "integrity": "sha1-vd7XARQpCCjAoDnnLvJfWq7ENUo=" + }, + "node_modules/ip-regex": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/ip-regex/-/ip-regex-2.1.0.tgz", + "integrity": "sha1-+ni/XS5pE8kRzp+BnuUUa7bYROk=", + "engines": { + "node": ">=4" + } + }, + "node_modules/ipaddr.js": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz", + "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/is-absolute-url": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-absolute-url/-/is-absolute-url-2.1.0.tgz", + "integrity": "sha1-UFMN+4T8yap9vnhS6Do3uTufKqY=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-accessor-descriptor": { + "version": "0.1.6", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", + "integrity": "sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-accessor-descriptor/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-arguments": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/is-arguments/-/is-arguments-1.0.4.tgz", + "integrity": "sha512-xPh0Rmt8NE65sNzvyUmWgI1tz3mKq74lGA0mL8LYZcoIzKOzDh6HmrYm3d18k60nHerC8A9Km8kYu87zfSFnLA==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-arrayish": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/is-arrayish/-/is-arrayish-0.2.1.tgz", + "integrity": "sha1-d8mYQFJ6qOyxqLppe4BkWnqSap0=" + }, + "node_modules/is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dependencies": { + "binary-extensions": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-buffer": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" + }, + "node_modules/is-callable": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.2.2.tgz", + "integrity": "sha512-dnMqspv5nU3LoewK2N/y7KLtxtakvTuaCsU9FU50/QDmdbHNy/4/JuRtMHqRU22o3q+W89YQndQEeCVwK+3qrA==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-color-stop": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-color-stop/-/is-color-stop-1.1.0.tgz", + "integrity": "sha1-z/9HGu5N1cnhWFmPvhKWe1za00U=", + "dependencies": { + "css-color-names": "^0.0.4", + "hex-color-regex": "^1.1.0", + "hsl-regex": "^1.0.0", + "hsla-regex": "^1.0.0", + "rgb-regex": "^1.0.1", + "rgba-regex": "^1.0.0" + } + }, + "node_modules/is-core-module": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.1.0.tgz", + "integrity": "sha512-YcV7BgVMRFRua2FqQzKtTDMz8iCuLEyGKjr70q8Zm1yy2qKcurbFEd79PAdHV77oL3NrAaOVQIbMmiHQCHB7ZA==", + "dependencies": { + "has": "^1.0.3" + } + }, + "node_modules/is-data-descriptor": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", + "integrity": "sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-data-descriptor/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-date-object": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.2.tgz", + "integrity": "sha512-USlDT524woQ08aoZFzh3/Z6ch9Y/EWXEHQ/AaRN0SkKq4t2Jw2R2339tSXmwuVoY7LLlBCbOIlx2myP/L5zk0g==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-descriptor": { + "version": "0.1.6", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz", + "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==", + "dependencies": { + "is-accessor-descriptor": "^0.1.6", + "is-data-descriptor": "^0.1.4", + "kind-of": "^5.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-descriptor/node_modules/kind-of": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", + "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-directory": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/is-directory/-/is-directory-0.3.1.tgz", + "integrity": "sha1-YTObbyR1/Hcv2cnYP1yFddwVSuE=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-docker": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-docker/-/is-docker-2.1.1.tgz", + "integrity": "sha512-ZOoqiXfEwtGknTiuDEy8pN2CfE3TxMHprvNer1mXiqwkOT77Rw3YVrUQ52EqAOU3QAWDQ+bQdx7HJzrv7LS2Hw==", + "bin": { + "is-docker": "cli.js" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-extendable": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", + "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-fullwidth-code-point": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", + "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=", + "engines": { + "node": ">=4" + } + }, + "node_modules/is-glob": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.1.tgz", + "integrity": "sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==", + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-interactive": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-interactive/-/is-interactive-1.0.0.tgz", + "integrity": "sha512-2HvIEKRoqS62guEC+qBjpvRubdX910WCMuJTZ+I9yvqKU2/12eSL549HMwtabb4oupdj2sMP50k+XJfB/8JE6w==", + "engines": { + "node": ">=8" + } + }, + "node_modules/is-negative-zero": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.0.tgz", + "integrity": "sha1-lVOxIbD6wohp2p7UWeIMdUN4hGE=", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/is-obj": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-2.0.0.tgz", + "integrity": "sha512-drqDG3cbczxxEJRoOXcOjtdp1J/lyp1mNn0xaznRs8+muBhgQcrnbspox5X5fOw0HnMnbfDzvnEMEtqDEJEo8w==", + "engines": { + "node": ">=8" + } + }, + "node_modules/is-path-cwd": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/is-path-cwd/-/is-path-cwd-2.2.0.tgz", + "integrity": "sha512-w942bTcih8fdJPJmQHFzkS76NEP8Kzzvmw92cXsazb8intwLqPibPPdXf4ANdKV3rYMuuQYGIWtvz9JilB3NFQ==", + "engines": { + "node": ">=6" + } + }, + "node_modules/is-path-in-cwd": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-path-in-cwd/-/is-path-in-cwd-2.1.0.tgz", + "integrity": "sha512-rNocXHgipO+rvnP6dk3zI20RpOtrAM/kzbB258Uw5BWr3TpXi861yzjo16Dn4hUox07iw5AyeMLHWsujkjzvRQ==", + "dependencies": { + "is-path-inside": "^2.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/is-path-inside": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-2.1.0.tgz", + "integrity": "sha512-wiyhTzfDWsvwAW53OBWF5zuvaOGlZ6PwYxAbPVDhpm+gM09xKQGjBq/8uYN12aDvMxnAnq3dxTyoSoRNmg5YFg==", + "dependencies": { + "path-is-inside": "^1.0.2" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/is-plain-obj": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-plain-obj/-/is-plain-obj-1.1.0.tgz", + "integrity": "sha1-caUMhCnfync8kqOQpKA7OfzVHT4=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-plain-object": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz", + "integrity": "sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==", + "dependencies": { + "isobject": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-regex": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.1.1.tgz", + "integrity": "sha512-1+QkEcxiLlB7VEyFtyBg94e08OAsvq7FUBgApTq/w2ymCLyKJgDPsybBENVtA7XCQEgEXxKPonG+mvYRxh/LIg==", + "dependencies": { + "has-symbols": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-resolvable": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-resolvable/-/is-resolvable-1.1.0.tgz", + "integrity": "sha512-qgDYXFSR5WvEfuS5dMj6oTMEbrrSaM0CrFk2Yiq/gXnBvD9pMa2jGXxyhGLfvhZpuMZe18CJpFxAt3CRs42NMg==" + }, + "node_modules/is-stream": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz", + "integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-svg": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-svg/-/is-svg-3.0.0.tgz", + "integrity": "sha512-gi4iHK53LR2ujhLVVj+37Ykh9GLqYHX6JOVXbLAucaG/Cqw9xwdFOjDM2qeifLs1sF1npXXFvDu0r5HNgCMrzQ==", + "dependencies": { + "html-comment-regex": "^1.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/is-symbol": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.3.tgz", + "integrity": "sha512-OwijhaRSgqvhm/0ZdAcXNZt9lYdKFpcRDT5ULUuYXPoT794UNOdU+gpT6Rzo7b4V2HUl/op6GqY894AZwv9faQ==", + "dependencies": { + "has-symbols": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-typedarray": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-typedarray/-/is-typedarray-1.0.0.tgz", + "integrity": "sha1-5HnICFjfDBsR3dppQPlgEfzaSpo=" + }, + "node_modules/is-windows": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz", + "integrity": "sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-wsl": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-2.2.0.tgz", + "integrity": "sha512-fKzAra0rGJUUBwGBgNkHZuToZcn+TtXHpeCgmkMJMMYx1sQDYaCSyjJBSCa2nH1DGm7s3n1oBnohoVTBaN7Lww==", + "dependencies": { + "is-docker": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/isarray": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz", + "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=" + }, + "node_modules/isexe": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", + "integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA=" + }, + "node_modules/isobject": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/isobject/-/isobject-3.0.1.tgz", + "integrity": "sha1-TkMekrEalzFjaqH5yNHMvP2reN8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/isstream": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/isstream/-/isstream-0.1.2.tgz", + "integrity": "sha1-R+Y/evVa+m+S4VAOaQ64uFKcCZo=" + }, + "node_modules/istanbul-lib-coverage": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/istanbul-lib-coverage/-/istanbul-lib-coverage-3.0.0.tgz", + "integrity": "sha512-UiUIqxMgRDET6eR+o5HbfRYP1l0hqkWOs7vNxC/mggutCMUIhWMm8gAHb8tHlyfD3/l6rlgNA5cKdDzEAf6hEg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/istanbul-lib-instrument": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/istanbul-lib-instrument/-/istanbul-lib-instrument-4.0.3.tgz", + "integrity": "sha512-BXgQl9kf4WTCPCCpmFGoJkz/+uhvm7h7PFKUYxh7qarQd3ER33vHG//qaE8eN25l07YqZPpHXU9I09l/RD5aGQ==", + "dependencies": { + "@babel/core": "^7.7.5", + "@istanbuljs/schema": "^0.1.2", + "istanbul-lib-coverage": "^3.0.0", + "semver": "^6.3.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/istanbul-lib-instrument/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/jest-worker": { + "version": "25.1.0", + "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-25.1.0.tgz", + "integrity": "sha512-ZHhHtlxOWSxCoNOKHGbiLzXnl42ga9CxDr27H36Qn+15pQZd3R/F24jrmjDelw9j/iHUIWMWs08/u2QN50HHOg==", + "dependencies": { + "merge-stream": "^2.0.0", + "supports-color": "^7.0.0" + }, + "engines": { + "node": ">= 8.3" + } + }, + "node_modules/jest-worker/node_modules/has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/jest-worker/node_modules/supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dependencies": { + "has-flag": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/js-tokens": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", + "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==" + }, + "node_modules/js-yaml": { + "version": "3.14.0", + "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-3.14.0.tgz", + "integrity": "sha512-/4IbIeHcD9VMHFqDR/gQ7EdZdLimOvW2DdcxFjdyyZ9NsbS+ccrXqVWDtab/lRl5AlUqmpBx8EhPaWR+OtY17A==", + "dependencies": { + "argparse": "^1.0.7", + "esprima": "^4.0.0" + }, + "bin": { + "js-yaml": "bin/js-yaml.js" + } + }, + "node_modules/jsbn": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/jsbn/-/jsbn-0.1.1.tgz", + "integrity": "sha1-peZUwuWi3rXyAdls77yoDA7y9RM=" + }, + "node_modules/jsesc": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", + "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", + "bin": { + "jsesc": "bin/jsesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/json-parse-better-errors": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/json-parse-better-errors/-/json-parse-better-errors-1.0.2.tgz", + "integrity": "sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw==" + }, + "node_modules/json-parse-even-better-errors": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/json-parse-even-better-errors/-/json-parse-even-better-errors-2.3.1.tgz", + "integrity": "sha512-xyFwyhro/JEof6Ghe2iz2NcXoj2sloNsWr/XsERDK/oiPCfaNhl5ONfp+jQdAZRQQ0IJWNzH9zIZF7li91kh2w==" + }, + "node_modules/json-schema": { + "version": "0.2.3", + "resolved": "https://registry.npmjs.org/json-schema/-/json-schema-0.2.3.tgz", + "integrity": "sha1-tIDIkuWaLwWVTOcnvT8qTogvnhM=" + }, + "node_modules/json-schema-traverse": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz", + "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==" + }, + "node_modules/json-stringify-safe": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz", + "integrity": "sha1-Epai1Y/UXxmg9s4B1lcB4sc1tus=" + }, + "node_modules/json3": { + "version": "3.3.3", + "resolved": "https://registry.npmjs.org/json3/-/json3-3.3.3.tgz", + "integrity": "sha512-c7/8mbUsKigAbLkD5B010BK4D9LZm7A1pNItkEwiUZRpIN66exu/e7YQWysGun+TRKaJp8MhemM+VkfWv42aCA==" + }, + "node_modules/json5": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/json5/-/json5-2.1.3.tgz", + "integrity": "sha512-KXPvOm8K9IJKFM0bmdn8QXh7udDh1g/giieX0NLCaMnb4hEiVFqnop2ImTXCc5e0/oHz3LTqmHGtExn5hfMkOA==", + "dependencies": { + "minimist": "^1.2.5" + }, + "bin": { + "json5": "lib/cli.js" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/jsonfile": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-4.0.0.tgz", + "integrity": "sha1-h3Gq4HmbZAdrdmQPygWPnBDjPss=", + "dependencies": { + "graceful-fs": "^4.1.6" + } + }, + "node_modules/jsonparse": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/jsonparse/-/jsonparse-1.3.1.tgz", + "integrity": "sha1-P02uSpH6wxX3EGL4UhzCOfE2YoA=", + "engines": [ + "node >= 0.2.0" + ] + }, + "node_modules/JSONStream": { + "version": "1.3.5", + "resolved": "https://registry.npmjs.org/JSONStream/-/JSONStream-1.3.5.tgz", + "integrity": "sha512-E+iruNOY8VV9s4JEbe1aNEm6MiszPRr/UfcHMz0TQh1BXSxHK+ASV1R6W4HpjBhSeS+54PIsAMCBmwD06LLsqQ==", + "dependencies": { + "jsonparse": "^1.2.0", + "through": ">=2.2.7 <3" + }, + "bin": { + "JSONStream": "bin.js" + }, + "engines": { + "node": "*" + } + }, + "node_modules/jsprim": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.4.1.tgz", + "integrity": "sha1-MT5mvB5cwG5Di8G3SZwuXFastqI=", + "engines": [ + "node >=0.6.0" + ], + "dependencies": { + "assert-plus": "1.0.0", + "extsprintf": "1.3.0", + "json-schema": "0.2.3", + "verror": "1.10.0" + } + }, + "node_modules/jwt-decode": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/jwt-decode/-/jwt-decode-3.1.2.tgz", + "integrity": "sha512-UfpWE/VZn0iP50d8cz9NrZLM9lSWhcJ+0Gt/nm4by88UL+J1SiKN8/5dkjMmbEzwL2CAe+67GsegCbIKtbp75A==" + }, + "node_modules/karma-source-map-support": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/karma-source-map-support/-/karma-source-map-support-1.4.0.tgz", + "integrity": "sha512-RsBECncGO17KAoJCYXjv+ckIz+Ii9NCi+9enk+rq6XC81ezYkb4/RHE6CTXdA7IOJqoF3wcaLfVG0CPmE5ca6A==", + "dependencies": { + "source-map-support": "^0.5.5" + } + }, + "node_modules/killable": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/killable/-/killable-1.0.1.tgz", + "integrity": "sha512-LzqtLKlUwirEUyl/nicirVmNiPvYs7l5n8wOPP7fyJVpUPkvCnW/vuiXGpylGUlnPDnB7311rARzAt3Mhswpjg==" + }, + "node_modules/kind-of": { + "version": "6.0.3", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.3.tgz", + "integrity": "sha512-dcS1ul+9tmeD95T+x28/ehLgd9mENa3LsvDTtzm3vyBEO7RPptvAD+t44WVXaUjTBRcrpFeFlC8WCruUR456hw==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/lcid": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/lcid/-/lcid-2.0.0.tgz", + "integrity": "sha512-avPEb8P8EGnwXKClwsNUgryVjllcRqtMYa49NTsbQagYuT1DcXnl1915oxWjoyGrXR6zH/Y0Zc96xWsPcoDKeA==", + "dependencies": { + "invert-kv": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/less": { + "version": "3.11.1", + "resolved": "https://registry.npmjs.org/less/-/less-3.11.1.tgz", + "integrity": "sha512-tlWX341RECuTOvoDIvtFqXsKj072hm3+9ymRBe76/mD6O5ZZecnlAOVDlWAleF2+aohFrxNidXhv2773f6kY7g==", + "dependencies": { + "clone": "^2.1.2", + "errno": "^0.1.1", + "graceful-fs": "^4.1.2", + "mime": "^1.4.1", + "mkdirp": "^0.5.0", + "request": "^2.83.0", + "tslib": "^1.10.0" + }, + "bin": { + "lessc": "bin/lessc" + }, + "engines": { + "node": ">=6" + }, + "optionalDependencies": { + "image-size": "~0.5.0", + "promise": "^7.1.1", + "source-map": "~0.6.0" + } + }, + "node_modules/less-loader": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/less-loader/-/less-loader-5.0.0.tgz", + "integrity": "sha512-bquCU89mO/yWLaUq0Clk7qCsKhsF/TZpJUzETRvJa9KSVEL9SO3ovCvdEHISBhrC81OwC8QSVX7E0bzElZj9cg==", + "dependencies": { + "clone": "^2.1.1", + "loader-utils": "^1.1.0", + "pify": "^4.0.1" + }, + "engines": { + "node": ">= 4.8.0" + } + }, + "node_modules/less-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/less-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/less/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/leven": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/leven/-/leven-3.1.0.tgz", + "integrity": "sha512-qsda+H8jTaUaN/x5vzW2rzc+8Rw4TAQ/4KjB46IwK5VH+IlVeeeje/EoZRpiXvIqjFgK84QffqPztGI3VBLG1A==", + "engines": { + "node": ">=6" + } + }, + "node_modules/levenary": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/levenary/-/levenary-1.1.1.tgz", + "integrity": "sha512-mkAdOIt79FD6irqjYSs4rdbnlT5vRonMEvBVPVb3XmevfS8kgRXwfes0dhPdEtzTWD/1eNE/Bm/G1iRt6DcnQQ==", + "dependencies": { + "leven": "^3.1.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/license-webpack-plugin": { + "version": "2.1.4", + "resolved": "https://registry.npmjs.org/license-webpack-plugin/-/license-webpack-plugin-2.1.4.tgz", + "integrity": "sha512-1Xq72fmPbTg5KofXs+yI5L4QqPFjQ6mZxoeI6D7gfiEDOtaEIk6PGrdLaej90bpDqKNHNxlQ/MW4tMAL6xMPJQ==", + "dependencies": { + "@types/webpack-sources": "^0.1.5", + "webpack-sources": "^1.2.0" + } + }, + "node_modules/loader-runner": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.4.0.tgz", + "integrity": "sha512-Jsmr89RcXGIwivFY21FcRrisYZfvLMTWx5kOLc+JTxtpBOG6xML0vzbc6SEQG2FO9/4Fc3wW4LVcB5DmGflaRw==", + "engines": { + "node": ">=4.3.0 <5.0.0 || >=5.10" + } + }, + "node_modules/loader-utils": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-2.0.0.tgz", + "integrity": "sha512-rP4F0h2RaWSvPEkD7BLDFQnvSf+nK+wr3ESUjNTyAGobqrijmW92zc+SO6d4p4B1wh7+B/Jg1mkQe5NYUEHtHQ==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^2.1.2" + }, + "engines": { + "node": ">=8.9.0" + } + }, + "node_modules/locate-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", + "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", + "dependencies": { + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/lodash": { + "version": "4.17.15", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.15.tgz", + "integrity": "sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A==" + }, + "node_modules/lodash.clonedeep": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/lodash.clonedeep/-/lodash.clonedeep-4.5.0.tgz", + "integrity": "sha1-4j8/nE+Pvd6HJSnBBxhXoIblzO8=" + }, + "node_modules/lodash.memoize": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/lodash.memoize/-/lodash.memoize-4.1.2.tgz", + "integrity": "sha1-vMbEmkKihA7Zl/Mj6tpezRguC/4=" + }, + "node_modules/lodash.uniq": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/lodash.uniq/-/lodash.uniq-4.5.0.tgz", + "integrity": "sha1-0CJTc662Uq3BvILklFM5qEJ1R3M=" + }, + "node_modules/log-symbols": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/log-symbols/-/log-symbols-3.0.0.tgz", + "integrity": "sha512-dSkNGuI7iG3mfvDzUuYZyvk5dD9ocYCYzNU6CYDE6+Xqd+gwme6Z00NS3dUh8mq/73HaEtT7m6W+yUPtU6BZnQ==", + "dependencies": { + "chalk": "^2.4.2" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/loglevel": { + "version": "1.6.8", + "resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.6.8.tgz", + "integrity": "sha512-bsU7+gc9AJ2SqpzxwU3+1fedl8zAntbtC5XYlt3s2j1hJcn2PsXSmgN8TaLG/J1/2mod4+cE/3vNL70/c1RNCA==", + "engines": { + "node": ">= 0.6.0" + } + }, + "node_modules/loose-envify": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz", + "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==", + "dependencies": { + "js-tokens": "^3.0.0 || ^4.0.0" + }, + "bin": { + "loose-envify": "cli.js" + } + }, + "node_modules/lru-cache": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", + "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", + "dependencies": { + "yallist": "^3.0.2" + } + }, + "node_modules/lru-cache/node_modules/yallist": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", + "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==" + }, + "node_modules/magic-string": { + "version": "0.25.7", + "resolved": "https://registry.npmjs.org/magic-string/-/magic-string-0.25.7.tgz", + "integrity": "sha512-4CrMT5DOHTDk4HYDlzmwu4FVCcIYI8gauveasrdCu2IKIFOJ3f0v/8MDGJCDL9oD2ppz/Av1b0Nj345H9M+XIA==", + "dependencies": { + "sourcemap-codec": "^1.4.4" + } + }, + "node_modules/make-dir": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-2.1.0.tgz", + "integrity": "sha512-LS9X+dc8KLxXCb8dni79fLIIUA5VyZoyjSMCwTluaXA0o27cCK0bhXkpgw+sTXVpPy/lSO57ilRixqk0vDmtRA==", + "dependencies": { + "pify": "^4.0.1", + "semver": "^5.6.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/make-dir/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/make-error": { + "version": "1.3.6", + "resolved": "https://registry.npmjs.org/make-error/-/make-error-1.3.6.tgz", + "integrity": "sha512-s8UhlNe7vPKomQhC1qFelMokr/Sc3AgNbso3n74mVPA5LTZwkB9NlXf4XPamLxJE8h0gh73rM94xvwRT2CVInw==" + }, + "node_modules/make-fetch-happen": { + "version": "5.0.2", + "resolved": "https://registry.npmjs.org/make-fetch-happen/-/make-fetch-happen-5.0.2.tgz", + "integrity": "sha512-07JHC0r1ykIoruKO8ifMXu+xEU8qOXDFETylktdug6vJDACnP+HKevOu3PXyNPzFyTSlz8vrBYlBO1JZRe8Cag==", + "dependencies": { + "agentkeepalive": "^3.4.1", + "cacache": "^12.0.0", + "http-cache-semantics": "^3.8.1", + "http-proxy-agent": "^2.1.0", + "https-proxy-agent": "^2.2.3", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "node-fetch-npm": "^2.0.2", + "promise-retry": "^1.1.1", + "socks-proxy-agent": "^4.0.0", + "ssri": "^6.0.0" + } + }, + "node_modules/make-fetch-happen/node_modules/cacache": { + "version": "12.0.4", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.4.tgz", + "integrity": "sha512-a0tMB40oefvuInr4Cwb3GerbL9xTj1D5yg0T5xrjGCGyfvbxseIXX7BAO/u/hIXdafzOI5JC3wDwHyf24buOAQ==", + "dependencies": { + "bluebird": "^3.5.5", + "chownr": "^1.1.1", + "figgy-pudding": "^3.5.1", + "glob": "^7.1.4", + "graceful-fs": "^4.1.15", + "infer-owner": "^1.0.3", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.3", + "ssri": "^6.0.1", + "unique-filename": "^1.1.1", + "y18n": "^4.0.0" + } + }, + "node_modules/make-fetch-happen/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/make-fetch-happen/node_modules/ssri": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/ssri/-/ssri-6.0.1.tgz", + "integrity": "sha512-3Wge10hNcT1Kur4PDFwEieXSCMCJs/7WvSACcrMYrNp+b8kDL1/0wJch5Ni2WrtwEa2IO8OsVfeKIciKCDx/QA==", + "dependencies": { + "figgy-pudding": "^3.5.1" + } + }, + "node_modules/mamacro": { + "version": "0.0.3", + "resolved": "https://registry.npmjs.org/mamacro/-/mamacro-0.0.3.tgz", + "integrity": "sha512-qMEwh+UujcQ+kbz3T6V+wAmO2U8veoq2w+3wY8MquqwVA3jChfwY+Tk52GZKDfACEPjuZ7r2oJLejwpt8jtwTA==" + }, + "node_modules/map-age-cleaner": { + "version": "0.1.3", + "resolved": "https://registry.npmjs.org/map-age-cleaner/-/map-age-cleaner-0.1.3.tgz", + "integrity": "sha512-bJzx6nMoP6PDLPBFmg7+xRKeFZvFboMrGlxmNj9ClvX53KrmvM5bXFXEWjbz4cz1AFn+jWJ9z/DJSz7hrs0w3w==", + "dependencies": { + "p-defer": "^1.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/map-cache": { + "version": "0.2.2", + "resolved": "https://registry.npmjs.org/map-cache/-/map-cache-0.2.2.tgz", + "integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/map-visit": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz", + "integrity": "sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=", + "dependencies": { + "object-visit": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/md5.js": { + "version": "1.3.5", + "resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.5.tgz", + "integrity": "sha512-xitP+WxNPcTTOgnTJcrhM0xvdPepipPSf3I8EIpGKeFLjt3PlJLIDG3u8EX53ZIubkb+5U2+3rELYpEhHhzdkg==", + "dependencies": { + "hash-base": "^3.0.0", + "inherits": "^2.0.1", + "safe-buffer": "^5.1.2" + } + }, + "node_modules/mdn-data": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/mdn-data/-/mdn-data-2.0.4.tgz", + "integrity": "sha512-iV3XNKw06j5Q7mi6h+9vbx23Tv7JkjEVgKHW4pimwyDGWm0OIQntJJ+u1C6mg6mK1EaTv42XQ7w76yuzH7M2cA==" + }, + "node_modules/media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mem": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/mem/-/mem-4.3.0.tgz", + "integrity": "sha512-qX2bG48pTqYRVmDB37rn/6PT7LcR8T7oAX3bf99u1Tt1nzxYfxkgqDwUwolPlXweM0XzBOBFzSx4kfp7KP1s/w==", + "dependencies": { + "map-age-cleaner": "^0.1.1", + "mimic-fn": "^2.0.0", + "p-is-promise": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/memory-fs": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.5.0.tgz", + "integrity": "sha512-jA0rdU5KoQMC0e6ppoNRtpp6vjFq6+NY7r8hywnC7V+1Xj/MtHwGIbB1QaK/dunyjWteJzmkpd7ooeWg10T7GA==", + "dependencies": { + "errno": "^0.1.3", + "readable-stream": "^2.0.1" + }, + "engines": { + "node": ">=4.3.0 <5.0.0 || >=5.10" + } + }, + "node_modules/merge-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=" + }, + "node_modules/merge-source-map": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/merge-source-map/-/merge-source-map-1.1.0.tgz", + "integrity": "sha512-Qkcp7P2ygktpMPh2mCQZaf3jhN6D3Z/qVZHSdWvQ+2Ef5HgRAPBO57A77+ENm0CPx2+1Ce/MYKi3ymqdfuqibw==", + "dependencies": { + "source-map": "^0.6.1" + } + }, + "node_modules/merge-source-map/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/merge-stream": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/merge-stream/-/merge-stream-2.0.0.tgz", + "integrity": "sha512-abv/qOcuPfk3URPfDzmZU1LKmuw8kT+0nIHvKrKgFrwifol/doWcdA4ZqsWQ8ENrFKkd67Mfpo/LovbIUsbt3w==" + }, + "node_modules/methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/micromatch": { + "version": "3.1.10", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", + "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", + "dependencies": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "braces": "^2.3.1", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "extglob": "^2.0.4", + "fragment-cache": "^0.2.1", + "kind-of": "^6.0.2", + "nanomatch": "^1.2.9", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/micromatch/node_modules/braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "dependencies": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/micromatch/node_modules/braces/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/micromatch/node_modules/fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "dependencies": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/micromatch/node_modules/fill-range/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/micromatch/node_modules/is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/micromatch/node_modules/is-number/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/micromatch/node_modules/to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "dependencies": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/miller-rabin": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz", + "integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==", + "dependencies": { + "bn.js": "^4.0.0", + "brorand": "^1.0.1" + }, + "bin": { + "miller-rabin": "bin/miller-rabin" + } + }, + "node_modules/miller-rabin/node_modules/bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==" + }, + "node_modules/mime": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/mime-db": { + "version": "1.44.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.44.0.tgz", + "integrity": "sha512-/NOTfLrsPBVeH7YtFPgsVWveuL+4SjjYxaQ1xtM1KMFj7HdxlBlxeyNLzhyJVx7r4rZGJAZ/6lkKCitSc/Nmpg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.27", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.27.tgz", + "integrity": "sha512-JIhqnCasI9yD+SsmkquHBxTSEuZdQX5BuQnS2Vc7puQQQ+8yiP5AY5uWhpdv4YL4VM5c6iliiYWPgJ/nJQLp7w==", + "dependencies": { + "mime-db": "1.44.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mimic-fn": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/mimic-fn/-/mimic-fn-2.1.0.tgz", + "integrity": "sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/mini-css-extract-plugin": { + "version": "0.9.0", + "resolved": "https://registry.npmjs.org/mini-css-extract-plugin/-/mini-css-extract-plugin-0.9.0.tgz", + "integrity": "sha512-lp3GeY7ygcgAmVIcRPBVhIkf8Us7FZjA+ILpal44qLdSu11wmjKQ3d9k15lfD7pO4esu9eUIAW7qiYIBppv40A==", + "dependencies": { + "loader-utils": "^1.1.0", + "normalize-url": "1.9.1", + "schema-utils": "^1.0.0", + "webpack-sources": "^1.1.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/mini-css-extract-plugin/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/mini-css-extract-plugin/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/mini-css-extract-plugin/node_modules/normalize-url": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/normalize-url/-/normalize-url-1.9.1.tgz", + "integrity": "sha1-LMDWazHqIwNkWENuNiDYWVTGbDw=", + "dependencies": { + "object-assign": "^4.0.1", + "prepend-http": "^1.0.0", + "query-string": "^4.1.0", + "sort-keys": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/mini-css-extract-plugin/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/minimalistic-assert": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", + "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==" + }, + "node_modules/minimalistic-crypto-utils": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz", + "integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo=" + }, + "node_modules/minimatch": { + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz", + "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==", + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/minimist": { + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", + "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==" + }, + "node_modules/minipass": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-3.1.3.tgz", + "integrity": "sha512-Mgd2GdMVzY+x3IJ+oHnVM+KG3lA5c8tnabyJKmHSaG2kAGpudxuOf8ToDkhumF7UzME7DecbQE9uOZhNm7PuJg==", + "dependencies": { + "yallist": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/minipass-collect": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/minipass-collect/-/minipass-collect-1.0.2.tgz", + "integrity": "sha512-6T6lH0H8OG9kITm/Jm6tdooIbogG9e0tLgpY6mphXSm/A9u8Nq1ryBG+Qspiub9LjWlBPsPS3tWQ/Botq4FdxA==", + "dependencies": { + "minipass": "^3.0.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/minipass-flush": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/minipass-flush/-/minipass-flush-1.0.5.tgz", + "integrity": "sha512-JmQSYYpPUqX5Jyn1mXaRwOda1uQ8HP5KAT/oDSLCzt1BYRhQU0/hDtsB1ufZfEEzMZ9aAVmsBw8+FWsIXlClWw==", + "dependencies": { + "minipass": "^3.0.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/minipass-pipeline": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/minipass-pipeline/-/minipass-pipeline-1.2.4.tgz", + "integrity": "sha512-xuIq7cIOt09RPRJ19gdi4b+RiNvDFYe5JH+ggNvBqGqpQXcru3PcRmOZuHBKWK1Txf9+cQ+HMVN4d6z46LZP7A==", + "dependencies": { + "minipass": "^3.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/minizlib": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/minizlib/-/minizlib-2.1.2.tgz", + "integrity": "sha512-bAxsR8BVfj60DWXHE3u30oHzfl4G7khkSuPW+qvpd7jFRHm7dLxOjUk1EHACJ/hxLY8phGJ0YhYHZo7jil7Qdg==", + "dependencies": { + "minipass": "^3.0.0", + "yallist": "^4.0.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/mississippi": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/mississippi/-/mississippi-3.0.0.tgz", + "integrity": "sha512-x471SsVjUtBRtcvd4BzKE9kFC+/2TeWgKCgw0bZcw1b9l2X3QX5vCWgF+KaZaYm87Ss//rHnWryupDrgLvmSkA==", + "dependencies": { + "concat-stream": "^1.5.0", + "duplexify": "^3.4.2", + "end-of-stream": "^1.1.0", + "flush-write-stream": "^1.0.0", + "from2": "^2.1.0", + "parallel-transform": "^1.1.0", + "pump": "^3.0.0", + "pumpify": "^1.3.3", + "stream-each": "^1.1.0", + "through2": "^2.0.0" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/mixin-deep": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/mixin-deep/-/mixin-deep-1.3.2.tgz", + "integrity": "sha512-WRoDn//mXBiJ1H40rqa3vH0toePwSsGb45iInWlTySa+Uu4k3tYUSxa2v1KqAiLtvlrSzaExqS1gtk96A9zvEA==", + "dependencies": { + "for-in": "^1.0.2", + "is-extendable": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/mixin-deep/node_modules/is-extendable": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz", + "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==", + "dependencies": { + "is-plain-object": "^2.0.4" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/mkdirp": { + "version": "0.5.5", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.5.tgz", + "integrity": "sha512-NKmAlESf6jMGym1++R0Ra7wvhV+wFW63FaSOFPwRahvea0gMUcGUhVeAg/0BC0wiv9ih5NYPB1Wn1UEI1/L+xQ==", + "dependencies": { + "minimist": "^1.2.5" + }, + "bin": { + "mkdirp": "bin/cmd.js" + } + }, + "node_modules/move-concurrently": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz", + "integrity": "sha1-viwAX9oy4LKa8fBdfEszIUxwH5I=", + "dependencies": { + "aproba": "^1.1.1", + "copy-concurrently": "^1.0.0", + "fs-write-stream-atomic": "^1.0.8", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.3" + } + }, + "node_modules/move-concurrently/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==" + }, + "node_modules/multicast-dns": { + "version": "6.2.3", + "resolved": "https://registry.npmjs.org/multicast-dns/-/multicast-dns-6.2.3.tgz", + "integrity": "sha512-ji6J5enbMyGRHIAkAOu3WdV8nggqviKCEKtXcOqfphZZtQrmHKycfynJ2V7eVPUA4NhJ6V7Wf4TmGbTwKE9B6g==", + "dependencies": { + "dns-packet": "^1.3.1", + "thunky": "^1.0.2" + }, + "bin": { + "multicast-dns": "cli.js" + } + }, + "node_modules/multicast-dns-service-types": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/multicast-dns-service-types/-/multicast-dns-service-types-1.1.0.tgz", + "integrity": "sha1-iZ8R2WhuXgXLkbNdXw5jt3PPyQE=" + }, + "node_modules/mute-stream": { + "version": "0.0.8", + "resolved": "https://registry.npmjs.org/mute-stream/-/mute-stream-0.0.8.tgz", + "integrity": "sha512-nnbWWOkoWyUsTjKrhgD0dcz22mdkSnpYqbEjIm2nhwhuxlSkpywJmBo8h0ZqJdkp73mb90SssHkN4rsRaBAfAA==" + }, + "node_modules/nanomatch": { + "version": "1.2.13", + "resolved": "https://registry.npmjs.org/nanomatch/-/nanomatch-1.2.13.tgz", + "integrity": "sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==", + "dependencies": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "fragment-cache": "^0.2.1", + "is-windows": "^1.0.2", + "kind-of": "^6.0.2", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/negotiator": { + "version": "0.6.2", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.2.tgz", + "integrity": "sha512-hZXc7K2e+PgeI1eDBe/10Ard4ekbfrrqG8Ep+8Jmf4JID2bNg7NvCPOZN+kfF574pFQI7mum2AUqDidoKqcTOw==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/neo-async": { + "version": "2.6.2", + "resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.6.2.tgz", + "integrity": "sha512-Yd3UES5mWCSqR+qNT93S3UoYUkqAZ9lLg8a7g9rimsWmYGK8cVToA4/sF3RrshdyV3sAGMXVUmpMYOw+dLpOuw==" + }, + "node_modules/ngx-toastr": { + "version": "12.0.1", + "resolved": "https://registry.npmjs.org/ngx-toastr/-/ngx-toastr-12.0.1.tgz", + "integrity": "sha512-PABtbn2dyHweVSbo/py1W3veXzcmZO7uVItfTW9AykSSeAUju3gOCgauAw89km0aJ9EBcPOieaoI+9tAR7Pfug==" + }, + "node_modules/nice-try": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/nice-try/-/nice-try-1.0.5.tgz", + "integrity": "sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ==" + }, + "node_modules/node-fetch-npm": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/node-fetch-npm/-/node-fetch-npm-2.0.4.tgz", + "integrity": "sha512-iOuIQDWDyjhv9qSDrj9aq/klt6F9z1p2otB3AV7v3zBDcL/x+OfGsvGQZZCcMZbUf4Ujw1xGNQkjvGnVT22cKg==", + "dependencies": { + "encoding": "^0.1.11", + "json-parse-better-errors": "^1.0.0", + "safe-buffer": "^5.1.1" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/node-forge": { + "version": "0.10.0", + "resolved": "https://registry.npmjs.org/node-forge/-/node-forge-0.10.0.tgz", + "integrity": "sha512-PPmu8eEeG9saEUvI97fm4OYxXVB6bFvyNTyiUOBichBpFG8A1Ljw3bY62+5oOjDEMHRnd0Y7HQ+x7uzxOzC6JA==", + "engines": { + "node": ">= 6.0.0" + } + }, + "node_modules/node-libs-browser": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.2.1.tgz", + "integrity": "sha512-h/zcD8H9kaDZ9ALUWwlBUDo6TKF8a7qBSCSEGfjTVIYeqsioSKaAX+BN7NgiMGp6iSIXZ3PxgCu8KS3b71YK5Q==", + "dependencies": { + "assert": "^1.1.1", + "browserify-zlib": "^0.2.0", + "buffer": "^4.3.0", + "console-browserify": "^1.1.0", + "constants-browserify": "^1.0.0", + "crypto-browserify": "^3.11.0", + "domain-browser": "^1.1.1", + "events": "^3.0.0", + "https-browserify": "^1.0.0", + "os-browserify": "^0.3.0", + "path-browserify": "0.0.1", + "process": "^0.11.10", + "punycode": "^1.2.4", + "querystring-es3": "^0.2.0", + "readable-stream": "^2.3.3", + "stream-browserify": "^2.0.1", + "stream-http": "^2.7.2", + "string_decoder": "^1.0.0", + "timers-browserify": "^2.0.4", + "tty-browserify": "0.0.0", + "url": "^0.11.0", + "util": "^0.11.0", + "vm-browserify": "^1.0.1" + } + }, + "node_modules/node-libs-browser/node_modules/punycode": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz", + "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=" + }, + "node_modules/node-releases": { + "version": "1.1.67", + "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-1.1.67.tgz", + "integrity": "sha512-V5QF9noGFl3EymEwUYzO+3NTDpGfQB4ve6Qfnzf3UNydMhjQRVPR1DZTuvWiLzaFJYw2fmDwAfnRNEVb64hSIg==" + }, + "node_modules/normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dependencies": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "node_modules/normalize-package-data/node_modules/hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==" + }, + "node_modules/normalize-package-data/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/normalize-range": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/normalize-range/-/normalize-range-0.1.2.tgz", + "integrity": "sha1-LRDAa9/TEuqXd2laTShDlFa3WUI=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/normalize-url": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/normalize-url/-/normalize-url-3.3.0.tgz", + "integrity": "sha512-U+JJi7duF1o+u2pynbp2zXDW2/PADgC30f0GsHZtRh+HOcXHnw137TrNlyxxRvWW5fjKd3bcLHPxofWuCjaeZg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/npm-bundled": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/npm-bundled/-/npm-bundled-1.1.1.tgz", + "integrity": "sha512-gqkfgGePhTpAEgUsGEgcq1rqPXA+tv/aVBlgEzfXwA1yiUJF7xtEt3CtVwOjNYQOVknDk0F20w58Fnm3EtG0fA==", + "dependencies": { + "npm-normalize-package-bin": "^1.0.1" + } + }, + "node_modules/npm-install-checks": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/npm-install-checks/-/npm-install-checks-4.0.0.tgz", + "integrity": "sha512-09OmyDkNLYwqKPOnbI8exiOZU2GVVmQp7tgez2BPi5OZC8M82elDAps7sxC4l//uSUtotWqoEIDwjRvWH4qz8w==", + "dependencies": { + "semver": "^7.1.1" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/npm-normalize-package-bin": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/npm-normalize-package-bin/-/npm-normalize-package-bin-1.0.1.tgz", + "integrity": "sha512-EPfafl6JL5/rU+ot6P3gRSCpPDW5VmIzX959Ob1+ySFUuuYHWHekXpwdUZcKP5C+DS4GEtdJluwBjnsNDl+fSA==" + }, + "node_modules/npm-package-arg": { + "version": "8.0.1", + "resolved": "https://registry.npmjs.org/npm-package-arg/-/npm-package-arg-8.0.1.tgz", + "integrity": "sha512-/h5Fm6a/exByzFSTm7jAyHbgOqErl9qSNJDQF32Si/ZzgwT2TERVxRxn3Jurw1wflgyVVAxnFR4fRHPM7y1ClQ==", + "dependencies": { + "hosted-git-info": "^3.0.2", + "semver": "^7.0.0", + "validate-npm-package-name": "^3.0.0" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/npm-packlist": { + "version": "1.4.8", + "resolved": "https://registry.npmjs.org/npm-packlist/-/npm-packlist-1.4.8.tgz", + "integrity": "sha512-5+AZgwru5IevF5ZdnFglB5wNlHG1AOOuw28WhUq8/8emhBmLv6jX5by4WJCh7lW0uSYZYS6DXqIsyZVIXRZU9A==", + "dependencies": { + "ignore-walk": "^3.0.1", + "npm-bundled": "^1.0.1", + "npm-normalize-package-bin": "^1.0.1" + } + }, + "node_modules/npm-pick-manifest": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/npm-pick-manifest/-/npm-pick-manifest-6.0.0.tgz", + "integrity": "sha512-PdJpXMvjqt4nftNEDpCgjBUF8yI3Q3MyuAmVB9nemnnCg32F4BPL/JFBfdj8DubgHCYUFQhtLWmBPvdsFtjWMg==", + "dependencies": { + "npm-install-checks": "^4.0.0", + "npm-package-arg": "^8.0.0", + "semver": "^7.0.0" + } + }, + "node_modules/npm-registry-fetch": { + "version": "4.0.7", + "resolved": "https://registry.npmjs.org/npm-registry-fetch/-/npm-registry-fetch-4.0.7.tgz", + "integrity": "sha512-cny9v0+Mq6Tjz+e0erFAB+RYJ/AVGzkjnISiobqP8OWj9c9FLoZZu8/SPSKJWE17F1tk4018wfjV+ZbIbqC7fQ==", + "dependencies": { + "bluebird": "^3.5.1", + "figgy-pudding": "^3.4.1", + "JSONStream": "^1.3.4", + "lru-cache": "^5.1.1", + "make-fetch-happen": "^5.0.0", + "npm-package-arg": "^6.1.0", + "safe-buffer": "^5.2.0" + } + }, + "node_modules/npm-registry-fetch/node_modules/hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==" + }, + "node_modules/npm-registry-fetch/node_modules/npm-package-arg": { + "version": "6.1.1", + "resolved": "https://registry.npmjs.org/npm-package-arg/-/npm-package-arg-6.1.1.tgz", + "integrity": "sha512-qBpssaL3IOZWi5vEKUKW0cO7kzLeT+EQO9W8RsLOZf76KF9E/K9+wH0C7t06HXPpaH8WH5xF1MExLuCwbTqRUg==", + "dependencies": { + "hosted-git-info": "^2.7.1", + "osenv": "^0.1.5", + "semver": "^5.6.0", + "validate-npm-package-name": "^3.0.0" + } + }, + "node_modules/npm-registry-fetch/node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==" + }, + "node_modules/npm-registry-fetch/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/npm-run-path": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz", + "integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=", + "dependencies": { + "path-key": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/nth-check": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/nth-check/-/nth-check-1.0.2.tgz", + "integrity": "sha512-WeBOdju8SnzPN5vTUJYxYUxLeXpCaVP5i5e0LF8fg7WORF2Wd7wFX/pk0tYZk7s8T+J7VLy0Da6J1+wCT0AtHg==", + "dependencies": { + "boolbase": "~1.0.0" + } + }, + "node_modules/num2fraction": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/num2fraction/-/num2fraction-1.2.2.tgz", + "integrity": "sha1-b2gragJ6Tp3fpFZM0lidHU5mnt4=" + }, + "node_modules/number-is-nan": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz", + "integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/oauth-sign": { + "version": "0.9.0", + "resolved": "https://registry.npmjs.org/oauth-sign/-/oauth-sign-0.9.0.tgz", + "integrity": "sha512-fexhUFFPTGV8ybAtSIGbV6gOkSv8UtRbDBnAyLQw4QPKkgNlsH2ByPGtMUqdWkos6YCRmAqViwgZrJc/mRDzZQ==", + "engines": { + "node": "*" + } + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-copy": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/object-copy/-/object-copy-0.1.0.tgz", + "integrity": "sha1-fn2Fi3gb18mRpBupde04EnVOmYw=", + "dependencies": { + "copy-descriptor": "^0.1.0", + "define-property": "^0.2.5", + "kind-of": "^3.0.3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-copy/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-copy/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-inspect": { + "version": "1.8.0", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.8.0.tgz", + "integrity": "sha512-jLdtEOB112fORuypAyl/50VRVIBIdVQOSUUGQHzJ4xBSbit81zRarz7GThkEFZy1RceYrWYcPcBFPQwHyAc1gA==" + }, + "node_modules/object-is": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/object-is/-/object-is-1.1.3.tgz", + "integrity": "sha512-teyqLvFWzLkq5B9ki8FVWA902UER2qkxmdA4nLf+wjOLAWgxzCWZNCxpDq9MvE8MmhWNr+I8w3BN49Vx36Y6Xg==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.18.0-next.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object-is/node_modules/es-abstract": { + "version": "1.18.0-next.1", + "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.18.0-next.1.tgz", + "integrity": "sha512-I4UGspA0wpZXWENrdA0uHbnhte683t3qT/1VFH9aX2dA5PPSf6QW5HHXf5HImaqPmjXaVeVk4RGWnaylmV7uAA==", + "dependencies": { + "es-to-primitive": "^1.2.1", + "function-bind": "^1.1.1", + "has": "^1.0.3", + "has-symbols": "^1.0.1", + "is-callable": "^1.2.2", + "is-negative-zero": "^2.0.0", + "is-regex": "^1.1.1", + "object-inspect": "^1.8.0", + "object-keys": "^1.1.1", + "object.assign": "^4.1.1", + "string.prototype.trimend": "^1.0.1", + "string.prototype.trimstart": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object-keys": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz", + "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object-visit": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/object-visit/-/object-visit-1.0.1.tgz", + "integrity": "sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=", + "dependencies": { + "isobject": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object.assign": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.2.tgz", + "integrity": "sha512-ixT2L5THXsApyiUPYKmW+2EHpXXe5Ii3M+f4e+aJFAHao5amFRW6J0OO6c/LU8Be47utCx2GL89hxGB6XSmKuQ==", + "dependencies": { + "call-bind": "^1.0.0", + "define-properties": "^1.1.3", + "has-symbols": "^1.0.1", + "object-keys": "^1.1.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object.getownpropertydescriptors": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/object.getownpropertydescriptors/-/object.getownpropertydescriptors-2.1.0.tgz", + "integrity": "sha512-Z53Oah9A3TdLoblT7VKJaTDdXdT+lQO+cNpKVnya5JDe9uLvzu1YyY1yFDFrcxrlRgWrEFH0jJtD/IbuwjcEVg==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.0-next.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/object.pick": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz", + "integrity": "sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=", + "dependencies": { + "isobject": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object.values": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/object.values/-/object.values-1.1.1.tgz", + "integrity": "sha512-WTa54g2K8iu0kmS/us18jEmdv1a4Wi//BZ/DTVYEcH0XhLM5NYdpDHja3gt57VrZLcNAO2WGA+KpWsDBaHt6eA==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.0-next.1", + "function-bind": "^1.1.1", + "has": "^1.0.3" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/obuf": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/obuf/-/obuf-1.1.2.tgz", + "integrity": "sha512-PX1wu0AmAdPqOL1mWhqmlOd8kOIZQwGZw6rh7uby9fTc5lhaOWFLX3I6R1hrF9k3zUY40e6igsLGkDXK92LJNg==" + }, + "node_modules/on-finished": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/on-headers": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.2.tgz", + "integrity": "sha512-pZAE+FJLoyITytdqK0U5s+FIpjN0JP3OzFi/u8Rx+EV5/W+JTWGXG8xFzevE7AjBfDqHv/8vL8qQsIhHnqRkrA==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/once": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", + "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=", + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/onetime": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/onetime/-/onetime-5.1.2.tgz", + "integrity": "sha512-kbpaSSGJTWdAY5KPVeMOKXSrPtr8C8C7wodJbcsd51jRnmD+GZu8Y0VoU6Dm5Z4vWr0Ig/1NKuWRKf7j5aaYSg==", + "dependencies": { + "mimic-fn": "^2.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/open": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/open/-/open-7.0.3.tgz", + "integrity": "sha512-sP2ru2v0P290WFfv49Ap8MF6PkzGNnGlAwHweB4WR4mr5d2d0woiCluUeJ218w7/+PmoBy9JmYgD5A4mLcWOFA==", + "dependencies": { + "is-docker": "^2.0.0", + "is-wsl": "^2.1.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/opn": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/opn/-/opn-5.5.0.tgz", + "integrity": "sha512-PqHpggC9bLV0VeWcdKhkpxY+3JTzetLSqTCWL/z/tFIbI6G8JCjondXklT1JinczLz2Xib62sSp0T/gKT4KksA==", + "dependencies": { + "is-wsl": "^1.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/opn/node_modules/is-wsl": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz", + "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=", + "engines": { + "node": ">=4" + } + }, + "node_modules/ora": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/ora/-/ora-4.0.3.tgz", + "integrity": "sha512-fnDebVFyz309A73cqCipVL1fBZewq4vwgSHfxh43vVy31mbyoQ8sCH3Oeaog/owYOs/lLlGVPCISQonTneg6Pg==", + "dependencies": { + "chalk": "^3.0.0", + "cli-cursor": "^3.1.0", + "cli-spinners": "^2.2.0", + "is-interactive": "^1.0.0", + "log-symbols": "^3.0.0", + "mute-stream": "0.0.8", + "strip-ansi": "^6.0.0", + "wcwidth": "^1.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ora/node_modules/ansi-regex": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", + "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/ora/node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ora/node_modules/chalk": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-3.0.0.tgz", + "integrity": "sha512-4D3B6Wf41KOYRFdszmDqMCGq5VV/uMAB273JILmO+3jAlh8X4qDtdtgCR3fxtbLEMzSx22QdhnDcJvu2u1fVwg==", + "dependencies": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ora/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/ora/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" + }, + "node_modules/ora/node_modules/has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/ora/node_modules/strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dependencies": { + "ansi-regex": "^5.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ora/node_modules/supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dependencies": { + "has-flag": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/original": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/original/-/original-1.0.2.tgz", + "integrity": "sha512-hyBVl6iqqUOJ8FqRe+l/gS8H+kKYjrEndd5Pm1MfBtsEKA038HkkdbAl/72EAXGyonD/PFsvmVG+EvcIpliMBg==", + "dependencies": { + "url-parse": "^1.4.3" + } + }, + "node_modules/os-browserify": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz", + "integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc=" + }, + "node_modules/os-homedir": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz", + "integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/os-locale": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/os-locale/-/os-locale-3.1.0.tgz", + "integrity": "sha512-Z8l3R4wYWM40/52Z+S265okfFj8Kt2cC2MKY+xNi3kFs+XGI7WXu/I309QQQYbRW4ijiZ+yxs9pqEhJh0DqW3Q==", + "dependencies": { + "execa": "^1.0.0", + "lcid": "^2.0.0", + "mem": "^4.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/os-tmpdir": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz", + "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/osenv": { + "version": "0.1.5", + "resolved": "https://registry.npmjs.org/osenv/-/osenv-0.1.5.tgz", + "integrity": "sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==", + "dependencies": { + "os-homedir": "^1.0.0", + "os-tmpdir": "^1.0.0" + } + }, + "node_modules/p-defer": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-defer/-/p-defer-1.0.0.tgz", + "integrity": "sha1-n26xgvbJqozXQwBKfU+WsZaw+ww=", + "engines": { + "node": ">=4" + } + }, + "node_modules/p-finally": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-finally/-/p-finally-1.0.0.tgz", + "integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4=", + "engines": { + "node": ">=4" + } + }, + "node_modules/p-is-promise": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/p-is-promise/-/p-is-promise-2.1.0.tgz", + "integrity": "sha512-Y3W0wlRPK8ZMRbNq97l4M5otioeA5lm1z7bkNkxCka8HSPjR0xRWmpCmc9utiaLP9Jb1eD8BgeIxTW4AIF45Pg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/p-limit": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", + "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", + "dependencies": { + "p-try": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/p-locate": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", + "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", + "dependencies": { + "p-limit": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/p-map": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/p-map/-/p-map-3.0.0.tgz", + "integrity": "sha512-d3qXVTF/s+W+CdJ5A29wywV2n8CQQYahlgz2bFiA+4eVNJbHJodPZ+/gXwPGh0bOqA+j8S+6+ckmvLGPk1QpxQ==", + "dependencies": { + "aggregate-error": "^3.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/p-retry": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/p-retry/-/p-retry-3.0.1.tgz", + "integrity": "sha512-XE6G4+YTTkT2a0UWb2kjZe8xNwf8bIbnqpc/IS/idOBVhyves0mK5OJgeocjx7q5pvX/6m23xuzVPYT1uGM73w==", + "dependencies": { + "retry": "^0.12.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/p-try": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", + "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", + "engines": { + "node": ">=6" + } + }, + "node_modules/pacote": { + "version": "9.5.12", + "resolved": "https://registry.npmjs.org/pacote/-/pacote-9.5.12.tgz", + "integrity": "sha512-BUIj/4kKbwWg4RtnBncXPJd15piFSVNpTzY0rysSr3VnMowTYgkGKcaHrbReepAkjTr8lH2CVWRi58Spg2CicQ==", + "dependencies": { + "bluebird": "^3.5.3", + "cacache": "^12.0.2", + "chownr": "^1.1.2", + "figgy-pudding": "^3.5.1", + "get-stream": "^4.1.0", + "glob": "^7.1.3", + "infer-owner": "^1.0.4", + "lru-cache": "^5.1.1", + "make-fetch-happen": "^5.0.0", + "minimatch": "^3.0.4", + "minipass": "^2.3.5", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "normalize-package-data": "^2.4.0", + "npm-normalize-package-bin": "^1.0.0", + "npm-package-arg": "^6.1.0", + "npm-packlist": "^1.1.12", + "npm-pick-manifest": "^3.0.0", + "npm-registry-fetch": "^4.0.0", + "osenv": "^0.1.5", + "promise-inflight": "^1.0.1", + "promise-retry": "^1.1.1", + "protoduck": "^5.0.1", + "rimraf": "^2.6.2", + "safe-buffer": "^5.1.2", + "semver": "^5.6.0", + "ssri": "^6.0.1", + "tar": "^4.4.10", + "unique-filename": "^1.1.1", + "which": "^1.3.1" + } + }, + "node_modules/pacote/node_modules/cacache": { + "version": "12.0.4", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.4.tgz", + "integrity": "sha512-a0tMB40oefvuInr4Cwb3GerbL9xTj1D5yg0T5xrjGCGyfvbxseIXX7BAO/u/hIXdafzOI5JC3wDwHyf24buOAQ==", + "dependencies": { + "bluebird": "^3.5.5", + "chownr": "^1.1.1", + "figgy-pudding": "^3.5.1", + "glob": "^7.1.4", + "graceful-fs": "^4.1.15", + "infer-owner": "^1.0.3", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.3", + "ssri": "^6.0.1", + "unique-filename": "^1.1.1", + "y18n": "^4.0.0" + } + }, + "node_modules/pacote/node_modules/fs-minipass": { + "version": "1.2.7", + "resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-1.2.7.tgz", + "integrity": "sha512-GWSSJGFy4e9GUeCcbIkED+bgAoFyj7XF1mV8rma3QW4NIqX9Kyx79N/PF61H5udOV3aY1IaMLs6pGbH71nlCTA==", + "dependencies": { + "minipass": "^2.6.0" + } + }, + "node_modules/pacote/node_modules/hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==" + }, + "node_modules/pacote/node_modules/minipass": { + "version": "2.9.0", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-2.9.0.tgz", + "integrity": "sha512-wxfUjg9WebH+CUDX/CdbRlh5SmfZiy/hpkxaRI16Y9W56Pa75sWgd/rvFilSgrauD9NyFymP/+JFV3KwzIsJeg==", + "dependencies": { + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" + } + }, + "node_modules/pacote/node_modules/minizlib": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/minizlib/-/minizlib-1.3.3.tgz", + "integrity": "sha512-6ZYMOEnmVsdCeTJVE0W9ZD+pVnE8h9Hma/iOwwRDsdQoePpoX56/8B6z3P9VNwppJuBKNRuFDRNRqRWexT9G9Q==", + "dependencies": { + "minipass": "^2.9.0" + } + }, + "node_modules/pacote/node_modules/npm-package-arg": { + "version": "6.1.1", + "resolved": "https://registry.npmjs.org/npm-package-arg/-/npm-package-arg-6.1.1.tgz", + "integrity": "sha512-qBpssaL3IOZWi5vEKUKW0cO7kzLeT+EQO9W8RsLOZf76KF9E/K9+wH0C7t06HXPpaH8WH5xF1MExLuCwbTqRUg==", + "dependencies": { + "hosted-git-info": "^2.7.1", + "osenv": "^0.1.5", + "semver": "^5.6.0", + "validate-npm-package-name": "^3.0.0" + } + }, + "node_modules/pacote/node_modules/npm-pick-manifest": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/npm-pick-manifest/-/npm-pick-manifest-3.0.2.tgz", + "integrity": "sha512-wNprTNg+X5nf+tDi+hbjdHhM4bX+mKqv6XmPh7B5eG+QY9VARfQPfCEH013H5GqfNj6ee8Ij2fg8yk0mzps1Vw==", + "dependencies": { + "figgy-pudding": "^3.5.1", + "npm-package-arg": "^6.0.0", + "semver": "^5.4.1" + } + }, + "node_modules/pacote/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/pacote/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/pacote/node_modules/ssri": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/ssri/-/ssri-6.0.1.tgz", + "integrity": "sha512-3Wge10hNcT1Kur4PDFwEieXSCMCJs/7WvSACcrMYrNp+b8kDL1/0wJch5Ni2WrtwEa2IO8OsVfeKIciKCDx/QA==", + "dependencies": { + "figgy-pudding": "^3.5.1" + } + }, + "node_modules/pacote/node_modules/tar": { + "version": "4.4.13", + "resolved": "https://registry.npmjs.org/tar/-/tar-4.4.13.tgz", + "integrity": "sha512-w2VwSrBoHa5BsSyH+KxEqeQBAllHhccyMFVHtGtdMpF4W7IRWfZjFiQceJPChOeTsSDVUpER2T8FA93pr0L+QA==", + "dependencies": { + "chownr": "^1.1.1", + "fs-minipass": "^1.2.5", + "minipass": "^2.8.6", + "minizlib": "^1.2.1", + "mkdirp": "^0.5.0", + "safe-buffer": "^5.1.2", + "yallist": "^3.0.3" + }, + "engines": { + "node": ">=4.5" + } + }, + "node_modules/pacote/node_modules/yallist": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", + "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==" + }, + "node_modules/pako": { + "version": "1.0.11", + "resolved": "https://registry.npmjs.org/pako/-/pako-1.0.11.tgz", + "integrity": "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw==" + }, + "node_modules/parallel-transform": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/parallel-transform/-/parallel-transform-1.2.0.tgz", + "integrity": "sha512-P2vSmIu38uIlvdcU7fDkyrxj33gTUy/ABO5ZUbGowxNCopBq/OoD42bP4UmMrJoPyk4Uqf0mu3mtWBhHCZD8yg==", + "dependencies": { + "cyclist": "^1.0.1", + "inherits": "^2.0.3", + "readable-stream": "^2.1.5" + } + }, + "node_modules/parse-asn1": { + "version": "5.1.6", + "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.6.tgz", + "integrity": "sha512-RnZRo1EPU6JBnra2vGHj0yhp6ebyjBZpmUCLHWiFhxlzvBCCpAuZ7elsBp1PVAbQN0/04VD/19rfzlBSwLstMw==", + "dependencies": { + "asn1.js": "^5.2.0", + "browserify-aes": "^1.0.0", + "evp_bytestokey": "^1.0.0", + "pbkdf2": "^3.0.3", + "safe-buffer": "^5.1.1" + } + }, + "node_modules/parse-json": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz", + "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=", + "dependencies": { + "error-ex": "^1.3.1", + "json-parse-better-errors": "^1.0.1" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/parse5": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/parse5/-/parse5-4.0.0.tgz", + "integrity": "sha512-VrZ7eOd3T1Fk4XWNXMgiGBK/z0MG48BWG2uQNU4I72fkQuKUTZpl+u9k+CxEG0twMVzSmXEEz12z5Fnw1jIQFA==" + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/pascalcase": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/pascalcase/-/pascalcase-0.1.1.tgz", + "integrity": "sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/path": { + "version": "0.12.7", + "resolved": "https://registry.npmjs.org/path/-/path-0.12.7.tgz", + "integrity": "sha1-1NwqUGxM4hl+tIHr/NWzbAFAsQ8=", + "dependencies": { + "process": "^0.11.1", + "util": "^0.10.3" + } + }, + "node_modules/path-browserify": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.1.tgz", + "integrity": "sha512-BapA40NHICOS+USX9SN4tyhq+A2RrN/Ws5F0Z5aMHDp98Fl86lX8Oti8B7uN93L4Ifv4fHOEA+pQw87gmMO/lQ==" + }, + "node_modules/path-dirname": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/path-dirname/-/path-dirname-1.0.2.tgz", + "integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=" + }, + "node_modules/path-exists": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", + "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", + "engines": { + "node": ">=4" + } + }, + "node_modules/path-is-absolute": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", + "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/path-is-inside": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/path-is-inside/-/path-is-inside-1.0.2.tgz", + "integrity": "sha1-NlQX3t5EQw0cEa9hAn+s8HS9/FM=" + }, + "node_modules/path-key": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/path-key/-/path-key-2.0.1.tgz", + "integrity": "sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A=", + "engines": { + "node": ">=4" + } + }, + "node_modules/path-parse": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.6.tgz", + "integrity": "sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==" + }, + "node_modules/path-to-regexp": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=" + }, + "node_modules/path-type": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", + "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", + "dependencies": { + "pify": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/path-type/node_modules/pify": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", + "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "engines": { + "node": ">=4" + } + }, + "node_modules/path/node_modules/inherits": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" + }, + "node_modules/path/node_modules/util": { + "version": "0.10.4", + "resolved": "https://registry.npmjs.org/util/-/util-0.10.4.tgz", + "integrity": "sha512-0Pm9hTQ3se5ll1XihRic3FDIku70C+iHUdT/W926rSgHV5QgXsYbKZN8MSC3tJtSkhuROzvsQjAaFENRXr+19A==", + "dependencies": { + "inherits": "2.0.3" + } + }, + "node_modules/pbkdf2": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.1.1.tgz", + "integrity": "sha512-4Ejy1OPxi9f2tt1rRV7Go7zmfDQ+ZectEQz3VGUQhgq62HtIRPDyG/JtnwIxs6x3uNMwo2V7q1fMvKjb+Tnpqg==", + "dependencies": { + "create-hash": "^1.1.2", + "create-hmac": "^1.1.4", + "ripemd160": "^2.0.1", + "safe-buffer": "^5.0.1", + "sha.js": "^2.4.8" + }, + "engines": { + "node": ">=0.12" + } + }, + "node_modules/performance-now": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/performance-now/-/performance-now-2.1.0.tgz", + "integrity": "sha1-Ywn04OX6kT7BxpMHrjZLSzd8nns=" + }, + "node_modules/picomatch": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.2.2.tgz", + "integrity": "sha512-q0M/9eZHzmr0AulXyPwNfZjtwZ/RBZlbN3K3CErVrk50T2ASYI7Bye0EvekFY3IP1Nt2DHu0re+V2ZHIpMkuWg==", + "engines": { + "node": ">=8.6" + } + }, + "node_modules/pify": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/pify/-/pify-4.0.1.tgz", + "integrity": "sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g==", + "engines": { + "node": ">=6" + } + }, + "node_modules/pinkie": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/pinkie/-/pinkie-2.0.4.tgz", + "integrity": "sha1-clVrgM+g1IqXToDnckjoDtT3+HA=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/pinkie-promise": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/pinkie-promise/-/pinkie-promise-2.0.1.tgz", + "integrity": "sha1-ITXW36ejWMBprJsXh3YogihFD/o=", + "dependencies": { + "pinkie": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/pkg-dir": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz", + "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", + "dependencies": { + "find-up": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/portfinder": { + "version": "1.0.28", + "resolved": "https://registry.npmjs.org/portfinder/-/portfinder-1.0.28.tgz", + "integrity": "sha512-Se+2isanIcEqf2XMHjyUKskczxbPH7dQnlMjXX6+dybayyHvAf/TCgyMRlzf/B6QDhAEFOGes0pzRo3by4AbMA==", + "dependencies": { + "async": "^2.6.2", + "debug": "^3.1.1", + "mkdirp": "^0.5.5" + }, + "engines": { + "node": ">= 0.12.0" + } + }, + "node_modules/portfinder/node_modules/debug": { + "version": "3.2.7", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz", + "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/posix-character-classes": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/posix-character-classes/-/posix-character-classes-0.1.1.tgz", + "integrity": "sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/postcss": { + "version": "7.0.27", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-7.0.27.tgz", + "integrity": "sha512-WuQETPMcW9Uf1/22HWUWP9lgsIC+KEHg2kozMflKjbeUtw9ujvFX6QmIfozaErDkmLWS9WEnEdEe6Uo9/BNTdQ==", + "dependencies": { + "chalk": "^2.4.2", + "source-map": "^0.6.1", + "supports-color": "^6.1.0" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/postcss-calc": { + "version": "7.0.5", + "resolved": "https://registry.npmjs.org/postcss-calc/-/postcss-calc-7.0.5.tgz", + "integrity": "sha512-1tKHutbGtLtEZF6PT4JSihCHfIVldU72mZ8SdZHIYriIZ9fh9k9aWSppaT8rHsyI3dX+KSR+W+Ix9BMY3AODrg==", + "dependencies": { + "postcss": "^7.0.27", + "postcss-selector-parser": "^6.0.2", + "postcss-value-parser": "^4.0.2" + } + }, + "node_modules/postcss-colormin": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/postcss-colormin/-/postcss-colormin-4.0.3.tgz", + "integrity": "sha512-WyQFAdDZpExQh32j0U0feWisZ0dmOtPl44qYmJKkq9xFWY3p+4qnRzCHeNrkeRhwPHz9bQ3mo0/yVkaply0MNw==", + "dependencies": { + "browserslist": "^4.0.0", + "color": "^3.0.0", + "has": "^1.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-colormin/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-convert-values": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-convert-values/-/postcss-convert-values-4.0.1.tgz", + "integrity": "sha512-Kisdo1y77KUC0Jmn0OXU/COOJbzM8cImvw1ZFsBgBgMgb1iL23Zs/LXRe3r+EZqM3vGYKdQ2YJVQ5VkJI+zEJQ==", + "dependencies": { + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-convert-values/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-discard-comments": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-discard-comments/-/postcss-discard-comments-4.0.2.tgz", + "integrity": "sha512-RJutN259iuRf3IW7GZyLM5Sw4GLTOH8FmsXBnv8Ab/Tc2k4SR4qbV4DNbyyY4+Sjo362SyDmW2DQ7lBSChrpkg==", + "dependencies": { + "postcss": "^7.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-discard-duplicates": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-discard-duplicates/-/postcss-discard-duplicates-4.0.2.tgz", + "integrity": "sha512-ZNQfR1gPNAiXZhgENFfEglF93pciw0WxMkJeVmw8eF+JZBbMD7jp6C67GqJAXVZP2BWbOztKfbsdmMp/k8c6oQ==", + "dependencies": { + "postcss": "^7.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-discard-empty": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-discard-empty/-/postcss-discard-empty-4.0.1.tgz", + "integrity": "sha512-B9miTzbznhDjTfjvipfHoqbWKwd0Mj+/fL5s1QOz06wufguil+Xheo4XpOnc4NqKYBCNqqEzgPv2aPBIJLox0w==", + "dependencies": { + "postcss": "^7.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-discard-overridden": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-discard-overridden/-/postcss-discard-overridden-4.0.1.tgz", + "integrity": "sha512-IYY2bEDD7g1XM1IDEsUT4//iEYCxAmP5oDSFMVU/JVvT7gh+l4fmjciLqGgwjdWpQIdb0Che2VX00QObS5+cTg==", + "dependencies": { + "postcss": "^7.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-import": { + "version": "12.0.1", + "resolved": "https://registry.npmjs.org/postcss-import/-/postcss-import-12.0.1.tgz", + "integrity": "sha512-3Gti33dmCjyKBgimqGxL3vcV8w9+bsHwO5UrBawp796+jdardbcFl4RP5w/76BwNL7aGzpKstIfF9I+kdE8pTw==", + "dependencies": { + "postcss": "^7.0.1", + "postcss-value-parser": "^3.2.3", + "read-cache": "^1.0.0", + "resolve": "^1.1.7" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/postcss-import/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-load-config": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/postcss-load-config/-/postcss-load-config-2.1.2.tgz", + "integrity": "sha512-/rDeGV6vMUo3mwJZmeHfEDvwnTKKqQ0S7OHUi/kJvvtx3aWtyWG2/0ZWnzCt2keEclwN6Tf0DST2v9kITdOKYw==", + "dependencies": { + "cosmiconfig": "^5.0.0", + "import-cwd": "^2.0.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/postcss-loader": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/postcss-loader/-/postcss-loader-3.0.0.tgz", + "integrity": "sha512-cLWoDEY5OwHcAjDnkyRQzAXfs2jrKjXpO/HQFcc5b5u/r7aa471wdmChmwfnv7x2u840iat/wi0lQ5nbRgSkUA==", + "dependencies": { + "loader-utils": "^1.1.0", + "postcss": "^7.0.0", + "postcss-load-config": "^2.0.0", + "schema-utils": "^1.0.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/postcss-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/postcss-loader/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/postcss-merge-longhand": { + "version": "4.0.11", + "resolved": "https://registry.npmjs.org/postcss-merge-longhand/-/postcss-merge-longhand-4.0.11.tgz", + "integrity": "sha512-alx/zmoeXvJjp7L4mxEMjh8lxVlDFX1gqWHzaaQewwMZiVhLo42TEClKaeHbRf6J7j82ZOdTJ808RtN0ZOZwvw==", + "dependencies": { + "css-color-names": "0.0.4", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0", + "stylehacks": "^4.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-merge-longhand/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-merge-rules": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/postcss-merge-rules/-/postcss-merge-rules-4.0.3.tgz", + "integrity": "sha512-U7e3r1SbvYzO0Jr3UT/zKBVgYYyhAz0aitvGIYOYK5CPmkNih+WDSsS5tvPrJ8YMQYlEMvsZIiqmn7HdFUaeEQ==", + "dependencies": { + "browserslist": "^4.0.0", + "caniuse-api": "^3.0.0", + "cssnano-util-same-parent": "^4.0.0", + "postcss": "^7.0.0", + "postcss-selector-parser": "^3.0.0", + "vendors": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-merge-rules/node_modules/postcss-selector-parser": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-3.1.2.tgz", + "integrity": "sha512-h7fJ/5uWuRVyOtkO45pnt1Ih40CEleeyCHzipqAZO2e5H20g25Y48uYnFUiShvY4rZWNJ/Bib/KVPmanaCtOhA==", + "dependencies": { + "dot-prop": "^5.2.0", + "indexes-of": "^1.0.1", + "uniq": "^1.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/postcss-minify-font-values": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-minify-font-values/-/postcss-minify-font-values-4.0.2.tgz", + "integrity": "sha512-j85oO6OnRU9zPf04+PZv1LYIYOprWm6IA6zkXkrJXyRveDEuQggG6tvoy8ir8ZwjLxLuGfNkCZEQG7zan+Hbtg==", + "dependencies": { + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-minify-font-values/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-minify-gradients": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-minify-gradients/-/postcss-minify-gradients-4.0.2.tgz", + "integrity": "sha512-qKPfwlONdcf/AndP1U8SJ/uzIJtowHlMaSioKzebAXSG4iJthlWC9iSWznQcX4f66gIWX44RSA841HTHj3wK+Q==", + "dependencies": { + "cssnano-util-get-arguments": "^4.0.0", + "is-color-stop": "^1.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-minify-gradients/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-minify-params": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-minify-params/-/postcss-minify-params-4.0.2.tgz", + "integrity": "sha512-G7eWyzEx0xL4/wiBBJxJOz48zAKV2WG3iZOqVhPet/9geefm/Px5uo1fzlHu+DOjT+m0Mmiz3jkQzVHe6wxAWg==", + "dependencies": { + "alphanum-sort": "^1.0.0", + "browserslist": "^4.0.0", + "cssnano-util-get-arguments": "^4.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0", + "uniqs": "^2.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-minify-params/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-minify-selectors": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-minify-selectors/-/postcss-minify-selectors-4.0.2.tgz", + "integrity": "sha512-D5S1iViljXBj9kflQo4YutWnJmwm8VvIsU1GeXJGiG9j8CIg9zs4voPMdQDUmIxetUOh60VilsNzCiAFTOqu3g==", + "dependencies": { + "alphanum-sort": "^1.0.0", + "has": "^1.0.0", + "postcss": "^7.0.0", + "postcss-selector-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-minify-selectors/node_modules/postcss-selector-parser": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-3.1.2.tgz", + "integrity": "sha512-h7fJ/5uWuRVyOtkO45pnt1Ih40CEleeyCHzipqAZO2e5H20g25Y48uYnFUiShvY4rZWNJ/Bib/KVPmanaCtOhA==", + "dependencies": { + "dot-prop": "^5.2.0", + "indexes-of": "^1.0.1", + "uniq": "^1.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/postcss-modules-extract-imports": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/postcss-modules-extract-imports/-/postcss-modules-extract-imports-2.0.0.tgz", + "integrity": "sha512-LaYLDNS4SG8Q5WAWqIJgdHPJrDDr/Lv775rMBFUbgjTz6j34lUznACHcdRWroPvXANP2Vj7yNK57vp9eFqzLWQ==", + "dependencies": { + "postcss": "^7.0.5" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss-modules-local-by-default": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/postcss-modules-local-by-default/-/postcss-modules-local-by-default-3.0.3.tgz", + "integrity": "sha512-e3xDq+LotiGesympRlKNgaJ0PCzoUIdpH0dj47iWAui/kyTgh3CiAr1qP54uodmJhl6p9rN6BoNcdEDVJx9RDw==", + "dependencies": { + "icss-utils": "^4.1.1", + "postcss": "^7.0.32", + "postcss-selector-parser": "^6.0.2", + "postcss-value-parser": "^4.1.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss-modules-local-by-default/node_modules/postcss": { + "version": "7.0.35", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-7.0.35.tgz", + "integrity": "sha512-3QT8bBJeX/S5zKTTjTCIjRF3If4avAT6kqxcASlTWEtAFCb9NH0OUxNDfgZSWdP5fJnBYCMEWkIFfWeugjzYMg==", + "dependencies": { + "chalk": "^2.4.2", + "source-map": "^0.6.1", + "supports-color": "^6.1.0" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/postcss-modules-local-by-default/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/postcss-modules-local-by-default/node_modules/supports-color": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz", + "integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==", + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/postcss-modules-scope": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/postcss-modules-scope/-/postcss-modules-scope-2.2.0.tgz", + "integrity": "sha512-YyEgsTMRpNd+HmyC7H/mh3y+MeFWevy7V1evVhJWewmMbjDHIbZbOXICC2y+m1xI1UVfIT1HMW/O04Hxyu9oXQ==", + "dependencies": { + "postcss": "^7.0.6", + "postcss-selector-parser": "^6.0.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss-modules-values": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/postcss-modules-values/-/postcss-modules-values-3.0.0.tgz", + "integrity": "sha512-1//E5jCBrZ9DmRX+zCtmQtRSV6PV42Ix7Bzj9GbwJceduuf7IqP8MgeTXuRDHOWj2m0VzZD5+roFWDuU8RQjcg==", + "dependencies": { + "icss-utils": "^4.0.0", + "postcss": "^7.0.6" + } + }, + "node_modules/postcss-normalize-charset": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-normalize-charset/-/postcss-normalize-charset-4.0.1.tgz", + "integrity": "sha512-gMXCrrlWh6G27U0hF3vNvR3w8I1s2wOBILvA87iNXaPvSNo5uZAMYsZG7XjCUf1eVxuPfyL4TJ7++SGZLc9A3g==", + "dependencies": { + "postcss": "^7.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-normalize-display-values": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-normalize-display-values/-/postcss-normalize-display-values-4.0.2.tgz", + "integrity": "sha512-3F2jcsaMW7+VtRMAqf/3m4cPFhPD3EFRgNs18u+k3lTJJlVe7d0YPO+bnwqo2xg8YiRpDXJI2u8A0wqJxMsQuQ==", + "dependencies": { + "cssnano-util-get-match": "^4.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-normalize-display-values/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-normalize-positions": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-normalize-positions/-/postcss-normalize-positions-4.0.2.tgz", + "integrity": "sha512-Dlf3/9AxpxE+NF1fJxYDeggi5WwV35MXGFnnoccP/9qDtFrTArZ0D0R+iKcg5WsUd8nUYMIl8yXDCtcrT8JrdA==", + "dependencies": { + "cssnano-util-get-arguments": "^4.0.0", + "has": "^1.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-normalize-positions/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-normalize-repeat-style": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-normalize-repeat-style/-/postcss-normalize-repeat-style-4.0.2.tgz", + "integrity": "sha512-qvigdYYMpSuoFs3Is/f5nHdRLJN/ITA7huIoCyqqENJe9PvPmLhNLMu7QTjPdtnVf6OcYYO5SHonx4+fbJE1+Q==", + "dependencies": { + "cssnano-util-get-arguments": "^4.0.0", + "cssnano-util-get-match": "^4.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-normalize-repeat-style/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-normalize-string": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-normalize-string/-/postcss-normalize-string-4.0.2.tgz", + "integrity": "sha512-RrERod97Dnwqq49WNz8qo66ps0swYZDSb6rM57kN2J+aoyEAJfZ6bMx0sx/F9TIEX0xthPGCmeyiam/jXif0eA==", + "dependencies": { + "has": "^1.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-normalize-string/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-normalize-timing-functions": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-normalize-timing-functions/-/postcss-normalize-timing-functions-4.0.2.tgz", + "integrity": "sha512-acwJY95edP762e++00Ehq9L4sZCEcOPyaHwoaFOhIwWCDfik6YvqsYNxckee65JHLKzuNSSmAdxwD2Cud1Z54A==", + "dependencies": { + "cssnano-util-get-match": "^4.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-normalize-timing-functions/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-normalize-unicode": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-normalize-unicode/-/postcss-normalize-unicode-4.0.1.tgz", + "integrity": "sha512-od18Uq2wCYn+vZ/qCOeutvHjB5jm57ToxRaMeNuf0nWVHaP9Hua56QyMF6fs/4FSUnVIw0CBPsU0K4LnBPwYwg==", + "dependencies": { + "browserslist": "^4.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-normalize-unicode/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-normalize-url": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-normalize-url/-/postcss-normalize-url-4.0.1.tgz", + "integrity": "sha512-p5oVaF4+IHwu7VpMan/SSpmpYxcJMtkGppYf0VbdH5B6hN8YNmVyJLuY9FmLQTzY3fag5ESUUHDqM+heid0UVA==", + "dependencies": { + "is-absolute-url": "^2.0.0", + "normalize-url": "^3.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-normalize-url/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-normalize-whitespace": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-normalize-whitespace/-/postcss-normalize-whitespace-4.0.2.tgz", + "integrity": "sha512-tO8QIgrsI3p95r8fyqKV+ufKlSHh9hMJqACqbv2XknufqEDhDvbguXGBBqxw9nsQoXWf0qOqppziKJKHMD4GtA==", + "dependencies": { + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-normalize-whitespace/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-ordered-values": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/postcss-ordered-values/-/postcss-ordered-values-4.1.2.tgz", + "integrity": "sha512-2fCObh5UanxvSxeXrtLtlwVThBvHn6MQcu4ksNT2tsaV2Fg76R2CV98W7wNSlX+5/pFwEyaDwKLLoEV7uRybAw==", + "dependencies": { + "cssnano-util-get-arguments": "^4.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-ordered-values/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-reduce-initial": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/postcss-reduce-initial/-/postcss-reduce-initial-4.0.3.tgz", + "integrity": "sha512-gKWmR5aUulSjbzOfD9AlJiHCGH6AEVLaM0AV+aSioxUDd16qXP1PCh8d1/BGVvpdWn8k/HiK7n6TjeoXN1F7DA==", + "dependencies": { + "browserslist": "^4.0.0", + "caniuse-api": "^3.0.0", + "has": "^1.0.0", + "postcss": "^7.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-reduce-transforms": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-reduce-transforms/-/postcss-reduce-transforms-4.0.2.tgz", + "integrity": "sha512-EEVig1Q2QJ4ELpJXMZR8Vt5DQx8/mo+dGWSR7vWXqcob2gQLyQGsionYcGKATXvQzMPn6DSN1vTN7yFximdIAg==", + "dependencies": { + "cssnano-util-get-match": "^4.0.0", + "has": "^1.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-reduce-transforms/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-selector-parser": { + "version": "6.0.4", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.0.4.tgz", + "integrity": "sha512-gjMeXBempyInaBqpp8gODmwZ52WaYsVOsfr4L4lDQ7n3ncD6mEyySiDtgzCT+NYC0mmeOLvtsF8iaEf0YT6dBw==", + "dependencies": { + "cssesc": "^3.0.0", + "indexes-of": "^1.0.1", + "uniq": "^1.0.1", + "util-deprecate": "^1.0.2" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/postcss-svgo": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-svgo/-/postcss-svgo-4.0.2.tgz", + "integrity": "sha512-C6wyjo3VwFm0QgBy+Fu7gCYOkCmgmClghO+pjcxvrcBKtiKt0uCF+hvbMO1fyv5BMImRK90SMb+dwUnfbGd+jw==", + "dependencies": { + "is-svg": "^3.0.0", + "postcss": "^7.0.0", + "postcss-value-parser": "^3.0.0", + "svgo": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-svgo/node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss-unique-selectors": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-unique-selectors/-/postcss-unique-selectors-4.0.1.tgz", + "integrity": "sha512-+JanVaryLo9QwZjKrmJgkI4Fn8SBgRO6WXQBJi7KiAVPlmxikB5Jzc4EvXMT2H0/m0RjrVVm9rGNhZddm/8Spg==", + "dependencies": { + "alphanum-sort": "^1.0.0", + "postcss": "^7.0.0", + "uniqs": "^2.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/postcss-value-parser": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-4.1.0.tgz", + "integrity": "sha512-97DXOFbQJhk71ne5/Mt6cOu6yxsSfM0QGQyl0L25Gca4yGWEGJaig7l7gbCX623VqTBNGLRLaVUCnNkcedlRSQ==" + }, + "node_modules/postcss/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/postcss/node_modules/supports-color": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz", + "integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==", + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/prepend-http": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/prepend-http/-/prepend-http-1.0.4.tgz", + "integrity": "sha1-1PRWKwzjaW5BrFLQ4ALlemNdxtw=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/process": { + "version": "0.11.10", + "resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz", + "integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI=", + "engines": { + "node": ">= 0.6.0" + } + }, + "node_modules/process-nextick-args": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz", + "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==" + }, + "node_modules/promise": { + "version": "7.3.1", + "resolved": "https://registry.npmjs.org/promise/-/promise-7.3.1.tgz", + "integrity": "sha512-nolQXZ/4L+bP/UGlkfaIujX9BKxGwmQ9OT4mOt5yvy8iK1h3wqTEJCijzGANTCCl9nWjY41juyAn2K3Q1hLLTg==", + "optional": true, + "dependencies": { + "asap": "~2.0.3" + } + }, + "node_modules/promise-inflight": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/promise-inflight/-/promise-inflight-1.0.1.tgz", + "integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM=" + }, + "node_modules/promise-retry": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/promise-retry/-/promise-retry-1.1.1.tgz", + "integrity": "sha1-ZznpaOMFHaIM5kl/srUPaRHfPW0=", + "dependencies": { + "err-code": "^1.0.0", + "retry": "^0.10.0" + }, + "engines": { + "node": ">=0.12" + } + }, + "node_modules/promise-retry/node_modules/retry": { + "version": "0.10.1", + "resolved": "https://registry.npmjs.org/retry/-/retry-0.10.1.tgz", + "integrity": "sha1-52OI0heZLCUnUCQdPTlW/tmNj/Q=", + "engines": { + "node": "*" + } + }, + "node_modules/protoduck": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/protoduck/-/protoduck-5.0.1.tgz", + "integrity": "sha512-WxoCeDCoCBY55BMvj4cAEjdVUFGRWed9ZxPlqTKYyw1nDDTQ4pqmnIMAGfJlg7Dx35uB/M+PHJPTmGOvaCaPTg==", + "dependencies": { + "genfun": "^5.0.0" + } + }, + "node_modules/proxy-addr": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.6.tgz", + "integrity": "sha512-dh/frvCBVmSsDYzw6n926jv974gddhkFPfiN8hPOi30Wax25QZyZEGveluCgliBnqmuM+UJmBErbAUFIoDbjOw==", + "dependencies": { + "forwarded": "~0.1.2", + "ipaddr.js": "1.9.1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/prr": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/prr/-/prr-1.0.1.tgz", + "integrity": "sha1-0/wRS6BplaRexok/SEzrHXj19HY=" + }, + "node_modules/psl": { + "version": "1.8.0", + "resolved": "https://registry.npmjs.org/psl/-/psl-1.8.0.tgz", + "integrity": "sha512-RIdOzyoavK+hA18OGGWDqUTsCLhtA7IcZ/6NCs4fFJaHBDab+pDDmDIByWFRQJq2Cd7r1OoQxBGKOaztq+hjIQ==" + }, + "node_modules/public-encrypt": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.3.tgz", + "integrity": "sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==", + "dependencies": { + "bn.js": "^4.1.0", + "browserify-rsa": "^4.0.0", + "create-hash": "^1.1.0", + "parse-asn1": "^5.0.0", + "randombytes": "^2.0.1", + "safe-buffer": "^5.1.2" + } + }, + "node_modules/public-encrypt/node_modules/bn.js": { + "version": "4.11.9", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.9.tgz", + "integrity": "sha512-E6QoYqCKZfgatHTdHzs1RRKP7ip4vvm+EyRUeE2RF0NblwVvb0p6jSVeNTOFxPn26QXN2o6SMfNxKp6kU8zQaw==" + }, + "node_modules/pump": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", + "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", + "dependencies": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + }, + "node_modules/pumpify": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/pumpify/-/pumpify-1.5.1.tgz", + "integrity": "sha512-oClZI37HvuUJJxSKKrC17bZ9Cu0ZYhEAGPsPUy9KlMUmv9dKX2o77RUmq7f3XjIxbwyGwYzbzQ1L2Ks8sIradQ==", + "dependencies": { + "duplexify": "^3.6.0", + "inherits": "^2.0.3", + "pump": "^2.0.0" + } + }, + "node_modules/pumpify/node_modules/pump": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz", + "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==", + "dependencies": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + }, + "node_modules/punycode": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz", + "integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==", + "engines": { + "node": ">=6" + } + }, + "node_modules/q": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/q/-/q-1.5.1.tgz", + "integrity": "sha1-fjL3W0E4EpHQRhHxvxQQmsAGUdc=", + "engines": { + "node": ">=0.6.0", + "teleport": ">=0.2.0" + } + }, + "node_modules/qs": { + "version": "6.5.2", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.2.tgz", + "integrity": "sha512-N5ZAX4/LxJmF+7wN74pUD6qAh9/wnvdQcjq9TZjevvXzSUo7bfmw91saqMjzGS2xq91/odN2dW/WOl7qQHNDGA==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/query-string": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/query-string/-/query-string-4.3.4.tgz", + "integrity": "sha1-u7aTucqRXCMlFbIosaArYJBD2+s=", + "dependencies": { + "object-assign": "^4.1.0", + "strict-uri-encode": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/querystring": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz", + "integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA=", + "engines": { + "node": ">=0.4.x" + } + }, + "node_modules/querystring-es3": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz", + "integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM=", + "engines": { + "node": ">=0.4.x" + } + }, + "node_modules/querystringify": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/querystringify/-/querystringify-2.2.0.tgz", + "integrity": "sha512-FIqgj2EUvTa7R50u0rGsyTftzjYmv/a3hO345bZNrqabNqjtgiDMgmo4mkUjd+nzU5oF3dClKqFIPUKybUyqoQ==" + }, + "node_modules/randombytes": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz", + "integrity": "sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==", + "dependencies": { + "safe-buffer": "^5.1.0" + } + }, + "node_modules/randomfill": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz", + "integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==", + "dependencies": { + "randombytes": "^2.0.5", + "safe-buffer": "^5.1.0" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/raw-body": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.4.0.tgz", + "integrity": "sha512-4Oz8DUIwdvoa5qMJelxipzi/iJIi40O5cGV1wNYp5hvZP8ZN0T+jiNkL0QepXs+EsQ9XJ8ipEDoiH70ySUJP3Q==", + "dependencies": { + "bytes": "3.1.0", + "http-errors": "1.7.2", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/raw-body/node_modules/bytes": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.0.tgz", + "integrity": "sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/raw-loader": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/raw-loader/-/raw-loader-4.0.0.tgz", + "integrity": "sha512-iINUOYvl1cGEmfoaLjnZXt4bKfT2LJnZZib5N/LLyAphC+Dd11vNP9CNVb38j+SAJpFI1uo8j9frmih53ASy7Q==", + "dependencies": { + "loader-utils": "^1.2.3", + "schema-utils": "^2.5.0" + }, + "engines": { + "node": ">= 10.13.0" + } + }, + "node_modules/raw-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/raw-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/read-cache": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/read-cache/-/read-cache-1.0.0.tgz", + "integrity": "sha1-5mTvMRYRZsl1HNvo28+GtftY93Q=", + "dependencies": { + "pify": "^2.3.0" + } + }, + "node_modules/read-cache/node_modules/pify": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", + "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/read-package-json": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/read-package-json/-/read-package-json-2.1.2.tgz", + "integrity": "sha512-D1KmuLQr6ZSJS0tW8hf3WGpRlwszJOXZ3E8Yd/DNRaM5d+1wVRZdHlpGBLAuovjr28LbWvjpWkBHMxpRGGjzNA==", + "dependencies": { + "glob": "^7.1.1", + "json-parse-even-better-errors": "^2.3.0", + "normalize-package-data": "^2.0.0", + "npm-normalize-package-bin": "^1.0.0" + } + }, + "node_modules/read-package-tree": { + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/read-package-tree/-/read-package-tree-5.3.1.tgz", + "integrity": "sha512-mLUDsD5JVtlZxjSlPPx1RETkNjjvQYuweKwNVt1Sn8kP5Jh44pvYuUHCp6xSVDZWbNxVxG5lyZJ921aJH61sTw==", + "dependencies": { + "read-package-json": "^2.0.0", + "readdir-scoped-modules": "^1.0.0", + "util-promisify": "^2.1.0" + } + }, + "node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/readdir-scoped-modules": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/readdir-scoped-modules/-/readdir-scoped-modules-1.1.0.tgz", + "integrity": "sha512-asaikDeqAQg7JifRsZn1NJZXo9E+VwlyCfbkZhwyISinqk5zNS6266HS5kah6P0SaQKGF6SkNnZVHUzHFYxYDw==", + "dependencies": { + "debuglog": "^1.0.1", + "dezalgo": "^1.0.0", + "graceful-fs": "^4.1.2", + "once": "^1.3.0" + } + }, + "node_modules/readdirp": { + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.5.0.tgz", + "integrity": "sha512-cMhu7c/8rdhkHXWsY+osBhfSy0JikwpHK/5+imo+LpeasTF8ouErHrlYkwT0++njiyuDvc7OFY5T3ukvZ8qmFQ==", + "dependencies": { + "picomatch": "^2.2.1" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/reflect-metadata": { + "version": "0.1.13", + "resolved": "https://registry.npmjs.org/reflect-metadata/-/reflect-metadata-0.1.13.tgz", + "integrity": "sha512-Ts1Y/anZELhSsjMcU605fU9RE4Oi3p5ORujwbIKXfWa+0Zxs510Qrmrce5/Jowq3cHSZSJqBjypxmHarc+vEWg==" + }, + "node_modules/regenerate": { + "version": "1.4.2", + "resolved": "https://registry.npmjs.org/regenerate/-/regenerate-1.4.2.tgz", + "integrity": "sha512-zrceR/XhGYU/d/opr2EKO7aRHUeiBI8qjtfHqADTwZd6Szfy16la6kqD0MIUs5z5hx6AaKa+PixpPrR289+I0A==" + }, + "node_modules/regenerate-unicode-properties": { + "version": "8.2.0", + "resolved": "https://registry.npmjs.org/regenerate-unicode-properties/-/regenerate-unicode-properties-8.2.0.tgz", + "integrity": "sha512-F9DjY1vKLo/tPePDycuH3dn9H1OTPIkVD9Kz4LODu+F2C75mgjAJ7x/gwy6ZcSNRAAkhNlJSOHRe8k3p+K9WhA==", + "dependencies": { + "regenerate": "^1.4.