diff --git a/.github/workflows/ci_run_scm_rts.yml b/.github/workflows/ci_run_scm_rts.yml
index b23c03422..2d91785e8 100644
--- a/.github/workflows/ci_run_scm_rts.yml
+++ b/.github/workflows/ci_run_scm_rts.yml
@@ -22,8 +22,8 @@ jobs:
sp_ROOT: /home/runner/NCEPLIBS-sp
w3emc_ROOT: /home/runner/myw3emc
SCM_ROOT: /home/runner/work/ccpp-scm/ccpp-scm
- suites: SCM_GFS_v15p2,SCM_GFS_v16,SCM_GFS_v17_p8,SCM_HRRR,SCM_RRFS_v1beta,SCM_RAP,SCM_WoFS_v0,SCM_HRRR_gf,SCM_GFS_v17_p8_ugwpv1,SCM_GFS_v16_RRTMGP
- suites_ps: SCM_GFS_v15p2_ps,SCM_GFS_v16_ps,SCM_GFS_v17_p8_ps,SCM_HRRR_ps,SCM_RRFS_v1beta_ps,SCM_RAP_ps,SCM_WoFS_v0_ps,SCM_HRRR_gf_ps,SCM_GFS_v17_p8_ugwpv1_ps,SCM_GFS_v16_RRTMGP_ps
+ suites: SCM_GFS_v15p2,SCM_GFS_v16,SCM_GFS_v17_p8,SCM_HRRR,SCM_RRFS_v1beta,SCM_RAP,SCM_WoFS_v0,SCM_HRRR_gf,SCM_GFS_v17_p8_ugwpv1,SCM_GFS_v16_RRTMGP,SCM_GFS_v16_debug
+ suites_ps: SCM_GFS_v15p2_ps,SCM_GFS_v16_ps,SCM_GFS_v17_p8_ps,SCM_HRRR_ps,SCM_RRFS_v1beta_ps,SCM_RAP_ps,SCM_WoFS_v0_ps,SCM_HRRR_gf_ps,SCM_GFS_v17_p8_ugwpv1_ps,SCM_GFS_v16_RRTMGP_ps,SCM_GFS_v16_debug_ps
dir_rt: /home/runner/work/ccpp-scm/ccpp-scm/test/artifact-${{matrix.build-type}}
dir_bl: /home/runner/work/ccpp-scm/ccpp-scm/test/BL-${{matrix.build-type}}
diff --git a/README.md b/README.md
index 3e7c37eb3..993628961 100644
--- a/README.md
+++ b/README.md
@@ -7,7 +7,7 @@
The SCM is a tool for developing physics suites and diagnosing their performance. This SCM works with the
- [Common Community Physics Package (CCPP):](https://github.com/NCAR/ccpp-physics) a library of physical parameterizations for atmospheric numerical models.
-- [CCPP Framework:](https://github.com/NCAR/ccpp-scm:) a framework for connecting atmospheric models to physics suites.
+- [CCPP Framework:](https://github.com/NCAR/ccpp-framework) a framework for connecting atmospheric models to physics suites.
## Documentation
- [SCM readthedocs](https://ccpp-scm.readthedocs.io/en/v7.0.0/)
diff --git a/ccpp/config/ccpp_prebuild_config.py b/ccpp/config/ccpp_prebuild_config.py
index d68aaf98b..c63650382 100755
--- a/ccpp/config/ccpp_prebuild_config.py
+++ b/ccpp/config/ccpp_prebuild_config.py
@@ -19,8 +19,8 @@
'ccpp/physics/physics/hooks/machine.F',
'ccpp/physics/physics/Radiation/RRTMG/radsw_param.f',
'ccpp/physics/physics/Radiation/RRTMG/radlw_param.f',
- 'ccpp/physics/physics/photochem/h2o_def.f',
'ccpp/physics/physics/photochem/module_ozphys.F90',
+ 'ccpp/physics/physics/photochem/module_h2ophys.F90',
'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/module_ccpp_suite_simulator.F90',
'scm/src/CCPP_typedefs.F90',
'scm/src/GFS_typedefs.F90',
@@ -49,8 +49,12 @@
'module_ozphys' : '',
'ty_ozphys' : '',
},
+ 'module_h2ophys' : {
+ 'module_h2ophys' : '',
+ 'ty_h2ophys' : '',
+ },
'CCPP_typedefs' : {
- 'GFS_interstitial_type' : 'physics%Interstitial',
+ 'GFS_interstitial_type' : 'physics%Interstitial(cdata%thrd_no)',
'CCPP_typedefs' : '',
},
'GFS_typedefs' : {
@@ -94,7 +98,9 @@
'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_PBL_generic_post.F90' ,
'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_SCNV_generic_pre.F90' ,
'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_SCNV_generic_post.F90' ,
+ 'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_debug.F90' ,
'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_phys_time_vary.scm.F90' ,
+ 'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_photochemistry.F90' ,
'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_rad_time_vary.scm.F90' ,
'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_radiation_surface.F90' ,
'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_rrtmg_post.F90' ,
@@ -163,7 +169,7 @@
'ccpp/physics/physics/GWD/gwdc_post.f',
'ccpp/physics/physics/GWD/gwdps.f',
'ccpp/physics/physics/GWD/rayleigh_damp.f',
- 'ccpp/physics/physics/photochem/h2ophys.f',
+ 'ccpp/physics/physics/photochem/module_h2ophys.F90',
'ccpp/physics/physics/photochem/module_ozphys.F90',
'ccpp/physics/physics/MP/Ferrier_Aligo/mp_fer_hires.F90',
'ccpp/physics/physics/MP/GFDL/gfdl_cloud_microphys.F90',
diff --git a/ccpp/physics b/ccpp/physics
index be05d12e0..9d967aab3 160000
--- a/ccpp/physics
+++ b/ccpp/physics
@@ -1 +1 @@
-Subproject commit be05d12e00fc51722084ad75c044e19d25c0b6d0
+Subproject commit 9d967aab3c81be72e879827db0170c14dba5048a
diff --git a/ccpp/suites/suite_HAFS_v0_hwrf.xml b/ccpp/suites/suite_HAFS_v0_hwrf.xml
index c96348cfd..1b71266eb 100644
--- a/ccpp/suites/suite_HAFS_v0_hwrf.xml
+++ b/ccpp/suites/suite_HAFS_v0_hwrf.xml
@@ -60,7 +60,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
diff --git a/ccpp/suites/suite_HAFS_v0_hwrf_ps.xml b/ccpp/suites/suite_HAFS_v0_hwrf_ps.xml
index cfae0831a..705b5942e 100644
--- a/ccpp/suites/suite_HAFS_v0_hwrf_ps.xml
+++ b/ccpp/suites/suite_HAFS_v0_hwrf_ps.xml
@@ -41,7 +41,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
diff --git a/ccpp/suites/suite_HAFS_v0_hwrf_thompson.xml b/ccpp/suites/suite_HAFS_v0_hwrf_thompson.xml
index e59f0ebfe..906912919 100644
--- a/ccpp/suites/suite_HAFS_v0_hwrf_thompson.xml
+++ b/ccpp/suites/suite_HAFS_v0_hwrf_thompson.xml
@@ -62,7 +62,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
diff --git a/ccpp/suites/suite_HAFS_v0_hwrf_thompson_ps.xml b/ccpp/suites/suite_HAFS_v0_hwrf_thompson_ps.xml
index 1831f8829..b4d01df6d 100644
--- a/ccpp/suites/suite_HAFS_v0_hwrf_thompson_ps.xml
+++ b/ccpp/suites/suite_HAFS_v0_hwrf_thompson_ps.xml
@@ -43,7 +43,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2.xml b/ccpp/suites/suite_SCM_GFS_v15p2.xml
index 087e25d4a..f5b6afea0 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2.xml
@@ -59,7 +59,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_ACM_ps.xml b/ccpp/suites/suite_SCM_GFS_v15p2_ACM_ps.xml
index 8f6cc0d53..97d026929 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_ACM_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_ACM_ps.xml
@@ -40,7 +40,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_FA.xml b/ccpp/suites/suite_SCM_GFS_v15p2_FA.xml
index 19d469bc6..2c4a6ba04 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_FA.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_FA.xml
@@ -59,7 +59,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_MYJ.xml b/ccpp/suites/suite_SCM_GFS_v15p2_MYJ.xml
index ff52d53dc..7a1221e82 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_MYJ.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_MYJ.xml
@@ -59,7 +59,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_RRTMGP.xml b/ccpp/suites/suite_SCM_GFS_v15p2_RRTMGP.xml
index 501705f91..700d6a3f5 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_RRTMGP.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_RRTMGP.xml
@@ -60,7 +60,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_RRTMGP_ps.xml b/ccpp/suites/suite_SCM_GFS_v15p2_RRTMGP_ps.xml
index ef731e0b5..03f602f86 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_RRTMGP_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_RRTMGP_ps.xml
@@ -41,7 +41,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_YSU_ps.xml b/ccpp/suites/suite_SCM_GFS_v15p2_YSU_ps.xml
index f63ab5537..aeb6bceab 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_YSU_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_YSU_ps.xml
@@ -40,7 +40,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_no_nsst.xml b/ccpp/suites/suite_SCM_GFS_v15p2_no_nsst.xml
index 8fb960315..4ab952c2e 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_no_nsst.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_no_nsst.xml
@@ -57,7 +57,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_no_nsst_ps.xml b/ccpp/suites/suite_SCM_GFS_v15p2_no_nsst_ps.xml
index a409f3edc..226651ec5 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_no_nsst_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_no_nsst_ps.xml
@@ -40,7 +40,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_noahmp.xml b/ccpp/suites/suite_SCM_GFS_v15p2_noahmp.xml
index c845c8878..18425531a 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_noahmp.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_noahmp.xml
@@ -59,7 +59,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_ps.xml b/ccpp/suites/suite_SCM_GFS_v15p2_ps.xml
index 9fb1ac66b..e474cdf3f 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_ps.xml
@@ -40,7 +40,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v15p2_saYSU_ps.xml b/ccpp/suites/suite_SCM_GFS_v15p2_saYSU_ps.xml
index 9b3948944..2e613b132 100644
--- a/ccpp/suites/suite_SCM_GFS_v15p2_saYSU_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v15p2_saYSU_ps.xml
@@ -40,7 +40,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v16.xml b/ccpp/suites/suite_SCM_GFS_v16.xml
index 723dbd910..723659ab3 100644
--- a/ccpp/suites/suite_SCM_GFS_v16.xml
+++ b/ccpp/suites/suite_SCM_GFS_v16.xml
@@ -59,7 +59,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v16_RRTMGP.xml b/ccpp/suites/suite_SCM_GFS_v16_RRTMGP.xml
index b427bcf25..174d07734 100644
--- a/ccpp/suites/suite_SCM_GFS_v16_RRTMGP.xml
+++ b/ccpp/suites/suite_SCM_GFS_v16_RRTMGP.xml
@@ -60,7 +60,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v16_RRTMGP_ps.xml b/ccpp/suites/suite_SCM_GFS_v16_RRTMGP_ps.xml
index 31ea5c712..4d8b8e8a6 100644
--- a/ccpp/suites/suite_SCM_GFS_v16_RRTMGP_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v16_RRTMGP_ps.xml
@@ -41,7 +41,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v16_debug.xml b/ccpp/suites/suite_SCM_GFS_v16_debug.xml
new file mode 100644
index 000000000..a7643d83c
--- /dev/null
+++ b/ccpp/suites/suite_SCM_GFS_v16_debug.xml
@@ -0,0 +1,85 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<suite name="SCM_GFS_v16_debug" version="1">
+ <group name="time_vary">
+ <subcycle loop="1">
+ <scheme>GFS_time_vary_pre</scheme>
+ <scheme>GFS_rrtmg_setup</scheme>
+ <scheme>GFS_rad_time_vary</scheme>
+ <scheme>GFS_phys_time_vary</scheme>
+ </subcycle>
+ </group>
+ <group name="radiation">
+ <subcycle loop="1">
+ <scheme>GFS_suite_interstitial_rad_reset</scheme>
+ <scheme>GFS_rrtmg_pre</scheme>
+ <scheme>GFS_radiation_surface</scheme>
+ <scheme>rad_sw_pre</scheme>
+ <scheme>rrtmg_sw</scheme>
+ <scheme>rrtmg_sw_post</scheme>
+ <scheme>rrtmg_lw</scheme>
+ <scheme>rrtmg_lw_post</scheme>
+ <scheme>GFS_rrtmg_post</scheme>
+ </subcycle>
+ </group>
+ <group name="physics">
+ <subcycle loop="1">
+ <scheme>GFS_suite_interstitial_phys_reset</scheme>
+ <scheme>GFS_suite_stateout_reset</scheme>
+ <scheme>get_prs_fv3</scheme>
+ <scheme>GFS_suite_interstitial_1</scheme>
+ <scheme>GFS_surface_generic_pre</scheme>
+ <scheme>GFS_surface_composites_pre</scheme>
+ <scheme>dcyc2t3</scheme>
+ <scheme>GFS_surface_composites_inter</scheme>
+ <scheme>GFS_suite_interstitial_2</scheme>
+ </subcycle>
+ <!-- Surface iteration loop -->
+ <subcycle loop="2">
+ <scheme>sfc_diff</scheme>
+ <scheme>GFS_surface_loop_control_part1</scheme>
+ <scheme>sfc_nst_pre</scheme>
+ <scheme>sfc_nst</scheme>
+ <scheme>sfc_nst_post</scheme>
+ <scheme>lsm_noah</scheme>
+ <scheme>sfc_sice</scheme>
+ <scheme>GFS_surface_loop_control_part2</scheme>
+ </subcycle>
+ <!-- End of surface iteration loop -->
+ <subcycle loop="1">
+ <scheme>GFS_surface_composites_post</scheme>
+ <scheme>sfc_diag</scheme>
+ <scheme>sfc_diag_post</scheme>
+ <scheme>GFS_surface_generic_post</scheme>
+ <scheme>GFS_PBL_generic_pre</scheme>
+ <scheme>satmedmfvdifq</scheme>
+ <scheme>GFS_PBL_generic_post</scheme>
+ <scheme>GFS_GWD_generic_pre</scheme>
+ <scheme>cires_ugwp</scheme>
+ <scheme>cires_ugwp_post</scheme>
+ <scheme>GFS_GWD_generic_post</scheme>
+ <scheme>GFS_suite_stateout_update</scheme>
+ <scheme>GFS_photochemistry</scheme>
+ <scheme>get_phi_fv3</scheme>
+ <scheme>GFS_suite_interstitial_3</scheme>
+ <scheme>GFS_DCNV_generic_pre</scheme>
+ <scheme>samfdeepcnv</scheme>
+ <scheme>GFS_DCNV_generic_post</scheme>
+ <scheme>GFS_SCNV_generic_pre</scheme>
+ <scheme>samfshalcnv</scheme>
+ <scheme>GFS_SCNV_generic_post</scheme>
+ <scheme>GFS_suite_interstitial_4</scheme>
+ <scheme>cnvc90</scheme>
+ <scheme>GFS_MP_generic_pre</scheme>
+ <scheme>gfdl_cloud_microphys</scheme>
+ <scheme>GFS_MP_generic_post</scheme>
+ <scheme>maximum_hourly_diagnostics</scheme>
+ <scheme>GFS_physics_post</scheme>
+ <scheme>GFS_diagtoscreen</scheme>
+ <scheme>GFS_interstitialtoscreen</scheme>
+ <scheme>GFS_checkland</scheme>
+ <scheme>GFS_checktracers</scheme>
+ <!--<scheme>GFS_abort</scheme>-->
+ </subcycle>
+ </group>
+</suite>
diff --git a/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml b/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml
new file mode 100644
index 000000000..4789c6cad
--- /dev/null
+++ b/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml
@@ -0,0 +1,66 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<suite name="SCM_GFS_v16_debug_ps" version="1">
+ <group name="time_vary">
+ <subcycle loop="1">
+ <scheme>GFS_time_vary_pre</scheme>
+ <scheme>GFS_rrtmg_setup</scheme>
+ <scheme>GFS_rad_time_vary</scheme>
+ <scheme>GFS_phys_time_vary</scheme>
+ </subcycle>
+ </group>
+ <group name="radiation">
+ <subcycle loop="1">
+ <scheme>GFS_suite_interstitial_rad_reset</scheme>
+ <scheme>GFS_rrtmg_pre</scheme>
+ <scheme>GFS_radiation_surface</scheme>
+ <scheme>rad_sw_pre</scheme>
+ <scheme>rrtmg_sw</scheme>
+ <scheme>rrtmg_sw_post</scheme>
+ <scheme>rrtmg_lw</scheme>
+ <scheme>rrtmg_lw_post</scheme>
+ <scheme>GFS_rrtmg_post</scheme>
+ </subcycle>
+ </group>
+ <group name="physics">
+ <subcycle loop="1">
+ <scheme>GFS_suite_interstitial_phys_reset</scheme>
+ <scheme>GFS_suite_stateout_reset</scheme>
+ <scheme>get_prs_fv3</scheme>
+ <scheme>GFS_suite_interstitial_1</scheme>
+ <scheme>GFS_surface_generic_pre</scheme>
+ <scheme>scm_sfc_flux_spec</scheme>
+ <scheme>dcyc2t3</scheme>
+ <scheme>GFS_suite_interstitial_2</scheme>
+ <scheme>GFS_PBL_generic_pre</scheme>
+ <scheme>satmedmfvdifq</scheme>
+ <scheme>GFS_PBL_generic_post</scheme>
+ <scheme>GFS_GWD_generic_pre</scheme>
+ <scheme>cires_ugwp</scheme>
+ <scheme>cires_ugwp_post</scheme>
+ <scheme>GFS_GWD_generic_post</scheme>
+ <scheme>GFS_suite_stateout_update</scheme>
+ <scheme>GFS_photochemistry</scheme>
+ <scheme>get_phi_fv3</scheme>
+ <scheme>GFS_suite_interstitial_3</scheme>
+ <scheme>GFS_DCNV_generic_pre</scheme>
+ <scheme>samfdeepcnv</scheme>
+ <scheme>GFS_DCNV_generic_post</scheme>
+ <scheme>GFS_SCNV_generic_pre</scheme>
+ <scheme>samfshalcnv</scheme>
+ <scheme>GFS_SCNV_generic_post</scheme>
+ <scheme>GFS_suite_interstitial_4</scheme>
+ <scheme>cnvc90</scheme>
+ <scheme>GFS_MP_generic_pre</scheme>
+ <scheme>gfdl_cloud_microphys</scheme>
+ <scheme>GFS_MP_generic_post</scheme>
+ <scheme>maximum_hourly_diagnostics</scheme>
+ <scheme>GFS_physics_post</scheme>
+ <scheme>GFS_diagtoscreen</scheme>
+ <scheme>GFS_interstitialtoscreen</scheme>
+ <scheme>GFS_checkland</scheme>
+ <scheme>GFS_checktracers</scheme>
+ <!--<scheme>GFS_abort</scheme>-->
+ </subcycle>
+ </group>
+</suite>
diff --git a/ccpp/suites/suite_SCM_GFS_v16_no_nsst.xml b/ccpp/suites/suite_SCM_GFS_v16_no_nsst.xml
index 19733a6eb..77d4d613f 100644
--- a/ccpp/suites/suite_SCM_GFS_v16_no_nsst.xml
+++ b/ccpp/suites/suite_SCM_GFS_v16_no_nsst.xml
@@ -57,7 +57,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v16_no_nsst_ps.xml b/ccpp/suites/suite_SCM_GFS_v16_no_nsst_ps.xml
index 5437699c1..e8a247683 100644