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/regenerator-runtime": { + "version": "0.13.5", + "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.5.tgz", + "integrity": "sha512-ZS5w8CpKFinUzOwW3c83oPeVXoNsrLsaCoLtJvAClH135j/R77RuymhiSErhm2lKcwSCIpmvIWSbDkIfAqKQlA==" + }, + "node_modules/regenerator-transform": { + "version": "0.14.5", + "resolved": "https://registry.npmjs.org/regenerator-transform/-/regenerator-transform-0.14.5.tgz", + "integrity": "sha512-eOf6vka5IO151Jfsw2NO9WpGX58W6wWmefK3I1zEGr0lOD0u8rwPaNqQL1aRxUaxLeKO3ArNh3VYg1KbaD+FFw==", + "dependencies": { + "@babel/runtime": "^7.8.4" + } + }, + "node_modules/regex-not": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz", + "integrity": "sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==", + "dependencies": { + "extend-shallow": "^3.0.2", + "safe-regex": "^1.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/regexp.prototype.flags": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/regexp.prototype.flags/-/regexp.prototype.flags-1.3.0.tgz", + "integrity": "sha512-2+Q0C5g951OlYlJz6yu5/M33IcsESLlLfsyIaLJaG4FA2r4yP8MvVMJUUP/fVBkSpbbbZlS5gynbEWLipiiXiQ==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.0-next.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/regexpu-core": { + "version": "4.7.1", + "resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-4.7.1.tgz", + "integrity": "sha512-ywH2VUraA44DZQuRKzARmw6S66mr48pQVva4LBeRhcOltJ6hExvWly5ZjFLYo67xbIxb6W1q4bAGtgfEl20zfQ==", + "dependencies": { + "regenerate": "^1.4.0", + "regenerate-unicode-properties": "^8.2.0", + "regjsgen": "^0.5.1", + "regjsparser": "^0.6.4", + "unicode-match-property-ecmascript": "^1.0.4", + "unicode-match-property-value-ecmascript": "^1.2.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/regjsgen": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.5.2.tgz", + "integrity": "sha512-OFFT3MfrH90xIW8OOSyUrk6QHD5E9JOTeGodiJeBS3J6IwlgzJMNE/1bZklWz5oTg+9dCMyEetclvCVXOPoN3A==" + }, + "node_modules/regjsparser": { + "version": "0.6.4", + "resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.6.4.tgz", + "integrity": "sha512-64O87/dPDgfk8/RQqC4gkZoGyyWFIEUTTh80CU6CWuK5vkCGyekIx+oKcEIYtP/RAxSQltCZHCNu/mdd7fqlJw==", + "dependencies": { + "jsesc": "~0.5.0" + }, + "bin": { + "regjsparser": "bin/parser" + } + }, + "node_modules/regjsparser/node_modules/jsesc": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz", + "integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=", + "bin": { + "jsesc": "bin/jsesc" + } + }, + "node_modules/remove-trailing-separator": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz", + "integrity": "sha1-wkvOKig62tW8P1jg1IJJuSN52O8=" + }, + "node_modules/repeat-element": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/repeat-element/-/repeat-element-1.1.3.tgz", + "integrity": "sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/repeat-string": { + "version": "1.6.1", + "resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-1.6.1.tgz", + "integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=", + "engines": { + "node": ">=0.10" + } + }, + "node_modules/request": { + "version": "2.88.2", + "resolved": "https://registry.npmjs.org/request/-/request-2.88.2.tgz", + "integrity": "sha512-MsvtOrfG9ZcrOwAW+Qi+F6HbD0CWXEh9ou77uOb7FM2WPhwT7smM833PzanhJLsgXjN89Ir6V2PczXNnMpwKhw==", + "dependencies": { + "aws-sign2": "~0.7.0", + "aws4": "^1.8.0", + "caseless": "~0.12.0", + "combined-stream": "~1.0.6", + "extend": "~3.0.2", + "forever-agent": "~0.6.1", + "form-data": "~2.3.2", + "har-validator": "~5.1.3", + "http-signature": "~1.2.0", + "is-typedarray": "~1.0.0", + "isstream": "~0.1.2", + "json-stringify-safe": "~5.0.1", + "mime-types": "~2.1.19", + "oauth-sign": "~0.9.0", + "performance-now": "^2.1.0", + "qs": "~6.5.2", + "safe-buffer": "^5.1.2", + "tough-cookie": "~2.5.0", + "tunnel-agent": "^0.6.0", + "uuid": "^3.3.2" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/request/node_modules/uuid": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.4.0.tgz", + "integrity": "sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A==", + "bin": { + "uuid": "bin/uuid" + } + }, + "node_modules/require-directory": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", + "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/require-main-filename": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-1.0.1.tgz", + "integrity": "sha1-l/cXtp1IeE9fUmpsWqj/3aBVpNE=" + }, + "node_modules/requires-port": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/requires-port/-/requires-port-1.0.0.tgz", + "integrity": "sha1-kl0mAdOaxIXgkc8NpcbmlNw9yv8=" + }, + "node_modules/resolve": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.19.0.tgz", + "integrity": "sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==", + "dependencies": { + "is-core-module": "^2.1.0", + "path-parse": "^1.0.6" + } + }, + "node_modules/resolve-cwd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz", + "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=", + "dependencies": { + "resolve-from": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/resolve-from": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz", + "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=", + "engines": { + "node": ">=4" + } + }, + "node_modules/resolve-url": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/resolve-url/-/resolve-url-0.2.1.tgz", + "integrity": "sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo=" + }, + "node_modules/restore-cursor": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/restore-cursor/-/restore-cursor-3.1.0.tgz", + "integrity": "sha512-l+sSefzHpj5qimhFSE5a8nufZYAM3sBSVMAPtYkmC+4EH2anSGaEMXSD0izRQbu9nfyQ9y5JrVmp7E8oZrUjvA==", + "dependencies": { + "onetime": "^5.1.0", + "signal-exit": "^3.0.2" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ret": { + "version": "0.1.15", + "resolved": "https://registry.npmjs.org/ret/-/ret-0.1.15.tgz", + "integrity": "sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==", + "engines": { + "node": ">=0.12" + } + }, + "node_modules/retry": { + "version": "0.12.0", + "resolved": "https://registry.npmjs.org/retry/-/retry-0.12.0.tgz", + "integrity": "sha1-G0KmJmoh8HQh0bC1S33BZ7AcATs=", + "engines": { + "node": ">= 4" + } + }, + "node_modules/rgb-regex": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/rgb-regex/-/rgb-regex-1.0.1.tgz", + "integrity": "sha1-wODWiC3w4jviVKR16O3UGRX+rrE=" + }, + "node_modules/rgba-regex": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/rgba-regex/-/rgba-regex-1.0.0.tgz", + "integrity": "sha1-QzdOLiyglosO8VI0YLfXMP8i7rM=" + }, + "node_modules/rimraf": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", + "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/ripemd160": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz", + "integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==", + "dependencies": { + "hash-base": "^3.0.0", + "inherits": "^2.0.1" + } + }, + "node_modules/rollup": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/rollup/-/rollup-2.1.0.tgz", + "integrity": "sha512-gfE1455AEazVVTJoeQtcOq/U6GSxwoj4XPSWVsuWmgIxj7sBQNLDOSA82PbdMe+cP8ql8fR1jogPFe8Wg8g4SQ==", + "bin": { + "rollup": "dist/bin/rollup" + }, + "engines": { + "node": ">=10.0.0" + }, + "optionalDependencies": { + "fsevents": "~2.1.2" + } + }, + "node_modules/run-async": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/run-async/-/run-async-2.4.1.tgz", + "integrity": "sha512-tvVnVv01b8c1RrA6Ep7JkStj85Guv/YrMcwqYQnwjsAS2cTmmPGBBjAjpCW7RrSodNSoE2/qg9O4bceNvUuDgQ==", + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/run-queue": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/run-queue/-/run-queue-1.0.3.tgz", + "integrity": "sha1-6Eg5bwV9Ij8kOGkkYY4laUFh7Ec=", + "dependencies": { + "aproba": "^1.1.1" + } + }, + "node_modules/rxjs": { + "version": "6.5.5", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.5.5.tgz", + "integrity": "sha512-WfQI+1gohdf0Dai/Bbmk5L5ItH5tYqm3ki2c5GdWhKjalzjg93N3avFjVStyZZz+A2Em+ZxKH5bNghw9UeylGQ==", + "dependencies": { + "tslib": "^1.9.0" + }, + "engines": { + "npm": ">=2.0.0" + } + }, + "node_modules/safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==" + }, + "node_modules/safe-regex": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz", + "integrity": "sha1-QKNmnzsHfR6UPURinhV91IAjvy4=", + "dependencies": { + "ret": "~0.1.10" + } + }, + "node_modules/safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==" + }, + "node_modules/sass": { + "version": "1.26.3", + "resolved": "https://registry.npmjs.org/sass/-/sass-1.26.3.tgz", + "integrity": "sha512-5NMHI1+YFYw4sN3yfKjpLuV9B5l7MqQ6FlkTcC4FT+oHbBRUZoSjHrrt/mE0nFXJyY2kQtU9ou9HxvFVjLFuuw==", + "dependencies": { + "chokidar": ">=2.0.0 <4.0.0" + }, + "bin": { + "sass": "sass.js" + }, + "engines": { + "node": ">=8.9.0" + } + }, + "node_modules/sass-loader": { + "version": "8.0.2", + "resolved": "https://registry.npmjs.org/sass-loader/-/sass-loader-8.0.2.tgz", + "integrity": "sha512-7o4dbSK8/Ol2KflEmSco4jTjQoV988bM82P9CZdmo9hR3RLnvNc0ufMNdMrB0caq38JQ/FgF4/7RcbcfKzxoFQ==", + "dependencies": { + "clone-deep": "^4.0.1", + "loader-utils": "^1.2.3", + "neo-async": "^2.6.1", + "schema-utils": "^2.6.1", + "semver": "^6.3.0" + }, + "engines": { + "node": ">= 8.9.0" + } + }, + "node_modules/sass-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/sass-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/sass-loader/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/sax": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/sax/-/sax-1.2.4.tgz", + "integrity": "sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==" + }, + "node_modules/schema-utils": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-2.7.1.tgz", + "integrity": "sha512-SHiNtMOUGWBQJwzISiVYKu82GiV4QYGePp3odlY1tuKO7gPtphAT5R/py0fA6xtbgLL/RvtJZnU9b8s0F1q0Xg==", + "dependencies": { + "@types/json-schema": "^7.0.5", + "ajv": "^6.12.4", + "ajv-keywords": "^3.5.2" + }, + "engines": { + "node": ">= 8.9.0" + } + }, + "node_modules/schema-utils/node_modules/ajv": { + "version": "6.12.6", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", + "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", + "dependencies": { + "fast-deep-equal": "^3.1.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" + } + }, + "node_modules/select-hose": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/select-hose/-/select-hose-2.0.0.tgz", + "integrity": "sha1-Yl2GWPhlr0Psliv8N2o3NZpJlMo=" + }, + "node_modules/selfsigned": { + "version": "1.10.8", + "resolved": "https://registry.npmjs.org/selfsigned/-/selfsigned-1.10.8.tgz", + "integrity": "sha512-2P4PtieJeEwVgTU9QEcwIRDQ/mXJLX8/+I3ur+Pg16nS8oNbrGxEso9NyYWy8NAmXiNl4dlAp5MwoNeCWzON4w==", + "dependencies": { + "node-forge": "^0.10.0" + } + }, + "node_modules/semver": { + "version": "7.1.3", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.1.3.tgz", + "integrity": "sha512-ekM0zfiA9SCBlsKa2X1hxyxiI4L3B6EbVJkkdgQXnSEEaHlGdvyodMruTiulSRWMMB4NeIuYNMC9rTKTz97GxA==", + "bin": { + "semver": "bin/semver.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/semver-intersect": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/semver-intersect/-/semver-intersect-1.4.0.tgz", + "integrity": "sha512-d8fvGg5ycKAq0+I6nfWeCx6ffaWJCsBYU0H2Rq56+/zFePYfT8mXkB3tWBSjR5BerkHNZ5eTPIk1/LBYas35xQ==", + "dependencies": { + "semver": "^5.0.0" + } + }, + "node_modules/semver-intersect/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/send": { + "version": "0.17.1", + "resolved": "https://registry.npmjs.org/send/-/send-0.17.1.tgz", + "integrity": "sha512-BsVKsiGcQMFwT8UxypobUKyv7irCNRHk1T0G680vk88yf6LBByGcZJOTJCrTP2xVN6yI+XjPJcNuE3V4fT9sAg==", + "dependencies": { + "debug": "2.6.9", + "depd": "~1.1.2", + "destroy": "~1.0.4", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "~1.7.2", + "mime": "1.6.0", + "ms": "2.1.1", + "on-finished": "~2.3.0", + "range-parser": "~1.2.1", + "statuses": "~1.5.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/send/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/send/node_modules/debug/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/send/node_modules/ms": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.1.tgz", + "integrity": "sha512-tgp+dl5cGk28utYktBsrFqA7HKgrhgPsg6Z/EfhWI4gl1Hwq8B/GmY/0oXZ6nF8hDVesS/FpnYaD/kOWhYQvyg==" + }, + "node_modules/serialize-javascript": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-2.1.2.tgz", + "integrity": "sha512-rs9OggEUF0V4jUSecXazOYsLfu7OGK2qIn3c7IPBiffz32XniEp/TX9Xmc9LQfK2nQ2QKHvZ2oygKUGU0lG4jQ==" + }, + "node_modules/serve-index": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/serve-index/-/serve-index-1.9.1.tgz", + "integrity": "sha1-03aNabHn2C5c4FD/9bRTvqEqkjk=", + "dependencies": { + "accepts": "~1.3.4", + "batch": "0.6.1", + "debug": "2.6.9", + "escape-html": "~1.0.3", + "http-errors": "~1.6.2", + "mime-types": "~2.1.17", + "parseurl": "~1.3.2" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/serve-index/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/serve-index/node_modules/http-errors": { + "version": "1.6.3", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.3.tgz", + "integrity": "sha1-i1VoC7S+KDoLW/TqLjhYC+HZMg0=", + "dependencies": { + "depd": "~1.1.2", + "inherits": "2.0.3", + "setprototypeof": "1.1.0", + "statuses": ">= 1.4.0 < 2" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/serve-index/node_modules/inherits": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" + }, + "node_modules/serve-index/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/serve-index/node_modules/setprototypeof": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.0.tgz", + "integrity": "sha512-BvE/TwpZX4FXExxOxZyRGQQv651MSwmWKZGqvmPcRIjDqWub67kTKuIMx43cZZrS/cBBzwBcNDWoFxt2XEFIpQ==" + }, + "node_modules/serve-static": { + "version": "1.14.1", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.14.1.tgz", + "integrity": "sha512-JMrvUwE54emCYWlTI+hGrGv5I8dEwmco/00EvkzIIsR7MqrHonbD9pO2MOfFnpFntl7ecpZs+3mW+XbQZu9QCg==", + "dependencies": { + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.17.1" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/set-blocking": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", + "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=" + }, + "node_modules/set-value": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/set-value/-/set-value-2.0.1.tgz", + "integrity": "sha512-JxHc1weCN68wRY0fhCoXpyK55m/XPHafOmK4UWD7m2CI14GMcFypt4w/0+NV5f/ZMby2F6S2wwA7fgynh9gWSw==", + "dependencies": { + "extend-shallow": "^2.0.1", + "is-extendable": "^0.1.1", + "is-plain-object": "^2.0.3", + "split-string": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/set-value/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/setimmediate": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz", + "integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU=" + }, + "node_modules/setprototypeof": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.1.tgz", + "integrity": "sha512-JvdAWfbXeIGaZ9cILp38HntZSFSo3mWg6xGcJJsd+d4aRMOqauag1C63dJfDw7OaMYwEbHMOxEZ1lqVRYP2OAw==" + }, + "node_modules/sha.js": { + "version": "2.4.11", + "resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz", + "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==", + "dependencies": { + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" + }, + "bin": { + "sha.js": "bin.js" + } + }, + "node_modules/shallow-clone": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/shallow-clone/-/shallow-clone-3.0.1.tgz", + "integrity": "sha512-/6KqX+GVUdqPuPPd2LxDDxzX6CAbjJehAAOKlNpqqUpAqPM6HeL8f+o3a+JsyGjn2lv0WY8UsTgUJjU9Ok55NA==", + "dependencies": { + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/shebang-command": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz", + "integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=", + "dependencies": { + "shebang-regex": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/shebang-regex": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz", + "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/signal-exit": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.3.tgz", + "integrity": "sha512-VUJ49FC8U1OxwZLxIbTTrDvLnf/6TDgxZcK8wxR8zs13xpx7xbG60ndBlhNrFi2EMuFRoeDoJO7wthSLq42EjA==" + }, + "node_modules/simple-swizzle": { + "version": "0.2.2", + "resolved": "https://registry.npmjs.org/simple-swizzle/-/simple-swizzle-0.2.2.tgz", + "integrity": "sha1-pNprY1/8zMoz9w0Xy5JZLeleVXo=", + "dependencies": { + "is-arrayish": "^0.3.1" + } + }, + "node_modules/simple-swizzle/node_modules/is-arrayish": { + "version": "0.3.2", + "resolved": "https://registry.npmjs.org/is-arrayish/-/is-arrayish-0.3.2.tgz", + "integrity": "sha512-eVRqCvVlZbuw3GrM63ovNSNAeA1K16kaR/LRY/92w0zxQ5/1YzwblUX652i4Xs9RwAGjW9d9y6X88t8OaAJfWQ==" + }, + "node_modules/slash": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/slash/-/slash-1.0.0.tgz", + "integrity": "sha1-xB8vbDn8FtHNF61LXYlhFK5HDVU=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/smart-buffer": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/smart-buffer/-/smart-buffer-4.1.0.tgz", + "integrity": "sha512-iVICrxOzCynf/SNaBQCw34eM9jROU/s5rzIhpOvzhzuYHfJR/DhZfDkXiZSgKXfgv26HT3Yni3AV/DGw0cGnnw==", + "engines": { + "node": ">= 6.0.0", + "npm": ">= 3.0.0" + } + }, + "node_modules/snapdragon": { + "version": "0.8.2", + "resolved": "https://registry.npmjs.org/snapdragon/-/snapdragon-0.8.2.tgz", + "integrity": "sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==", + "dependencies": { + "base": "^0.11.1", + "debug": "^2.2.0", + "define-property": "^0.2.5", + "extend-shallow": "^2.0.1", + "map-cache": "^0.2.2", + "source-map": "^0.5.6", + "source-map-resolve": "^0.5.0", + "use": "^3.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/snapdragon-node/-/snapdragon-node-2.1.1.tgz", + "integrity": "sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==", + "dependencies": { + "define-property": "^1.0.0", + "isobject": "^3.0.0", + "snapdragon-util": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node/node_modules/define-property": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", + "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", + "dependencies": { + "is-descriptor": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node/node_modules/is-accessor-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", + "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node/node_modules/is-data-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", + "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node/node_modules/is-descriptor": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", + "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", + "dependencies": { + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-util": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/snapdragon-util/-/snapdragon-util-3.0.1.tgz", + "integrity": "sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==", + "dependencies": { + "kind-of": "^3.2.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-util/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/snapdragon/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/snapdragon/node_modules/source-map": { + "version": "0.5.7", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", + "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/sockjs": { + "version": "0.3.19", + "resolved": "https://registry.npmjs.org/sockjs/-/sockjs-0.3.19.tgz", + "integrity": "sha512-V48klKZl8T6MzatbLlzzRNhMepEys9Y4oGFpypBFFn1gLI/QQ9HtLLyWJNbPlwGLelOVOEijUbTTJeLLI59jLw==", + "dependencies": { + "faye-websocket": "^0.10.0", + "uuid": "^3.0.1" + } + }, + "node_modules/sockjs-client": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/sockjs-client/-/sockjs-client-1.4.0.tgz", + "integrity": "sha512-5zaLyO8/nri5cua0VtOrFXBPK1jbL4+1cebT/mmKA1E1ZXOvJrII75bPu0l0k843G/+iAbhEqzyKr0w/eCCj7g==", + "dependencies": { + "debug": "^3.2.5", + "eventsource": "^1.0.7", + "faye-websocket": "~0.11.1", + "inherits": "^2.0.3", + "json3": "^3.3.2", + "url-parse": "^1.4.3" + } + }, + "node_modules/sockjs-client/node_modules/debug": { + "version": "3.2.7", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz", + "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/sockjs-client/node_modules/faye-websocket": { + "version": "0.11.3", + "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.11.3.tgz", + "integrity": "sha512-D2y4bovYpzziGgbHYtGCMjlJM36vAl/y+xUyn1C+FVx8szd1E+86KwVw6XvYSzOP8iMpm1X0I4xJD+QtUb36OA==", + "dependencies": { + "websocket-driver": ">=0.5.1" + }, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/sockjs/node_modules/uuid": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.4.0.tgz", + "integrity": "sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A==", + "bin": { + "uuid": "bin/uuid" + } + }, + "node_modules/socks": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/socks/-/socks-2.3.3.tgz", + "integrity": "sha512-o5t52PCNtVdiOvzMry7wU4aOqYWL0PeCXRWBEiJow4/i/wr+wpsJQ9awEu1EonLIqsfGd5qSgDdxEOvCdmBEpA==", + "dependencies": { + "ip": "1.1.5", + "smart-buffer": "^4.1.0" + }, + "engines": { + "node": ">= 6.0.0", + "npm": ">= 3.0.0" + } + }, + "node_modules/socks-proxy-agent": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/socks-proxy-agent/-/socks-proxy-agent-4.0.2.tgz", + "integrity": "sha512-NT6syHhI9LmuEMSK6Kd2V7gNv5KFZoLE7V5udWmn0de+3Mkj3UMA/AJPLyeNUVmElCurSHtUdM3ETpR3z770Wg==", + "dependencies": { + "agent-base": "~4.2.1", + "socks": "~2.3.2" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/socks-proxy-agent/node_modules/agent-base": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-4.2.1.tgz", + "integrity": "sha512-JVwXMr9nHYTUXsBFKUqhJwvlcYU/blreOEUkhNR2eXZIvwd+c+o5V4MgDPKWnMS/56awN3TRzIP+KoPn+roQtg==", + "dependencies": { + "es6-promisify": "^5.0.0" + }, + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/sort-keys": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/sort-keys/-/sort-keys-1.1.2.tgz", + "integrity": "sha1-RBttTTRnmPG05J6JIK37oOVD+a0=", + "dependencies": { + "is-plain-obj": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/source-list-map": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-2.0.1.tgz", + "integrity": "sha512-qnQ7gVMxGNxsiL4lEuJwe/To8UnK7fAnmbGEEH8RpLouuKbeEm0lhbQVFIrNSuB+G7tVrAlVsZgETT5nljf+Iw==" + }, + "node_modules/source-map": { + "version": "0.7.3", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.7.3.tgz", + "integrity": "sha512-CkCj6giN3S+n9qrYiBTX5gystlENnRW5jZeNLHpe6aue+SrHcG5VYwujhW9s4dY31mEGsxBDrHR6oI69fTXsaQ==", + "engines": { + "node": ">= 8" + } + }, + "node_modules/source-map-loader": { + "version": "0.2.4", + "resolved": "https://registry.npmjs.org/source-map-loader/-/source-map-loader-0.2.4.tgz", + "integrity": "sha512-OU6UJUty+i2JDpTItnizPrlpOIBLmQbWMuBg9q5bVtnHACqw1tn9nNwqJLbv0/00JjnJb/Ee5g5WS5vrRv7zIQ==", + "dependencies": { + "async": "^2.5.0", + "loader-utils": "^1.1.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/source-map-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/source-map-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/source-map-resolve": { + "version": "0.5.3", + "resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.3.tgz", + "integrity": "sha512-Htz+RnsXWk5+P2slx5Jh3Q66vhQj1Cllm0zvnaY98+NFx+Dv2CF/f5O/t8x+KaNdrdIAsruNzoh/KpialbqAnw==", + "dependencies": { + "atob": "^2.1.2", + "decode-uri-component": "^0.2.0", + "resolve-url": "^0.2.1", + "source-map-url": "^0.4.0", + "urix": "^0.1.0" + } + }, + "node_modules/source-map-support": { + "version": "0.5.19", + "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.19.tgz", + "integrity": "sha512-Wonm7zOCIJzBGQdB+thsPar0kYuCIzYvxZwlBa87yi/Mdjv7Tip2cyVbLj5o0cFPN4EVkuTwb3GDDyUx2DGnGw==", + "dependencies": { + "buffer-from": "^1.0.0", + "source-map": "^0.6.0" + } + }, + "node_modules/source-map-support/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/source-map-url": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/source-map-url/-/source-map-url-0.4.0.tgz", + "integrity": "sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=" + }, + "node_modules/sourcemap-codec": { + "version": "1.4.8", + "resolved": "https://registry.npmjs.org/sourcemap-codec/-/sourcemap-codec-1.4.8.tgz", + "integrity": "sha512-9NykojV5Uih4lgo5So5dtw+f0JgJX30KCNI8gwhz2J9A15wD0Ml6tjHKwf6fTSa6fAdVBdZeNOs9eJ71qCk8vA==" + }, + "node_modules/spdx-correct": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/spdx-correct/-/spdx-correct-3.1.1.tgz", + "integrity": "sha512-cOYcUWwhCuHCXi49RhFRCyJEK3iPj1Ziz9DpViV3tbZOwXD49QzIN3MpOLJNxh2qwq2lJJZaKMVw9qNi4jTC0w==", + "dependencies": { + "spdx-expression-parse": "^3.0.0", + "spdx-license-ids": "^3.0.0" + } + }, + "node_modules/spdx-exceptions": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/spdx-exceptions/-/spdx-exceptions-2.3.0.tgz", + "integrity": "sha512-/tTrYOC7PPI1nUAgx34hUpqXuyJG+DTHJTnIULG4rDygi4xu/tfgmq1e1cIRwRzwZgo4NLySi+ricLkZkw4i5A==" + }, + "node_modules/spdx-expression-parse": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/spdx-expression-parse/-/spdx-expression-parse-3.0.1.tgz", + "integrity": "sha512-cbqHunsQWnJNE6KhVSMsMeH5H/L9EpymbzqTQ3uLwNCLZ1Q481oWaofqH7nO6V07xlXwY6PhQdQ2IedWx/ZK4Q==", + "dependencies": { + "spdx-exceptions": "^2.1.0", + "spdx-license-ids": "^3.0.0" + } + }, + "node_modules/spdx-license-ids": { + "version": "3.0.6", + "resolved": "https://registry.npmjs.org/spdx-license-ids/-/spdx-license-ids-3.0.6.tgz", + "integrity": "sha512-+orQK83kyMva3WyPf59k1+Y525csj5JejicWut55zeTWANuN17qSiSLUXWtzHeNWORSvT7GLDJ/E/XiIWoXBTw==" + }, + "node_modules/spdy": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/spdy/-/spdy-4.0.2.tgz", + "integrity": "sha512-r46gZQZQV+Kl9oItvl1JZZqJKGr+oEkB08A6BzkiR7593/7IbtuncXHd2YoYeTsG4157ZssMu9KYvUHLcjcDoA==", + "dependencies": { + "debug": "^4.1.0", + "handle-thing": "^2.0.0", + "http-deceiver": "^1.2.7", + "select-hose": "^2.0.0", + "spdy-transport": "^3.0.0" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/spdy-transport": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/spdy-transport/-/spdy-transport-3.0.0.tgz", + "integrity": "sha512-hsLVFE5SjA6TCisWeJXFKniGGOpBgMLmerfO2aCyCU5s7nJ/rpAepqmFifv/GCbSbueEeAJJnmSQ2rKC/g8Fcw==", + "dependencies": { + "debug": "^4.1.0", + "detect-node": "^2.0.4", + "hpack.js": "^2.1.6", + "obuf": "^1.1.2", + "readable-stream": "^3.0.6", + "wbuf": "^1.7.3" + } + }, + "node_modules/spdy-transport/node_modules/readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dependencies": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/speed-measure-webpack-plugin": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/speed-measure-webpack-plugin/-/speed-measure-webpack-plugin-1.3.1.tgz", + "integrity": "sha512-qVIkJvbtS9j/UeZumbdfz0vg+QfG/zxonAjzefZrqzkr7xOncLVXkeGbTpzd1gjCBM4PmVNkWlkeTVhgskAGSQ==", + "dependencies": { + "chalk": "^2.0.1" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/split-string": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz", + "integrity": "sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==", + "dependencies": { + "extend-shallow": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/sprintf-js": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz", + "integrity": "sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=" + }, + "node_modules/sshpk": { + "version": "1.16.1", + "resolved": "https://registry.npmjs.org/sshpk/-/sshpk-1.16.1.tgz", + "integrity": "sha512-HXXqVUq7+pcKeLqqZj6mHFUMvXtOJt1uoUx09pFW6011inTMxqI8BA8PM95myrIyyKwdnzjdFjLiE6KBPVtJIg==", + "dependencies": { + "asn1": "~0.2.3", + "assert-plus": "^1.0.0", + "bcrypt-pbkdf": "^1.0.0", + "dashdash": "^1.12.0", + "ecc-jsbn": "~0.1.1", + "getpass": "^0.1.1", + "jsbn": "~0.1.0", + "safer-buffer": "^2.0.2", + "tweetnacl": "~0.14.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/ssri": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/ssri/-/ssri-8.0.0.tgz", + "integrity": "sha512-aq/pz989nxVYwn16Tsbj1TqFpD5LLrQxHf5zaHuieFV+R0Bbr4y8qUsOA45hXT/N4/9UNXTarBjnjVmjSOVaAA==", + "dependencies": { + "minipass": "^3.1.1" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/stable": { + "version": "0.1.8", + "resolved": "https://registry.npmjs.org/stable/-/stable-0.1.8.tgz", + "integrity": "sha512-ji9qxRnOVfcuLDySj9qzhGSEFVobyt1kIOSkj1qZzYLzq7Tos/oUUWvotUPQLlrsidqsK6tBH89Bc9kL5zHA6w==" + }, + "node_modules/static-extend": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/static-extend/-/static-extend-0.1.2.tgz", + "integrity": "sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=", + "dependencies": { + "define-property": "^0.2.5", + "object-copy": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/static-extend/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/statuses": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.5.0.tgz", + "integrity": "sha1-Fhx9rBd2Wf2YEfQ3cfqZOBR4Yow=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/ste-core": { + "version": "1.6.11", + "resolved": "https://registry.npmjs.org/ste-core/-/ste-core-1.6.11.tgz", + "integrity": "sha512-hY/HiY8h7AC0dozwUTcVIjKf9QqyipLZ+5FS8VKOpm5yx38zRgtJ81KJmG162efAUqbNiijOWq/MccO1Zgx1bg==", + "engines": { + "node": ">=4.2.4" + } + }, + "node_modules/ste-events": { + "version": "1.6.11", + "resolved": "https://registry.npmjs.org/ste-events/-/ste-events-1.6.11.tgz", + "integrity": "sha512-seOP2iRYQNOJbhSgGN5ZWHnvAUCJ9tOUpiKoahQ+x69Nm/Rr0NFksMjnce7TJd7n1j6SUaWAUEuY0cw4AS/a+Q==", + "dependencies": { + "ste-core": "^1.6.10" + }, + "engines": { + "node": ">=4.2.4" + } + }, + "node_modules/ste-signals": { + "version": "1.6.11", + "resolved": "https://registry.npmjs.org/ste-signals/-/ste-signals-1.6.11.tgz", + "integrity": "sha512-R/PpeHMdaTCbtNIfkrO/vbnwRa9PxcOVOCYJRL00TIhfsbD7azRDRma1lIzP5rQHqpGr+iTuDbprVcMCvjZr4g==", + "dependencies": { + "ste-core": "^1.6.10" + }, + "engines": { + "node": ">=4.2.4" + } + }, + "node_modules/ste-simple-events": { + "version": "1.6.11", + "resolved": "https://registry.npmjs.org/ste-simple-events/-/ste-simple-events-1.6.11.tgz", + "integrity": "sha512-u12WI/7p3GGk1Y32BPM4chYuk5Hq6EW6yAbBnlSWqZPv//hzhcpxMOEOTeT3M2di+EpVcwjmtE8ELLW+Tu60EQ==", + "dependencies": { + "ste-core": "^1.6.10" + }, + "engines": { + "node": ">=4.2.4" + } + }, + "node_modules/stream-browserify": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.2.tgz", + "integrity": "sha512-nX6hmklHs/gr2FuxYDltq8fJA1GDlxKQCz8O/IM4atRqBH8OORmBNgfvW5gG10GT/qQ9u0CzIvr2X5Pkt6ntqg==", + "dependencies": { + "inherits": "~2.0.1", + "readable-stream": "^2.0.2" + } + }, + "node_modules/stream-each": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/stream-each/-/stream-each-1.2.3.tgz", + "integrity": "sha512-vlMC2f8I2u/bZGqkdfLQW/13Zihpej/7PmSiMQsbYddxuTsJp8vRe2x2FvVExZg7FaOds43ROAuFJwPR4MTZLw==", + "dependencies": { + "end-of-stream": "^1.1.0", + "stream-shift": "^1.0.0" + } + }, + "node_modules/stream-http": { + "version": "2.8.3", + "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz", + "integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==", + "dependencies": { + "builtin-status-codes": "^3.0.0", + "inherits": "^2.0.1", + "readable-stream": "^2.3.6", + "to-arraybuffer": "^1.0.0", + "xtend": "^4.0.0" + } + }, + "node_modules/stream-shift": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.1.tgz", + "integrity": "sha512-AiisoFqQ0vbGcZgQPY1cdP2I76glaVA/RauYR4G4thNFgkTqr90yXTo4LYX60Jl+sIlPNHHdGSwo01AvbKUSVQ==" + }, + "node_modules/strict-uri-encode": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/strict-uri-encode/-/strict-uri-encode-1.1.0.tgz", + "integrity": "sha1-J5siXfHVgrH1TmWt3UNS4Y+qBxM=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/string-width": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz", + "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==", + "dependencies": { + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^4.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/string-width/node_modules/ansi-regex": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz", + "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=", + "engines": { + "node": ">=4" + } + }, + "node_modules/string-width/node_modules/strip-ansi": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz", + "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", + "dependencies": { + "ansi-regex": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/string.prototype.trimend": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/string.prototype.trimend/-/string.prototype.trimend-1.0.3.tgz", + "integrity": "sha512-ayH0pB+uf0U28CtjlLvL7NaohvR1amUvVZk+y3DYb0Ey2PUV5zPkkKy9+U1ndVEIXO8hNg18eIv9Jntbii+dKw==", + "dependencies": { + "call-bind": "^1.0.0", + "define-properties": "^1.1.3" + } + }, + "node_modules/string.prototype.trimstart": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/string.prototype.trimstart/-/string.prototype.trimstart-1.0.3.tgz", + "integrity": "sha512-oBIBUy5lea5tt0ovtOFiEQaBkoBBkyJhZXzJYrSmDo5IUUqbOPvVezuRs/agBIdZ2p2Eo1FD6bD9USyBLfl3xg==", + "dependencies": { + "call-bind": "^1.0.0", + "define-properties": "^1.1.3" + } + }, + "node_modules/strip-ansi": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", + "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", + "dependencies": { + "ansi-regex": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/strip-eof": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz", + "integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/strongly-typed-events": { + "version": "1.6.11", + "resolved": "https://registry.npmjs.org/strongly-typed-events/-/strongly-typed-events-1.6.11.tgz", + "integrity": "sha512-MpFClTaPVXDvR1rzmc5vjKKGH+WyBHc3nmFSdURLTBbiHJMCA7ZwY8mP9tRnI369fYJ5VeEYU+tCplr1VXF6jA==", + "dependencies": { + "ste-core": "^1.6.10", + "ste-events": "^1.6.10", + "ste-signals": "^1.6.10", + "ste-simple-events": "^1.6.10" + }, + "engines": { + "node": ">=4.2.4" + } + }, + "node_modules/style-loader": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/style-loader/-/style-loader-1.1.3.tgz", + "integrity": "sha512-rlkH7X/22yuwFYK357fMN/BxYOorfnfq0eD7+vqlemSK4wEcejFF1dg4zxP0euBW8NrYx2WZzZ8PPFevr7D+Kw==", + "dependencies": { + "loader-utils": "^1.2.3", + "schema-utils": "^2.6.4" + }, + "engines": { + "node": ">= 8.9.0" + } + }, + "node_modules/style-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/style-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/stylehacks": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/stylehacks/-/stylehacks-4.0.3.tgz", + "integrity": "sha512-7GlLk9JwlElY4Y6a/rmbH2MhVlTyVmiJd1PfTCqFaIBEGMYNsrO/v3SeGTdhBThLg4Z+NbOk/qFMwCa+J+3p/g==", + "dependencies": { + "browserslist": "^4.0.0", + "postcss": "^7.0.0", + "postcss-selector-parser": "^3.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/stylehacks/node_modules/postcss-selector-parser": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-3.1.2.tgz", + "integrity": "sha512-h7fJ/5uWuRVyOtkO45pnt1Ih40CEleeyCHzipqAZO2e5H20g25Y48uYnFUiShvY4rZWNJ/Bib/KVPmanaCtOhA==", + "dependencies": { + "dot-prop": "^5.2.0", + "indexes-of": "^1.0.1", + "uniq": "^1.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/stylus": { + "version": "0.54.7", + "resolved": "https://registry.npmjs.org/stylus/-/stylus-0.54.7.tgz", + "integrity": "sha512-Yw3WMTzVwevT6ZTrLCYNHAFmanMxdylelL3hkWNgPMeTCpMwpV3nXjpOHuBXtFv7aiO2xRuQS6OoAdgkNcSNug==", + "dependencies": { + "css-parse": "~2.0.0", + "debug": "~3.1.0", + "glob": "^7.1.3", + "mkdirp": "~0.5.x", + "safer-buffer": "^2.1.2", + "sax": "~1.2.4", + "semver": "^6.0.0", + "source-map": "^0.7.3" + }, + "bin": { + "stylus": "bin/stylus" + }, + "engines": { + "node": "*" + } + }, + "node_modules/stylus-loader": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/stylus-loader/-/stylus-loader-3.0.2.tgz", + "integrity": "sha512-+VomPdZ6a0razP+zinir61yZgpw2NfljeSsdUF5kJuEzlo3khXhY19Fn6l8QQz1GRJGtMCo8nG5C04ePyV7SUA==", + "dependencies": { + "loader-utils": "^1.0.2", + "lodash.clonedeep": "^4.5.0", + "when": "~3.6.x" + } + }, + "node_modules/stylus-loader/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/stylus-loader/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/stylus/node_modules/debug": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/stylus/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/stylus/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/supports-color": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", + "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/supports-hyperlinks": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/supports-hyperlinks/-/supports-hyperlinks-2.1.0.tgz", + "integrity": "sha512-zoE5/e+dnEijk6ASB6/qrK+oYdm2do1hjoLWrqUC/8WEIW1gbxFcKuBof7sW8ArN6e+AYvsE8HBGiVRWL/F5CA==", + "dependencies": { + "has-flag": "^4.0.0", + "supports-color": "^7.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/supports-hyperlinks/node_modules/has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/supports-hyperlinks/node_modules/supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dependencies": { + "has-flag": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/svgo": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/svgo/-/svgo-1.3.2.tgz", + "integrity": "sha512-yhy/sQYxR5BkC98CY7o31VGsg014AKLEPxdfhora76l36hD9Rdy5NZA/Ocn6yayNPgSamYdtX2rFJdcv07AYVw==", + "dependencies": { + "chalk": "^2.4.1", + "coa": "^2.0.2", + "css-select": "^2.0.0", + "css-select-base-adapter": "^0.1.1", + "css-tree": "1.0.0-alpha.37", + "csso": "^4.0.2", + "js-yaml": "^3.13.1", + "mkdirp": "~0.5.1", + "object.values": "^1.1.0", + "sax": "~1.2.4", + "stable": "^0.1.8", + "unquote": "~1.1.1", + "util.promisify": "~1.0.0" + }, + "bin": { + "svgo": "bin/svgo" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/sweetalert2": { + "version": "9.17.1", + "resolved": "https://registry.npmjs.org/sweetalert2/-/sweetalert2-9.17.1.tgz", + "integrity": "sha512-D/VE2lT/bKd64/RBglLUtQ+3nsftzjzIiP2iqN6zPzPwf+2djIY+4k8Bg430zxRUn4DkZzyIuU58q3n0J43lvw==" + }, + "node_modules/symbol-observable": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/symbol-observable/-/symbol-observable-1.2.0.tgz", + "integrity": "sha512-e900nM8RRtGhlV36KGEU9k65K3mPb1WV70OdjfxlG2EAuM1noi/E/BaW/uMhL7bPEssK8QV57vN3esixjUvcXQ==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/tapable": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/tapable/-/tapable-1.1.3.tgz", + "integrity": "sha512-4WK/bYZmj8xLr+HUCODHGF1ZFzsYffasLUgEiMBY4fgtltdO6B4WJtlSbPaDTLpYTcGVwM2qLnFTICEcNxs3kA==", + "engines": { + "node": ">=6" + } + }, + "node_modules/tar": { + "version": "6.0.5", + "resolved": "https://registry.npmjs.org/tar/-/tar-6.0.5.tgz", + "integrity": "sha512-0b4HOimQHj9nXNEAA7zWwMM91Zhhba3pspja6sQbgTpynOJf+bkjBnfybNYzbpLbnwXnbyB4LOREvlyXLkCHSg==", + "dependencies": { + "chownr": "^2.0.0", + "fs-minipass": "^2.0.0", + "minipass": "^3.0.0", + "minizlib": "^2.1.1", + "mkdirp": "^1.0.3", + "yallist": "^4.0.0" + }, + "engines": { + "node": ">= 10" + } + }, + "node_modules/tar/node_modules/chownr": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/chownr/-/chownr-2.0.0.tgz", + "integrity": "sha512-bIomtDF5KGpdogkLd9VspvFzk9KfpyyGlS8YFVZl7TGPBHL5snIOnxeshwVgPteQ9b4Eydl+pVbIyE1DcvCWgQ==", + "engines": { + "node": ">=10" + } + }, + "node_modules/tar/node_modules/mkdirp": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-1.0.4.tgz", + "integrity": "sha512-vVqVZQyf3WLx2Shd0qJ9xuvqgAyKPLAiqITEtqW0oIUjzo3PePDd6fW9iFz30ef7Ysp/oiWqbhszeGWW2T6Gzw==", + "bin": { + "mkdirp": "bin/cmd.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/term-size": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/term-size/-/term-size-2.2.1.tgz", + "integrity": "sha512-wK0Ri4fOGjv/XPy8SBHZChl8CM7uMc5VML7SqiQ0zG7+J5Vr+RMQDoHa2CNT6KHUnTGIXH34UDMkPzAUyapBZg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/terminal-link": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/terminal-link/-/terminal-link-2.1.1.tgz", + "integrity": "sha512-un0FmiRUQNr5PJqy9kP7c40F5BOfpGlYTrxonDChEZB7pzZxRNp/bt+ymiy9/npwXya9KH99nJ/GXFIiUkYGFQ==", + "dependencies": { + "ansi-escapes": "^4.2.1", + "supports-hyperlinks": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/terser": { + "version": "4.6.10", + "resolved": "https://registry.npmjs.org/terser/-/terser-4.6.10.tgz", + "integrity": "sha512-qbF/3UOo11Hggsbsqm2hPa6+L4w7bkr+09FNseEe8xrcVD3APGLFqE+Oz1ZKAxjYnFsj80rLOfgAtJ0LNJjtTA==", + "dependencies": { + "commander": "^2.20.0", + "source-map": "~0.6.1", + "source-map-support": "~0.5.12" + }, + "bin": { + "terser": "bin/terser" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/terser-webpack-plugin": { + "version": "2.3.5", + "resolved": "https://registry.npmjs.org/terser-webpack-plugin/-/terser-webpack-plugin-2.3.5.tgz", + "integrity": "sha512-WlWksUoq+E4+JlJ+h+U+QUzXpcsMSSNXkDy9lBVkSqDn1w23Gg29L/ary9GeJVYCGiNJJX7LnVc4bwL1N3/g1w==", + "dependencies": { + "cacache": "^13.0.1", + "find-cache-dir": "^3.2.0", + "jest-worker": "^25.1.0", + "p-limit": "^2.2.2", + "schema-utils": "^2.6.4", + "serialize-javascript": "^2.1.2", + "source-map": "^0.6.1", + "terser": "^4.4.3", + "webpack-sources": "^1.4.3" + }, + "engines": { + "node": ">= 8.9.0" + } + }, + "node_modules/terser-webpack-plugin/node_modules/cacache": { + "version": "13.0.1", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-13.0.1.tgz", + "integrity": "sha512-5ZvAxd05HDDU+y9BVvcqYu2LLXmPnQ0hW62h32g4xBTgL/MppR4/04NHfj/ycM2y6lmTnbw6HVi+1eN0Psba6w==", + "dependencies": { + "chownr": "^1.1.2", + "figgy-pudding": "^3.5.1", + "fs-minipass": "^2.0.0", + "glob": "^7.1.4", + "graceful-fs": "^4.2.2", + "infer-owner": "^1.0.4", + "lru-cache": "^5.1.1", + "minipass": "^3.0.0", + "minipass-collect": "^1.0.2", + "minipass-flush": "^1.0.5", + "minipass-pipeline": "^1.2.2", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "p-map": "^3.0.0", + "promise-inflight": "^1.0.1", + "rimraf": "^2.7.1", + "ssri": "^7.0.0", + "unique-filename": "^1.1.1" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/terser-webpack-plugin/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/terser-webpack-plugin/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/terser-webpack-plugin/node_modules/ssri": { + "version": "7.1.0", + "resolved": "https://registry.npmjs.org/ssri/-/ssri-7.1.0.tgz", + "integrity": "sha512-77/WrDZUWocK0mvA5NTRQyveUf+wsrIc6vyrxpS8tVvYBcX215QbafrJR3KtkpskIzoFLqqNuuYQvxaMjXJ/0g==", + "dependencies": { + "figgy-pudding": "^3.5.1", + "minipass": "^3.1.1" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/terser/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/through": { + "version": "2.3.8", + "resolved": "https://registry.npmjs.org/through/-/through-2.3.8.tgz", + "integrity": "sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=" + }, + "node_modules/through2": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz", + "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", + "dependencies": { + "readable-stream": "~2.3.6", + "xtend": "~4.0.1" + } + }, + "node_modules/thunky": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/thunky/-/thunky-1.1.0.tgz", + "integrity": "sha512-eHY7nBftgThBqOyHGVN+l8gF0BucP09fMo0oO/Lb0w1OF80dJv+lDVpXG60WMQvkcxAkNybKsrEIE3ZtKGmPrA==" + }, + "node_modules/timers-browserify": { + "version": "2.0.12", + "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.12.tgz", + "integrity": "sha512-9phl76Cqm6FhSX9Xe1ZUAMLtm1BLkKj2Qd5ApyWkXzsMRaA7dgr81kf4wJmQf/hAvg8EEyJxDo3du/0KlhPiKQ==", + "dependencies": { + "setimmediate": "^1.0.4" + }, + "engines": { + "node": ">=0.6.0" + } + }, + "node_modules/timsort": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/timsort/-/timsort-0.3.0.tgz", + "integrity": "sha1-QFQRqOfmM5/mTbmiNN4R3DHgK9Q=" + }, + "node_modules/tmp": { + "version": "0.0.33", + "resolved": "https://registry.npmjs.org/tmp/-/tmp-0.0.33.tgz", + "integrity": "sha512-jRCJlojKnZ3addtTOjdIqoRuPEKBvNXcGYqzO6zWZX8KfKEpnGY5jfggJQ3EjKuu8D4bJRr0y+cYJFmYbImXGw==", + "dependencies": { + "os-tmpdir": "~1.0.2" + }, + "engines": { + "node": ">=0.6.0" + } + }, + "node_modules/to-arraybuffer": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz", + "integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M=" + }, + "node_modules/to-fast-properties": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", + "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", + "engines": { + "node": ">=4" + } + }, + "node_modules/to-object-path": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/to-object-path/-/to-object-path-0.3.0.tgz", + "integrity": "sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/to-object-path/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/to-regex": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/to-regex/-/to-regex-3.0.2.tgz", + "integrity": "sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==", + "dependencies": { + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "regex-not": "^1.0.2", + "safe-regex": "^1.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + }, + "node_modules/toidentifier": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.0.tgz", + "integrity": "sha512-yaOH/Pk/VEhBWWTlhI+qXxDFXlejDGcQipMlyxda9nthulaxLZUNcUqFxokp0vcYnvteJln5FNQDRrxj3YcbVw==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/tough-cookie": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.5.0.tgz", + "integrity": "sha512-nlLsUzgm1kfLXSXfRZMc1KLAugd4hqJHDTvc2hDIwS3mZAfMEuMbc03SujMF+GEcpaX/qboeycw6iO8JwVv2+g==", + "dependencies": { + "psl": "^1.1.28", + "punycode": "^2.1.1" + }, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/tree-kill": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/tree-kill/-/tree-kill-1.2.2.tgz", + "integrity": "sha512-L0Orpi8qGpRG//Nd+H90vFB+3iHnue1zSSGmNOOCh1GLJ7rUKVwV2HvijphGQS2UmhUZewS9VgvxYIdgr+fG1A==", + "bin": { + "tree-kill": "cli.js" + } + }, + "node_modules/ts-node": { + "version": "8.10.1", + "resolved": "https://registry.npmjs.org/ts-node/-/ts-node-8.10.1.tgz", + "integrity": "sha512-bdNz1L4ekHiJul6SHtZWs1ujEKERJnHs4HxN7rjTyyVOFf3HaJ6sLqe6aPG62XTzAB/63pKRh5jTSWL0D7bsvw==", + "dependencies": { + "arg": "^4.1.0", + "diff": "^4.0.1", + "make-error": "^1.1.1", + "source-map-support": "^0.5.17", + "yn": "3.1.1" + }, + "bin": { + "ts-node": "dist/bin.js", + "ts-node-script": "dist/bin-script.js", + "ts-node-transpile-only": "dist/bin-transpile.js", + "ts-script": "dist/bin-script-deprecated.js" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/tslib": { + "version": "1.12.0", + "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.12.0.tgz", + "integrity": "sha512-5rxCQkP0kytf4H1T4xz1imjxaUUPMvc5aWp0rJ/VMIN7ClRiH1FwFvBt8wOeMasp/epeUnmSW6CixSIePtiLqA==" + }, + "node_modules/tslint": { + "version": "6.1.2", + "resolved": "https://registry.npmjs.org/tslint/-/tslint-6.1.2.tgz", + "integrity": "sha512-UyNrLdK3E0fQG/xWNqAFAC5ugtFyPO4JJR1KyyfQAyzR8W0fTRrC91A8Wej4BntFzcvETdCSDa/4PnNYJQLYiA==", + "dependencies": { + "@babel/code-frame": "^7.0.0", + "builtin-modules": "^1.1.1", + "chalk": "^2.3.0", + "commander": "^2.12.1", + "diff": "^4.0.1", + "glob": "^7.1.1", + "js-yaml": "^3.13.1", + "minimatch": "^3.0.4", + "mkdirp": "^0.5.3", + "resolve": "^1.3.2", + "semver": "^5.3.0", + "tslib": "^1.10.0", + "tsutils": "^2.29.0" + }, + "bin": { + "tslint": "bin/tslint" + }, + "engines": { + "node": ">=4.8.0" + } + }, + "node_modules/tslint/node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/tsutils": { + "version": "2.29.0", + "resolved": "https://registry.npmjs.org/tsutils/-/tsutils-2.29.0.tgz", + "integrity": "sha512-g5JVHCIJwzfISaXpXE1qvNalca5Jwob6FjI4AoPlqMusJ6ftFE7IkkFoMhVLRgK+4Kx3gkzb8UZK5t5yTTvEmA==", + "dependencies": { + "tslib": "^1.8.1" + } + }, + "node_modules/tty-browserify": { + "version": "0.0.0", + "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz", + "integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY=" + }, + "node_modules/tunnel-agent": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.6.0.tgz", + "integrity": "sha1-J6XeoGs2sEoKmWZ3SykIaPD8QP0=", + "dependencies": { + "safe-buffer": "^5.0.1" + }, + "engines": { + "node": "*" + } + }, + "node_modules/tweetnacl": { + "version": "0.14.5", + "resolved": "https://registry.npmjs.org/tweetnacl/-/tweetnacl-0.14.5.tgz", + "integrity": "sha1-WuaBd/GS1EViadEIr6k/+HQ/T2Q=" + }, + "node_modules/type-fest": { + "version": "0.11.0", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.11.0.tgz", + "integrity": "sha512-OdjXJxnCN1AvyLSzeKIgXTXxV+99ZuXl3Hpo9XpJAv9MBcHrrJOQ5kV7ypXOuQie+AmWG25hLbiKdwYTifzcfQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/type-is": { + "version": "1.6.18", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/typedarray": { + "version": "0.0.6", + "resolved": "https://registry.npmjs.org/typedarray/-/typedarray-0.0.6.tgz", + "integrity": "sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=" + }, + "node_modules/typescript": { + "version": "3.8.3", + "resolved": "https://registry.npmjs.org/typescript/-/typescript-3.8.3.tgz", + "integrity": "sha512-MYlEfn5VrLNsgudQTVJeNaQFUAI7DkhnOjdpAp4T+ku1TfQClewlbSuTVHiA+8skNBgaf02TL/kLOvig4y3G8w==", + "bin": { + "tsc": "bin/tsc", + "tsserver": "bin/tsserver" + }, + "engines": { + "node": ">=4.2.0" + } + }, + "node_modules/unicode-canonical-property-names-ecmascript": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/unicode-canonical-property-names-ecmascript/-/unicode-canonical-property-names-ecmascript-1.0.4.tgz", + "integrity": "sha512-jDrNnXWHd4oHiTZnx/ZG7gtUTVp+gCcTTKr8L0HjlwphROEW3+Him+IpvC+xcJEFegapiMZyZe02CyuOnRmbnQ==", + "engines": { + "node": ">=4" + } + }, + "node_modules/unicode-match-property-ecmascript": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/unicode-match-property-ecmascript/-/unicode-match-property-ecmascript-1.0.4.tgz", + "integrity": "sha512-L4Qoh15vTfntsn4P1zqnHulG0LdXgjSO035fEpdtp6YxXhMT51Q6vgM5lYdG/5X3MjS+k/Y9Xw4SFCY9IkR0rg==", + "dependencies": { + "unicode-canonical-property-names-ecmascript": "^1.0.4", + "unicode-property-aliases-ecmascript": "^1.0.4" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/unicode-match-property-value-ecmascript": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/unicode-match-property-value-ecmascript/-/unicode-match-property-value-ecmascript-1.2.0.tgz", + "integrity": "sha512-wjuQHGQVofmSJv1uVISKLE5zO2rNGzM/KCYZch/QQvez7C1hUhBIuZ701fYXExuufJFMPhv2SyL8CyoIfMLbIQ==", + "engines": { + "node": ">=4" + } + }, + "node_modules/unicode-property-aliases-ecmascript": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/unicode-property-aliases-ecmascript/-/unicode-property-aliases-ecmascript-1.1.0.tgz", + "integrity": "sha512-PqSoPh/pWetQ2phoj5RLiaqIk4kCNwoV3CI+LfGmWLKI3rE3kl1h59XpX2BjgDrmbxD9ARtQobPGU1SguCYuQg==", + "engines": { + "node": ">=4" + } + }, + "node_modules/union-value": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.1.tgz", + "integrity": "sha512-tJfXmxMeWYnczCVs7XAEvIV7ieppALdyepWMkHkwciRpZraG/xwT+s2JN8+pr1+8jCRf80FFzvr+MpQeeoF4Xg==", + "dependencies": { + "arr-union": "^3.1.0", + "get-value": "^2.0.6", + "is-extendable": "^0.1.1", + "set-value": "^2.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/uniq": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/uniq/-/uniq-1.0.1.tgz", + "integrity": "sha1-sxxa6CVIRKOoKBVBzisEuGWnNP8=" + }, + "node_modules/uniqs": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/uniqs/-/uniqs-2.0.0.tgz", + "integrity": "sha1-/+3ks2slKQaW5uFl1KWe25mOawI=" + }, + "node_modules/unique-filename": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.1.tgz", + "integrity": "sha512-Vmp0jIp2ln35UTXuryvjzkjGdRyf9b2lTXuSYUiPmzRcl3FDtYqAwOnTJkAngD9SWhnoJzDbTKwaOrZ+STtxNQ==", + "dependencies": { + "unique-slug": "^2.0.0" + } + }, + "node_modules/unique-slug": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.2.tgz", + "integrity": "sha512-zoWr9ObaxALD3DOPfjPSqxt4fnZiWblxHIgeWqW8x7UqDzEtHEQLzji2cuJYQFCU6KmoJikOYAZlrTHHebjx2w==", + "dependencies": { + "imurmurhash": "^0.1.4" + } + }, + "node_modules/universal-analytics": { + "version": "0.4.20", + "resolved": "https://registry.npmjs.org/universal-analytics/-/universal-analytics-0.4.20.tgz", + "integrity": "sha512-gE91dtMvNkjO+kWsPstHRtSwHXz0l2axqptGYp5ceg4MsuurloM0PU3pdOfpb5zBXUvyjT4PwhWK2m39uczZuw==", + "dependencies": { + "debug": "^3.0.0", + "request": "^2.88.0", + "uuid": "^3.0.0" + } + }, + "node_modules/universal-analytics/node_modules/debug": { + "version": "3.2.7", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz", + "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/universal-analytics/node_modules/uuid": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.4.0.tgz", + "integrity": "sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A==", + "bin": { + "uuid": "bin/uuid" + } + }, + "node_modules/universalify": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/universalify/-/universalify-0.1.2.tgz", + "integrity": "sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg==", + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/unquote": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/unquote/-/unquote-1.1.1.tgz", + "integrity": "sha1-j97XMk7G6IoP+LkF58CYzcCG1UQ=" + }, + "node_modules/unset-value": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unset-value/-/unset-value-1.0.0.tgz", + "integrity": "sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=", + "dependencies": { + "has-value": "^0.3.1", + "isobject": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/unset-value/node_modules/has-value": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/has-value/-/has-value-0.3.1.tgz", + "integrity": "sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=", + "dependencies": { + "get-value": "^2.0.3", + "has-values": "^0.1.4", + "isobject": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/unset-value/node_modules/has-value/node_modules/isobject": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz", + "integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=", + "dependencies": { + "isarray": "1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/unset-value/node_modules/has-values": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/has-values/-/has-values-0.1.4.tgz", + "integrity": "sha1-bWHeldkd/Km5oCCJrThL/49it3E=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/upath": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/upath/-/upath-1.2.0.tgz", + "integrity": "sha512-aZwGpamFO61g3OlfT7OQCHqhGnW43ieH9WZeP7QxN/G/jS4jfqUkZxoryvJgVPEcrl5NL/ggHsSmLMHuH64Lhg==", + "engines": { + "node": ">=4", + "yarn": "*" + } + }, + "node_modules/uri-js": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.4.0.tgz", + "integrity": "sha512-B0yRTzYdUCCn9n+F4+Gh4yIDtMQcaJsmYBDsTSG8g/OejKBodLQ2IHfN3bM7jUsRXndopT7OIXWdYqc1fjmV6g==", + "dependencies": { + "punycode": "^2.1.0" + } + }, + "node_modules/urix": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/urix/-/urix-0.1.0.tgz", + "integrity": "sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI=" + }, + "node_modules/url": { + "version": "0.11.0", + "resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz", + "integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=", + "dependencies": { + "punycode": "1.3.2", + "querystring": "0.2.0" + } + }, + "node_modules/url-parse": { + "version": "1.4.7", + "resolved": "https://registry.npmjs.org/url-parse/-/url-parse-1.4.7.tgz", + "integrity": "sha512-d3uaVyzDB9tQoSXFvuSUNFibTd9zxd2bkVrDRvF5TmvWWQwqE4lgYJ5m+x1DbecWkw+LK4RNl2CU1hHuOKPVlg==", + "dependencies": { + "querystringify": "^2.1.1", + "requires-port": "^1.0.0" + } + }, + "node_modules/url/node_modules/punycode": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz", + "integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0=" + }, + "node_modules/use": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/use/-/use-3.1.1.tgz", + "integrity": "sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/util": { + "version": "0.11.1", + "resolved": "https://registry.npmjs.org/util/-/util-0.11.1.tgz", + "integrity": "sha512-HShAsny+zS2TZfaXxD9tYj4HQGlBezXZMZuM/S5PKLLoZkShZiGk9o5CzukI1LVHZvjdvZ2Sj1aW/Ndn2NB/HQ==", + "dependencies": { + "inherits": "2.0.3" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=" + }, + "node_modules/util-promisify": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/util-promisify/-/util-promisify-2.1.0.tgz", + "integrity": "sha1-PCI2R2xNMsX/PEcAKt18E7moKlM=", + "dependencies": { + "object.getownpropertydescriptors": "^2.0.3" + } + }, + "node_modules/util.promisify": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/util.promisify/-/util.promisify-1.0.1.tgz", + "integrity": "sha512-g9JpC/3He3bm38zsLupWryXHoEcS22YHthuPQSJdMy6KNrzIRzWqcsHzD/WUnqe45whVou4VIsPew37DoXWNrA==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.2", + "has-symbols": "^1.0.1", + "object.getownpropertydescriptors": "^2.1.0" + } + }, + "node_modules/util/node_modules/inherits": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" + }, + "node_modules/utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM=", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/uuid": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-8.0.0.tgz", + "integrity": "sha512-jOXGuXZAWdsTH7eZLtyXMqUb9EcWMGZNbL9YcGBJl4MH4nrxHmZJhEHvyLFrkxo+28uLb/NYRcStH48fnD0Vzw==", + "bin": { + "uuid": "dist/bin/uuid" + } + }, + "node_modules/validate-npm-package-license": { + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/validate-npm-package-license/-/validate-npm-package-license-3.0.4.tgz", + "integrity": "sha512-DpKm2Ui/xN7/HQKCtpZxoRWBhZ9Z0kqtygG8XCgNQ8ZlDnxuQmWhj566j8fN4Cu3/JmbhsDo7fcAJq4s9h27Ew==", + "dependencies": { + "spdx-correct": "^3.0.0", + "spdx-expression-parse": "^3.0.0" + } + }, + "node_modules/validate-npm-package-name": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/validate-npm-package-name/-/validate-npm-package-name-3.0.0.tgz", + "integrity": "sha1-X6kS2B630MdK/BQN5zF/DKffQ34=", + "dependencies": { + "builtins": "^1.0.3" + } + }, + "node_modules/vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha1-IpnwLG3tMNSllhsLn3RSShj2NPw=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/vendors": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/vendors/-/vendors-1.0.4.tgz", + "integrity": "sha512-/juG65kTL4Cy2su4P8HjtkTxk6VmJDiOPBufWniqQ6wknac6jNiXS9vU+hO3wgusiyqWlzTbVHi0dyJqRONg3w==" + }, + "node_modules/verror": { + "version": "1.10.0", + "resolved": "https://registry.npmjs.org/verror/-/verror-1.10.0.tgz", + "integrity": "sha1-OhBcoXBTr1XW4nDB+CiGguGNpAA=", + "engines": [ + "node >=0.6.0" + ], + "dependencies": { + "assert-plus": "^1.0.0", + "core-util-is": "1.0.2", + "extsprintf": "^1.2.0" + } + }, + "node_modules/vm-browserify": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-1.1.2.tgz", + "integrity": "sha512-2ham8XPWTONajOR0ohOKOHXkm3+gaBmGut3SRuu75xLd/RRaY6vqgh8NBYYk7+RW3u5AtzPQZG8F10LHkl0lAQ==" + }, + "node_modules/watchpack": { + "version": "1.7.5", + "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.7.5.tgz", + "integrity": "sha512-9P3MWk6SrKjHsGkLT2KHXdQ/9SNkyoJbabxnKOoJepsvJjJG8uYTR3yTPxPQvNDI3w4Nz1xnE0TLHK4RIVe/MQ==", + "dependencies": { + "chokidar": "^3.4.1", + "graceful-fs": "^4.1.2", + "neo-async": "^2.5.0" + }, + "optionalDependencies": { + "watchpack-chokidar2": "^2.0.1" + } + }, + "node_modules/watchpack-chokidar2": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/watchpack-chokidar2/-/watchpack-chokidar2-2.0.1.tgz", + "integrity": "sha512-nCFfBIPKr5Sh61s4LPpy1Wtfi0HE8isJ3d2Yb5/Ppw2P2B/3eVSEBjKfN0fmHJSK14+31KwMKmcrzs2GM4P0Ww==", + "optional": true, + "dependencies": { + "chokidar": "^2.1.8" + } + }, + "node_modules/watchpack-chokidar2/node_modules/anymatch": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", + "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", + "optional": true, + "dependencies": { + "micromatch": "^3.1.4", + "normalize-path": "^2.1.1" + } + }, + "node_modules/watchpack-chokidar2/node_modules/anymatch/node_modules/normalize-path": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", + "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", + "optional": true, + "dependencies": { + "remove-trailing-separator": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/watchpack-chokidar2/node_modules/binary-extensions": { + "version": "1.13.1", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz", + "integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/watchpack-chokidar2/node_modules/braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "optional": true, + "dependencies": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/watchpack-chokidar2/node_modules/chokidar": { + "version": "2.1.8", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz", + "integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==", + "optional": true, + "dependencies": { + "anymatch": "^2.0.0", + "async-each": "^1.0.1", + "braces": "^2.3.2", + "fsevents": "^1.2.7", + "glob-parent": "^3.1.0", + "inherits": "^2.0.3", + "is-binary-path": "^1.0.0", + "is-glob": "^4.0.0", + "normalize-path": "^3.0.0", + "path-is-absolute": "^1.0.0", + "readdirp": "^2.2.1", + "upath": "^1.1.1" + } + }, + "node_modules/watchpack-chokidar2/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "optional": true, + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/watchpack-chokidar2/node_modules/fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "optional": true, + "dependencies": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/watchpack-chokidar2/node_modules/fsevents": { + "version": "1.2.13", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.13.tgz", + "integrity": "sha512-oWb1Z6mkHIskLzEJ/XWX0srkpkTQ7vaopMQkyaEIoq0fmtFVxOthb8cCxeT+p3ynTdkk/RZwbgG4brR5BeWECw==", + "hasInstallScript": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 4.0" + } + }, + "node_modules/watchpack-chokidar2/node_modules/is-binary-path": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz", + "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=", + "optional": true, + "dependencies": { + "binary-extensions": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/watchpack-chokidar2/node_modules/is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "optional": true, + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/watchpack-chokidar2/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "optional": true, + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/watchpack-chokidar2/node_modules/readdirp": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz", + "integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==", + "optional": true, + "dependencies": { + "graceful-fs": "^4.1.11", + "micromatch": "^3.1.10", + "readable-stream": "^2.0.2" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/watchpack-chokidar2/node_modules/to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "optional": true, + "dependencies": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/wbuf": { + "version": "1.7.3", + "resolved": "https://registry.npmjs.org/wbuf/-/wbuf-1.7.3.tgz", + "integrity": "sha512-O84QOnr0icsbFGLS0O3bI5FswxzRr8/gHwWkDlQFskhSPryQXvrTMxjxGP4+iWYoauLoBvfDpkrOauZ+0iZpDA==", + "dependencies": { + "minimalistic-assert": "^1.0.0" + } + }, + "node_modules/wcwidth": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/wcwidth/-/wcwidth-1.0.1.tgz", + "integrity": "sha1-8LDc+RW8X/FSivrbLA4XtTLaL+g=", + "dependencies": { + "defaults": "^1.0.3" + } + }, + "node_modules/webpack": { + "version": "4.42.0", + "resolved": "https://registry.npmjs.org/webpack/-/webpack-4.42.0.tgz", + "integrity": "sha512-EzJRHvwQyBiYrYqhyjW9AqM90dE4+s1/XtCfn7uWg6cS72zH+2VPFAlsnW0+W0cDi0XRjNKUMoJtpSi50+Ph6w==", + "dependencies": { + "@webassemblyjs/ast": "1.8.5", + "@webassemblyjs/helper-module-context": "1.8.5", + "@webassemblyjs/wasm-edit": "1.8.5", + "@webassemblyjs/wasm-parser": "1.8.5", + "acorn": "^6.2.1", + "ajv": "^6.10.2", + "ajv-keywords": "^3.4.1", + "chrome-trace-event": "^1.0.2", + "enhanced-resolve": "^4.1.0", + "eslint-scope": "^4.0.3", + "json-parse-better-errors": "^1.0.2", + "loader-runner": "^2.4.0", + "loader-utils": "^1.2.3", + "memory-fs": "^0.4.1", + "micromatch": "^3.1.10", + "mkdirp": "^0.5.1", + "neo-async": "^2.6.1", + "node-libs-browser": "^2.2.1", + "schema-utils": "^1.0.0", + "tapable": "^1.1.3", + "terser-webpack-plugin": "^1.4.3", + "watchpack": "^1.6.0", + "webpack-sources": "^1.4.1" + }, + "bin": { + "webpack": "bin/webpack.js" + }, + "engines": { + "node": ">=6.11.5" + } + }, + "node_modules/webpack-dev-middleware": { + "version": "3.7.2", + "resolved": "https://registry.npmjs.org/webpack-dev-middleware/-/webpack-dev-middleware-3.7.2.tgz", + "integrity": "sha512-1xC42LxbYoqLNAhV6YzTYacicgMZQTqRd27Sim9wn5hJrX3I5nxYy1SxSd4+gjUFsz1dQFj+yEe6zEVmSkeJjw==", + "dependencies": { + "memory-fs": "^0.4.1", + "mime": "^2.4.4", + "mkdirp": "^0.5.1", + "range-parser": "^1.2.1", + "webpack-log": "^2.0.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/webpack-dev-middleware/node_modules/memory-fs": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz", + "integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=", + "dependencies": { + "errno": "^0.1.3", + "readable-stream": "^2.0.1" + } + }, + "node_modules/webpack-dev-middleware/node_modules/mime": { + "version": "2.4.6", + "resolved": "https://registry.npmjs.org/mime/-/mime-2.4.6.tgz", + "integrity": "sha512-RZKhC3EmpBchfTGBVb8fb+RL2cWyw/32lshnsETttkBAyAUXSGHxbEJWWRXc751DrIxG1q04b8QwMbAwkRPpUA==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/webpack-dev-server": { + "version": "3.10.3", + "resolved": "https://registry.npmjs.org/webpack-dev-server/-/webpack-dev-server-3.10.3.tgz", + "integrity": "sha512-e4nWev8YzEVNdOMcNzNeCN947sWJNd43E5XvsJzbAL08kGc2frm1tQ32hTJslRS+H65LCb/AaUCYU7fjHCpDeQ==", + "dependencies": { + "ansi-html": "0.0.7", + "bonjour": "^3.5.0", + "chokidar": "^2.1.8", + "compression": "^1.7.4", + "connect-history-api-fallback": "^1.6.0", + "debug": "^4.1.1", + "del": "^4.1.1", + "express": "^4.17.1", + "html-entities": "^1.2.1", + "http-proxy-middleware": "0.19.1", + "import-local": "^2.0.0", + "internal-ip": "^4.3.0", + "ip": "^1.1.5", + "is-absolute-url": "^3.0.3", + "killable": "^1.0.1", + "loglevel": "^1.6.6", + "opn": "^5.5.0", + "p-retry": "^3.0.1", + "portfinder": "^1.0.25", + "schema-utils": "^1.0.0", + "selfsigned": "^1.10.7", + "semver": "^6.3.0", + "serve-index": "^1.9.1", + "sockjs": "0.3.19", + "sockjs-client": "1.4.0", + "spdy": "^4.0.1", + "strip-ansi": "^3.0.1", + "supports-color": "^6.1.0", + "url": "^0.11.0", + "webpack-dev-middleware": "^3.7.2", + "webpack-log": "^2.0.0", + "ws": "^6.2.1", + "yargs": "12.0.5" + }, + "bin": { + "webpack-dev-server": "bin/webpack-dev-server.js" + }, + "engines": { + "node": ">= 6.11.5" + } + }, + "node_modules/webpack-dev-server/node_modules/anymatch": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", + "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", + "dependencies": { + "micromatch": "^3.1.4", + "normalize-path": "^2.1.1" + } + }, + "node_modules/webpack-dev-server/node_modules/anymatch/node_modules/normalize-path": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", + "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", + "dependencies": { + "remove-trailing-separator": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/binary-extensions": { + "version": "1.13.1", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz", + "integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "dependencies": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/chokidar": { + "version": "2.1.8", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz", + "integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==", + "dependencies": { + "anymatch": "^2.0.0", + "async-each": "^1.0.1", + "braces": "^2.3.2", + "glob-parent": "^3.1.0", + "inherits": "^2.0.3", + "is-binary-path": "^1.0.0", + "is-glob": "^4.0.0", + "normalize-path": "^3.0.0", + "path-is-absolute": "^1.0.0", + "readdirp": "^2.2.1", + "upath": "^1.1.1" + }, + "optionalDependencies": { + "fsevents": "^1.2.7" + } + }, + "node_modules/webpack-dev-server/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "dependencies": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/fsevents": { + "version": "1.2.13", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.13.tgz", + "integrity": "sha512-oWb1Z6mkHIskLzEJ/XWX0srkpkTQ7vaopMQkyaEIoq0fmtFVxOthb8cCxeT+p3ynTdkk/RZwbgG4brR5BeWECw==", + "hasInstallScript": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 4.0" + } + }, + "node_modules/webpack-dev-server/node_modules/is-absolute-url": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/is-absolute-url/-/is-absolute-url-3.0.3.tgz", + "integrity": "sha512-opmNIX7uFnS96NtPmhWQgQx6/NYFgsUXYMllcfzwWKUMwfo8kku1TvE6hkNcH+Q1ts5cMVrsY7j0bxXQDciu9Q==", + "engines": { + "node": ">=8" + } + }, + "node_modules/webpack-dev-server/node_modules/is-binary-path": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz", + "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=", + "dependencies": { + "binary-extensions": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/readdirp": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz", + "integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==", + "dependencies": { + "graceful-fs": "^4.1.11", + "micromatch": "^3.1.10", + "readable-stream": "^2.0.2" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/webpack-dev-server/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/webpack-dev-server/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/webpack-dev-server/node_modules/supports-color": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz", + "integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==", + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/webpack-dev-server/node_modules/to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "dependencies": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-log": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/webpack-log/-/webpack-log-2.0.0.tgz", + "integrity": "sha512-cX8G2vR/85UYG59FgkoMamwHUIkSSlV3bBMRsbxVXVUk2j6NleCKjQ/WE9eYg9WY4w25O9w8wKP4rzNZFmUcUg==", + "dependencies": { + "ansi-colors": "^3.0.0", + "uuid": "^3.3.2" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/webpack-log/node_modules/uuid": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.4.0.tgz", + "integrity": "sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A==", + "bin": { + "uuid": "bin/uuid" + } + }, + "node_modules/webpack-merge": { + "version": "4.2.2", + "resolved": "https://registry.npmjs.org/webpack-merge/-/webpack-merge-4.2.2.tgz", + "integrity": "sha512-TUE1UGoTX2Cd42j3krGYqObZbOD+xF7u28WB7tfUordytSjbWTIjK/8V0amkBfTYN4/pB/GIDlJZZ657BGG19g==", + "dependencies": { + "lodash": "^4.17.15" + } + }, + "node_modules/webpack-sources": { + "version": "1.4.3", + "resolved": "https://registry.npmjs.org/webpack-sources/-/webpack-sources-1.4.3.tgz", + "integrity": "sha512-lgTS3Xhv1lCOKo7SA5TjKXMjpSM4sBjNV5+q2bqesbSPs5FjGmU6jjtBSkX9b4qW87vDIsCIlUPOEhbZrMdjeQ==", + "dependencies": { + "source-list-map": "^2.0.0", + "source-map": "~0.6.1" + } + }, + "node_modules/webpack-sources/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-subresource-integrity": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/webpack-subresource-integrity/-/webpack-subresource-integrity-1.4.0.tgz", + "integrity": "sha512-GB1kB/LwAWC3CxwcedGhMkxGpNZxSheCe1q+KJP1bakuieAdX/rGHEcf5zsEzhKXpqsGqokgsDoD9dIkr61VDQ==", + "dependencies": { + "webpack-sources": "^1.3.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/webpack/node_modules/cacache": { + "version": "12.0.4", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.4.tgz", + "integrity": "sha512-a0tMB40oefvuInr4Cwb3GerbL9xTj1D5yg0T5xrjGCGyfvbxseIXX7BAO/u/hIXdafzOI5JC3wDwHyf24buOAQ==", + "dependencies": { + "bluebird": "^3.5.5", + "chownr": "^1.1.1", + "figgy-pudding": "^3.5.1", + "glob": "^7.1.4", + "graceful-fs": "^4.1.15", + "infer-owner": "^1.0.3", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.3", + "ssri": "^6.0.1", + "unique-filename": "^1.1.1", + "y18n": "^4.0.0" + } + }, + "node_modules/webpack/node_modules/find-cache-dir": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-2.1.0.tgz", + "integrity": "sha512-Tq6PixE0w/VMFfCgbONnkiQIVol/JJL7nRMi20fqzA4NRs9AfeqMGeRdPi3wIhYkxjeBaWh2rxwapn5Tu3IqOQ==", + "dependencies": { + "commondir": "^1.0.1", + "make-dir": "^2.0.0", + "pkg-dir": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/webpack/node_modules/is-wsl": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz", + "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=", + "engines": { + "node": ">=4" + } + }, + "node_modules/webpack/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/webpack/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/webpack/node_modules/memory-fs": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz", + "integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=", + "dependencies": { + "errno": "^0.1.3", + "readable-stream": "^2.0.1" + } + }, + "node_modules/webpack/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/webpack/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/webpack/node_modules/serialize-javascript": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-4.0.0.tgz", + "integrity": "sha512-GaNA54380uFefWghODBWEGisLZFj00nS5ACs6yHa9nLqlLpVLO8ChDGeKRjZnV4Nh4n0Qi7nhYZD/9fCPzEqkw==", + "dependencies": { + "randombytes": "^2.1.0" + } + }, + "node_modules/webpack/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack/node_modules/ssri": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/ssri/-/ssri-6.0.1.tgz", + "integrity": "sha512-3Wge10hNcT1Kur4PDFwEieXSCMCJs/7WvSACcrMYrNp+b8kDL1/0wJch5Ni2WrtwEa2IO8OsVfeKIciKCDx/QA==", + "dependencies": { + "figgy-pudding": "^3.5.1" + } + }, + "node_modules/webpack/node_modules/terser-webpack-plugin": { + "version": "1.4.5", + "resolved": "https://registry.npmjs.org/terser-webpack-plugin/-/terser-webpack-plugin-1.4.5.tgz", + "integrity": "sha512-04Rfe496lN8EYruwi6oPQkG0vo8C+HT49X687FZnpPF0qMAIHONI6HEXYPKDOE8e5HjXTyKfqRd/agHtH0kOtw==", + "dependencies": { + "cacache": "^12.0.2", + "find-cache-dir": "^2.1.0", + "is-wsl": "^1.1.0", + "schema-utils": "^1.0.0", + "serialize-javascript": "^4.0.0", + "source-map": "^0.6.1", + "terser": "^4.1.2", + "webpack-sources": "^1.4.0", + "worker-farm": "^1.7.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/websocket-driver": { + "version": "0.7.4", + "resolved": "https://registry.npmjs.org/websocket-driver/-/websocket-driver-0.7.4.tgz", + "integrity": "sha512-b17KeDIQVjvb0ssuSDF2cYXSg2iztliJ4B9WdsuB6J952qCPKmnVq4DyW5motImXHDC1cBT/1UezrJVsKw5zjg==", + "dependencies": { + "http-parser-js": ">=0.5.1", + "safe-buffer": ">=5.1.0", + "websocket-extensions": ">=0.1.1" + }, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/websocket-extensions": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/websocket-extensions/-/websocket-extensions-0.1.4.tgz", + "integrity": "sha512-OqedPIGOfsDlo31UNwYbCFMSaO9m9G/0faIHj5/dZFDMFqPTcx6UwqyOy3COEaEOg/9VsGIpdqn62W5KhoKSpg==", + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/when": { + "version": "3.6.4", + "resolved": "https://registry.npmjs.org/when/-/when-3.6.4.tgz", + "integrity": "sha1-RztRfsFZ4rhQBUl6E5g/CVQS404=" + }, + "node_modules/which": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz", + "integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==", + "dependencies": { + "isexe": "^2.0.0" + }, + "bin": { + "which": "bin/which" + } + }, + "node_modules/which-module": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", + "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=" + }, + "node_modules/widest-line": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/widest-line/-/widest-line-3.1.0.tgz", + "integrity": "sha512-NsmoXalsWVDMGupxZ5R08ka9flZjjiLvHVAWYOKtiKM8ujtZWr9cRffak+uSE48+Ob8ObalXpwyeUiyDD6QFgg==", + "dependencies": { + "string-width": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/widest-line/node_modules/ansi-regex": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", + "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/widest-line/node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/widest-line/node_modules/string-width": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.0.tgz", + "integrity": "sha512-zUz5JD+tgqtuDjMhwIg5uFVV3dtqZ9yQJlZVfq4I01/K5Paj5UHj7VyrQOJvzawSVlKpObApbfD0Ed6yJc+1eg==", + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/widest-line/node_modules/strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dependencies": { + "ansi-regex": "^5.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/worker-farm": { + "version": "1.7.0", + "resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.7.0.tgz", + "integrity": "sha512-rvw3QTZc8lAxyVrqcSGVm5yP/IJ2UcB3U0graE3LCFoZ0Yn2x4EoVSqJKdB/T5M+FLcRPjz4TDacRf3OCfNUzw==", + "dependencies": { + "errno": "~0.1.7" + } + }, + "node_modules/worker-plugin": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/worker-plugin/-/worker-plugin-4.0.3.tgz", + "integrity": "sha512-7hFDYWiKcE3yHZvemsoM9lZis/PzurHAEX1ej8PLCu818Rt6QqUAiDdxHPCKZctzmhqzPpcFSgvMCiPbtooqAg==", + "dependencies": { + "loader-utils": "^1.1.0" + } + }, + "node_modules/worker-plugin/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/worker-plugin/node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/wrap-ansi": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-2.1.0.tgz", + "integrity": "sha1-2Pw9KE3QV5T+hJc8rs3Rz4JP3YU=", + "dependencies": { + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/wrap-ansi/node_modules/is-fullwidth-code-point": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz", + "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=", + "dependencies": { + "number-is-nan": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/wrap-ansi/node_modules/string-width": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz", + "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=", + "dependencies": { + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/wrappy": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=" + }, + "node_modules/ws": { + "version": "6.2.1", + "resolved": "https://registry.npmjs.org/ws/-/ws-6.2.1.tgz", + "integrity": "sha512-GIyAXC2cB7LjvpgMt9EKS2ldqr0MTrORaleiOno6TweZ6r3TKtoFQWay/2PceJ3RuBasOHzXNn5Lrw1X0bEjqA==", + "dependencies": { + "async-limiter": "~1.0.0" + } + }, + "node_modules/xtend": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz", + "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==", + "engines": { + "node": ">=0.4" + } + }, + "node_modules/y18n": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", + "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==" + }, + "node_modules/yallist": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-4.0.0.tgz", + "integrity": "sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A==" + }, + "node_modules/yargs": { + "version": "12.0.5", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-12.0.5.tgz", + "integrity": "sha512-Lhz8TLaYnxq/2ObqHDql8dX8CJi97oHxrjUcYtzKbbykPtVW9WB+poxI+NM2UIzsMgNCZTIf0AQwsjK5yMAqZw==", + "dependencies": { + "cliui": "^4.0.0", + "decamelize": "^1.2.0", + "find-up": "^3.0.0", + "get-caller-file": "^1.0.1", + "os-locale": "^3.0.0", + "require-directory": "^2.1.1", + "require-main-filename": "^1.0.1", + "set-blocking": "^2.0.0", + "string-width": "^2.0.0", + "which-module": "^2.0.0", + "y18n": "^3.2.1 || ^4.0.0", + "yargs-parser": "^11.1.1" + } + }, + "node_modules/yargs-parser": { + "version": "11.1.1", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-11.1.1.tgz", + "integrity": "sha512-C6kB/WJDiaxONLJQnF8ccx9SEeoTTLek8RVbaOIsrAUS8VrBEXfmeSnCZxygc+XC2sNMBIwOOnfcxiynjHsVSQ==", + "dependencies": { + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" + } + }, + "node_modules/yn": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yn/-/yn-3.1.1.tgz", + "integrity": "sha512-Ux4ygGWsu2c7isFWe8Yu1YluJmqVhxqK2cLXNQA5AcC3QfbGNpM7fu0Y8b/z16pXLnFxZYvWhd3fhBY9DLmC6Q==", + "engines": { + "node": ">=6" + } + }, + "node_modules/zone.js": { + "version": "0.10.3", + "resolved": "https://registry.npmjs.org/zone.js/-/zone.js-0.10.3.tgz", + "integrity": "sha512-LXVLVEq0NNOqK/fLJo3d0kfzd4sxwn2/h67/02pjCjfKDxgx1i9QqpvtHD8CrBnSSwMw5+dy11O7FRX5mkO7Cg==" + } + }, "dependencies": { "@angular-devkit/architect": { "version": "0.901.5", @@ -1589,13 +14801,13 @@ } }, "@exlibris/exl-cloudapp-angular-lib": { - "version": "0.2.2", - "resolved": "https://registry.npmjs.org/@exlibris/exl-cloudapp-angular-lib/-/exl-cloudapp-angular-lib-0.2.2.tgz", + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@exlibris/exl-cloudapp-angular-lib/-/exl-cloudapp-angular-lib-1.0.1.tgz", "integrity": "sha512-84ASbbHqqUHPLEFiOt01vmRTAkJgOzBRPSoMRYK6ESZTZ7aUffU0fCdn52Y1CvQyaHswhiF5t2mSAQPMnecuSQ==" }, "@exlibris/exl-cloudapp-base": { - "version": "0.2.2", - "resolved": "https://registry.npmjs.org/@exlibris/exl-cloudapp-base/-/exl-cloudapp-base-0.2.2.tgz", + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@exlibris/exl-cloudapp-base/-/exl-cloudapp-base-1.0.1.tgz", "integrity": "sha512-Fmtbo8TX5bBReSL8v3Jqj7UI85vlRmnF0IcaISlUBcKwiApz/cbl/waRGalcYQimkREO1Y9Or9tTAjMAEl/geg==", "requires": { "@angular-devkit/build-angular": "0.901.5", @@ -1614,7 +14826,7 @@ "@angular/router": "9.1.6", "@biesbjerg/ngx-translate-extract": "6.0.4", "@biesbjerg/ngx-translate-extract-marker": "1.0.0", - "@exlibris/exl-cloudapp-angular-lib": "^0.2.2", + "@exlibris/exl-cloudapp-angular-lib": "^1.0.1", "@ngx-translate/core": "12.1.2", "@ngx-translate/http-loader": "4.0.0", "@types/node": "13.13.5", @@ -1973,15 +15185,6 @@ "resolved": "https://registry.npmjs.org/@yarnpkg/lockfile/-/lockfile-1.1.0.tgz", "integrity": "sha512-GpSwvyXOcOOlV70vbnzjj4fW5xW/FdUF6nQEt1ENy7m4ZCczi1+/buVUPAqmGfqznsORNFzUMjctTIp8a9tuCQ==" }, - "JSONStream": { - "version": "1.3.5", - "resolved": "https://registry.npmjs.org/JSONStream/-/JSONStream-1.3.5.tgz", - "integrity": "sha512-E+iruNOY8VV9s4JEbe1aNEm6MiszPRr/UfcHMz0TQh1BXSxHK+ASV1R6W4HpjBhSeS+54PIsAMCBmwD06LLsqQ==", - "requires": { - "jsonparse": "^1.2.0", - "through": ">=2.2.7 <3" - } - }, "accepts": { "version": "1.3.7", "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.7.tgz", @@ -5829,6 +19032,15 @@ "resolved": "https://registry.npmjs.org/jsonparse/-/jsonparse-1.3.1.tgz", "integrity": "sha1-P02uSpH6wxX3EGL4UhzCOfE2YoA=" }, + "JSONStream": { + "version": "1.3.5", + "resolved": "https://registry.npmjs.org/JSONStream/-/JSONStream-1.3.5.tgz", + "integrity": "sha512-E+iruNOY8VV9s4JEbe1aNEm6MiszPRr/UfcHMz0TQh1BXSxHK+ASV1R6W4HpjBhSeS+54PIsAMCBmwD06LLsqQ==", + "requires": { + "jsonparse": "^1.2.0", + "through": ">=2.2.7 <3" + } + }, "jsprim": { "version": "1.4.1", "resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.4.1.tgz", @@ -6742,9 +19954,9 @@ "resolved": "https://registry.npmjs.org/npm-registry-fetch/-/npm-registry-fetch-4.0.7.tgz", "integrity": "sha512-cny9v0+Mq6Tjz+e0erFAB+RYJ/AVGzkjnISiobqP8OWj9c9FLoZZu8/SPSKJWE17F1tk4018wfjV+ZbIbqC7fQ==", "requires": { - "JSONStream": "^1.3.4", "bluebird": "^3.5.1", "figgy-pudding": "^3.4.1", + "JSONStream": "^1.3.4", "lru-cache": "^5.1.1", "make-fetch-happen": "^5.0.0", "npm-package-arg": "^6.1.0", @@ -9456,6 +22668,14 @@ "resolved": "https://registry.npmjs.org/strict-uri-encode/-/strict-uri-encode-1.1.0.tgz", "integrity": "sha1-J5siXfHVgrH1TmWt3UNS4Y+qBxM=" }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "requires": { + "safe-buffer": "~5.1.0" + } + }, "string-width": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz", @@ -9498,14 +22718,6 @@ "define-properties": "^1.1.3" } }, - "string_decoder": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", - "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", - "requires": { - "safe-buffer": "~5.1.0" - } - }, "strip-ansi": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", From f9f9a2a0db87621cda46cc2465948aaa93bf7367 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Sun, 20 Jun 2021 12:12:26 +0300 Subject: [PATCH 03/28] Copy catalog search form first version --- cloudapp/src/app/app-routing.module.ts | 3 + cloudapp/src/app/app.module.ts | 7 +- .../src/app/catalog/search-form/form-utils.ts | 34 +++++++ .../search-form/search-form.component.html | 56 +++++++++++ .../search-form/search-form.component.scss | 29 ++++++ .../search-form/search-form.component.ts | 81 ++++++++++++++++ .../src/app/main-menu/main-menu.component.ts | 32 +++---- cloudapp/src/app/service/catalog.service.ts | 32 +++++++ cloudapp/src/app/service/holdings.service.ts | 5 +- cloudapp/src/i18n/en.json | 95 ++++++++++++++++++- cloudapp/src/i18n/jp.json | 92 +++++++++++++++++- 11 files changed, 442 insertions(+), 24 deletions(-) create mode 100644 cloudapp/src/app/catalog/search-form/form-utils.ts create mode 100644 cloudapp/src/app/catalog/search-form/search-form.component.html create mode 100644 cloudapp/src/app/catalog/search-form/search-form.component.scss create mode 100644 cloudapp/src/app/catalog/search-form/search-form.component.ts create mode 100644 cloudapp/src/app/service/catalog.service.ts diff --git a/cloudapp/src/app/app-routing.module.ts b/cloudapp/src/app/app-routing.module.ts index 335553f..272332b 100644 --- a/cloudapp/src/app/app-routing.module.ts +++ b/cloudapp/src/app/app-routing.module.ts @@ -6,6 +6,7 @@ import { FormComponent } from './holdings/form/form.component'; import { ConfigurationComponent } from './configuration/configuration.component'; import { HelpComponent } from './holdings/help/help.component'; import { MainMenuComponent } from './main-menu/main-menu.component'; +import { CatalogSearchFormComponent } from './catalog/search-form/search-form.component'; const routes: Routes = [ { path: '', component: MainMenuComponent }, @@ -16,6 +17,8 @@ const routes: Routes = [ { path: 'holdings/:mmsId/new/:mmsTitle', component: FormComponent }, { path: 'holdings/:mmsId/view/:holdingId/:mmsTitle', component: FormComponent }, { path: 'help', component: HelpComponent }, + + { path: 'catalog', component: CatalogSearchFormComponent }, ]; @NgModule({ diff --git a/cloudapp/src/app/app.module.ts b/cloudapp/src/app/app.module.ts index 3979ff6..d07506c 100644 --- a/cloudapp/src/app/app.module.ts +++ b/cloudapp/src/app/app.module.ts @@ -13,15 +13,15 @@ import { FooterComponent } from './footer/footer.component'; import { HoldingsComponent } from './holdings/holdings/holdings.component'; import { FormComponent } from './holdings/form/form.component'; import { ConfigurationComponent } from './configuration/configuration.component'; - import { FlexLayoutModule } from '@angular/flex-layout'; - import {MatDialogModule} from '@angular/material/dialog'; import {ConfirmationDialog} from './dialog/confirmation-dialog.component'; - import { HelpComponent } from './holdings/help/help.component'; import { MainMenuComponent } from './main-menu/main-menu.component'; +import { CatalogSearchFormComponent } from './catalog/search-form/search-form.component'; + + export function getToastrModule() { return ToastrModule.forRoot({ @@ -41,6 +41,7 @@ export function getToastrModule() { ConfirmationDialog, HelpComponent, MainMenuComponent, + CatalogSearchFormComponent ], entryComponents: [ConfirmationDialog], imports: [ diff --git a/cloudapp/src/app/catalog/search-form/form-utils.ts b/cloudapp/src/app/catalog/search-form/form-utils.ts new file mode 100644 index 0000000..bf1b64d --- /dev/null +++ b/cloudapp/src/app/catalog/search-form/form-utils.ts @@ -0,0 +1,34 @@ +import { FormControl } from "@angular/forms"; + + +export class SearchItem { + _key: string; + _fieldLabel: string; + _formControl: FormControl; + + constructor(key:string, entity:SearchType){ + this._key = key; + this._fieldLabel = "Catalog.Form." + entity + ".Field." + key; + this._formControl = new FormControl(); + } + + getKey(): string { + return this._key; + } + + getFieldLabel() : string { + return this._fieldLabel; + } + + getFormControl() : FormControl { + return this._formControl; + } +} + + +export enum SearchType { + Monographs = "Monographs", + Serials = "Serials", + Names = "Names", + UniformTitles = "UniformTitles" +} diff --git a/cloudapp/src/app/catalog/search-form/search-form.component.html b/cloudapp/src/app/catalog/search-form/search-form.component.html new file mode 100644 index 0000000..d1e6915 --- /dev/null +++ b/cloudapp/src/app/catalog/search-form/search-form.component.html @@ -0,0 +1,56 @@ +
+ + + +
+ + +
+
+ +

{{'Catalog.Form.MainTitle' | translate}}

+ + + {{'Catalog.Form.SelectSearchType' | translate}} + + + {{searchType.value | translate}} + + + + + +

+ +
+ + + {{'Catalog.Form.SelectDatabase' | translate}} + + + {{ database }} + + + + + +
+ + {{item.getFieldLabel() | translate}} + + +
+
+ +

{{url}}

+
+ +


\ No newline at end of file diff --git a/cloudapp/src/app/catalog/search-form/search-form.component.scss b/cloudapp/src/app/catalog/search-form/search-form.component.scss new file mode 100644 index 0000000..887d04e --- /dev/null +++ b/cloudapp/src/app/catalog/search-form/search-form.component.scss @@ -0,0 +1,29 @@ +p { + margin-bottom: 15px; + } + +.align-space-between { + justify-content: space-between; + margin-bottom: 20px; +} + +.form-buttons { + display: inline-flex; + column-gap: 20px; +} + +.mat-form-field { + display: contents; +} + +.serach-form-card { + display: grid; + grid-template-columns: repeat(auto-fit, minmax(200px, 1fr)); + column-gap: 20px; + row-gap: 1em; + background-color: whitesmoke !important; +} + +.form-card-inputs{ + display: block; +} diff --git a/cloudapp/src/app/catalog/search-form/search-form.component.ts b/cloudapp/src/app/catalog/search-form/search-form.component.ts new file mode 100644 index 0000000..cf50791 --- /dev/null +++ b/cloudapp/src/app/catalog/search-form/search-form.component.ts @@ -0,0 +1,81 @@ +import { Component, OnInit } from '@angular/core'; +import { SearchItem, SearchType } from './form-utils'; +import { MatSelectChange } from "@angular/material/select"; +import { CatalogService } from '../../service/catalog.service'; + + + +@Component({ + selector: 'catalog-search-form', + templateUrl: './search-form.component.html', + styleUrls: ['./search-form.component.scss'] + }) + +export class CatalogSearchFormComponent{ + private catalogService: CatalogService; + + private ALL_DATABASES_MAP = new Map([ + [SearchType.Monographs, ['All','BOOK','PREBOOK','JPMARC','TRCMARC','USMARC','USMARCX','GPOMARC','UKMARC','REMARC','DNMARC','CHMARC','KORMARC','RECON','HBZBKS','SPABKS','ITABKS','KERISB','KERISX','BNFBKS']], + [SearchType.Serials, ['All','SERIAL','JPMARCS','USMARCS','SPASER','ITASER','KERISS','BNFSER']], + [SearchType.Names, ['All', 'NAME', 'JPMARCA', 'USMARCA']], + [SearchType.UniformTitles, ['All', 'TITLE', 'USMARCT']] + ]); + private ALL_FIELDS_MAP = new Map([ + [SearchType.Monographs, ['TITLE','FTITLE','PTBL','VOL','TiPtVo','AUTH','ISSN','ISBN','NBN','NDLCN','PUB','YEAR','PLACE','CNTRY','LANG','SH','AKEY','ID','PID']], + [SearchType.Serials, ['TITLE','FTITLE','AUTH','ISSN','CODEN','NDLPN','PUB','YEAR','PLACE','CNTRY','LANG','SH','AKEY','ID','FID']], + [SearchType.Names, ['AUTH', 'AKEY', 'PLACE', 'DATE', 'ID', 'SAID']], + [SearchType.UniformTitles, ['TITLE', 'AUTH', 'AKEY', 'ID', 'SAID']] + ]); + + private currentSearchType: SearchType; + private currentDatabase: string = 'All'; // default selection (includes all other DBs) + private isSearchTypeChoosed: boolean = false; + + private searchItemArray: Array; + private url: string = ""; // TODO: getting the base url from the catalog service + + constructor(){} + + getSearchTypeList(): Map{ + let searchTypeMap = new Map(); // + Object.values(SearchType).forEach(type=> { + searchTypeMap.set(type, "Catalog.Form." + type + ".MainTitle") + }); + return searchTypeMap; + } + + searchTypeSelection(event: MatSelectChange){ + this.currentSearchType = SearchType[event.value]; + this.isSearchTypeChoosed = true; + + let fieldsArray = this.ALL_FIELDS_MAP.get(this.currentSearchType); + this.searchItemArray = new Array(); + fieldsArray.forEach(field => { + this.searchItemArray.push(new SearchItem(field, this.currentSearchType)); + }); + } + + getDatabases(): Array { + return this.ALL_DATABASES_MAP.get(this.currentSearchType); + } + + save() { + this.url = ""; + this.url = this.url + "searchType=" + this.currentSearchType; + this.url = this.url + "&database=" + this.currentDatabase; + this.searchItemArray.forEach(item =>{ + if(item.getFormControl().value !== null){ + this.url = this.url + "&" + item.getKey(); + this.url = this.url + "=" + item.getFormControl().value; + } + }); + } + + clear() { + this.searchItemArray.forEach(searchItem => { + searchItem.getFormControl().setValue(null) + }); + } + +} + diff --git a/cloudapp/src/app/main-menu/main-menu.component.ts b/cloudapp/src/app/main-menu/main-menu.component.ts index 4b695c4..a894ebb 100644 --- a/cloudapp/src/app/main-menu/main-menu.component.ts +++ b/cloudapp/src/app/main-menu/main-menu.component.ts @@ -24,28 +24,28 @@ import { TranslateService } from '@ngx-translate/core'; return new Array( { title: 'MainMenu.Holdings.Title', - text: 'NACSIS holding information management', + text: 'MainMenu.Holdings.Text', icon: 'uxf-icon uxf-link', link: 'holdings' }, { - title: 'Catalog', - text: 'Search and Copy cataloging NACSIS Bib/Auth records', + title: 'MainMenu.Catalog.Title', + text: 'MainMenu.Catalog.Text', icon: 'uxf-icon uxf-background-color', - link: 'main' + link: 'catalog' }, - /*{ - title: 'Members', - text: 'NACSIS members information management', - icon: 'uxf-icon uxf-switch', - link: 'main' - }, - { - title: 'ILL Borrowing Requests', - text: 'NACSIS borrowing request creation', - icon: 'uxf-icon uxf-external-link', - link: 'main' - },*/ + // { + // title: 'Members', + // text: 'NACSIS members information management', + // icon: 'uxf-icon uxf-switch', + // link: 'main' + // }, + // { + // title: 'ILL Borrowing Requests', + // text: 'NACSIS borrowing request creation', + // icon: 'uxf-icon uxf-external-link', + // link: 'main' + // }, ); } diff --git a/cloudapp/src/app/service/catalog.service.ts b/cloudapp/src/app/service/catalog.service.ts new file mode 100644 index 0000000..ecb3f5d --- /dev/null +++ b/cloudapp/src/app/service/catalog.service.ts @@ -0,0 +1,32 @@ +import { Injectable } from '@angular/core'; +import { HttpClient } from "@angular/common/http"; +import { CloudAppEventsService, InitData } from '@exlibris/exl-cloudapp-angular-lib'; +import { BaseService } from "./base.service"; + + +@Injectable({ + providedIn: 'root' +}) +export class CatalogService extends BaseService { + + constructor( + protected eventsService: CloudAppEventsService, + protected http: HttpClient + ) { + super(eventsService, http); + } + + setBaseUrl(initData: InitData) : string { + let baseUrl = super.setBaseUrl(initData); + baseUrl = baseUrl + "copyCatalog"; + return baseUrl; + } + + + + + + + + +} \ No newline at end of file diff --git a/cloudapp/src/app/service/holdings.service.ts b/cloudapp/src/app/service/holdings.service.ts index 432ced5..e60df3e 100644 --- a/cloudapp/src/app/service/holdings.service.ts +++ b/cloudapp/src/app/service/holdings.service.ts @@ -4,7 +4,6 @@ import { of } from 'rxjs'; import { Injectable } from '@angular/core'; import { CloudAppEventsService, InitData } from '@exlibris/exl-cloudapp-angular-lib'; - import { BaseService } from "./base.service"; @Injectable({ @@ -17,8 +16,8 @@ export class HoldingsService extends BaseService { private PREVIEW_MAX_LENGTH: number = 30; constructor( - protected http: HttpClient, - protected eventsService: CloudAppEventsService + protected eventsService: CloudAppEventsService, + protected http: HttpClient ) { super(eventsService, http); } diff --git a/cloudapp/src/i18n/en.json b/cloudapp/src/i18n/en.json index 7347b08..17dd115 100644 --- a/cloudapp/src/i18n/en.json +++ b/cloudapp/src/i18n/en.json @@ -1,9 +1,102 @@ { "MainMenu": { "Holdings": { - "Title": "Holdings" + "Title": "Holdings", + "Text": "NACSIS holding information management" + }, + "Catalog": { + "Title": "Catalog", + "Text": "Search and Copy cataloging NACSIS Bib/Auth records" + } + }, + + "Catalog": { + "Form": { + "MainTitle": "Search records in NACSIS central catalog", + "SelectSearchType": "Select search type", + "SelectDatabase": "Select a database", + "Monographs": { + "MainTitle": "Monographs", + "Field": { + "TITLE": "TITLE", + "FTITLE": "FTITLE", + "PTBL": "PTBL", + "VOL": "VOL", + "TiPtVo": "TITLE / PTBL / VOL", + "AUTH": "AUTH", + "ISSN": "ISSN", + "ISBN": "ISBN", + "NBN": "NBN", + "NDLCN": "NDLCN / LCCN / OTHN", + "PUB": "PUB", + "YEAR": "YEAR", + "PLACE": "PLACE", + "CNTRY": "CNTRY", + "LANG": "LANG", + "SH": "SH", + "AKEY": "AKEY", + "ID": "ID", + "PID": "PID" + } + }, + "Serials": { + "MainTitle": "Serials", + "Field": { + "TITLE": "TITLE", + "FTITLE": "FTITLE", + "AUTH": "AUTH", + "ISSN": "ISSN", + "CODEN": "CODEN", + "NDLPN": "NDLPN / LCCN", + "PUB": "PUB", + "YEAR": "YEAR", + "PLACE": "PLACE", + "CNTRY": "CNTRY", + "LANG": "LANG", + "SH": "SH", + "AKEY": "AKEY", + "ID": "ID", + "FID": "FID" + } + }, + "Names": { + "MainTitle": "Name", + "Database": { + "All": "All", + "NAME": "NAME", + "JPMARCA": "JPMARCA", + "USMARCA": "USMARCA" + }, + "Field": { + "AUTH": "AUTH", + "AKEY": "AKEY", + "PLACE": "PLACE", + "DATE": "DATE", + "ID": "ID", + "SAID": "SAID" + } + }, + "UniformTitles": { + "MainTitle": "Uniform Titles", + "Database": { + "All": "All", + "TITLE": "TITLE", + "USMARCT": "USMARCT" + }, + "Field": { + "TITLE": "TITLE", + "AUTH": "AUTH", + "AKEY": "AKEY", + "ID": "ID", + "SAID": "SAID" + } + } } }, + + + "comment":"TODO: Holdings", + "Main": { "Intro": "Select a record to retrieve NACSIS holdings:", "NoRecords": "To view NACSIS holdings, navigate to a bibliographic record.", diff --git a/cloudapp/src/i18n/jp.json b/cloudapp/src/i18n/jp.json index 30a356b..27d6c39 100644 --- a/cloudapp/src/i18n/jp.json +++ b/cloudapp/src/i18n/jp.json @@ -1,9 +1,99 @@ { "MainMenu": { "Holdings": { - "Title": "タイトル" + "Title": "タイトル", + "Text": "??? NACSIS holding ???" + }, + "Catalog": { + "Title": "???", + "Text": "??? Search and Copy cataloging ???" + } + }, + + "Catalog": { + "Form": { + "MainTitle": "Search records ???", + "SelectSearchType": "Select search ???", + "SelectDatabase": "Select a ???", + "Monographs": { + "MainTitle": "Monographs??", + "Field": { + "TITLE": "TITLE??", + "FTITLE": "FTITLE??", + "PTBL": "PTBL", + "VOL": "VOL", + "TiPtVo": "TITLE / PTBL / VOL", + "AUTH": "AUTH", + "ISSN": "ISSN", + "ISBN": "ISBN", + "NBN": "NBN", + "NDLCN": "NDLCN / LCCN / OTHN", + "PUB": "PUB", + "YEAR": "YEAR", + "PLACE": "PLACE", + "CNTRY": "CNTRY", + "LANG": "LANG", + "SH": "SH", + "AKEY": "AKEY", + "ID": "ID", + "PID": "PID" + } + }, + "Serials": { + "MainTitle": "Serials???", + "Field": { + "TITLE": "TITLE??", + "FTITLE": "FTITLE??", + "AUTH": "AUTH", + "ISSN": "ISSN", + "CODEN": "CODEN", + "NDLPN": "NDLPN / LCCN", + "PUB": "PUB", + "YEAR": "YEAR", + "PLACE": "PLACE", + "CNTRY": "CNTRY", + "LANG": "LANG", + "SH": "SH", + "AKEY": "AKEY", + "ID": "ID", + "FID": "FID" + } + }, + "Names": { + "MainTitle": "Name??", + "Database": { + "All": "All??", + "NAME": "NAME??", + "JPMARCA": "JPMARCA", + "USMARCA": "USMARCA" + }, + "Field": { + "AUTH": "AUTH??", + "AKEY": "AKEY??", + "PLACE": "PLACE", + "DATE": "DATE", + "ID": "ID", + "SAID": "SAID" + } + }, + "UniformTitles": { + "MainTitle": "Uniform Titles???", + "Database": { + "All": "All", + "TITLE": "TITLE", + "USMARCT": "USMARCT" + }, + "Field": { + "TITLE": "TITLE???", + "AUTH": "AUTH???", + "AKEY": "AKEY", + "ID": "ID", + "SAID": "SAID" + } + } } }, + "Main": { "Intro": "NACSISから所蔵を取得するための書誌レコードを選択してください:", "NoRecords": "NACSISの所蔵を閲覧表示するため、該当の書誌レコードに移動します。", From 610123d3894bcd410bfc9cdfa8868f414290547d Mon Sep 17 00:00:00 2001 From: shayhadar Date: Mon, 5 Jul 2021 15:00:02 +0300 Subject: [PATCH 04/28] filter by dropdown to display only access records --- .../src/app/holdings/main/main.component.html | 7 +- .../src/app/holdings/main/main.component.ts | 67 +++++++++++-- cloudapp/src/app/service/alma.api.service.ts | 97 +++++++++++++++++++ 3 files changed, 160 insertions(+), 11 deletions(-) create mode 100644 cloudapp/src/app/service/alma.api.service.ts diff --git a/cloudapp/src/app/holdings/main/main.component.html b/cloudapp/src/app/holdings/main/main.component.html index bf02243..2503caa 100644 --- a/cloudapp/src/app/holdings/main/main.component.html +++ b/cloudapp/src/app/holdings/main/main.component.html @@ -1,4 +1,4 @@ -
+
- -