--- a/ccpp/suites/suite_SCM_GFS_v16_no_nsst_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v16_no_nsst_ps.xml
@@ -40,7 +40,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v16_ps.xml b/ccpp/suites/suite_SCM_GFS_v16_ps.xml
index 6320bf6a6..98d24e590 100644
--- a/ccpp/suites/suite_SCM_GFS_v16_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v16_ps.xml
@@ -40,7 +40,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v16_ugwpv1.xml b/ccpp/suites/suite_SCM_GFS_v16_ugwpv1.xml
index 0d4ebc861..0e7a06823 100644
--- a/ccpp/suites/suite_SCM_GFS_v16_ugwpv1.xml
+++ b/ccpp/suites/suite_SCM_GFS_v16_ugwpv1.xml
@@ -59,7 +59,7 @@
<scheme>ugwpv1_gsldrag_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v17_p8.xml b/ccpp/suites/suite_SCM_GFS_v17_p8.xml
index 17eb9993b..49662418d 100644
--- a/ccpp/suites/suite_SCM_GFS_v17_p8.xml
+++ b/ccpp/suites/suite_SCM_GFS_v17_p8.xml
@@ -60,7 +60,7 @@
<scheme>unified_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v17_p8_c3.xml b/ccpp/suites/suite_SCM_GFS_v17_p8_c3.xml
index 5105ec520..a984aab62 100644
--- a/ccpp/suites/suite_SCM_GFS_v17_p8_c3.xml
+++ b/ccpp/suites/suite_SCM_GFS_v17_p8_c3.xml
@@ -60,7 +60,7 @@
<scheme>unified_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v17_p8_c3_ps.xml b/ccpp/suites/suite_SCM_GFS_v17_p8_c3_ps.xml
index 4a759285c..eee4317c7 100644
--- a/ccpp/suites/suite_SCM_GFS_v17_p8_c3_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v17_p8_c3_ps.xml
@@ -41,7 +41,7 @@
<scheme>unified_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v17_p8_ps.xml b/ccpp/suites/suite_SCM_GFS_v17_p8_ps.xml
index 35c3941a8..68d4970eb 100644
--- a/ccpp/suites/suite_SCM_GFS_v17_p8_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v17_p8_ps.xml
@@ -41,7 +41,7 @@
<scheme>unified_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v17_p8_ugwpv1.xml b/ccpp/suites/suite_SCM_GFS_v17_p8_ugwpv1.xml
index 865fe47f6..e39f865a8 100644
--- a/ccpp/suites/suite_SCM_GFS_v17_p8_ugwpv1.xml
+++ b/ccpp/suites/suite_SCM_GFS_v17_p8_ugwpv1.xml
@@ -60,7 +60,7 @@
<scheme>ugwpv1_gsldrag_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GFS_v17_p8_ugwpv1_ps.xml b/ccpp/suites/suite_SCM_GFS_v17_p8_ugwpv1_ps.xml
index cd62b628e..b0dd07353 100644
--- a/ccpp/suites/suite_SCM_GFS_v17_p8_ugwpv1_ps.xml
+++ b/ccpp/suites/suite_SCM_GFS_v17_p8_ugwpv1_ps.xml
@@ -41,7 +41,7 @@
<scheme>ugwpv1_gsldrag_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GSD_v1.xml b/ccpp/suites/suite_SCM_GSD_v1.xml
index d7d45d10f..ae48d3ef1 100644
--- a/ccpp/suites/suite_SCM_GSD_v1.xml
+++ b/ccpp/suites/suite_SCM_GSD_v1.xml
@@ -59,7 +59,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GSD_v1_ps.xml b/ccpp/suites/suite_SCM_GSD_v1_ps.xml
index 83fa060a2..94d72810e 100644
--- a/ccpp/suites/suite_SCM_GSD_v1_ps.xml
+++ b/ccpp/suites/suite_SCM_GSD_v1_ps.xml
@@ -41,7 +41,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GSD_v1nssl.xml b/ccpp/suites/suite_SCM_GSD_v1nssl.xml
index fefdc11ad..f77b5eba6 100644
--- a/ccpp/suites/suite_SCM_GSD_v1nssl.xml
+++ b/ccpp/suites/suite_SCM_GSD_v1nssl.xml
@@ -59,7 +59,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_GSD_v1nssl_ps.xml b/ccpp/suites/suite_SCM_GSD_v1nssl_ps.xml
index fbf82ce98..88fc1e8fa 100644
--- a/ccpp/suites/suite_SCM_GSD_v1nssl_ps.xml
+++ b/ccpp/suites/suite_SCM_GSD_v1nssl_ps.xml
@@ -41,7 +41,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_HRRR.xml b/ccpp/suites/suite_SCM_HRRR.xml
index 7904da3f3..57912f78a 100644
--- a/ccpp/suites/suite_SCM_HRRR.xml
+++ b/ccpp/suites/suite_SCM_HRRR.xml
@@ -59,7 +59,7 @@
<scheme>drag_suite</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_suite_interstitial_4</scheme>
diff --git a/ccpp/suites/suite_SCM_HRRR_gf.xml b/ccpp/suites/suite_SCM_HRRR_gf.xml
index f80ab4c7c..e4637008b 100644
--- a/ccpp/suites/suite_SCM_HRRR_gf.xml
+++ b/ccpp/suites/suite_SCM_HRRR_gf.xml
@@ -57,7 +57,7 @@
<scheme>drag_suite</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_HRRR_gf_ps.xml b/ccpp/suites/suite_SCM_HRRR_gf_ps.xml
index 3fc25cc5b..1329f4b97 100644
--- a/ccpp/suites/suite_SCM_HRRR_gf_ps.xml
+++ b/ccpp/suites/suite_SCM_HRRR_gf_ps.xml
@@ -41,7 +41,7 @@
<scheme>drag_suite</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_HRRR_ps.xml b/ccpp/suites/suite_SCM_HRRR_ps.xml
index e1f930dbf..0ac6c29ff 100644
--- a/ccpp/suites/suite_SCM_HRRR_ps.xml
+++ b/ccpp/suites/suite_SCM_HRRR_ps.xml
@@ -40,7 +40,7 @@
<scheme>drag_suite</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_suite_interstitial_4</scheme>
diff --git a/ccpp/suites/suite_SCM_RAP.xml b/ccpp/suites/suite_SCM_RAP.xml
index 68040872d..62e945e1e 100644
--- a/ccpp/suites/suite_SCM_RAP.xml
+++ b/ccpp/suites/suite_SCM_RAP.xml
@@ -58,7 +58,7 @@
<scheme>drag_suite</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_RAP_ps.xml b/ccpp/suites/suite_SCM_RAP_ps.xml
index 6855b1167..4149acba5 100644
--- a/ccpp/suites/suite_SCM_RAP_ps.xml
+++ b/ccpp/suites/suite_SCM_RAP_ps.xml
@@ -40,7 +40,7 @@
<scheme>drag_suite</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_RRFS_v1alpha.xml b/ccpp/suites/suite_SCM_RRFS_v1alpha.xml
index 7b0ec9db9..8a6e99e05 100644
--- a/ccpp/suites/suite_SCM_RRFS_v1alpha.xml
+++ b/ccpp/suites/suite_SCM_RRFS_v1alpha.xml
@@ -60,7 +60,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_suite_interstitial_4</scheme>
diff --git a/ccpp/suites/suite_SCM_RRFS_v1alpha_ps.xml b/ccpp/suites/suite_SCM_RRFS_v1alpha_ps.xml
index f21105dba..5e6f6e34a 100644
--- a/ccpp/suites/suite_SCM_RRFS_v1alpha_ps.xml
+++ b/ccpp/suites/suite_SCM_RRFS_v1alpha_ps.xml
@@ -41,7 +41,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_suite_interstitial_4</scheme>
diff --git a/ccpp/suites/suite_SCM_RRFS_v1beta.xml b/ccpp/suites/suite_SCM_RRFS_v1beta.xml
index 1921f3f56..4e87c32cc 100644
--- a/ccpp/suites/suite_SCM_RRFS_v1beta.xml
+++ b/ccpp/suites/suite_SCM_RRFS_v1beta.xml
@@ -60,7 +60,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_suite_interstitial_4</scheme>
diff --git a/ccpp/suites/suite_SCM_RRFS_v1beta_ps.xml b/ccpp/suites/suite_SCM_RRFS_v1beta_ps.xml
index 4c554c438..d663d450b 100644
--- a/ccpp/suites/suite_SCM_RRFS_v1beta_ps.xml
+++ b/ccpp/suites/suite_SCM_RRFS_v1beta_ps.xml
@@ -41,7 +41,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_suite_interstitial_4</scheme>
diff --git a/ccpp/suites/suite_SCM_RRFS_v1nssl.xml b/ccpp/suites/suite_SCM_RRFS_v1nssl.xml
index 439f34737..926a5e12a 100644
--- a/ccpp/suites/suite_SCM_RRFS_v1nssl.xml
+++ b/ccpp/suites/suite_SCM_RRFS_v1nssl.xml
@@ -60,7 +60,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<!-- <scheme>GFS_suite_interstitial_3</scheme> -->
<!-- <scheme>GFS_suite_interstitial_4</scheme> -->
diff --git a/ccpp/suites/suite_SCM_WoFS_v0.xml b/ccpp/suites/suite_SCM_WoFS_v0.xml
index a16c8b116..87a728561 100644
--- a/ccpp/suites/suite_SCM_WoFS_v0.xml
+++ b/ccpp/suites/suite_SCM_WoFS_v0.xml
@@ -60,7 +60,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_MP_generic_pre</scheme>
<scheme>mp_nssl</scheme>
diff --git a/ccpp/suites/suite_SCM_WoFS_v0_ps.xml b/ccpp/suites/suite_SCM_WoFS_v0_ps.xml
index 3592ac2b5..24948795e 100644
--- a/ccpp/suites/suite_SCM_WoFS_v0_ps.xml
+++ b/ccpp/suites/suite_SCM_WoFS_v0_ps.xml
@@ -41,7 +41,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_MP_generic_pre</scheme>
<scheme>mp_nssl</scheme>
diff --git a/ccpp/suites/suite_SCM_csawmg.xml b/ccpp/suites/suite_SCM_csawmg.xml
index 61e856774..a0b541b3c 100644
--- a/ccpp/suites/suite_SCM_csawmg.xml
+++ b/ccpp/suites/suite_SCM_csawmg.xml
@@ -60,7 +60,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/ccpp/suites/suite_SCM_csawmg_ps.xml b/ccpp/suites/suite_SCM_csawmg_ps.xml
index c7ccf9963..44e09e6f0 100644
--- a/ccpp/suites/suite_SCM_csawmg_ps.xml
+++ b/ccpp/suites/suite_SCM_csawmg_ps.xml
@@ -41,7 +41,7 @@
<scheme>cires_ugwp_post</scheme>
<scheme>GFS_GWD_generic_post</scheme>
<scheme>GFS_suite_stateout_update</scheme>
- <scheme>h2ophys</scheme>
+ <scheme>GFS_photochemistry</scheme>
<scheme>get_phi_fv3</scheme>
<scheme>GFS_suite_interstitial_3</scheme>
<scheme>GFS_DCNV_generic_pre</scheme>
diff --git a/contrib/get_aerosol_climo.sh b/contrib/get_aerosol_climo.sh
index 695d1c7a7..fdaaf3016 100755
--- a/contrib/get_aerosol_climo.sh
+++ b/contrib/get_aerosol_climo.sh
@@ -1,5 +1,35 @@
#!/bin/bash
+# Function to display help message
+print_help() {
+ echo "get_aerosol_climo.sh: contrib/get_aerosol_climo.sh [-v,--verbose]"
+ echo " Script for downloading/extracting the GOCART climatological aerosol data."
+ echo ""
+ echo "Options:"
+ echo " -v, --verbose Turn on wget verbose output."
+ echo " --help Show this help message and exit."
+}
+
+verbose="-q"
+# Parse command-line arguments
+while [[ "$#" -gt 0 ]]; do
+ case $1 in
+ --help)
+ print_help
+ exit 0
+ ;;
+ -v|--verbose)
+ verbose="-v"
+ ;;
+ *)
+ echo "Unknown option: $1"
+ print_help
+ exit 1
+ ;;
+ esac
+ shift
+done
+
#set -ex
# Directory where this script is located
@@ -20,10 +50,9 @@ data_files=("FV3_aeroclim1" "FV3_aeroclim2" "FV3_aeroclim3" "FV3_aeroclim_optics
cd $BASEDIR/scm/data/physics_input_data/
for file in "${data_files[@]}"; do
echo "Retrieving $file.tar.gz"
- wget https://github.com/NCAR/ccpp-scm/releases/download/v7.0.0-beta/${file}.tar.gz
+ wget ${verbose} https://github.com/NCAR/ccpp-scm/releases/download/v7.0.0/${file}.tar.gz
tar -xvf ${file}.tar.gz
rm -f ${file}.tar.gz
done
cd $BASEDIR/
-
diff --git a/contrib/get_all_static_data.sh b/contrib/get_all_static_data.sh
index 99c0cd4de..d7d9aa7e9 100755
--- a/contrib/get_all_static_data.sh
+++ b/contrib/get_all_static_data.sh
@@ -1,5 +1,35 @@
#!/bin/bash
+# Function to display help message
+print_help() {
+ echo "get_all_static_data.sh: contrib/get_all_static_data.sh [-v,--verbose]"
+ echo " Script for downloading/extracting the processed SCM case data."
+ echo ""
+ echo "Options:"
+ echo " -v, --verbose Turn on wget verbose output."
+ echo " --help Show this help message and exit."
+}
+
+verbose="-q"
+# Parse command-line arguments
+while [[ "$#" -gt 0 ]]; do
+ case $1 in
+ --help)
+ print_help
+ exit 0
+ ;;
+ -v|--verbose)
+ verbose="-v"
+ ;;
+ *)
+ echo "Unknown option: $1"
+ print_help
+ exit 1
+ ;;
+ esac
+ shift
+done
+
#set -ex
# Directory where this script is located
@@ -21,10 +51,9 @@ for file in "${data_files[@]}"; do
mkdir -p $BASEDIR/scm/data/$file
cd $BASEDIR/scm/data/$file
echo "Retrieving $file"
- wget https://github.com/NCAR/ccpp-scm/releases/download/v7.0.0-beta/${file}.tar.gz
+ wget ${verbose} https://github.com/NCAR/ccpp-scm/releases/download/v7.0.0/${file}.tar.gz
tar -xf ${file}.tar.gz
rm -f ${file}.tar.gz
done
cd $BASEDIR/
-
diff --git a/contrib/get_mg_inccn_data.sh b/contrib/get_mg_inccn_data.sh
index e98c277a8..6b37ec786 100755
--- a/contrib/get_mg_inccn_data.sh
+++ b/contrib/get_mg_inccn_data.sh
@@ -1,5 +1,35 @@
#!/bin/bash
+# Function to display help message
+print_help() {
+ echo "get_mg_inccn_data.sh: contrib/get_mg_inccn_data.sh [-v,--verbose]"
+ echo " Script for downloading/extracting the Morrison-Gettelman data."
+ echo ""
+ echo "Options:"
+ echo " -v, --verbose Turn on wget verbose output."
+ echo " --help Show this help message and exit."
+}
+
+verbose="-q"
+# Parse command-line arguments
+while [[ "$#" -gt 0 ]]; do
+ case $1 in
+ --help)
+ print_help
+ exit 0
+ ;;
+ -v|--verbose)
+ verbose="-v"
+ ;;
+ *)
+ echo "Unknown option: $1"
+ print_help
+ exit 1
+ ;;
+ esac
+ shift
+done
+
set -ex
# Directory where this script is located
@@ -16,8 +46,7 @@ BASEDIR=$MYDIR/..
# Change to directory containing the physics input data, download and extract archive
cd $BASEDIR/scm/data/physics_input_data/
-wget https://github.com/NCAR/ccpp-scm/releases/download/v7.0.0-beta/MG_INCCN_data.tar.gz
+wget ${verbose} https://github.com/NCAR/ccpp-scm/releases/download/v7.0.0/MG_INCCN_data.tar.gz
tar -xvf MG_INCCN_data.tar.gz
rm -f MG_INCCN_data.tar.gz
cd $BASEDIR/
-
diff --git a/contrib/get_thompson_tables.sh b/contrib/get_thompson_tables.sh
index 86a9487bc..b40188e74 100755
--- a/contrib/get_thompson_tables.sh
+++ b/contrib/get_thompson_tables.sh
@@ -1,5 +1,35 @@
#!/bin/bash
+# Function to display help message
+print_help() {
+ echo "get_thompson_tables.sh: contrib/get_thompson_tables.sh [-v,--verbose]"
+ echo " Script for downloading/extracting the Thompson lookup tables."
+ echo ""
+ echo "Options:"
+ echo " -v, --verbose Turn on wget verbose output."
+ echo " --help Show this help message and exit."
+}
+
+verbose="-q"
+# Parse command-line arguments
+while [[ "$#" -gt 0 ]]; do
+ case $1 in
+ --help)
+ print_help
+ exit 0
+ ;;
+ -v|--verbose)
+ verbose="-v"
+ ;;
+ *)
+ echo "Unknown option: $1"
+ print_help
+ exit 1
+ ;;
+ esac
+ shift
+done
+
set -ex
if [[ $(uname -s) == Darwin ]]; then
@@ -15,8 +45,7 @@ BASEDIR=$MYDIR/..
# Change to directory containing the physics input data, download and extract archive
cd $BASEDIR/scm/data/physics_input_data/
-wget https://github.com/NCAR/ccpp-scm/releases/download/v7.0.0-beta/thompson_tables.tar.gz
+wget ${verbose} https://github.com/NCAR/ccpp-scm/releases/download/v7.0.0/thompson_tables.tar.gz
tar -xvf thompson_tables.tar.gz
rm -f thompson_tables.tar.gz
cd $BASEDIR/
-
diff --git a/docker/Dockerfile b/docker/Dockerfile
index 97ced6d17..979781134 100644
--- a/docker/Dockerfile
+++ b/docker/Dockerfile
@@ -74,7 +74,7 @@ ENV w3emc_ROOT=/comsoftware/nceplibs
# Obtain CCPP SCM source code, build code, and download static data
RUN if [ -z "$PR_NUMBER" ]; then \
cd /comsoftware \
- && git clone --recursive -b main https://github.com/NCAR/ccpp-scm; \
+ && git clone --recursive -b release/public-v7 https://github.com/NCAR/ccpp-scm; \
else \
cd /comsoftware \
&& git clone https://github.com/NCAR/ccpp-scm \
diff --git a/environment-scm_analysis.yml b/environment-scm_analysis.yml
new file mode 100644
index 000000000..b8ce5d17b
--- /dev/null
+++ b/environment-scm_analysis.yml
@@ -0,0 +1,9 @@
+name: env_scm_analysis
+
+dependencies:
+ - conda-forge::python=3.7
+ - conda-forge::netcdf4
+ - conda-forge::f90nml
+ - conda-forge::configobj
+ - conda-forge::matplotlib
+ - conda-forge::pandas
diff --git a/scm/doc/TechGuide/chap_cases.rst b/scm/doc/TechGuide/chap_cases.rst
index a9c9bbdaa..780eb2f1f 100644
--- a/scm/doc/TechGuide/chap_cases.rst
+++ b/scm/doc/TechGuide/chap_cases.rst
@@ -297,6 +297,20 @@ Activate environment:
.. code:: bash
> conda activate env_ufscasegen
+
+Note that it may be possible for conda to fail to solve for the environment when attempting to use the yml file. It
+should still be possible to create the same environment manually:
+
+.. code:: bash
+
+ > conda create --name env_ufscasegen
+ > conda install -n env_ufscasegen --channel=conda-forge python=3.8.5
+ > conda install -n env_ufscasegen --channel=conda-forge netcdf4
+ > conda install -n env_ufscasegen --channel=conda-forge f90nml
+ > conda install -n env_ufscasegen --channel=conda-forge xarray
+ > conda install -n env_ufscasegen --channel=conda-forge numpy
+ > conda install -n env_ufscasegen --channel=conda-forge shapely
+ > conda install -n env_ufscasegen --channel=conda-forge xesmf
.. _`ufscasegen`:
@@ -422,13 +436,24 @@ appreciably different than the calculated geostrophic winds), this often leads t
with time. An option exists within the script to assume that the mean three-dimensional winds are, in fact, identical to the
geostrophic winds as well. Using this option eliminates any spurious turning.