Main.Intro

Main.SelectBib - {{bib.description}} + {{bib.id}}: {{bib.description}} diff --git a/cloudapp/src/app/holdings/main/main.component.ts b/cloudapp/src/app/holdings/main/main.component.ts index f66964c..9ba9dc5 100644 --- a/cloudapp/src/app/holdings/main/main.component.ts +++ b/cloudapp/src/app/holdings/main/main.component.ts @@ -1,11 +1,15 @@ -import { Subscription } from 'rxjs'; +import { Subscription, of, forkJoin} from 'rxjs'; import { Component, OnInit, OnDestroy } from '@angular/core'; -import { CloudAppEventsService, Entity, EntityType } from '@exlibris/exl-cloudapp-angular-lib'; +import { CloudAppEventsService, Entity, EntityType, CloudAppRestService } from '@exlibris/exl-cloudapp-angular-lib'; import { Router } from '@angular/router'; import { HoldingsService} from '../../service/holdings.service'; import { TranslateService } from '@ngx-translate/core'; import { AlertService } from '@exlibris/exl-cloudapp-angular-lib'; +import { map, catchError, switchMap, tap } from 'rxjs/operators'; +import { AlmaApiService, IntegrationProfile } from '../../service/alma.api.service'; + + @Component({ selector: 'app-main', @@ -23,12 +27,18 @@ export class MainComponent implements OnInit, OnDestroy { message: string; isErrorMessageVisible: boolean = false; + processed = 0; + integrationProfile: IntegrationProfile; + constructor( private eventsService: CloudAppEventsService, private router: Router, private nacsis: HoldingsService, private translate: TranslateService, - private alert: AlertService + private alert: AlertService, + + private restService: CloudAppRestService, + private almaApiService: AlmaApiService, ) { } @@ -37,13 +47,56 @@ export class MainComponent implements OnInit, OnDestroy { this.nacsis.clearSessionStorage(); this.pageLoad$ = this.eventsService.onPageLoad(pageInfo => { - this.bibs = (pageInfo.entities || []).filter(e => e.type == EntityType.BIB_MMS); + + this.loading=true; + + this.almaApiService.getIntegrationProfile() + .subscribe(integrationProfile => this.integrationProfile = integrationProfile); + + let rawBibs = (pageInfo.entities || []).filter(e => e.type == EntityType.BIB_MMS); + let nacsisBibs: Entity[] = []; + + forkJoin(rawBibs.map(entity => this.getRecord(entity))) + .subscribe({ + next: (records: any[])=>{ + + let index: number=0; + + records.forEach(record=>{ + console.log(record); + let nacsisId = this.almaApiService.extractNacsisId(record.anies, this.integrationProfile.systemNumberPrefix); + if(nacsisId != null) { + // tweak: override mmsId by nacsisId + let nacsisBib = rawBibs[index]; + nacsisBib.id = nacsisId; + nacsisBibs.push(nacsisBib); + } + index++; + }) + }, + error: e => { + this.loading = false; + console.log(e.message); + //this.alert.error(e.message, {keepAfterRouteChange:true}); + }, + complete: () => { + this.loading=false; + this.bibs = nacsisBibs; + } + }); }); - } + } ngOnDestroy(): void { this.pageLoad$.unsubscribe(); } + + getRecord(entity: Entity) { + return this.restService.call(entity.link).pipe( + tap(()=>this.processed++), + catchError(e => of(e)), + ) + } search() { if (this.selected) { @@ -51,7 +104,8 @@ export class MainComponent implements OnInit, OnDestroy { try { let bib = this.bibs.filter(bib => bib.id == this.selected); - this.nacsis.getHoldingsFromNacsis(this.selected, "Mine") .subscribe({ + this.nacsis.getHoldingsFromNacsis(this.selected, "Mine") + .subscribe({ next: (header) => { if (header.status === this.nacsis.OkStatus) { this.router.navigate(['/holdings', this.selected, bib[0].description]); @@ -78,3 +132,4 @@ export class MainComponent implements OnInit, OnDestroy { this.isErrorMessageVisible = false; } } + diff --git a/cloudapp/src/app/service/alma.api.service.ts b/cloudapp/src/app/service/alma.api.service.ts new file mode 100644 index 0000000..585fdf3 --- /dev/null +++ b/cloudapp/src/app/service/alma.api.service.ts @@ -0,0 +1,97 @@ +import { Injectable } from '@angular/core'; +import { CloudAppRestService } from '@exlibris/exl-cloudapp-angular-lib'; +import { mergeMap } from 'rxjs/operators'; +import { of } from 'rxjs'; + + +@Injectable({ + providedIn: 'root' +}) +export class AlmaApiService { + + integrationProfile :IntegrationProfile; + + constructor( + private restService: CloudAppRestService, + + ) { } + + /* + + + 00944pam a2200301 a 4500 + 99960780000541 + ... + + BB26104986 + JP-ToKJK + + ... + + */ + extractNacsisId(stringXml, systemNumberPrefix) : string{ + const doc = new DOMParser().parseFromString(stringXml, "application/xml"); + let datafields = doc.getElementsByTagName("datafield"); + let subfield_016_a, subfield_016_2; + + for (let index = 0; index < datafields.length; index++) { + const field = datafields[index]; + let tag = field.getAttribute("tag").valueOf(); + console.log(tag); + if(tag === "016") { + let subfields = field.getElementsByTagName("subfield"); + for (let index = 0; index < subfields.length; index++) { + const subfield = subfields[index]; + let tag = subfield.getAttribute("code").valueOf(); + if(tag === "a") { + subfield_016_a = subfield.innerHTML; + } + if(tag === "2") { + subfield_016_2 = subfield.innerHTML; + } + } + if(subfield_016_2 == systemNumberPrefix) { + return subfield_016_a; + } + return null; + } + } + return null; + } + + getIntegrationProfile() { + + let url = "/conf/integration-profiles?type=CENTRAL_CATALOG_INTEGRATION"; + + if(this.integrationProfile != null) { + return of(this.integrationProfile) + } + + return this.restService.call(url).pipe( + mergeMap(response => { + + this.integrationProfile = new IntegrationProfile(); + + // extract integration profile + let nacsisIntegrationProfile = response.integration_profile[0]; // assume can be only one CENTRAL_CATALOG_INTEGRATION + let systemNumberPrefixParam = nacsisIntegrationProfile.parameter.filter(param => param.action.value == "CENTRAL_CATALOG_INFORMATION_B" && param.name.value == "systemNumberPrefix"); + this.integrationProfile.systemNumberPrefix = systemNumberPrefixParam[0].value; + + // todo: extract import profiles + // repositoryImportProfile + // authorityImportProfileNames + // authorityImportProfileUniformTitles + + return of(this.integrationProfile); + }) + ); + } + +} + +export class IntegrationProfile { + systemNumberPrefix: string; + repositoryImportProfile: string; + authorityImportProfileNames: string; + authorityImportProfileUniformTitles: string; +} From 4eacbd93715679397e90c8587bb5c6e12738632c Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Tue, 20 Jul 2021 19:21:47 +0300 Subject: [PATCH 05/28] Copy catalog integration Summery view Full view View holdings holdings component name to viewHoldings --- cloudapp/src/app/app-routing.module.ts | 3 +- cloudapp/src/app/app.module.ts | 5 +- .../app/catalog/results-types/monographs.ts | 315 ++++++++++++++++++ .../src/app/catalog/results-types/name.ts | 139 ++++++++ .../catalog/results-types/results-common.ts | 193 +++++++++++ .../src/app/catalog/results-types/serials.ts | 282 ++++++++++++++++ .../app/catalog/results-types/uniformTitle.ts | 131 ++++++++ .../src/app/catalog/search-form/form-utils.ts | 79 ++++- .../search-form/search-form.component.html | 170 ++++++++-- .../search-form/search-form.component.scss | 78 ++++- .../search-form/search-form.component.ts | 314 ++++++++++++++--- .../src/app/holdings/main/main.component.ts | 4 +- .../viewHoldings.component.html} | 2 +- .../viewHoldings.component.scss} | 0 .../viewHoldings.component.ts} | 13 +- .../app/main-menu/main-menu.component.html | 11 +- .../src/app/main-menu/main-menu.component.ts | 11 +- cloudapp/src/app/service/base.service.ts | 16 + cloudapp/src/app/service/catalog.service.ts | 121 ++++++- cloudapp/src/app/service/holdings.service.ts | 30 +- cloudapp/src/i18n/en.json | 18 +- cloudapp/src/i18n/jp.json | 10 + 22 files changed, 1800 insertions(+), 145 deletions(-) create mode 100644 cloudapp/src/app/catalog/results-types/monographs.ts create mode 100644 cloudapp/src/app/catalog/results-types/name.ts create mode 100644 cloudapp/src/app/catalog/results-types/results-common.ts create mode 100644 cloudapp/src/app/catalog/results-types/serials.ts create mode 100644 cloudapp/src/app/catalog/results-types/uniformTitle.ts rename cloudapp/src/app/holdings/{holdings/holdings.component.html => viewHoldings/viewHoldings.component.html} (98%) rename cloudapp/src/app/holdings/{holdings/holdings.component.scss => viewHoldings/viewHoldings.component.scss} (100%) rename cloudapp/src/app/holdings/{holdings/holdings.component.ts => viewHoldings/viewHoldings.component.ts} (92%) diff --git a/cloudapp/src/app/app-routing.module.ts b/cloudapp/src/app/app-routing.module.ts index 272332b..6ea7a1a 100644 --- a/cloudapp/src/app/app-routing.module.ts +++ b/cloudapp/src/app/app-routing.module.ts @@ -1,7 +1,7 @@ import { NgModule } from '@angular/core'; import { Routes, RouterModule } from '@angular/router'; import { MainComponent } from './holdings/main/main.component'; -import { HoldingsComponent } from './holdings/holdings/holdings.component'; +import { HoldingsComponent } from './holdings/viewHoldings/viewHoldings.component'; import { FormComponent } from './holdings/form/form.component'; import { ConfigurationComponent } from './configuration/configuration.component'; import { HelpComponent } from './holdings/help/help.component'; @@ -17,7 +17,6 @@ const routes: Routes = [ { path: 'holdings/:mmsId/new/:mmsTitle', component: FormComponent }, { path: 'holdings/:mmsId/view/:holdingId/:mmsTitle', component: FormComponent }, { path: 'help', component: HelpComponent }, - { path: 'catalog', component: CatalogSearchFormComponent }, ]; diff --git a/cloudapp/src/app/app.module.ts b/cloudapp/src/app/app.module.ts index d07506c..645385e 100644 --- a/cloudapp/src/app/app.module.ts +++ b/cloudapp/src/app/app.module.ts @@ -10,11 +10,11 @@ import { AppComponent } from './app.component'; import { AppRoutingModule } from './app-routing.module'; import { MainComponent } from './holdings/main/main.component'; import { FooterComponent } from './footer/footer.component'; -import { HoldingsComponent } from './holdings/holdings/holdings.component'; +import { HoldingsComponent } from './holdings/viewHoldings/viewHoldings.component'; import { FormComponent } from './holdings/form/form.component'; import { ConfigurationComponent } from './configuration/configuration.component'; import { FlexLayoutModule } from '@angular/flex-layout'; -import {MatDialogModule} from '@angular/material/dialog'; +import { MatDialogModule } from '@angular/material/dialog'; import {ConfirmationDialog} from './dialog/confirmation-dialog.component'; import { HelpComponent } from './holdings/help/help.component'; import { MainMenuComponent } from './main-menu/main-menu.component'; @@ -22,7 +22,6 @@ import { MainMenuComponent } from './main-menu/main-menu.component'; import { CatalogSearchFormComponent } from './catalog/search-form/search-form.component'; - export function getToastrModule() { return ToastrModule.forRoot({ positionClass: 'toast-top-right', diff --git a/cloudapp/src/app/catalog/results-types/monographs.ts b/cloudapp/src/app/catalog/results-types/monographs.ts new file mode 100644 index 0000000..3814495 --- /dev/null +++ b/cloudapp/src/app/catalog/results-types/monographs.ts @@ -0,0 +1,315 @@ +import { TranslateService } from '@ngx-translate/core'; +import { IDisplayLinesSummary, BaseResult, FullViewField, IDisplayLinesFull, FullViewLine, FieldBuilder } from './results-common'; + + +export class Monograph extends BaseResult{ + summaryView: MonographSummary; + fullView : MonographFull; + + constructor(record: any){ + super(record); + } +} + +export class MonographSummary{ + TITLE: string = ""; + AUTH: string = ""; + PUBL: string = ""; + LANG: string = ""; + YEAR: string = ""; + ID: string = ""; + ISBN: string = ""; + SH: string = ""; +} + +export class MonographFull{ + ID: string = ""; + CRTDT: string = ""; + CRTFA: string = ""; + RNWDT: string = ""; + RNWFA: string = ""; + ISSN: string = ""; + NBN: string = ""; + LCCN: string = ""; + NDLCN: string = ""; + REPRO: string = ""; + GPON: string = ""; + OTHN: string = ""; + GMD: string = ""; + SMD: string = ""; + YEAR: string = ""; + CNTRY: string = ""; + TTLL: string = ""; + TXTL: string = ""; + ORGL: string = ""; + VOLG: MonographVOLG[]; + TRD: string = ""; + TRR: string = ""; + TRVR: string = ""; + ED: string = ""; + PUB: MonographPUB[]; + PUBDT: string = ""; + PHYSP: string = ""; + PHYSI: string = ""; + PHYSS: string = ""; + PHYSA: string = ""; + VT: MonographVT[]; + CW: MonographCW[]; + NOTE: MonographNOTE[]; + PTBL: MonographPTBL[]; + AL: MonographAL[]; + UTL: MonographUTL[]; + CLS: MonographCLS[]; + SH: MonographSH[]; + IDENT: MonographIDENT[]; +} + +export class MonographVOLG{ + VOL: string = ""; + ISBN: string = ""; + PRICE: string = ""; + XISBN: string = ""; +} + +export class MonographPUB{ + PUBP: string = ""; + PUBL: string = ""; +} + +export class MonographVT{ + VTK: string = ""; + VTD: string = ""; + VTR: string = ""; + VTVR: string = ""; +} + +export class MonographCW{ + CWT: string = ""; + CWA: string = ""; + CWR: string = ""; + CWVR: string = ""; +} + +export class MonographNOTE{ + NOTE: string = ""; +} + +export class MonographPTBL{ + PTBTR: string = ""; + PTBTRR: string = ""; + PTBTRVR: string = ""; + PTBID: string = ""; + PTBNO: string = ""; + PTBK: string = ""; +} + +export class MonographAL{ + AFLG: string = ""; + AHDNG: string = ""; + AHDNGR: string = ""; + AHDNGVR: string = ""; + AID: string = ""; + AF: string = ""; +} + +export class MonographUTL{ + UTFLG: string = ""; + UTHDNG: string = ""; + UTHDNGR: string = ""; + UTHDNGVR: string = ""; + UTID: string = ""; + UTINFO: string = ""; +} + +export class MonographCLS{ + CLSK: string = ""; + CLSD: string = ""; +} + +export class MonographSH{ + SHT: string = ""; + SHD: string = ""; + SHR: string = ""; + SHVR: string = ""; + SHK: string = ""; +} + +export class MonographIDENT{ + IDENT: string = ""; +} + +export class MonographSummaryDisplay implements IDisplayLinesSummary{ + private fullRecordData: Monograph; + private record: MonographSummary; + + constructor( + private translate: TranslateService, + fullRecordData: Monograph + ) { + this.fullRecordData = fullRecordData; + this.record = this.fullRecordData.getSummaryView(); + } + + getDisplayTitle(): string { + return this.record.TITLE; + } + + initContentDisplay(): Array { + let summaryLines = new Array(); + + summaryLines.push(this.translate.instant('Catalog.Results.By') + " " + this.record.AUTH + " (" + + this.translate.instant("Catalog.Results.Book") + " " + this.record.PUBL + + ", " + this.record.LANG + ": " + this.record.YEAR + ")"); + summaryLines.push( this.translate.instant("Catalog.Results.NACSISID") + ": " + this.record.ID); + summaryLines.push( this.translate.instant("Catalog.Results.ISBN") + ": " + this.record.ISBN); + summaryLines.push( this.translate.instant("Catalog.Results.Subjects") + ": " + this.record.SH); + + return summaryLines; + } + + getFullRecordData() { + return this.fullRecordData; + } +} + +export class MonographFullDisplay extends IDisplayLinesFull { + + constructor(fullViewRecord: MonographFull) { + super(fullViewRecord); + } + + initContentDisplay(){ + this.fullViewLines = new Array(); + let fieldArray = new Array() + fieldArray.push(new FieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); + fieldArray.push(new FieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link('').build()); + fieldArray.push(new FieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); + fieldArray.push(new FieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link('').build()); + this.addLine(new FieldBuilder().build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().label("ISSN: ").content(this.record.ISSN).build()); + fieldArray.push(new FieldBuilder().label("NBN: ").content(this.record.NBN).build()); + fieldArray.push(new FieldBuilder().label("LCCN: ").content(this.record.LCCN).build()); + fieldArray.push(new FieldBuilder().label("NDLCN: ").content(this.record.NDLCN).build()); + fieldArray.push(new FieldBuilder().label("REPRO: ").content(this.record.REPRO).build()); + fieldArray.push(new FieldBuilder().label("GPON: ").content(this.record.GPON).build()); + fieldArray.push(new FieldBuilder().label("OTHN: ").content(this.record.OTHN).build()); + this.addLine(new FieldBuilder().label("CODE").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().label("GMD: ").content(this.record.GMD).build()); + fieldArray.push(new FieldBuilder().label("SMD: ").content(this.record.SMD).build()); + fieldArray.push(new FieldBuilder().label("YEAR: ").content(this.record.YEAR).build()); + fieldArray.push(new FieldBuilder().label("CNTRY: ").content(this.record.CNTRY).build()); + fieldArray.push(new FieldBuilder().label("TTLL: ").content(this.record.TTLL).build()); + fieldArray.push(new FieldBuilder().label("TXTL: ").content(this.record.TXTL).build()); + fieldArray.push(new FieldBuilder().label("ORGL: ").content(this.record.ORGL).build()); + this.addLine(new FieldBuilder().label("CODE").build(), fieldArray); + this.record.VOLG?.forEach(vol=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().label("VOL: ").content(vol.VOL).build()); + fieldArray.push(new FieldBuilder().label("ISBN: ").content(vol.ISBN).build()); + fieldArray.push(new FieldBuilder().label("PRICE: ").content(vol.PRICE).build()); + fieldArray.push(new FieldBuilder().label("XISBN: ").content(vol.XISBN).build()); + this.addLine(new FieldBuilder().label("VOLG").build(), fieldArray); + }); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.TRD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(this.record.TRR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(this.record.TRVR).build()); + this.addLine(new FieldBuilder().label("TR").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.ED).build()); + this.addLine(new FieldBuilder().label("ED").build(), fieldArray); + this.record.PUB?.forEach(pub=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(pub.PUBP).build()); + fieldArray.push(new FieldBuilder().label(": ").content(pub.PUBL).build()); + fieldArray.push(new FieldBuilder().label(", ").content(pub.PUBDT).build()); + this.addLine(new FieldBuilder().label("PUB").build(), fieldArray); + }); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.PHYSP).build()); + fieldArray.push(new FieldBuilder().label("; ").content(this.record.PHYSI).build()); + fieldArray.push(new FieldBuilder().label("; ").content(this.record.PHYSS).build()); + fieldArray.push(new FieldBuilder().label("+").content(this.record.PHYSA).build()); + this.addLine(new FieldBuilder().label("PHYS").build(), fieldArray); + this.record.VT?.forEach(vt=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(vt.VTK).build()); + fieldArray.push(new FieldBuilder().label(": ").content(vt.VTD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(vt.VTR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(vt.VTVR).build()); + this.addLine(new FieldBuilder().label("VT").build(), fieldArray); + }); + this.record.CW?.forEach(cw=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(cw.CWT).build()); + fieldArray.push(new FieldBuilder().label("/ ").content(cw.CWA).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(cw.CWR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(cw.CWVR).build()); + this.addLine(new FieldBuilder().label("CW").build(), fieldArray); + }); + this.record.NOTE?.forEach(note=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(note.NOTE).build()); + this.addLine(new FieldBuilder().label("NOTE").build(), fieldArray); + }); + this.record.PTBL?.forEach(ptbl=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(ptbl.PTBTR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(ptbl.PTBTRR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(ptbl.PTBTRVR).build()); + fieldArray.push(new FieldBuilder().content(ptbl.PTBID).link('').build()); + fieldArray.push(new FieldBuilder().content(ptbl.PTBNO).build()); + fieldArray.push(new FieldBuilder().label("// ").content(ptbl.PTBK).build()); + this.addLine(new FieldBuilder().label("PTBL").build(), fieldArray); + }); + this.record.AL?.forEach(al=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(al.AFLG).build()); + fieldArray.push(new FieldBuilder().content(al.AHDNG).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(al.AHDNGR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(al.AHDNGVR).build()); + fieldArray.push(new FieldBuilder().content(al.AID).link('').build()); + fieldArray.push(new FieldBuilder().content(al.AF).build()); + this.addLine(new FieldBuilder().label("AL").build(), fieldArray); + }); + this.record.UTL?.forEach(utl=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(utl.UTFLG).build()); + fieldArray.push(new FieldBuilder().content(utl.UTHDNG).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(utl.UTHDNGR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(utl.UTHDNGVR).build()); + fieldArray.push(new FieldBuilder().content(utl.UTID).build()); + fieldArray.push(new FieldBuilder().content(utl.UTINFO).build()); + this.addLine(new FieldBuilder().label("UTL").build(), fieldArray); + }); + this.record.CLS?.forEach(cls=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(cls.CLSK).build()); + fieldArray.push(new FieldBuilder().label(": ").content(cls.CLSD).build()); + this.addLine(new FieldBuilder().label("CLS").build(), fieldArray); + }); + this.record.SH?.forEach(sh=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(sh.SHT).build()); + fieldArray.push(new FieldBuilder().label(": ").content(sh.SHD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(sh.SHR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(sh.SHVR).build()); + fieldArray.push(new FieldBuilder().label("// ").content(sh.SHK).build()); + this.addLine(new FieldBuilder().label("SH").build(), fieldArray); + }); + this.record.IDENT?.forEach(ident=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(ident.IDENT).build()); + this.addLine(new FieldBuilder().label("IDENT").build(), fieldArray); + }); + + return this.fullViewLines; + + + } + + +} + diff --git a/cloudapp/src/app/catalog/results-types/name.ts b/cloudapp/src/app/catalog/results-types/name.ts new file mode 100644 index 0000000..08617bc --- /dev/null +++ b/cloudapp/src/app/catalog/results-types/name.ts @@ -0,0 +1,139 @@ +import { TranslateService } from '@ngx-translate/core'; +import { IDisplayLinesSummary, BaseResult, IDisplayLinesFull, FullViewField, FullViewLine, FieldBuilder } from './results-common'; + + +export class Name extends BaseResult { + summaryView: NameSummary; + fullView : NameFull; + + constructor(record: any){ + super(record); + } +} + +export class NameSummary{ + AUTH: string = ""; + DATE: string = ""; + ID: string = ""; +} + +export class NameFull{ + ID: string = ""; + CRTDT: string = ""; + CRTFA: string = ""; + RNWDT: string = ""; + RNWFA: string = ""; + HDNGD: string = ""; + HDNGR: string = ""; + HDNGVR: string = ""; + LCAID: string = ""; + TYPE: string = ""; + PLACE: string = ""; + YEAR: string = ""; + SF: NameSF[]; + SAF: NameSAF[]; + NOTE: NameNOTE[]; +} + +export class NameSF{ + SFD: string = ""; + SFR: string = ""; + SFVR: string = ""; +} + +export class NameSAF{ + SAFD: string = ""; + SAFR: string = ""; + SAFVR: string = ""; + SAFID: string = ""; +} + +export class NameNOTE{ + NOTE: string = ""; +} + +export class NameSummaryDisplay implements IDisplayLinesSummary{ + private fullRecordData: Name; + private record: NameSummary; + + constructor( + private translate: TranslateService, + fullRecordData: Name){ + this.fullRecordData = fullRecordData; + this.record = this.fullRecordData.getSummaryView(); + } + + getDisplayTitle(): string { + let title = this.record.AUTH + "; " + this.record.DATE; + return title; + } + + initContentDisplay(): Array { + let summaryLines = new Array(); + summaryLines.push( this.translate.instant("Catalog.Results.NACSISID") + ": " + this.record.ID); + return summaryLines; + } + + getFullRecordData() { + return this.fullRecordData; + } +} + +export class NameFullDisplay extends IDisplayLinesFull { + + constructor(fullViewRecord: NameFull) { + super(fullViewRecord); + } + + initContentDisplay(){ + this.fullViewLines = new Array(); + let fieldArray = new Array() + fieldArray.push(new FieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); + fieldArray.push(new FieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link('').build()); + fieldArray.push(new FieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); + fieldArray.push(new FieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link('').build()); + this.addLine(new FieldBuilder().build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.HDNGD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(this.record.HDNGR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + this.addLine(new FieldBuilder().label("HDNG").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.LCAID).build()); + this.addLine(new FieldBuilder().label("LCAID").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.TYPE).build()); + this.addLine(new FieldBuilder().label("TYPE").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.PLACE).build()); + this.addLine(new FieldBuilder().label("PLACE").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.YEAR).build()); + this.addLine(new FieldBuilder().label("DATE").build(), fieldArray); + this.record.SF?.forEach(sf=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(sf.SFD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(sf.SFR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(sf.SFVR).build()); + this.addLine(new FieldBuilder().label("SF").build(), fieldArray); + }); + this.record.SAF?.forEach(saf=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(saf.SAFD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFVR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFID).link('').build()); + this.addLine(new FieldBuilder().label("SAF").build(), fieldArray); + }); + this.record.NOTE?.forEach(note=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(note.NOTE).build()); + this.addLine(new FieldBuilder().label("NOTE").build(), fieldArray); + }); + + return this.fullViewLines; + } + + +} + diff --git a/cloudapp/src/app/catalog/results-types/results-common.ts b/cloudapp/src/app/catalog/results-types/results-common.ts new file mode 100644 index 0000000..15a93b6 --- /dev/null +++ b/cloudapp/src/app/catalog/results-types/results-common.ts @@ -0,0 +1,193 @@ +import { SearchType } from "../search-form/form-utils"; +import { Header } from "../../service/base.service"; + +export interface IDisplayLinesSummary { + getDisplayTitle(): string; + initContentDisplay(): Array; + getFullRecordData() : BaseResult; +} + + +export abstract class IDisplayLinesFull { + protected record: any; + protected fullViewLines: Array; + + constructor(fullViewRecord: any) { + this.record = fullViewRecord; + } + + initContentDisplay(){}; + + protected addLine(header: FullViewField, content: Array){ + let filteredArray = content.filter(field => field.hasContent() === true); + if(filteredArray.length > 0){ + this.fullViewLines.push(new FullViewLine(header, filteredArray)); + } + } + + protected dateFormatDisplay(field: string) { + if(field != "" && field != undefined){ + return field.substring(0,4) + "/" + field.substring(4,6) + "/" + field.substring(6,8); + } else { + return ""; + } + } + +} + + +export class NacsisCatalogResults { + header: ResultsHeader; + results: Array; + + constructor(){ } + + getHeader() { + return this.header; + } + + setHeader(header: ResultsHeader) { + this.header = header; + } + + getResults() { + return this.results; + } + + setResults(arr: Array) { + this.results = arr; + } +} + +export class ResultsHeader extends Header { + totalRecords: number; + numberOfRecords: number; + searchType: SearchType; +} + +export abstract class BaseResult { + ID: string = ""; + summaryView: any; + fullView : any; + rawData: string = ""; + + constructor(record: any){ + this.ID = record.ID; + this.summaryView = record.summaryView; + this.fullView = record.fullView; + this.rawData = record.rawData; + } + + getID(){ + return this.ID; + } + + getSummaryView(){ + return this.summaryView; + } + + getFullView(){ + return this.fullView; + } + + getRawData(){ + return this.rawData; + } +} + +export class FullViewField { + + private label: string; + private content: string; + private link: string; + + constructor(fieldBuilder: FieldBuilder) { + this.label = fieldBuilder.getLabel(); + this.content = fieldBuilder.getContent(); + this.link = fieldBuilder.getLink(); + } + + getLabel() { + return this.label; + } + + hasLabel() { + return (this.label != null); + } + + getContent() { + return this.content; + } + + hasContent() { + return (this.content != "" && this.content != undefined); + } + + isLinkable() { + return (this.link != null); + } + + getLink() { + return this.link; + } + +} + +export class FieldBuilder { + + private _label: string; + private _content: string; + private _link: string; + + constructor() { } + + + getLabel() { + return this._label; + } + + getContent() { + return this._content; + } + + getLink() { + return this._link; + } + + label(label: string) { + this._label = label; + return this; + } + + content(content: string) { + this._content = content; + return this; + } + + link(link: string) { + this._link = link; + return this; + } + + build() { + return new FullViewField(this); + } + +} + +export class FullViewLine { + + constructor ( + private header: FullViewField, + private content: Array + ) { } + + getHeaderLabel() { + return this.header.getLabel(); + } + + getContent() { + return this.content; + } + +} diff --git a/cloudapp/src/app/catalog/results-types/serials.ts b/cloudapp/src/app/catalog/results-types/serials.ts new file mode 100644 index 0000000..3610911 --- /dev/null +++ b/cloudapp/src/app/catalog/results-types/serials.ts @@ -0,0 +1,282 @@ +import { TranslateService } from '@ngx-translate/core'; +import { IDisplayLinesSummary, BaseResult, FullViewField, IDisplayLinesFull, FullViewLine, FieldBuilder } from './results-common'; + + +export class Serial extends BaseResult{ + summaryView: SerialSummary; + fullView : SerialFull; + + constructor(record: any){ + super(record); + } +} + +export class SerialSummary{ + TITLE: string = ""; + AUTH: string = ""; + PUBL: string = ""; + LANG: string = ""; + VOL: string = ""; + YEAR: string = ""; + ID: string = ""; + ISSN: string = ""; + SH: string = ""; +} + +export class SerialFull{ + ID: string = ""; + // empty header + CRTDT: string = ""; + CRTFA: string = ""; + RNWDT: string = ""; + RNWFA: string = ""; + // CODE + ISSN: string = ""; + XISSN: string = ""; + CODEN: string = ""; + LCCN: string = ""; + NDLPN: string = ""; + ULPN: string = ""; + GPON: string = ""; + GMD: string = ""; + SMD: string = ""; + YEAR: string = ""; + CNTRY: string = ""; + TTLL: string = ""; + TXTL: string = ""; + ORGL: string = ""; + REPRO: string = ""; + PSTAT: string = ""; + FREQ: string = ""; + REGL: string = ""; + TYPE: string = ""; + // TR + TRD: string = ""; + TRR: string = ""; + TRVR: string = ""; + // ED + ED: string = ""; + // VLYR + VLYR: string = ""; + // PUB + PUB: serialPUB[]; + // PHYS + PHYSP: string = ""; + PHYSI: string = ""; + PHYSS: string = ""; + PHYSA: string = ""; + // VT + VT: serialVT[]; + // NOTE + NOTE: serialNOTE[]; + // PRICE + PRICE: string = ""; + // FID + FID: string = ""; + // BHNT + BHNT: serialBHNT[]; + // AL + AL: serialAL[]; + // SH + SH: serialSH[]; + // IDENT + IDENT: serialIDENT[]; +} + +export class serialPUB{ + PUBP: string = ""; + PUBL: string = ""; + PUBDT: string = ""; +} + +export class serialVT{ + VTK: string = ""; + VTD: string = ""; + VTR: string = ""; + VTVR: string = ""; +} + +export class serialNOTE{ + NOTE: string = ""; +} + +export class serialBHNT{ + BHK: string = ""; + BHTR: string = ""; + BHBID: string = ""; +} + +export class serialAL{ + AFLG: string = ""; + AHDNG: string = ""; + AHDNGR: string = ""; + AHDNGVR: string = ""; + AID: string = ""; + AF: string = ""; +} + +export class serialSH{ + SHT: string = ""; + SHD: string = ""; + SHR: string = ""; + SHVR: string = ""; + SHK: string = ""; +} + +export class serialIDENT{ + IDENT: string = ""; +} + + +export class SerialSummaryDisplay implements IDisplayLinesSummary{ + private fullRecordData: Serial; + private record: SerialSummary; + + constructor( + private translate: TranslateService, + fullRecordData: Serial + ) { + this.fullRecordData = fullRecordData; + this.record = this.fullRecordData.getSummaryView(); + } + + getDisplayTitle(): string { + return this.record.TITLE; + } + + initContentDisplay(): Array { + let summaryLines = new Array(); + + summaryLines.push(this.translate.instant('Catalog.Results.By') + " " + this.record.AUTH + " (" + + this.translate.instant("Catalog.Results.Book") + " " + this.record.PUBL + + ", " + this.record.LANG + ": " + this.record.VOL + "; " + this.record.YEAR + ")"); + summaryLines.push( this.translate.instant("Catalog.Results.NACSISID") + ": " + this.record.ID); + summaryLines.push( this.translate.instant("Catalog.Results.ISSN") + ": " + this.record.ISSN); + summaryLines.push( this.translate.instant("Catalog.Results.Subjects") + ": " + this.record.SH); + + return summaryLines; + } + + getFullRecordData() { + return this.fullRecordData; + } +} + +export class SerialFullDisplay extends IDisplayLinesFull { + + constructor( + fullViewRecord: SerialFull + ) { + super(fullViewRecord); + } + + initContentDisplay(){ + this.fullViewLines = new Array(); + let fieldArray = new Array() + fieldArray.push(new FieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); + fieldArray.push(new FieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link('').build()); + fieldArray.push(new FieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); + fieldArray.push(new FieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link('').build()); + this.addLine(new FieldBuilder().build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().label("ISSN: ").content(this.record.ISSN).build()); + fieldArray.push(new FieldBuilder().label("XISSN: ").content(this.record.XISSN).build()); + fieldArray.push(new FieldBuilder().label("CODEN: ").content(this.record.CODEN).build()); + fieldArray.push(new FieldBuilder().label("LCCN: ").content(this.record.LCCN).build()); + fieldArray.push(new FieldBuilder().label("NDLPN: ").content(this.record.NDLPN).build()); + fieldArray.push(new FieldBuilder().label("ULPN: ").content(this.record.ULPN).build()); + fieldArray.push(new FieldBuilder().label("GPON: ").content(this.record.GPON).build()); + this.addLine(new FieldBuilder().label("CODE").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().label("GMD: ").content(this.record.GMD).build()); + fieldArray.push(new FieldBuilder().label("SMD: ").content(this.record.SMD).build()); + fieldArray.push(new FieldBuilder().label("YEAR: ").content(this.record.YEAR).build()); + fieldArray.push(new FieldBuilder().label("CNTRY: ").content(this.record.CNTRY).build()); + fieldArray.push(new FieldBuilder().label("TTLL: ").content(this.record.TTLL).build()); + fieldArray.push(new FieldBuilder().label("TXTL: ").content(this.record.TXTL).build()); + fieldArray.push(new FieldBuilder().label("ORGL: ").content(this.record.ORGL).build()); + fieldArray.push(new FieldBuilder().label("REPRO: ").content(this.record.REPRO).build()); + fieldArray.push(new FieldBuilder().label("PSTAT: ").content(this.record.PSTAT).build()); + fieldArray.push(new FieldBuilder().label("FREQ: ").content(this.record.FREQ).build()); + fieldArray.push(new FieldBuilder().label("REGL: ").content(this.record.REGL).build()); + fieldArray.push(new FieldBuilder().label("TYPE: ").content(this.record.TYPE).build()); + this.addLine(new FieldBuilder().label("CODE").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.TRD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(this.record.TRR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(this.record.TRVR).build()); + this.addLine(new FieldBuilder().label("TR").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.ED).build()); + this.addLine(new FieldBuilder().label("ED").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.VLYR).build()); + this.addLine(new FieldBuilder().label("VLYR").build(), fieldArray); + this.record.PUB?.forEach(pub=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(pub.PUBP).build()); + fieldArray.push(new FieldBuilder().label(": ").content(pub.PUBL).build()); + fieldArray.push(new FieldBuilder().label(", ").content(pub.PUBDT).build()); + this.addLine(new FieldBuilder().label("PUB").build(), fieldArray); + }); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.PHYSP).build()); + fieldArray.push(new FieldBuilder().label("; ").content(this.record.PHYSI).build()); + fieldArray.push(new FieldBuilder().label("; ").content(this.record.PHYSS).build()); + fieldArray.push(new FieldBuilder().label("+").content(this.record.PHYSA).build()); + this.addLine(new FieldBuilder().label("PHYS").build(), fieldArray); + this.record.VT?.forEach(vt=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(vt.VTK).build()); + fieldArray.push(new FieldBuilder().label(": ").content(vt.VTD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(vt.VTR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(vt.VTVR).build()); + this.addLine(new FieldBuilder().label("VT").build(), fieldArray); + }); + this.record.NOTE?.forEach(note=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(note.NOTE).build()); + this.addLine(new FieldBuilder().label("NOTE").build(), fieldArray); + }); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.PRICE).build()); + this.addLine(new FieldBuilder().label("PRICE").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.FID).link('').build()); + this.addLine(new FieldBuilder().label("FID").build(), fieldArray); + this.record.BHNT?.forEach(bhnt=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(bhnt.BHK).build()); + fieldArray.push(new FieldBuilder().label(": ").content(bhnt.BHTR).build()); + fieldArray.push(new FieldBuilder().content(bhnt.BHBID).link('').build()); + this.addLine(new FieldBuilder().label("BHNT").build(), fieldArray); + }); + this.record.AL?.forEach(al=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(al.AFLG).build()); + fieldArray.push(new FieldBuilder().content(al.AHDNG).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(al.AHDNGR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(al.AHDNGVR).build()); + fieldArray.push(new FieldBuilder().content(al.AID).link('').build()); + fieldArray.push(new FieldBuilder().content(al.AF).build()); + this.addLine(new FieldBuilder().label("AL").build(), fieldArray); + }); + this.record.SH?.forEach(sh=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(sh.SHT).build()); + fieldArray.push(new FieldBuilder().label(": ").content(sh.SHD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(sh.SHR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(sh.SHVR).build()); + fieldArray.push(new FieldBuilder().label("// ").content(sh.SHK).build()); + this.addLine(new FieldBuilder().label("SH").build(), fieldArray); + }); + this.record.IDENT?.forEach(ident=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(ident.IDENT).build()); + this.addLine(new FieldBuilder().label("IDENT").build(), fieldArray); + }); + return this.fullViewLines; + } + +} + diff --git a/cloudapp/src/app/catalog/results-types/uniformTitle.ts b/cloudapp/src/app/catalog/results-types/uniformTitle.ts new file mode 100644 index 0000000..cf966dc --- /dev/null +++ b/cloudapp/src/app/catalog/results-types/uniformTitle.ts @@ -0,0 +1,131 @@ +import { TranslateService } from '@ngx-translate/core'; +import { IDisplayLinesSummary, BaseResult, IDisplayLinesFull, FullViewField, FullViewLine, FieldBuilder } from './results-common'; + + +export class UniformTitle extends BaseResult { + summaryView: UniformTitleSummary; + fullView : UniformTitleFull; + + constructor(record: any){ + super(record); + } +} + +export class UniformTitleSummary{ + TITLE: string = ""; + ID: string = ""; +} + +export class UniformTitleFull{ + ID: string = ""; + // empty header + CRTDT: string = ""; + CRTFA: string = ""; + RNWDT: string = ""; + RNWFA: string = ""; + // HDNG + HDNGD: string = ""; + HDNGR: string = ""; + HDNGVR: string = ""; + // LCUID + LCUID: string = ""; + // SF + SF: UniformTitleSF[]; + // SAF + SAF: UniformTitleSAF[]; + // NOTE + NOTE: UniformTitleNOTE[]; +} + +export class UniformTitleSF{ + SFD: string = ""; + SFR: string = ""; + SFVR: string = ""; +} + +export class UniformTitleSAF{ + SAFD: string = ""; + SAFR: string = ""; + SAFVR: string = ""; + SAFID: string = ""; +} + +export class UniformTitleNOTE{ + NOTE: string = ""; +} + +export class UniformTitleSummaryDisplay implements IDisplayLinesSummary{ + private fullRecordData: UniformTitle; + private record: UniformTitleSummary; + + constructor( + private translate: TranslateService, + fullRecordData: UniformTitle){ + this.fullRecordData = fullRecordData; + this.record = this.fullRecordData.getSummaryView(); + } + + getDisplayTitle(): string { + return this.record.TITLE; + } + + initContentDisplay(): Array { + let summaryLines = new Array(); + summaryLines.push( this.translate.instant("Catalog.Results.NACSISID") + ": " + this.record.ID); + return summaryLines; + } + + getFullRecordData() { + return this.fullRecordData; + } +} + +export class UniformTitleFullDisplay extends IDisplayLinesFull { + + constructor(fullViewRecord: UniformTitleFull) { + super(fullViewRecord); + } + + initContentDisplay(){ + this.fullViewLines = new Array(); + let fieldArray = new Array() + fieldArray.push(new FieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); + fieldArray.push(new FieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link('').build()); + fieldArray.push(new FieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); + fieldArray.push(new FieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link('').build()); + this.addLine(new FieldBuilder().build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.HDNGD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(this.record.HDNGR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + this.addLine(new FieldBuilder().label("HDNG").build(), fieldArray); + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(this.record.LCUID).build()); + this.addLine(new FieldBuilder().label("LCUID").build(), fieldArray); + this.record.SF?.forEach(sf=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(sf.SFD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(sf.SFR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(sf.SFVR).build()); + this.addLine(new FieldBuilder().label("SF").build(), fieldArray); + }); + this.record.SAF?.forEach(saf=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(saf.SAFD).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFVR).build()); + fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFID).link('').build()); + this.addLine(new FieldBuilder().label("SAF").build(), fieldArray); + }); + this.record.NOTE?.forEach(note=>{ + fieldArray = new Array(); + fieldArray.push(new FieldBuilder().content(note.NOTE).build()); + this.addLine(new FieldBuilder().label("NOTE").build(), fieldArray); + }); + + return this.fullViewLines; + } + + +} + diff --git a/cloudapp/src/app/catalog/search-form/form-utils.ts b/cloudapp/src/app/catalog/search-form/form-utils.ts index bf1b64d..85b873f 100644 --- a/cloudapp/src/app/catalog/search-form/form-utils.ts +++ b/cloudapp/src/app/catalog/search-form/form-utils.ts @@ -1,27 +1,42 @@ import { FormControl } from "@angular/forms"; -export class SearchItem { - _key: string; - _fieldLabel: string; - _formControl: FormControl; - - constructor(key:string, entity:SearchType){ - this._key = key; - this._fieldLabel = "Catalog.Form." + entity + ".Field." + key; - this._formControl = new FormControl(); +export class SearchField { + + key: FieldName; + fieldLabel: string; + formControl: FormControl; + fieldLength: FieldSize = FieldSize.regular; + + constructor(key: FieldName, fieldSize?: FieldSize){ + this.key = key; + this.formControl = new FormControl(); + this.fieldLength = fieldSize; } - + getKey(): string { - return this._key; + return this.key; + } + + getFieldLabel(searchType: SearchType): string { + this.fieldLabel = "Catalog.Form." + searchType + ".Field." + this.key; + return this.fieldLabel; + } + + getFormControl(): FormControl { + return this.formControl; } - getFieldLabel() : string { - return this._fieldLabel; + setFormControl(data: string) { + this.formControl.setValue(data); } - getFormControl() : FormControl { - return this._formControl; + getFieldLength(): string { + return this.fieldLength; + } + + setFieldLength(size: FieldSize) { + this.fieldLength = size; } } @@ -32,3 +47,37 @@ export enum SearchType { Names = "Names", UniformTitles = "UniformTitles" } + +export enum FieldSize { + regular = "form-card-child-regular", + large = "form-card-child-large" +} + +export enum FieldName { + TITLE = "TITLE", + FTITLE = "FTITLE", + PTBL = "PTBL", + VOL = "VOL", + TiPtVo = "TiPtVo", + AUTH = "AUTH", + ISSN = "ISSN", + ISBN = "ISBN", + NBN = "NBN", + NDLCN = "NDLCN", + PUB = "PUB", + YEAR = "YEAR", + PLACE = "PLACE", + CNTRY = "CNTRY", + LANG = "LANG", + SH = "SH", + AKEY = "AKEY", + ID = "ID", + PID = "PID", + CODEN = "CODEN", + NDLPN = "NDLPN", + FID = "FID", + DATE = "DATE", + SAID = "SAID", +} + + diff --git a/cloudapp/src/app/catalog/search-form/search-form.component.html b/cloudapp/src/app/catalog/search-form/search-form.component.html index d1e6915..6e1ae1f 100644 --- a/cloudapp/src/app/catalog/search-form/search-form.component.html +++ b/cloudapp/src/app/catalog/search-form/search-form.component.html @@ -1,56 +1,162 @@ -
+
-
- - -
- +

{{'Catalog.Form.MainTitle' | translate}}

- - {{'Catalog.Form.SelectSearchType' | translate}} - - - {{searchType.value | translate}} - - - + + + + + + {{ 'Catalog.Form.RefineSearch' | translate }} + + + + + + + + + + -

-
- +
+ + +
+ + + + {{'Catalog.Form.SelectDatabase' | translate}} - + {{ database }} - - -
- - {{item.getFieldLabel() | translate}} - +
+ + + + {{ item.getFieldLabel(currentSearchType) | translate }} + + +
+
+ + +
+ +
-

{{url}}

-
+ + + + +
+
+

{{'Catalog.Results.Title' | translate}} ({{numOfResults}})

+
+ + + + +
+ +
+ {{i + 1}} +
+ + {{record.getDisplayTitle()}} + +
+ + {{line}} + +
+
+ + + +
+ +
+
+
+
+
+
+
+
+ + +
+ +

{{'Catalog.Results.NoRecordsExist' | translate}}

+
+
+ + +
+
+ + + + + + +


+ +
+
+
+ {{line.getHeaderLabel()}} +
+
+
+
+ {{field.getLabel()}} +
+ + {{field.getContent()}} + + + {{field.getContent()}} + +
+
+
+
+ +



\ No newline at end of file diff --git a/cloudapp/src/app/catalog/search-form/search-form.component.scss b/cloudapp/src/app/catalog/search-form/search-form.component.scss index 887d04e..4a4075e 100644 --- a/cloudapp/src/app/catalog/search-form/search-form.component.scss +++ b/cloudapp/src/app/catalog/search-form/search-form.component.scss @@ -2,21 +2,21 @@ p { margin-bottom: 15px; } -.align-space-between { - justify-content: space-between; - margin-bottom: 20px; +.align-to-left { + justify-content: flex-start; + margin-bottom: 15px; } -.form-buttons { - display: inline-flex; - column-gap: 20px; +.align-to-right { + justify-content: flex-end; + margin-bottom: 20px; } .mat-form-field { display: contents; } -.serach-form-card { +.form-card-parent { display: grid; grid-template-columns: repeat(auto-fit, minmax(200px, 1fr)); column-gap: 20px; @@ -24,6 +24,68 @@ p { background-color: whitesmoke !important; } -.form-card-inputs{ +.form-card-child-large{ + display: block; + grid-column-start: 1; + grid-column-end: -1; +} + +.form-card-child-regular{ display: block; } + +.result-list-item{ + padding-bottom: 15px !important; +} + +.result-card{ + display: flex; + justify-content: space-between; + width: 100%; + background-color: whitesmoke !important; +} + +.result-card-index { + margin-right: 20px; +} + + .result-card-content { + margin: 0px; +} + +.noResults{ + text-align: center; + height: fit-content; + margin-top: 40px; +} + +.full-view-line { + display: grid; + grid-template-columns: 100px auto; + padding-top: 0.5em; + padding-bottom: 0.5em; +} + +.even { + background-color: whitesmoke; +} + +.full-view-line-header { + font-weight: bold; + padding-right: 15px; +} + +.full-view-line-content { + display: flex; + flex-wrap: wrap; +} + +.full-view-line-field-label { + font-weight: bold; + padding-right: 5px; +} + +.full-view-line-field { + display: flex; + padding-right: 10px; +} diff --git a/cloudapp/src/app/catalog/search-form/search-form.component.ts b/cloudapp/src/app/catalog/search-form/search-form.component.ts index cf50791..740d8ea 100644 --- a/cloudapp/src/app/catalog/search-form/search-form.component.ts +++ b/cloudapp/src/app/catalog/search-form/search-form.component.ts @@ -1,7 +1,19 @@ -import { Component, OnInit } from '@angular/core'; -import { SearchItem, SearchType } from './form-utils'; -import { MatSelectChange } from "@angular/material/select"; +import { Component, AfterViewInit , ViewChild, TemplateRef } from '@angular/core'; +import { SearchField, SearchType, FieldSize, FieldName } from './form-utils'; +import { MatTabChangeEvent } from '@angular/material/tabs'; +// import { MatMenuContent } from '@angular/material/menu'; import { CatalogService } from '../../service/catalog.service'; +import { AlertService } from '@exlibris/exl-cloudapp-angular-lib'; +import { TranslateService } from '@ngx-translate/core'; +import { Router } from '@angular/router'; + +import { IDisplayLinesSummary, NacsisCatalogResults, BaseResult, IDisplayLinesFull } from '../results-types/results-common' +import { MonographSummaryDisplay, MonographFullDisplay } from '../results-types/monographs' +import { SerialSummaryDisplay, SerialFullDisplay } from '../results-types/serials'; +import { NameSummaryDisplay, NameFullDisplay } from '../results-types/name'; +import { UniformTitleFullDisplay, UniformTitleSummaryDisplay } from '../results-types/uniformTitle'; +import { HoldingsService } from '../../service/holdings.service'; +import { AppRoutingState, ROUTING_STATE_KEY } from '../../service/base.service'; @@ -11,71 +23,291 @@ import { CatalogService } from '../../service/catalog.service'; styleUrls: ['./search-form.component.scss'] }) -export class CatalogSearchFormComponent{ - private catalogService: CatalogService; +export class CatalogSearchFormComponent implements AfterViewInit { - private ALL_DATABASES_MAP = new Map([ + public SEARCH_TYPE_ARRAY = new Array (SearchType.Monographs, SearchType.Serials, SearchType.Names, SearchType.UniformTitles); + public ALL_DATABASES_MAP = new Map([ [SearchType.Monographs, ['All','BOOK','PREBOOK','JPMARC','TRCMARC','USMARC','USMARCX','GPOMARC','UKMARC','REMARC','DNMARC','CHMARC','KORMARC','RECON','HBZBKS','SPABKS','ITABKS','KERISB','KERISX','BNFBKS']], [SearchType.Serials, ['All','SERIAL','JPMARCS','USMARCS','SPASER','ITASER','KERISS','BNFSER']], [SearchType.Names, ['All', 'NAME', 'JPMARCA', 'USMARCA']], [SearchType.UniformTitles, ['All', 'TITLE', 'USMARCT']] ]); - private ALL_FIELDS_MAP = new Map([ - [SearchType.Monographs, ['TITLE','FTITLE','PTBL','VOL','TiPtVo','AUTH','ISSN','ISBN','NBN','NDLCN','PUB','YEAR','PLACE','CNTRY','LANG','SH','AKEY','ID','PID']], - [SearchType.Serials, ['TITLE','FTITLE','AUTH','ISSN','CODEN','NDLPN','PUB','YEAR','PLACE','CNTRY','LANG','SH','AKEY','ID','FID']], - [SearchType.Names, ['AUTH', 'AKEY', 'PLACE', 'DATE', 'ID', 'SAID']], - [SearchType.UniformTitles, ['TITLE', 'AUTH', 'AKEY', 'ID', 'SAID']] + public allFieldsMap = new Map([ + [SearchType.Monographs, [new SearchField(FieldName.TITLE, FieldSize.large), new SearchField(FieldName.FTITLE), new SearchField(FieldName.PTBL), new SearchField(FieldName.VOL), new SearchField(FieldName.TiPtVo), new SearchField(FieldName.AUTH), new SearchField(FieldName.ISSN), new SearchField(FieldName.ISBN), new SearchField(FieldName.NBN), new SearchField(FieldName.NDLCN), new SearchField(FieldName.PUB), new SearchField(FieldName.YEAR), new SearchField(FieldName.PLACE), new SearchField(FieldName.CNTRY), new SearchField(FieldName.LANG), new SearchField(FieldName.SH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.PID)]], + [SearchType.Serials, [new SearchField(FieldName.TITLE), new SearchField(FieldName.FTITLE), new SearchField(FieldName.AUTH), new SearchField(FieldName.ISSN), new SearchField(FieldName.CODEN), new SearchField(FieldName.NDLPN), new SearchField(FieldName.PUB), new SearchField(FieldName.YEAR), new SearchField(FieldName.PLACE), new SearchField(FieldName.CNTRY), new SearchField(FieldName.LANG), new SearchField(FieldName.SH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.FID)]], + [SearchType.Names, [new SearchField(FieldName.AUTH), new SearchField(FieldName.AKEY), new SearchField(FieldName.PLACE), new SearchField(FieldName.DATE), new SearchField(FieldName.ID), new SearchField(FieldName.SAID)]], + [SearchType.UniformTitles, [new SearchField(FieldName.TITLE), new SearchField(FieldName.AUTH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.SAID)]] ]); + private resultActionList: Array = ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import', 'Catalog.Results.Actions.ViewHoldings'] + - private currentSearchType: SearchType; + // Selection variables + public currentSearchType: SearchType = SearchType.Monographs; private currentDatabase: string = 'All'; // default selection (includes all other DBs) - private isSearchTypeChoosed: boolean = false; - private searchItemArray: Array; - private url: string = ""; // TODO: getting the base url from the catalog service + // UI variables + private panelState: boolean = true; + private loading: boolean = false; + + // Data variables + private urlParams: string = ""; + private catalogResultsData: NacsisCatalogResults; + private numOfResults: number; + private resultsSummaryDisplay: Array; + private resultFullDisplay; + + // Templates + @ViewChild('notSearched') notSearchedTmpl:TemplateRef; + @ViewChild('searchResults') searchResultsTmpl:TemplateRef; + @ViewChild('noResults') noResultsTmpl:TemplateRef; + @ViewChild('fullRecord') fullRecordTmpl:TemplateRef; + private currentResulsTmpl: TemplateRef; - constructor(){} - getSearchTypeList(): Map{ - let searchTypeMap = new Map(); // - Object.values(SearchType).forEach(type=> { - searchTypeMap.set(type, "Catalog.Form." + type + ".MainTitle") + constructor( + private catalogService: CatalogService, + private holdingsService: HoldingsService, + private router: Router, + private alert: AlertService, + private translate: TranslateService, + ) { } + + + ngAfterViewInit(){ + if(sessionStorage.getItem(ROUTING_STATE_KEY) == "") { + this.catalogService.clearAllSearchResults(); + } else { + this.searchFormRefill(); + } + } + + + // Search Form Section + + getSearchTypesLabels(): Array{ + let searchTypeMap = new Array(); + this.SEARCH_TYPE_ARRAY.forEach(type=> { + searchTypeMap.push("Catalog.Form." + type + ".MainTitle") }); return searchTypeMap; } + + getCurrentDatabases(): Array { + return this.ALL_DATABASES_MAP.get(this.currentSearchType); + } - searchTypeSelection(event: MatSelectChange){ - this.currentSearchType = SearchType[event.value]; - this.isSearchTypeChoosed = true; + getSearchFields(): Array { + return this.allFieldsMap.get(this.currentSearchType); + } - let fieldsArray = this.ALL_FIELDS_MAP.get(this.currentSearchType); - this.searchItemArray = new Array(); - fieldsArray.forEach(field => { - this.searchItemArray.push(new SearchItem(field, this.currentSearchType)); - }); + onTabChange(event: MatTabChangeEvent){ + this.currentSearchType = this.SEARCH_TYPE_ARRAY[event.index]; + if(this.catalogService.getSearchResults(this.currentSearchType).getResults() != null){ + this.setSearchResultsDisplay(); + } else { + this.currentResulsTmpl = this.notSearchedTmpl; + this.panelState = true; + } } - getDatabases(): Array { - return this.ALL_DATABASES_MAP.get(this.currentSearchType); + clear() { + this.allFieldsMap.get(this.currentSearchType).forEach(searchField => { + searchField.getFormControl().setValue(null) + }); + } + + panelOpenState() { + this.panelState = true; } - save() { - this.url = ""; - this.url = this.url + "searchType=" + this.currentSearchType; - this.url = this.url + "&database=" + this.currentDatabase; - this.searchItemArray.forEach(item =>{ + panelCloseState() { + this.panelState = false; + } + + generateUrl() { + this.urlParams = ""; + this.urlParams = this.urlParams + "searchType=" + this.currentSearchType; + this.urlParams = this.urlParams + "&database=" + this.getDatabaseParam(); + this.allFieldsMap.get(this.currentSearchType).forEach(item =>{ if(item.getFormControl().value !== null){ - this.url = this.url + "&" + item.getKey(); - this.url = this.url + "=" + item.getFormControl().value; + this.urlParams = this.urlParams + "&" + item.getKey(); + this.urlParams = this.urlParams + "=" + item.getFormControl().value; } }); } + + getDatabaseParam() { + if(this.currentDatabase === 'All') { + let allDatabases = this.ALL_DATABASES_MAP.get(this.currentSearchType)[1]; + this.ALL_DATABASES_MAP.get(this.currentSearchType).slice(2).forEach(database=>{ // slice(2) -> skiping the two first positions + allDatabases = allDatabases + "," + database; + }); + return allDatabases; + } else { + return this.currentDatabase; + } + } - clear() { - this.searchItemArray.forEach(searchItem => { - searchItem.getFormControl().setValue(null) - }); + search() { + this.generateUrl(); + this.loading = true; + + try{ + this.catalogService.getSearchResultsFromNacsis(this.urlParams, this.currentSearchType) + .subscribe({ + next: (catalogResults) => { + if (catalogResults.status === this.catalogService.OkStatus) { + if(this.currentSearchType == catalogResults.searchType){ + this.setSearchResultsDisplay(); + } + } else { + this.alert.error(catalogResults.errorMessage, {keepAfterRouteChange:true}); + } }, + error: e => { + this.loading = false; + console.log(e.message); + this.alert.error(e.message, {keepAfterRouteChange:true}); + }, + complete: () => this.loading = false + }); + } catch (e) { + this.loading = false; + console.log(e); + this.alert.error(this.translate.instant('Errors.generalError'), {keepAfterRouteChange:true}); + } + } + + + // Summary View Section + + private setSearchResultsDisplay(){ + this.catalogResultsData = this.catalogService.getSearchResults(this.currentSearchType); + this.numOfResults = this.catalogResultsData.getHeader().totalRecords; + this.resultsSummaryDisplay = new Array(); + this.catalogResultsData.getResults().forEach(result=>{ + this.resultsSummaryDisplay.push(this.summaryDisplayFactory(this.translate, result)); + }); + this.resultsTemplateFactory(); + this.panelState = false; + } + + summaryDisplayFactory(translate: TranslateService, record: BaseResult){ + switch (this.currentSearchType) { + case SearchType.Monographs: + return new MonographSummaryDisplay(translate, record); + case SearchType.Serials: + return new SerialSummaryDisplay(translate, record); + case SearchType.Names: + return new NameSummaryDisplay(translate, record); + case SearchType.UniformTitles: + return new UniformTitleSummaryDisplay(translate, record); + default: + return null; + } + } + + resultsTemplateFactory() { + if(this.numOfResults > 0){ + this.currentResulsTmpl = this.searchResultsTmpl; + } else if(this.numOfResults == 0) { + this.currentResulsTmpl = this.noResultsTmpl; + } else { + this.currentResulsTmpl = this.notSearchedTmpl; + } + } + + onActionsClick(choice: number, result: IDisplayLinesSummary) { + switch (choice) { + case 0: // Full view + this.currentResulsTmpl = this.fullRecordTmpl; + this.resultFullDisplay = this.fullDisplayFactory(result.getFullRecordData()).initContentDisplay(); + break; + case 2: // View Holdings + this.onViewHoldings(result.getFullRecordData().getID(), result.getDisplayTitle()); + break; + + default: { + this.currentResulsTmpl = this.noResultsTmpl; + } + } + + } + + + // Full View Section + + fullDisplayFactory(record: BaseResult){ + switch (this.currentSearchType) { + case SearchType.Monographs: + return new MonographFullDisplay(record.getFullView()); + case SearchType.Serials: + return new SerialFullDisplay(record.getFullView()); + case SearchType.Names: + return new NameFullDisplay(record.getFullView()); + case SearchType.UniformTitles: + return new UniformTitleFullDisplay(record.getFullView()); + default: + return null; + } + } + + onBackFromFullView() { + this.currentResulsTmpl = this.searchResultsTmpl; + } + + isEvenRow(i: number) { + if(i % 2 == 0){ + return "even"; + } + } + + + // View Holdings + + onViewHoldings(nacsisId: string, title: string) { + this.loading = true; + + try { + this.holdingsService.getHoldingsFromNacsis(nacsisId, "Mine") + .subscribe({ + next: (header) => { + if (header.status === this.holdingsService.OkStatus) { + sessionStorage.setItem(ROUTING_STATE_KEY, AppRoutingState.CatalogSearchPage); + this.router.navigate(['/holdings', nacsisId, title]); + } else { + this.alert.error(header.errorMessage, {keepAfterRouteChange:true}); + } + }, + error: e => { + this.loading = false; + console.log(e.message); + this.alert.error(e.message, {keepAfterRouteChange:true}); + }, + complete: () => this.loading = false + }); + } catch (e) { + this.loading = false; + console.log(e); + this.alert.error(this.translate.instant('Errors.generalError'), {keepAfterRouteChange:true}); + } + } + + searchFormRefill() { + let paramsMap = new Map(); + this.catalogService.getQueryParams().split("&").forEach(param => { + let paramAsKeyValue = param.split("="); + paramsMap.set(paramAsKeyValue[0],paramAsKeyValue[1]); + }); + this.currentSearchType = SearchType[paramsMap.get('searchType')]; + this.currentDatabase = paramsMap.get('database'); + this.allFieldsMap.get(this.currentSearchType).forEach(field => { + if(paramsMap.has(field.getKey())){ + field.setFormControl(paramsMap.get(field.getKey())); + } + }); + this.setSearchResultsDisplay(); } } + diff --git a/cloudapp/src/app/holdings/main/main.component.ts b/cloudapp/src/app/holdings/main/main.component.ts index 9ba9dc5..fe16d3e 100644 --- a/cloudapp/src/app/holdings/main/main.component.ts +++ b/cloudapp/src/app/holdings/main/main.component.ts @@ -8,6 +8,7 @@ import { AlertService } from '@exlibris/exl-cloudapp-angular-lib'; import { map, catchError, switchMap, tap } from 'rxjs/operators'; import { AlmaApiService, IntegrationProfile } from '../../service/alma.api.service'; +import { AppRoutingState, ROUTING_STATE_KEY } from '../../service/base.service'; @@ -44,7 +45,7 @@ export class MainComponent implements OnInit, OnDestroy { ngOnInit() { - this.nacsis.clearSessionStorage(); + sessionStorage.clear(); this.pageLoad$ = this.eventsService.onPageLoad(pageInfo => { @@ -108,6 +109,7 @@ export class MainComponent implements OnInit, OnDestroy { .subscribe({ next: (header) => { if (header.status === this.nacsis.OkStatus) { + sessionStorage.setItem(ROUTING_STATE_KEY, AppRoutingState.HoldingsMainPage); this.router.navigate(['/holdings', this.selected, bib[0].description]); } else { this.alert.error(header.errorMessage, {keepAfterRouteChange:true}); diff --git a/cloudapp/src/app/holdings/holdings/holdings.component.html b/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.html similarity index 98% rename from cloudapp/src/app/holdings/holdings/holdings.component.html rename to cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.html index 9a74707..f9085b6 100644 --- a/cloudapp/src/app/holdings/holdings/holdings.component.html +++ b/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.html @@ -1,7 +1,7 @@
- + +
+ + +
+
+
+ +

{{'Catalog.Form.MainTitle' | translate}}

+ + + + + + + {{ 'Catalog.Form.RefineSearch' | translate }} + + + +
+
+
+
+
+

+ + + +
+ + +
+ +


+ + + + + + + + + +
+ +

{{'Catalog.Results.NoRecordsExist' | translate}}

+
+
+ + + +
+
+ + + + +


+
+
+ + +
+
+ + + +
+
+ +
\ No newline at end of file diff --git a/cloudapp/src/app/catalog/main/main.component.scss b/cloudapp/src/app/catalog/main/main.component.scss new file mode 100644 index 0000000..ebf7b17 --- /dev/null +++ b/cloudapp/src/app/catalog/main/main.component.scss @@ -0,0 +1,58 @@ +p { + margin-bottom: 15px; + } + +.align-to-left { + justify-content: flex-start; + margin-bottom: 15px; +} + +.align-to-right { + justify-content: flex-end; +} + +.align-space-between { + justify-content: space-between; + margin-bottom: 20px; +} + +.noResults{ + text-align: center; + height: fit-content; + margin-top: 40px; +} + + +.full-view { + display: flex; + flex-direction: row; + +} + +.full-view-left-table { + flex: 1; + margin-right: 8px; +} + +.full-view-right-table { + position: relative; + flex: 1; +} + +a, +a label { + cursor: pointer; +} + + +.close-button { + background: transparent; + border: none; + position: absolute; + right: 2px; + top: 2px; + i { + font-size: 12px; + } +} + diff --git a/cloudapp/src/app/catalog/search-form/search-form.component.ts b/cloudapp/src/app/catalog/main/main.component.ts similarity index 69% rename from cloudapp/src/app/catalog/search-form/search-form.component.ts rename to cloudapp/src/app/catalog/main/main.component.ts index 740d8ea..f96a6e4 100644 --- a/cloudapp/src/app/catalog/search-form/search-form.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -1,11 +1,11 @@ import { Component, AfterViewInit , ViewChild, TemplateRef } from '@angular/core'; -import { SearchField, SearchType, FieldSize, FieldName } from './form-utils'; +import { SearchField, SearchType, FieldSize, FieldName, QueryParams } from './form-utils'; import { MatTabChangeEvent } from '@angular/material/tabs'; -// import { MatMenuContent } from '@angular/material/menu'; import { CatalogService } from '../../service/catalog.service'; import { AlertService } from '@exlibris/exl-cloudapp-angular-lib'; import { TranslateService } from '@ngx-translate/core'; import { Router } from '@angular/router'; +import { PageEvent } from '@angular/material/paginator'; import { IDisplayLinesSummary, NacsisCatalogResults, BaseResult, IDisplayLinesFull } from '../results-types/results-common' import { MonographSummaryDisplay, MonographFullDisplay } from '../results-types/monographs' @@ -18,19 +18,19 @@ import { AppRoutingState, ROUTING_STATE_KEY } from '../../service/base.service'; @Component({ - selector: 'catalog-search-form', - templateUrl: './search-form.component.html', - styleUrls: ['./search-form.component.scss'] + selector: 'catalog-main', + templateUrl: './main.component.html', + styleUrls: ['./main.component.scss'] }) -export class CatalogSearchFormComponent implements AfterViewInit { +export class CatalogMainComponent implements AfterViewInit { public SEARCH_TYPE_ARRAY = new Array (SearchType.Monographs, SearchType.Serials, SearchType.Names, SearchType.UniformTitles); public ALL_DATABASES_MAP = new Map([ - [SearchType.Monographs, ['All','BOOK','PREBOOK','JPMARC','TRCMARC','USMARC','USMARCX','GPOMARC','UKMARC','REMARC','DNMARC','CHMARC','KORMARC','RECON','HBZBKS','SPABKS','ITABKS','KERISB','KERISX','BNFBKS']], - [SearchType.Serials, ['All','SERIAL','JPMARCS','USMARCS','SPASER','ITASER','KERISS','BNFSER']], - [SearchType.Names, ['All', 'NAME', 'JPMARCA', 'USMARCA']], - [SearchType.UniformTitles, ['All', 'TITLE', 'USMARCT']] + [SearchType.Monographs, ['BOOK','PREBOOK','JPMARC','TRCMARC','USMARC','USMARCX','GPOMARC','UKMARC','REMARC','DNMARC','CHMARC','KORMARC','RECON','HBZBKS','SPABKS','ITABKS','KERISB','KERISX','BNFBKS']], + [SearchType.Serials, ['SERIAL','JPMARCS','USMARCS','SPASER','ITASER','KERISS','BNFSER']], + [SearchType.Names, ['NAME', 'JPMARCA', 'USMARCA']], + [SearchType.UniformTitles, ['TITLE', 'USMARCT']] ]); public allFieldsMap = new Map([ [SearchType.Monographs, [new SearchField(FieldName.TITLE, FieldSize.large), new SearchField(FieldName.FTITLE), new SearchField(FieldName.PTBL), new SearchField(FieldName.VOL), new SearchField(FieldName.TiPtVo), new SearchField(FieldName.AUTH), new SearchField(FieldName.ISSN), new SearchField(FieldName.ISBN), new SearchField(FieldName.NBN), new SearchField(FieldName.NDLCN), new SearchField(FieldName.PUB), new SearchField(FieldName.YEAR), new SearchField(FieldName.PLACE), new SearchField(FieldName.CNTRY), new SearchField(FieldName.LANG), new SearchField(FieldName.SH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.PID)]], @@ -43,7 +43,7 @@ export class CatalogSearchFormComponent implements AfterViewInit { // Selection variables public currentSearchType: SearchType = SearchType.Monographs; - private currentDatabase: string = 'All'; // default selection (includes all other DBs) + private currentDatabase: string;// = 'BOOK'; // first default selection (since opened with Monographs) // UI variables private panelState: boolean = true; @@ -55,6 +55,10 @@ export class CatalogSearchFormComponent implements AfterViewInit { private numOfResults: number; private resultsSummaryDisplay: Array; private resultFullDisplay; + private fromIndex: number = 1; + private toIndex: number = 20; + + // Templates @ViewChild('notSearched') notSearchedTmpl:TemplateRef; @@ -63,6 +67,9 @@ export class CatalogSearchFormComponent implements AfterViewInit { @ViewChild('fullRecord') fullRecordTmpl:TemplateRef; private currentResulsTmpl: TemplateRef; + isRightTableOpen: boolean = false; + isColapsedMode: boolean = true; + constructor( private catalogService: CatalogService, @@ -87,7 +94,7 @@ export class CatalogSearchFormComponent implements AfterViewInit { getSearchTypesLabels(): Array{ let searchTypeMap = new Array(); this.SEARCH_TYPE_ARRAY.forEach(type=> { - searchTypeMap.push("Catalog.Form." + type + ".MainTitle") + searchTypeMap.push("Catalog.Form.SearchTypes." + type) }); return searchTypeMap; } @@ -96,12 +103,17 @@ export class CatalogSearchFormComponent implements AfterViewInit { return this.ALL_DATABASES_MAP.get(this.currentSearchType); } + setCurrentDatabase(db: string) { + this.currentDatabase = db; + } + getSearchFields(): Array { return this.allFieldsMap.get(this.currentSearchType); } onTabChange(event: MatTabChangeEvent){ this.currentSearchType = this.SEARCH_TYPE_ARRAY[event.index]; + this.currentDatabase = this.getCurrentDatabases()[0]; if(this.catalogService.getSearchResults(this.currentSearchType).getResults() != null){ this.setSearchResultsDisplay(); } else { @@ -126,40 +138,36 @@ export class CatalogSearchFormComponent implements AfterViewInit { generateUrl() { this.urlParams = ""; - this.urlParams = this.urlParams + "searchType=" + this.currentSearchType; - this.urlParams = this.urlParams + "&database=" + this.getDatabaseParam(); - this.allFieldsMap.get(this.currentSearchType).forEach(item =>{ - if(item.getFormControl().value !== null){ - this.urlParams = this.urlParams + "&" + item.getKey(); - this.urlParams = this.urlParams + "=" + item.getFormControl().value; - } - }); - } - - getDatabaseParam() { - if(this.currentDatabase === 'All') { - let allDatabases = this.ALL_DATABASES_MAP.get(this.currentSearchType)[1]; - this.ALL_DATABASES_MAP.get(this.currentSearchType).slice(2).forEach(database=>{ // slice(2) -> skiping the two first positions - allDatabases = allDatabases + "," + database; + this.urlParams = this.urlParams + this.getPaginationIndex(); + this.urlParams = this.urlParams + "&" + QueryParams.searchType + "=" + this.currentSearchType; + this.urlParams = this.urlParams + "&" + QueryParams.databases + "=" + this.currentDatabase; + let valuableFields = this.allFieldsMap.get(this.currentSearchType).filter(field => field.getFormControl().value !== null); + if (valuableFields.length > 0){ + valuableFields.forEach(field => { + this.urlParams = this.urlParams + "&" + field.getKey(); + this.urlParams = this.urlParams + "=" + field.getFormControl().value; }); - return allDatabases; } else { - return this.currentDatabase; + this.urlParams = ""; } - } + } + + search() { this.generateUrl(); - this.loading = true; + if(this.urlParams == ""){ + this.alert.error(this.translate.instant('Catalog.Form.EmptyForm'), {keepAfterRouteChange:true}); + return; + } + this.loading = true; try{ this.catalogService.getSearchResultsFromNacsis(this.urlParams, this.currentSearchType) .subscribe({ next: (catalogResults) => { if (catalogResults.status === this.catalogService.OkStatus) { - if(this.currentSearchType == catalogResults.searchType){ - this.setSearchResultsDisplay(); - } + this.setSearchResultsDisplay(); } else { this.alert.error(catalogResults.errorMessage, {keepAfterRouteChange:true}); } }, @@ -173,7 +181,7 @@ export class CatalogSearchFormComponent implements AfterViewInit { } catch (e) { this.loading = false; console.log(e); - this.alert.error(this.translate.instant('Errors.generalError'), {keepAfterRouteChange:true}); + this.alert.error(this.translate.instant('General.Errors.generalError'), {keepAfterRouteChange:true}); } } @@ -184,7 +192,7 @@ export class CatalogSearchFormComponent implements AfterViewInit { this.catalogResultsData = this.catalogService.getSearchResults(this.currentSearchType); this.numOfResults = this.catalogResultsData.getHeader().totalRecords; this.resultsSummaryDisplay = new Array(); - this.catalogResultsData.getResults().forEach(result=>{ + this.catalogResultsData.getResults()?.forEach(result=>{ this.resultsSummaryDisplay.push(this.summaryDisplayFactory(this.translate, result)); }); this.resultsTemplateFactory(); @@ -209,29 +217,37 @@ export class CatalogSearchFormComponent implements AfterViewInit { resultsTemplateFactory() { if(this.numOfResults > 0){ this.currentResulsTmpl = this.searchResultsTmpl; - } else if(this.numOfResults == 0) { + } else if(this.numOfResults == 0 || this.numOfResults == null) { this.currentResulsTmpl = this.noResultsTmpl; } else { this.currentResulsTmpl = this.notSearchedTmpl; } } - onActionsClick(choice: number, result: IDisplayLinesSummary) { - switch (choice) { + onActionsClick(selection) { + switch (selection[0]) { case 0: // Full view this.currentResulsTmpl = this.fullRecordTmpl; - this.resultFullDisplay = this.fullDisplayFactory(result.getFullRecordData()).initContentDisplay(); + this.resultFullDisplay = this.fullDisplayFactory(selection[1].getFullRecordData()).initContentDisplay(); + break; + case 1: // Import the record + this.onImportRecord(selection[1].getFullRecordData().getRawData()); break; case 2: // View Holdings - this.onViewHoldings(result.getFullRecordData().getID(), result.getDisplayTitle()); + this.onViewHoldings(selection[1].getFullRecordData().getID(), selection[1].getDisplayTitle()); break; - default: { this.currentResulsTmpl = this.noResultsTmpl; } } } + + onTitleClick(result: IDisplayLinesSummary) { + // Opening the full view + this.currentResulsTmpl = this.fullRecordTmpl; + this.resultFullDisplay = this.fullDisplayFactory(result.getFullRecordData()).initContentDisplay(); + } // Full View Section @@ -253,20 +269,28 @@ export class CatalogSearchFormComponent implements AfterViewInit { onBackFromFullView() { this.currentResulsTmpl = this.searchResultsTmpl; + this.isRightTableOpen = false; } - isEvenRow(i: number) { - if(i % 2 == 0){ - return "even"; - } + onFullViewLink(searchType?: string) { + this.isRightTableOpen = true; + this.isColapsedMode = (window.innerWidth <= 600) ? true : false; + } + + onFullViewLinkClose() { + this.isRightTableOpen = false; } + onResize(event) { + this.isColapsedMode = (event.target.innerWidth <= 600) ? true : false; + } + // View Holdings onViewHoldings(nacsisId: string, title: string) { this.loading = true; - + title = "Harry Potter" try { this.holdingsService.getHoldingsFromNacsis(nacsisId, "Mine") .subscribe({ @@ -288,10 +312,48 @@ export class CatalogSearchFormComponent implements AfterViewInit { } catch (e) { this.loading = false; console.log(e); - this.alert.error(this.translate.instant('Errors.generalError'), {keepAfterRouteChange:true}); + this.alert.error(this.translate.instant('General.Errors.generalError'), {keepAfterRouteChange:true}); } } + // Import + + onImportRecord(rawData: string) { + this.loading = true; + try { + this.catalogService.importRecordToAlma(this.currentSearchType, rawData) + .subscribe({ + next: (warnings) => { + let x = 7; + }, + error: e => { + this.loading = false; + console.log(e.message); + this.alert.error(e.message, {keepAfterRouteChange:true}); + }, + complete: () => this.loading = false + }); + } catch (e) { + this.loading = false; + console.log(e); + this.alert.error(this.translate.instant('General.Errors.generalError'), {keepAfterRouteChange:true}); + } + } + + + // Pagination + + getPaginationIndex() { + return QueryParams.fromIndex + "=" + this.fromIndex + "&" + QueryParams.toIndex + "=" + this.toIndex; + } + + onPageAction(pageEvent: PageEvent) { + this.fromIndex = (pageEvent.pageIndex*20) + 1; + this.toIndex = (pageEvent.pageIndex+1) * 20; + this.search(); + } + + searchFormRefill() { let paramsMap = new Map(); this.catalogService.getQueryParams().split("&").forEach(param => { @@ -308,6 +370,6 @@ export class CatalogSearchFormComponent implements AfterViewInit { this.setSearchResultsDisplay(); } -} - + +} diff --git a/cloudapp/src/app/catalog/results-types/results-common.ts b/cloudapp/src/app/catalog/results-types/results-common.ts index 15a93b6..21c73cc 100644 --- a/cloudapp/src/app/catalog/results-types/results-common.ts +++ b/cloudapp/src/app/catalog/results-types/results-common.ts @@ -1,4 +1,4 @@ -import { SearchType } from "../search-form/form-utils"; +import { SearchType } from "../main/form-utils"; import { Header } from "../../service/base.service"; export interface IDisplayLinesSummary { @@ -61,7 +61,6 @@ export class NacsisCatalogResults { export class ResultsHeader extends Header { totalRecords: number; - numberOfRecords: number; searchType: SearchType; } diff --git a/cloudapp/src/app/catalog/search-form/search-form.component.html b/cloudapp/src/app/catalog/search-form/search-form.component.html deleted file mode 100644 index 6e1ae1f..0000000 --- a/cloudapp/src/app/catalog/search-form/search-form.component.html +++ /dev/null @@ -1,162 +0,0 @@ - -
-

{{'Catalog.Form.MainTitle' | translate}}

- - - - - - - {{ 'Catalog.Form.RefineSearch' | translate }} - - - - - - - - - - - - - -
- - -
- - - - - - {{'Catalog.Form.SelectDatabase' | translate}} - - - {{ database }} - - - -
- -
- - {{ item.getFieldLabel(currentSearchType) | translate }} - - - -
-
-
-
- - -
- -
- - - - - -
-
-

{{'Catalog.Results.Title' | translate}} ({{numOfResults}})

-
- - - - -
- -
- {{i + 1}} -
- - {{record.getDisplayTitle()}} - -
- - {{line}} - -
-
- - - -
- -
-
-
-
-
-
-
-
- - -
- -

{{'Catalog.Results.NoRecordsExist' | translate}}

-
-
- - -
-
- - - - - - -


- -
-
-
- {{line.getHeaderLabel()}} -
-
-
-
- {{field.getLabel()}} -
- - {{field.getContent()}} - - - {{field.getContent()}} - -
-
-
-
- -
- -


\ No newline at end of file diff --git a/cloudapp/src/app/catalog/search-form/search-form.component.scss b/cloudapp/src/app/catalog/search-form/search-form.component.scss deleted file mode 100644 index 4a4075e..0000000 --- a/cloudapp/src/app/catalog/search-form/search-form.component.scss +++ /dev/null @@ -1,91 +0,0 @@ -p { - margin-bottom: 15px; - } - -.align-to-left { - justify-content: flex-start; - margin-bottom: 15px; -} - -.align-to-right { - justify-content: flex-end; - margin-bottom: 20px; -} - -.mat-form-field { - display: contents; -} - -.form-card-parent { - display: grid; - grid-template-columns: repeat(auto-fit, minmax(200px, 1fr)); - column-gap: 20px; - row-gap: 1em; - background-color: whitesmoke !important; -} - -.form-card-child-large{ - display: block; - grid-column-start: 1; - grid-column-end: -1; -} - -.form-card-child-regular{ - display: block; -} - -.result-list-item{ - padding-bottom: 15px !important; -} - -.result-card{ - display: flex; - justify-content: space-between; - width: 100%; - background-color: whitesmoke !important; -} - -.result-card-index { - margin-right: 20px; -} - - .result-card-content { - margin: 0px; -} - -.noResults{ - text-align: center; - height: fit-content; - margin-top: 40px; -} - -.full-view-line { - display: grid; - grid-template-columns: 100px auto; - padding-top: 0.5em; - padding-bottom: 0.5em; -} - -.even { - background-color: whitesmoke; -} - -.full-view-line-header { - font-weight: bold; - padding-right: 15px; -} - -.full-view-line-content { - display: flex; - flex-wrap: wrap; -} - -.full-view-line-field-label { - font-weight: bold; - padding-right: 5px; -} - -.full-view-line-field { - display: flex; - padding-right: 10px; -} diff --git a/cloudapp/src/app/holdings/form/form.component.html b/cloudapp/src/app/holdings/form/form.component.html index c093e29..f5ca061 100644 --- a/cloudapp/src/app/holdings/form/form.component.html +++ b/cloudapp/src/app/holdings/form/form.component.html @@ -3,20 +3,20 @@
@@ -24,7 +24,7 @@ (onCloseEvent)="onCloseClick()"> -->
-

{{ (isReadOnly ? 'Form.ViewTitle' : holdingId ? 'Form.EditTitle' : 'Form.AddTitle') | translate}}

+

{{ (isReadOnly ? 'Holdings.Form.ViewTitle' : holdingId ? 'Holdings.Form.EditTitle' : 'Holdings.Form.AddTitle') | translate}}

@@ -32,16 +32,16 @@

{{ (isReadOnly ? 'Form.ViewTitle' : holdingId ? 'Form.EditTitle' : 'Form.Add

- {{'Holdings.ID' | translate}}: {{holdingId}} - {{'Holdings.Library' | translate}}: {{getLibraryFullName()}} + {{'Holdings.ViewHoldings.ID' | translate}}: {{holdingId}} + {{'Holdings.ViewHoldings.Library' | translate}}: {{getLibraryFullName()}}
- {{'Form.Title' | translate}}: {{mmsTitle}} + {{'Holdings.Form.Title' | translate}}: {{mmsTitle}}
- Form.Fields.Location + Holdings.Form.Fields.Location - Form.Errors.LOC + Holdings.Form.Errors.LOC
@@ -50,32 +50,32 @@

{{ (isReadOnly ? 'Form.ViewTitle' : holdingId ? 'Form.EditTitle' : 'Form.Add
- Form.Fields.VOL + Holdings.Form.Fields.VOL - Form.Fields.CLN + Holdings.Form.Fields.CLN - Form.Fields.RGTN + Holdings.Form.Fields.RGTN - Form.Fields.CPYR + Holdings.Form.Fields.CPYR - Form.Fields.CPYNT + Holdings.Form.Fields.CPYNT - Form.Fields.LDF + Holdings.Form.Fields.LDF @@ -83,34 +83,34 @@

{{ (isReadOnly ? 'Form.ViewTitle' : holdingId ? 'Form.EditTitle' : 'Form.Add
- Form.Fields.HLYR + Holdings.Form.Fields.HLYR - Form.Errors.HLYR + Holdings.Form.Errors.HLYR - Form.Fields.HLV + Holdings.Form.Fields.HLV - Form.Errors.HLV + Holdings.Form.Errors.HLV - Form.Fields.CONT + Holdings.Form.Fields.CONT - Form.Fields.CLN + Holdings.Form.Fields.CLN - Form.Fields.LDF + Holdings.Form.Fields.LDF - Form.Fields.CPYNT + Holdings.Form.Fields.CPYNT diff --git a/cloudapp/src/app/holdings/form/form.component.ts b/cloudapp/src/app/holdings/form/form.component.ts index 84ac22e..64e49f4 100644 --- a/cloudapp/src/app/holdings/form/form.component.ts +++ b/cloudapp/src/app/holdings/form/form.component.ts @@ -168,7 +168,7 @@ export class FormComponent implements OnInit { next: (header) => { console.log(header); if (header.status === this.nacsis.OkStatus) { - this.alert.success(this.translate.instant('Form.Success'), {keepAfterRouteChange:true}); + this.alert.success(this.translate.instant('Holdings.Form.Success'), {keepAfterRouteChange:true}); this.holdingId = header.holdingId; this.holding.ID = header.holdingId; this.nacsis.saveHolding(this.holding); @@ -187,7 +187,7 @@ export class FormComponent implements OnInit { } catch (e) { this.loading = false; console.log(e); - this.alert.error(this.translate.instant('Errors.generalError'), {keepAfterRouteChange:true}); + this.alert.error(this.translate.instant('General.Errors.generalError'), {keepAfterRouteChange:true}); } } diff --git a/cloudapp/src/app/holdings/help/help.component.ts b/cloudapp/src/app/holdings/help/help.component.ts index 9d7c97b..47c4aea 100644 --- a/cloudapp/src/app/holdings/help/help.component.ts +++ b/cloudapp/src/app/holdings/help/help.component.ts @@ -6,7 +6,7 @@ import { TranslateService } from '@ngx-translate/core'; template: `

Help.Text

diff --git a/cloudapp/src/app/holdings/main/main.component.html b/cloudapp/src/app/holdings/main/main.component.html index 2503caa..7a568fa 100644 --- a/cloudapp/src/app/holdings/main/main.component.html +++ b/cloudapp/src/app/holdings/main/main.component.html @@ -4,17 +4,17 @@
-

Main.Intro

+

Holdings.Main.Intro

- Main.SelectBib + Holdings.Main.SelectBib {{bib.id}}: {{bib.description}} @@ -33,9 +33,9 @@

-

Main.NoRecords

+

Holdings.Main.NoRecords

\ No newline at end of file diff --git a/cloudapp/src/app/holdings/main/main.component.ts b/cloudapp/src/app/holdings/main/main.component.ts index fe16d3e..3a5a839 100644 --- a/cloudapp/src/app/holdings/main/main.component.ts +++ b/cloudapp/src/app/holdings/main/main.component.ts @@ -1,8 +1,8 @@ -import { Subscription, of, forkJoin} from 'rxjs'; +import { Subscription, of, forkJoin } from 'rxjs'; import { Component, OnInit, OnDestroy } from '@angular/core'; import { CloudAppEventsService, Entity, EntityType, CloudAppRestService } from '@exlibris/exl-cloudapp-angular-lib'; import { Router } from '@angular/router'; -import { HoldingsService} from '../../service/holdings.service'; +import { HoldingsService } from '../../service/holdings.service'; import { TranslateService } from '@ngx-translate/core'; import { AlertService } from '@exlibris/exl-cloudapp-angular-lib'; @@ -44,57 +44,60 @@ export class MainComponent implements OnInit, OnDestroy { ) { } ngOnInit() { - - sessionStorage.clear(); - - this.pageLoad$ = this.eventsService.onPageLoad(pageInfo => { - - this.loading=true; - - this.almaApiService.getIntegrationProfile() - .subscribe(integrationProfile => this.integrationProfile = integrationProfile); - - let rawBibs = (pageInfo.entities || []).filter(e => e.type == EntityType.BIB_MMS); - let nacsisBibs: Entity[] = []; - - forkJoin(rawBibs.map(entity => this.getRecord(entity))) - .subscribe({ - next: (records: any[])=>{ - - let index: number=0; - - records.forEach(record=>{ - console.log(record); - let nacsisId = this.almaApiService.extractNacsisId(record.anies, this.integrationProfile.systemNumberPrefix); - if(nacsisId != null) { - // tweak: override mmsId by nacsisId - let nacsisBib = rawBibs[index]; - nacsisBib.id = nacsisId; - nacsisBibs.push(nacsisBib); - } - index++; - }) - }, - error: e => { - this.loading = false; - console.log(e.message); - //this.alert.error(e.message, {keepAfterRouteChange:true}); - }, - complete: () => { - this.loading=false; - this.bibs = nacsisBibs; - } - }); + + sessionStorage.clear(); + + this.pageLoad$ = this.eventsService.onPageLoad(pageInfo => { + + this.loading = true; + + this.almaApiService.getIntegrationProfile() + .subscribe(integrationProfile => { + + this.integrationProfile = integrationProfile; + + let rawBibs = (pageInfo.entities || []).filter(e => e.type == EntityType.BIB_MMS); + let nacsisBibs: Entity[] = []; + + forkJoin(rawBibs.map(entity => this.getRecord(entity))) + .subscribe({ + next: (records: any[]) => { + + let index: number = 0; + + records.forEach(record => { + // console.log(record); + let nacsisId = this.almaApiService.extractNacsisId(record.anies, this.integrationProfile.libraryCode); + if (nacsisId != null) { + // tweak: override mmsId by nacsisId + let nacsisBib = rawBibs[index]; + nacsisBib.id = nacsisId; + nacsisBibs.push(nacsisBib); + } + index++; + }) + }, + error: e => { + this.loading = false; + console.log(e.message); + //this.alert.error(e.message, {keepAfterRouteChange:true}); + }, + complete: () => { + this.loading = false; + this.bibs = nacsisBibs; + } + }); + }); }); } ngOnDestroy(): void { this.pageLoad$.unsubscribe(); } - + getRecord(entity: Entity) { return this.restService.call(entity.link).pipe( - tap(()=>this.processed++), + tap(() => this.processed++), catchError(e => of(e)), ) } @@ -106,26 +109,26 @@ export class MainComponent implements OnInit, OnDestroy { try { let bib = this.bibs.filter(bib => bib.id == this.selected); this.nacsis.getHoldingsFromNacsis(this.selected, "Mine") - .subscribe({ - next: (header) => { - if (header.status === this.nacsis.OkStatus) { - sessionStorage.setItem(ROUTING_STATE_KEY, AppRoutingState.HoldingsMainPage); - this.router.navigate(['/holdings', this.selected, bib[0].description]); - } else { - this.alert.error(header.errorMessage, {keepAfterRouteChange:true}); - } - }, - error: e => { - this.loading = false; - console.log(e.message); - this.alert.error(e.message, {keepAfterRouteChange:true}); - }, - complete: () => this.loading = false - }); + .subscribe({ + next: (header) => { + if (header.status === this.nacsis.OkStatus) { + sessionStorage.setItem(ROUTING_STATE_KEY, AppRoutingState.HoldingsMainPage); + this.router.navigate(['/holdings', this.selected, bib[0].description]); + } else { + this.alert.error(header.errorMessage, { keepAfterRouteChange: true }); + } + }, + error: e => { + this.loading = false; + console.log(e.message); + this.alert.error(e.message, { keepAfterRouteChange: true }); + }, + complete: () => this.loading = false + }); } catch (e) { this.loading = false; console.log(e); - this.alert.error(this.translate.instant('Errors.generalError'), {keepAfterRouteChange:true}); + this.alert.error(this.translate.instant('General.Errors.generalError'), { keepAfterRouteChange: true }); } } } diff --git a/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.html b/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.html index f9085b6..aa4c658 100644 --- a/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.html +++ b/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.html @@ -4,11 +4,11 @@

@@ -17,7 +17,7 @@

{{mmsTitle}}

- {{'Holdings.Owner' | translate}} + {{'Holdings.ViewHoldings.Owner' | translate}} {{owner.name}} @@ -26,7 +26,7 @@

{{mmsTitle}}

-

{{'Holdings.Title' | translate}} ({{getNumOfRecords()}})

+

{{'Holdings.ViewHoldings.Title' | translate}} ({{getNumOfRecords()}})

@@ -45,13 +45,13 @@

{{'Holdings.Title' | translate}} ({{getNumOfRecords()}})

- {{'Holdings.ID' | translate}}: {{holding.ID}} + {{'Holdings.ViewHoldings.ID' | translate}}: {{holding.ID}}
- {{'Holdings.Library' | translate}}: {{holding.libraryFullName}} - {{'Holdings.Location' | translate}}: {{holding.LOC}} + {{'Holdings.ViewHoldings.Library' | translate}}: {{holding.libraryFullName}} + {{'Holdings.ViewHoldings.Location' | translate}}: {{holding.LOC}} {{holding.info}} @@ -68,7 +68,7 @@

{{'Holdings.Title' | translate}} ({{getNumOfRecords()}})

-

{{'Holdings.NoHoldingRecordsExist' | translate}}

+

{{'Holdings.ViewHoldings.NoHoldingRecordsExist' | translate}}

diff --git a/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.ts b/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.ts index 4ebe01d..c88f2dd 100644 --- a/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.ts +++ b/cloudapp/src/app/holdings/viewHoldings/viewHoldings.component.ts @@ -39,8 +39,8 @@ export class HoldingsComponent implements OnInit { ) { this.owners = [ - { id: "0", name: this.translate.instant('Holdings.All') }, - { id: "1", name: this.translate.instant('Holdings.Mine') } + { id: "0", name: this.translate.instant('Holdings.ViewHoldings.All') }, + { id: "1", name: this.translate.instant('Holdings.ViewHoldings.Mine') } ]; } @@ -105,7 +105,7 @@ export class HoldingsComponent implements OnInit { } catch (e) { this.loading = false; console.log(e); - this.alert.error(this.translate.instant('Errors.generalError'), {keepAfterRouteChange:true}); + this.alert.error(this.translate.instant('General.Errors.generalError'), {keepAfterRouteChange:true}); } } } @@ -144,11 +144,11 @@ export class HoldingsComponent implements OnInit { const dialogRef = this.dialog.open(ConfirmationDialog, { autoFocus: false, data: { - message: this.translate.instant('Holdings.ConfirmDelete'), - title: this.translate.instant('Holdings.DeleteTitle'), + message: this.translate.instant('Holdings.ViewHoldings.ConfirmDelete'), + title: this.translate.instant('Holdings.ViewHoldings.DeleteTitle'), buttonText: { - ok: this.translate.instant('Holdings.DeleteYesButton'), - cancel: this.translate.instant('Holdings.DeleteNoButton') + ok: this.translate.instant('Holdings.ViewHoldings.DeleteYesButton'), + cancel: this.translate.instant('Holdings.ViewHoldings.DeleteNoButton') } }/*, position: { @@ -168,7 +168,7 @@ export class HoldingsComponent implements OnInit { next: (header) => { console.log(header); if (header.status === this.nacsis.OkStatus) { - this.alert.success(this.translate.instant('Holdings.Deleted'), {keepAfterRouteChange:true}); + this.alert.success(this.translate.instant('Holdings.ViewHoldings.Deleted'), {keepAfterRouteChange:true}); this.nacsis.deleteHolding(holdingId); this.router.navigate(['/holdings', this.mmsId, this.mmsTitle]); } else { @@ -186,7 +186,7 @@ export class HoldingsComponent implements OnInit { } catch (e) { this.loading = false; console.log(e); - this.alert.error(this.translate.instant('Errors.generalError')); + this.alert.error(this.translate.instant('General.Errors.generalError')); } } }); diff --git a/cloudapp/src/app/main-menu/main-menu.component.html b/cloudapp/src/app/main-menu/main-menu.component.html index 99aaf8e..86a4b8f 100644 --- a/cloudapp/src/app/main-menu/main-menu.component.html +++ b/cloudapp/src/app/main-menu/main-menu.component.html @@ -1,5 +1,5 @@
-

This app includes all functionalities within NACSIS-CAT/ILL

+

{{ 'MainMenu.Intro' | translate }}

{{item.text | translate}} diff --git a/cloudapp/src/app/main-menu/main-menu.component.ts b/cloudapp/src/app/main-menu/main-menu.component.ts index ad4b867..2d84bbc 100644 --- a/cloudapp/src/app/main-menu/main-menu.component.ts +++ b/cloudapp/src/app/main-menu/main-menu.component.ts @@ -36,17 +36,17 @@ import { ROUTING_STATE_KEY, AppRoutingState } from '../service/base.service'; link: 'catalog' }, // { - // title: 'Members', - // text: 'NACSIS members information management', - // icon: 'uxf-icon uxf-switch', - // link: 'main' - // }, - // { - // title: 'ILL Borrowing Requests', - // text: 'NACSIS borrowing request creation', - // icon: 'uxf-icon uxf-external-link', - // link: 'main' + // title: 'MainMenu.Member.Title', + // text: 'MainMenu.Member.Text', + // icon: 'uxf-icon uxf-switch', + // link: 'main' // }, + { + title: 'MainMenu.ILL.Title', + text: 'MainMenu.ILL.Text', + icon: 'uxf-icon uxf-external-link', + link: 'ILL' + }, ); } diff --git a/cloudapp/src/app/service/alma.api.service.ts b/cloudapp/src/app/service/alma.api.service.ts index 585fdf3..3994d44 100644 --- a/cloudapp/src/app/service/alma.api.service.ts +++ b/cloudapp/src/app/service/alma.api.service.ts @@ -37,7 +37,7 @@ export class AlmaApiService { for (let index = 0; index < datafields.length; index++) { const field = datafields[index]; let tag = field.getAttribute("tag").valueOf(); - console.log(tag); + // console.log(tag); if(tag === "016") { let subfields = field.getElementsByTagName("subfield"); for (let index = 0; index < subfields.length; index++) { @@ -63,26 +63,40 @@ export class AlmaApiService { let url = "/conf/integration-profiles?type=CENTRAL_CATALOG_INTEGRATION"; - if(this.integrationProfile != null) { + if(this.integrationProfile != null && this.integrationProfile != undefined) { return of(this.integrationProfile) } - + + let repositoryImportProfile: string = null; + let authorityImportProfileNames: string = null; + let authorityImportProfileUniformTitles: string = null; + return this.restService.call(url).pipe( mergeMap(response => { - - this.integrationProfile = new IntegrationProfile(); - // extract integration profile let nacsisIntegrationProfile = response.integration_profile[0]; // assume can be only one CENTRAL_CATALOG_INTEGRATION - let systemNumberPrefixParam = nacsisIntegrationProfile.parameter.filter(param => param.action.value == "CENTRAL_CATALOG_INFORMATION_B" && param.name.value == "systemNumberPrefix"); - this.integrationProfile.systemNumberPrefix = systemNumberPrefixParam[0].value; - - // todo: extract import profiles - // repositoryImportProfile - // authorityImportProfileNames - // authorityImportProfileUniformTitles - + // extract import profiles + let ContributionConfigurationParams = nacsisIntegrationProfile.parameter.filter(param => param.action.value == "CENTRAL_CATALOG_CONTRIBUTION_CONFIGURATION"); + repositoryImportProfile = ContributionConfigurationParams.filter(param => param.name.value == "repositoryImportProfile")[0].value; + authorityImportProfileNames = ContributionConfigurationParams.filter(param => param.name.value == "authNames")[0].value; + authorityImportProfileUniformTitles = ContributionConfigurationParams.filter(param => param.name.value == "authUniformTitle")[0].value; return of(this.integrationProfile); + }), + mergeMap(() => { + url = "/almaws/v1/conf/code-tables/NacsisExternalSystemCodes"; + return this.restService.call(url); + }), + mergeMap(response => { + let libraryCode = response.row.filter(row => row.code == "libraryCode")[0].description; + let systemPrefix = response.row.filter(row => row.code == "systemPrefix")[0].description; + + this.integrationProfile = new IntegrationProfile(); + this.integrationProfile.libraryCode = libraryCode; + this.integrationProfile.systemPrefix = systemPrefix; + this.integrationProfile.repositoryImportProfile = repositoryImportProfile; + this.integrationProfile.authorityImportProfileNames = authorityImportProfileNames; + this.integrationProfile.authorityImportProfileUniformTitles = authorityImportProfileUniformTitles; + return of(this.integrationProfile); }) ); } @@ -90,8 +104,10 @@ export class AlmaApiService { } export class IntegrationProfile { - systemNumberPrefix: string; + libraryCode: string; + systemPrefix: string; repositoryImportProfile: string; authorityImportProfileNames: string; authorityImportProfileUniformTitles: string; } + diff --git a/cloudapp/src/app/service/catalog.service.ts b/cloudapp/src/app/service/catalog.service.ts index bb7626c..790f772 100644 --- a/cloudapp/src/app/service/catalog.service.ts +++ b/cloudapp/src/app/service/catalog.service.ts @@ -5,14 +5,13 @@ import { BaseService, Header } from "./base.service"; import { mergeMap } from 'rxjs/operators'; import { of } from 'rxjs'; -import { SearchType } from '../catalog/search-form/form-utils'; +import { SearchType } from '../catalog/main/form-utils'; import { NacsisCatalogResults, ResultsHeader } from '../catalog/results-types/results-common'; import { Monograph } from '../catalog/results-types/monographs'; import { Serial } from '../catalog/results-types/serials'; import { Name } from '../catalog/results-types/name'; import { UniformTitle } from '../catalog/results-types/uniformTitle'; - - +import { AlmaApiService, IntegrationProfile } from './alma.api.service'; @Injectable({ providedIn: 'root' @@ -21,12 +20,14 @@ export class CatalogService extends BaseService { private resultsHeader: ResultsHeader; private searchResultsMap: Map; + private integrationProfile: string; public queryParams: string = ""; constructor( protected eventsService: CloudAppEventsService, - protected http: HttpClient + protected http: HttpClient, + protected almaApi: AlmaApiService ) { super(eventsService, http); this.initResultsMap(); @@ -62,7 +63,7 @@ export class CatalogService extends BaseService { getSearchResultsFromNacsis(queryParams: string, searchType:SearchType){ let fullUrl: string; - this.queryParams = this.addPaginationParams() + queryParams; + this.queryParams = queryParams; return this.getInitData().pipe( mergeMap(initData => { @@ -74,7 +75,7 @@ export class CatalogService extends BaseService { return this.http.get(fullUrl, { headers }) }), mergeMap(response => { - if (response.status === this.OkStatus) { + if (response.status === this.OkStatus && !this.isEmpty(response.records)) { this.searchResultsMap.get(searchType).setHeader(response); this.searchResultsMap.get(searchType).setResults(new Array()); response.records.forEach(record => { @@ -103,10 +104,29 @@ export class CatalogService extends BaseService { } } - addPaginationParams(): string { - let fromIndex = 1; - let toIndex = 20; - return "fromIndex=" + fromIndex + "&toIndex=" + toIndex + "&"; + importRecordToAlma(searchType: SearchType, rawData: string) { + return this.almaApi.getIntegrationProfile().pipe( + mergeMap(integrationProfile => { + let integrationProfileID = this.integrationProfileFactory(searchType, integrationProfile); + let body = "catp" + rawData + ""; + return this.http.post("/almaws/v1/bibs?import_profile="+integrationProfileID, body) + }), + mergeMap(response => { + return of(response); + // return of(response.warnings, response.mms_id); + }) + ); + } + + integrationProfileFactory(searchType: SearchType, integrationProfile: IntegrationProfile) { + switch(searchType) { + case (SearchType.Monographs || SearchType.Serials): + return integrationProfile.repositoryImportProfile; + case (SearchType.Names): + return integrationProfile.authorityImportProfileNames; + case (SearchType.UniformTitles): + return integrationProfile.authorityImportProfileUniformTitles; + } } } diff --git a/cloudapp/src/app/user-controls/result-card/result-card.component.html b/cloudapp/src/app/user-controls/result-card/result-card.component.html new file mode 100644 index 0000000..adee077 --- /dev/null +++ b/cloudapp/src/app/user-controls/result-card/result-card.component.html @@ -0,0 +1,29 @@ + +
+ +
+ {{index + 1}} +
+ + {{record.getDisplayTitle()}} + +
+ + {{line}} + +
+ +
+ + +
+ +
+
+
+
+ diff --git a/cloudapp/src/app/user-controls/result-card/result-card.component.scss b/cloudapp/src/app/user-controls/result-card/result-card.component.scss new file mode 100644 index 0000000..185ece6 --- /dev/null +++ b/cloudapp/src/app/user-controls/result-card/result-card.component.scss @@ -0,0 +1,19 @@ +.result-card{ + display: flex; + justify-content: space-between; + width: 100%; + background-color: whitesmoke !important; +} + +.result-card-index { + margin-right: 20px; +} + + .result-card-content { + margin: 0px; +} + +a, +a label { + cursor: pointer; +} diff --git a/cloudapp/src/app/user-controls/result-card/result-card.component.ts b/cloudapp/src/app/user-controls/result-card/result-card.component.ts new file mode 100644 index 0000000..df6ad66 --- /dev/null +++ b/cloudapp/src/app/user-controls/result-card/result-card.component.ts @@ -0,0 +1,36 @@ +import { Component, Input, Output, EventEmitter } from '@angular/core'; +import { PageEvent } from '@angular/material/paginator'; +import { IDisplayLinesSummary } from '../../catalog/results-types/results-common'; + + +@Component({ + selector: 'result-card', + templateUrl: './result-card.component.html', + styleUrls: ['./result-card.component.scss'] + }) + +export class ResultCardComponent { + + @Input() index: number; + @Input() record: IDisplayLinesSummary; + @Input() resultActionList: Array = new Array(); + @Output() onActionSelected = new EventEmitter<[number, IDisplayLinesSummary]>(); + @Output() onTitleSelected = new EventEmitter(); + + + constructor() { } + + onActionsClick(actionIndex: number, record: IDisplayLinesSummary) { + this.onActionSelected.emit([actionIndex, record]); + } + + onTitleClick(record: IDisplayLinesSummary) { + this.onTitleSelected.emit(record); + } + + + + +} + + diff --git a/cloudapp/src/app/user-controls/results-list/results-list.component.html b/cloudapp/src/app/user-controls/results-list/results-list.component.html new file mode 100644 index 0000000..17e1fcd --- /dev/null +++ b/cloudapp/src/app/user-controls/results-list/results-list.component.html @@ -0,0 +1,15 @@ +

{{'Catalog.Results.Title' | translate}} ({{numOfResults}})

+ + + + + + + + \ No newline at end of file diff --git a/cloudapp/src/app/user-controls/results-list/results-list.component.scss b/cloudapp/src/app/user-controls/results-list/results-list.component.scss new file mode 100644 index 0000000..bf4ed0b --- /dev/null +++ b/cloudapp/src/app/user-controls/results-list/results-list.component.scss @@ -0,0 +1,8 @@ +.result-list-item{ + padding-bottom: 15px !important; +} + +result-card{ + display: flex; + width: 100%; +} diff --git a/cloudapp/src/app/user-controls/results-list/results-list.component.ts b/cloudapp/src/app/user-controls/results-list/results-list.component.ts new file mode 100644 index 0000000..b406bff --- /dev/null +++ b/cloudapp/src/app/user-controls/results-list/results-list.component.ts @@ -0,0 +1,41 @@ +import { Component, Input, Output, EventEmitter } from '@angular/core'; +import { PageEvent } from '@angular/material/paginator'; +import { IDisplayLinesSummary } from '../../catalog/results-types/results-common'; + + +@Component({ + selector: 'results-list', + templateUrl: './results-list.component.html', + styleUrls: ['./results-list.component.scss'] + }) + +export class ResultsListComponent { + + @Input() numOfResults: number; + @Input() resultsSummaryDisplay: Array = new Array(); + @Input() resultActionList: Array = new Array(); + @Output() onActionSelected = new EventEmitter<[number, IDisplayLinesSummary]>(); + @Output() onTitleSelected = new EventEmitter(); + @Output() onPageSelected = new EventEmitter(); + + + constructor() { } + + onActionsClick(selection: any) { + this.onActionSelected.emit(selection); + } + + onTitleClick(result: IDisplayLinesSummary) { + this.onTitleSelected.emit(result); + } + + onPageAction(pageEvent: PageEvent) { + this.onPageSelected.emit(pageEvent); + } + + + + +} + + diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.html b/cloudapp/src/app/user-controls/search-form/search-form.component.html new file mode 100644 index 0000000..c1caff0 --- /dev/null +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.html @@ -0,0 +1,17 @@ + + {{'Catalog.Form.SelectDatabase' | translate}} + + + {{ database }} + + + +
+ + + + {{ field.getFieldLabel() | translate }} + + + + \ No newline at end of file diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.scss b/cloudapp/src/app/user-controls/search-form/search-form.component.scss new file mode 100644 index 0000000..142ebaf --- /dev/null +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.scss @@ -0,0 +1,21 @@ +.mat-form-field { + display: contents; +} + +.form-card-parent { + display: grid; + grid-template-columns: repeat(auto-fit, minmax(200px, 1fr)); + column-gap: 20px; + row-gap: 1em; + background-color: whitesmoke !important; +} + +.form-card-child-large{ + display: block; + grid-column-start: 1; + grid-column-end: -1; +} + +.form-card-child-regular{ + display: block; +} diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.ts b/cloudapp/src/app/user-controls/search-form/search-form.component.ts new file mode 100644 index 0000000..084e453 --- /dev/null +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.ts @@ -0,0 +1,34 @@ +import { Component, Input, Output, EventEmitter, OnChanges } from '@angular/core'; +import { SearchField } from '../../catalog/main/form-utils'; +import { MatSelectChange } from '@angular/material/select'; + + +@Component({ + selector: 'search-form', + templateUrl: './search-form.component.html', + styleUrls: ['./search-form.component.scss'] + }) + +export class SearchFormComponent implements OnChanges { + + @Input() databasesList: Array = new Array(); + @Input() fieldsList: Array = new Array(); + @Output() selectedDatabase = new EventEmitter(); + private firstDatabase; + + constructor() { } + + ngOnChanges() { + this.firstDatabase = this.databasesList[0]; + this.selectedDatabase.emit(this.firstDatabase); + } + + selectDatabase(db: MatSelectChange) { + this.selectedDatabase.emit(db.value); + } + + + +} + + diff --git a/cloudapp/src/i18n/en.json b/cloudapp/src/i18n/en.json index 74ecc8b..334c8d8 100644 --- a/cloudapp/src/i18n/en.json +++ b/cloudapp/src/i18n/en.json @@ -1,5 +1,19 @@ { + "General": { + "Back": "Back", + "BackToMenu": "Back to menu", + "Cancel": "Cancel", + "Save": "Save", + "OK": "OK", + "Clear": "Clear", + "Search": "Search", + "Errors": { + "generalError": "App general error" + } + }, + "MainMenu": { + "Intro": "This app includes all functionalities within NACSIS-CAT/ILL", "Holdings": { "Title": "Holdings", "Text": "NACSIS holding information management" @@ -7,6 +21,14 @@ "Catalog": { "Title": "Catalog", "Text": "Search and Copy cataloging NACSIS Bib/Auth records" + }, + "ILL": { + "Title": "ILL Borrowing Requests", + "Text": "NACSIS borrowing request creation" + }, + "Members": { + "Title": "Members", + "Text": "NACSIS members information management" } }, @@ -16,81 +38,38 @@ "RefineSearch": "Refine Search", "SelectSearchType": "Select search type", "SelectDatabase": "Select a database", - "Monographs": { - "MainTitle": "Monographs", - "Field": { - "TITLE": "TITLE", - "FTITLE": "FTITLE", - "PTBL": "PTBL", - "VOL": "VOL", - "TiPtVo": "TITLE / PTBL / VOL", - "AUTH": "AUTH", - "ISSN": "ISSN", - "ISBN": "ISBN", - "NBN": "NBN", - "NDLCN": "NDLCN / LCCN / OTHN", - "PUB": "PUB", - "YEAR": "YEAR", - "PLACE": "PLACE", - "CNTRY": "CNTRY", - "LANG": "LANG", - "SH": "SH", - "AKEY": "AKEY", - "ID": "ID", - "PID": "PID" - } - }, - "Serials": { - "MainTitle": "Serials", - "Field": { - "TITLE": "TITLE", - "FTITLE": "FTITLE", - "AUTH": "AUTH", - "ISSN": "ISSN", - "CODEN": "CODEN", - "NDLPN": "NDLPN / LCCN", - "PUB": "PUB", - "YEAR": "YEAR", - "PLACE": "PLACE", - "CNTRY": "CNTRY", - "LANG": "LANG", - "SH": "SH", - "AKEY": "AKEY", - "ID": "ID", - "FID": "FID" - } - }, - "Names": { - "MainTitle": "Names", - "Database": { - "All": "All", - "NAME": "NAME", - "JPMARCA": "JPMARCA", - "USMARCA": "USMARCA" - }, - "Field": { - "AUTH": "AUTH", - "AKEY": "AKEY", - "PLACE": "PLACE", - "DATE": "DATE", - "ID": "ID", - "SAID": "SAID" - } + "EmptyForm": "The search form is empty. Please enter at least one value", + "SearchTypes": { + "Monographs": "Monographs", + "Serials": "Serials", + "Names": "Names", + "UniformTitles": "Uniform Titles" }, - "UniformTitles": { - "MainTitle": "Uniform Titles", - "Database": { - "All": "All", - "TITLE": "TITLE", - "USMARCT": "USMARCT" - }, - "Field": { - "TITLE": "TITLE", - "AUTH": "AUTH", - "AKEY": "AKEY", - "ID": "ID", - "SAID": "SAID" - } + "Fields": { + "TITLE": "TITLE", + "FTITLE": "FTITLE", + "PTBL": "PTBL", + "VOL": "VOL", + "TiPtVo": "TITLE / PTBL / VOL", + "AUTH": "AUTH", + "ISSN": "ISSN", + "ISBN": "ISBN", + "NBN": "NBN", + "NDLCN": "NDLCN / LCCN / OTHN", + "PUB": "PUB", + "YEAR": "YEAR", + "PLACE": "PLACE", + "CNTRY": "CNTRY", + "LANG": "LANG", + "SH": "SH", + "AKEY": "AKEY", + "ID": "ID", + "PID": "PID", + "CODEN": "CODEN", + "NDLPN": "NDLPN / LCCN", + "FID": "FID", + "DATE": "DATE", + "SAID": "SAID" } }, "Results": { @@ -110,70 +89,67 @@ } }, - - "comment":"TODO: Holdings", - - "Main": { - "Intro": "Select a record to retrieve NACSIS holdings:", - "NoRecords": "To view NACSIS holdings, navigate to a bibliographic record.", - "SelectBib": "Select a title", - "RetrieveHoldings": "Retrieve NACSIS Holdings" - }, - "Errors": { - "generalError": "App general error" - }, "Holdings": { - "Owner": "Owner", - "All": "All", - "Mine": "Mine", - "ID": "ID", - "Title": "Holdings", - "Library": "Library", - "Location": "Location", - "ConfirmDelete": "Are you sure you wish to delete this holding record?", - "DeleteTitle": "Delete Holding record", - "Deleted": "Record successfully deleted.", - "Add": "Add NACSIS Holding", - "NoHoldingRecordsExist": "No holding records exist.", - "DeleteYesButton": "Yes, delete it", - "DeleteNoButton": "No, keep it", - "Errors": { - "NoNoldings": "No holdings record were found", - "GetFailed": "Get holdings failed", - "DeleteFailed": "Delete holding failed" - } - }, - "Form": { - "Title":"Title", - "EditTitle": "Edit holding", - "AddTitle": "Add holding", - "ViewTitle": "View holding", - "Success": "Holding successfully saved.", - "Fields": { - "Id": "ID", - "Description": "Description", + "Main": { + "Intro": "Select a record to retrieve NACSIS holdings:", + "NoRecords": "To view NACSIS holdings, navigate to a bibliographic record.", + "SelectBib": "Select a title", + "RetrieveHoldings": "Retrieve NACSIS Holdings" + }, + "ViewHoldings": { + "Owner": "Owner", + "All": "All", + "Mine": "Mine", + "ID": "ID", + "Title": "Holdings", "Library": "Library", "Location": "Location", - "Ill": "Available for resource sharing", - "VOL": "VOL", - "CLN": "CLN", - "RGTN": "RGTN", - "CPYR": "CPYR", - "CPYNT": "CPYNT", - "LDF": "LDF", - "LTR": "LTR", - "HLV": "HLV", - "CONT": "CONT", - "HLYR": "HLYR" + "ConfirmDelete": "Are you sure you wish to delete this holding record?", + "DeleteTitle": "Delete Holding record", + "Deleted": "Record successfully deleted.", + "Add": "Add NACSIS Holding", + "NoHoldingRecordsExist": "No holding records exist.", + "DeleteYesButton": "Yes, delete it", + "DeleteNoButton": "No, keep it", + "Errors": { + "NoNoldings": "No holdings record were found", + "GetFailed": "Get holdings failed", + "DeleteFailed": "Delete holding failed" + } }, - "Errors": { - "Id": "ID field is required", - "SaveFailed": "Save holding failed", - "HLYR": "HLYR field is required", - "HLV": "HLV field is required", - "LOC": "LOC field is required" + "Form": { + "Title":"Title", + "EditTitle": "Edit holding", + "AddTitle": "Add holding", + "ViewTitle": "View holding", + "Success": "Holding successfully saved.", + "Fields": { + "Id": "ID", + "Description": "Description", + "Library": "Library", + "Location": "Location", + "Ill": "Available for resource sharing", + "VOL": "VOL", + "CLN": "CLN", + "RGTN": "RGTN", + "CPYR": "CPYR", + "CPYNT": "CPYNT", + "LDF": "LDF", + "LTR": "LTR", + "HLV": "HLV", + "CONT": "CONT", + "HLYR": "HLYR" + }, + "Errors": { + "Id": "ID field is required", + "SaveFailed": "Save holding failed", + "HLYR": "HLYR field is required", + "HLV": "HLV field is required", + "LOC": "LOC field is required" + } } }, + "Config": { "Title": "Configuration", "Success": "Configuration successfully saved.", @@ -181,12 +157,37 @@ "Code": "NACSIS Code" } }, + "Help": { "Text": "This app is supported by Ex Libris. To view the documentation, click the link below. For additional help or to report a problem, please open a SalesForce case.", "OLH": "To the online help" }, - "Back": "Back", - "Cancel": "Cancel", - "Save": "Save", - "OK": "OK" + + "Common": { + "Fields": { + "TITLE": "TITLE", + "FTITLE": "FTITLE", + "PTBL": "PTBL", + "VOL": "VOL", + "TiPtVo": "TITLE / PTBL / VOL", + "AUTH": "AUTH", + "ISSN": "ISSN", + "ISBN": "ISBN", + "NBN": "NBN", + "NDLCN": "NDLCN / LCCN / OTHN", + "PUB": "PUB", + "YEAR": "YEAR", + "PLACE": "PLACE", + "CNTRY": "CNTRY", + "LANG": "LANG", + "SH": "SH", + "AKEY": "AKEY", + "ID": "ID", + "PID": "PID", + "CODEN": "CODEN", + "NDLPN": "NDLPN / LCCN", + "FID": "FID" + } + } + } \ No newline at end of file diff --git a/cloudapp/src/i18n/jp.json b/cloudapp/src/i18n/jp.json index 1ae2bad..b938977 100644 --- a/cloudapp/src/i18n/jp.json +++ b/cloudapp/src/i18n/jp.json @@ -1,12 +1,34 @@ { + "General": { + "Back": "戻る", + "BackToMenu": "???Back to menu", + "Cancel": "キャンセル", + "Save": "保存", + "OK": "OK", + "Clear": "???Clear", + "Search": "???Search", + "Errors": { + "generalError": "アプリケーションエラー" + } + }, + "MainMenu": { + "Intro": "???This app includes all functionalities within NACSIS-CAT/ILL", "Holdings": { "Title": "タイトル", "Text": "??? NACSIS holding ???" }, "Catalog": { - "Title": "???", + "Title": "Copy Catalog12 345 ???", "Text": "??? Search and Copy cataloging ???" + }, + "ILL": { + "Title": "ILL Borrowing ??? Requests", + "Text": "NACSIS borrowing request creation???" + }, + "Members": { + "Title": "Members??", + "Text": "NACSIS members information management???" } }, @@ -16,152 +38,118 @@ "RefineSearch": "Refine Search???", "SelectSearchType": "Select search ???", "SelectDatabase": "Select a ???", - "Monographs": { - "MainTitle": "Monographs??", - "Field": { - "TITLE": "TITLE??", - "FTITLE": "FTITLE??", - "PTBL": "PTBL", - "VOL": "VOL", - "TiPtVo": "TITLE / PTBL / VOL", - "AUTH": "AUTH", - "ISSN": "ISSN", - "ISBN": "ISBN", - "NBN": "NBN", - "NDLCN": "NDLCN / LCCN / OTHN", - "PUB": "PUB", - "YEAR": "YEAR", - "PLACE": "PLACE", - "CNTRY": "CNTRY", - "LANG": "LANG", - "SH": "SH", - "AKEY": "AKEY", - "ID": "ID", - "PID": "PID" - } - }, - "Serials": { - "MainTitle": "Serials???", - "Field": { - "TITLE": "TITLE??", - "FTITLE": "FTITLE??", - "AUTH": "AUTH", - "ISSN": "ISSN", - "CODEN": "CODEN", - "NDLPN": "NDLPN / LCCN", - "PUB": "PUB", - "YEAR": "YEAR", - "PLACE": "PLACE", - "CNTRY": "CNTRY", - "LANG": "LANG", - "SH": "SH", - "AKEY": "AKEY", - "ID": "ID", - "FID": "FID" - } - }, - "Names": { - "MainTitle": "Name??", - "Database": { - "All": "All??", - "NAME": "NAME??", - "JPMARCA": "JPMARCA", - "USMARCA": "USMARCA" - }, - "Field": { - "AUTH": "AUTH??", - "AKEY": "AKEY??", - "PLACE": "PLACE", - "DATE": "DATE", - "ID": "ID", - "SAID": "SAID" - } + "EmptyForm": "The search form is empty. ???", + "SearchTypes": { + "Monographs": "Monographs???", + "Serials": "Serials???", + "Names": "Names???", + "UniformTitles": "Uniform Titles???" }, - "UniformTitles": { - "MainTitle": "Uniform Titles???", - "Database": { - "All": "All", - "TITLE": "TITLE", - "USMARCT": "USMARCT" - }, - "Field": { - "TITLE": "TITLE???", - "AUTH": "AUTH???", - "AKEY": "AKEY", - "ID": "ID", - "SAID": "SAID" - } + "Fields": { + "TITLE": "TITLE???", + "FTITLE": "FTITLE???", + "PTBL": "PTBL???", + "VOL": "VOL", + "TiPtVo": "TITLE / PTBL / VOL", + "AUTH": "AUTH", + "ISSN": "ISSN", + "ISBN": "ISBN", + "NBN": "NBN", + "NDLCN": "NDLCN / LCCN / OTHN", + "PUB": "PUB", + "YEAR": "YEAR", + "PLACE": "PLACE", + "CNTRY": "CNTRY", + "LANG": "LANG", + "SH": "SH", + "AKEY": "AKEY", + "ID": "ID", + "PID": "PID", + "CODEN": "CODEN", + "NDLPN": "NDLPN / LCCN", + "FID": "FID", + "DATE": "DATE", + "SAID": "SAID" } }, - "Search": { - "Title": "Records???", - "NoRecordsExist": "No ??? exist.", - "By": "Byby???", - "Book": "Book", - "NACSISID": "NACSISID", - "ISBN": "ISBN", - "Subjects": "Subjects???" + "Results": { + "Title": "???Records", + "NoRecordsExist": "???No records exist.", + "By": "???By", + "Book": "???Book", + "NACSISID": "???NACSIS ID", + "ISBN": "???ISBN", + "ISSN": "???ISSN", + "Subjects": "???Subjects", + "Actions" : { + "View" : "???View", + "Import" : "???Import", + "ViewHoldings" : "???View Holdings" + } } }, - "Main": { - "Intro": "NACSISから所蔵を取得するための書誌レコードを選択してください:", - "NoRecords": "NACSISの所蔵を閲覧表示するため、該当の書誌レコードに移動します。", - "SelectBib": "書誌レコードの選択", - "RetrieveHoldings": "所蔵の検索" - }, - "Errors": { - "generalError": "アプリケーションエラー" - }, "Holdings": { - "Owner": "所蔵館", - "All": "すべて", - "Mine": "自館所蔵", - "ID": "所蔵データID", - "Title": "タイトル", - "Library": "図書館", - "Location": "配置場所", - "ConfirmDelete": "このレコードを本当に削除しますか?", - "Deleted": "レコードが削除されました.", - "Add": "所蔵レコードの追加", - "NoHoldingRecordsExist": "所蔵レコードがありません。", - "Errors": { - "NoNoldings": "所蔵レコードが見つかりません。", - "GetFailed": "所蔵レコードの取得ができませんでした。", - "DeleteFailed": "所蔵レコードの削除ができませんでした。" - } - }, - "Form": { - "Title": "タイトル", - "EditTitle": "所蔵の編集", - "AddTitle": "所蔵の追加", - "ViewTitle": "タイトルの表示", - "Success": "所蔵が保存されました.", - "Fields": { - "Id": "データID", - "Description": "記述", + "Main": { + "Intro": "NACSISから所蔵を取得するための書誌レコードを選択してください:", + "NoRecords": "NACSISの所蔵を閲覧表示するため、該当の書誌レコードに移動します。", + "SelectBib": "書誌レコードの選択", + "RetrieveHoldings": "所蔵の検索" + }, + "ViewHoldings": { + "Owner": "所蔵館", + "All": "すべて", + "Mine": "自館所蔵", + "ID": "所蔵データID", + "Title": "タイトル", "Library": "図書館", "Location": "配置場所", - "Ill": "ILL(リソース共有)可", - "VOL": "巻冊次等", - "CLN": "請求記号", - "RGTN": "登録番号", - "CPYR": "刷の出版年", - "CPYNT": "刷の注記", - "LDF": "図書館定義フィールド", - "LTR": "ローカルトレーシング", - "HLV": "所蔵巻次データ", - "CONT": "受入継続表示", - "HLYR": "所蔵年次データ" + "ConfirmDelete": "このレコードを本当に削除しますか?", + "DeleteTitle": "???Delete Holding record", + "Deleted": "レコードが削除されました.", + "Add": "所蔵レコードの追加", + "NoHoldingRecordsExist": "所蔵レコードがありません。", + "DeleteYesButton": "???Yes, delete it", + "DeleteNoButton": "???No, keep it", + "Errors": { + "NoNoldings": "所蔵レコードが見つかりません。", + "GetFailed": "所蔵レコードの取得ができませんでした。", + "DeleteFailed": "所蔵レコードの削除ができませんでした。" + } }, - "Errors": { - "Id": "所蔵IDの入力は必須です。", - "SaveFailed": "所蔵の保存ができませんでした。", - "HLYR": "所蔵年次データの入力は必須です。", - "HLV": "所蔵巻次データの入力は必須です", - "LOC": "配置コードの入力は必須です" + "Form": { + "Title": "タイトル", + "EditTitle": "所蔵の編集", + "AddTitle": "所蔵の追加", + "ViewTitle": "タイトルの表示", + "Success": "所蔵が保存されました.", + "Fields": { + "Id": "データID", + "Description": "記述", + "Library": "図書館", + "Location": "配置場所", + "Ill": "ILL(リソース共有)可", + "VOL": "巻冊次等", + "CLN": "請求記号", + "RGTN": "登録番号", + "CPYR": "刷の出版年", + "CPYNT": "刷の注記", + "LDF": "図書館定義フィールド", + "LTR": "ローカルトレーシング", + "HLV": "所蔵巻次データ", + "CONT": "受入継続表示", + "HLYR": "所蔵年次データ" + }, + "Errors": { + "Id": "所蔵IDの入力は必須です。", + "SaveFailed": "所蔵の保存ができませんでした。", + "HLYR": "所蔵年次データの入力は必須です。", + "HLV": "所蔵巻次データの入力は必須です", + "LOC": "配置コードの入力は必須です" + } } }, + "Config": { "Title": "設定", "Success": "設定が保存されました.", @@ -169,12 +157,9 @@ "Code": "NACSISのコード" } }, + "Help": { "Text": "このアプリはEx Librisでサポートされています。 ドキュメントを表示するには、下のリンクをクリックしてください。 さらにヘルプが必要な場合や問題を報告するには、SalesForceケースを開いてください。", "OLH": "オンラインヘルプへ" - }, - "Back": "戻る", - "Cancel": "キャンセル", - "Save": "保存", - "OK": "OK" + } } \ No newline at end of file From b8d270437436fde1dbd1f159afad08566a3eb6b1 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Wed, 25 Aug 2021 15:28:42 +0300 Subject: [PATCH 10/28] Updating the user controls --- cloudapp/src/app/app.module.ts | 20 ++++++++++------ .../src/app/catalog/main/main.component.ts | 17 +++++++------ cloudapp/src/app/service/catalog.service.ts | 2 +- .../result-card/result-card.component.html | 8 +++---- .../result-card/result-card.component.ts | 24 ++++++++++++------- .../results-list/results-list.component.html | 2 +- .../results-list/results-list.component.ts | 11 +++++---- .../search-form/search-form.component.html | 2 +- .../search-form/search-form.component.ts | 6 ++--- 9 files changed, 54 insertions(+), 38 deletions(-) diff --git a/cloudapp/src/app/app.module.ts b/cloudapp/src/app/app.module.ts index 0ea1aeb..30a818c 100644 --- a/cloudapp/src/app/app.module.ts +++ b/cloudapp/src/app/app.module.ts @@ -5,24 +5,30 @@ import { BrowserAnimationsModule } from '@angular/platform-browser/animations'; import { MaterialModule, getTranslateModule, AlertModule, MenuModule } from '@exlibris/exl-cloudapp-angular-lib'; import { ToastrModule } from 'ngx-toastr'; import { FormsModule, ReactiveFormsModule } from '@angular/forms'; +import { FlexLayoutModule } from '@angular/flex-layout'; +import { MatDialogModule } from '@angular/material/dialog'; import { AppComponent } from './app.component'; import { AppRoutingModule } from './app-routing.module'; -import { MainComponent } from './holdings/main/main.component'; import { FooterComponent } from './footer/footer.component'; -import { HoldingsComponent } from './holdings/viewHoldings/viewHoldings.component'; import { FormComponent } from './holdings/form/form.component'; import { ConfigurationComponent } from './configuration/configuration.component'; -import { FlexLayoutModule } from '@angular/flex-layout'; -import { MatDialogModule } from '@angular/material/dialog'; import {ConfirmationDialog} from './dialog/confirmation-dialog.component'; -import { HelpComponent } from './holdings/help/help.component'; import { MainMenuComponent } from './main-menu/main-menu.component'; + +// Holding +import { MainComponent } from './holdings/main/main.component'; +import { HoldingsComponent } from './holdings/viewHoldings/viewHoldings.component'; +import { HelpComponent } from './holdings/help/help.component'; + +// Catalog import { CatalogMainComponent } from './catalog/main/main.component'; +import { FullviewDisplayComponent } from './catalog/full-view-display/full-view-display.component'; + +// User Controls import { SearchFormComponent } from './user-controls/search-form/search-form.component'; import { ResultsListComponent } from './user-controls/results-list/results-list.component'; import { ResultCardComponent } from './user-controls/result-card/result-card.component'; -import { FullviewDisplayComponent } from './catalog/full-view-display/full-view-display.component'; @@ -49,7 +55,7 @@ export function getToastrModule() { SearchFormComponent, ResultsListComponent, ResultCardComponent, - FullviewDisplayComponent + FullviewDisplayComponent, ], entryComponents: [ConfirmationDialog], imports: [ diff --git a/cloudapp/src/app/catalog/main/main.component.ts b/cloudapp/src/app/catalog/main/main.component.ts index f96a6e4..fc16bb7 100644 --- a/cloudapp/src/app/catalog/main/main.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -14,6 +14,7 @@ import { NameSummaryDisplay, NameFullDisplay } from '../results-types/name'; import { UniformTitleFullDisplay, UniformTitleSummaryDisplay } from '../results-types/uniformTitle'; import { HoldingsService } from '../../service/holdings.service'; import { AppRoutingState, ROUTING_STATE_KEY } from '../../service/base.service'; +import { RecordSelection } from '../../user-controls/result-card/result-card.component'; @@ -224,17 +225,18 @@ export class CatalogMainComponent implements AfterViewInit { } } - onActionsClick(selection) { - switch (selection[0]) { + onActionsClick(selection: RecordSelection) { + let record = this.resultsSummaryDisplay[selection.recordIndex]; + switch (selection.actionIndex) { case 0: // Full view this.currentResulsTmpl = this.fullRecordTmpl; - this.resultFullDisplay = this.fullDisplayFactory(selection[1].getFullRecordData()).initContentDisplay(); + this.resultFullDisplay = this.fullDisplayFactory(record.getFullRecordData()).initContentDisplay(); break; case 1: // Import the record - this.onImportRecord(selection[1].getFullRecordData().getRawData()); + this.onImportRecord(record.getFullRecordData().getRawData()); break; case 2: // View Holdings - this.onViewHoldings(selection[1].getFullRecordData().getID(), selection[1].getDisplayTitle()); + this.onViewHoldings(record.getFullRecordData().getID(), record.getDisplayTitle()); break; default: { this.currentResulsTmpl = this.noResultsTmpl; @@ -243,10 +245,11 @@ export class CatalogMainComponent implements AfterViewInit { } - onTitleClick(result: IDisplayLinesSummary) { + onTitleClick(recordIndex: number) { // Opening the full view + let record = this.resultsSummaryDisplay[recordIndex]; this.currentResulsTmpl = this.fullRecordTmpl; - this.resultFullDisplay = this.fullDisplayFactory(result.getFullRecordData()).initContentDisplay(); + this.resultFullDisplay = this.fullDisplayFactory(record.getFullRecordData()).initContentDisplay(); } diff --git a/cloudapp/src/app/service/catalog.service.ts b/cloudapp/src/app/service/catalog.service.ts index 790f772..7cb7750 100644 --- a/cloudapp/src/app/service/catalog.service.ts +++ b/cloudapp/src/app/service/catalog.service.ts @@ -108,7 +108,7 @@ export class CatalogService extends BaseService { return this.almaApi.getIntegrationProfile().pipe( mergeMap(integrationProfile => { let integrationProfileID = this.integrationProfileFactory(searchType, integrationProfile); - let body = "catp" + rawData + ""; + let body = "catp"; return this.http.post("/almaws/v1/bibs?import_profile="+integrationProfileID, body) }), mergeMap(response => { diff --git a/cloudapp/src/app/user-controls/result-card/result-card.component.html b/cloudapp/src/app/user-controls/result-card/result-card.component.html index adee077..3f57804 100644 --- a/cloudapp/src/app/user-controls/result-card/result-card.component.html +++ b/cloudapp/src/app/user-controls/result-card/result-card.component.html @@ -2,9 +2,9 @@
- {{index + 1}} + {{recordIndex + 1}}
- + {{record.getDisplayTitle()}}
@@ -18,8 +18,8 @@ more_horiz -
-
diff --git a/cloudapp/src/app/user-controls/result-card/result-card.component.ts b/cloudapp/src/app/user-controls/result-card/result-card.component.ts index df6ad66..689e834 100644 --- a/cloudapp/src/app/user-controls/result-card/result-card.component.ts +++ b/cloudapp/src/app/user-controls/result-card/result-card.component.ts @@ -11,26 +11,32 @@ import { IDisplayLinesSummary } from '../../catalog/results-types/results-common export class ResultCardComponent { - @Input() index: number; + @Input() recordIndex: number; @Input() record: IDisplayLinesSummary; @Input() resultActionList: Array = new Array(); - @Output() onActionSelected = new EventEmitter<[number, IDisplayLinesSummary]>(); - @Output() onTitleSelected = new EventEmitter(); + @Output() onActionSelected = new EventEmitter(); + @Output() onTitleSelected = new EventEmitter(); constructor() { } - onActionsClick(actionIndex: number, record: IDisplayLinesSummary) { - this.onActionSelected.emit([actionIndex, record]); + onActionsClick(recordIndex: number, actionIndex: number) { + this.onActionSelected.emit(new RecordSelection(recordIndex, actionIndex)); } - onTitleClick(record: IDisplayLinesSummary) { - this.onTitleSelected.emit(record); + onTitleClick(recordIndex: number) { + this.onTitleSelected.emit(recordIndex); } + +} - - +export class RecordSelection { + constructor ( + public recordIndex: number, + public actionIndex: number + ) { } } + diff --git a/cloudapp/src/app/user-controls/results-list/results-list.component.html b/cloudapp/src/app/user-controls/results-list/results-list.component.html index 17e1fcd..dfcc18e 100644 --- a/cloudapp/src/app/user-controls/results-list/results-list.component.html +++ b/cloudapp/src/app/user-controls/results-list/results-list.component.html @@ -3,7 +3,7 @@