+Writing UFS Comparison Data
+
+The `--save_comp` (or `-sc`) options allow one to write out the UFS data for the chosen column in NetCDF format. The profiles of the state variables
+`u`, `v`, `T`, and `q_v` are written out for the given point for each history file time. In addition, a collection of other
+diagnostics like profiles of physics tendencies and scalar surface variables are saved and written. One can include any variable that is
+provided in the UFS history files, although the specific variables are hard-coded in the `UFS_case_gen.py` file which will require editing
+to change. The file with comparison data is automatically written out to the `scm/data/comparison_data` directory, although this is controlled
+by the `COMPARISON_DATA_DIR` global variable in the `UFS_case_gen.py` script. The filename is a concatenation of the case name (specified by the
+`--case_name (-n)` argument) and `_comp_data.nc`.
+
.. _`ufsforcingensemblegenerator`:
UFS_forcing_ensemble_generator.py
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
There is an additional script in ``scm/etc/scripts/UFS_forcing_ensemble_generator.py`` to create UFS-caseGen case(s) starting
-with output from UFS Weather Model (UWM) Regression Tests (RTs).
+with output from UFS Weather Model (UWM) Regression Tests (RTs). This script provides a wrapper for ``UFS_case_gen.py`` for
+generating multiple cases at once.
.. code:: bash
@@ -489,11 +514,12 @@ staged UWM RTs located at:
Example 1: UFS-caseGen for single point
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
-UFS regression test, ``control_c192``, for single point.
+UFS regression test, ``control_c192``, for a single point using calculated horizontal advective tendencies,
+supplying the vertical velocity for the vertical advective terms and nudging the horizontal winds:
.. code:: bash
- ./UFS_forcing_ensemble_generator.py -d [path_to_regression_tests_output]/control_c192_intel/ -sc --C_RES 192 -dt 360 -n control_c192 -lons 300 -lats 34
+ ./UFS_forcing_ensemble_generator.py -d [path_to_regression_tests_output]/control_c192_intel/ -sc --C_RES 192 -dt 360 -n control_c192 -lons 300 -lats 34 -fm 2 -vm 2 -wn
Upon successful completion of the script, the command to run the case(s)
will print to the screen. For example,
@@ -509,11 +535,11 @@ The file ``scm_ufsens_control_c192.py`` is created in ``ccpp-scm/scm/bin/``, whe
Example 2: UFS-caseGen for list of points
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
-UFS regression test, ``control_c384``, for multiple points.
+UFS regression test, ``control_c384``, for multiple points assuming the same forcing method as above:
.. code:: bash
- ./UFS_forcing_ensemble_generator.py -d /glade/derecho/scratch/epicufsrt/ufs-weather-model/RT/NEMSfv3gfs/develop-20240607/control_c384_intel/ -sc --C_RES 384 -dt 225 -n control_c384 -lons 300 300 300 300 -lats 34 35 35 37
+ ./UFS_forcing_ensemble_generator.py -d /glade/derecho/scratch/epicufsrt/ufs-weather-model/RT/NEMSfv3gfs/develop-20240607/control_c384_intel/ -sc --C_RES 384 -dt 225 -n control_c384 -lons 300 300 300 300 -lats 34 35 35 37 -fm 2 -vm 2 -wn
Upon successful completion of the script, the command to run the case(s)
will print to the screen. For example,
diff --git a/scm/doc/TechGuide/chap_ccpp.rst b/scm/doc/TechGuide/chap_ccpp.rst
index cc5420ee5..b0b8c354e 100644
--- a/scm/doc/TechGuide/chap_ccpp.rst
+++ b/scm/doc/TechGuide/chap_ccpp.rst
@@ -380,4 +380,4 @@ called ‘smoke’.
physics (``ccpp-scm/scm/src/GFS_typedefs.F90/GFS_stateout_type/gq0``). If the tracer needs to be part of these arrays, there are
a few additional steps to take. If you need help, please post on the
support forum at:
- https://dtcenter.org/forum/ccpp-user-support/ccpp-single-column-model.
+ https://github.com/NCAR/ccpp-scm/discussions
diff --git a/scm/doc/TechGuide/chap_quick.rst b/scm/doc/TechGuide/chap_quick.rst
index 5c7880535..969c1e758 100644
--- a/scm/doc/TechGuide/chap_quick.rst
+++ b/scm/doc/TechGuide/chap_quick.rst
@@ -216,13 +216,6 @@ Unified Forecast System and related applications, only a minority of which are r
install libraries manually if they wish, but they will need to make sure the appropriate environment variables
are set to the correct values so that the build system can find them, as described in the following paragraphs.
-
-<<<<<<< HEAD
-Setting up compilation environment
-^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
-
-For users on a pre-configured platform, the spack-stack environment can be loaded via one of the provided modules in ``scm/etc/modules/`` as described in :numref:`Section %s <use_preconfigured_platforms>`.
-=======
For users on a pre-configured platform, you can load the spack-stack environment via one of the provided modules in ``scm/etc/modules/``.
For example, users on the NSF NCAR machine Derecho who wish to use Intel compilers can do the following:
@@ -231,7 +224,6 @@ For example, users on the NSF NCAR machine Derecho who wish to use Intel compile
cd [path/to/ccpp-scm/]
module use scm/etc/modules/
module load derecho_intel
->>>>>>> feature/modulefile_updates
Additionally, for users who have installed spack-stack on their own MacOS or Linux machine can use the provided ``macos_clang``
or ``linux_gnu`` modules.
@@ -602,6 +594,12 @@ If using the main branch, you should run the above command to ensure you have th
- Use this to specify the timestep to use (if different than the
default specified in ``../src/suite_info.py``).
+- ``--mpi_command``
+
+ - Provide argument to define the MPI command that will be invoked.
+ Default MPI command is ``mpirun -np 1``.
+ (Note: to run on a Derecho login node the empty argument ``--mpi_command ''`` is required.)
+
- ``--verbose [-v]``
- Use this option to see additional debugging output from the run
@@ -613,11 +611,7 @@ configuration files located in ``../etc/case_config`` (*without the .nml extensi
specifying a suite other than the default, the suite name used must
match the value of the suite name in one of the suite definition files
located in ``../../ccpp/suites`` (Note: not the filename of the suite definition file). As
-<<<<<<< HEAD
-part of the CCPP SCM v7.0.0 release, the following suite names are supported:
-=======
part of the seventh CCPP release, the following suite names are supported:
->>>>>>> feature/modulefile_updates
#. SCM_GFS_v16
@@ -888,7 +882,7 @@ Running the Docker image
#. To run the SCM, you can run the Docker container that was just
created and give it the same run commands as discussed in :numref:`Section %s <singlerunscript>`
- **Be sure to remember to include the ``-d`` and ``--mpi_command "mpirun -np 1 --allow-run-as-root"``
+ **Be sure to remember to include the ``-d`` and ``--mpi_command "mpirun -np 1 --allow-run-as-root"``
options for all run commands**. For example,
.. code:: bash
diff --git a/scm/etc/scm_qsub_example.py b/scm/etc/scm_qsub_example.py
index e34d80ab4..70b3d82a4 100755
--- a/scm/etc/scm_qsub_example.py
+++ b/scm/etc/scm_qsub_example.py
@@ -34,7 +34,7 @@
WALLTIME = "walltime=00:20:00"
PROCESSORS = "select=1:ncpus=1"
QUEUE = "develop"
-COMMAND = "./run_scm.py -c twpice"
+COMMAND = "cd $PBS_O_WORKDIR; ./run_scm.py -c twpice"
EMAIL_ADDR = MY_EMAIL
SERIAL_MEM = "512M"
WORKING_DIR = os.path.dirname(os.path.abspath(__file__))
diff --git a/scm/etc/scripts/plot_configs/twpice_all_suites.ini b/scm/etc/scripts/plot_configs/twpice_all_suites.ini
index 1cc5b1da0..f9a57798a 100644
--- a/scm/etc/scripts/plot_configs/twpice_all_suites.ini
+++ b/scm/etc/scripts/plot_configs/twpice_all_suites.ini
@@ -1,5 +1,5 @@
-scm_datasets = output_twpice_SCM_GFS_v16/output.nc, output_twpice_SCM_GFS_v17_p8/output.nc, output_twpice_SCM_RAP/output.nc, output_twpice_SCM_RRFS_v1beta/output.nc, output_twpice_SCM_WoFS_v0/output.nc, output_twpice_SCM_HRRR/output.nc
-scm_datasets_labels = GFSv16, GFSv17p8, RAP, RRFSv1b, WoFSv0, HRRR
+scm_datasets = output_twpice_SCM_GFS_v16/output.nc, output_twpice_SCM_GFS_v16_RRTMGP/output.nc, output_twpice_SCM_GFS_v17_p8_ugwpv1/output.nc, output_twpice_SCM_WoFS_v0/output.nc, output_twpice_SCM_HRRR_gf/output.nc
+scm_datasets_labels = GFSv16, GFSv16-GP, GFSv17p8-ugwpv1, WoFSv0, HRRR-gf
plot_dir = plots_twpice_all_suites/
obs_file = ../data/raw_case_input/twp180iopsndgvarana_v2.1_C3.c1.20060117.000000.cdf
obs_compare = True
@@ -23,24 +23,27 @@ time_series_resample = True
y_log = False
y_min_option = min #min, max, val (if val, add y_min = float value)
y_max_option = max #min, max, val (if val, add y_max = float value)
- conversion_factor = 1000.0, 1000.0, 1.0, 1.0, 1.0, 1.0, 1.0, 1.0, 1.0
+ conversion_factor = 1000.0, 1000.0, 1.0, 86400.0, 86400.0, 86400.0, 86400.0, 86400.0
[[profiles_mean_multi]]
[[[T_forcing]]]
vars = T_force_tend, dT_dt_pbl, dT_dt_conv, dT_dt_micro, dT_dt_lwrad, dT_dt_swrad
vars_labels = 'force', 'PBL', 'Conv', 'MP', 'LW', 'SW'
x_label = 'K/day'
+ conversion_factor = 86400.0
[[[conv_tendencies]]]
vars = dT_dt_deepconv, dT_dt_shalconv
vars_labels = 'deep', 'shallow'
x_label = 'K/day'
+ conversion_factor = 86400.0
[[profiles_instant]]
[[time_series]]
- vars = 'pres_s','lhf','shf','tprcp_rate_inst'
+ vars = 'pres_s','lhf','shf','tprcp_rate_accum'
vars_labels = 'surface pressure (Pa)','latent heat flux ($W$ $m^{-2}$)','sensible heat flux ($W$ $m^{-2}$)','surface rainfall rate ($mm$ $hr{-1}$)'
-
+ conversion_factor = 1.0, 1.0, 1.0, 3600000.0
+
[[contours]]
vars = qv,
vars_labels = 'Water Vapor ($g$ $kg^{-1}$)',
diff --git a/scm/src/GFS_typedefs.F90 b/scm/src/GFS_typedefs.F90
index 35f325f03..f73f6a90c 100644
--- a/scm/src/GFS_typedefs.F90
+++ b/scm/src/GFS_typedefs.F90
@@ -5,8 +5,8 @@ module GFS_typedefs
use module_radsw_parameters, only: topfsw_type, sfcfsw_type
use module_radlw_parameters, only: topflw_type, sfcflw_type
- use h2o_def, only: levh2o, h2o_coeff
use module_ozphys, only: ty_ozphys
+ use module_h2ophys, only: ty_h2ophys
use module_ccpp_suite_simulator, only: base_physics_process
implicit none
@@ -291,6 +291,11 @@ module GFS_typedefs
real (kind=kind_phys), pointer :: spec_sh_flux (:) => null() !< specified kinematic surface sensible heat flux
real (kind=kind_phys), pointer :: spec_lh_flux (:) => null() !< specified kinematic surface latent heat flux
+!--- fire_behavior
+ real (kind=kind_phys), pointer :: hflx_fire (:) => null() !< kinematic surface upward sensible heat flux of fire
+ real (kind=kind_phys), pointer :: evap_fire (:) => null() !< kinematic surface upward latent heat flux of fire
+ real (kind=kind_phys), pointer :: smoke_fire (:) => null() !< smoke emission of fire
+
!-- In/Out
real (kind=kind_phys), pointer :: maxupmf(:) => null() !< maximum up draft mass flux for Grell-Freitas
real (kind=kind_phys), pointer :: conv_act(:) => null() !< convective activity counter for Grell-Freitas
@@ -742,7 +747,11 @@ module GFS_typedefs
integer :: nblks !< for explicit data blocking: number of blocks
integer, pointer :: blksz(:) !< for explicit data blocking: block sizes of all blocks
integer :: ncols !< total number of columns for all blocks
-
+ !
+ integer :: nchunks !< number of chunks of an array that are used in the CCPP run phase
+ integer, pointer :: chunk_begin(:) !< first indices of chunks of an array for the CCPP run phase
+ integer, pointer :: chunk_end(:) !< last indices of chunks of an array for the CCPP run phase
+ !
integer :: fire_aux_data_levels !< vertical levels of fire auxiliary data
!--- coupling parameters
@@ -756,6 +765,7 @@ module GFS_typedefs
logical :: cpllnd !< default no cpllnd collection
logical :: cpllnd2atm !< default no lnd->atm coupling
logical :: rrfs_sd !< default no rrfs_sd collection
+ logical :: cpl_fire !< default no fire_behavior collection
logical :: use_cice_alb !< default .false. - i.e. don't use albedo imported from the ice model
logical :: cpl_imp_mrg !< default no merge import with internal forcings
logical :: cpl_imp_dbg !< default no write import data to file post merge
@@ -1008,6 +1018,7 @@ module GFS_typedefs
real(kind=kind_phys) :: dt_inner !< time step for the inner loop in s
logical :: sedi_semi !< flag for semi Lagrangian sedi of rain
integer :: decfl !< deformed CFL factor
+ logical :: thpsnmp_is_init !< Local scheme initialization flag
!--- GFDL microphysical paramters
logical :: lgfdlmprad !< flag for GFDL mp scheme and radiation consistency
@@ -1475,6 +1486,7 @@ module GFS_typedefs
integer :: nto2 !< tracer index for oxygen
integer :: ntwa !< tracer index for water friendly aerosol
integer :: ntia !< tracer index for ice friendly aerosol
+ integer :: ntfsmoke !< tracer index for fire smoke
integer :: ntsmoke !< tracer index for smoke
integer :: ntdust !< tracer index for dust
integer :: ntcoarsepm !< tracer index for coarse PM
@@ -1597,6 +1609,9 @@ module GFS_typedefs
real(kind=kind_phys), pointer :: si(:) !< vertical sigma coordinate for model initialization
real(kind=kind_phys) :: sec !< seconds since model initialization
+!--- Increment grid
+ logical :: increment_file_on_native_grid ! increment on native grid else Gaussian grid
+
!--- IAU
integer :: iau_offset
real(kind=kind_phys) :: iau_delthrs ! iau time interval (to scale increments) in hours
@@ -1620,6 +1635,10 @@ module GFS_typedefs
type(ty_ozphys) :: ozphys !< DDT with data needed by ozone physics
integer :: levozp !< Number of vertical layers in ozone forcing data
integer :: oz_coeff !< Number of coefficients in ozone forcing data
+!--- NRL h2o photchemistry physics
+ type(ty_h2ophys) :: h2ophys !< DDT with data needed by h2o photchemistry physics.
+ integer :: levh2o !< Number of vertical layers in stratospheric h2o data.
+ integer :: h2o_coeff !< Number of coefficients in stratospheric h2o data.
!--- CCPP suite simulator
logical :: do_ccpp_suite_sim !
@@ -1652,50 +1671,50 @@ module GFS_typedefs
!!