{{'Catalog.Results.Title' | translate}} ({{numOfResult = new Array(); @Input() resultActionList: Array = new Array(); - @Output() onActionSelected = new EventEmitter<[number, IDisplayLinesSummary]>(); - @Output() onTitleSelected = new EventEmitter(); + @Output() onActionSelected = new EventEmitter(); + @Output() onTitleSelected = new EventEmitter(); @Output() onPageSelected = new EventEmitter(); constructor() { } - onActionsClick(selection: any) { + onActionsClick(selection: RecordSelection) { this.onActionSelected.emit(selection); } - onTitleClick(result: IDisplayLinesSummary) { - this.onTitleSelected.emit(result); + onTitleClick(recordIndex: number) { + this.onTitleSelected.emit(recordIndex); } onPageAction(pageEvent: PageEvent) { diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.html b/cloudapp/src/app/user-controls/search-form/search-form.component.html index c1caff0..90b8fa1 100644 --- a/cloudapp/src/app/user-controls/search-form/search-form.component.html +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.html @@ -1,6 +1,6 @@ {{'Catalog.Form.SelectDatabase' | translate}} - + {{ database }} diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.ts b/cloudapp/src/app/user-controls/search-form/search-form.component.ts index 084e453..9395165 100644 --- a/cloudapp/src/app/user-controls/search-form/search-form.component.ts +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.ts @@ -14,13 +14,13 @@ export class SearchFormComponent implements OnChanges { @Input() databasesList: Array = new Array(); @Input() fieldsList: Array = new Array(); @Output() selectedDatabase = new EventEmitter(); - private firstDatabase; + private defaultDatabase ; constructor() { } ngOnChanges() { - this.firstDatabase = this.databasesList[0]; - this.selectedDatabase.emit(this.firstDatabase); + this.defaultDatabase = this.databasesList[0]; + this.selectedDatabase.emit(this.defaultDatabase ); } selectDatabase(db: MatSelectChange) { From 5848239ca013b5f48313111cb2f77d2923f04f0a Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Tue, 31 Aug 2021 16:36:06 +0300 Subject: [PATCH 11/28] Updating Summary View --- .../full-view-display.component.html | 2 +- .../full-view-display.component.scss | 11 +- .../full-view-display.component.ts | 16 +- cloudapp/src/app/catalog/main/form-utils.ts | 14 +- .../src/app/catalog/main/main.component.html | 3 +- .../src/app/catalog/main/main.component.ts | 183 +++++----- .../app/catalog/results-types/monographs.ts | 324 ++++++++++------- .../src/app/catalog/results-types/name.ts | 147 ++++---- .../catalog/results-types/results-common.ts | 194 +++++++---- .../src/app/catalog/results-types/serials.ts | 329 ++++++++++-------- .../app/catalog/results-types/uniformTitle.ts | 129 ++++--- .../src/app/holdings/form/form.component.html | 24 +- .../src/app/holdings/form/form.component.scss | 6 +- cloudapp/src/app/service/catalog.service.ts | 29 +- .../result-card/result-card.component.html | 66 ++-- .../result-card/result-card.component.scss | 55 ++- .../result-card/result-card.component.ts | 15 +- .../results-list/results-list.component.html | 2 +- .../results-list/results-list.component.ts | 4 +- .../search-form/search-form.component.html | 2 +- .../search-form/search-form.component.scss | 3 + cloudapp/src/i18n/en.json | 47 +-- cloudapp/src/i18n/jp.json | 68 ++-- 23 files changed, 976 insertions(+), 697 deletions(-) diff --git a/cloudapp/src/app/catalog/full-view-display/full-view-display.component.html b/cloudapp/src/app/catalog/full-view-display/full-view-display.component.html index e6562be..d7492aa 100644 --- a/cloudapp/src/app/catalog/full-view-display/full-view-display.component.html +++ b/cloudapp/src/app/catalog/full-view-display/full-view-display.component.html @@ -8,7 +8,7 @@
{{field.getLabel()}}
- + {{field.getContent()}} diff --git a/cloudapp/src/app/catalog/full-view-display/full-view-display.component.scss b/cloudapp/src/app/catalog/full-view-display/full-view-display.component.scss index 14c4364..e5909c6 100644 --- a/cloudapp/src/app/catalog/full-view-display/full-view-display.component.scss +++ b/cloudapp/src/app/catalog/full-view-display/full-view-display.component.scss @@ -15,6 +15,7 @@ .full-view-line-header { font-weight: bold; padding-right: 15px; + padding-left: 5px; } .full-view-line-content { @@ -22,16 +23,16 @@ flex-wrap: wrap; } -.full-view-line-field-label { - font-weight: bold; - padding-right: 5px; -} - .full-view-line-field { display: flex; padding-right: 10px; } +.full-view-line-field-label { + font-weight: bold; + padding-right: 5px; +} + a, a label { cursor: pointer; diff --git a/cloudapp/src/app/catalog/full-view-display/full-view-display.component.ts b/cloudapp/src/app/catalog/full-view-display/full-view-display.component.ts index 7e5f7e6..02c0af1 100644 --- a/cloudapp/src/app/catalog/full-view-display/full-view-display.component.ts +++ b/cloudapp/src/app/catalog/full-view-display/full-view-display.component.ts @@ -1,4 +1,5 @@ import { Component, Input, Output, EventEmitter } from '@angular/core'; +import { SearchType } from '../main/form-utils'; @Component({ @@ -10,20 +11,27 @@ import { Component, Input, Output, EventEmitter } from '@angular/core'; export class FullviewDisplayComponent { @Input() resultFullDisplay; - @Output() onFullViewLinkSelected = new EventEmitter(); + @Output() onFullViewLinkSelected = new EventEmitter(); constructor() { } - onFullViewLink() { - this.onFullViewLinkSelected.emit("searchType"); + onFullViewLink(searchType: SearchType, linkID: string) { + this.onFullViewLinkSelected.emit(new FullViewLink(searchType, linkID)); } isEvenRow(i: number) { if (i % 2 == 0) { return "even"; } - } + } + +export class FullViewLink { + constructor ( + public searchType: SearchType, + public linkID: string + ) { } +} \ No newline at end of file diff --git a/cloudapp/src/app/catalog/main/form-utils.ts b/cloudapp/src/app/catalog/main/form-utils.ts index 3d410ce..0540c3c 100644 --- a/cloudapp/src/app/catalog/main/form-utils.ts +++ b/cloudapp/src/app/catalog/main/form-utils.ts @@ -19,7 +19,7 @@ export class SearchField { } getFieldLabel(): string { - this.fieldLabel = "Catalog.Form.Fields." + this.key; + this.fieldLabel = "UserControls.Fields." + this.key; return this.fieldLabel; } @@ -45,14 +45,16 @@ export enum SearchType { Monographs = "Monographs", Serials = "Serials", Names = "Names", - UniformTitles = "UniformTitles" + UniformTitles = "UniformTitles", + Member = "Member" } export enum QueryParams { - fromIndex = "fromIndex", - toIndex = "toIndex", - searchType = "searchType", - databases = "dataBase" + PageIndex = "pageIndex", + PageSize = "pageSize", + SearchType = "searchType", + Databases = "dataBase", + ID = "ID" } export enum FieldSize { diff --git a/cloudapp/src/app/catalog/main/main.component.html b/cloudapp/src/app/catalog/main/main.component.html index 7415473..c1a95d2 100644 --- a/cloudapp/src/app/catalog/main/main.component.html +++ b/cloudapp/src/app/catalog/main/main.component.html @@ -56,6 +56,7 @@

{{'Catalog.Results.NoRecordsExist' | translate}}

+


@@ -79,7 +80,7 @@

{{'Catalog.Results.NoRecordsExist' | translate}}

- +
diff --git a/cloudapp/src/app/catalog/main/main.component.ts b/cloudapp/src/app/catalog/main/main.component.ts index fc16bb7..0953103 100644 --- a/cloudapp/src/app/catalog/main/main.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -7,7 +7,7 @@ import { TranslateService } from '@ngx-translate/core'; import { Router } from '@angular/router'; import { PageEvent } from '@angular/material/paginator'; -import { IDisplayLinesSummary, NacsisCatalogResults, BaseResult, IDisplayLinesFull } from '../results-types/results-common' +import { NacsisCatalogResults, BaseResult, IDisplayLines } from '../results-types/results-common' import { MonographSummaryDisplay, MonographFullDisplay } from '../results-types/monographs' import { SerialSummaryDisplay, SerialFullDisplay } from '../results-types/serials'; import { NameSummaryDisplay, NameFullDisplay } from '../results-types/name'; @@ -15,6 +15,7 @@ import { UniformTitleFullDisplay, UniformTitleSummaryDisplay } from '../results- import { HoldingsService } from '../../service/holdings.service'; import { AppRoutingState, ROUTING_STATE_KEY } from '../../service/base.service'; import { RecordSelection } from '../../user-controls/result-card/result-card.component'; +import { FullViewLink } from '../full-view-display/full-view-display.component'; @@ -49,17 +50,20 @@ export class CatalogMainComponent implements AfterViewInit { // UI variables private panelState: boolean = true; private loading: boolean = false; + isRightTableOpen: boolean = false; + isColapsedMode: boolean = true; - // Data variables + // Search variables private urlParams: string = ""; private catalogResultsData: NacsisCatalogResults; private numOfResults: number; - private resultsSummaryDisplay: Array; - private resultFullDisplay; - private fromIndex: number = 1; - private toIndex: number = 20; - + private pageIndex: number = 0; + private pageSize: number = 20; + // Display variables + private resultsSummaryDisplay: Array; + private resultFullDisplay; + private resultFullLinkDisplay; // Templates @ViewChild('notSearched') notSearchedTmpl:TemplateRef; @@ -68,9 +72,6 @@ export class CatalogMainComponent implements AfterViewInit { @ViewChild('fullRecord') fullRecordTmpl:TemplateRef; private currentResulsTmpl: TemplateRef; - isRightTableOpen: boolean = false; - isColapsedMode: boolean = true; - constructor( private catalogService: CatalogService, @@ -90,7 +91,7 @@ export class CatalogMainComponent implements AfterViewInit { } - // Search Form Section + /*** Search Form Section ***/ getSearchTypesLabels(): Array{ let searchTypeMap = new Array(); @@ -112,17 +113,6 @@ export class CatalogMainComponent implements AfterViewInit { return this.allFieldsMap.get(this.currentSearchType); } - onTabChange(event: MatTabChangeEvent){ - this.currentSearchType = this.SEARCH_TYPE_ARRAY[event.index]; - this.currentDatabase = this.getCurrentDatabases()[0]; - if(this.catalogService.getSearchResults(this.currentSearchType).getResults() != null){ - this.setSearchResultsDisplay(); - } else { - this.currentResulsTmpl = this.notSearchedTmpl; - this.panelState = true; - } - } - clear() { this.allFieldsMap.get(this.currentSearchType).forEach(searchField => { searchField.getFormControl().setValue(null) @@ -137,47 +127,66 @@ export class CatalogMainComponent implements AfterViewInit { this.panelState = false; } - generateUrl() { + onTabChange(event: MatTabChangeEvent){ + this.currentSearchType = this.SEARCH_TYPE_ARRAY[event.index]; + this.currentDatabase = this.getCurrentDatabases()[0]; + if(this.catalogService.getSearchResults(this.currentSearchType).getResults() != null){ + this.setSearchResultsDisplay(); + this.resultsTemplateFactory(); + } else { + this.currentResulsTmpl = this.notSearchedTmpl; + this.panelState = true; + } + this.isRightTableOpen = false; + } + + search() { + // Generating the URL by the fields' Form Control this.urlParams = ""; - this.urlParams = this.urlParams + this.getPaginationIndex(); - this.urlParams = this.urlParams + "&" + QueryParams.searchType + "=" + this.currentSearchType; - this.urlParams = this.urlParams + "&" + QueryParams.databases + "=" + this.currentDatabase; let valuableFields = this.allFieldsMap.get(this.currentSearchType).filter(field => field.getFormControl().value !== null); if (valuableFields.length > 0){ + this.urlParams = this.urlParams + this.getPaginationIndex(); + this.urlParams = this.urlParams + "&" + QueryParams.SearchType + "=" + this.currentSearchType; + this.urlParams = this.urlParams + "&" + QueryParams.Databases + "=" + this.currentDatabase; valuableFields.forEach(field => { this.urlParams = this.urlParams + "&" + field.getKey(); this.urlParams = this.urlParams + "=" + field.getFormControl().value; }); + this.getResultsFromNacsis(false); } else { - this.urlParams = ""; + return; } } - - - search() { - this.generateUrl(); - if(this.urlParams == ""){ - this.alert.error(this.translate.instant('Catalog.Form.EmptyForm'), {keepAfterRouteChange:true}); - return; - } - + // Calling Nacsis servlet + getResultsFromNacsis(isFullViewLink: boolean) { this.loading = true; try{ this.catalogService.getSearchResultsFromNacsis(this.urlParams, this.currentSearchType) .subscribe({ next: (catalogResults) => { if (catalogResults.status === this.catalogService.OkStatus) { - this.setSearchResultsDisplay(); + if(!isFullViewLink) { + if (catalogResults.totalRecords >= 1) { + this.catalogService.setSearchResultsMap(this.currentSearchType, catalogResults) + this.setSearchResultsDisplay(); + } else { + this.numOfResults = 0; + } + this.resultsTemplateFactory(); + } else { + let baseResult = this.catalogService.resultsTypeFactory(this.currentSearchType, catalogResults.records[0]); + this.resultFullLinkDisplay = baseResult.getFullViewDisplay().initContentDisplay(); + } } else { this.alert.error(catalogResults.errorMessage, {keepAfterRouteChange:true}); } }, - error: e => { + error: e => { this.loading = false; console.log(e.message); this.alert.error(e.message, {keepAfterRouteChange:true}); - }, - complete: () => this.loading = false + }, + complete: () => this.loading = false }); } catch (e) { this.loading = false; @@ -186,57 +195,41 @@ export class CatalogMainComponent implements AfterViewInit { } } + resultsTemplateFactory() { + if(this.numOfResults > 0){ + this.currentResulsTmpl = this.searchResultsTmpl; + } else if(this.numOfResults == 0 || this.numOfResults == null) { + this.currentResulsTmpl = this.noResultsTmpl; + } else { + this.currentResulsTmpl = this.notSearchedTmpl; + } + } + - // Summary View Section + /*** Summary View Section ***/ private setSearchResultsDisplay(){ this.catalogResultsData = this.catalogService.getSearchResults(this.currentSearchType); this.numOfResults = this.catalogResultsData.getHeader().totalRecords; this.resultsSummaryDisplay = new Array(); this.catalogResultsData.getResults()?.forEach(result=>{ - this.resultsSummaryDisplay.push(this.summaryDisplayFactory(this.translate, result)); + this.resultsSummaryDisplay.push(result.getSummaryDisplay()); }); - this.resultsTemplateFactory(); this.panelState = false; } - summaryDisplayFactory(translate: TranslateService, record: BaseResult){ - switch (this.currentSearchType) { - case SearchType.Monographs: - return new MonographSummaryDisplay(translate, record); - case SearchType.Serials: - return new SerialSummaryDisplay(translate, record); - case SearchType.Names: - return new NameSummaryDisplay(translate, record); - case SearchType.UniformTitles: - return new UniformTitleSummaryDisplay(translate, record); - default: - return null; - } - } - - resultsTemplateFactory() { - if(this.numOfResults > 0){ - this.currentResulsTmpl = this.searchResultsTmpl; - } else if(this.numOfResults == 0 || this.numOfResults == null) { - this.currentResulsTmpl = this.noResultsTmpl; - } else { - this.currentResulsTmpl = this.notSearchedTmpl; - } - } - onActionsClick(selection: RecordSelection) { let record = this.resultsSummaryDisplay[selection.recordIndex]; switch (selection.actionIndex) { case 0: // Full view this.currentResulsTmpl = this.fullRecordTmpl; - this.resultFullDisplay = this.fullDisplayFactory(record.getFullRecordData()).initContentDisplay(); + this.resultFullDisplay = record.getFullRecordData().getFullViewDisplay().initContentDisplay(); break; case 1: // Import the record this.onImportRecord(record.getFullRecordData().getRawData()); break; case 2: // View Holdings - this.onViewHoldings(record.getFullRecordData().getID(), record.getDisplayTitle()); + this.onViewHoldings(record.getFullRecordData().getID(), record.initTitleDisplay().toString()); break; default: { this.currentResulsTmpl = this.noResultsTmpl; @@ -246,42 +239,36 @@ export class CatalogMainComponent implements AfterViewInit { } onTitleClick(recordIndex: number) { - // Opening the full view + // Clicking on title will open the full view let record = this.resultsSummaryDisplay[recordIndex]; this.currentResulsTmpl = this.fullRecordTmpl; - this.resultFullDisplay = this.fullDisplayFactory(record.getFullRecordData()).initContentDisplay(); + this.resultFullDisplay = record.getFullRecordData().getFullViewDisplay().initContentDisplay(); } - // Full View Section - - fullDisplayFactory(record: BaseResult){ - switch (this.currentSearchType) { - case SearchType.Monographs: - return new MonographFullDisplay(record.getFullView()); - case SearchType.Serials: - return new SerialFullDisplay(record.getFullView()); - case SearchType.Names: - return new NameFullDisplay(record.getFullView()); - case SearchType.UniformTitles: - return new UniformTitleFullDisplay(record.getFullView()); - default: - return null; - } - } + /*** Full View Section ***/ onBackFromFullView() { this.currentResulsTmpl = this.searchResultsTmpl; this.isRightTableOpen = false; } - onFullViewLink(searchType?: string) { + onFullViewLink(fullViewLink: FullViewLink) { + this.urlParams = ""; + this.urlParams = this.urlParams + this.getPaginationIndex(); + this.urlParams = this.urlParams + "&" + QueryParams.SearchType + "=" + fullViewLink.searchType; + this.urlParams = this.urlParams + "&" + QueryParams.Databases + "=" + this.ALL_DATABASES_MAP.get(fullViewLink.searchType)[0]; + this.urlParams = this.urlParams + "&" + QueryParams.ID + "=" + fullViewLink.linkID; + + this.getResultsFromNacsis(true); this.isRightTableOpen = true; this.isColapsedMode = (window.innerWidth <= 600) ? true : false; + } onFullViewLinkClose() { this.isRightTableOpen = false; + this.resultFullLinkDisplay = null; } onResize(event) { @@ -289,11 +276,10 @@ export class CatalogMainComponent implements AfterViewInit { } - // View Holdings + /*** View Holdings ***/ onViewHoldings(nacsisId: string, title: string) { this.loading = true; - title = "Harry Potter" try { this.holdingsService.getHoldingsFromNacsis(nacsisId, "Mine") .subscribe({ @@ -319,15 +305,16 @@ export class CatalogMainComponent implements AfterViewInit { } } - // Import + /*** Import ***/ onImportRecord(rawData: string) { this.loading = true; try { this.catalogService.importRecordToAlma(this.currentSearchType, rawData) .subscribe({ - next: (warnings) => { - let x = 7; + next: (importedRecord) => { + let mmsIdText = " (" + importedRecord.mms_id + ")"; + this.alert.success(this.translate.instant('Catalog.Results.ImportSucceeded') + mmsIdText, {autoClose: false, keepAfterRouteChange:true}); }, error: e => { this.loading = false; @@ -344,15 +331,15 @@ export class CatalogMainComponent implements AfterViewInit { } - // Pagination + /*** Pagination ***/ getPaginationIndex() { - return QueryParams.fromIndex + "=" + this.fromIndex + "&" + QueryParams.toIndex + "=" + this.toIndex; + return QueryParams.PageIndex + "=" + this.pageIndex + "&" + QueryParams.PageSize + "=" + this.pageSize; } onPageAction(pageEvent: PageEvent) { - this.fromIndex = (pageEvent.pageIndex*20) + 1; - this.toIndex = (pageEvent.pageIndex+1) * 20; + this.pageIndex = pageEvent.pageIndex; + this.pageSize = pageEvent.pageSize; this.search(); } diff --git a/cloudapp/src/app/catalog/results-types/monographs.ts b/cloudapp/src/app/catalog/results-types/monographs.ts index 3814495..ab7103d 100644 --- a/cloudapp/src/app/catalog/results-types/monographs.ts +++ b/cloudapp/src/app/catalog/results-types/monographs.ts @@ -1,25 +1,39 @@ import { TranslateService } from '@ngx-translate/core'; -import { IDisplayLinesSummary, BaseResult, FullViewField, IDisplayLinesFull, FullViewLine, FieldBuilder } from './results-common'; +import { IDisplayLines, BaseResult, ViewField, ViewLine, ViewFieldBuilder, BLANK_SPACE } from './results-common'; +import { SearchType } from '../main/form-utils'; export class Monograph extends BaseResult{ summaryView: MonographSummary; fullView : MonographFull; - constructor(record: any){ - super(record); + constructor(record: any, translate: TranslateService){ + super(record, translate); + } + + getSummaryDisplay() { + return new MonographSummaryDisplay(this.translate, this); + } + + getFullViewDisplay() { + return new MonographFullDisplay(this); } } export class MonographSummary{ - TITLE: string = ""; - AUTH: string = ""; + TRD: string = ""; + AL: MonographAL[]; PUBL: string = ""; - LANG: string = ""; - YEAR: string = ""; + TTLL: string = ""; + YEAR1: string = ""; + YEAR2: string = ""; + TRR: string = ""; + TRVR: string = ""; ID: string = ""; ISBN: string = ""; - SH: string = ""; + hasMoreThen1ISBN: boolean; + SH: MonographSH[]; + hasMoreThen3SH: Boolean; } export class MonographFull{ @@ -37,7 +51,8 @@ export class MonographFull{ OTHN: string = ""; GMD: string = ""; SMD: string = ""; - YEAR: string = ""; + YEAR1: string = ""; + YEAR2: string = ""; CNTRY: string = ""; TTLL: string = ""; TXTL: string = ""; @@ -74,6 +89,7 @@ export class MonographVOLG{ export class MonographPUB{ PUBP: string = ""; PUBL: string = ""; + PUBDT: string = ""; } export class MonographVT{ @@ -138,174 +154,214 @@ export class MonographIDENT{ IDENT: string = ""; } -export class MonographSummaryDisplay implements IDisplayLinesSummary{ - private fullRecordData: Monograph; +export class MonographSummaryDisplay extends IDisplayLines{ private record: MonographSummary; constructor( private translate: TranslateService, fullRecordData: Monograph ) { - this.fullRecordData = fullRecordData; - this.record = this.fullRecordData.getSummaryView(); + super(fullRecordData); + this.record = fullRecordData.getSummaryView(); } - getDisplayTitle(): string { - return this.record.TITLE; + initTitleDisplay(): ViewLine { + let fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.TRD).build()); + this.titleLine = new ViewLine(new ViewFieldBuilder().build(), fieldsArray); + return this.titleLine; } - initContentDisplay(): Array { - let summaryLines = new Array(); + initContentDisplay(): Array { + this.viewLines = new Array(); + let fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.By').content(this.record.AL[0]?.AHDNG).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.AL[0]?.AHDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.AL[0]?.AHDNGVR).build()); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.Book').build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PUBL).build()); + fieldsArray.push(new ViewFieldBuilder().label(", ").content(this.record.TTLL).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(this.record.YEAR1).build()); + fieldsArray.push(new ViewFieldBuilder().label("- ").content(this.record.YEAR2).build()); + fieldsArray.push(new ViewFieldBuilder().label(")").build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.TRR).link('').build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.TRVR).link('').build()); + fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.NACSISID').content(this.record.ID).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.ISBN').content(this.record.ISBN).build()); + if(this.record.hasMoreThen1ISBN){ + fieldsArray.push(new ViewFieldBuilder().content(('Catalog.Results.AndOthers')).build()); + } + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + let shStrFields = ""; + for (let i = 0; i < this.record.SH.length-1; i++) { + shStrFields = shStrFields + this.toStringPairOfFields(this.record.SH[i].SHD, this.record.SH[i].SHR, "||"); + shStrFields = shStrFields + "
"; + } + if (this.record.SH.length > 0) { + let j = this.record.SH.length - 1; + shStrFields = shStrFields + this.toStringPairOfFields(this.record.SH[j].SHD, this.record.SH[j].SHR, "||"); + if(this.record.hasMoreThen3SH) { + shStrFields = shStrFields + " " + this.translate.instant('Catalog.Results.AndOthers'); + } + } + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.Subjects').content(shStrFields).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); - summaryLines.push(this.translate.instant('Catalog.Results.By') + " " + this.record.AUTH + " (" - + this.translate.instant("Catalog.Results.Book") + " " + this.record.PUBL - + ", " + this.record.LANG + ": " + this.record.YEAR + ")"); - summaryLines.push( this.translate.instant("Catalog.Results.NACSISID") + ": " + this.record.ID); - summaryLines.push( this.translate.instant("Catalog.Results.ISBN") + ": " + this.record.ISBN); - summaryLines.push( this.translate.instant("Catalog.Results.Subjects") + ": " + this.record.SH); - - return summaryLines; + return this.viewLines; } - getFullRecordData() { - return this.fullRecordData; - } } -export class MonographFullDisplay extends IDisplayLinesFull { +export class MonographFullDisplay extends IDisplayLines { + private record: MonographFull; - constructor(fullViewRecord: MonographFull) { + constructor(fullViewRecord: Monograph) { super(fullViewRecord); + this.record = fullViewRecord.getFullView(); } initContentDisplay(){ - this.fullViewLines = new Array(); - let fieldArray = new Array() - fieldArray.push(new FieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); - fieldArray.push(new FieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link('').build()); - fieldArray.push(new FieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); - fieldArray.push(new FieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link('').build()); - this.addLine(new FieldBuilder().build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().label("ISSN: ").content(this.record.ISSN).build()); - fieldArray.push(new FieldBuilder().label("NBN: ").content(this.record.NBN).build()); - fieldArray.push(new FieldBuilder().label("LCCN: ").content(this.record.LCCN).build()); - fieldArray.push(new FieldBuilder().label("NDLCN: ").content(this.record.NDLCN).build()); - fieldArray.push(new FieldBuilder().label("REPRO: ").content(this.record.REPRO).build()); - fieldArray.push(new FieldBuilder().label("GPON: ").content(this.record.GPON).build()); - fieldArray.push(new FieldBuilder().label("OTHN: ").content(this.record.OTHN).build()); - this.addLine(new FieldBuilder().label("CODE").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().label("GMD: ").content(this.record.GMD).build()); - fieldArray.push(new FieldBuilder().label("SMD: ").content(this.record.SMD).build()); - fieldArray.push(new FieldBuilder().label("YEAR: ").content(this.record.YEAR).build()); - fieldArray.push(new FieldBuilder().label("CNTRY: ").content(this.record.CNTRY).build()); - fieldArray.push(new FieldBuilder().label("TTLL: ").content(this.record.TTLL).build()); - fieldArray.push(new FieldBuilder().label("TXTL: ").content(this.record.TXTL).build()); - fieldArray.push(new FieldBuilder().label("ORGL: ").content(this.record.ORGL).build()); - this.addLine(new FieldBuilder().label("CODE").build(), fieldArray); + this.viewLines = new Array(); + let fieldsArray = new Array() + fieldsArray = new Array() + fieldsArray.push(new ViewFieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); + fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); + fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label("ISSN: ").content(this.record.ISSN).build()); + fieldsArray.push(new ViewFieldBuilder().label("NBN: ").content(this.record.NBN).build()); + fieldsArray.push(new ViewFieldBuilder().label("LCCN: ").content(this.record.LCCN).build()); + fieldsArray.push(new ViewFieldBuilder().label("NDLCN: ").content(this.record.NDLCN).build()); + fieldsArray.push(new ViewFieldBuilder().label("REPRO: ").content(this.record.REPRO).build()); + fieldsArray.push(new ViewFieldBuilder().label("GPON: ").content(this.record.GPON).build()); + fieldsArray.push(new ViewFieldBuilder().label("OTHN: ").content(this.record.OTHN).build()); + this.addLine(new ViewFieldBuilder().label("CODE").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label("GMD: ").content(this.record.GMD).build()); + fieldsArray.push(new ViewFieldBuilder().label("SMD: ").content(this.record.SMD).build()); + fieldsArray.push(new ViewFieldBuilder().label("YEAR: ").content(this.record.YEAR1).build()); + fieldsArray.push(new ViewFieldBuilder().label("- ").content(this.record.YEAR2).build()); + fieldsArray.push(new ViewFieldBuilder().label("CNTRY: ").content(this.record.CNTRY).build()); + fieldsArray.push(new ViewFieldBuilder().label("TTLL: ").content(this.record.TTLL).build()); + fieldsArray.push(new ViewFieldBuilder().label("TXTL: ").content(this.record.TXTL).build()); + fieldsArray.push(new ViewFieldBuilder().label("ORGL: ").content(this.record.ORGL).build()); + this.addLine(new ViewFieldBuilder().label("CODE").build(), fieldsArray); this.record.VOLG?.forEach(vol=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().label("VOL: ").content(vol.VOL).build()); - fieldArray.push(new FieldBuilder().label("ISBN: ").content(vol.ISBN).build()); - fieldArray.push(new FieldBuilder().label("PRICE: ").content(vol.PRICE).build()); - fieldArray.push(new FieldBuilder().label("XISBN: ").content(vol.XISBN).build()); - this.addLine(new FieldBuilder().label("VOLG").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label("VOL: ").content(vol.VOL).build()); + fieldsArray.push(new ViewFieldBuilder().label("ISBN: ").content(vol.ISBN).build()); + fieldsArray.push(new ViewFieldBuilder().label("PRICE: ").content(vol.PRICE).build()); + fieldsArray.push(new ViewFieldBuilder().label("XISBN: ").content(vol.XISBN).build()); + this.addLine(new ViewFieldBuilder().label("VOLG").build(), fieldsArray); }); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.TRD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(this.record.TRR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(this.record.TRVR).build()); - this.addLine(new FieldBuilder().label("TR").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.ED).build()); - this.addLine(new FieldBuilder().label("ED").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.TRD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.TRR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.TRVR).build()); + this.addLine(new ViewFieldBuilder().label("TR").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.ED).build()); + this.addLine(new ViewFieldBuilder().label("ED").build(), fieldsArray); this.record.PUB?.forEach(pub=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(pub.PUBP).build()); - fieldArray.push(new FieldBuilder().label(": ").content(pub.PUBL).build()); - fieldArray.push(new FieldBuilder().label(", ").content(pub.PUBDT).build()); - this.addLine(new FieldBuilder().label("PUB").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(pub.PUBP).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(pub.PUBL).build()); + fieldsArray.push(new ViewFieldBuilder().label(", ").content(pub.PUBDT).build()); + this.addLine(new ViewFieldBuilder().label("PUB").build(), fieldsArray); }); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.PHYSP).build()); - fieldArray.push(new FieldBuilder().label("; ").content(this.record.PHYSI).build()); - fieldArray.push(new FieldBuilder().label("; ").content(this.record.PHYSS).build()); - fieldArray.push(new FieldBuilder().label("+").content(this.record.PHYSA).build()); - this.addLine(new FieldBuilder().label("PHYS").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSP).build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSI).build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSS).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, ";"); + fieldsArray.push(new ViewFieldBuilder().label("+").content(this.record.PHYSA).build()); + this.addLine(new ViewFieldBuilder().label("PHYS").build(), fieldsArray); this.record.VT?.forEach(vt=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(vt.VTK).build()); - fieldArray.push(new FieldBuilder().label(": ").content(vt.VTD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(vt.VTR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(vt.VTVR).build()); - this.addLine(new FieldBuilder().label("VT").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(vt.VTK).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(vt.VTD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(vt.VTR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(vt.VTVR).build()); + this.addLine(new ViewFieldBuilder().label("VT").build(), fieldsArray); }); this.record.CW?.forEach(cw=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(cw.CWT).build()); - fieldArray.push(new FieldBuilder().label("/ ").content(cw.CWA).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(cw.CWR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(cw.CWVR).build()); - this.addLine(new FieldBuilder().label("CW").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(cw.CWT).build()); + fieldsArray.push(new ViewFieldBuilder().label("/ ").content(cw.CWA).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(cw.CWR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(cw.CWVR).build()); + this.addLine(new ViewFieldBuilder().label("CW").build(), fieldsArray); }); this.record.NOTE?.forEach(note=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(note.NOTE).build()); - this.addLine(new FieldBuilder().label("NOTE").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(note.NOTE).build()); + this.addLine(new ViewFieldBuilder().label("NOTE").build(), fieldsArray); }); this.record.PTBL?.forEach(ptbl=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(ptbl.PTBTR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(ptbl.PTBTRR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(ptbl.PTBTRVR).build()); - fieldArray.push(new FieldBuilder().content(ptbl.PTBID).link('').build()); - fieldArray.push(new FieldBuilder().content(ptbl.PTBNO).build()); - fieldArray.push(new FieldBuilder().label("// ").content(ptbl.PTBK).build()); - this.addLine(new FieldBuilder().label("PTBL").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBTR).build()); + fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBTRR).build()); + fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBTRVR).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBID).link(SearchType.Monographs).build()); + fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBNO).build()); + fieldsArray.push(new ViewFieldBuilder().label("// ").content(ptbl.PTBK).build()); + this.addLine(new ViewFieldBuilder().label("PTBL").build(), fieldsArray); }); this.record.AL?.forEach(al=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(al.AFLG).build()); - fieldArray.push(new FieldBuilder().content(al.AHDNG).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(al.AHDNGR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(al.AHDNGVR).build()); - fieldArray.push(new FieldBuilder().content(al.AID).link('').build()); - fieldArray.push(new FieldBuilder().content(al.AF).build()); - this.addLine(new FieldBuilder().label("AL").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(al.AFLG).build()); + fieldsArray.push(new ViewFieldBuilder().content(al.AHDNG).build()); + fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGVR).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray.push(new ViewFieldBuilder().content(al.AID).link(SearchType.Names).build()); + fieldsArray.push(new ViewFieldBuilder().content(al.AF).build()); + this.addLine(new ViewFieldBuilder().label("AL").build(), fieldsArray); }); this.record.UTL?.forEach(utl=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(utl.UTFLG).build()); - fieldArray.push(new FieldBuilder().content(utl.UTHDNG).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(utl.UTHDNGR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(utl.UTHDNGVR).build()); - fieldArray.push(new FieldBuilder().content(utl.UTID).build()); - fieldArray.push(new FieldBuilder().content(utl.UTINFO).build()); - this.addLine(new FieldBuilder().label("UTL").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(utl.UTFLG).build()); + fieldsArray.push(new ViewFieldBuilder().content(utl.UTHDNG).build()); + fieldsArray.push(new ViewFieldBuilder().content(utl.UTHDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().content(utl.UTHDNGVR).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray.push(new ViewFieldBuilder().content(utl.UTID).build()); + fieldsArray.push(new ViewFieldBuilder().content(utl.UTINFO).build()); + this.addLine(new ViewFieldBuilder().label("UTL").build(), fieldsArray); }); this.record.CLS?.forEach(cls=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(cls.CLSK).build()); - fieldArray.push(new FieldBuilder().label(": ").content(cls.CLSD).build()); - this.addLine(new FieldBuilder().label("CLS").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(cls.CLSK).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(cls.CLSD).build()); + this.addLine(new ViewFieldBuilder().label("CLS").build(), fieldsArray); }); this.record.SH?.forEach(sh=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(sh.SHT).build()); - fieldArray.push(new FieldBuilder().label(": ").content(sh.SHD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(sh.SHR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(sh.SHVR).build()); - fieldArray.push(new FieldBuilder().label("// ").content(sh.SHK).build()); - this.addLine(new FieldBuilder().label("SH").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(sh.SHT).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(sh.SHD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(sh.SHR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(sh.SHVR).build()); + fieldsArray.push(new ViewFieldBuilder().label("// ").content(sh.SHK).build()); + this.addLine(new ViewFieldBuilder().label("SH").build(), fieldsArray); }); this.record.IDENT?.forEach(ident=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(ident.IDENT).build()); - this.addLine(new FieldBuilder().label("IDENT").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(ident.IDENT).build()); + this.addLine(new ViewFieldBuilder().label("IDENT").build(), fieldsArray); }); - return this.fullViewLines; + return this.viewLines; } diff --git a/cloudapp/src/app/catalog/results-types/name.ts b/cloudapp/src/app/catalog/results-types/name.ts index 08617bc..71e5542 100644 --- a/cloudapp/src/app/catalog/results-types/name.ts +++ b/cloudapp/src/app/catalog/results-types/name.ts @@ -1,19 +1,29 @@ import { TranslateService } from '@ngx-translate/core'; -import { IDisplayLinesSummary, BaseResult, IDisplayLinesFull, FullViewField, FullViewLine, FieldBuilder } from './results-common'; +import { IDisplayLines, BaseResult, ViewField, ViewLine, ViewFieldBuilder } from './results-common'; +import { SearchType } from '../main/form-utils'; export class Name extends BaseResult { summaryView: NameSummary; fullView : NameFull; - constructor(record: any){ - super(record); + constructor(record: any, translate: TranslateService){ + super(record, translate); + } + + getSummaryDisplay() { + return new NameSummaryDisplay(this.translate, this); + } + + getFullViewDisplay() { + return new NameFullDisplay(this); } } export class NameSummary{ - AUTH: string = ""; - DATE: string = ""; + HDNGD: string = ""; + HDNGR: string = ""; + HDNGVR: string = ""; ID: string = ""; } @@ -52,86 +62,95 @@ export class NameNOTE{ NOTE: string = ""; } -export class NameSummaryDisplay implements IDisplayLinesSummary{ - private fullRecordData: Name; + +export class NameSummaryDisplay extends IDisplayLines{ private record: NameSummary; constructor( private translate: TranslateService, - fullRecordData: Name){ - this.fullRecordData = fullRecordData; - this.record = this.fullRecordData.getSummaryView(); - } + fullRecordData: Name + ) { + super(fullRecordData); + this.record = fullRecordData.getSummaryView(); + } - getDisplayTitle(): string { - let title = this.record.AUTH + "; " + this.record.DATE; - return title; + initTitleDisplay(): ViewLine { + let fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNGD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + this.titleLine = new ViewLine(new ViewFieldBuilder().build(), fieldsArray.filter(field => field.hasContent() === true)); + return this.titleLine; } - initContentDisplay(): Array { - let summaryLines = new Array(); - summaryLines.push( this.translate.instant("Catalog.Results.NACSISID") + ": " + this.record.ID); - return summaryLines; + initContentDisplay(): Array { + this.viewLines = new Array(); + let fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.NACSISID').content(this.record.ID).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + + return this.viewLines; } - getFullRecordData() { - return this.fullRecordData; - } } -export class NameFullDisplay extends IDisplayLinesFull { +export class NameFullDisplay extends IDisplayLines { + private record: NameFull; - constructor(fullViewRecord: NameFull) { - super(fullViewRecord); - } + constructor(fullViewRecord: Name) { + super(fullViewRecord); + this.record = fullViewRecord.getFullView(); + } initContentDisplay(){ - this.fullViewLines = new Array(); - let fieldArray = new Array() - fieldArray.push(new FieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); - fieldArray.push(new FieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link('').build()); - fieldArray.push(new FieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); - fieldArray.push(new FieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link('').build()); - this.addLine(new FieldBuilder().build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.HDNGD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(this.record.HDNGR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(this.record.HDNGVR).build()); - this.addLine(new FieldBuilder().label("HDNG").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.LCAID).build()); - this.addLine(new FieldBuilder().label("LCAID").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.TYPE).build()); - this.addLine(new FieldBuilder().label("TYPE").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.PLACE).build()); - this.addLine(new FieldBuilder().label("PLACE").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.YEAR).build()); - this.addLine(new FieldBuilder().label("DATE").build(), fieldArray); + this.viewLines = new Array(); + let fieldsArray = new Array() + fieldsArray.push(new ViewFieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); + fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); + fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNGD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + this.addLine(new ViewFieldBuilder().label("HDNG").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.LCAID).build()); + this.addLine(new ViewFieldBuilder().label("LCAID").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.TYPE).build()); + this.addLine(new ViewFieldBuilder().label("TYPE").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PLACE).build()); + this.addLine(new ViewFieldBuilder().label("PLACE").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.YEAR).build()); + this.addLine(new ViewFieldBuilder().label("DATE").build(), fieldsArray); this.record.SF?.forEach(sf=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(sf.SFD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(sf.SFR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(sf.SFVR).build()); - this.addLine(new FieldBuilder().label("SF").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(sf.SFD).build()); + fieldsArray.push(new ViewFieldBuilder().content(sf.SFR).build()); + fieldsArray.push(new ViewFieldBuilder().content(sf.SFVR).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + this.addLine(new ViewFieldBuilder().label("SF").build(), fieldsArray); }); this.record.SAF?.forEach(saf=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(saf.SAFD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFVR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFID).link('').build()); - this.addLine(new FieldBuilder().label("SAF").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(saf.SAFD).build()); + fieldsArray.push(new ViewFieldBuilder().content(saf.SAFR).build()); + fieldsArray.push(new ViewFieldBuilder().content(saf.SAFVR).build()); + fieldsArray.push(new ViewFieldBuilder().content(saf.SAFID).link(SearchType.Names).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + this.addLine(new ViewFieldBuilder().label("SAF").build(), fieldsArray); }); this.record.NOTE?.forEach(note=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(note.NOTE).build()); - this.addLine(new FieldBuilder().label("NOTE").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(note.NOTE).build()); + this.addLine(new ViewFieldBuilder().label("NOTE").build(), fieldsArray); }); - return this.fullViewLines; + return this.viewLines; } diff --git a/cloudapp/src/app/catalog/results-types/results-common.ts b/cloudapp/src/app/catalog/results-types/results-common.ts index 21c73cc..bc4454b 100644 --- a/cloudapp/src/app/catalog/results-types/results-common.ts +++ b/cloudapp/src/app/catalog/results-types/results-common.ts @@ -1,41 +1,10 @@ +import { TranslateService } from '@ngx-translate/core'; import { SearchType } from "../main/form-utils"; import { Header } from "../../service/base.service"; -export interface IDisplayLinesSummary { - getDisplayTitle(): string; - initContentDisplay(): Array; - getFullRecordData() : BaseResult; -} - - -export abstract class IDisplayLinesFull { - protected record: any; - protected fullViewLines: Array; - - constructor(fullViewRecord: any) { - this.record = fullViewRecord; - } - - initContentDisplay(){}; - - protected addLine(header: FullViewField, content: Array){ - let filteredArray = content.filter(field => field.hasContent() === true); - if(filteredArray.length > 0){ - this.fullViewLines.push(new FullViewLine(header, filteredArray)); - } - } - - protected dateFormatDisplay(field: string) { - if(field != "" && field != undefined){ - return field.substring(0,4) + "/" + field.substring(4,6) + "/" + field.substring(6,8); - } else { - return ""; - } - } - -} - +export const BLANK_SPACE = " "; +// NacsisCatalogResults contains the Nacsis servlet's response export class NacsisCatalogResults { header: ResultsHeader; results: Array; @@ -59,26 +28,34 @@ export class NacsisCatalogResults { } } + export class ResultsHeader extends Header { totalRecords: number; searchType: SearchType; } +// BaseResult a prototype of a Ncsis servlet's result export abstract class BaseResult { - ID: string = ""; + id: string = ""; summaryView: any; fullView : any; rawData: string = ""; - constructor(record: any){ - this.ID = record.ID; + summaryDisplay: IDisplayLines; + fullViewDisplay: IDisplayLines; + + constructor( + record: any, + protected translate: TranslateService + ){ + this.id = record.id; this.summaryView = record.summaryView; this.fullView = record.fullView; this.rawData = record.rawData; } getID(){ - return this.ID; + return this.id; } getSummaryView(){ @@ -92,18 +69,114 @@ export abstract class BaseResult { getRawData(){ return this.rawData; } + + abstract getSummaryDisplay():IDisplayLines; + + abstract getFullViewDisplay():IDisplayLines; + } -export class FullViewField { + +export abstract class IDisplayLines { + protected fullRecord: BaseResult; + protected viewLines: Array; + protected titleLine: ViewLine; + + + constructor(viewRecord: BaseResult) { + this.fullRecord = viewRecord; + } + + getFullRecordData() { + return this.fullRecord; + } + + initTitleDisplay():any{}; + + initContentDisplay():any{}; + + protected addLine(header: ViewField, content: Array){ + let filteredArray = content.filter(field => field.hasContent() || field.isOnlyLabel()); + if(filteredArray.length > 0){ + this.viewLines.push(new ViewLine(header, filteredArray)); + } + } + + protected dateFormatDisplay(field: string) { + if(field != "" && field != undefined){ + return field.substring(0,4) + "/" + field.substring(4,6) + "/" + field.substring(6,8); + } else { + return ""; + } + } + + isEmpty(str): boolean { + return (str == "" || str == undefined || str == null); + } + + toStringPairOfFields(fieldA, fieldB, labelB?: string): string { + let str = ""; + if(!this.isEmpty(fieldA)){ + str = str + fieldA; + } if(!this.isEmpty(fieldA) && !this.isEmpty(fieldB)){ + str = str + labelB; + } if(!this.isEmpty(fieldB)){ + str = str + fieldB; + } return str; + } + + setMiddleLabel(fieldsArr: Array, label: string): Array { + let filteredArray = fieldsArr.filter(field => field.hasContent()); + let arrWithLabels = new Array(); + for (let i = 0; i < filteredArray.length; i++) { + arrWithLabels.push(filteredArray[i]); + if(i != filteredArray.length-1){ + arrWithLabels.push(new ViewFieldBuilder().label(label).build()); + } + } + return arrWithLabels; + } +} + + +export class ViewLine { + + constructor ( + private header: ViewField, + private content: Array + ) { } + + getHeaderLabel() { + return this.header.getLabel(); + } + + getContent() { + return this.content; + } + + public toString(): string{ + let lines = ""; + this.content.forEach(field => { + lines = lines + field.getLabel() + " "; + lines = lines + field.getContent() + " "; + }); + return lines; + } +} + +export class ViewField { private label: string; private content: string; private link: string; + private onlyLabel: boolean; - constructor(fieldBuilder: FieldBuilder) { - this.label = fieldBuilder.getLabel(); - this.content = fieldBuilder.getContent(); - this.link = fieldBuilder.getLink(); + + constructor(ViewFieldBuilder: ViewFieldBuilder) { + this.label = ViewFieldBuilder.getLabel(); + this.content = ViewFieldBuilder.getContent(); + this.link = ViewFieldBuilder.getLink(); + this.onlyLabel = ViewFieldBuilder.isOnlyLabel()? true : false; } getLabel() { @@ -118,6 +191,10 @@ export class FullViewField { return this.content; } + getLink() { + return this.link; + } + hasContent() { return (this.content != "" && this.content != undefined); } @@ -126,17 +203,17 @@ export class FullViewField { return (this.link != null); } - getLink() { - return this.link; + isOnlyLabel() { + return this.onlyLabel; } - } -export class FieldBuilder { +export class ViewFieldBuilder { private _label: string; private _content: string; private _link: string; + private _onlyLabel: boolean = true; constructor() { } @@ -153,6 +230,10 @@ export class FieldBuilder { return this._link; } + isOnlyLabel() { + return this._onlyLabel; + } + label(label: string) { this._label = label; return this; @@ -160,6 +241,7 @@ export class FieldBuilder { content(content: string) { this._content = content; + this._onlyLabel = false; return this; } @@ -169,24 +251,8 @@ export class FieldBuilder { } build() { - return new FullViewField(this); + return new ViewField(this); } - } -export class FullViewLine { - constructor ( - private header: FullViewField, - private content: Array - ) { } - - getHeaderLabel() { - return this.header.getLabel(); - } - - getContent() { - return this.content; - } - -} diff --git a/cloudapp/src/app/catalog/results-types/serials.ts b/cloudapp/src/app/catalog/results-types/serials.ts index 3610911..5229ecf 100644 --- a/cloudapp/src/app/catalog/results-types/serials.ts +++ b/cloudapp/src/app/catalog/results-types/serials.ts @@ -1,28 +1,43 @@ import { TranslateService } from '@ngx-translate/core'; -import { IDisplayLinesSummary, BaseResult, FullViewField, IDisplayLinesFull, FullViewLine, FieldBuilder } from './results-common'; +import { IDisplayLines, BaseResult, ViewField, ViewLine, ViewFieldBuilder } from './results-common'; +import { SearchType } from '../main/form-utils'; export class Serial extends BaseResult{ summaryView: SerialSummary; fullView : SerialFull; - constructor(record: any){ - super(record); + constructor(record: any, translate: TranslateService){ + super(record, translate); + } + + getSummaryDisplay() { + return new SerialSummaryDisplay(this.translate, this); + } + + getFullViewDisplay() { + return new SerialFullDisplay(this); } } export class SerialSummary{ - TITLE: string = ""; - AUTH: string = ""; + TRD: string = ""; + AL: SerialAL[]; PUBL: string = ""; - LANG: string = ""; - VOL: string = ""; - YEAR: string = ""; + VLYR: string = ""; + TTLL: string = ""; + YEAR1: string = ""; + YEAR2: string = ""; + TRR: string = ""; + TRVR: string = ""; ID: string = ""; ISSN: string = ""; - SH: string = ""; + hasMoreThen1ISBN: boolean; + SH: SerialSH[]; + hasMoreThen3SH: Boolean; } + export class SerialFull{ ID: string = ""; // empty header @@ -40,7 +55,8 @@ export class SerialFull{ GPON: string = ""; GMD: string = ""; SMD: string = ""; - YEAR: string = ""; + YEAR1: string = ""; + YEAR2: string = ""; CNTRY: string = ""; TTLL: string = ""; TXTL: string = ""; @@ -59,54 +75,54 @@ export class SerialFull{ // VLYR VLYR: string = ""; // PUB - PUB: serialPUB[]; + PUB: SerialPUB[]; // PHYS PHYSP: string = ""; PHYSI: string = ""; PHYSS: string = ""; PHYSA: string = ""; // VT - VT: serialVT[]; + VT: SerialVT[]; // NOTE - NOTE: serialNOTE[]; + NOTE: SerialNOTE[]; // PRICE PRICE: string = ""; // FID FID: string = ""; // BHNT - BHNT: serialBHNT[]; + BHNT: SerialBHNT[]; // AL - AL: serialAL[]; + AL: SerialAL[]; // SH - SH: serialSH[]; + SH: SerialSH[]; // IDENT - IDENT: serialIDENT[]; + IDENT: SerialIDENT[]; } -export class serialPUB{ +export class SerialPUB{ PUBP: string = ""; PUBL: string = ""; PUBDT: string = ""; } -export class serialVT{ +export class SerialVT{ VTK: string = ""; VTD: string = ""; VTR: string = ""; VTVR: string = ""; } -export class serialNOTE{ +export class SerialNOTE{ NOTE: string = ""; } -export class serialBHNT{ +export class SerialBHNT{ BHK: string = ""; BHTR: string = ""; BHBID: string = ""; } -export class serialAL{ +export class SerialAL{ AFLG: string = ""; AHDNG: string = ""; AHDNGR: string = ""; @@ -115,7 +131,7 @@ export class serialAL{ AF: string = ""; } -export class serialSH{ +export class SerialSH{ SHT: string = ""; SHD: string = ""; SHR: string = ""; @@ -123,159 +139,196 @@ export class serialSH{ SHK: string = ""; } -export class serialIDENT{ +export class SerialIDENT{ IDENT: string = ""; } -export class SerialSummaryDisplay implements IDisplayLinesSummary{ - private fullRecordData: Serial; +export class SerialSummaryDisplay extends IDisplayLines{ private record: SerialSummary; constructor( private translate: TranslateService, fullRecordData: Serial ) { - this.fullRecordData = fullRecordData; - this.record = this.fullRecordData.getSummaryView(); + super(fullRecordData); + this.record = fullRecordData.getSummaryView(); } - getDisplayTitle(): string { - return this.record.TITLE; + initTitleDisplay(): ViewLine { + let fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.TRD).build()); + this.titleLine = new ViewLine(new ViewFieldBuilder().build(), fieldsArray); + return this.titleLine; } - initContentDisplay(): Array { - let summaryLines = new Array(); - - summaryLines.push(this.translate.instant('Catalog.Results.By') + " " + this.record.AUTH + " (" - + this.translate.instant("Catalog.Results.Book") + " " + this.record.PUBL - + ", " + this.record.LANG + ": " + this.record.VOL + "; " + this.record.YEAR + ")"); - summaryLines.push( this.translate.instant("Catalog.Results.NACSISID") + ": " + this.record.ID); - summaryLines.push( this.translate.instant("Catalog.Results.ISSN") + ": " + this.record.ISSN); - summaryLines.push( this.translate.instant("Catalog.Results.Subjects") + ": " + this.record.SH); + initContentDisplay(): Array { + this.viewLines = new Array(); + let fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.By').content(this.record.AL[0]?.AHDNG).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.AL[0]?.AHDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.AL[0]?.AHDNGVR).build()); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.Journal').build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PUBL).build()); + fieldsArray.push(new ViewFieldBuilder().label(", ").content(this.record.TTLL).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(this.record.VLYR).build()); + fieldsArray.push(new ViewFieldBuilder().label("; ").content(this.record.YEAR1).build()); + fieldsArray.push(new ViewFieldBuilder().label(" - ").content(this.record.YEAR2).build()); + fieldsArray.push(new ViewFieldBuilder().label(")").build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.TRR).link('').build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.TRVR).link('').build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.NACSISID').content(this.record.ID).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.ISBN').content(this.record.ISSN).build()); + if(this.record.hasMoreThen1ISBN){ + fieldsArray.push(new ViewFieldBuilder().content(('Catalog.Results.AndOthers')).build()); + } + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + let shStrFields = ""; + for (let i = 0; i < this.record.SH.length-1; i++) { + shStrFields = shStrFields + this.toStringPairOfFields(this.record.SH[i].SHD, this.record.SH[i].SHR, "||"); + shStrFields = shStrFields + "
"; + } + if (this.record.SH.length > 0) { + let j = this.record.SH.length - 1; + shStrFields = shStrFields + this.toStringPairOfFields(this.record.SH[j].SHD, this.record.SH[j].SHR, "||"); + if(this.record.hasMoreThen3SH) { + shStrFields = shStrFields + " " + ('Catalog.Results.AndOthers'); + } + } + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.Subjects').content(shStrFields).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); - return summaryLines; + return this.viewLines; } - getFullRecordData() { - return this.fullRecordData; - } } -export class SerialFullDisplay extends IDisplayLinesFull { + + +export class SerialFullDisplay extends IDisplayLines { + private record: SerialFull; - constructor( - fullViewRecord: SerialFull - ) { + constructor(fullViewRecord: Serial) { super(fullViewRecord); + this.record = fullViewRecord.getFullView(); } initContentDisplay(){ - this.fullViewLines = new Array(); - let fieldArray = new Array() - fieldArray.push(new FieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); - fieldArray.push(new FieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link('').build()); - fieldArray.push(new FieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); - fieldArray.push(new FieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link('').build()); - this.addLine(new FieldBuilder().build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().label("ISSN: ").content(this.record.ISSN).build()); - fieldArray.push(new FieldBuilder().label("XISSN: ").content(this.record.XISSN).build()); - fieldArray.push(new FieldBuilder().label("CODEN: ").content(this.record.CODEN).build()); - fieldArray.push(new FieldBuilder().label("LCCN: ").content(this.record.LCCN).build()); - fieldArray.push(new FieldBuilder().label("NDLPN: ").content(this.record.NDLPN).build()); - fieldArray.push(new FieldBuilder().label("ULPN: ").content(this.record.ULPN).build()); - fieldArray.push(new FieldBuilder().label("GPON: ").content(this.record.GPON).build()); - this.addLine(new FieldBuilder().label("CODE").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().label("GMD: ").content(this.record.GMD).build()); - fieldArray.push(new FieldBuilder().label("SMD: ").content(this.record.SMD).build()); - fieldArray.push(new FieldBuilder().label("YEAR: ").content(this.record.YEAR).build()); - fieldArray.push(new FieldBuilder().label("CNTRY: ").content(this.record.CNTRY).build()); - fieldArray.push(new FieldBuilder().label("TTLL: ").content(this.record.TTLL).build()); - fieldArray.push(new FieldBuilder().label("TXTL: ").content(this.record.TXTL).build()); - fieldArray.push(new FieldBuilder().label("ORGL: ").content(this.record.ORGL).build()); - fieldArray.push(new FieldBuilder().label("REPRO: ").content(this.record.REPRO).build()); - fieldArray.push(new FieldBuilder().label("PSTAT: ").content(this.record.PSTAT).build()); - fieldArray.push(new FieldBuilder().label("FREQ: ").content(this.record.FREQ).build()); - fieldArray.push(new FieldBuilder().label("REGL: ").content(this.record.REGL).build()); - fieldArray.push(new FieldBuilder().label("TYPE: ").content(this.record.TYPE).build()); - this.addLine(new FieldBuilder().label("CODE").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.TRD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(this.record.TRR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(this.record.TRVR).build()); - this.addLine(new FieldBuilder().label("TR").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.ED).build()); - this.addLine(new FieldBuilder().label("ED").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.VLYR).build()); - this.addLine(new FieldBuilder().label("VLYR").build(), fieldArray); + this.viewLines = new Array(); + let fieldsArray = new Array() + fieldsArray.push(new ViewFieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); + fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); + fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label("ISSN: ").content(this.record.ISSN).build()); + fieldsArray.push(new ViewFieldBuilder().label("XISSN: ").content(this.record.XISSN).build()); + fieldsArray.push(new ViewFieldBuilder().label("CODEN: ").content(this.record.CODEN).build()); + fieldsArray.push(new ViewFieldBuilder().label("LCCN: ").content(this.record.LCCN).build()); + fieldsArray.push(new ViewFieldBuilder().label("NDLPN: ").content(this.record.NDLPN).build()); + fieldsArray.push(new ViewFieldBuilder().label("ULPN: ").content(this.record.ULPN).build()); + fieldsArray.push(new ViewFieldBuilder().label("GPON: ").content(this.record.GPON).build()); + this.addLine(new ViewFieldBuilder().label("CODE").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label("GMD: ").content(this.record.GMD).build()); + fieldsArray.push(new ViewFieldBuilder().label("SMD: ").content(this.record.SMD).build()); + fieldsArray.push(new ViewFieldBuilder().label("YEAR: ").content(this.record.YEAR1).build()); + fieldsArray.push(new ViewFieldBuilder().label("- ").content(this.record.YEAR2).build()); + fieldsArray.push(new ViewFieldBuilder().label("CNTRY: ").content(this.record.CNTRY).build()); + fieldsArray.push(new ViewFieldBuilder().label("TTLL: ").content(this.record.TTLL).build()); + fieldsArray.push(new ViewFieldBuilder().label("TXTL: ").content(this.record.TXTL).build()); + fieldsArray.push(new ViewFieldBuilder().label("ORGL: ").content(this.record.ORGL).build()); + fieldsArray.push(new ViewFieldBuilder().label("REPRO: ").content(this.record.REPRO).build()); + fieldsArray.push(new ViewFieldBuilder().label("PSTAT: ").content(this.record.PSTAT).build()); + fieldsArray.push(new ViewFieldBuilder().label("FREQ: ").content(this.record.FREQ).build()); + fieldsArray.push(new ViewFieldBuilder().label("REGL: ").content(this.record.REGL).build()); + fieldsArray.push(new ViewFieldBuilder().label("TYPE: ").content(this.record.TYPE).build()); + this.addLine(new ViewFieldBuilder().label("CODE").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.TRD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.TRR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.TRVR).build()); + this.addLine(new ViewFieldBuilder().label("TR").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.ED).build()); + this.addLine(new ViewFieldBuilder().label("ED").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.VLYR).build()); + this.addLine(new ViewFieldBuilder().label("VLYR").build(), fieldsArray); this.record.PUB?.forEach(pub=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(pub.PUBP).build()); - fieldArray.push(new FieldBuilder().label(": ").content(pub.PUBL).build()); - fieldArray.push(new FieldBuilder().label(", ").content(pub.PUBDT).build()); - this.addLine(new FieldBuilder().label("PUB").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(pub.PUBP).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(pub.PUBL).build()); + fieldsArray.push(new ViewFieldBuilder().label(", ").content(pub.PUBDT).build()); + this.addLine(new ViewFieldBuilder().label("PUB").build(), fieldsArray); }); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.PHYSP).build()); - fieldArray.push(new FieldBuilder().label("; ").content(this.record.PHYSI).build()); - fieldArray.push(new FieldBuilder().label("; ").content(this.record.PHYSS).build()); - fieldArray.push(new FieldBuilder().label("+").content(this.record.PHYSA).build()); - this.addLine(new FieldBuilder().label("PHYS").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSP).build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSI).build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSS).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, ";"); + fieldsArray.push(new ViewFieldBuilder().label("+").content(this.record.PHYSA).build()); + this.addLine(new ViewFieldBuilder().label("PHYS").build(), fieldsArray); this.record.VT?.forEach(vt=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(vt.VTK).build()); - fieldArray.push(new FieldBuilder().label(": ").content(vt.VTD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(vt.VTR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(vt.VTVR).build()); - this.addLine(new FieldBuilder().label("VT").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(vt.VTK).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(vt.VTD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(vt.VTR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(vt.VTVR).build()); + this.addLine(new ViewFieldBuilder().label("VT").build(), fieldsArray); }); this.record.NOTE?.forEach(note=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(note.NOTE).build()); - this.addLine(new FieldBuilder().label("NOTE").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(note.NOTE).build()); + this.addLine(new ViewFieldBuilder().label("NOTE").build(), fieldsArray); }); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.PRICE).build()); - this.addLine(new FieldBuilder().label("PRICE").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.FID).link('').build()); - this.addLine(new FieldBuilder().label("FID").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.PRICE).build()); + this.addLine(new ViewFieldBuilder().label("PRICE").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.FID).build()); + this.addLine(new ViewFieldBuilder().label("FID").build(), fieldsArray); this.record.BHNT?.forEach(bhnt=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(bhnt.BHK).build()); - fieldArray.push(new FieldBuilder().label(": ").content(bhnt.BHTR).build()); - fieldArray.push(new FieldBuilder().content(bhnt.BHBID).link('').build()); - this.addLine(new FieldBuilder().label("BHNT").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(bhnt.BHK).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(bhnt.BHTR).build()); + fieldsArray.push(new ViewFieldBuilder().content(bhnt.BHBID).link(SearchType.Serials).build()); + this.addLine(new ViewFieldBuilder().label("BHNT").build(), fieldsArray); }); this.record.AL?.forEach(al=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(al.AFLG).build()); - fieldArray.push(new FieldBuilder().content(al.AHDNG).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(al.AHDNGR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(al.AHDNGVR).build()); - fieldArray.push(new FieldBuilder().content(al.AID).link('').build()); - fieldArray.push(new FieldBuilder().content(al.AF).build()); - this.addLine(new FieldBuilder().label("AL").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(al.AFLG).build()); + fieldsArray.push(new ViewFieldBuilder().content(al.AHDNG).build()); + fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGVR).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray.push(new ViewFieldBuilder().content(al.AID).link(SearchType.Names).build()); + fieldsArray.push(new ViewFieldBuilder().content(al.AF).build()); + this.addLine(new ViewFieldBuilder().label("AL").build(), fieldsArray); }); this.record.SH?.forEach(sh=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(sh.SHT).build()); - fieldArray.push(new FieldBuilder().label(": ").content(sh.SHD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(sh.SHR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(sh.SHVR).build()); - fieldArray.push(new FieldBuilder().label("// ").content(sh.SHK).build()); - this.addLine(new FieldBuilder().label("SH").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(sh.SHT).build()); + fieldsArray.push(new ViewFieldBuilder().label(": ").content(sh.SHD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(sh.SHR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(sh.SHVR).build()); + fieldsArray.push(new ViewFieldBuilder().label("// ").content(sh.SHK).build()); + this.addLine(new ViewFieldBuilder().label("SH").build(), fieldsArray); }); this.record.IDENT?.forEach(ident=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(ident.IDENT).build()); - this.addLine(new FieldBuilder().label("IDENT").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(ident.IDENT).build()); + this.addLine(new ViewFieldBuilder().label("IDENT").build(), fieldsArray); }); - return this.fullViewLines; + return this.viewLines; } } diff --git a/cloudapp/src/app/catalog/results-types/uniformTitle.ts b/cloudapp/src/app/catalog/results-types/uniformTitle.ts index cf966dc..c658bc3 100644 --- a/cloudapp/src/app/catalog/results-types/uniformTitle.ts +++ b/cloudapp/src/app/catalog/results-types/uniformTitle.ts @@ -1,18 +1,29 @@ import { TranslateService } from '@ngx-translate/core'; -import { IDisplayLinesSummary, BaseResult, IDisplayLinesFull, FullViewField, FullViewLine, FieldBuilder } from './results-common'; +import { IDisplayLines, BaseResult, ViewField, ViewLine, ViewFieldBuilder } from './results-common'; +import { SearchType } from '../main/form-utils'; export class UniformTitle extends BaseResult { summaryView: UniformTitleSummary; fullView : UniformTitleFull; - constructor(record: any){ - super(record); + constructor(record: any, translate: TranslateService){ + super(record, translate); + } + + getSummaryDisplay() { + return new UniformTitleSummaryDisplay(this.translate, this); + } + + getFullViewDisplay() { + return new UniformTitleFullDisplay(this); } } export class UniformTitleSummary{ - TITLE: string = ""; + HDNGD: string = ""; + HDNGR: string = ""; + HDNGVR: string = ""; ID: string = ""; } @@ -54,76 +65,88 @@ export class UniformTitleNOTE{ NOTE: string = ""; } -export class UniformTitleSummaryDisplay implements IDisplayLinesSummary{ - private fullRecordData: UniformTitle; + + +export class UniformTitleSummaryDisplay extends IDisplayLines{ private record: UniformTitleSummary; constructor( private translate: TranslateService, - fullRecordData: UniformTitle){ - this.fullRecordData = fullRecordData; - this.record = this.fullRecordData.getSummaryView(); - } + fullRecordData: UniformTitle + ) { + super(fullRecordData); + this.record = fullRecordData.getSummaryView(); + } - getDisplayTitle(): string { - return this.record.TITLE; + initTitleDisplay(): ViewLine { + let fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNGD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + this.titleLine = new ViewLine(new ViewFieldBuilder().build(), fieldsArray.filter(field => field.hasContent() === true)); + return this.titleLine; } - initContentDisplay(): Array { - let summaryLines = new Array(); - summaryLines.push( this.translate.instant("Catalog.Results.NACSISID") + ": " + this.record.ID); - return summaryLines; + initContentDisplay(): Array { + this.viewLines = new Array(); + let fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.NACSISID').content(this.record.ID).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + + return this.viewLines; } - getFullRecordData() { - return this.fullRecordData; - } } -export class UniformTitleFullDisplay extends IDisplayLinesFull { +export class UniformTitleFullDisplay extends IDisplayLines { - constructor(fullViewRecord: UniformTitleFull) { - super(fullViewRecord); - } + private record: UniformTitleFull; + + constructor(fullViewRecord: UniformTitle) { + super(fullViewRecord); + this.record = fullViewRecord.getFullView(); + } initContentDisplay(){ - this.fullViewLines = new Array(); - let fieldArray = new Array() - fieldArray.push(new FieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); - fieldArray.push(new FieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link('').build()); - fieldArray.push(new FieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); - fieldArray.push(new FieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link('').build()); - this.addLine(new FieldBuilder().build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.HDNGD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(this.record.HDNGR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(this.record.HDNGVR).build()); - this.addLine(new FieldBuilder().label("HDNG").build(), fieldArray); - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(this.record.LCUID).build()); - this.addLine(new FieldBuilder().label("LCUID").build(), fieldArray); + this.viewLines = new Array(); + let fieldsArray = new Array() + fieldsArray.push(new ViewFieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); + fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); + fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); + this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNGD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + this.addLine(new ViewFieldBuilder().label("HDNG").build(), fieldsArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(this.record.LCUID).build()); + this.addLine(new ViewFieldBuilder().label("LCUID").build(), fieldsArray); this.record.SF?.forEach(sf=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(sf.SFD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(sf.SFR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(sf.SFVR).build()); - this.addLine(new FieldBuilder().label("SF").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(sf.SFD).build()); + fieldsArray.push(new ViewFieldBuilder().content(sf.SFR).build()); + fieldsArray.push(new ViewFieldBuilder().content(sf.SFVR).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + this.addLine(new ViewFieldBuilder().label("SF").build(), fieldsArray); }); this.record.SAF?.forEach(saf=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(saf.SAFD).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFVR).build()); - fieldArray.push(new FieldBuilder().label("|| ").content(saf.SAFID).link('').build()); - this.addLine(new FieldBuilder().label("SAF").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(saf.SAFD).build()); + fieldsArray.push(new ViewFieldBuilder().content(saf.SAFR).build()); + fieldsArray.push(new ViewFieldBuilder().content(saf.SAFVR).build()); + fieldsArray.push(new ViewFieldBuilder().content(saf.SAFID).link(SearchType.UniformTitles).build()); + fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + this.addLine(new ViewFieldBuilder().label("SAF").build(), fieldsArray); }); this.record.NOTE?.forEach(note=>{ - fieldArray = new Array(); - fieldArray.push(new FieldBuilder().content(note.NOTE).build()); - this.addLine(new FieldBuilder().label("NOTE").build(), fieldArray); + fieldsArray = new Array(); + fieldsArray.push(new ViewFieldBuilder().content(note.NOTE).build()); + this.addLine(new ViewFieldBuilder().label("NOTE").build(), fieldsArray); }); - return this.fullViewLines; + return this.viewLines; } diff --git a/cloudapp/src/app/holdings/form/form.component.html b/cloudapp/src/app/holdings/form/form.component.html index f5ca061..1eb2be9 100644 --- a/cloudapp/src/app/holdings/form/form.component.html +++ b/cloudapp/src/app/holdings/form/form.component.html @@ -49,32 +49,32 @@