type GFS_grid_type
- real (kind=kind_phys), pointer :: xlon (:) => null() !< grid longitude in radians, ok for both 0->2pi
- !! or -pi -> +pi ranges
- real (kind=kind_phys), pointer :: xlat (:) => null() !< grid latitude in radians, default to pi/2 ->
- !! -pi/2 range, otherwise adj in subr called
- real (kind=kind_phys), pointer :: xlat_d (:) => null() !< grid latitude in degrees, default to 90 ->
- !! -90 range, otherwise adj in subr called
- real (kind=kind_phys), pointer :: xlon_d (:) => null() !< grid longitude in degrees, default to 0 ->
- !! 360 range, otherwise adj in subr called
- real (kind=kind_phys), pointer :: sinlat (:) => null() !< sine of the grids corresponding latitudes
- real (kind=kind_phys), pointer :: coslat (:) => null() !< cosine of the grids corresponding latitudes
- real (kind=kind_phys), pointer :: area (:) => null() !< area of the grid cell
- real (kind=kind_phys), pointer :: dx (:) => null() !< relative dx for the grid cell
+ real (kind=kind_phys), pointer :: xlon (:) !< grid longitude in radians, ok for both 0->2pi
+ !! or -pi -> +pi ranges
+ real (kind=kind_phys), pointer :: xlat (:) !< grid latitude in radians, default to pi/2 ->
+ !! -pi/2 range, otherwise adj in subr called
+ real (kind=kind_phys), pointer :: xlat_d (:) !< grid latitude in degrees, default to 90 ->
+ !! -90 range, otherwise adj in subr called
+ real (kind=kind_phys), pointer :: xlon_d (:) !< grid longitude in degrees, default to 0 ->
+ !! 360 range, otherwise adj in subr called
+ real (kind=kind_phys), pointer :: sinlat (:) !< sine of the grids corresponding latitudes
+ real (kind=kind_phys), pointer :: coslat (:) !< cosine of the grids corresponding latitudes
+ real (kind=kind_phys), pointer :: area (:) !< area of the grid cell
+ real (kind=kind_phys), pointer :: dx (:) !< relative dx for the grid cell
!--- grid-related interpolation data for prognostic ozone
- real (kind=kind_phys), pointer :: ddy_o3 (:) => null() !< interpolation weight for ozone
- integer, pointer :: jindx1_o3 (:) => null() !< interpolation low index for ozone
- integer, pointer :: jindx2_o3 (:) => null() !< interpolation high index for ozone
+ real (kind=kind_phys), pointer :: ddy_o3 (:) !< interpolation weight for ozone
+ integer, pointer :: jindx1_o3 (:) !< interpolation low index for ozone
+ integer, pointer :: jindx2_o3 (:) !< interpolation high index for ozone
!--- grid-related interpolation data for stratosphere water
- real (kind=kind_phys), pointer :: ddy_h (:) => null() !< interpolation weight for h2o
- integer, pointer :: jindx1_h (:) => null() !< interpolation low index for h2o
- integer, pointer :: jindx2_h (:) => null() !< interpolation high index for h2o
+ real (kind=kind_phys), pointer :: ddy_h (:) !< interpolation weight for h2o
+ integer, pointer :: jindx1_h (:) !< interpolation low index for h2o
+ integer, pointer :: jindx2_h (:) !< interpolation high index for h2o
!--- grid-related interpolation data for prognostic iccn
- real (kind=kind_phys), pointer :: ddy_ci (:) => null() !< interpolation weight for iccn
- integer, pointer :: jindx1_ci (:) => null() !< interpolation low index for iccn
- integer, pointer :: jindx2_ci (:) => null() !< interpolation high index for iccn
- real (kind=kind_phys), pointer :: ddx_ci (:) => null() !< interpolation weight for iccn
- integer, pointer :: iindx1_ci (:) => null() !< interpolation low index for iccn
- integer, pointer :: iindx2_ci (:) => null() !< interpolation high index for iccn
+ real (kind=kind_phys), pointer :: ddy_ci (:) !< interpolation weight for iccn
+ integer, pointer :: jindx1_ci (:) !< interpolation low index for iccn
+ integer, pointer :: jindx2_ci (:) !< interpolation high index for iccn
+ real (kind=kind_phys), pointer :: ddx_ci (:) !< interpolation weight for iccn
+ integer, pointer :: iindx1_ci (:) !< interpolation low index for iccn
+ integer, pointer :: iindx2_ci (:) !< interpolation high index for iccn
!--- grid-related interpolation data for prescribed aerosols
- real (kind=kind_phys), pointer :: ddy_aer (:) => null() !< interpolation weight for iaerclm
- integer, pointer :: jindx1_aer (:) => null() !< interpolation low index for iaerclm
- integer, pointer :: jindx2_aer (:) => null() !< interpolation high index for iaerclm
- real (kind=kind_phys), pointer :: ddx_aer (:) => null() !< interpolation weight for iaerclm
- integer, pointer :: iindx1_aer (:) => null() !< interpolation low index for iaerclm
- integer, pointer :: iindx2_aer (:) => null() !< interpolation high index for iaerclm
+ real (kind=kind_phys), pointer :: ddy_aer (:) !< interpolation weight for iaerclm
+ integer, pointer :: jindx1_aer (:) !< interpolation low index for iaerclm
+ integer, pointer :: jindx2_aer (:) !< interpolation high index for iaerclm
+ real (kind=kind_phys), pointer :: ddx_aer (:) !< interpolation weight for iaerclm
+ integer, pointer :: iindx1_aer (:) !< interpolation low index for iaerclm
+ integer, pointer :: iindx2_aer (:) !< interpolation high index for iaerclm
!--- grid-related interpolation data for cires_ugwp_v1
- real (kind=kind_phys), pointer :: ddy_j1tau (:) => null() !< interpolation weight for tau_ugwp
- real (kind=kind_phys), pointer :: ddy_j2tau (:) => null() !< interpolation weight for tau_ugwp
- integer, pointer :: jindx1_tau (:) => null() !< interpolation low index for tau_ugwp
- integer, pointer :: jindx2_tau (:) => null() !< interpolation high index for tau_ugwp
+ real (kind=kind_phys), pointer :: ddy_j1tau (:) !< interpolation weight for tau_ugwp
+ real (kind=kind_phys), pointer :: ddy_j2tau (:) !< interpolation weight for tau_ugwp
+ integer, pointer :: jindx1_tau (:) !< interpolation low index for tau_ugwp
+ integer, pointer :: jindx2_tau (:) !< interpolation high index for tau_ugwp
contains
procedure :: create => grid_create !< allocate array data
@@ -2195,12 +2214,14 @@ module GFS_typedefs
!------------------------
! GFS_statein_type%create
!------------------------
- subroutine statein_create (Statein, IM, Model)
+ subroutine statein_create (Statein, Model)
implicit none
class(GFS_statein_type) :: Statein
- integer, intent(in) :: IM
type(GFS_control_type), intent(in) :: Model
+ integer :: IM
+
+ IM = Model%ncols
!--- level geopotential and pressures
allocate (Statein%phii (IM,Model%levs+1))
@@ -2262,13 +2283,15 @@ end subroutine statein_create
!-------------------------
! GFS_stateout_type%create
!-------------------------
- subroutine stateout_create (Stateout, IM, Model)
+ subroutine stateout_create (Stateout, Model)
implicit none
class(GFS_stateout_type) :: Stateout
- integer, intent(in) :: IM
type(GFS_control_type), intent(in) :: Model
+ integer :: IM
+
+ IM = Model%ncols
allocate (Stateout%gu0 (IM,Model%levs))
allocate (Stateout%gv0 (IM,Model%levs))
@@ -2286,13 +2309,15 @@ end subroutine stateout_create
!------------------------
! GFS_sfcprop_type%create
!------------------------
- subroutine sfcprop_create (Sfcprop, IM, Model)
+ subroutine sfcprop_create (Sfcprop, Model)
implicit none
class(GFS_sfcprop_type) :: Sfcprop
- integer, intent(in) :: IM
type(GFS_control_type), intent(in) :: Model
+ integer :: IM
+
+ IM = Model%ncols
!--- physics and radiation
allocate (Sfcprop%slmsk (IM))
@@ -2855,19 +2880,31 @@ subroutine sfcprop_create (Sfcprop, IM, Model)
Sfcprop%lu_qfire = clear_val
endif
+ !--- if fire_behavior is on
+ if(Model%cpl_fire) then
+ allocate (Sfcprop%hflx_fire (IM))
+ allocate (Sfcprop%evap_fire (IM))
+ allocate (Sfcprop%smoke_fire (IM))
+ Sfcprop%hflx_fire = zero
+ Sfcprop%evap_fire = zero
+ Sfcprop%smoke_fire = zero
+ endif
+
end subroutine sfcprop_create
!-------------------------
! GFS_coupling_type%create
!-------------------------
- subroutine coupling_create (Coupling, IM, Model)
+ subroutine coupling_create (Coupling, Model)
implicit none
class(GFS_coupling_type) :: Coupling
- integer, intent(in) :: IM
type(GFS_control_type), intent(in) :: Model
+ integer :: IM
+
+ IM = Model%ncols
!--- radiation out
!--- physics in
@@ -2912,7 +2949,7 @@ subroutine coupling_create (Coupling, IM, Model)
Coupling%tsfc_radtime = clear_val
endif
- if (Model%cplflx .or. Model%do_sppt .or. Model%cplchm .or. Model%ca_global .or. Model%cpllnd) then
+ if (Model%cplflx .or. Model%do_sppt .or. Model%cplchm .or. Model%ca_global .or. Model%cpllnd .or. Model%cpl_fire) then
allocate (Coupling%rain_cpl (IM))
allocate (Coupling%snow_cpl (IM))
Coupling%rain_cpl = clear_val
@@ -2941,7 +2978,7 @@ subroutine coupling_create (Coupling, IM, Model)
! Coupling%zorlwav_cpl = clear_val
! endif
- if (Model%cplflx .or. Model%cpllnd) then
+ if (Model%cplflx .or. Model%cpllnd .or. Model%cpl_fire) then
allocate (Coupling%dlwsfci_cpl (IM))
allocate (Coupling%dswsfci_cpl (IM))
allocate (Coupling%dlwsfc_cpl (IM))
@@ -2975,7 +3012,7 @@ subroutine coupling_create (Coupling, IM, Model)
Coupling%nvisdf_cpl = clear_val
end if
- if (Model%cplflx) then
+ if (Model%cplflx .or. Model%cpl_fire) then
!--- incoming quantities
allocate (Coupling%slimskin_cpl (IM))
allocate (Coupling%dusfcin_cpl (IM))
@@ -3140,7 +3177,7 @@ subroutine coupling_create (Coupling, IM, Model)
Coupling%pfl_lsan = clear_val
endif
- if (Model%cplchm .or. Model%cplflx .or. Model%cpllnd) then
+ if (Model%cplchm .or. Model%cplflx .or. Model%cpllnd .or. Model%cpl_fire) then
!--- accumulated convective rainfall
allocate (Coupling%rainc_cpl (IM))
Coupling%rainc_cpl = clear_val
@@ -3349,6 +3386,7 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
logical :: cpllnd = .false. !< default no cpllnd collection
logical :: cpllnd2atm = .false. !< default no cpllnd2atm coupling
logical :: rrfs_sd = .false. !< default no rrfs_sd collection
+ logical :: cpl_fire = .false. !< default no fire behavior colleciton
logical :: use_cice_alb = .false. !< default no cice albedo
logical :: cpl_imp_mrg = .false. !< default no merge import with internal forcings
logical :: cpl_imp_dbg = .false. !< default no write import data to file post merge
@@ -3544,6 +3582,7 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
real(kind=kind_phys) :: dt_inner = -999.0 !< time step for the inner loop
logical :: sedi_semi = .false. !< flag for semi Lagrangian sedi of rain
integer :: decfl = 8 !< deformed CFL factor
+ logical :: thpsnmp_is_init = .false. !< Local scheme initialization flag
!--- GFDL microphysical parameters
logical :: lgfdlmprad = .false. !< flag for GFDLMP radiation interaction
@@ -3888,6 +3927,9 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
logical :: ca_entr = .false.
logical :: ca_trigger = .false.
+!--- Increment grid
+ logical :: increment_file_on_native_grid = .false. ! increment on native grid else Gaussian grid
+
!--- IAU options
real(kind=kind_phys) :: iau_delthrs = 0 !< iau time interval (to scale increments)
character(len=240) :: iau_inc_files(7) = '' !< list of increment files
@@ -3973,6 +4015,9 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
integer :: kozpl = 28 !< File identifier for ozone forcing data
integer :: kozc = 48 !< File identifier for ozone climotology data
+!--- NRL h2o photochemistry physics
+ integer :: kh2oc = 29 !< File identifier for h2o photochemistry data.
+
!--- CCPP suite simulator
logical :: do_ccpp_suite_sim = .false.
integer :: nphys_proc = 0
@@ -4003,7 +4048,7 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
!--- coupling parameters
cplflx, cplice, cplocn2atm, cplwav, cplwav2atm, cplaqm, &
cplchm, cpllnd, cpllnd2atm, cpl_imp_mrg, cpl_imp_dbg, &
- rrfs_sd, use_cice_alb, &
+ cpl_fire, rrfs_sd, use_cice_alb, &
#ifdef IDEA_PHYS
lsidea, weimer_model, f107_kp_size, f107_kp_interval, &
f107_kp_skip_size, f107_kp_data_size, f107_kp_read_in_start, &
@@ -4122,6 +4167,8 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
nseed, nseed_g, nthresh, do_ca, ca_advect, &
ca_sgs, ca_global,iseed_ca,ca_smooth, &
nspinup,ca_amplitude,nsmooth,ca_closure,ca_entr,ca_trigger, &
+ !--- Increment grid
+ increment_file_on_native_grid, &
!--- IAU
iau_delthrs,iaufhrs,iau_inc_files,iau_filter_increments, &
iau_drymassfixer, &
@@ -4387,7 +4434,17 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
allocate(Model%blksz(1:Model%nblks))
Model%blksz = blksz
Model%ncols = sum(Model%blksz)
-
+ ! DH*
+ Model%nchunks = size(blksz)
+ allocate(Model%chunk_begin(Model%nchunks))
+ allocate(Model%chunk_end(Model%nchunks))
+ Model%chunk_begin(1) = 1
+ Model%chunk_end(1) = Model%chunk_begin(1) + blksz(1) - 1
+ do i=2,Model%nchunks
+ Model%chunk_begin(i) = Model%chunk_end(i-1) + 1
+ Model%chunk_end(i) = Model%chunk_begin(i) + blksz(i) - 1
+ end do
+
!--- coupling parameters
Model%cplflx = cplflx
Model%cplice = cplice
@@ -4413,6 +4470,7 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
!--- RRFS-SD
Model%rrfs_sd = rrfs_sd
+ Model%cpl_fire = cpl_fire
Model%dust_drylimit_factor = dust_drylimit_factor
Model%dust_moist_correction = dust_moist_correction
Model%dust_moist_opt = dust_moist_opt
@@ -4944,18 +5002,6 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
Model%oz_phys_2015 = oz_phys_2015
Model%h2o_phys = h2o_phys
- ! To ensure that these values match what's in the physics,
- ! array sizes are compared during model init in GFS_phys_time_vary_init()
- !
- ! from module h2ointerp
- if (h2o_phys) then
- levh2o = 72
- h2o_coeff = 3
- else
- levh2o = 1
- h2o_coeff = 1
- end if
-
Model%pdfcld = pdfcld
Model%shcnvcw = shcnvcw
Model%redrag = redrag
@@ -5238,6 +5284,9 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
Model%nqrimef = get_tracer_index(Model%tracer_names, 'q_rimef', Model%me, Model%master, Model%debug)
Model%ntwa = get_tracer_index(Model%tracer_names, 'liq_aero', Model%me, Model%master, Model%debug)
Model%ntia = get_tracer_index(Model%tracer_names, 'ice_aero', Model%me, Model%master, Model%debug)
+ if (Model%cpl_fire) then
+ Model%ntfsmoke = get_tracer_index(Model%tracer_names, 'fsmoke', Model%me, Model%master, Model%debug)
+ endif
if (Model%rrfs_sd) then
Model%ntsmoke = get_tracer_index(Model%tracer_names, 'smoke', Model%me, Model%master, Model%debug)
Model%ntdust = get_tracer_index(Model%tracer_names, 'dust', Model%me, Model%master, Model%debug)
@@ -5671,6 +5720,17 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, &
err_message = Model%ozphys%load_o3clim('global_o3prdlos.f77',kozc)
end if
+ !--- NRL h2o photochemistry physics.
+ if (Model%h2o_phys) then
+ ! Load data for h2o photochemistry physics.
+ err_message = Model%h2ophys%load('global_h2oprdlos.f77',kh2oc)
+ Model%levh2o = Model%h2ophys%nlev
+ Model%h2o_coeff = Model%h2ophys%ncf
+ else
+ Model%levh2o = 1
+ Model%h2o_coeff = 1
+ end if
+
!--- quantities to be used to derive phy_f*d totals
Model%nshoc_2d = nshoc_2d
Model%nshoc_3d = nshoc_3d
@@ -6539,6 +6599,7 @@ subroutine control_print(Model)
print *, ' cpllnd : ', Model%cpllnd
print *, ' cpllnd2atm : ', Model%cpllnd2atm
print *, ' rrfs_sd : ', Model%rrfs_sd
+ print *, ' cpl_fire : ', Model%cpl_fire
print *, ' use_cice_alb : ', Model%use_cice_alb
print *, ' cpl_imp_mrg : ', Model%cpl_imp_mrg
print *, ' cpl_imp_dbg : ', Model%cpl_imp_dbg
@@ -7011,6 +7072,7 @@ subroutine control_print(Model)
print *, ' nto2 : ', Model%nto2
print *, ' ntwa : ', Model%ntwa
print *, ' ntia : ', Model%ntia
+ print *, ' ntfsmoke : ', Model%ntfsmoke
print *, ' ntsmoke : ', Model%ntsmoke
print *, ' ntdust : ', Model%ntdust
print *, ' ntcoarsepm : ', Model%ntcoarsepm
@@ -7074,14 +7136,15 @@ end subroutine control_print
!----------------
! GFS_grid%create
!----------------
- subroutine grid_create (Grid, IM, Model)
+ subroutine grid_create (Grid, Model)
implicit none
class(GFS_grid_type) :: Grid
- integer, intent(in) :: IM
type(GFS_control_type), intent(in) :: Model
+ integer :: IM
+ IM = Model%ncols
allocate (Grid%xlon (IM))
allocate (Grid%xlat (IM))
allocate (Grid%xlat_d (IM))
@@ -7175,14 +7238,15 @@ end subroutine grid_create
!--------------------
! GFS_tbd_type%create
!--------------------
- subroutine tbd_create (Tbd, IM, Model)
+ subroutine tbd_create (Tbd, Model)
implicit none
class(GFS_tbd_type) :: Tbd
- integer, intent(in) :: IM
type(GFS_control_type), intent(in) :: Model
+ integer :: IM
+ IM = Model%ncols
!--- In
!--- sub-grid cloud radiation
if ( Model%isubc_lw == 2 .or. Model%isubc_sw == 2 ) then
@@ -7211,24 +7275,21 @@ subroutine tbd_create (Tbd, IM, Model)
!--- ozone and stratosphere h2o needs
allocate (Tbd%ozpl (IM,Model%levozp,Model%oz_coeff))
- allocate (Tbd%h2opl (IM,levh2o,h2o_coeff))
+ allocate (Tbd%h2opl (IM,Model%levh2o,Model%h2o_coeff))
Tbd%h2opl = clear_val
Tbd%ozpl = clear_val
!--- ccn and in needs
- ! DH* allocate only for MG? *DH
allocate (Tbd%in_nm (IM,Model%levs))
allocate (Tbd%ccn_nm (IM,Model%levs))
Tbd%in_nm = clear_val
Tbd%ccn_nm = clear_val
!--- aerosol fields
- ! DH* allocate only for MG? *DH
allocate (Tbd%aer_nm (IM,Model%levs,ntrcaer))
Tbd%aer_nm = clear_val
!--- tau_amf for NGWs
- ! DH* allocate only for UGWP ? *DH
allocate (Tbd%tau_amf(im) )
Tbd%tau_amf = clear_val
@@ -7372,13 +7433,15 @@ end subroutine tbd_create
!------------------------
! GFS_cldprop_type%create
!------------------------
- subroutine cldprop_create (Cldprop, IM, Model)
+ subroutine cldprop_create (Cldprop, Model)
implicit none
class(GFS_cldprop_type) :: Cldprop
- integer, intent(in) :: IM
type(GFS_control_type), intent(in) :: Model
+ integer :: IM
+
+ IM = Model%ncols
allocate (Cldprop%cv (IM))
allocate (Cldprop%cvt (IM))
@@ -7394,13 +7457,15 @@ end subroutine cldprop_create
!******************************************
! GFS_radtend_type%create
!******************************************
- subroutine radtend_create (Radtend, IM, Model)
+ subroutine radtend_create (Radtend, Model)
implicit none
class(GFS_radtend_type) :: Radtend
- integer, intent(in) :: IM
type(GFS_control_type), intent(in) :: Model
+ integer :: IM
+
+ IM = Model%ncols
!--- Out (radiation only)
allocate (Radtend%sfcfsw (IM))
@@ -7672,16 +7737,16 @@ end subroutine label_dtend_cause
!----------------
! GFS_diag%create
!----------------
- subroutine diag_create (Diag, IM, Model)
+ subroutine diag_create (Diag, Model)
use parse_tracers, only: get_tracer_index
class(GFS_diag_type) :: Diag
- integer, intent(in) :: IM
type(GFS_control_type), intent(in) :: Model
-
-!
+ integer :: IM
logical, save :: linit
logical :: have_pbl, have_dcnv, have_scnv, have_mp, have_oz_phys
+ IM = Model%ncols
+
if(Model%print_diff_pgr) then
allocate(Diag%old_pgr(IM))
Diag%old_pgr = clear_val
diff --git a/scm/src/GFS_typedefs.meta b/scm/src/GFS_typedefs.meta
index 2e74c0e7a..7f08839c9 100644
--- a/scm/src/GFS_typedefs.meta
+++ b/scm/src/GFS_typedefs.meta
@@ -10,112 +10,112 @@
standard_name = geopotential_at_interface
long_name = geopotential at model layer interfaces
units = m2 s-2
- dimensions = (horizontal_loop_extent,vertical_interface_dimension)
+ dimensions = (horizontal_dimension,vertical_interface_dimension)
type = real
kind = kind_phys
[prsi]
standard_name = air_pressure_at_interface
long_name = air pressure at model layer interfaces
units = Pa
- dimensions = (horizontal_loop_extent,vertical_interface_dimension)
+ dimensions = (horizontal_dimension,vertical_interface_dimension)
type = real
kind = kind_phys
[prsi(:,1)]
standard_name = air_pressure_at_lowest_model_interface
long_name = air pressure at lowest model interface
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[prsik]
standard_name = dimensionless_exner_function_at_interface
long_name = dimensionless Exner function at model layer interfaces
units = none
- dimensions = (horizontal_loop_extent,vertical_interface_dimension)
+ dimensions = (horizontal_dimension,vertical_interface_dimension)
type = real
kind = kind_phys
[prsik(:,1)]
standard_name = surface_dimensionless_exner_function
long_name = dimensionless Exner function at lowest model interface
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[phil]
standard_name = geopotential
long_name = geopotential at model layer centers
units = m2 s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[prsl]
standard_name = air_pressure
long_name = mean layer pressure
units = Pa
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[prsl(:,1)]
standard_name = air_pressure_at_surface_adjacent_layer
long_name = mean pressure at lowest model layer
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[prslk]
standard_name = dimensionless_exner_function
long_name = dimensionless Exner function at model layer centers
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[prslk(:,1)]
standard_name = dimensionless_exner_function_at_surface_adjacent_layer
long_name = dimensionless Exner function at lowest model layer
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[pgr]
standard_name = surface_air_pressure
long_name = surface pressure
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ugrs]
standard_name = x_wind
long_name = zonal wind
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[ugrs(:,1)]
standard_name = x_wind_at_surface_adjacent_layer
long_name = zonal wind at lowest model layer
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[vgrs]
standard_name = y_wind
long_name = meridional wind
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[vgrs(:,1)]
standard_name = y_wind_at_surface_adjacent_layer
long_name = meridional wind at lowest model layer
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[wgrs]
standard_name = unsmoothed_nonhydrostatic_upward_air_velocity
long_name = unsmoothed non-hydrostatic upward air velocity
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_lightning_threat_index_calculations)
@@ -123,91 +123,91 @@
standard_name = lagrangian_tendency_of_air_pressure
long_name = layer mean vertical velocity
units = Pa s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[tgrs]
standard_name = air_temperature
long_name = model layer mean temperature
units = K
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[tgrs(:,1)]
standard_name = air_temperature_at_surface_adjacent_layer
long_name = mean temperature at lowest model layer
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[qgrs]
standard_name = tracer_concentration
long_name = model layer mean tracer concentration
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_tracers)
+ dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_tracers)
type = real
kind = kind_phys
[qgrs(:,:,index_of_specific_humidity_in_tracer_concentration_array)]
standard_name = specific_humidity
long_name = water vapor specific humidity
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,1,index_of_specific_humidity_in_tracer_concentration_array)]
standard_name = specific_humidity_at_surface_adjacent_layer
long_name = water vapor specific humidity at lowest model layer
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_cloud_liquid_water_mixing_ratio_in_tracer_concentration_array)]
standard_name = cloud_liquid_water_mixing_ratio
long_name = ratio of mass of cloud water to mass of dry air plus vapor (without condensates)
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,1,index_of_cloud_liquid_water_mixing_ratio_in_tracer_concentration_array)]
standard_name = cloud_liquid_water_mixing_ratio_at_surface_adjacent_layer
long_name = ratio of mass of cloud water to mass of dry air plus vapor (without condensates) at lowest model layer
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_cloud_ice_mixing_ratio_in_tracer_concentration_array)]
standard_name = cloud_ice_mixing_ratio
long_name = ratio of mass of ice water to mass of dry air plus vapor (without condensates)
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_rain_mixing_ratio_in_tracer_concentration_array)]
standard_name = rain_mixing_ratio
long_name = ratio of mass of rain water to mass of dry air plus vapor (without condensates)
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_snow_mixing_ratio_in_tracer_concentration_array)]
standard_name = snow_mixing_ratio
long_name = ratio of mass of snow water to mass of dry air plus vapor (without condensates)
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_graupel_mixing_ratio_in_tracer_concentration_array)]
standard_name = graupel_mixing_ratio
long_name = ratio of mass of graupel to mass of dry air plus vapor (without condensates)
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_hail_mixing_ratio_in_tracer_concentration_array)]
standard_name = hail_mixing_ratio
long_name = ratio of mass of hail to mass of dry air plus vapor (without condensates)
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_hail_mixing_ratio_in_tracer_concentration_array > 0)
@@ -215,14 +215,14 @@
standard_name = ozone_mixing_ratio
long_name = ozone mixing ratio
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_mass_number_concentration_of_hygroscopic_aerosols_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_hygroscopic_aerosols
long_name = number concentration of water-friendly aerosols
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
active = (index_of_mass_number_concentration_of_hygroscopic_aerosols_in_tracer_concentration_array > 0)
type = real
kind = kind_phys
@@ -230,7 +230,7 @@
standard_name = mass_number_concentration_of_nonhygroscopic_ice_nucleating_aerosols
long_name = number concentration of ice-friendly aerosols
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
active = (index_of_mass_number_concentration_of_nonhygroscopic_ice_nucleating_aerosols_in_tracer_concentration_array > 0)
type = real
kind = kind_phys
@@ -238,7 +238,7 @@
standard_name = mass_number_concentration_of_cloud_liquid_water_particles_in_air
long_name = number concentration of cloud droplets (liquid)
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_mass_number_concentration_of_cloud_droplets_in_tracer_concentration_array > 0)
@@ -246,35 +246,35 @@
standard_name = mass_number_concentration_of_cloud_ice_water_crystals_in_air
long_name = number concentration of ice
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_mass_number_concentration_of_rain_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_rain_water_in_air
long_name = number concentration of rain
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_mass_number_concentration_of_snow_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_snow_in_air
long_name = number concentration of snow
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_mass_number_concentration_of_graupel_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_graupel_in_air
long_name = number concentration of graupel
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_mass_number_concentration_of_hail_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_hail_in_air
long_name = number concentration of hail
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_mass_number_concentration_of_hail_in_tracer_concentration_array > 0)
@@ -282,7 +282,7 @@
standard_name = reflectivity_of_rain_in_air
long_name = reflectivity of rain
units = m6 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_reflectivity_of_rain_in_tracer_concentration_array > 0)
@@ -290,7 +290,7 @@
standard_name = reflectivity_of_graupel_in_air
long_name = reflectivity of graupel
units = m6 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_reflectivity_of_graupel_in_tracer_concentration_array > 0)
@@ -298,7 +298,7 @@
standard_name = reflectivity_of_hail_in_air
long_name = reflectivity of hail
units = m6 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_reflectivity_of_hail_in_tracer_concentration_array > 0)
@@ -306,7 +306,7 @@
standard_name = cloud_condensation_nuclei_number_concentration
long_name = number concentration of cloud condensation nuclei
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_cloud_condensation_nuclei_number_concentration_in_tracer_concentration_array > 0 )
@@ -314,7 +314,7 @@
standard_name = activated_cloud_condensation_nuclei_number_concentration
long_name = number concentration of activated cloud condensation nuclei
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_activated_cloud_condensation_nuclei_number_concentration_in_tracer_concentration_array > 0 )
@@ -322,7 +322,7 @@
standard_name = graupel_volume
long_name = graupel particle volume
units = m3 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_graupel_volume_in_tracer_concentration_array > 0 )
@@ -330,7 +330,7 @@
standard_name = hail_volume
long_name = hail particle volume
units = m3 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_hail_volume_in_tracer_concentration_array > 0 )
@@ -338,14 +338,14 @@
standard_name = turbulent_kinetic_energy
long_name = turbulent kinetic energy
units = J
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_of_updraft_area_fraction_in_tracer_concentration_array)]
standard_name = prognostic_updraft_area_fraction_in_convection
long_name = convective updraft area fraction
units = frac
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_updraft_area_fraction_in_tracer_concentration_array > 0 )
@@ -353,21 +353,21 @@
standard_name = smoke_tracer_concentration
long_name = concentration of smoke
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[qgrs(:,:,index_for_dust_in_tracer_concentration_array)]
standard_name = dust_tracer_concentration
long_name = concentration of dust
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[diss_est]
standard_name = dissipation_estimate_of_air_temperature_at_model_layers
long_name = dissipation estimate model layer mean temperature
units = K
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
@@ -384,112 +384,112 @@
standard_name = x_wind_of_new_state
long_name = zonal wind updated by physics
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gu0(:,1)]
standard_name = x_wind_of_new_state_at_surface_adjacent_layer
long_name = zonal wind at lowest model layer updated by physics
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[gv0]
standard_name = y_wind_of_new_state
long_name = meridional wind updated by physics
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gv0(:,1)]
standard_name = y_wind_of_new_state_at_surface_adjacent_layer
long_name = meridional wind at lowest model layer updated by physics
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[gt0]
standard_name = air_temperature_of_new_state
long_name = temperature updated by physics
units = K
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gt0(:,1)]
standard_name = air_temperature_of_new_state_at_surface_adjacent_layer
long_name = temperature at lowest model layer updated by physics
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[gq0]
standard_name = tracer_concentration_of_new_state
long_name = tracer concentration updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_tracers)
+ dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_tracers)
type = real
kind = kind_phys
[gq0(:,:,index_of_specific_humidity_in_tracer_concentration_array)]
standard_name = specific_humidity_of_new_state
long_name = water vapor specific humidity updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,1,index_of_specific_humidity_in_tracer_concentration_array)]
standard_name = specific_humidity_of_new_state_at_surface_adjacent_layer
long_name = water vapor specific humidity at lowest model layer updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_ozone_mixing_ratio_in_tracer_concentration_array)]
standard_name = ozone_concentration_of_new_state
long_name = ozone concentration updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_cloud_liquid_water_mixing_ratio_in_tracer_concentration_array)]
standard_name = cloud_liquid_water_mixing_ratio_of_new_state
long_name = ratio of mass of cloud water to mass of dry air plus vapor (without condensates) updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_cloud_ice_mixing_ratio_in_tracer_concentration_array)]
standard_name = cloud_ice_mixing_ratio_of_new_state
long_name = ratio of mass of ice water to mass of dry air plus vapor (without condensates) updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_rain_mixing_ratio_in_tracer_concentration_array)]
standard_name = rain_mixing_ratio_of_new_state
long_name = ratio of mass of rain water to mass of dry air plus vapor (without condensates) updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_snow_mixing_ratio_in_tracer_concentration_array)]
standard_name = snow_mixing_ratio_of_new_state
long_name = ratio of mass of snow water to mass of dry air plus vapor (without condensates) updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_graupel_mixing_ratio_in_tracer_concentration_array)]
standard_name = graupel_mixing_ratio_of_new_state
long_name = ratio of mass of graupel to mass of dry air plus vapor (without condensates) updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_hail_mixing_ratio_in_tracer_concentration_array)]
standard_name = hail_mixing_ratio_of_new_state
long_name = ratio of mass of hail to mass of dry air plus vapor (without condensates) updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_hail_mixing_ratio_in_tracer_concentration_array > 0 )
@@ -497,14 +497,14 @@
standard_name = mass_weighted_rime_factor_of_new_state
long_name = mass weighted rime factor updated by physics
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_mass_number_concentration_of_hygroscopic_aerosols_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_hygroscopic_aerosols_of_new_state
long_name = number concentration of water-friendly aerosols updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_mass_number_concentration_of_hygroscopic_aerosols_in_tracer_concentration_array > 0)
@@ -512,7 +512,7 @@
standard_name = mass_number_concentration_of_nonhygroscopic_ice_nucleating_aerosols_of_new_state
long_name = number concentration of ice-friendly aerosols updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_mass_number_concentration_of_nonhygroscopic_ice_nucleating_aerosols_in_tracer_concentration_array > 0)
@@ -520,7 +520,7 @@
standard_name = mass_number_concentration_of_cloud_liquid_water_particles_in_air_of_new_state
long_name = number concentration of cloud droplets updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_mass_number_concentration_of_cloud_droplets_in_tracer_concentration_array > 0)
@@ -528,35 +528,35 @@
standard_name = mass_number_concentration_of_cloud_ice_water_crystals_in_air_of_new_state
long_name = number concentration of ice updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_mass_number_concentration_of_rain_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_rain_of_new_state
long_name = number concentration of rain updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_mass_number_concentration_of_snow_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_snow_of_new_state
long_name = number concentration of snow updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_mass_number_concentration_of_graupel_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_graupel_of_new_state
long_name = number concentration of graupel updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_mass_number_concentration_of_hail_in_tracer_concentration_array)]
standard_name = mass_number_concentration_of_hail_of_new_state
long_name = number concentration of hail updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_mass_number_concentration_of_hail_in_tracer_concentration_array > 0 )
@@ -564,7 +564,7 @@
standard_name = cloud_condensation_nuclei_number_concentration_of_new_state
long_name = number concentration of cloud condensation nuclei updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_cloud_condensation_nuclei_number_concentration_in_tracer_concentration_array > 0 )
@@ -572,7 +572,7 @@
standard_name = activated_cloud_condensation_nuclei_number_concentration_of_new_state
long_name = number concentration of cloud condensation nuclei updated by physics
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_activated_cloud_condensation_nuclei_number_concentration_in_tracer_concentration_array > 0 )
@@ -580,7 +580,7 @@
standard_name = graupel_volume_of_new_state
long_name = graupel volume updated by physics
units = m3 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_graupel_volume_in_tracer_concentration_array > 0 )
@@ -588,7 +588,7 @@
standard_name = hail_volume_of_new_state
long_name = hail volume updated by physics
units = m3 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_hail_volume_in_tracer_concentration_array > 0 )
@@ -596,7 +596,7 @@
standard_name = reflectivity_of_rain_of_new_state
long_name = reflectivity of rain updated by physics
units = m6 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_reflectivity_of_rain_in_tracer_concentration_array > 0 )
@@ -604,7 +604,7 @@
standard_name = reflectivity_of_graupel_of_new_state
long_name = reflectivity of graupel updated by physics
units = m6 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_reflectivity_of_graupel_in_tracer_concentration_array > 0 )
@@ -612,7 +612,7 @@
standard_name = reflectivity_of_hail_of_new_state
long_name = reflectivity of hail updated by physics
units = m6 kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_reflectivity_of_hail_in_tracer_concentration_array > 0 )
@@ -620,17 +620,18 @@
standard_name = cloud_area_fraction_in_atmosphere_layer_of_new_state
long_name = cloud fraction updated by physics
units = frac
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[gq0(:,:,index_of_updraft_area_fraction_in_tracer_concentration_array)]
standard_name = updraft_area_fraction_updated_by_physics
long_name = convective updraft area fraction updated by physics
units = frac
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( index_of_updraft_area_fraction_in_tracer_concentration_array > 0 )
+
########################################################################
[ccpp-table-properties]
name = GFS_sfcprop_type
@@ -644,56 +645,56 @@
standard_name = area_type
long_name = landmask: sea/land/ice=0/1/2
units = flag
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[oceanfrac]
standard_name = sea_area_fraction
long_name = fraction of horizontal grid area occupied by ocean
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[landfrac]
standard_name = land_area_fraction
long_name = fraction of horizontal grid area occupied by land
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[vegtype_frac]
standard_name = fraction_of_vegetation_category
long_name = fraction of horizontal grid area occupied by given vegetation category
units = frac
- dimensions = (horizontal_loop_extent,number_of_vegetation_categories)
+ dimensions = (horizontal_dimension,number_of_vegetation_categories)
type = real
kind = kind_phys
[soiltype_frac]
standard_name = fraction_of_soil_category
long_name = fraction of horizontal grid area occupied by given soil category
units = frac
- dimensions = (horizontal_loop_extent,number_of_soil_categories)
+ dimensions = (horizontal_dimension,number_of_soil_categories)
type = real
kind = kind_phys
[lakefrac]
standard_name = lake_area_fraction
long_name = fraction of horizontal grid area occupied by lake
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[lakedepth]
standard_name = lake_depth
long_name = lake depth
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[clm_lakedepth]
standard_name = clm_lake_depth
long_name = clm internal copy of lake depth with 10.0 replaced by default lake depth
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2)
@@ -701,13 +702,13 @@
standard_name = flag_for_using_lake_model
long_name = flag indicating lake points using a lake model
units = flag
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[lake_t2m]
standard_name = temperature_at_2m_from_clm_lake
long_name = temperature at 2m from clm lake
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2)
@@ -715,7 +716,7 @@
standard_name = specific_humidity_at_2m_from_clm_lake
long_name = specific humidity at 2m from clm lake
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2)
@@ -723,7 +724,7 @@
standard_name = mixed_layer_depth_of_lakes
long_name = depth of lake mixing layer
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0)
@@ -731,7 +732,7 @@
standard_name = lake_mixed_layer_temperature
long_name = temperature of lake mixing layer
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0)
@@ -739,7 +740,7 @@
standard_name = mean_temperature_of_the_water_column
long_name = thee mean temperature of the water column
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0)
@@ -747,7 +748,7 @@
standard_name = the_thermally_active_layer_depth_of_the_bottom_sediment
long_name = the depth of the thermally active layer of the bottom sediment
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0)
@@ -755,7 +756,7 @@
standard_name = temperature_at_the_bottom_of_the_sediment_upper_layer
long_name = the temperature at the bottom of the sediment upper layer
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0)
@@ -763,7 +764,7 @@
standard_name = lake_bottom_temperature
long_name = the temperature at the water-bottom sediment interface
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0)
@@ -771,7 +772,7 @@
standard_name = temperature_for_bottom_layer_of_water
long_name = the temperature at the lake bottom layer water
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0)
@@ -779,7 +780,7 @@
standard_name = shape_factor_of_water_temperature_vertical_profile
long_name = the shape factor of water temperature vertical profile
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0)
@@ -787,7 +788,7 @@
standard_name = temperature_of_snow_on_lake
long_name = temperature of snow on a lake
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_execution_method > 0)
@@ -795,147 +796,147 @@
standard_name = surface_skin_temperature
long_name = surface skin temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tsfco]
standard_name = sea_surface_temperature
long_name = sea surface temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[usfco]
standard_name = x_ocean_current
long_name = zonal current at ocean surface
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[vsfco]
standard_name = y_ocean_current
long_name = meridional current at ocean surface
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tsfcl]
standard_name = surface_skin_temperature_over_land
long_name = surface skin temperature over land
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tisfc]
standard_name = surface_skin_temperature_over_ice
long_name = surface skin temperature over ice
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tiice]
standard_name = temperature_in_ice_layer
long_name = sea ice internal temperature
units = K
- dimensions = (horizontal_loop_extent,vertical_dimension_of_sea_ice)
+ dimensions = (horizontal_dimension,vertical_dimension_of_sea_ice)
type = real
kind = kind_phys
[snowd]
standard_name = lwe_surface_snow
long_name = water equivalent snow depth
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[zorl]
standard_name = surface_roughness_length
long_name = surface roughness length
units = cm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[zorlw]
standard_name = surface_roughness_length_over_water
long_name = surface roughness length over water
units = cm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[zorll]
standard_name = surface_roughness_length_over_land
long_name = surface roughness length over land
units = cm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[zorli]
standard_name = surface_roughness_length_over_ice
long_name = surface roughness length over ice
units = cm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[zorlwav]
standard_name = surface_roughness_length_from_wave_model
long_name = surface roughness length from wave model
units = cm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[fice]
standard_name = sea_ice_area_fraction_of_sea_area_fraction
long_name = ice fraction over open water
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[snodl]
standard_name = surface_snow_thickness_water_equivalent_over_land