{{ (isReadOnly ? 'Holdings.Form.ViewTitle' : holdingId ? 'Holdings.Form.Edit
- + Holdings.Form.Fields.VOL - + Holdings.Form.Fields.CLN - + Holdings.Form.Fields.RGTN - + Holdings.Form.Fields.CPYR - + Holdings.Form.Fields.CPYNT - + Holdings.Form.Fields.LDF @@ -82,34 +82,34 @@

{{ (isReadOnly ? 'Holdings.Form.ViewTitle' : holdingId ? 'Holdings.Form.Edit

- + Holdings.Form.Fields.HLYR Holdings.Form.Errors.HLYR - + Holdings.Form.Fields.HLV Holdings.Form.Errors.HLV - + Holdings.Form.Fields.CONT - + Holdings.Form.Fields.CLN - + Holdings.Form.Fields.LDF - + Holdings.Form.Fields.CPYNT diff --git a/cloudapp/src/app/holdings/form/form.component.scss b/cloudapp/src/app/holdings/form/form.component.scss index ed1d8a7..6b7f0d3 100644 --- a/cloudapp/src/app/holdings/form/form.component.scss +++ b/cloudapp/src/app/holdings/form/form.component.scss @@ -30,10 +30,12 @@ mat-card { padding-left: 0px; padding-right: 0px; margin-bottom: 40px; - .form-card-inputs { padding-top: 10px; - } + ::ng-deep .mat-form-field-wrapper { + padding-bottom: 0px !important; + } + } } .form-commands { diff --git a/cloudapp/src/app/service/catalog.service.ts b/cloudapp/src/app/service/catalog.service.ts index 7cb7750..e81a7be 100644 --- a/cloudapp/src/app/service/catalog.service.ts +++ b/cloudapp/src/app/service/catalog.service.ts @@ -4,6 +4,8 @@ import { CloudAppEventsService, InitData } from '@exlibris/exl-cloudapp-angular- import { BaseService, Header } from "./base.service"; import { mergeMap } from 'rxjs/operators'; import { of } from 'rxjs'; +import { TranslateService } from '@ngx-translate/core'; + import { SearchType } from '../catalog/main/form-utils'; import { NacsisCatalogResults, ResultsHeader } from '../catalog/results-types/results-common'; @@ -13,6 +15,7 @@ import { Name } from '../catalog/results-types/name'; import { UniformTitle } from '../catalog/results-types/uniformTitle'; import { AlmaApiService, IntegrationProfile } from './alma.api.service'; + @Injectable({ providedIn: 'root' }) @@ -27,7 +30,8 @@ export class CatalogService extends BaseService { constructor( protected eventsService: CloudAppEventsService, protected http: HttpClient, - protected almaApi: AlmaApiService + protected almaApi: AlmaApiService, + protected translate: TranslateService ) { super(eventsService, http); this.initResultsMap(); @@ -46,6 +50,14 @@ export class CatalogService extends BaseService { return this.searchResultsMap.get(type); } + setSearchResultsMap(searchType: SearchType, response: any) { + this.searchResultsMap.get(searchType).setHeader(response); + this.searchResultsMap.get(searchType).setResults(new Array()); + response.records.forEach(record => { + this.searchResultsMap.get(searchType).getResults().push(this.resultsTypeFactory(searchType, record)); + }); + } + clearAllSearchResults(){ this.initResultsMap(); } @@ -75,13 +87,6 @@ export class CatalogService extends BaseService { return this.http.get(fullUrl, { headers }) }), mergeMap(response => { - if (response.status === this.OkStatus && !this.isEmpty(response.records)) { - this.searchResultsMap.get(searchType).setHeader(response); - this.searchResultsMap.get(searchType).setResults(new Array()); - response.records.forEach(record => { - this.searchResultsMap.get(searchType).getResults().push(this.resultsTypeFactory(searchType, record)); - }); - } return of(response); }) ); @@ -91,13 +96,13 @@ export class CatalogService extends BaseService { resultsTypeFactory(type: SearchType, record: any){ switch (type){ case SearchType.Monographs: - return new Monograph(record); + return new Monograph(record, this.translate); case SearchType.Serials: - return new Serial(record); + return new Serial(record, this.translate); case SearchType.Names: - return new Name(record); + return new Name(record, this.translate); case SearchType.UniformTitles: - return new UniformTitle(record); + return new UniformTitle(record, this.translate); default: return null; diff --git a/cloudapp/src/app/user-controls/result-card/result-card.component.html b/cloudapp/src/app/user-controls/result-card/result-card.component.html index 3f57804..4a2696e 100644 --- a/cloudapp/src/app/user-controls/result-card/result-card.component.html +++ b/cloudapp/src/app/user-controls/result-card/result-card.component.html @@ -1,29 +1,43 @@ - -
- -
- {{recordIndex + 1}} + + - -
- - -
- + + + +
+
+
+ + +
+
- -
- +
+ +
+
+ + +
+ +
+
+
+
\ No newline at end of file diff --git a/cloudapp/src/app/user-controls/result-card/result-card.component.scss b/cloudapp/src/app/user-controls/result-card/result-card.component.scss index 185ece6..d00160a 100644 --- a/cloudapp/src/app/user-controls/result-card/result-card.component.scss +++ b/cloudapp/src/app/user-controls/result-card/result-card.component.scss @@ -1,18 +1,67 @@ -.result-card{ +@mixin flexText { display: flex; +} + +@mixin filedPadding { + padding-right: 3px; +} + + +.result-card{ + @include flexText; justify-content: space-between; width: 100%; background-color: whitesmoke !important; } +.card-title { + @include flexText; + font-weight: bold; + margin-left: 20px; +} + +.card-title-field { + @include flexText; +} + +.card-content-line { + @include flexText; + flex-wrap: wrap; +} + +.card-content-field { + @include flexText; +} + +.card-content-field-label { + font-weight: bold; + @include filedPadding; +} + +.card-content-field-content { + @include flexText; + @include filedPadding; +} + +/* .result-card-index { margin-right: 20px; } - .result-card-content { - margin: 0px; +.result-card-text-content { + margin-bottom: 5px; +} + +.result-line-field { + padding-right: 8px; } +.label { + font-weight: bold; +} + +*/ + a, a label { cursor: pointer; diff --git a/cloudapp/src/app/user-controls/result-card/result-card.component.ts b/cloudapp/src/app/user-controls/result-card/result-card.component.ts index 689e834..a34c0c2 100644 --- a/cloudapp/src/app/user-controls/result-card/result-card.component.ts +++ b/cloudapp/src/app/user-controls/result-card/result-card.component.ts @@ -1,6 +1,6 @@ -import { Component, Input, Output, EventEmitter } from '@angular/core'; +import { Component, Input, Output, EventEmitter, OnInit } from '@angular/core'; import { PageEvent } from '@angular/material/paginator'; -import { IDisplayLinesSummary } from '../../catalog/results-types/results-common'; +import { IDisplayLines, ViewLine, ViewField } from '../../catalog/results-types/results-common'; @Component({ @@ -9,17 +9,24 @@ import { IDisplayLinesSummary } from '../../catalog/results-types/results-common styleUrls: ['./result-card.component.scss'] }) -export class ResultCardComponent { +export class ResultCardComponent implements OnInit { @Input() recordIndex: number; - @Input() record: IDisplayLinesSummary; + @Input() record: IDisplayLines; @Input() resultActionList: Array = new Array(); @Output() onActionSelected = new EventEmitter(); @Output() onTitleSelected = new EventEmitter(); + private titleDisplay: Array; + private contentDisplay: Array; constructor() { } + ngOnInit() { + this.titleDisplay = this.record.initTitleDisplay().getContent(); + this.contentDisplay = this.record.initContentDisplay(); + } + onActionsClick(recordIndex: number, actionIndex: number) { this.onActionSelected.emit(new RecordSelection(recordIndex, actionIndex)); } diff --git a/cloudapp/src/app/user-controls/results-list/results-list.component.html b/cloudapp/src/app/user-controls/results-list/results-list.component.html index dfcc18e..d517739 100644 --- a/cloudapp/src/app/user-controls/results-list/results-list.component.html +++ b/cloudapp/src/app/user-controls/results-list/results-list.component.html @@ -11,5 +11,5 @@

{{'Catalog.Results.Title' | translate}} ({{numOfResult - + \ No newline at end of file diff --git a/cloudapp/src/app/user-controls/results-list/results-list.component.ts b/cloudapp/src/app/user-controls/results-list/results-list.component.ts index e33233f..5a0fce2 100644 --- a/cloudapp/src/app/user-controls/results-list/results-list.component.ts +++ b/cloudapp/src/app/user-controls/results-list/results-list.component.ts @@ -1,6 +1,6 @@ import { Component, Input, Output, EventEmitter } from '@angular/core'; import { PageEvent } from '@angular/material/paginator'; -import { IDisplayLinesSummary } from '../../catalog/results-types/results-common'; +import { IDisplayLines } from '../../catalog/results-types/results-common'; import { RecordSelection } from '../result-card/result-card.component'; @@ -13,7 +13,7 @@ import { RecordSelection } from '../result-card/result-card.component'; export class ResultsListComponent { @Input() numOfResults: number; - @Input() resultsSummaryDisplay: Array = new Array(); + @Input() resultsSummaryDisplay: Array = new Array(); @Input() resultActionList: Array = new Array(); @Output() onActionSelected = new EventEmitter(); @Output() onTitleSelected = new EventEmitter(); diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.html b/cloudapp/src/app/user-controls/search-form/search-form.component.html index 90b8fa1..c564c69 100644 --- a/cloudapp/src/app/user-controls/search-form/search-form.component.html +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.html @@ -9,7 +9,7 @@
- + {{ field.getFieldLabel() | translate }} diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.scss b/cloudapp/src/app/user-controls/search-form/search-form.component.scss index 142ebaf..89028b4 100644 --- a/cloudapp/src/app/user-controls/search-form/search-form.component.scss +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.scss @@ -8,6 +8,9 @@ column-gap: 20px; row-gap: 1em; background-color: whitesmoke !important; + ::ng-deep .mat-form-field-wrapper { + padding-bottom: 0px !important; + } } .form-card-child-large{ diff --git a/cloudapp/src/i18n/en.json b/cloudapp/src/i18n/en.json index 334c8d8..5371d02 100644 --- a/cloudapp/src/i18n/en.json +++ b/cloudapp/src/i18n/en.json @@ -44,48 +44,25 @@ "Serials": "Serials", "Names": "Names", "UniformTitles": "Uniform Titles" - }, - "Fields": { - "TITLE": "TITLE", - "FTITLE": "FTITLE", - "PTBL": "PTBL", - "VOL": "VOL", - "TiPtVo": "TITLE / PTBL / VOL", - "AUTH": "AUTH", - "ISSN": "ISSN", - "ISBN": "ISBN", - "NBN": "NBN", - "NDLCN": "NDLCN / LCCN / OTHN", - "PUB": "PUB", - "YEAR": "YEAR", - "PLACE": "PLACE", - "CNTRY": "CNTRY", - "LANG": "LANG", - "SH": "SH", - "AKEY": "AKEY", - "ID": "ID", - "PID": "PID", - "CODEN": "CODEN", - "NDLPN": "NDLPN / LCCN", - "FID": "FID", - "DATE": "DATE", - "SAID": "SAID" } }, "Results": { "Title": "Records", "NoRecordsExist": "No records exist.", "By": "By", - "Book": "Book", - "NACSISID": "NACSIS ID", - "ISBN": "ISBN", - "ISSN": "ISSN", - "Subjects": "Subjects", + "Book": "(Book", + "Journal": "(Journal", + "NACSISID": "NACSIS ID:", + "ISBN": "ISBN:", + "ISSN": "ISSN:", + "Subjects": "Subjects:", + "AndOthers": "and others", "Actions" : { "View" : "View", "Import" : "Import", "ViewHoldings" : "View Holdings" - } + }, + "ImportSucceeded": "The record was successfully imported" } }, @@ -163,7 +140,7 @@ "OLH": "To the online help" }, - "Common": { + "UserControls": { "Fields": { "TITLE": "TITLE", "FTITLE": "FTITLE", @@ -186,7 +163,9 @@ "PID": "PID", "CODEN": "CODEN", "NDLPN": "NDLPN / LCCN", - "FID": "FID" + "FID": "FID", + "DATE": "DATE", + "SAID": "SAID" } } diff --git a/cloudapp/src/i18n/jp.json b/cloudapp/src/i18n/jp.json index b938977..629c385 100644 --- a/cloudapp/src/i18n/jp.json +++ b/cloudapp/src/i18n/jp.json @@ -44,48 +44,25 @@ "Serials": "Serials???", "Names": "Names???", "UniformTitles": "Uniform Titles???" - }, - "Fields": { - "TITLE": "TITLE???", - "FTITLE": "FTITLE???", - "PTBL": "PTBL???", - "VOL": "VOL", - "TiPtVo": "TITLE / PTBL / VOL", - "AUTH": "AUTH", - "ISSN": "ISSN", - "ISBN": "ISBN", - "NBN": "NBN", - "NDLCN": "NDLCN / LCCN / OTHN", - "PUB": "PUB", - "YEAR": "YEAR", - "PLACE": "PLACE", - "CNTRY": "CNTRY", - "LANG": "LANG", - "SH": "SH", - "AKEY": "AKEY", - "ID": "ID", - "PID": "PID", - "CODEN": "CODEN", - "NDLPN": "NDLPN / LCCN", - "FID": "FID", - "DATE": "DATE", - "SAID": "SAID" } }, "Results": { "Title": "???Records", "NoRecordsExist": "???No records exist.", "By": "???By", - "Book": "???Book", - "NACSISID": "???NACSIS ID", - "ISBN": "???ISBN", - "ISSN": "???ISSN", - "Subjects": "???Subjects", + "Book": "???(Book", + "Journal": "???(Journal", + "NACSISID": "???NACSIS ID:", + "ISBN": "???ISBN:", + "ISSN": "???ISSN:", + "Subjects": "???Subjects:", + "AndOthers": "???and others", "Actions" : { "View" : "???View", "Import" : "???Import", "ViewHoldings" : "???View Holdings" - } + }, + "ImportSucceeded": "The record was successfully imported ???" } }, @@ -161,5 +138,32 @@ "Help": { "Text": "このアプリはEx Librisでサポートされています。 ドキュメントを表示するには、下のリンクをクリックしてください。 さらにヘルプが必要な場合や問題を報告するには、SalesForceケースを開いてください。", "OLH": "オンラインヘルプへ" + }, + + "UserControls": { + "Fields": { + "TITLE": "TITLE???", + "FTITLE": "FTITLE???", + "PTBL": "PTBL???", + "VOL": "VOL???", + "TiPtVo": "TITLE / PTBL / VOL???", + "AUTH": "AUTH???", + "ISSN": "ISSN", + "ISBN": "ISBN", + "NBN": "NBN", + "NDLCN": "NDLCN / LCCN / OTHN", + "PUB": "PUB", + "YEAR": "YEAR", + "PLACE": "PLACE", + "CNTRY": "CNTRY", + "LANG": "LANG", + "SH": "SH", + "AKEY": "AKEY", + "ID": "ID", + "PID": "PID", + "CODEN": "CODEN", + "NDLPN": "NDLPN / LCCN", + "FID": "FID" + } } } \ No newline at end of file From cb424311415115247242edbba497538fbedb5f5f Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Tue, 31 Aug 2021 17:40:08 +0300 Subject: [PATCH 12/28] setSeparator --- cloudapp/src/app/catalog/results-types/monographs.ts | 10 +++++----- cloudapp/src/app/catalog/results-types/name.ts | 4 ++-- .../src/app/catalog/results-types/results-common.ts | 4 ++-- cloudapp/src/app/catalog/results-types/serials.ts | 4 ++-- cloudapp/src/app/catalog/results-types/uniformTitle.ts | 4 ++-- 5 files changed, 13 insertions(+), 13 deletions(-) diff --git a/cloudapp/src/app/catalog/results-types/monographs.ts b/cloudapp/src/app/catalog/results-types/monographs.ts index ab7103d..6069eef 100644 --- a/cloudapp/src/app/catalog/results-types/monographs.ts +++ b/cloudapp/src/app/catalog/results-types/monographs.ts @@ -188,7 +188,7 @@ export class MonographSummaryDisplay extends IDisplayLines{ fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().content(this.record.TRR).link('').build()); fieldsArray.push(new ViewFieldBuilder().content(this.record.TRVR).link('').build()); - fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray = this.setSeparator(fieldsArray, "||"); this.addLine(new ViewFieldBuilder().build(), fieldsArray); fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.NACSISID').content(this.record.ID).build()); @@ -283,7 +283,7 @@ export class MonographFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSP).build()); fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSI).build()); fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSS).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, ";"); + fieldsArray = this.setSeparator(fieldsArray, ";"); fieldsArray.push(new ViewFieldBuilder().label("+").content(this.record.PHYSA).build()); this.addLine(new ViewFieldBuilder().label("PHYS").build(), fieldsArray); this.record.VT?.forEach(vt=>{ @@ -312,7 +312,7 @@ export class MonographFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBTR).build()); fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBTRR).build()); fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBTRVR).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray = this.setSeparator(fieldsArray, "||"); fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBID).link(SearchType.Monographs).build()); fieldsArray.push(new ViewFieldBuilder().content(ptbl.PTBNO).build()); fieldsArray.push(new ViewFieldBuilder().label("// ").content(ptbl.PTBK).build()); @@ -324,7 +324,7 @@ export class MonographFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(al.AHDNG).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGR).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGVR).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray = this.setSeparator(fieldsArray, "||"); fieldsArray.push(new ViewFieldBuilder().content(al.AID).link(SearchType.Names).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AF).build()); this.addLine(new ViewFieldBuilder().label("AL").build(), fieldsArray); @@ -335,7 +335,7 @@ export class MonographFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(utl.UTHDNG).build()); fieldsArray.push(new ViewFieldBuilder().content(utl.UTHDNGR).build()); fieldsArray.push(new ViewFieldBuilder().content(utl.UTHDNGVR).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray = this.setSeparator(fieldsArray, "||"); fieldsArray.push(new ViewFieldBuilder().content(utl.UTID).build()); fieldsArray.push(new ViewFieldBuilder().content(utl.UTINFO).build()); this.addLine(new ViewFieldBuilder().label("UTL").build(), fieldsArray); diff --git a/cloudapp/src/app/catalog/results-types/name.ts b/cloudapp/src/app/catalog/results-types/name.ts index 71e5542..2243d7c 100644 --- a/cloudapp/src/app/catalog/results-types/name.ts +++ b/cloudapp/src/app/catalog/results-types/name.ts @@ -132,7 +132,7 @@ export class NameFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(sf.SFD).build()); fieldsArray.push(new ViewFieldBuilder().content(sf.SFR).build()); fieldsArray.push(new ViewFieldBuilder().content(sf.SFVR).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray = this.setSeparator(fieldsArray, "||"); this.addLine(new ViewFieldBuilder().label("SF").build(), fieldsArray); }); this.record.SAF?.forEach(saf=>{ @@ -141,7 +141,7 @@ export class NameFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(saf.SAFR).build()); fieldsArray.push(new ViewFieldBuilder().content(saf.SAFVR).build()); fieldsArray.push(new ViewFieldBuilder().content(saf.SAFID).link(SearchType.Names).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray = this.setSeparator(fieldsArray, "||"); this.addLine(new ViewFieldBuilder().label("SAF").build(), fieldsArray); }); this.record.NOTE?.forEach(note=>{ diff --git a/cloudapp/src/app/catalog/results-types/results-common.ts b/cloudapp/src/app/catalog/results-types/results-common.ts index bc4454b..63ddab1 100644 --- a/cloudapp/src/app/catalog/results-types/results-common.ts +++ b/cloudapp/src/app/catalog/results-types/results-common.ts @@ -125,13 +125,13 @@ export abstract class IDisplayLines { } return str; } - setMiddleLabel(fieldsArr: Array, label: string): Array { + setSeparator(fieldsArr: Array, separator: string): Array { let filteredArray = fieldsArr.filter(field => field.hasContent()); let arrWithLabels = new Array(); for (let i = 0; i < filteredArray.length; i++) { arrWithLabels.push(filteredArray[i]); if(i != filteredArray.length-1){ - arrWithLabels.push(new ViewFieldBuilder().label(label).build()); + arrWithLabels.push(new ViewFieldBuilder().label(separator).build()); } } return arrWithLabels; diff --git a/cloudapp/src/app/catalog/results-types/serials.ts b/cloudapp/src/app/catalog/results-types/serials.ts index 5229ecf..e6af15f 100644 --- a/cloudapp/src/app/catalog/results-types/serials.ts +++ b/cloudapp/src/app/catalog/results-types/serials.ts @@ -274,7 +274,7 @@ export class SerialFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSP).build()); fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSI).build()); fieldsArray.push(new ViewFieldBuilder().content(this.record.PHYSS).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, ";"); + fieldsArray = this.setSeparator(fieldsArray, ";"); fieldsArray.push(new ViewFieldBuilder().label("+").content(this.record.PHYSA).build()); this.addLine(new ViewFieldBuilder().label("PHYS").build(), fieldsArray); this.record.VT?.forEach(vt=>{ @@ -309,7 +309,7 @@ export class SerialFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(al.AHDNG).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGR).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGVR).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray = this.setSeparator(fieldsArray, "||"); fieldsArray.push(new ViewFieldBuilder().content(al.AID).link(SearchType.Names).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AF).build()); this.addLine(new ViewFieldBuilder().label("AL").build(), fieldsArray); diff --git a/cloudapp/src/app/catalog/results-types/uniformTitle.ts b/cloudapp/src/app/catalog/results-types/uniformTitle.ts index c658bc3..a73c4e2 100644 --- a/cloudapp/src/app/catalog/results-types/uniformTitle.ts +++ b/cloudapp/src/app/catalog/results-types/uniformTitle.ts @@ -128,7 +128,7 @@ export class UniformTitleFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(sf.SFD).build()); fieldsArray.push(new ViewFieldBuilder().content(sf.SFR).build()); fieldsArray.push(new ViewFieldBuilder().content(sf.SFVR).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray = this.setSeparator(fieldsArray, "||"); this.addLine(new ViewFieldBuilder().label("SF").build(), fieldsArray); }); this.record.SAF?.forEach(saf=>{ @@ -137,7 +137,7 @@ export class UniformTitleFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(saf.SAFR).build()); fieldsArray.push(new ViewFieldBuilder().content(saf.SAFVR).build()); fieldsArray.push(new ViewFieldBuilder().content(saf.SAFID).link(SearchType.UniformTitles).build()); - fieldsArray = this.setMiddleLabel(fieldsArray, "||"); + fieldsArray = this.setSeparator(fieldsArray, "||"); this.addLine(new ViewFieldBuilder().label("SAF").build(), fieldsArray); }); this.record.NOTE?.forEach(note=>{ From b2d83778e1def9b642a3a59f5928f3df20eea5a6 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Wed, 1 Sep 2021 13:16:33 +0300 Subject: [PATCH 13/28] Results' Indexes The Results' Indexes are updated according to the pages --- .../results-list/results-list.component.html | 2 +- .../results-list/results-list.component.ts | 21 ++++++++++++++++--- 2 files changed, 19 insertions(+), 4 deletions(-) diff --git a/cloudapp/src/app/user-controls/results-list/results-list.component.html b/cloudapp/src/app/user-controls/results-list/results-list.component.html index d517739..5646ade 100644 --- a/cloudapp/src/app/user-controls/results-list/results-list.component.html +++ b/cloudapp/src/app/user-controls/results-list/results-list.component.html @@ -3,7 +3,7 @@

{{'Catalog.Results.Title' | translate}} ({{numOfResult = new Array(); @@ -18,10 +18,25 @@ export class ResultsListComponent { @Output() onActionSelected = new EventEmitter(); @Output() onTitleSelected = new EventEmitter(); @Output() onPageSelected = new EventEmitter(); + + @ViewChild(MatPaginator) paginator: MatPaginator; + private recordIndex: number; constructor() { } + ngAfterViewInit() { + this.setRecordIndex(); + } + + ngOnChanges() { + this.setRecordIndex(); + } + + setRecordIndex() { + this.recordIndex = this.paginator.pageIndex * this.paginator.pageSize; + } + onActionsClick(selection: RecordSelection) { this.onActionSelected.emit(selection); } From 932a37e0ad9db6afbb25254da27f4da289dbe539 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Thu, 2 Sep 2021 10:14:51 +0300 Subject: [PATCH 14/28] Fixing Bugs Page index Back to the correct spot --- .../src/app/catalog/main/main.component.html | 6 +- .../src/app/catalog/main/main.component.ts | 73 +++++++++++-------- .../src/app/catalog/results-types/name.ts | 26 ++++--- .../catalog/results-types/results-common.ts | 18 ++++- .../app/catalog/results-types/uniformTitle.ts | 27 +++---- cloudapp/src/app/service/catalog.service.ts | 19 ++--- .../results-list/results-list.component.ts | 18 ++++- 7 files changed, 113 insertions(+), 74 deletions(-) diff --git a/cloudapp/src/app/catalog/main/main.component.html b/cloudapp/src/app/catalog/main/main.component.html index c1a95d2..a10fb49 100644 --- a/cloudapp/src/app/catalog/main/main.component.html +++ b/cloudapp/src/app/catalog/main/main.component.html @@ -44,9 +44,9 @@ - + diff --git a/cloudapp/src/app/catalog/main/main.component.ts b/cloudapp/src/app/catalog/main/main.component.ts index 0953103..87b90a7 100644 --- a/cloudapp/src/app/catalog/main/main.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -50,8 +50,8 @@ export class CatalogMainComponent implements AfterViewInit { // UI variables private panelState: boolean = true; private loading: boolean = false; - isRightTableOpen: boolean = false; - isColapsedMode: boolean = true; + private isRightTableOpen: boolean = false; + private isColapsedMode: boolean = true; // Search variables private urlParams: string = ""; @@ -73,6 +73,7 @@ export class CatalogMainComponent implements AfterViewInit { private currentResulsTmpl: TemplateRef; + constructor( private catalogService: CatalogService, private holdingsService: HoldingsService, @@ -86,7 +87,7 @@ export class CatalogMainComponent implements AfterViewInit { if(sessionStorage.getItem(ROUTING_STATE_KEY) == "") { this.catalogService.clearAllSearchResults(); } else { - this.searchFormRefill(); + this.onBackFromViewHolding(); } } @@ -132,7 +133,6 @@ export class CatalogMainComponent implements AfterViewInit { this.currentDatabase = this.getCurrentDatabases()[0]; if(this.catalogService.getSearchResults(this.currentSearchType).getResults() != null){ this.setSearchResultsDisplay(); - this.resultsTemplateFactory(); } else { this.currentResulsTmpl = this.notSearchedTmpl; this.panelState = true; @@ -142,41 +142,45 @@ export class CatalogMainComponent implements AfterViewInit { search() { // Generating the URL by the fields' Form Control - this.urlParams = ""; - let valuableFields = this.allFieldsMap.get(this.currentSearchType).filter(field => field.getFormControl().value !== null); + let urlParams = ""; + let valuableFields = this.allFieldsMap.get(this.currentSearchType).filter(field => (field.getFormControl().value != null) && (field.getFormControl().value != "")); if (valuableFields.length > 0){ - this.urlParams = this.urlParams + this.getPaginationIndex(); - this.urlParams = this.urlParams + "&" + QueryParams.SearchType + "=" + this.currentSearchType; - this.urlParams = this.urlParams + "&" + QueryParams.Databases + "=" + this.currentDatabase; + this.pageIndex = 0; + this.pageSize = 20; + urlParams = urlParams + this.generatePageParams(); + urlParams = urlParams + "&" + QueryParams.SearchType + "=" + this.currentSearchType; + urlParams = urlParams + "&" + QueryParams.Databases + "=" + this.currentDatabase; valuableFields.forEach(field => { - this.urlParams = this.urlParams + "&" + field.getKey(); - this.urlParams = this.urlParams + "=" + field.getFormControl().value; + urlParams = urlParams + "&" + field.getKey(); + urlParams = urlParams + "=" + field.getFormControl().value; }); - this.getResultsFromNacsis(false); + this.urlParams = urlParams; + this.getResultsFromNacsis(urlParams, false); } else { return; } } // Calling Nacsis servlet - getResultsFromNacsis(isFullViewLink: boolean) { + getResultsFromNacsis(urlParams:string, isFullViewLink: boolean) { this.loading = true; try{ - this.catalogService.getSearchResultsFromNacsis(this.urlParams, this.currentSearchType) + this.catalogService.getSearchResultsFromNacsis(urlParams) .subscribe({ next: (catalogResults) => { if (catalogResults.status === this.catalogService.OkStatus) { if(!isFullViewLink) { if (catalogResults.totalRecords >= 1) { - this.catalogService.setSearchResultsMap(this.currentSearchType, catalogResults) + this.catalogService.setSearchResultsMap(this.currentSearchType, catalogResults, urlParams) this.setSearchResultsDisplay(); } else { this.numOfResults = 0; + this.resultsTemplateFactory(); } - this.resultsTemplateFactory(); } else { let baseResult = this.catalogService.resultsTypeFactory(this.currentSearchType, catalogResults.records[0]); this.resultFullLinkDisplay = baseResult.getFullViewDisplay().initContentDisplay(); + this.isRightTableOpen = true; } } else { this.alert.error(catalogResults.errorMessage, {keepAfterRouteChange:true}); @@ -216,6 +220,7 @@ export class CatalogMainComponent implements AfterViewInit { this.resultsSummaryDisplay.push(result.getSummaryDisplay()); }); this.panelState = false; + this.resultsTemplateFactory(); } onActionsClick(selection: RecordSelection) { @@ -229,7 +234,7 @@ export class CatalogMainComponent implements AfterViewInit { this.onImportRecord(record.getFullRecordData().getRawData()); break; case 2: // View Holdings - this.onViewHoldings(record.getFullRecordData().getID(), record.initTitleDisplay().toString()); + this.onViewHoldings(record.getFullRecordData().getID(), record.initTitleDisplay().toStringLine()); break; default: { this.currentResulsTmpl = this.noResultsTmpl; @@ -254,14 +259,13 @@ export class CatalogMainComponent implements AfterViewInit { } onFullViewLink(fullViewLink: FullViewLink) { - this.urlParams = ""; - this.urlParams = this.urlParams + this.getPaginationIndex(); - this.urlParams = this.urlParams + "&" + QueryParams.SearchType + "=" + fullViewLink.searchType; - this.urlParams = this.urlParams + "&" + QueryParams.Databases + "=" + this.ALL_DATABASES_MAP.get(fullViewLink.searchType)[0]; - this.urlParams = this.urlParams + "&" + QueryParams.ID + "=" + fullViewLink.linkID; + let urlParams = ""; + urlParams = urlParams + QueryParams.PageIndex + "=0&" + QueryParams.PageSize + "=20"; + urlParams = urlParams + "&" + QueryParams.SearchType + "=" + fullViewLink.searchType; + urlParams = urlParams + "&" + QueryParams.Databases + "=" + this.ALL_DATABASES_MAP.get(fullViewLink.searchType)[0]; + urlParams = urlParams + "&" + QueryParams.ID + "=" + fullViewLink.linkID; - this.getResultsFromNacsis(true); - this.isRightTableOpen = true; + this.getResultsFromNacsis(urlParams, true); this.isColapsedMode = (window.innerWidth <= 600) ? true : false; } @@ -286,6 +290,7 @@ export class CatalogMainComponent implements AfterViewInit { next: (header) => { if (header.status === this.holdingsService.OkStatus) { sessionStorage.setItem(ROUTING_STATE_KEY, AppRoutingState.CatalogSearchPage); + this.catalogService.setCurrentSearchType(this.currentSearchType); this.router.navigate(['/holdings', nacsisId, title]); } else { this.alert.error(header.errorMessage, {keepAfterRouteChange:true}); @@ -305,6 +310,11 @@ export class CatalogMainComponent implements AfterViewInit { } } + onBackFromViewHolding() { + this.searchFormRefill(); + this.setSearchResultsDisplay(); + } + /*** Import ***/ onImportRecord(rawData: string) { @@ -333,14 +343,16 @@ export class CatalogMainComponent implements AfterViewInit { /*** Pagination ***/ - getPaginationIndex() { + generatePageParams(): string { return QueryParams.PageIndex + "=" + this.pageIndex + "&" + QueryParams.PageSize + "=" + this.pageSize; } - + onPageAction(pageEvent: PageEvent) { this.pageIndex = pageEvent.pageIndex; this.pageSize = pageEvent.pageSize; - this.search(); + let pageParams = this.generatePageParams(); + let nextPagrUrlParams = this.urlParams.replace("pageIndex=0&pageSize=20", pageParams); + this.getResultsFromNacsis(nextPagrUrlParams, false); } @@ -350,14 +362,15 @@ export class CatalogMainComponent implements AfterViewInit { let paramAsKeyValue = param.split("="); paramsMap.set(paramAsKeyValue[0],paramAsKeyValue[1]); }); - this.currentSearchType = SearchType[paramsMap.get('searchType')]; - this.currentDatabase = paramsMap.get('database'); + this.pageIndex = paramsMap.get(QueryParams.PageIndex); + this.pageSize = paramsMap.get(QueryParams.PageSize); + this.currentSearchType = SearchType[paramsMap.get(QueryParams.SearchType)]; + this.currentDatabase = paramsMap.get(QueryParams.Databases); this.allFieldsMap.get(this.currentSearchType).forEach(field => { if(paramsMap.has(field.getKey())){ field.setFormControl(paramsMap.get(field.getKey())); } }); - this.setSearchResultsDisplay(); } diff --git a/cloudapp/src/app/catalog/results-types/name.ts b/cloudapp/src/app/catalog/results-types/name.ts index 2243d7c..700d00b 100644 --- a/cloudapp/src/app/catalog/results-types/name.ts +++ b/cloudapp/src/app/catalog/results-types/name.ts @@ -21,9 +21,7 @@ export class Name extends BaseResult { } export class NameSummary{ - HDNGD: string = ""; - HDNGR: string = ""; - HDNGVR: string = ""; + HDNG: NameHDNG[]; ID: string = ""; } @@ -33,9 +31,7 @@ export class NameFull{ CRTFA: string = ""; RNWDT: string = ""; RNWFA: string = ""; - HDNGD: string = ""; - HDNGR: string = ""; - HDNGVR: string = ""; + HDNG: NameHDNG[]; LCAID: string = ""; TYPE: string = ""; PLACE: string = ""; @@ -45,6 +41,12 @@ export class NameFull{ NOTE: NameNOTE[]; } +export class NameHDNG { + HDNGD: string = ""; + HDNGR: string = ""; + HDNGVR: string = ""; +} + export class NameSF{ SFD: string = ""; SFR: string = ""; @@ -76,9 +78,9 @@ export class NameSummaryDisplay extends IDisplayLines{ initTitleDisplay(): ViewLine { let fieldsArray = new Array(); - fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNGD).build()); - fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGR).build()); - fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNG[0].HDNGD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGVR).build()); this.titleLine = new ViewLine(new ViewFieldBuilder().build(), fieldsArray.filter(field => field.hasContent() === true)); return this.titleLine; } @@ -111,9 +113,9 @@ export class NameFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); fieldsArray = new Array(); - fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNGD).build()); - fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGR).build()); - fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNG[0].HDNGD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGVR).build()); this.addLine(new ViewFieldBuilder().label("HDNG").build(), fieldsArray); fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().content(this.record.LCAID).build()); diff --git a/cloudapp/src/app/catalog/results-types/results-common.ts b/cloudapp/src/app/catalog/results-types/results-common.ts index 63ddab1..2ae3654 100644 --- a/cloudapp/src/app/catalog/results-types/results-common.ts +++ b/cloudapp/src/app/catalog/results-types/results-common.ts @@ -8,6 +8,7 @@ export const BLANK_SPACE = " "; export class NacsisCatalogResults { header: ResultsHeader; results: Array; + queryParams: string; constructor(){ } @@ -26,6 +27,14 @@ export class NacsisCatalogResults { setResults(arr: Array) { this.results = arr; } + + getQueryParams() { + return this.queryParams; + } + + setQueryParams(urlParams: string) { + this.queryParams = urlParams; + } } @@ -154,11 +163,14 @@ export class ViewLine { return this.content; } - public toString(): string{ + protected toStringLine(): string{ let lines = ""; this.content.forEach(field => { - lines = lines + field.getLabel() + " "; - lines = lines + field.getContent() + " "; + if(field.getLabel() != undefined){ + lines = lines + field.getLabel() + " "; + } if(field.getContent() != undefined){ + lines = lines + field.getContent() + " "; + } }); return lines; } diff --git a/cloudapp/src/app/catalog/results-types/uniformTitle.ts b/cloudapp/src/app/catalog/results-types/uniformTitle.ts index a73c4e2..e78b541 100644 --- a/cloudapp/src/app/catalog/results-types/uniformTitle.ts +++ b/cloudapp/src/app/catalog/results-types/uniformTitle.ts @@ -21,9 +21,7 @@ export class UniformTitle extends BaseResult { } export class UniformTitleSummary{ - HDNGD: string = ""; - HDNGR: string = ""; - HDNGVR: string = ""; + HDNG: UniformTitleHDNG[]; ID: string = ""; } @@ -34,10 +32,7 @@ export class UniformTitleFull{ CRTFA: string = ""; RNWDT: string = ""; RNWFA: string = ""; - // HDNG - HDNGD: string = ""; - HDNGR: string = ""; - HDNGVR: string = ""; + HDNG: UniformTitleHDNG[]; // LCUID LCUID: string = ""; // SF @@ -48,6 +43,12 @@ export class UniformTitleFull{ NOTE: UniformTitleNOTE[]; } +export class UniformTitleHDNG { + HDNGD: string = ""; + HDNGR: string = ""; + HDNGVR: string = ""; +} + export class UniformTitleSF{ SFD: string = ""; SFR: string = ""; @@ -80,9 +81,9 @@ export class UniformTitleSummaryDisplay extends IDisplayLines{ initTitleDisplay(): ViewLine { let fieldsArray = new Array(); - fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNGD).build()); - fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGR).build()); - fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNG[0].HDNGD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGVR).build()); this.titleLine = new ViewLine(new ViewFieldBuilder().build(), fieldsArray.filter(field => field.hasContent() === true)); return this.titleLine; } @@ -116,9 +117,9 @@ export class UniformTitleFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); fieldsArray = new Array(); - fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNGD).build()); - fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGR).build()); - fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNGVR).build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNG[0].HDNGD).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGVR).build()); this.addLine(new ViewFieldBuilder().label("HDNG").build(), fieldsArray); fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().content(this.record.LCUID).build()); diff --git a/cloudapp/src/app/service/catalog.service.ts b/cloudapp/src/app/service/catalog.service.ts index e81a7be..1336b22 100644 --- a/cloudapp/src/app/service/catalog.service.ts +++ b/cloudapp/src/app/service/catalog.service.ts @@ -21,11 +21,8 @@ import { AlmaApiService, IntegrationProfile } from './alma.api.service'; }) export class CatalogService extends BaseService { - private resultsHeader: ResultsHeader; private searchResultsMap: Map; - private integrationProfile: string; - - public queryParams: string = ""; + public currentSearchType: SearchType; constructor( protected eventsService: CloudAppEventsService, @@ -50,8 +47,9 @@ export class CatalogService extends BaseService { return this.searchResultsMap.get(type); } - setSearchResultsMap(searchType: SearchType, response: any) { + setSearchResultsMap(searchType: SearchType, response: any, urlParams: string) { this.searchResultsMap.get(searchType).setHeader(response); + this.searchResultsMap.get(searchType).setQueryParams(urlParams); this.searchResultsMap.get(searchType).setResults(new Array()); response.records.forEach(record => { this.searchResultsMap.get(searchType).getResults().push(this.resultsTypeFactory(searchType, record)); @@ -61,9 +59,13 @@ export class CatalogService extends BaseService { clearAllSearchResults(){ this.initResultsMap(); } + + setCurrentSearchType(searchType: SearchType) { + this.currentSearchType = searchType; + } getQueryParams() { - return this.queryParams; + return this.searchResultsMap.get(this.currentSearchType).getQueryParams(); } setBaseUrl(initData: InitData) : string { @@ -72,14 +74,13 @@ export class CatalogService extends BaseService { return baseUrl; } - getSearchResultsFromNacsis(queryParams: string, searchType:SearchType){ + getSearchResultsFromNacsis(queryParams: string){ let fullUrl: string; - this.queryParams = queryParams; return this.getInitData().pipe( mergeMap(initData => { - fullUrl = this.setBaseUrl(initData) + this.queryParams; + fullUrl = this.setBaseUrl(initData) + queryParams; return this.getAuthToken() }), mergeMap(authToken => { diff --git a/cloudapp/src/app/user-controls/results-list/results-list.component.ts b/cloudapp/src/app/user-controls/results-list/results-list.component.ts index 0a12701..d0a79ba 100644 --- a/cloudapp/src/app/user-controls/results-list/results-list.component.ts +++ b/cloudapp/src/app/user-controls/results-list/results-list.component.ts @@ -13,6 +13,8 @@ import { RecordSelection } from '../result-card/result-card.component'; export class ResultsListComponent implements OnChanges, AfterViewInit { @Input() numOfResults: number; + @Input() pageIndex: number; + @Input() pageSize: number; @Input() resultsSummaryDisplay: Array = new Array(); @Input() resultActionList: Array = new Array(); @Output() onActionSelected = new EventEmitter(); @@ -26,22 +28,30 @@ export class ResultsListComponent implements OnChanges, AfterViewInit { constructor() { } ngAfterViewInit() { - this.setRecordIndex(); + this.setPageVariables(); } ngOnChanges() { - this.setRecordIndex(); + if(this.paginator == undefined) { // For case that ngOnChanges() is called at initialization + this.recordIndex = 0; + } else{ + this.setPageVariables(); + } } - setRecordIndex() { - this.recordIndex = this.paginator.pageIndex * this.paginator.pageSize; + setPageVariables() { + this.paginator.pageIndex = this.pageIndex; + this.paginator.pageSize = this.pageSize; + this.recordIndex = this.pageIndex * this.pageSize; } onActionsClick(selection: RecordSelection) { + selection.recordIndex = selection.recordIndex - this.recordIndex; // Geting omly the for loop's index (i) this.onActionSelected.emit(selection); } onTitleClick(recordIndex: number) { + recordIndex = recordIndex - this.recordIndex; // Geting omly the for loop's index (i) this.onTitleSelected.emit(recordIndex); } From 04d3d96b72fb2f819b35f97fd2e9b9d7f1e79f37 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Thu, 9 Sep 2021 15:52:20 +0300 Subject: [PATCH 15/28] small changes --- .../src/app/catalog/main/main.component.html | 11 +++-- .../src/app/catalog/main/main.component.ts | 46 ++++++++++--------- .../app/catalog/results-types/monographs.ts | 4 +- .../src/app/catalog/results-types/name.ts | 3 ++ .../src/app/catalog/results-types/serials.ts | 3 ++ .../app/catalog/results-types/uniformTitle.ts | 3 ++ cloudapp/src/app/service/alma.api.service.ts | 5 +- cloudapp/src/app/service/catalog.service.ts | 8 +++- 8 files changed, 54 insertions(+), 29 deletions(-) diff --git a/cloudapp/src/app/catalog/main/main.component.html b/cloudapp/src/app/catalog/main/main.component.html index a10fb49..1eb1a90 100644 --- a/cloudapp/src/app/catalog/main/main.component.html +++ b/cloudapp/src/app/catalog/main/main.component.html @@ -45,8 +45,9 @@ + [resultsSummaryDisplay]="resultsSummaryDisplay" [resultActionList]="resultActionList" + (onActionSelected)="onActionsClick($event)" (onTitleSelected)="onTitleClick($event)" + (onPageSelected)="onPageAction($event)"> @@ -80,8 +81,10 @@