long_name = water equivalent snow depth over land
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[weasdl]
standard_name = water_equivalent_accumulated_snow_depth_over_land
long_name = water equiv of acc snow depth over land
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[snodi]
standard_name = surface_snow_thickness_water_equivalent_over_ice
long_name = water equivalent snow depth over ice
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[weasdi]
standard_name = water_equivalent_accumulated_snow_depth_over_ice
long_name = water equiv of acc snow depth over land
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[hprime]
standard_name = statistical_measures_of_subgrid_orography_collection_array
long_name = orographic metrics
units = mixed
- dimensions = (horizontal_loop_extent,number_of_statistical_measures_of_subgrid_orography)
+ dimensions = (horizontal_dimension,number_of_statistical_measures_of_subgrid_orography)
type = real
kind = kind_phys
[hprime(:,1)]
standard_name = standard_deviation_of_subgrid_orography
long_name = standard deviation of subgrid height_above_mean_sea_level
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dust12m_in]
standard_name = fengsha_dust12m_input
long_name = fengsha dust input
units = various
- dimensions = (horizontal_loop_extent,12,5)
+ dimensions = (horizontal_dimension,12,5)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -943,7 +944,7 @@
standard_name = anthropogenic_background_input
long_name = anthropogenic background input
units = various
- dimensions = (horizontal_loop_extent,1)
+ dimensions = (horizontal_dimension,1)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -951,7 +952,7 @@
standard_name = emission_smoke_RRFS
long_name = emission fire RRFS
units = various
- dimensions = (horizontal_loop_extent,24,2)
+ dimensions = (horizontal_dimension,24,2)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -959,7 +960,7 @@
standard_name = emission_smoke_prvd_RRFS
long_name = emission fire RRFS daily
units = various
- dimensions = (horizontal_loop_extent,4)
+ dimensions = (horizontal_dimension,4)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -967,7 +968,7 @@
standard_name = baseline_surface_roughness_length
long_name = baseline surface roughness length for momentum in meter
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -975,28 +976,28 @@
standard_name = baseline_surface_longwave_emissivity
long_name = baseline surface lw emissivity in fraction
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sncovr]
standard_name = surface_snow_area_fraction_over_land
long_name = surface snow area fraction
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sncovr_ice]
standard_name = surface_snow_area_fraction_over_ice
long_name = surface snow area fraction over ice
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[fire_heat_flux]
standard_name = surface_fire_heat_flux
long_name = heat flux of fire at the surface
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1004,7 +1005,7 @@
standard_name = fraction_of_grid_cell_burning
long_name = ration of the burnt area to the grid cell area
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1012,35 +1013,35 @@
standard_name = upper_bound_of_max_albedo_assuming_deep_snow
long_name = maximum snow albedo
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[emis_lnd]
standard_name = surface_longwave_emissivity_over_land
long_name = surface lw emissivity in fraction over land
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[emis_ice]
standard_name = surface_longwave_emissivity_over_ice
long_name = surface lw emissivity in fraction over ice
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[emis_wat]
standard_name = surface_longwave_emissivity_over_water
long_name = surface lw emissivity in fraction over water
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sfalb_lnd]
standard_name = surface_diffused_shortwave_albedo_over_land
long_name = mean surface diffused sw albedo over land
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1048,7 +1049,7 @@
standard_name = surface_diffused_shortwave_albedo_over_ice
long_name = mean surface diffused sw albedo over ice
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1056,7 +1057,7 @@
standard_name = surface_snow_free_albedo_over_land
long_name = surface snow-free albedo over ice
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1064,118 +1065,118 @@
standard_name = vis_albedo_weak_cosz
long_name = mean vis albedo with weak cosz dependency
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[alnwf]
standard_name = nir_albedo_weak_cosz
long_name = mean nir albedo with weak cosz dependency
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[slope]
standard_name = surface_slope_classification
long_name = sfc slope type for lsm
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[slope_save]
standard_name = surface_slope_classification_save
long_name = sfc slope type for lsm save
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[shdmin]
standard_name = min_vegetation_area_fraction
long_name = min fractional coverage of green vegetation
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[shdmax]
standard_name = max_vegetation_area_fraction
long_name = max fractional coverage of green vegetation
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tg3]
standard_name = deep_soil_temperature
long_name = deep soil temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[vfrac]
standard_name = vegetation_area_fraction
long_name = areal fractional cover of green vegetation
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[vtype]
standard_name = vegetation_type_classification
long_name = vegetation type for lsm
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[vtype_save]
standard_name = vegetation_type_classification_save
long_name = vegetation type for lsm save
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[stype]
standard_name = soil_type_classification
long_name = soil type for lsm
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[stype_save]
standard_name = soil_type_classification_save
long_name = soil type for lsm save
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[scolor]
standard_name = soil_color_classification
long_name = soil color for lsm
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[scolor_save]
standard_name = soil_color_classification_save
long_name = soil color for lsm save
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[uustar]
standard_name = surface_friction_velocity
long_name = boundary layer parameter
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[oro]
standard_name = height_above_mean_sea_level
long_name = height_above_mean_sea_level
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[oro_uf]
standard_name = unfiltered_height_above_mean_sea_level
long_name = unfiltered height_above_mean_sea_level
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[maxupmf]
standard_name = maximum_convective_updraft_mass_flux
long_name = maximum convective updraft mass flux within a column
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection)
@@ -1183,7 +1184,7 @@
standard_name = consecutive_calls_for_grell_freitas_convection
long_name = Memory counter for GF
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection)
@@ -1191,7 +1192,7 @@
standard_name = consecutive_calls_for_grell_freitas_mid_level_convection
long_name = Memory counter for GF midlevel
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection)
@@ -1199,63 +1200,63 @@
standard_name = specified_surface_upward_temperature_flux
long_name = specified kinematic surface upward sensible heat flux
units = K m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[spec_lh_flux]
standard_name = specified_surface_upward_specific_humidity_flux
long_name = specified kinematic surface upward latent heat flux
units = kg kg-1 m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[hice]
standard_name = sea_ice_thickness
long_name = sea ice thickness
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[weasd]
standard_name = lwe_thickness_of_surface_snow_amount
long_name = water equiv of acc snow depth over land and sea ice
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[canopy]
standard_name = canopy_water_amount
long_name = canopy water amount
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ffmm]
standard_name = Monin_Obukhov_similarity_function_for_momentum
long_name = Monin-Obukhov similarity function for momentum
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ffhh]
standard_name = Monin_Obukhov_similarity_function_for_heat
long_name = Monin-Obukhov similarity function for heat
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[f10m]
standard_name = ratio_of_wind_at_surface_adjacent_layer_to_wind_at_10m
long_name = ratio of sigma level 1 wind and 10m wind
units = ratio
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[rca]
standard_name = aerodynamic_resistance_in_canopy
long_name = canopy resistance
units = s m-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noah_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1263,63 +1264,63 @@
standard_name = nonnegative_lwe_thickness_of_precipitation_amount_on_dynamics_timestep
long_name = total precipitation amount in each time step
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[srflag]
standard_name = precipitation_type
long_name = snow/rain flag for precipitation
units = flag
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[slc]
standard_name = volume_fraction_of_unfrozen_water_in_soil
long_name = liquid soil moisture
units = frac
- dimensions = (horizontal_loop_extent,vertical_dimension_of_soil)
+ dimensions = (horizontal_dimension,vertical_dimension_of_soil)
type = real
kind = kind_phys
[smc]
standard_name = volume_fraction_of_condensed_water_in_soil
long_name = total soil moisture
units = frac
- dimensions = (horizontal_loop_extent,vertical_dimension_of_soil)
+ dimensions = (horizontal_dimension,vertical_dimension_of_soil)
type = real
kind = kind_phys
[stc]
standard_name = soil_temperature
long_name = soil temperature
units = K
- dimensions = (horizontal_loop_extent,vertical_dimension_of_soil)
+ dimensions = (horizontal_dimension,vertical_dimension_of_soil)
type = real
kind = kind_phys
[t2m]
standard_name = air_temperature_at_2m
long_name = 2 meter temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[th2m]
standard_name = air_potential_temperature_at_2m
long_name = 2 meter potential temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[q2m]
standard_name = specific_humidity_at_2m
long_name = 2 meter specific humidity
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tref]
standard_name = reference_sea_surface_temperature
long_name = sea surface reference temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1327,7 +1328,7 @@
standard_name = molecular_sublayer_thickness_in_sea_water
long_name = sub-layer cooling thickness
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1335,7 +1336,7 @@
standard_name = coefficient_c_0
long_name = coefficient 1 to calculate d(Tz)/d(Ts)
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1343,7 +1344,7 @@
standard_name = coefficient_c_d
long_name = coefficient 2 to calculate d(Tz)/d(Ts)
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1351,7 +1352,7 @@
standard_name = coefficient_w_0
long_name = coefficient 3 to calculate d(Tz)/d(Ts)
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1359,7 +1360,7 @@
standard_name = coefficient_w_d
long_name = coefficient 4 to calculate d(Tz)/d(Ts)
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1367,7 +1368,7 @@
standard_name = heat_content_in_diurnal_thermocline
long_name = heat content in diurnal thermocline layer
units = K m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1375,7 +1376,7 @@
standard_name = sea_water_salinity_in_diurnal_thermocline
long_name = salinity content in diurnal thermocline layer
units = ppt m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1383,7 +1384,7 @@
standard_name = x_current_in_diurnal_thermocline
long_name = u-current content in diurnal thermocline layer
units = m2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1391,7 +1392,7 @@
standard_name = y_current_in_diurnal_thermocline
long_name = v-current content in diurnal thermocline layer
units = m2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1399,7 +1400,7 @@
standard_name = diurnal_thermocline_layer_thickness
long_name = diurnal thermocline layer thickness
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1407,7 +1408,7 @@
standard_name = ocean_mixed_layer_thickness
long_name = mixed layer thickness
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1415,7 +1416,7 @@
standard_name = derivative_of_heat_content_in_diurnal_thermocline_wrt_surface_skin_temperature
long_name = d(xt)/d(ts)
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1423,7 +1424,7 @@
standard_name = derivative_of_diurnal_thermocline_layer_thickness_wrt_surface_skin_temperature
long_name = d(xz)/d(ts)
units = m K-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1431,7 +1432,7 @@
standard_name = free_convection_layer_thickness_in_sea_water
long_name = thickness of free convection layer (FCL)
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1439,7 +1440,7 @@
standard_name = control_for_diurnal_thermocline_calculation
long_name = index to start dtlm run or not
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1447,7 +1448,7 @@
standard_name = molecular_sublayer_temperature_correction_in_sea_water
long_name = sub-layer cooling amount
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1455,7 +1456,7 @@
standard_name = surface_sensible_heat_due_to_rainfall
long_name = sensible heat flux due to rainfall
units = W
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_nsstm > 0)
@@ -1463,7 +1464,7 @@
standard_name = number_of_snow_layers
long_name = number of snow layers
units = count
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1471,7 +1472,7 @@
standard_name = canopy_temperature
long_name = vegetation temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1479,7 +1480,7 @@
standard_name = ground_temperature
long_name = ground temperature for noahmp
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1487,7 +1488,7 @@
standard_name = canopy_intercepted_ice_mass
long_name = canopy intercepted ice mass
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1495,7 +1496,7 @@
standard_name = canopy_intercepted_liquid_water
long_name = canopy intercepted liquid water
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1503,7 +1504,7 @@
standard_name = air_vapor_pressure_in_canopy
long_name = canopy air vapor pressure
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1511,7 +1512,7 @@
standard_name = air_temperature_in_canopy
long_name = canopy air temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1519,7 +1520,7 @@
standard_name = surface_drag_coefficient_for_momentum_for_noahmp
long_name = surface drag coefficient for momentum for noahmp
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1527,7 +1528,7 @@
standard_name = surface_drag_coefficient_for_heat_and_moisture_for_noahmp
long_name = surface exchange coeff heat & moisture for noahmp
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1535,7 +1536,7 @@
standard_name = wet_canopy_area_fraction
long_name = area fraction of canopy that is wetted/snowed
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1543,7 +1544,7 @@
standard_name = lwe_thickness_of_snowfall_amount_on_previous_timestep
long_name = snow mass at previous time step
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1551,7 +1552,7 @@
standard_name = surface_albedo_assuming_deep_snow_on_previous_timestep
long_name = snow albedo at previous time step
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1559,7 +1560,7 @@
standard_name = lwe_snowfall_rate
long_name = snow precipitation rate at surface
units = mm s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1567,7 +1568,7 @@
standard_name = water_storage_in_lake
long_name = lake water storage
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1575,7 +1576,7 @@
standard_name = water_table_depth
long_name = water table depth
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1583,7 +1584,7 @@
standard_name = water_storage_in_aquifer
long_name = water storage in aquifer
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1591,7 +1592,7 @@
standard_name = water_storage_in_aquifer_and_saturated_soil
long_name = water storage in aquifer and saturated soil
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1599,7 +1600,7 @@
standard_name = temperature_in_surface_snow
long_name = temperature_in_surface_snow
units = K
- dimensions = (horizontal_loop_extent, lower_bound_of_vertical_dimension_of_surface_snow:0)
+ dimensions = (horizontal_dimension, lower_bound_of_vertical_dimension_of_surface_snow:0)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1607,7 +1608,7 @@
standard_name = depth_from_snow_surface_at_bottom_interface
long_name = depth from the top of the snow surface at the bottom of the layer
units = m
- dimensions = (horizontal_loop_extent, lower_bound_of_vertical_dimension_of_surface_snow:vertical_dimension_of_soil_internal_to_land_surface_scheme)
+ dimensions = (horizontal_dimension, lower_bound_of_vertical_dimension_of_surface_snow:vertical_dimension_of_soil_internal_to_land_surface_scheme)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1615,7 +1616,7 @@
standard_name = lwe_thickness_of_ice_in_surface_snow
long_name = snow layer ice
units = mm
- dimensions = (horizontal_loop_extent, lower_bound_of_vertical_dimension_of_surface_snow:0)
+ dimensions = (horizontal_dimension, lower_bound_of_vertical_dimension_of_surface_snow:0)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1623,7 +1624,7 @@
standard_name = lwe_thickness_of_liquid_water_in_surface_snow
long_name = snow layer liquid water
units = mm
- dimensions = (horizontal_loop_extent, lower_bound_of_vertical_dimension_of_surface_snow:0)
+ dimensions = (horizontal_dimension, lower_bound_of_vertical_dimension_of_surface_snow:0)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1631,7 +1632,7 @@
standard_name = leaf_mass_content
long_name = leaf mass
units = g m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1639,7 +1640,7 @@
standard_name = fine_root_mass_content
long_name = fine root mass
units = g m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1647,7 +1648,7 @@
standard_name = stem_mass_content
long_name = stem mass
units = g m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1655,7 +1656,7 @@
standard_name = wood_mass_content
long_name = wood mass including woody roots
units = g m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1663,7 +1664,7 @@
standard_name = slow_soil_pool_mass_content_of_carbon
long_name = stable carbon in deep soil
units = g m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1671,7 +1672,7 @@
standard_name = fast_soil_pool_mass_content_of_carbon
long_name = short-lived carbon in shallow soil
units = g m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1679,7 +1680,7 @@
standard_name = leaf_area_index
long_name = leaf area index
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noah_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1687,7 +1688,7 @@
standard_name = stem_area_index
long_name = stem area index
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1695,7 +1696,7 @@
standard_name = dimensionless_age_of_surface_snow
long_name = non-dimensional snow age
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1703,7 +1704,7 @@
standard_name = volumetric_equilibrium_soil_moisture
long_name = equilibrium soil water content
units = m3 m-3
- dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme)
+ dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1711,7 +1712,7 @@
standard_name = volumetric_soil_moisture_between_soil_bottom_and_water_table
long_name = soil water content between the bottom of the soil and the water table
units = m3 m-3
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1719,7 +1720,7 @@
standard_name = water_table_recharge_assuming_deep
long_name = recharge to or from the water table when deep
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1727,7 +1728,7 @@
standard_name = water_table_recharge_assuming_shallow
long_name = recharge to or from the water table when shallow
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -1735,35 +1736,35 @@
standard_name = surface_albedo_direct_visible_over_land
long_name = direct surface albedo visible band over land
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[albdirnir_lnd]
standard_name = surface_albedo_direct_NIR_over_land
long_name = direct surface albedo NIR band over land
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[albdifvis_lnd]
standard_name = surface_albedo_diffuse_visible_over_land
long_name = diffuse surface albedo visible band over land
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[albdifnir_lnd]
standard_name = surface_albedo_diffuse_NIR_over_land
long_name = diffuse surface albedo NIR band over land
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[albdirvis_ice]
standard_name = surface_albedo_direct_visible_over_ice
long_name = direct surface albedo visible band over ice
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. flag_for_cice_albedo)
@@ -1771,7 +1772,7 @@
standard_name = surface_albedo_diffuse_visible_over_ice
long_name = diffuse surface albedo visible band over ice
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. flag_for_cice_albedo)
@@ -1779,7 +1780,7 @@
standard_name = surface_albedo_direct_NIR_over_ice
long_name = direct surface albedo NIR band over ice
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. flag_for_cice_albedo)
@@ -1787,7 +1788,7 @@
standard_name = surface_albedo_diffuse_NIR_over_ice
long_name = diffuse surface albedo NIR band over ice
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. flag_for_cice_albedo)
@@ -1795,7 +1796,7 @@
standard_name = normalized_soil_wetness_for_land_surface_model
long_name = normalized soil wetness for lsm
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1803,7 +1804,7 @@
standard_name = volume_fraction_of_unfrozen_soil_moisture_for_land_surface_model
long_name = volume fraction of unfrozen soil moisture for lsm
units = frac
- dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme)
+ dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1811,7 +1812,7 @@
standard_name = volume_fraction_of_frozen_soil_moisture_for_land_surface_model
long_name = volume fraction of frozen soil moisture for lsm
units = frac
- dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme)
+ dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1819,7 +1820,7 @@
standard_name = volume_fraction_of_soil_moisture_for_land_surface_model
long_name = volumetric fraction of soil moisture for lsm
units = frac
- dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme)
+ dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1827,7 +1828,7 @@
standard_name = soil_temperature_for_land_surface_model
long_name = soil temperature for land surface model
units = K
- dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme)
+ dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1835,7 +1836,7 @@
standard_name = cloud_condensed_water_mixing_ratio_at_surface_over_land
long_name = moist cloud water mixing ratio at surface over land
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1843,7 +1844,7 @@
standard_name = cloud_condensed_water_mixing_ratio_at_surface_over_ice
long_name = moist cloud water mixing ratio at surface over ice
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1851,7 +1852,7 @@
standard_name = water_vapor_mixing_ratio_at_surface_over_land
long_name = water vapor mixing ratio at surface over land
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1859,7 +1860,7 @@
standard_name = water_vapor_mixing_ratio_at_surface_over_ice
long_name = water vapor mixing ratio at surface over ice
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1867,7 +1868,7 @@
standard_name = control_for_frozen_soil_physics
long_name = flag for frozen soil physics (RUC)
units = flag
- dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme)
+ dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1875,7 +1876,7 @@
standard_name = lsm_internal_surface_frozen_precipitation_density
long_name = density of frozen precipitation
units = kg m-3
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1883,7 +1884,7 @@
standard_name = temperature_in_surface_snow_at_surface_adjacent_layer_over_land
long_name = snow temperature at the bottom of the first snow layer over land
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1891,7 +1892,7 @@
standard_name = temperature_in_surface_snow_at_surface_adjacent_layer_over_ice
long_name = snow temperature at the bottom of the first snow layer over ice
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1899,7 +1900,7 @@
standard_name = surface_snow_amount_assuming_variable_snow_density_over_land
long_name = run-total snow accumulation on the ground with variable snow density over land
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1907,14 +1908,14 @@
standard_name = surface_snow_lwe_thickness_amount_over_land
long_name = run-total snowfall water equivalent over land
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[snowfallac_ice]
standard_name = surface_snow_amount_assuming_variable_snow_density_over_ice
long_name = run-total snow accumulation on the ground with variable snow density over ice
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -1922,14 +1923,14 @@
standard_name = surface_snow_lwe_thickness_amount_over_ice
long_name = run-total snowfall water equivalent over ice
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ustm]
standard_name = surface_friction_velocity_for_momentum
long_name = friction velocity isolated for momentum only
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme)
@@ -1937,7 +1938,7 @@
standard_name = ratio_of_height_to_monin_obukhov_length
long_name = monin obukhov surface stability parameter
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme)
@@ -1945,7 +1946,7 @@
standard_name = surface_temperature_scale
long_name = temperature flux divided by ustar (temperature scale)
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme)
@@ -1953,28 +1954,28 @@
standard_name = reciprocal_of_obukhov_length
long_name = one over obukhov length
units = m-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[flhc]
standard_name = surface_exchange_coefficient_for_heat
long_name = surface exchange coefficient for heat
units = W m-2 K-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[flqc]
standard_name = surface_exchange_coefficient_for_moisture
long_name = surface exchange coefficient for moisture
units = kg m-2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[chs2]
standard_name = surface_exchange_coefficient_for_heat_at_2m
long_name = exchange coefficient for heat at 2 meters
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme)
@@ -1982,7 +1983,7 @@
standard_name = surface_exchange_coefficient_for_moisture_at_2m
long_name = exchange coefficient for moisture at 2 meters
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme)
@@ -1990,7 +1991,7 @@
standard_name = surface_upward_latent_heat_flux
long_name = latent heating at the surface (pos = up)
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme)
@@ -1998,28 +1999,28 @@
standard_name = surface_upward_specific_humidity_flux
long_name = kinematic surface upward latent heat flux
units = kg kg-1 m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[hflx]
standard_name = surface_upward_temperature_flux
long_name = kinematic surface upward sensible heat flux
units = K m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[qss]
standard_name = surface_specific_humidity
long_name = surface air saturation specific humidity
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[raincprv]
standard_name = lwe_thickness_of_convective_precipitation_amount_on_previous_timestep
long_name = convective_precipitation_amount from previous timestep
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme .or. ( control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2) )
@@ -2027,7 +2028,7 @@
standard_name = lwe_thickness_of_explicit_precipitation_amount_on_previous_timestep
long_name = explicit rainfall from previous timestep
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme .or. ( control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2) )
@@ -2035,7 +2036,7 @@
standard_name = lwe_thickness_of_ice_precipitation_amount_on_previous_timestep
long_name = ice amount from previous timestep
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -2043,7 +2044,7 @@
standard_name = snow_mass_on_previous_timestep
long_name = snow amount from previous timestep
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -2051,7 +2052,7 @@
standard_name = lwe_thickness_of_graupel_amount_on_previous_timestep
long_name = graupel amount from previous timestep
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -2059,7 +2060,7 @@
standard_name = convective_precipitation_rate_on_previous_timestep
long_name = convective precipitation rate from previous timestep
units = mm s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -2067,7 +2068,7 @@
standard_name = explicit_precipitation_rate_on_previous_timestep
long_name = explicit rainfall rate previous timestep
units = mm s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -2075,7 +2076,7 @@
standard_name = ice_precipitation_rate_on_previous_timestep
long_name = ice precipitation rate from previous timestep
units = mm s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -2083,7 +2084,7 @@
standard_name = snowfall_rate_on_previous_timestep
long_name = snow precipitation rate from previous timestep
units = mm s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -2091,7 +2092,7 @@
standard_name = graupel_precipitation_rate_on_previous_timestep
long_name = graupel precipitation rate from previous timestep
units = mm s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -2099,35 +2100,35 @@
standard_name = vis_albedo_strong_cosz
long_name = mean vis albedo with strong cosz dependency
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[alnsf]
standard_name = nir_albedo_strong_cosz
long_name = mean nir albedo with strong cosz dependency
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[facsf]
standard_name =strong_cosz_area_fraction
long_name = fractional coverage with strong cosz dependency
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[facwf]
standard_name = weak_cosz_area_fraction
long_name = fractional coverage with weak cosz dependency
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[lake_albedo]
standard_name = mid_day_surface_albedo_over_lake
long_name = mid day surface albedo over lake
units = fraction
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2135,7 +2136,7 @@
standard_name = lake_depth_before_correction
long_name = lake depth_before_correction
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2143,7 +2144,7 @@
standard_name = water_equivalent_accumulated_snow_depth_in_clm_lake_model
long_name = water equiv of acc snow depth over lake in clm lake model
units = mm
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2151,7 +2152,7 @@
standard_name = actual_snow_depth_in_clm_lake_model
long_name = actual acc snow depth over lake in clm lake model
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2159,7 +2160,7 @@
standard_name = snow_layers_in_clm_lake_model
long_name = snow layers in clm lake model (treated as integer)
units = count
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2167,7 +2168,7 @@
standard_name = snow_level_depth_in_clm_lake_model
long_name = snow level depth in clm lake model
units = m
- dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
+ dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2175,7 +2176,7 @@
standard_name = snow_level_thickness_in_clm_lake_model
long_name = snow level thickness in clm lake model
units = m
- dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
+ dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2183,7 +2184,7 @@
standard_name = snow_interface_depth_in_clm_lake_model
long_name = snow interface_depth in clm lake model
units = m
- dimensions = (horizontal_loop_extent,snow_plus_soil_vertical_dimension_for_clm_lake_model)
+ dimensions = (horizontal_dimension,snow_plus_soil_vertical_dimension_for_clm_lake_model)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2191,7 +2192,7 @@
standard_name = volumetric_soil_water_in_clm_lake_model
long_name = volumetric soil water in clm lake model
units = m3 m-3
- dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
+ dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2199,7 +2200,7 @@
standard_name = soil_liquid_water_content_in_clm_lake_model
long_name = soil liquid water content in clm lake model
units = kg m-3
- dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
+ dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2207,7 +2208,7 @@
standard_name = soil_ice_water_content_in_clm_lake_model
long_name = soil ice water content in clm lake model
units = kg m-3
- dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
+ dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2215,7 +2216,7 @@
standard_name = skin_temperature_from_lake_model
long_name = skin temperature from lake model
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2223,7 +2224,7 @@
standard_name = soil_or_snow_layer_temperature_from_clm_lake_model
long_name = soil or snow layer temperature from clm lake model
units = K
- dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
+ dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2231,7 +2232,7 @@
standard_name = lake_layer_temperature_from_clm_lake_model
long_name = lake layer temperature from clm lake model
units = K
- dimensions = (horizontal_loop_extent,lake_vertical_dimension_for_clm_lake_model)
+ dimensions = (horizontal_dimension,lake_vertical_dimension_for_clm_lake_model)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2239,7 +2240,7 @@
standard_name = top_level_eddy_conductivity_from_previous_timestep_in_clm_lake_model
long_name = top level eddy conductivity from previous timestep in clm lake model
units = kg m-3
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2247,14 +2248,14 @@
standard_name = lake_fractional_ice_cover_on_clm_lake_levels
long_name = lake fractional ice cover on clm lake levels
units = kg m-3
- dimensions = (horizontal_loop_extent,lake_vertical_dimension_for_clm_lake_model)
+ dimensions = (horizontal_dimension,lake_vertical_dimension_for_clm_lake_model)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
[lake_ht]
standard_name = test_lake_ht
long_name = test_lake_ht
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
units = unitless
type = real
kind = kind_phys
@@ -2263,7 +2264,7 @@
standard_name = flag_for_clm_lake_initialization
long_name = set to true in clm_lake_run after likeini is called for that gridpoint
units = flag
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
@@ -2271,21 +2272,21 @@
standard_name = clm_lake_is_salty
long_name = lake at this point is salty (1) or not (0)
units = 1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
[lake_cannot_freeze]
standard_name = clm_lake_cannot_freeze
long_name = lake at this point is so salty it cannot freeze
units = 1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0)
[emdust]
standard_name = emission_of_dust_for_smoke
long_name = emission of dust for smoke
units = ug m-2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2293,7 +2294,7 @@
standard_name = emission_of_sea_salt_for_mp_indir_fdb
long_name = emission of sea salt for mp indirect feedabck
units = ug m-2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2301,7 +2302,7 @@
standard_name = emission_of_anothropogenic_for_mp_indir_fdb
long_name = emission of anothropogenic for mp indirect feedabck
units = ug m-2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2309,7 +2310,7 @@
standard_name = surface_smoke_emission
long_name = emission of surface smoke
units = ug m-2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2317,7 +2318,7 @@
standard_name = frp_hourly
long_name = hourly fire radiative power
units = MW
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2325,7 +2326,7 @@
standard_name = fire_hist
long_name = coefficient to scale the fire activity depending on the fire duration
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2333,7 +2334,7 @@
standard_name = coef_bb_dc
long_name = coef to estimate the fire emission
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2341,14 +2342,14 @@
standard_name = fire_type
long_name = type of fire
units = 1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (do_smoke_coupling)
[peak_hr]
standard_name = peak_hr_fire
long_name = time_of_peak_fire_emissions
units = s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2356,7 +2357,7 @@
standard_name = sum_of_land_use_fractions_for_no_fire_pixels
long_name = land use of no fire pixels for type
units = 1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2364,7 +2365,7 @@
standard_name = sum_of_land_use_fractions_for_cropland_fire_pixels
long_name = land use of fire pixels for type
units = 1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -2372,10 +2373,34 @@
standard_name = smoke_fire_auxiliary_input
long_name = smoke fire auxiliary input variables
units = various
- dimensions = (horizontal_loop_extent,fire_auxiliary_data_extent)
+ dimensions = (horizontal_dimension,fire_auxiliary_data_extent)
type = real
kind = kind_phys
active = (do_smoke_coupling)
+[hflx_fire]
+ standard_name = kinematic_surface_upward_sensible_heat_flux_of_fire
+ long_name = kinematic surface upward sensible heat flux of fire
+ units = K m s-1
+ dimensions = (horizontal_loop_extent)
+ type = real
+ kind = kind_phys
+ active = (do_fire_coupling)
+[evap_fire]
+ standard_name = surface_upward_specific_humidity_flux_of_fire
+ long_name = kinematic surface upward latent heat flux of fire
+ units = kg kg-1 m s-1
+ dimensions = (horizontal_loop_extent)
+ type = real
+ kind = kind_phys
+ active = (do_fire_coupling)
+[smoke_fire]
+ standard_name = smoke_emission_of_fire
+ long_name = smoke emission of fire
+ units = kg m-2
+ dimensions = (horizontal_loop_extent)
+ type = real
+ kind = kind_phys
+ active = (do_fire_coupling)
########################################################################
[ccpp-table-properties]
@@ -2390,91 +2415,91 @@
standard_name = surface_downwelling_direct_nir_shortwave_flux_on_radiation_timestep
long_name = sfc nir beam sw downward flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[nirdfdi]
standard_name = surface_downwelling_diffuse_nir_shortwave_flux_on_radiation_timestep
long_name = sfc nir diff sw downward flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[visbmdi]
standard_name = surface_downwelling_direct_uv_and_vis_shortwave_flux_on_radiation_timestep
long_name = sfc uv+vis beam sw downward flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[visdfdi]
standard_name = surface_downwelling_diffuse_uv_and_vis_shortwave_flux_on_radiation_timestep
long_name = sfc uv+vis diff sw downward flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[nirbmui]
standard_name = surface_upwelling_direct_nir_shortwave_flux_on_radiation_timestep
long_name = sfc nir beam sw upward flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[nirdfui]
standard_name = surface_upwelling_diffuse_nir_shortwave_flux_on_radiation_timestep
long_name = sfc nir diff sw upward flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[visbmui]
standard_name = surface_upwelling_direct_uv_and_vis_shortwave_flux_on_radiation_timestep
long_name = sfc uv+vis beam sw upward flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[visdfui]
standard_name = surface_upwelling_diffuse_uv_and_vis_shortwave_flux_on_radiation_timestep
long_name = sfc uv+vis diff sw upward flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sfcdsw]
standard_name = surface_downwelling_shortwave_flux_on_radiation_timestep
long_name = total sky sfc downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sfcnsw]
standard_name = surface_net_downwelling_shortwave_flux_on_radiation_timestep
long_name = total sky sfc netsw flx into ground
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sfcdlw]
standard_name = surface_downwelling_longwave_flux_on_radiation_timestep
long_name = total sky sfc downward lw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sfculw]
standard_name = surface_upwelling_longwave_flux_on_radiation_timestep
long_name = total sky sfc upward lw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[rain_cpl]
standard_name = cumulative_lwe_thickness_of_precipitation_amount_for_coupling
long_name = total rain precipitation
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_stochastic_physics_perturbations .or. flag_for_chemistry_coupling .or. flag_for_global_cellular_automata .or. flag_for_land_coupling)
@@ -2482,23 +2507,23 @@
standard_name = cumulative_lwe_thickness_of_convective_precipitation_amount_for_coupling
long_name = total convective precipitation
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
- active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_land_coupling)
+ active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_land_coupling .or. do_fire_coupling)
[snow_cpl]
standard_name = cumulative_lwe_thickness_of_snow_amount_for_coupling
long_name = total snow precipitation
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
- active = (flag_for_surface_flux_coupling .or. flag_for_stochastic_physics_perturbations .or. flag_for_chemistry_coupling .or. flag_for_global_cellular_automata .or. flag_for_land_coupling)
+ active = (flag_for_surface_flux_coupling .or. flag_for_stochastic_physics_perturbations .or. flag_for_chemistry_coupling .or. flag_for_global_cellular_automata .or. flag_for_land_coupling .or. do_fire_coupling)
[dusfc_cpl]
standard_name = cumulative_surface_x_momentum_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc x momentum flux multiplied by timestep
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2506,7 +2531,7 @@
standard_name = cumulative_surface_y_momentum_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc y momentum flux multiplied by timestep
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2514,7 +2539,7 @@
standard_name = cumulative_surface_upward_sensible_heat_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc sensible heat flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2522,7 +2547,7 @@
standard_name = cumulative_surface_upward_latent_heat_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc latent heat flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2530,7 +2555,7 @@
standard_name = cumulative_surface_downwelling_longwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc downward lw flux mulitplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2538,7 +2563,7 @@
standard_name = cumulative_surface_downwelling_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc downward sw flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2546,7 +2571,7 @@
standard_name = cumulative_surface_downwelling_direct_nir_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc nir beam downward sw flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2554,7 +2579,7 @@
standard_name = cumulative_surface_downwelling_diffuse_nir_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc nir diff downward sw flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2562,7 +2587,7 @@
standard_name = cumulative_surface_downwelling_direct_uv_and_vis_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc uv+vis beam dnwd sw flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2570,7 +2595,7 @@
standard_name = cumulative_surface_downwelling_diffuse_uv_and_vis_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative sfc uv+vis diff dnwd sw flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2578,7 +2603,7 @@
standard_name = cumulative_surface_net_downwelling_longwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative net downward lw flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2586,7 +2611,7 @@
standard_name = cumulative_surface_net_downwelling_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative net downward sw flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2594,7 +2619,7 @@
standard_name = cumulative_surface_net_downwelling_direct_nir_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative net nir beam downward sw flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2602,7 +2627,7 @@
standard_name = cumulative_surface_net_downwellling_diffuse_nir_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative net nir diff downward sw flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2610,7 +2635,7 @@
standard_name = cumulative_surface_net_downwelling_direct_uv_and_vis_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative net uv+vis beam downward sw rad flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2618,7 +2643,7 @@
standard_name = cumulative_surface_net_downwelling_diffuse_uv_and_vis_shortwave_flux_for_coupling_multiplied_by_timestep
long_name = cumulative net uv+vis diff downward sw rad flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2626,7 +2651,7 @@
standard_name = surface_x_momentum_flux_for_coupling
long_name = instantaneous sfc x momentum flux
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2634,7 +2659,7 @@
standard_name = surface_y_momentum_flux_for_coupling
long_name = instantaneous sfc y momentum flux
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2642,7 +2667,7 @@
standard_name = surface_upward_sensible_heat_flux_for_coupling
long_name = instantaneous sfc sensible heat flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling)
@@ -2650,7 +2675,7 @@
standard_name = surface_upward_latent_heat_flux_for_coupling
long_name = instantaneous sfc latent heat flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling)
@@ -2658,7 +2683,7 @@
standard_name = surface_downwelling_longwave_flux_for_coupling
long_name = instantaneous sfc downward lw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2666,7 +2691,7 @@
standard_name = surface_downwelling_shortwave_flux_for_coupling
long_name = instantaneous sfc downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2674,7 +2699,7 @@
standard_name = surface_downwelling_direct_nir_shortwave_flux_for_coupling
long_name = instantaneous sfc nir beam downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2682,7 +2707,7 @@
standard_name = surface_downwelling_diffuse_nir_shortwave_flux_for_coupling
long_name = instantaneous sfc nir diff downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2690,7 +2715,7 @@
standard_name = surface_downwelling_direct_uv_and_vis_shortwave_flux_for_coupling
long_name = instantaneous sfc uv+vis beam downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2698,7 +2723,7 @@
standard_name = surface_downwelling_diffuse_uv_and_vis_shortwave_flux_for_coupling
long_name = instantaneous sfc uv+vis diff downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2706,7 +2731,7 @@
standard_name = surface_net_downwelling_longwave_flux_for_coupling
long_name = instantaneous net sfc downward lw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2714,7 +2739,7 @@
standard_name = surface_net_downwelling_shortwave_flux_for_coupling
long_name = instantaneous net sfc downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling .or. flag_for_land_coupling)
@@ -2722,7 +2747,7 @@
standard_name = surface_net_downwelling_direct_nir_shortwave_flux_for_coupling
long_name = instantaneous net nir beam sfc downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2730,7 +2755,7 @@
standard_name = surface_net_downwelling_diffuse_nir_shortwave_flux_for_coupling
long_name = instantaneous net nir diff sfc downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2738,7 +2763,7 @@
standard_name = surface_net_downwelling_direct_uv_and_vis_shortwave_flux_for_coupling
long_name = instantaneous net uv+vis beam downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2746,7 +2771,7 @@
standard_name = surface_net_downwelling_diffuse_uv_and_vis_shortwave_flux_for_coupling
long_name = instantaneous net uv+vis diff downward sw flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling)
@@ -2754,23 +2779,23 @@
standard_name = temperature_at_2m_for_coupling
long_name = instantaneous T2m
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
- active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling)
+ active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling .or. do_fire_coupling)
[q2mi_cpl]
standard_name = specific_humidity_at_2m_for_coupling
long_name = instantaneous Q2m
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
- active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling)
+ active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling .or. do_fire_coupling)
[u10mi_cpl]
standard_name = x_wind_at_10m_for_coupling
long_name = instantaneous U10m
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_ocean_wave_coupling)
@@ -2778,7 +2803,7 @@
standard_name = y_wind_at_10m_for_coupling
long_name = instantaneous V10m
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_ocean_wave_coupling)
@@ -2786,7 +2811,7 @@
standard_name = surface_skin_temperature_for_coupling
long_name = instantaneous sfc temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_land_coupling)
@@ -2794,15 +2819,15 @@
standard_name = surface_air_pressure_for_coupling
long_name = instantaneous sfc pressure
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
- active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling .or. flag_for_land_coupling)
+ active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling .or. flag_for_land_coupling .or. do_fire_coupling)
[ulwsfcin_cpl]
standard_name = surface_upwelling_longwave_flux_from_coupled_process
long_name = surface upwelling LW flux for coupling
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2810,7 +2835,7 @@
standard_name = surface_x_momentum_flux_from_coupled_process
long_name = sfc x momentum flux for coupling
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2818,7 +2843,7 @@
standard_name = surface_y_momentum_flux_from_coupled_process
long_name = sfc y momentum flux for coupling
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2826,7 +2851,7 @@
standard_name = surface_upward_sensible_heat_flux_from_coupled_process
long_name = sfc sensible heat flux input
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2834,7 +2859,7 @@
standard_name = surface_upward_latent_heat_flux_from_coupled_process
long_name = sfc latent heat flux input for coupling
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -2842,7 +2867,7 @@
standard_name = surface_upwelling_longwave_flux_over_ocean_from_mediator
long_name = surface upwelling LW flux over ocean for coupling
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes)
@@ -2850,7 +2875,7 @@
standard_name = surface_x_momentum_flux_over_ocean_from_mediator