{{'Catalog.Results.NoRecordsExist' | translate}}

- - +
+ + +

diff --git a/cloudapp/src/app/catalog/main/main.component.ts b/cloudapp/src/app/catalog/main/main.component.ts index 87b90a7..eb00416 100644 --- a/cloudapp/src/app/catalog/main/main.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -8,14 +8,10 @@ import { Router } from '@angular/router'; import { PageEvent } from '@angular/material/paginator'; import { NacsisCatalogResults, BaseResult, IDisplayLines } from '../results-types/results-common' -import { MonographSummaryDisplay, MonographFullDisplay } from '../results-types/monographs' -import { SerialSummaryDisplay, SerialFullDisplay } from '../results-types/serials'; -import { NameSummaryDisplay, NameFullDisplay } from '../results-types/name'; -import { UniformTitleFullDisplay, UniformTitleSummaryDisplay } from '../results-types/uniformTitle'; -import { HoldingsService } from '../../service/holdings.service'; import { AppRoutingState, ROUTING_STATE_KEY } from '../../service/base.service'; import { RecordSelection } from '../../user-controls/result-card/result-card.component'; import { FullViewLink } from '../full-view-display/full-view-display.component'; +import { HoldingsService } from '../../service/holdings.service'; @@ -54,7 +50,6 @@ export class CatalogMainComponent implements AfterViewInit { private isColapsedMode: boolean = true; // Search variables - private urlParams: string = ""; private catalogResultsData: NacsisCatalogResults; private numOfResults: number; private pageIndex: number = 0; @@ -145,16 +140,13 @@ export class CatalogMainComponent implements AfterViewInit { let urlParams = ""; let valuableFields = this.allFieldsMap.get(this.currentSearchType).filter(field => (field.getFormControl().value != null) && (field.getFormControl().value != "")); if (valuableFields.length > 0){ - this.pageIndex = 0; - this.pageSize = 20; - urlParams = urlParams + this.generatePageParams(); + urlParams = urlParams + QueryParams.PageIndex + "=0&" + QueryParams.PageSize + "=20"; urlParams = urlParams + "&" + QueryParams.SearchType + "=" + this.currentSearchType; urlParams = urlParams + "&" + QueryParams.Databases + "=" + this.currentDatabase; valuableFields.forEach(field => { urlParams = urlParams + "&" + field.getKey(); urlParams = urlParams + "=" + field.getFormControl().value; }); - this.urlParams = urlParams; this.getResultsFromNacsis(urlParams, false); } else { return; @@ -171,16 +163,22 @@ export class CatalogMainComponent implements AfterViewInit { if (catalogResults.status === this.catalogService.OkStatus) { if(!isFullViewLink) { if (catalogResults.totalRecords >= 1) { - this.catalogService.setSearchResultsMap(this.currentSearchType, catalogResults, urlParams) + this.catalogService.setSearchResultsMap(this.currentSearchType, catalogResults, urlParams); + this.setPageIndexAndSize(urlParams); this.setSearchResultsDisplay(); } else { this.numOfResults = 0; this.resultsTemplateFactory(); } } else { - let baseResult = this.catalogService.resultsTypeFactory(this.currentSearchType, catalogResults.records[0]); - this.resultFullLinkDisplay = baseResult.getFullViewDisplay().initContentDisplay(); - this.isRightTableOpen = true; + if (catalogResults.totalRecords >= 1) { + let baseResult = this.catalogService.resultsTypeFactory(this.currentSearchType, catalogResults.records[0]); + this.resultFullLinkDisplay = baseResult.getFullViewDisplay().initContentDisplay(); + this.isRightTableOpen = true; + } else { + this.resultFullLinkDisplay == null; + this.isRightTableOpen = true; + } } } else { this.alert.error(catalogResults.errorMessage, {keepAfterRouteChange:true}); @@ -343,16 +341,22 @@ export class CatalogMainComponent implements AfterViewInit { /*** Pagination ***/ - generatePageParams(): string { - return QueryParams.PageIndex + "=" + this.pageIndex + "&" + QueryParams.PageSize + "=" + this.pageSize; + setPageIndexAndSize(urlParams: string) { + let pageIndexParam = QueryParams.PageIndex + "="; + let pageSizeParam = "&" + QueryParams.PageSize + "="; + let searchTypeParam = "&" + QueryParams.SearchType; + this.pageIndex = Number(urlParams.split(pageIndexParam).pop().split(pageSizeParam)[0]); + this.pageSize = Number(urlParams.split(pageSizeParam).pop().split(searchTypeParam)[0]); } onPageAction(pageEvent: PageEvent) { - this.pageIndex = pageEvent.pageIndex; - this.pageSize = pageEvent.pageSize; - let pageParams = this.generatePageParams(); - let nextPagrUrlParams = this.urlParams.replace("pageIndex=0&pageSize=20", pageParams); - this.getResultsFromNacsis(nextPagrUrlParams, false); + let urlParams = this.catalogService.getQueryParams(this.currentSearchType); + let newIndexStr = QueryParams.PageIndex + "=" + pageEvent.pageIndex + "&" + QueryParams.PageSize; + urlParams = urlParams.replace(/pageIndex=.*pageSize/, newIndexStr); + let newSizeStr = QueryParams.PageSize + "=" + pageEvent.pageSize + "&" + QueryParams.SearchType; + urlParams = urlParams.replace(/pageSize=.*searchType/, newSizeStr); + + this.getResultsFromNacsis(urlParams, false); } diff --git a/cloudapp/src/app/catalog/results-types/monographs.ts b/cloudapp/src/app/catalog/results-types/monographs.ts index 6069eef..cec8232 100644 --- a/cloudapp/src/app/catalog/results-types/monographs.ts +++ b/cloudapp/src/app/catalog/results-types/monographs.ts @@ -231,12 +231,14 @@ export class MonographFullDisplay extends IDisplayLines { initContentDisplay(){ this.viewLines = new Array(); let fieldsArray = new Array() - fieldsArray = new Array() fieldsArray.push(new ViewFieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link(SearchType.Member).build()); fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array() + fieldsArray.push(new ViewFieldBuilder().content(this.record.ID).build()); + this.addLine(new ViewFieldBuilder().label("ID").build(), fieldsArray); fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().label("ISSN: ").content(this.record.ISSN).build()); fieldsArray.push(new ViewFieldBuilder().label("NBN: ").content(this.record.NBN).build()); diff --git a/cloudapp/src/app/catalog/results-types/name.ts b/cloudapp/src/app/catalog/results-types/name.ts index 700d00b..01bb2e6 100644 --- a/cloudapp/src/app/catalog/results-types/name.ts +++ b/cloudapp/src/app/catalog/results-types/name.ts @@ -112,6 +112,9 @@ export class NameFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array() + fieldsArray.push(new ViewFieldBuilder().content(this.record.ID).build()); + this.addLine(new ViewFieldBuilder().label("ID").build(), fieldsArray); fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNG[0].HDNGD).build()); fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGR).build()); diff --git a/cloudapp/src/app/catalog/results-types/serials.ts b/cloudapp/src/app/catalog/results-types/serials.ts index e6af15f..aea45ad 100644 --- a/cloudapp/src/app/catalog/results-types/serials.ts +++ b/cloudapp/src/app/catalog/results-types/serials.ts @@ -228,6 +228,9 @@ export class SerialFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array() + fieldsArray.push(new ViewFieldBuilder().content(this.record.ID).build()); + this.addLine(new ViewFieldBuilder().label("ID").build(), fieldsArray); fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().label("ISSN: ").content(this.record.ISSN).build()); fieldsArray.push(new ViewFieldBuilder().label("XISSN: ").content(this.record.XISSN).build()); diff --git a/cloudapp/src/app/catalog/results-types/uniformTitle.ts b/cloudapp/src/app/catalog/results-types/uniformTitle.ts index e78b541..eee2805 100644 --- a/cloudapp/src/app/catalog/results-types/uniformTitle.ts +++ b/cloudapp/src/app/catalog/results-types/uniformTitle.ts @@ -116,6 +116,9 @@ export class UniformTitleFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); + fieldsArray = new Array() + fieldsArray.push(new ViewFieldBuilder().content(this.record.ID).build()); + this.addLine(new ViewFieldBuilder().label("ID").build(), fieldsArray); fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().content(this.record.HDNG[0].HDNGD).build()); fieldsArray.push(new ViewFieldBuilder().label("|| ").content(this.record.HDNG[0].HDNGR).build()); diff --git a/cloudapp/src/app/service/alma.api.service.ts b/cloudapp/src/app/service/alma.api.service.ts index 3994d44..2345126 100644 --- a/cloudapp/src/app/service/alma.api.service.ts +++ b/cloudapp/src/app/service/alma.api.service.ts @@ -66,7 +66,7 @@ export class AlmaApiService { if(this.integrationProfile != null && this.integrationProfile != undefined) { return of(this.integrationProfile) } - + let libraryID: string = null; let repositoryImportProfile: string = null; let authorityImportProfileNames: string = null; let authorityImportProfileUniformTitles: string = null; @@ -75,6 +75,7 @@ export class AlmaApiService { mergeMap(response => { // extract integration profile let nacsisIntegrationProfile = response.integration_profile[0]; // assume can be only one CENTRAL_CATALOG_INTEGRATION + libraryID = nacsisIntegrationProfile.parameter.filter(param => param.action.value == "CENTRAL_CATALOG_INFORMATION_B" && param.name.value == "nacsisLibraryId")[0].value; // extract import profiles let ContributionConfigurationParams = nacsisIntegrationProfile.parameter.filter(param => param.action.value == "CENTRAL_CATALOG_CONTRIBUTION_CONFIGURATION"); repositoryImportProfile = ContributionConfigurationParams.filter(param => param.name.value == "repositoryImportProfile")[0].value; @@ -92,6 +93,7 @@ export class AlmaApiService { this.integrationProfile = new IntegrationProfile(); this.integrationProfile.libraryCode = libraryCode; + this.integrationProfile.libraryID = libraryID; this.integrationProfile.systemPrefix = systemPrefix; this.integrationProfile.repositoryImportProfile = repositoryImportProfile; this.integrationProfile.authorityImportProfileNames = authorityImportProfileNames; @@ -105,6 +107,7 @@ export class AlmaApiService { export class IntegrationProfile { libraryCode: string; + libraryID: string; systemPrefix: string; repositoryImportProfile: string; authorityImportProfileNames: string; diff --git a/cloudapp/src/app/service/catalog.service.ts b/cloudapp/src/app/service/catalog.service.ts index 1336b22..f4c296a 100644 --- a/cloudapp/src/app/service/catalog.service.ts +++ b/cloudapp/src/app/service/catalog.service.ts @@ -64,8 +64,12 @@ export class CatalogService extends BaseService { this.currentSearchType = searchType; } - getQueryParams() { - return this.searchResultsMap.get(this.currentSearchType).getQueryParams(); + getQueryParams(searchType?: SearchType) { + if(searchType !== undefined) { + return this.searchResultsMap.get(searchType).getQueryParams(); + } else { + return this.searchResultsMap.get(this.currentSearchType).getQueryParams(); + } } setBaseUrl(initData: InitData) : string { From 34f558986e51081cedac4da4ada9e7660d3c117e Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Sun, 12 Sep 2021 18:59:43 +0300 Subject: [PATCH 16/28] Suitable Action Menu --- cloudapp/src/app/catalog/main/form-utils.ts | 2 +- .../src/app/catalog/main/main.component.html | 2 +- cloudapp/src/app/catalog/main/main.component.ts | 16 +++++++++++++--- cloudapp/src/i18n/en.json | 9 +++++---- 4 files changed, 20 insertions(+), 9 deletions(-) diff --git a/cloudapp/src/app/catalog/main/form-utils.ts b/cloudapp/src/app/catalog/main/form-utils.ts index 0540c3c..f3a891b 100644 --- a/cloudapp/src/app/catalog/main/form-utils.ts +++ b/cloudapp/src/app/catalog/main/form-utils.ts @@ -67,7 +67,6 @@ export enum FieldName { FTITLE = "FTITLE", PTBL = "PTBL", VOL = "VOL", - TiPtVo = "TiPtVo", AUTH = "AUTH", ISSN = "ISSN", ISBN = "ISBN", @@ -84,6 +83,7 @@ export enum FieldName { PID = "PID", CODEN = "CODEN", NDLPN = "NDLPN", + LCCN = "LCCN", FID = "FID", DATE = "DATE", SAID = "SAID", diff --git a/cloudapp/src/app/catalog/main/main.component.html b/cloudapp/src/app/catalog/main/main.component.html index 1eb1a90..a788e3b 100644 --- a/cloudapp/src/app/catalog/main/main.component.html +++ b/cloudapp/src/app/catalog/main/main.component.html @@ -45,7 +45,7 @@ diff --git a/cloudapp/src/app/catalog/main/main.component.ts b/cloudapp/src/app/catalog/main/main.component.ts index eb00416..dec093b 100644 --- a/cloudapp/src/app/catalog/main/main.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -31,12 +31,18 @@ export class CatalogMainComponent implements AfterViewInit { [SearchType.UniformTitles, ['TITLE', 'USMARCT']] ]); public allFieldsMap = new Map([ - [SearchType.Monographs, [new SearchField(FieldName.TITLE, FieldSize.large), new SearchField(FieldName.FTITLE), new SearchField(FieldName.PTBL), new SearchField(FieldName.VOL), new SearchField(FieldName.TiPtVo), new SearchField(FieldName.AUTH), new SearchField(FieldName.ISSN), new SearchField(FieldName.ISBN), new SearchField(FieldName.NBN), new SearchField(FieldName.NDLCN), new SearchField(FieldName.PUB), new SearchField(FieldName.YEAR), new SearchField(FieldName.PLACE), new SearchField(FieldName.CNTRY), new SearchField(FieldName.LANG), new SearchField(FieldName.SH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.PID)]], - [SearchType.Serials, [new SearchField(FieldName.TITLE), new SearchField(FieldName.FTITLE), new SearchField(FieldName.AUTH), new SearchField(FieldName.ISSN), new SearchField(FieldName.CODEN), new SearchField(FieldName.NDLPN), new SearchField(FieldName.PUB), new SearchField(FieldName.YEAR), new SearchField(FieldName.PLACE), new SearchField(FieldName.CNTRY), new SearchField(FieldName.LANG), new SearchField(FieldName.SH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.FID)]], + [SearchType.Monographs, [new SearchField(FieldName.TITLE, FieldSize.large), new SearchField(FieldName.FTITLE), new SearchField(FieldName.PTBL), new SearchField(FieldName.VOL), new SearchField(FieldName.AUTH), new SearchField(FieldName.ISSN), new SearchField(FieldName.ISBN), new SearchField(FieldName.NBN), new SearchField(FieldName.NDLCN), new SearchField(FieldName.LCCN), new SearchField(FieldName.PUB), new SearchField(FieldName.YEAR), new SearchField(FieldName.PLACE), new SearchField(FieldName.CNTRY), new SearchField(FieldName.LANG), new SearchField(FieldName.SH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.PID)]], + [SearchType.Serials, [new SearchField(FieldName.TITLE), new SearchField(FieldName.FTITLE), new SearchField(FieldName.AUTH), new SearchField(FieldName.ISSN), new SearchField(FieldName.CODEN), new SearchField(FieldName.NDLPN), new SearchField(FieldName.LCCN), new SearchField(FieldName.PUB), new SearchField(FieldName.YEAR), new SearchField(FieldName.PLACE), new SearchField(FieldName.CNTRY), new SearchField(FieldName.LANG), new SearchField(FieldName.SH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.FID)]], [SearchType.Names, [new SearchField(FieldName.AUTH), new SearchField(FieldName.AKEY), new SearchField(FieldName.PLACE), new SearchField(FieldName.DATE), new SearchField(FieldName.ID), new SearchField(FieldName.SAID)]], [SearchType.UniformTitles, [new SearchField(FieldName.TITLE), new SearchField(FieldName.AUTH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.SAID)]] ]); - private resultActionList: Array = ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import', 'Catalog.Results.Actions.ViewHoldings'] + public ACTIONS_MENU_LIST = new Map([ + [SearchType.Monographs, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import', 'Catalog.Results.Actions.ViewHoldings']], + [SearchType.Serials, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import', 'Catalog.Results.Actions.ViewHoldings']], + [SearchType.Names, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import']], + [SearchType.UniformTitles, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import']] + ]); + // private resultActionList: Array = ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import', 'Catalog.Results.Actions.ViewHoldings'] // Selection variables @@ -210,6 +216,10 @@ export class CatalogMainComponent implements AfterViewInit { /*** Summary View Section ***/ + private getActionMenu() { + return this.ACTIONS_MENU_LIST.get(this.currentSearchType); + } + private setSearchResultsDisplay(){ this.catalogResultsData = this.catalogService.getSearchResults(this.currentSearchType); this.numOfResults = this.catalogResultsData.getHeader().totalRecords; diff --git a/cloudapp/src/i18n/en.json b/cloudapp/src/i18n/en.json index 5371d02..494c609 100644 --- a/cloudapp/src/i18n/en.json +++ b/cloudapp/src/i18n/en.json @@ -91,7 +91,8 @@ "Errors": { "NoNoldings": "No holdings record were found", "GetFailed": "Get holdings failed", - "DeleteFailed": "Delete holding failed" + "DeleteFailed": "Delete holding failed", + "Uneditable": "This holding is not a member of +++ therefore can't be edit" } }, "Form": { @@ -146,12 +147,11 @@ "FTITLE": "FTITLE", "PTBL": "PTBL", "VOL": "VOL", - "TiPtVo": "TITLE / PTBL / VOL", "AUTH": "AUTH", "ISSN": "ISSN", "ISBN": "ISBN", "NBN": "NBN", - "NDLCN": "NDLCN / LCCN / OTHN", + "NDLCN": "NDLCN", "PUB": "PUB", "YEAR": "YEAR", "PLACE": "PLACE", @@ -162,7 +162,8 @@ "ID": "ID", "PID": "PID", "CODEN": "CODEN", - "NDLPN": "NDLPN / LCCN", + "NDLPN": "NDLPN", + "LCCN": "LCCN", "FID": "FID", "DATE": "DATE", "SAID": "SAID" From 92b283ed0bed3dc0f2eb5eb50ffc9c272633e636 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Sun, 12 Sep 2021 19:00:28 +0300 Subject: [PATCH 17/28] Importing an Authority Record --- cloudapp/src/app/service/catalog.service.ts | 20 ++++++++++++++------ 1 file changed, 14 insertions(+), 6 deletions(-) diff --git a/cloudapp/src/app/service/catalog.service.ts b/cloudapp/src/app/service/catalog.service.ts index f4c296a..a87c365 100644 --- a/cloudapp/src/app/service/catalog.service.ts +++ b/cloudapp/src/app/service/catalog.service.ts @@ -117,9 +117,9 @@ export class CatalogService extends BaseService { importRecordToAlma(searchType: SearchType, rawData: string) { return this.almaApi.getIntegrationProfile().pipe( mergeMap(integrationProfile => { - let integrationProfileID = this.integrationProfileFactory(searchType, integrationProfile); - let body = "catp"; - return this.http.post("/almaws/v1/bibs?import_profile="+integrationProfileID, body) + let factoryValues = this.integrationProfileFactory(searchType, integrationProfile); + let body = "<" + factoryValues.typeTag + ">catp"; + return this.http.post("/almaws/v1/bibs" + factoryValues.urlType + "?import_profile=" + factoryValues.ID, body) }), mergeMap(response => { return of(response); @@ -131,14 +131,22 @@ export class CatalogService extends BaseService { integrationProfileFactory(searchType: SearchType, integrationProfile: IntegrationProfile) { switch(searchType) { case (SearchType.Monographs || SearchType.Serials): - return integrationProfile.repositoryImportProfile; + return { typeTag: "bib", urlType: "", ID: integrationProfile.repositoryImportProfile }; case (SearchType.Names): - return integrationProfile.authorityImportProfileNames; + return { typeTag: "authority", urlType: "/authorities", ID: integrationProfile.authorityImportProfileNames }; case (SearchType.UniformTitles): - return integrationProfile.authorityImportProfileUniformTitles; + return { typeTag: "authority", urlType: "/authorities", ID: integrationProfile.authorityImportProfileUniformTitles}; } } } +/* +*** BIB *** +url - /almaws/v1/bibs? +tags - +*** AUTH *** +url - almaws/v1/bibs/authorities? +tags - +*/ \ No newline at end of file From 8720b861244ff573af322a2682e335d0bcd72f09 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Mon, 13 Sep 2021 13:11:10 +0300 Subject: [PATCH 18/28] Updating the Search Fields Sizes --- cloudapp/src/app/catalog/main/form-utils.ts | 8 +- .../src/app/catalog/main/main.component.ts | 78 ++++++++++++++++--- .../search-form/search-form.component.scss | 35 ++++++--- 3 files changed, 96 insertions(+), 25 deletions(-) diff --git a/cloudapp/src/app/catalog/main/form-utils.ts b/cloudapp/src/app/catalog/main/form-utils.ts index f3a891b..4e826aa 100644 --- a/cloudapp/src/app/catalog/main/form-utils.ts +++ b/cloudapp/src/app/catalog/main/form-utils.ts @@ -6,7 +6,7 @@ export class SearchField { key: FieldName; fieldLabel: string; formControl: FormControl; - fieldLength: FieldSize = FieldSize.regular; + fieldLength: FieldSize; constructor(key: FieldName, fieldSize?: FieldSize){ this.key = key; @@ -58,8 +58,10 @@ export enum QueryParams { } export enum FieldSize { - regular = "form-card-child-regular", - large = "form-card-child-large" + fullWidth = "form-card-field-full-width", + large = "form-card-field-large", + medium = "form-card-field-medium", + small = "form-card-field-small" } export enum FieldName { diff --git a/cloudapp/src/app/catalog/main/main.component.ts b/cloudapp/src/app/catalog/main/main.component.ts index dec093b..4d11ac6 100644 --- a/cloudapp/src/app/catalog/main/main.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -30,11 +30,11 @@ export class CatalogMainComponent implements AfterViewInit { [SearchType.Names, ['NAME', 'JPMARCA', 'USMARCA']], [SearchType.UniformTitles, ['TITLE', 'USMARCT']] ]); - public allFieldsMap = new Map([ - [SearchType.Monographs, [new SearchField(FieldName.TITLE, FieldSize.large), new SearchField(FieldName.FTITLE), new SearchField(FieldName.PTBL), new SearchField(FieldName.VOL), new SearchField(FieldName.AUTH), new SearchField(FieldName.ISSN), new SearchField(FieldName.ISBN), new SearchField(FieldName.NBN), new SearchField(FieldName.NDLCN), new SearchField(FieldName.LCCN), new SearchField(FieldName.PUB), new SearchField(FieldName.YEAR), new SearchField(FieldName.PLACE), new SearchField(FieldName.CNTRY), new SearchField(FieldName.LANG), new SearchField(FieldName.SH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.PID)]], - [SearchType.Serials, [new SearchField(FieldName.TITLE), new SearchField(FieldName.FTITLE), new SearchField(FieldName.AUTH), new SearchField(FieldName.ISSN), new SearchField(FieldName.CODEN), new SearchField(FieldName.NDLPN), new SearchField(FieldName.LCCN), new SearchField(FieldName.PUB), new SearchField(FieldName.YEAR), new SearchField(FieldName.PLACE), new SearchField(FieldName.CNTRY), new SearchField(FieldName.LANG), new SearchField(FieldName.SH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.FID)]], - [SearchType.Names, [new SearchField(FieldName.AUTH), new SearchField(FieldName.AKEY), new SearchField(FieldName.PLACE), new SearchField(FieldName.DATE), new SearchField(FieldName.ID), new SearchField(FieldName.SAID)]], - [SearchType.UniformTitles, [new SearchField(FieldName.TITLE), new SearchField(FieldName.AUTH), new SearchField(FieldName.AKEY), new SearchField(FieldName.ID), new SearchField(FieldName.SAID)]] + public ALL_SEARCH_FIELDS_MAP = new Map([ + [SearchType.Monographs, this.initMonographsSearchFields()], + [SearchType.Serials, this.initSerialsSearchFields()], + [SearchType.Names, this.initNamesSearchFields()], + [SearchType.UniformTitles, this.initUniformTitlesSearchFields()] ]); public ACTIONS_MENU_LIST = new Map([ [SearchType.Monographs, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import', 'Catalog.Results.Actions.ViewHoldings']], @@ -42,7 +42,6 @@ export class CatalogMainComponent implements AfterViewInit { [SearchType.Names, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import']], [SearchType.UniformTitles, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import']] ]); - // private resultActionList: Array = ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import', 'Catalog.Results.Actions.ViewHoldings'] // Selection variables @@ -74,7 +73,6 @@ export class CatalogMainComponent implements AfterViewInit { private currentResulsTmpl: TemplateRef; - constructor( private catalogService: CatalogService, private holdingsService: HoldingsService, @@ -112,11 +110,11 @@ export class CatalogMainComponent implements AfterViewInit { } getSearchFields(): Array { - return this.allFieldsMap.get(this.currentSearchType); + return this.ALL_SEARCH_FIELDS_MAP.get(this.currentSearchType); } clear() { - this.allFieldsMap.get(this.currentSearchType).forEach(searchField => { + this.ALL_SEARCH_FIELDS_MAP.get(this.currentSearchType).forEach(searchField => { searchField.getFormControl().setValue(null) }); } @@ -144,7 +142,7 @@ export class CatalogMainComponent implements AfterViewInit { search() { // Generating the URL by the fields' Form Control let urlParams = ""; - let valuableFields = this.allFieldsMap.get(this.currentSearchType).filter(field => (field.getFormControl().value != null) && (field.getFormControl().value != "")); + let valuableFields = this.ALL_SEARCH_FIELDS_MAP.get(this.currentSearchType).filter(field => (field.getFormControl().value != null) && (field.getFormControl().value != "")); if (valuableFields.length > 0){ urlParams = urlParams + QueryParams.PageIndex + "=0&" + QueryParams.PageSize + "=20"; urlParams = urlParams + "&" + QueryParams.SearchType + "=" + this.currentSearchType; @@ -380,7 +378,7 @@ export class CatalogMainComponent implements AfterViewInit { this.pageSize = paramsMap.get(QueryParams.PageSize); this.currentSearchType = SearchType[paramsMap.get(QueryParams.SearchType)]; this.currentDatabase = paramsMap.get(QueryParams.Databases); - this.allFieldsMap.get(this.currentSearchType).forEach(field => { + this.ALL_SEARCH_FIELDS_MAP.get(this.currentSearchType).forEach(field => { if(paramsMap.has(field.getKey())){ field.setFormControl(paramsMap.get(field.getKey())); } @@ -389,4 +387,62 @@ export class CatalogMainComponent implements AfterViewInit { + /*** initsilizeing the search fields ***/ + + initMonographsSearchFields(): Array { + return new Array(new SearchField(FieldName.TITLE, FieldSize.fullWidth), + new SearchField(FieldName.FTITLE, FieldSize.fullWidth), + new SearchField(FieldName.PTBL, FieldSize.fullWidth), + new SearchField(FieldName.AUTH, FieldSize.fullWidth), + new SearchField(FieldName.VOL, FieldSize.large), + new SearchField(FieldName.AKEY, FieldSize.large), + new SearchField(FieldName.PUB, FieldSize.large), + new SearchField(FieldName.YEAR, FieldSize.large), + new SearchField(FieldName.PLACE, FieldSize.medium), + new SearchField(FieldName.CNTRY, FieldSize.medium), + new SearchField(FieldName.LANG, FieldSize.medium), + new SearchField(FieldName.SH, FieldSize.medium), + new SearchField(FieldName.ID, FieldSize.medium), + new SearchField(FieldName.PID, FieldSize.medium), + new SearchField(FieldName.ISSN, FieldSize.small), + new SearchField(FieldName.ISBN, FieldSize.small), + new SearchField(FieldName.NBN, FieldSize.small), + new SearchField(FieldName.NDLCN, FieldSize.small), + new SearchField(FieldName.LCCN, FieldSize.small)); + } + + initSerialsSearchFields(): Array { + return new Array(new SearchField(FieldName.TITLE, FieldSize.fullWidth), + new SearchField(FieldName.FTITLE, FieldSize.fullWidth), + new SearchField(FieldName.AUTH, FieldSize.fullWidth), + new SearchField(FieldName.PUB, FieldSize.large), + new SearchField(FieldName.YEAR, FieldSize.large), + new SearchField(FieldName.PLACE, FieldSize.medium), + new SearchField(FieldName.CNTRY, FieldSize.medium), + new SearchField(FieldName.LANG, FieldSize.medium), + new SearchField(FieldName.SH, FieldSize.medium), + new SearchField(FieldName.AKEY, FieldSize.medium), + new SearchField(FieldName.ID, FieldSize.medium), + new SearchField(FieldName.FID, FieldSize.small), + new SearchField(FieldName.ISSN, FieldSize.small), + new SearchField(FieldName.CODEN, FieldSize.small), + new SearchField(FieldName.NDLPN, FieldSize.small), + new SearchField(FieldName.LCCN, FieldSize.small)); + } + initNamesSearchFields(): Array { + return new Array(new SearchField(FieldName.AUTH, FieldSize.fullWidth), + new SearchField(FieldName.ID, FieldSize.large), + new SearchField(FieldName.SAID, FieldSize.large), + new SearchField(FieldName.AKEY, FieldSize.medium), + new SearchField(FieldName.PLACE, FieldSize.medium), + new SearchField(FieldName.DATE, FieldSize.medium)); + } + + initUniformTitlesSearchFields(): Array { + return new Array(new SearchField(FieldName.TITLE, FieldSize.fullWidth), + new SearchField(FieldName.AUTH, FieldSize.fullWidth), + new SearchField(FieldName.AKEY, FieldSize.medium), + new SearchField(FieldName.ID, FieldSize.medium), + new SearchField(FieldName.SAID, FieldSize.medium)); + } } diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.scss b/cloudapp/src/app/user-controls/search-form/search-form.component.scss index 89028b4..02bfb30 100644 --- a/cloudapp/src/app/user-controls/search-form/search-form.component.scss +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.scss @@ -3,22 +3,35 @@ } .form-card-parent { - display: grid; - grid-template-columns: repeat(auto-fit, minmax(200px, 1fr)); - column-gap: 20px; - row-gap: 1em; + display: flex; + flex-wrap: wrap; + justify-content: space-between; + column-gap: 30px; background-color: whitesmoke !important; ::ng-deep .mat-form-field-wrapper { - padding-bottom: 0px !important; + padding-bottom: 5px !important; } } -.form-card-child-large{ - display: block; - grid-column-start: 1; - grid-column-end: -1; +.form-card-field-full-width { + width: 100%; } -.form-card-child-regular{ - display: block; +.form-card-field-large { + width: 45%; + flex-grow: 1; + min-width: 200px; } + +.form-card-field-medium { + width: 30%; + flex-grow: 1; + min-width: 200px; +} + +.form-card-field-small { + width: 17%; + flex-grow: 2; + min-width: 100px; +} + From b34495326eab62fb3631cc30a79ff1a82cd2e431 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Tue, 14 Sep 2021 22:12:35 +0300 Subject: [PATCH 19/28] Relocating "form-utils.ts" --- .../full-view-display.component.ts | 2 +- .../src/app/catalog/main/main.component.ts | 34 ++++++++++++------- .../app/catalog/results-types/monographs.ts | 2 +- .../src/app/catalog/results-types/name.ts | 2 +- .../catalog/results-types/results-common.ts | 2 +- .../src/app/catalog/results-types/serials.ts | 2 +- .../app/catalog/results-types/uniformTitle.ts | 2 +- cloudapp/src/app/service/catalog.service.ts | 2 +- .../search-form/search-form-utils.ts} | 27 +++++---------- .../search-form/search-form.component.scss | 3 +- .../search-form/search-form.component.ts | 2 +- 11 files changed, 40 insertions(+), 40 deletions(-) rename cloudapp/src/app/{catalog/main/form-utils.ts => user-controls/search-form/search-form-utils.ts} (89%) diff --git a/cloudapp/src/app/catalog/full-view-display/full-view-display.component.ts b/cloudapp/src/app/catalog/full-view-display/full-view-display.component.ts index 02c0af1..69369b2 100644 --- a/cloudapp/src/app/catalog/full-view-display/full-view-display.component.ts +++ b/cloudapp/src/app/catalog/full-view-display/full-view-display.component.ts @@ -1,5 +1,5 @@ import { Component, Input, Output, EventEmitter } from '@angular/core'; -import { SearchType } from '../main/form-utils'; +import { SearchType } from '../../user-controls/search-form/search-form-utils'; @Component({ diff --git a/cloudapp/src/app/catalog/main/main.component.ts b/cloudapp/src/app/catalog/main/main.component.ts index 4d11ac6..c9b3898 100644 --- a/cloudapp/src/app/catalog/main/main.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -1,5 +1,5 @@ import { Component, AfterViewInit , ViewChild, TemplateRef } from '@angular/core'; -import { SearchField, SearchType, FieldSize, FieldName, QueryParams } from './form-utils'; +import { SearchType, SearchField, FieldSize, FieldName } from '../../user-controls/search-form/search-form-utils'; import { MatTabChangeEvent } from '@angular/material/tabs'; import { CatalogService } from '../../service/catalog.service'; import { AlertService } from '@exlibris/exl-cloudapp-angular-lib'; @@ -39,8 +39,8 @@ export class CatalogMainComponent implements AfterViewInit { public ACTIONS_MENU_LIST = new Map([ [SearchType.Monographs, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import', 'Catalog.Results.Actions.ViewHoldings']], [SearchType.Serials, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import', 'Catalog.Results.Actions.ViewHoldings']], - [SearchType.Names, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import']], - [SearchType.UniformTitles, ['Catalog.Results.Actions.View', 'Catalog.Results.Actions.Import']] + [SearchType.Names, ['Catalog.Results.Actions.View' /* , 'Catalog.Results.Actions.Import' */]], + [SearchType.UniformTitles, ['Catalog.Results.Actions.View'/* , 'Catalog.Results.Actions.Import' */]] ]); @@ -387,7 +387,7 @@ export class CatalogMainComponent implements AfterViewInit { - /*** initsilizeing the search fields ***/ + /*** initializing the search fields ***/ initMonographsSearchFields(): Array { return new Array(new SearchField(FieldName.TITLE, FieldSize.fullWidth), @@ -415,19 +415,19 @@ export class CatalogMainComponent implements AfterViewInit { return new Array(new SearchField(FieldName.TITLE, FieldSize.fullWidth), new SearchField(FieldName.FTITLE, FieldSize.fullWidth), new SearchField(FieldName.AUTH, FieldSize.fullWidth), + new SearchField(FieldName.ISSN, FieldSize.small), + new SearchField(FieldName.CODEN, FieldSize.small), + new SearchField(FieldName.NDLPN, FieldSize.small), + new SearchField(FieldName.LCCN, FieldSize.small), new SearchField(FieldName.PUB, FieldSize.large), new SearchField(FieldName.YEAR, FieldSize.large), + new SearchField(FieldName.SH, FieldSize.small), + new SearchField(FieldName.AKEY, FieldSize.small), + new SearchField(FieldName.ID, FieldSize.small), + new SearchField(FieldName.FID, FieldSize.small), new SearchField(FieldName.PLACE, FieldSize.medium), new SearchField(FieldName.CNTRY, FieldSize.medium), - new SearchField(FieldName.LANG, FieldSize.medium), - new SearchField(FieldName.SH, FieldSize.medium), - new SearchField(FieldName.AKEY, FieldSize.medium), - new SearchField(FieldName.ID, FieldSize.medium), - new SearchField(FieldName.FID, FieldSize.small), - new SearchField(FieldName.ISSN, FieldSize.small), - new SearchField(FieldName.CODEN, FieldSize.small), - new SearchField(FieldName.NDLPN, FieldSize.small), - new SearchField(FieldName.LCCN, FieldSize.small)); + new SearchField(FieldName.LANG, FieldSize.medium)); } initNamesSearchFields(): Array { return new Array(new SearchField(FieldName.AUTH, FieldSize.fullWidth), @@ -446,3 +446,11 @@ export class CatalogMainComponent implements AfterViewInit { new SearchField(FieldName.SAID, FieldSize.medium)); } } + +export enum QueryParams { + PageIndex = "pageIndex", + PageSize = "pageSize", + SearchType = "searchType", + Databases = "dataBase", + ID = "ID" +} \ No newline at end of file diff --git a/cloudapp/src/app/catalog/results-types/monographs.ts b/cloudapp/src/app/catalog/results-types/monographs.ts index cec8232..460f10d 100644 --- a/cloudapp/src/app/catalog/results-types/monographs.ts +++ b/cloudapp/src/app/catalog/results-types/monographs.ts @@ -1,6 +1,6 @@ import { TranslateService } from '@ngx-translate/core'; import { IDisplayLines, BaseResult, ViewField, ViewLine, ViewFieldBuilder, BLANK_SPACE } from './results-common'; -import { SearchType } from '../main/form-utils'; +import { SearchType } from '../../user-controls/search-form/search-form-utils'; export class Monograph extends BaseResult{ diff --git a/cloudapp/src/app/catalog/results-types/name.ts b/cloudapp/src/app/catalog/results-types/name.ts index 01bb2e6..61538a4 100644 --- a/cloudapp/src/app/catalog/results-types/name.ts +++ b/cloudapp/src/app/catalog/results-types/name.ts @@ -1,6 +1,6 @@ import { TranslateService } from '@ngx-translate/core'; import { IDisplayLines, BaseResult, ViewField, ViewLine, ViewFieldBuilder } from './results-common'; -import { SearchType } from '../main/form-utils'; +import { SearchType } from '../../user-controls/search-form/search-form-utils'; export class Name extends BaseResult { diff --git a/cloudapp/src/app/catalog/results-types/results-common.ts b/cloudapp/src/app/catalog/results-types/results-common.ts index 2ae3654..612652a 100644 --- a/cloudapp/src/app/catalog/results-types/results-common.ts +++ b/cloudapp/src/app/catalog/results-types/results-common.ts @@ -1,5 +1,5 @@ import { TranslateService } from '@ngx-translate/core'; -import { SearchType } from "../main/form-utils"; +import { SearchType } from '../../user-controls/search-form/search-form-utils'; import { Header } from "../../service/base.service"; export const BLANK_SPACE = " "; diff --git a/cloudapp/src/app/catalog/results-types/serials.ts b/cloudapp/src/app/catalog/results-types/serials.ts index aea45ad..9d06153 100644 --- a/cloudapp/src/app/catalog/results-types/serials.ts +++ b/cloudapp/src/app/catalog/results-types/serials.ts @@ -1,6 +1,6 @@ import { TranslateService } from '@ngx-translate/core'; import { IDisplayLines, BaseResult, ViewField, ViewLine, ViewFieldBuilder } from './results-common'; -import { SearchType } from '../main/form-utils'; +import { SearchType } from '../../user-controls/search-form/search-form-utils'; export class Serial extends BaseResult{ diff --git a/cloudapp/src/app/catalog/results-types/uniformTitle.ts b/cloudapp/src/app/catalog/results-types/uniformTitle.ts index eee2805..14722b5 100644 --- a/cloudapp/src/app/catalog/results-types/uniformTitle.ts +++ b/cloudapp/src/app/catalog/results-types/uniformTitle.ts @@ -1,6 +1,6 @@ import { TranslateService } from '@ngx-translate/core'; import { IDisplayLines, BaseResult, ViewField, ViewLine, ViewFieldBuilder } from './results-common'; -import { SearchType } from '../main/form-utils'; +import { SearchType } from '../../user-controls/search-form/search-form-utils'; export class UniformTitle extends BaseResult { diff --git a/cloudapp/src/app/service/catalog.service.ts b/cloudapp/src/app/service/catalog.service.ts index a87c365..cdc290b 100644 --- a/cloudapp/src/app/service/catalog.service.ts +++ b/cloudapp/src/app/service/catalog.service.ts @@ -7,7 +7,7 @@ import { of } from 'rxjs'; import { TranslateService } from '@ngx-translate/core'; -import { SearchType } from '../catalog/main/form-utils'; +import { SearchType } from '../user-controls/search-form/search-form-utils'; import { NacsisCatalogResults, ResultsHeader } from '../catalog/results-types/results-common'; import { Monograph } from '../catalog/results-types/monographs'; import { Serial } from '../catalog/results-types/serials'; diff --git a/cloudapp/src/app/catalog/main/form-utils.ts b/cloudapp/src/app/user-controls/search-form/search-form-utils.ts similarity index 89% rename from cloudapp/src/app/catalog/main/form-utils.ts rename to cloudapp/src/app/user-controls/search-form/search-form-utils.ts index 4e826aa..8f06008 100644 --- a/cloudapp/src/app/catalog/main/form-utils.ts +++ b/cloudapp/src/app/user-controls/search-form/search-form-utils.ts @@ -1,12 +1,20 @@ import { FormControl } from "@angular/forms"; +export enum SearchType { + Monographs = "Monographs", + Serials = "Serials", + Names = "Names", + UniformTitles = "UniformTitles", + Member = "Member" +} + export class SearchField { key: FieldName; fieldLabel: string; formControl: FormControl; - fieldLength: FieldSize; + fieldLength: FieldSize = FieldSize.fullWidth; constructor(key: FieldName, fieldSize?: FieldSize){ this.key = key; @@ -40,23 +48,6 @@ export class SearchField { } } - -export enum SearchType { - Monographs = "Monographs", - Serials = "Serials", - Names = "Names", - UniformTitles = "UniformTitles", - Member = "Member" -} - -export enum QueryParams { - PageIndex = "pageIndex", - PageSize = "pageSize", - SearchType = "searchType", - Databases = "dataBase", - ID = "ID" -} - export enum FieldSize { fullWidth = "form-card-field-full-width", large = "form-card-field-large", diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.scss b/cloudapp/src/app/user-controls/search-form/search-form.component.scss index 02bfb30..c9639d9 100644 --- a/cloudapp/src/app/user-controls/search-form/search-form.component.scss +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.scss @@ -31,7 +31,8 @@ .form-card-field-small { width: 17%; - flex-grow: 2; + // max-width: 130px; + flex-grow: 1; min-width: 100px; } diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.ts b/cloudapp/src/app/user-controls/search-form/search-form.component.ts index 9395165..b19ba71 100644 --- a/cloudapp/src/app/user-controls/search-form/search-form.component.ts +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.ts @@ -1,5 +1,5 @@ import { Component, Input, Output, EventEmitter, OnChanges } from '@angular/core'; -import { SearchField } from '../../catalog/main/form-utils'; +import { SearchField } from './search-form-utils'; import { MatSelectChange } from '@angular/material/select'; From c02d96e86ab671bf96a9c248f1908d5c41f54145 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Sun, 3 Oct 2021 17:03:56 +0300 Subject: [PATCH 20/28] Quick bugs Close draw when there are no results; Fixing serials importing; --- .../src/app/catalog/main/main.component.scss | 2 +- .../src/app/catalog/main/main.component.ts | 1 + cloudapp/src/app/service/catalog.service.ts | 4 +++- .../search-form/search-form.component.html | 2 +- .../search-form/search-form.component.scss | 20 ++++++++++--------- 5 files changed, 17 insertions(+), 12 deletions(-) diff --git a/cloudapp/src/app/catalog/main/main.component.scss b/cloudapp/src/app/catalog/main/main.component.scss index ebf7b17..1725f5a 100644 --- a/cloudapp/src/app/catalog/main/main.component.scss +++ b/cloudapp/src/app/catalog/main/main.component.scss @@ -1,5 +1,5 @@ p { - margin-bottom: 15px; + margin-bottom: 0px; } .align-to-left { diff --git a/cloudapp/src/app/catalog/main/main.component.ts b/cloudapp/src/app/catalog/main/main.component.ts index c9b3898..7114434 100644 --- a/cloudapp/src/app/catalog/main/main.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -171,6 +171,7 @@ export class CatalogMainComponent implements AfterViewInit { this.setPageIndexAndSize(urlParams); this.setSearchResultsDisplay(); } else { + this.panelState = false; this.numOfResults = 0; this.resultsTemplateFactory(); } diff --git a/cloudapp/src/app/service/catalog.service.ts b/cloudapp/src/app/service/catalog.service.ts index cdc290b..74fa930 100644 --- a/cloudapp/src/app/service/catalog.service.ts +++ b/cloudapp/src/app/service/catalog.service.ts @@ -130,7 +130,9 @@ export class CatalogService extends BaseService { integrationProfileFactory(searchType: SearchType, integrationProfile: IntegrationProfile) { switch(searchType) { - case (SearchType.Monographs || SearchType.Serials): + case (SearchType.Monographs): + return { typeTag: "bib", urlType: "", ID: integrationProfile.repositoryImportProfile }; + case (SearchType.Serials): return { typeTag: "bib", urlType: "", ID: integrationProfile.repositoryImportProfile }; case (SearchType.Names): return { typeTag: "authority", urlType: "/authorities", ID: integrationProfile.authorityImportProfileNames }; diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.html b/cloudapp/src/app/user-controls/search-form/search-form.component.html index c564c69..8bf5578 100644 --- a/cloudapp/src/app/user-controls/search-form/search-form.component.html +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.html @@ -6,7 +6,7 @@
-
+ diff --git a/cloudapp/src/app/user-controls/search-form/search-form.component.scss b/cloudapp/src/app/user-controls/search-form/search-form.component.scss index c9639d9..c417caa 100644 --- a/cloudapp/src/app/user-controls/search-form/search-form.component.scss +++ b/cloudapp/src/app/user-controls/search-form/search-form.component.scss @@ -6,11 +6,14 @@ display: flex; flex-wrap: wrap; justify-content: space-between; - column-gap: 30px; + column-gap: 2%; background-color: whitesmoke !important; ::ng-deep .mat-form-field-wrapper { padding-bottom: 5px !important; } + // ::ng-deep .mat-form-field-flex { + // height: 45px; + // } } .form-card-field-full-width { @@ -18,21 +21,20 @@ } .form-card-field-large { - width: 45%; - flex-grow: 1; + width: 49%; min-width: 200px; + flex-grow: 1; } .form-card-field-medium { - width: 30%; - flex-grow: 1; + width: 32%; min-width: 200px; + flex-grow: 1; } .form-card-field-small { - width: 17%; - // max-width: 130px; + width: 18%; flex-grow: 1; - min-width: 100px; -} + min-width: 130px; +} From 28b6235bb12a4a78e48ff6c70527980a42c4a6d8 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Tue, 12 Oct 2021 10:50:48 +0300 Subject: [PATCH 21/28] Full view updates Removing first row links Fixing the display of the links --- cloudapp/src/app/catalog/main/main.component.ts | 6 ++++-- cloudapp/src/app/catalog/results-types/monographs.ts | 4 ++-- cloudapp/src/app/catalog/results-types/name.ts | 4 ++-- cloudapp/src/app/catalog/results-types/serials.ts | 4 ++-- cloudapp/src/app/catalog/results-types/uniformTitle.ts | 4 ++-- 5 files changed, 12 insertions(+), 10 deletions(-) diff --git a/cloudapp/src/app/catalog/main/main.component.ts b/cloudapp/src/app/catalog/main/main.component.ts index 7114434..c7f470d 100644 --- a/cloudapp/src/app/catalog/main/main.component.ts +++ b/cloudapp/src/app/catalog/main/main.component.ts @@ -47,7 +47,8 @@ export class CatalogMainComponent implements AfterViewInit { // Selection variables public currentSearchType: SearchType = SearchType.Monographs; private currentDatabase: string;// = 'BOOK'; // first default selection (since opened with Monographs) - + private linkSearchType: SearchType; + // UI variables private panelState: boolean = true; private loading: boolean = false; @@ -177,7 +178,7 @@ export class CatalogMainComponent implements AfterViewInit { } } else { if (catalogResults.totalRecords >= 1) { - let baseResult = this.catalogService.resultsTypeFactory(this.currentSearchType, catalogResults.records[0]); + let baseResult = this.catalogService.resultsTypeFactory(this.linkSearchType, catalogResults.records[0]); this.resultFullLinkDisplay = baseResult.getFullViewDisplay().initContentDisplay(); this.isRightTableOpen = true; } else { @@ -266,6 +267,7 @@ export class CatalogMainComponent implements AfterViewInit { } onFullViewLink(fullViewLink: FullViewLink) { + this.linkSearchType = fullViewLink.searchType; let urlParams = ""; urlParams = urlParams + QueryParams.PageIndex + "=0&" + QueryParams.PageSize + "=20"; urlParams = urlParams + "&" + QueryParams.SearchType + "=" + fullViewLink.searchType; diff --git a/cloudapp/src/app/catalog/results-types/monographs.ts b/cloudapp/src/app/catalog/results-types/monographs.ts index 460f10d..3c9bd1a 100644 --- a/cloudapp/src/app/catalog/results-types/monographs.ts +++ b/cloudapp/src/app/catalog/results-types/monographs.ts @@ -232,9 +232,9 @@ export class MonographFullDisplay extends IDisplayLines { this.viewLines = new Array(); let fieldsArray = new Array() fieldsArray.push(new ViewFieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); - fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).build()); fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); - fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); fieldsArray = new Array() fieldsArray.push(new ViewFieldBuilder().content(this.record.ID).build()); diff --git a/cloudapp/src/app/catalog/results-types/name.ts b/cloudapp/src/app/catalog/results-types/name.ts index 61538a4..fe6fa13 100644 --- a/cloudapp/src/app/catalog/results-types/name.ts +++ b/cloudapp/src/app/catalog/results-types/name.ts @@ -108,9 +108,9 @@ export class NameFullDisplay extends IDisplayLines { this.viewLines = new Array(); let fieldsArray = new Array() fieldsArray.push(new ViewFieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); - fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).build()); fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); - fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); fieldsArray = new Array() fieldsArray.push(new ViewFieldBuilder().content(this.record.ID).build()); diff --git a/cloudapp/src/app/catalog/results-types/serials.ts b/cloudapp/src/app/catalog/results-types/serials.ts index 9d06153..1c68cee 100644 --- a/cloudapp/src/app/catalog/results-types/serials.ts +++ b/cloudapp/src/app/catalog/results-types/serials.ts @@ -224,9 +224,9 @@ export class SerialFullDisplay extends IDisplayLines { this.viewLines = new Array(); let fieldsArray = new Array() fieldsArray.push(new ViewFieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); - fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).build()); fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); - fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); fieldsArray = new Array() fieldsArray.push(new ViewFieldBuilder().content(this.record.ID).build()); diff --git a/cloudapp/src/app/catalog/results-types/uniformTitle.ts b/cloudapp/src/app/catalog/results-types/uniformTitle.ts index 14722b5..06046b3 100644 --- a/cloudapp/src/app/catalog/results-types/uniformTitle.ts +++ b/cloudapp/src/app/catalog/results-types/uniformTitle.ts @@ -112,9 +112,9 @@ export class UniformTitleFullDisplay extends IDisplayLines { this.viewLines = new Array(); let fieldsArray = new Array() fieldsArray.push(new ViewFieldBuilder().label("Create date: ").content(this.dateFormatDisplay(this.record.CRTDT)).build()); - fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Creating institution: ").content(this.record.CRTFA).build()); fieldsArray.push(new ViewFieldBuilder().label("Update date: ").content(this.dateFormatDisplay(this.record.RNWDT)).build()); - fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).link(SearchType.Member).build()); + fieldsArray.push(new ViewFieldBuilder().label("Modifying institution: ").content(this.record.RNWFA).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); fieldsArray = new Array() fieldsArray.push(new ViewFieldBuilder().content(this.record.ID).build()); From 7cf0c21c8d499fa671d7fbe8a0a83227c0df8722 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Tue, 2 Nov 2021 15:29:33 +0200 Subject: [PATCH 22/28] Full view labels fixing --- cloudapp/src/app/catalog/results-types/monographs.ts | 5 ++--- cloudapp/src/app/catalog/results-types/name.ts | 4 ++-- cloudapp/src/app/catalog/results-types/serials.ts | 7 +++---- 3 files changed, 7 insertions(+), 9 deletions(-) diff --git a/cloudapp/src/app/catalog/results-types/monographs.ts b/cloudapp/src/app/catalog/results-types/monographs.ts index 3c9bd1a..901620a 100644 --- a/cloudapp/src/app/catalog/results-types/monographs.ts +++ b/cloudapp/src/app/catalog/results-types/monographs.ts @@ -324,9 +324,8 @@ export class MonographFullDisplay extends IDisplayLines { fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().content(al.AFLG).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AHDNG).build()); - fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGR).build()); - fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGVR).build()); - fieldsArray = this.setSeparator(fieldsArray, "||"); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(al.AHDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(al.AHDNGVR).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AID).link(SearchType.Names).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AF).build()); this.addLine(new ViewFieldBuilder().label("AL").build(), fieldsArray); diff --git a/cloudapp/src/app/catalog/results-types/name.ts b/cloudapp/src/app/catalog/results-types/name.ts index fe6fa13..5c97563 100644 --- a/cloudapp/src/app/catalog/results-types/name.ts +++ b/cloudapp/src/app/catalog/results-types/name.ts @@ -35,7 +35,7 @@ export class NameFull{ LCAID: string = ""; TYPE: string = ""; PLACE: string = ""; - YEAR: string = ""; + DATE: string = ""; SF: NameSF[]; SAF: NameSAF[]; NOTE: NameNOTE[]; @@ -130,7 +130,7 @@ export class NameFullDisplay extends IDisplayLines { fieldsArray.push(new ViewFieldBuilder().content(this.record.PLACE).build()); this.addLine(new ViewFieldBuilder().label("PLACE").build(), fieldsArray); fieldsArray = new Array(); - fieldsArray.push(new ViewFieldBuilder().content(this.record.YEAR).build()); + fieldsArray.push(new ViewFieldBuilder().content(this.record.DATE).build()); this.addLine(new ViewFieldBuilder().label("DATE").build(), fieldsArray); this.record.SF?.forEach(sf=>{ fieldsArray = new Array(); diff --git a/cloudapp/src/app/catalog/results-types/serials.ts b/cloudapp/src/app/catalog/results-types/serials.ts index 1c68cee..830a49d 100644 --- a/cloudapp/src/app/catalog/results-types/serials.ts +++ b/cloudapp/src/app/catalog/results-types/serials.ts @@ -184,7 +184,7 @@ export class SerialSummaryDisplay extends IDisplayLines{ fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.NACSISID').content(this.record.ID).build()); this.addLine(new ViewFieldBuilder().build(), fieldsArray); fieldsArray = new Array(); - fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.ISBN').content(this.record.ISSN).build()); + fieldsArray.push(new ViewFieldBuilder().label('Catalog.Results.ISSN').content(this.record.ISSN).build()); if(this.record.hasMoreThen1ISBN){ fieldsArray.push(new ViewFieldBuilder().content(('Catalog.Results.AndOthers')).build()); } @@ -310,9 +310,8 @@ export class SerialFullDisplay extends IDisplayLines { fieldsArray = new Array(); fieldsArray.push(new ViewFieldBuilder().content(al.AFLG).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AHDNG).build()); - fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGR).build()); - fieldsArray.push(new ViewFieldBuilder().content(al.AHDNGVR).build()); - fieldsArray = this.setSeparator(fieldsArray, "||"); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(al.AHDNGR).build()); + fieldsArray.push(new ViewFieldBuilder().label("|| ").content(al.AHDNGVR).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AID).link(SearchType.Names).build()); fieldsArray.push(new ViewFieldBuilder().content(al.AF).build()); this.addLine(new ViewFieldBuilder().label("AL").build(), fieldsArray); From 0e6ddabbbc5cb277fcf1ec9f37876544c5746dd0 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Sun, 28 Nov 2021 13:04:57 +0200 Subject: [PATCH 23/28] General description update Cloud-app description updated. Note: This is without the Japanese translation --- cloudapp/src/assets/nacsis-new-logo.png | Bin 0 -> 6625 bytes manifest.json | 10 +++++----- 2 files changed, 5 insertions(+), 5 deletions(-) create mode 100644 cloudapp/src/assets/nacsis-new-logo.png diff --git a/cloudapp/src/assets/nacsis-new-logo.png b/cloudapp/src/assets/nacsis-new-logo.png new file mode 100644 index 0000000000000000000000000000000000000000..ee9b0273301f8fc169ea79a539110290f0bc241b GIT binary patch literal 6625 zcmd^^)n8O^xc13mm>~ujhAsh-4ucTs?slZRyA>q{22iA>8y|DqeD18pD0aYzqibv{(iyiX!u^6}{BdE!ZHm;YkK(|+)waDM%hg9k0{G1TOPT|{k*)rzEBu( zWhG8ejyZ2wZuqke-`@pS-#_l*Lh}v{2LDvgd@XrC>2lHu=H{Po(XM}QLG$901xX^0J!+-aPOi7TQJr z^_jzK4KoqGqq`Q3oe##B{E~HYhr;$cVzaKG^6XBEj57a~L#f8m>??hy8~1U?=;~lv zVwIlj{?(WNed2eq*)4F+3yXkoVe{k9tuc)Y^DW_1t<`!xZsQbgFZ6cphSIIl5M7(2 z_gr3WOW!W&mUJFRu|le3EIw+hy|+2t`I@$b6&dBB&q%9fc0xt;kb}l_M@3~9FM3ft zVC+ZS*j1ooGfJ=A!$xQE&tQD)q0gR$B`u1r1_uUMpoGKXQI<=A+rPJ3oP)e>`qtlN z3{XcM=AwE8Qc9Tw^L6soq&Zh=3?USp#?SbMmW|qPBk3i54Pxj;vi6Th)(`fe#{|%1 zYPL4H5N9**Rm-aaj|{n{y9X{Oh_DVM)1+xDSMA=vto+S85zE~Oe^QVtk*CSN|A(Ku zDNLhBYuYo*t!^$3v;))|FzZnF^1@1@sb8JDLU0xLe#i>@J%asCP-%XY@;pE1*}Jkf z|Ect|z1N!DZdG`YRBisMnJF*hHt~~j@cC0hlH+H%oIHZSu%4+z=B$OFDRq`I%g_*? zczCt@z-HG5VZRF^7eM<>uQ<*|d}=s;T*hiqHp>%L`r?Ro;3 za)ko>Q+y*9J_<$GQGIZSnb@%J!lSjf)K=CF3NGMI@73)Z&%@5uR(fS`D6)~ zIDPORM1|GSCcpURok z1Z|an+8J6D>1Pp=sVJTHYK?7RhM6_gyd3*rEQYuL+v|sSJC^hd0V+&acTc|y{eS}} z6syYPUFaq<%ZbX<#n9~E0&>J=K(p==Tlv1i;%m1*r$2iMvEMbe-v6CASx1E4->q2U zfua;kG7=<4S1LFH$BmwTB$he-S>|LtjF>;W@o=k}HPV}I4)9z!by;kc;)uygWcs@| z%Rkj9em6=?c5!0fHWW!^AbQMjAyp)Mqp`bwnO=9LvAJo&sG7h;#dCDGx#{r zc%ZLCC|=40NPR!6R|0QMJ-u5?3plU0iY=uv-6~1k{H9+7qTvDHmS-wk)enC0kW@aL zx7{|T6c?t~nnxUiBXK*^L6iiDMi%+#cDqq*1M0vC{l=y6t~G6##yq!+*y};>6L;Yi zjbP;D#Q=JJ^DOYld9EeEVCV$7{z&m-P!Xg4#y3+{?~{3chfPntlf%m5{WEj@R~iN@ z{&_KP?P5!XEG_|(fzE=sp$&}q4`17lH*H4ItfrO#%PLb(C6hmHlamS+2 zL5fSG+rYel|1N9Xm9#M))lK*m>vb1x18-5l`vvBGqs=}YPrs@ivf0x2qLzvEAS`Fi z&woTj#i!Qb~pS4^m`Eg$BX=HP$j`2H!G(F+vWQLbm(N5K1(>NnQ?k6l|KPFul|>r|JX(X3#;MNI5`!z)`+#Fm7?Yi23iZ?6cRLGuDBn>eYTQz6YgFO( z3dQ|_@?6odSafs+N|4BH#QWBsNz^E~zpWX96Z^ZzgCNIHT!-q*u=xX3QePP!W-b)o zLO#MDXj|&6)GD%BuXgq5YwunkkM%leXOQGN(x&R(h4Vt?mpvqU_b ze!|*D$APX`{=^3fl;OfA!m4(6E&$VgnU(-)0$TN2xKb-#=^L5nWhyT2Y&;uXHKedAbLY$&pME{w{>qI7`z^IVl&O ziq^TM=u#7eT&Lbjj^uvlvLm5ayf9S=GvB_ zl9;9#X;c%~Yr&b7`qly-+vZc3vUL$%q*@Y&xPE$eA(acFL>E=ll`HL!S9~fr_0-a7 zmt@u)RgR62;u#lm-y5g7lW4pmgQ3k#TTL%0kYXHo-W;)WT>SswPu5|}e8d?^c_@D( zP!y?vD?~tdotz6A-*4Jtdf38C0%y)4o@btXIIq<`Fv~U1eBV?k8!n9FsuzFxUMO$? zAR5HC_&Y=@iPsFCJhoVM9PcAZpM0&ZTIO`>p7F4~j*2X zmNYbjG@dv8YMP{V*$-X=!tU8w$<`Iq;^J866znj<@yNlS{8#LQ;|B`bP4lA@9a|5V zJH-4cB3pQ)XngzTXpiH6jBv^PB^JU)L6i{0+hw9M)A>z+ngR)&eZK{1#tA;|rYfh< zrK+{vX2HOTP0yxcKCZ#iyUco)a!NwOOIJDkZ96z#Q>%T1hAWGm#sin^O?lkUs*0o= z#tIsb?mTQC!6$XyuwX52g~*27-Zc*~{E;`E#Qgq-y z0Lb3%##-rcTZX~ihohm*Z?DVJMZ!~n63fq3Nds;ZKfS`_7J6Ci}1 zguUjGwK!(B#~bF{V)n&lk>~eyTWF&+OW?>A9 z9HUMb&-(;Z0ZMVx_bhtr8ZSviD~FLDkdI>qw+c5O+ODiKU{m@P zUeTXGeD_IU(m~SN3(+y*b@E4@a5ays2}Lc-7em?mw#Kq7+mfXo^*%4C<&cY0Jw}*i zsFs(1HMNKa!3j;6G$$;yQiB5iomGj&-BcYertW9pfbnYK!_UOvBKs`{XanZYU;s;^ zbNLr@W&}_!LlE3Uhf!i_bNxSII)r&nCJW5TAqhd{#LBMv1`_mjhRx4z4Jy*K%3h5J zgsp1kki0p(bw+<~6+5Gi#Sg`42qfhhuLeSrUNROxT8A}&%N&00hHSyZy6av6Yh);N z=FLue7KdiMK2~CY>@bUj*Ppt03 zuyJ%ZWn%b=lnTU0y5ouxdtNrWV_IQ5xGbTBp4jQUw}Q>W7uyN=N7_dxKh>-9a|@=9tNNqe|1DJe!-bsj@>>E>4oC69T01 zWcAW}0FdQ#Gk3CV%_%NI1y|uYyugFPsu0+dtaeN9;iSiXdSYt4Y|q4;NW*cU|o9NMJF-l0FwupGgA zz^+StwYRd59gcebV&v#uNtUsWZnuIp5rph%Bwc7;jUflZWRgkE?SpayvCLE}+FLXr z+(7k9cdLvk;342E0H5kS2`dQPUDIyp7Xfg*S$L@lo@acQmpz<%S^Jr`PGJm3kh0*T zY?C7-$05gUR{e9aP3I07(cLIo@1;0_%%^>9w&uLvHC)u=?*YrdX@R=Nk+X2|N3*aWg=i_SDPRZQoV%7q1eEk(F^~ z($~Lyn*vc~6rjfE?)oc$SI4&9Lqbg?+fFfMpB=YAS7gIh)x2DJ6RjwXwWy*NfkLs_ zNKl`uX(ifcweDG587{In;upPlbTDV(-^1mkHXyMpRjHROua}}b)!B}jCOJ23hKIz_ z5~BKc-E2f$_)(%939{F2rK`cAqEQ~d*9{2$dgQuu=~82L>Y+Tfk3@cR%!*=|9k@Sp z7S+w5*N$1nu(!blUfLnt=$l9|)oW+dWtWeIafj8N{zC3&>IqqLLdeffh%kiGtOid3 zPV)}5Ut=z(5e_TTziAODu+cMW&|H(28etJvr=jdMdh=je+tbae4zGd+efbUi(o&ydXEeNe|X2jb|NYeunbiFs%0EEab6 zmP$d>BE_cCRJRzcJ=pWcT@K$>zW9uv&o&ao_pd&S8_nTXl@dWP-#2mXM_C}-z(s2& zD43khYlpF7+iAJ#WicukYf!>0m8p`%yOpVLfbXeb?ui2k8B1+sosm2!j_5SX(W+MP zhehG>+2g&z#se@6+SYYOR}AhzMJOQQ-?6BGm0(K&U~^X%`Rrq?I&utd!9MAh;o$_Y zhyP|_*f!k`1HHC0Atb~kaLoZ%dtcvz*l$4`_mu%yh7-m4{oM}Z+9Szn-av;GcFwr9|J*1H;@csuCE zDNhKS(11LI@82GV(d<85%EzO#-%^m6Sh+Xv?H%V5lev39Yt#x^>A_l6cPM9Zo69^ivaa%_+gpXLsVU4+7 zU_)#*ZKIKJ_GfMX`S`p0=_S?Y44*~0w+xe|hI( z-kd>bw6U$IzE7(C{Ld6hF4wcDb4^G3Wrw;%VtIM7Qc|uFZ-K~q_hXn%YcDnvV}3FF zBDmf(GQA;&Bept9x98d`>6d~G3xkep4@`aggx zmQMI(YVhvHQiNQkL>&fUqb1U#OBByw*hW1vI=|U=E+7OHQ%JhAbp(F8gu+{iQVR-h zXmYHn5%-YoVPcPpeBE1ZoDv5=5Phe4HPrs`PfV8MkgL&{j@~|(w%Pq9JX>P(D8yei zr9Z)Xd${$Q-Z~JHDeq2YHgKC8Ny052$0@@ZR2&^qa!R`8l2F!@b4k@KBhd-Ri?`%* z)t>wG4%WyGDT^hjO2lmm)CL!hp{)0FeeJx*8*rlvoxUFa`L39Pj#2NIg;iUi)9n9o zvdp?Q65=FoAz@LPQdg}NP(H+0lmw%LFn9M%Ct>$w)FhvABb+Ok3|P4SD{?p@)IfE4 z6-|>)742?epz69hJiirz2}PZ^Uv|FY&=*(u(Ktv(Y5hq}3x*A+P!#-etE{_d6{Z%~ zxj1QsXcTdERXx$hA1?iWVI95Ud+KZkQ2~hgk9A%;#Y&l#I!VFBYDzAL;*3A)h@4E1 z@wK;?iek=a(#!k3`U6lplwZoe+yG>Hf|Sl=qk0u{PeqJ}mzcZDANJyKkZVG4eE(5g z&dIuCh#-_uEi%C7c4VT>h|)w9aVC^bPH=9Vz!~}Z)d*H~hT{B)XLEixe!lH>n$mxY zM>a5H{=!*g#Zo>4$@y7U2)1>bcW4D1W&qYVZ|H z)yxsgS*_~+BqJuy#}^Chn|9Qb`Kvxh`7a};{d}ie)#{G*ACWimJz#;n;BzgPjBFtR z(xotr3EP0e`uWfdnKTARt0_pYyp^uAnZ<2!is*D=?Y%59^)mL28N4FNfvI+k>z+ov zp>ZLOgu-PGme|M_$1RUp`0p*WmHcqK)3TfFOq2PkpV~;HUy=(`K%usSVq(hE>8 zEvuRFw_c|?%2I~k0fRITk<^5I@2sOSuB5V757E!qK`gWWC^@4^9=kmX{}@B`AWpu^ zSK=`qV8EwOk{HqWN}cCE_M(%71x{MuK$3nZl`27?kuAcXVZgYGdi)?0#cmMdZ~dHj z^abiYilm2!i}gNY+xGuP$^ZYm(Si0_?ZR&>3xfni4m{xM-DH8QU$c*5_H3|} Date: Sun, 28 Nov 2021 13:45:57 +0200 Subject: [PATCH 24/28] Menu entries --- cloudapp/src/app/main-menu/main-menu.component.ts | 12 ++++++------ 1 file changed, 6 insertions(+), 6 deletions(-) diff --git a/cloudapp/src/app/main-menu/main-menu.component.ts b/cloudapp/src/app/main-menu/main-menu.component.ts index 2d84bbc..98db514 100644 --- a/cloudapp/src/app/main-menu/main-menu.component.ts +++ b/cloudapp/src/app/main-menu/main-menu.component.ts @@ -41,12 +41,12 @@ import { ROUTING_STATE_KEY, AppRoutingState } from '../service/base.service'; // icon: 'uxf-icon uxf-switch', // link: 'main' // }, - { - title: 'MainMenu.ILL.Title', - text: 'MainMenu.ILL.Text', - icon: 'uxf-icon uxf-external-link', - link: 'ILL' - }, + // { + // title: 'MainMenu.ILL.Title', + // text: 'MainMenu.ILL.Text', + // icon: 'uxf-icon uxf-external-link', + // link: 'ILL' + // }, ); } From e6a93af76c4e32a355ee7e7a11e2b97273ef149d Mon Sep 17 00:00:00 2001 From: shayhadar Date: Mon, 29 Nov 2021 12:03:05 +0200 Subject: [PATCH 25/28] set Japanese as a default value 1. set Japanese as a default value 2. add margin top to footer to avoid card overflow --- cloudapp/src/app/footer/footer.component.scss | 1 + cloudapp/src/app/footer/footer.component.ts | 1 + 2 files changed, 2 insertions(+) diff --git a/cloudapp/src/app/footer/footer.component.scss b/cloudapp/src/app/footer/footer.component.scss index 9435185..edd675f 100644 --- a/cloudapp/src/app/footer/footer.component.scss +++ b/cloudapp/src/app/footer/footer.component.scss @@ -6,6 +6,7 @@ div.langs { display: block; + margin-top: 40px; } div.langs a { diff --git a/cloudapp/src/app/footer/footer.component.ts b/cloudapp/src/app/footer/footer.component.ts index 886144b..d9e37cc 100644 --- a/cloudapp/src/app/footer/footer.component.ts +++ b/cloudapp/src/app/footer/footer.component.ts @@ -13,6 +13,7 @@ export class FooterComponent implements OnInit { ) { } ngOnInit() { + this.translate.use('jp'); } setLang(lang: string) { From 0d6ce3877d0d424572b5e251a45c0d71bcabc0c1 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Mon, 29 Nov 2021 12:59:53 +0200 Subject: [PATCH 26/28] Translation and result number --- .../src/app/holdings/main/main.component.ts | 82 +++++++------- .../results-list/results-list.component.html | 2 +- cloudapp/src/i18n/en.json | 1 - cloudapp/src/i18n/jp.json | 105 +++++++++--------- 4 files changed, 99 insertions(+), 91 deletions(-) diff --git a/cloudapp/src/app/holdings/main/main.component.ts b/cloudapp/src/app/holdings/main/main.component.ts index 3a5a839..5aacb55 100644 --- a/cloudapp/src/app/holdings/main/main.component.ts +++ b/cloudapp/src/app/holdings/main/main.component.ts @@ -50,46 +50,52 @@ export class MainComponent implements OnInit, OnDestroy { this.pageLoad$ = this.eventsService.onPageLoad(pageInfo => { this.loading = true; - - this.almaApiService.getIntegrationProfile() - .subscribe(integrationProfile => { - - this.integrationProfile = integrationProfile; - - let rawBibs = (pageInfo.entities || []).filter(e => e.type == EntityType.BIB_MMS); - let nacsisBibs: Entity[] = []; - - forkJoin(rawBibs.map(entity => this.getRecord(entity))) - .subscribe({ - next: (records: any[]) => { - - let index: number = 0; - - records.forEach(record => { - // console.log(record); - let nacsisId = this.almaApiService.extractNacsisId(record.anies, this.integrationProfile.libraryCode); - if (nacsisId != null) { - // tweak: override mmsId by nacsisId - let nacsisBib = rawBibs[index]; - nacsisBib.id = nacsisId; - nacsisBibs.push(nacsisBib); - } - index++; - }) - }, - error: e => { - this.loading = false; - console.log(e.message); - //this.alert.error(e.message, {keepAfterRouteChange:true}); - }, - complete: () => { - this.loading = false; - this.bibs = nacsisBibs; - } - }); - }); + try{ + this.almaApiService.getIntegrationProfile() + .subscribe(integrationProfile => { + + this.integrationProfile = integrationProfile; + + let rawBibs = (pageInfo.entities || []).filter(e => e.type == EntityType.BIB_MMS); + let nacsisBibs: Entity[] = []; + + forkJoin(rawBibs.map(entity => this.getRecord(entity))) + .subscribe({ + next: (records: any[]) => { + + let index: number = 0; + + records.forEach(record => { + // console.log(record); + let nacsisId = this.almaApiService.extractNacsisId(record.anies, this.integrationProfile.libraryCode); + if (nacsisId != null) { + // tweak: override mmsId by nacsisId + let nacsisBib = rawBibs[index]; + nacsisBib.id = nacsisId; + nacsisBibs.push(nacsisBib); + } + index++; + }) + }, + error: e => { + this.loading = false; + console.log(e.message); + //this.alert.error(e.message, {keepAfterRouteChange:true}); + }, + complete: () => { + this.loading = false; + this.bibs = nacsisBibs; + } + }); + }); + } catch(e) { + this.loading = false; + console.log(e); + this.alert.error(this.translate.instant('General.Errors.generalError'), {keepAfterRouteChange:true}); + } }); + } ngOnDestroy(): void { this.pageLoad$.unsubscribe(); diff --git a/cloudapp/src/app/user-controls/results-list/results-list.component.html b/cloudapp/src/app/user-controls/results-list/results-list.component.html index 5646ade..d41880e 100644 --- a/cloudapp/src/app/user-controls/results-list/results-list.component.html +++ b/cloudapp/src/app/user-controls/results-list/results-list.component.html @@ -11,5 +11,5 @@

{{'Catalog.Results.Title' | translate}} ({{numOfResult - + \ No newline at end of file diff --git a/cloudapp/src/i18n/en.json b/cloudapp/src/i18n/en.json index 494c609..f046534 100644 --- a/cloudapp/src/i18n/en.json +++ b/cloudapp/src/i18n/en.json @@ -169,5 +169,4 @@ "SAID": "SAID" } } - } \ No newline at end of file diff --git a/cloudapp/src/i18n/jp.json b/cloudapp/src/i18n/jp.json index 629c385..504c03b 100644 --- a/cloudapp/src/i18n/jp.json +++ b/cloudapp/src/i18n/jp.json @@ -1,68 +1,68 @@ { "General": { "Back": "戻る", - "BackToMenu": "???Back to menu", + "BackToMenu": "メニューに戻る", "Cancel": "キャンセル", "Save": "保存", "OK": "OK", - "Clear": "???Clear", - "Search": "???Search", + "Clear": "クリア", + "Search": "検索", "Errors": { "generalError": "アプリケーションエラー" } }, - + "MainMenu": { - "Intro": "???This app includes all functionalities within NACSIS-CAT/ILL", + "Intro": "このアップはNACSIS-CAT/ILLの対象機能をすべて提供します", "Holdings": { - "Title": "タイトル", - "Text": "??? NACSIS holding ???" + "Title": "所蔵", + "Text": "NACSIS所蔵レコードを管理する" }, "Catalog": { - "Title": "Copy Catalog12 345 ???", - "Text": "??? Search and Copy cataloging ???" + "Title": "目録", + "Text": "NACSISの書誌・典拠レコードを検索・ダウウンロードする" }, "ILL": { - "Title": "ILL Borrowing ??? Requests", - "Text": "NACSIS borrowing request creation???" + "Title": "ILL依頼", + "Text": "新規ILL依頼を作成する" }, "Members": { - "Title": "Members??", - "Text": "NACSIS members information management???" + "Title": "参加組織", + "Text": "NACSISの参加組織情報を管理する" } }, "Catalog": { "Form": { - "MainTitle": "Search records ???", - "RefineSearch": "Refine Search???", - "SelectSearchType": "Select search ???", - "SelectDatabase": "Select a ???", - "EmptyForm": "The search form is empty. ???", + "MainTitle": "NACSIS総合目録データベースでレコード検索する", + "RefineSearch": "検索条件を絞り込む", + "SelectSearchType": "レコード種別を選択する", + "SelectDatabase": "ファイルを選択する", + "EmptyForm": "検索フォームが空です。条件を入力してください", "SearchTypes": { - "Monographs": "Monographs???", - "Serials": "Serials???", - "Names": "Names???", - "UniformTitles": "Uniform Titles???" + "Monographs": "図書書誌", + "Serials": "雑誌書誌", + "Names": "著者名典拠", + "UniformTitles": "統一書名典拠" } }, "Results": { - "Title": "???Records", - "NoRecordsExist": "???No records exist.", - "By": "???By", - "Book": "???(Book", - "Journal": "???(Journal", - "NACSISID": "???NACSIS ID:", - "ISBN": "???ISBN:", - "ISSN": "???ISSN:", - "Subjects": "???Subjects:", - "AndOthers": "???and others", + "Title": "レコード件数", + "NoRecordsExist": "レコードがありません", + "By": "", + "Book": "(図書", + "Journal": "(雑誌", + "NACSISID": "NACSIS ID:", + "ISBN": "ISBN:", + "ISSN": "ISSN:", + "Subjects": "件名:", + "AndOthers": "その他", "Actions" : { - "View" : "???View", - "Import" : "???Import", - "ViewHoldings" : "???View Holdings" + "View" : "プレビュー", + "Import" : "ダウウンロード", + "ViewHoldings" : "所蔵を確認する" }, - "ImportSucceeded": "The record was successfully imported ???" + "ImportSucceeded": "レコードがダウウンロードされました" } }, @@ -81,17 +81,18 @@ "Title": "タイトル", "Library": "図書館", "Location": "配置場所", - "ConfirmDelete": "このレコードを本当に削除しますか?", - "DeleteTitle": "???Delete Holding record", + "ConfirmDelete": "このレコードを本当に削除しますか", + "DeleteTitle": "所蔵レコードを削除する", "Deleted": "レコードが削除されました.", "Add": "所蔵レコードの追加", "NoHoldingRecordsExist": "所蔵レコードがありません。", - "DeleteYesButton": "???Yes, delete it", - "DeleteNoButton": "???No, keep it", + "DeleteYesButton": "削除する", + "DeleteNoButton": "削除しない", "Errors": { "NoNoldings": "所蔵レコードが見つかりません。", "GetFailed": "所蔵レコードの取得ができませんでした。", - "DeleteFailed": "所蔵レコードの削除ができませんでした。" + "DeleteFailed": "所蔵レコードの削除ができませんでした。", + "Uneditable": "This holding is not a member of +++ therefore can't be edit" } }, "Form": { @@ -140,18 +141,17 @@ "OLH": "オンラインヘルプへ" }, - "UserControls": { +"UserControls": { "Fields": { - "TITLE": "TITLE???", - "FTITLE": "FTITLE???", - "PTBL": "PTBL???", - "VOL": "VOL???", - "TiPtVo": "TITLE / PTBL / VOL???", - "AUTH": "AUTH???", + "TITLE": "TITLE", + "FTITLE": "FTITLE", + "PTBL": "PTBL", + "VOL": "VOL", + "AUTH": "AUTH", "ISSN": "ISSN", "ISBN": "ISBN", "NBN": "NBN", - "NDLCN": "NDLCN / LCCN / OTHN", + "NDLCN": "NDLCN", "PUB": "PUB", "YEAR": "YEAR", "PLACE": "PLACE", @@ -162,8 +162,11 @@ "ID": "ID", "PID": "PID", "CODEN": "CODEN", - "NDLPN": "NDLPN / LCCN", - "FID": "FID" + "NDLPN": "NDLPN", + "LCCN": "LCCN", + "FID": "FID", + "DATE": "DATE", + "SAID": "SAID" } } } \ No newline at end of file From 35222e6673c81fd709a1bc04935f335178edfe01 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Mon, 29 Nov 2021 13:38:03 +0200 Subject: [PATCH 27/28] General description translate --- manifest.json | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/manifest.json b/manifest.json index 3a848a8..e8c1dad 100644 --- a/manifest.json +++ b/manifest.json @@ -13,7 +13,7 @@ "subtitle": [ { "lang": "jp", - "text": "Integrate with the NACSIS central catalog and ILL system" + "text": "NACSIS総合目録データベース・相互貸借サービスとの統合" }, { "lang": "en", @@ -24,7 +24,7 @@ "description": [ { "lang": "jp", - "text": "This app is used for integrating Alma with the NACSIS central catalog. The app support the followings: Manage holding records from the NACSIS-CAT for a given Bibliographic record in Alma. Copy cataloging of NACSIS-CAT Bibliographic and Authority records to Alma. Contribution of new or edited Bibliographic and Authority records to NACSIS-CAT. This app is supported by Ex Libris. Currently available for beta testing." + S"text": "このアップは、AlmaをNACSIS総合目録データベースと統合する-ために使用できます。次の機能を提供します:Almaのローカル書誌レコードに関連するNACSIS-CAT所蔵レコードを管理する、NACSIS-CATの書誌・典拠レコードをローカルにダウウンロードする、作成・更新されたローカルレコードをNACSIS-CATにアップロードする。このアップは、Ex Librisサポートに対象内になります。現在、ベータテストの目標で提供されています。" }, { "lang": "en", From c0213bd95ac06259bbf184c728005fe8805cdc25 Mon Sep 17 00:00:00 2001 From: Dor-Karni Date: Mon, 29 Nov 2021 13:47:15 +0200 Subject: [PATCH 28/28] Fixing mistakes --- manifest.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/manifest.json b/manifest.json index e8c1dad..f957adc 100644 --- a/manifest.json +++ b/manifest.json @@ -24,7 +24,7 @@ "description": [ { "lang": "jp", - S"text": "このアップは、AlmaをNACSIS総合目録データベースと統合する-ために使用できます。次の機能を提供します:Almaのローカル書誌レコードに関連するNACSIS-CAT所蔵レコードを管理する、NACSIS-CATの書誌・典拠レコードをローカルにダウウンロードする、作成・更新されたローカルレコードをNACSIS-CATにアップロードする。このアップは、Ex Librisサポートに対象内になります。現在、ベータテストの目標で提供されています。" + "text": "このアップは、AlmaをNACSIS総合目録データベースと統合する-ために使用できます。次の機能を提供します:Almaのローカル書誌レコードに関連するNACSIS-CAT所蔵レコードを管理する、NACSIS-CATの書誌・典拠レコードをローカルにダウウンロードする、作成・更新されたローカルレコードをNACSIS-CATにアップロードする。このアップは、Ex Librisサポートに対象内になります。現在、ベータテストの目標で提供されています。" }, { "lang": "en",