long_name = sfc x momentum flux over ocean for coupling
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes)
@@ -2858,7 +2883,7 @@
standard_name = surface_y_momentum_flux_over_ocean_from_mediator
long_name = sfc y momentum flux over ocean for coupling
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes)
@@ -2866,7 +2891,7 @@
standard_name = surface_upward_sensible_heat_flux_over_ocean_from_mediator
long_name = sfc sensible heat flux input over ocean for coupling
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes)
@@ -2874,7 +2899,7 @@
standard_name = surface_upward_latent_heat_flux_over_ocean_from_mediator
long_name = sfc latent heat flux input over ocean for coupling
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes)
@@ -2882,7 +2907,7 @@
standard_name = surface_snow_area_fraction_over_land_from_land
long_name = surface snow area fraction over land for coupling
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2890,7 +2915,7 @@
standard_name = surface_specific_humidity_over_land_from_land
long_name = surface air saturation specific humidity over land
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2898,7 +2923,7 @@
standard_name = surface_upward_sensible_heat_flux_over_land_from_land
long_name = sfc sensible heat flux input over land for coupling
units = K m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2906,7 +2931,7 @@
standard_name = surface_upward_latent_heat_flux_over_land_from_land
long_name = sfc latent heat flux input over land for coupling
units = kg kg-1 m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2914,7 +2939,7 @@
standard_name = surface_upward_potential_latent_heat_flux_over_land_from_land
long_name = surface upward potential latent heat flux over land for coupling
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2922,7 +2947,7 @@
standard_name = temperature_at_2m_over_land_from_land
long_name = 2 meter temperature over land for coupling
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2930,7 +2955,7 @@
standard_name = specific_humidity_at_2m_over_land_from_land
long_name = 2 meter specific humidity over land for coupling
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2938,7 +2963,7 @@
standard_name = upward_heat_flux_in_soil_over_land_from_land
long_name = soil heat flux over land for coupling
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2946,7 +2971,7 @@
standard_name = surface_runoff_flux_from_land
long_name = surface runoff flux over land for coupling
units = kg m-2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2954,7 +2979,7 @@
standard_name = subsurface_runoff_flux_from_land
long_name = subsurface runoff flux over land for coupling
units = kg m-2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2962,7 +2987,7 @@
standard_name = surface_drag_wind_speed_for_momentum_in_air_over_land_from_land
long_name = momentum exchange coefficient over land for coupling
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2970,7 +2995,7 @@
standard_name = surface_drag_mass_flux_for_heat_and_moisture_in_air_over_land_from_land
long_name = thermal exchange coefficient over land for coupling
units = kg m-2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2978,7 +3003,7 @@
standard_name = function_of_surface_roughness_length_and_green_vegetation_fraction_from_land
long_name = function of surface roughness length and green vegetation fraction
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere)
@@ -2986,14 +3011,14 @@
standard_name = lwe_surface_snow_from_coupled_process
long_name = sfc snow depth in meters over sea ice for coupling
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[slimskin_cpl]
standard_name = area_type_from_coupled_process
long_name = sea/land/ice mask input (=0/1/2)
units = flag
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling)
@@ -3001,7 +3026,7 @@
standard_name = instantaneous_tendency_of_specific_humidity_due_to_microphysics
long_name = instantaneous_tendency_of_specific_humidity_due_to_microphysics
units = kg kg-1 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_prognostic_updraft_area_fraction)
@@ -3009,7 +3034,7 @@
standard_name = cellular_automata_area_fraction_for_deep_convection_from_coupled_process
long_name = fraction of cellular automata for deep convection
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_cellular_automata)
@@ -3017,7 +3042,7 @@
standard_name = cellular_automata_global_pattern_from_coupled_process
long_name = cellular automata global pattern
units = flag
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_cellular_automata)
@@ -3025,14 +3050,14 @@
standard_name = physics_field_for_coupling
long_name = physics_field_for_coupling
units = m2 s-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[shum_wts]
standard_name = shum_weights_from_coupled_process
long_name = weights for stochastic shum perturbation
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_stochastic_shum_option)
@@ -3040,7 +3065,7 @@
standard_name = sppt_weights_from_coupled_process
long_name = weights for stochastic sppt perturbation
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_stochastic_physics_perturbations .or. flag_for_global_cellular_automata)
@@ -3048,7 +3073,7 @@
standard_name = skeb_x_wind_weights_from_coupled_process
long_name = weights for stochastic skeb perturbation of x wind
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_stochastic_skeb_option)
@@ -3056,7 +3081,7 @@
standard_name = skeb_y_wind_weights_from_coupled_process
long_name = weights for stochastic skeb perturbation of y wind
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_stochastic_skeb_option)
@@ -3064,7 +3089,7 @@
standard_name = spp_weights_for_pbl_scheme
long_name = spp weights for pbl scheme
units = 1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_stochastically_perturbed_parameterizations)
@@ -3072,7 +3097,7 @@
standard_name = spp_weights_for_surface_layer_scheme
long_name = spp weights for surface layer scheme
units = 1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_stochastically_perturbed_parameterizations)
@@ -3080,7 +3105,7 @@
standard_name = spp_weights_for_microphysics_scheme
long_name = spp weights for microphysics scheme
units = 1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_stochastically_perturbed_parameterizations)
@@ -3088,7 +3113,7 @@
standard_name = spp_weights_for_gravity_wave_drag_scheme
long_name = spp weights for gravity wave drag scheme
units = 1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_stochastically_perturbed_parameterizations)
@@ -3096,7 +3121,7 @@
standard_name = spp_weights_for_radiation_scheme
long_name = spp weights for radiation scheme
units = 1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_stochastically_perturbed_parameterizations)
@@ -3104,7 +3129,7 @@
standard_name = spp_weights_for_cu_deep_scheme
long_name = spp weights for cu deep scheme
units = 1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_stochastically_perturbed_parameterizations)
@@ -3112,7 +3137,7 @@
standard_name = surface_stochastic_weights_from_coupled_process
long_name = weights for stochastic surface physics perturbation
units = 1
- dimensions = (horizontal_loop_extent,number_of_perturbed_land_surface_variables)
+ dimensions = (horizontal_dimension,number_of_perturbed_land_surface_variables)
type = real
kind = kind_phys
active = (control_for_stochastic_land_surface_perturbation /= 0)
@@ -3120,7 +3145,7 @@
standard_name = tendency_of_hygroscopic_aerosols_at_surface_adjacent_layer
long_name = instantaneous water-friendly sfc aerosol source
units = kg-1 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_microphysics_scheme == identifier_for_thompson_microphysics_scheme .and. flag_for_aerosol_physics)
@@ -3128,7 +3153,7 @@
standard_name = tendency_of_nonhygroscopic_ice_nucleating_aerosols_at_surface_adjacent_layer
long_name = instantaneous ice-friendly sfc aerosol source
units = kg-1 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_microphysics_scheme == identifier_for_thompson_microphysics_scheme .and. flag_for_aerosol_physics)
@@ -3136,7 +3161,7 @@
standard_name = ebu_smoke
long_name = buffer of vertical fire emission
units = various
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3144,7 +3169,7 @@
standard_name = extinction_coefficient_in_air_due_to_smoke
long_name = extinction coefficient in air due to smoke
units = various
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3152,7 +3177,7 @@
standard_name = extinction_coefficient_in_air_due_to_dust
long_name = extinction coefficient in air due to dust
units = various
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3160,7 +3185,7 @@
standard_name = chem3d_mynn_pbl_transport
long_name = mynn pbl transport of smoke and dust
units = various
- dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_chemical_species_vertically_mixed)
+ dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_chemical_species_vertically_mixed)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3168,7 +3193,7 @@
standard_name = dry_deposition_velocity_mynn_pbl_transport
long_name = dry deposition velocity by mynn pbl transport
units = m s-1
- dimensions = (horizontal_loop_extent,number_of_chemical_species_deposited)
+ dimensions = (horizontal_dimension,number_of_chemical_species_deposited)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3176,7 +3201,7 @@
standard_name = conv_wet_deposition_smoke_dust
long_name = convective wet removal of smoke and dust
units = kg kg-1
- dimensions = (horizontal_loop_extent,number_of_chemical_species_vertically_mixed)
+ dimensions = (horizontal_dimension,number_of_chemical_species_vertically_mixed)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3184,7 +3209,7 @@
standard_name = mp_wet_deposition_smoke_dust
long_name = large scale wet deposition of smoke and dust
units = kg kg-1
- dimensions = (horizontal_loop_extent,number_of_chemical_species_vertically_mixed)
+ dimensions = (horizontal_dimension,number_of_chemical_species_vertically_mixed)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3192,7 +3217,7 @@
standard_name = dry_deposition_flux
long_name = rrfs dry deposition flux
units = ug m-2
- dimensions = (horizontal_loop_extent,number_of_chemical_species_deposited)
+ dimensions = (horizontal_dimension,number_of_chemical_species_deposited)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3200,7 +3225,7 @@
standard_name = minimum_fire_plume_sigma_pressure_level
long_name = minimum model level of fire plumerise
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3208,7 +3233,7 @@
standard_name = maximum_fire_plume_sigma_pressure_level
long_name = maximum model level of fire plumerise
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3216,7 +3241,7 @@
standard_name = mean_wind_speed_in_boundary_layer
long_name = average wind speed within the boundary layer
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3224,7 +3249,7 @@
standard_name = atmosphere_boundary_layer_thickness_from_modified_parcel
long_name = pbl height based on modified parcel method
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3232,7 +3257,7 @@
standard_name = hourly_wildfire_potential
long_name = rrfs hourly fire weather potential
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3240,7 +3265,7 @@
standard_name = hourly_wildfire_potential_average
long_name = rrfs hourly fire weather potential average
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (do_smoke_coupling)
@@ -3248,7 +3273,7 @@
standard_name = surface_upward_sensible_heat_flux_for_chemistry_coupling
long_name = instantaneous upward sensible heat flux for chemistry coupling
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_chemistry_coupling)
@@ -3256,7 +3281,7 @@
standard_name = convective_cloud_condesate_after_rainout
long_name = convective cloud condesate after rainout
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection)
@@ -3264,7 +3289,7 @@
standard_name = ice_flux_due_to_large_scale_precipitation
long_name = instantaneous 3D flux of ice from nonconvective precipitation
units = kg m-2 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_chemistry_coupling)
@@ -3272,7 +3297,7 @@
standard_name = liquid_flux_due_to_large_scale_precipitation
long_name = instantaneous 3D flux of liquid water from nonconvective precipitation
units = kg m-2 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_chemistry_coupling)
@@ -3280,7 +3305,7 @@
standard_name = updated_tendency_of_air_temperature_due_to_longwave_heating_on_physics_timestep
long_name = total sky longwave heating rate on physics time step
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_rrtmgp_radiation_scheme)
@@ -3288,7 +3313,7 @@
standard_name = surface_skin_temperature_on_radiation_timestep
long_name = surface skin temperature on radiation timestep
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_rrtmgp_radiation_scheme)
@@ -3296,7 +3321,7 @@
standard_name = RRTMGP_jacobian_of_lw_flux_upward
long_name = RRTMGP Jacobian upward longwave flux profile
units = W m-2 K-1
- dimensions = (horizontal_loop_extent,vertical_interface_dimension)
+ dimensions = (horizontal_dimension,vertical_interface_dimension)
type = real
kind = kind_phys
active = (flag_for_rrtmgp_radiation_scheme)
@@ -3304,7 +3329,7 @@
standard_name = RRTMGP_lw_flux_profile_upward_allsky_on_radiation_timestep
long_name = RRTMGP upward longwave all-sky flux profile
units = W m-2
- dimensions = (horizontal_loop_extent,vertical_interface_dimension)
+ dimensions = (horizontal_dimension,vertical_interface_dimension)
type = real
kind = kind_phys
active = (flag_for_rrtmgp_radiation_scheme)
@@ -3312,7 +3337,7 @@
standard_name = RRTMGP_lw_flux_profile_downward_allsky_on_radiation_timestep
long_name = RRTMGP downward longwave all-sky flux profile
units = W m-2
- dimensions = (horizontal_loop_extent,vertical_interface_dimension)
+ dimensions = (horizontal_dimension,vertical_interface_dimension)
type = real
kind = kind_phys
active = (flag_for_rrtmgp_radiation_scheme)
@@ -3551,6 +3576,36 @@
units = count
dimensions = ()
type = integer
+[nchunks]
+ standard_name = ccpp_chunk_extent
+ long_name = number of chunks of array data used in run phase
+ units = count
+ dimensions = ()
+ type = integer
+[chunk_begin]
+ standard_name = horizontal_loop_begin_all_chunks
+ long_name = first index for horizontal loop extent in run phase
+ units = index
+ dimensions = (ccpp_chunk_extent)
+ type = integer
+[chunk_begin(ccpp_chunk_number)]
+ standard_name = horizontal_loop_begin
+ long_name = first index for horizontal loop extent in run phase
+ units = index
+ dimensions = ()
+ type = integer
+[chunk_end]
+ standard_name = horizontal_loop_end_all_chunks
+ long_name = last index for horizontal loop extent in run phase
+ units = index
+ dimensions = (ccpp_chunk_extent)
+ type = integer
+[chunk_end(ccpp_chunk_number)]
+ standard_name = horizontal_loop_end
+ long_name = last index for horizontal loop extent in run phase
+ units = index
+ dimensions = ()
+ type = integer
[tile_num]
standard_name = index_of_cubed_sphere_tile
long_name = tile number
@@ -3617,6 +3672,12 @@
units = flag
dimensions = ()
type = logical
+[cpl_fire]
+ standard_name = do_fire_coupling
+ long_name = flag controlling fire_behavior collection (default off)
+ units = flag
+ dimensions = ()
+ type = logical
[cpl_imp_mrg]
standard_name = flag_for_merging_imported_data
long_name = flag controlling cpl_imp_mrg for imported data (default off)
@@ -4835,6 +4896,12 @@
units = count
dimensions = ()
type = integer
+[thpsnmp_is_init]
+ standard_name = flag_for_thompson_mp_scheme_initialization
+ long_name = flag carrying scheme initialization status
+ units = flag
+ dimensions = ()
+ type = logical
[lgfdlmprad]
standard_name = flag_for_GFDL_microphysics_radiation_interaction
long_name = flag for GFDL microphysics-radiation interaction
@@ -5348,6 +5415,12 @@
units = mixed
dimensions = ()
type = ty_ozphys
+[h2ophys]
+ standard_name = dataset_for_h2o_photochemistry_physics
+ long_name = dataset for NRL h2o photochemistry physics
+ units = mixed
+ dimensions = ()
+ type = ty_h2ophys
[h2o_phys]
standard_name = flag_for_stratospheric_water_vapor_physics
long_name = flag for stratospheric water vapor physics
@@ -6520,6 +6593,12 @@
units = index
dimensions = ()
type = integer
+[ntfsmoke]
+ standard_name = index_for_fire_smoke_in_tracer_concentration_array
+ long_name = tracer index for fire smoke
+ units = index
+ dimensions = ()
+ type = integer
[ntdust]
standard_name = index_for_dust_in_tracer_concentration_array
long_name = tracer index for dust
@@ -7032,6 +7111,18 @@
units = count
dimensions = ()
type = integer
+[levh2o]
+ standard_name = vertical_dimension_of_h2o_forcing_data
+ long_name = number of vertical layers in h2o forcing data
+ units = count
+ dimensions = ()
+ type = integer
+[h2o_coeff]
+ standard_name = number_of_coefficients_in_h2o_forcing_data
+ long_name = number of coefficients in h2o forcing data
+ units = index
+ dimensions = ()
+ type = integer
[do_ccpp_suite_sim]
standard_name = flag_for_CCPP_suite_simulator
long_name = flag for ccpp suite simulator
@@ -7627,77 +7718,77 @@
standard_name = cell_area
long_name = area of the grid cell
units = m2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dx]
standard_name = characteristic_grid_lengthscale
long_name = relative dx for the grid cell
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[xlat]
standard_name = latitude
long_name = latitude
units = radian
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[xlon]
standard_name = longitude
long_name = longitude
units = radian
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[coslat]
standard_name = cosine_of_latitude
long_name = cosine of latitude
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sinlat]
standard_name = sine_of_latitude
long_name = sine of latitude
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[xlat_d]
standard_name = latitude_in_degree
long_name = latitude in degree north
units = degree_north
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[xlon_d]
standard_name = longitude_in_degree
long_name = longitude in degree east
units = degree_east
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[jindx1_o3]
standard_name = lower_latitude_index_of_ozone_forcing_for_interpolation
long_name = interpolation low index for ozone
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (index_of_ozone_mixing_ratio_in_tracer_concentration_array>0)
[jindx2_o3]
standard_name = upper_latitude_index_of_ozone_forcing_for_interpolation
long_name = interpolation high index for ozone
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (index_of_ozone_mixing_ratio_in_tracer_concentration_array>0)
[ddy_o3]
standard_name = latitude_interpolation_weight_for_ozone_forcing
long_name = interpolation high index for ozone
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (index_of_ozone_mixing_ratio_in_tracer_concentration_array>0)
@@ -7705,21 +7796,21 @@
standard_name = lower_latitude_index_of_stratospheric_water_vapor_forcing_for_interpolation
long_name = interpolation low index for stratospheric water vapor
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_stratospheric_water_vapor_physics)
[jindx2_h]
standard_name = upper_latitude_index_of_stratospheric_water_vapor_forcing_for_interpolation
long_name = interpolation high index for stratospheric water vapor
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_stratospheric_water_vapor_physics)
[ddy_h]
standard_name = latitude_interpolation_weight_for_stratospheric_water_vapor_forcing
long_name = interpolation high index for stratospheric water vapor
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_stratospheric_water_vapor_physics)
@@ -7727,21 +7818,21 @@
standard_name = lower_latitude_index_of_aerosol_forcing_for_interpolation
long_name = interpolation low index for prescribed aerosols in the y direction
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_aerosol_input_MG_radiation)
[jindx2_aer]
standard_name = upper_latitude_index_of_aerosol_forcing_for_interpolation
long_name = interpolation high index for prescribed aerosols in the y direction
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_aerosol_input_MG_radiation)
[ddy_aer]
standard_name = latitude_interpolation_weight_for_aerosol_forcing
long_name = interpolation high index for prescribed aerosols in the y direction
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_aerosol_input_MG_radiation)
@@ -7749,21 +7840,21 @@
standard_name = lower_longitude_index_of_aerosol_forcing_for_interpolation
long_name = interpolation low index for prescribed aerosols in the x direction
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_aerosol_input_MG_radiation)
[iindx2_aer]
standard_name = upper_longitude_index_of_aerosol_forcing_for_interpolation
long_name = interpolation high index for prescribed aerosols in the x direction
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_aerosol_input_MG_radiation)
[ddx_aer]
standard_name = longitude_interpolation_weight_for_aerosol_forcing
long_name = interpolation high index for prescribed aerosols in the x direction
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_aerosol_input_MG_radiation)
@@ -7771,21 +7862,21 @@
standard_name = lower_latitude_index_of_cloud_nuclei_forcing_for_interpolation
long_name = interpolation low index for ice and cloud condensation nuclei in the y direction
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (control_for_ice_cloud_condensation_nuclei_forcing==1)
[jindx2_ci]
standard_name = upper_latitude_index_of_cloud_nuclei_forcing_for_interpolation
long_name = interpolation high index for ice and cloud condensation nuclei in the y direction
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (control_for_ice_cloud_condensation_nuclei_forcing==1)
[ddy_ci]
standard_name = latitude_interpolation_weight_for_cloud_nuclei_forcing
long_name = interpolation high index for ice and cloud condensation nuclei in the y direction
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_ice_cloud_condensation_nuclei_forcing==1)
@@ -7793,21 +7884,21 @@
standard_name = lower_longitude_index_of_cloud_nuclei_forcing_for_interpolation
long_name = interpolation low index for ice and cloud condensation nuclei in the x direction
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (control_for_ice_cloud_condensation_nuclei_forcing==1)
[iindx2_ci]
standard_name = upper_longitude_index_of_cloud_nuclei_forcing_for_interpolation
long_name = interpolation high index for ice and cloud condensation nuclei in the x direction
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (control_for_ice_cloud_condensation_nuclei_forcing==1)
[ddx_ci]
standard_name = longitude_interpolation_weight_for_cloud_nuclei_forcing
long_name = interpolation high index for ice and cloud condensation nuclei in the x direction
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_ice_cloud_condensation_nuclei_forcing==1)
@@ -7815,21 +7906,21 @@
standard_name = lower_latitude_index_of_absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag_for_interpolation
long_name = index1 for weight1 for tau NGWs
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_ugwp_version_1)
[jindx2_tau]
standard_name = upper_latitude_index_of_absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag_for_interpolation
long_name = index2 for weight2 for tau NGWs
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_ugwp_version_1)
[ddy_j1tau]
standard_name = latitude_interpolation_weight_complement_for_absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag
long_name = interpolation weight1 for tau NGWs
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1)
@@ -7837,7 +7928,7 @@
standard_name = latitude_interpolation_weight_for_absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag
long_name = interpolation weight2 for tau NGWs
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1)
@@ -7855,56 +7946,56 @@
standard_name = random_number_seed_for_mcica_shortwave
long_name = random seeds for sub-column cloud generators sw
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_lw_clouds_sub_grid_approximation == 2 .or. flag_for_sw_clouds_grid_approximation == 2)
[icsdlw]
standard_name = random_number_seed_for_mcica_longwave
long_name = random seeds for sub-column cloud generators lw
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_lw_clouds_sub_grid_approximation == 2 .or. flag_for_sw_clouds_grid_approximation == 2)
[rseeds]
standard_name = random_number_seeds_from_host
long_name = random number seeds from host
units = none
- dimensions = (horizontal_loop_extent, number_of_host_provided_random_number_streams)
+ dimensions = (horizontal_dimension, number_of_host_provided_random_number_streams)
type = integer
active = ((flag_for_lw_clouds_sub_grid_approximation == 2 .or. flag_for_sw_clouds_grid_approximation == 2) .and. do_host_provided_random_seeds)
[tau_amf]
standard_name = absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag
long_name = ngw_absolute_momentum_flux
units = mixed
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ozpl]
standard_name = ozone_forcing
long_name = ozone forcing data
units = mixed
- dimensions = (horizontal_loop_extent,vertical_dimension_of_ozone_forcing_data,number_of_coefficients_in_ozone_data)
+ dimensions = (horizontal_dimension,vertical_dimension_of_ozone_forcing_data,number_of_coefficients_in_ozone_data)
type = real
kind = kind_phys
[h2opl]
standard_name = stratospheric_water_vapor_forcing
long_name = water forcing data
units = mixed
- dimensions = (horizontal_loop_extent,vertical_dimension_of_h2o_forcing_data,number_of_coefficients_in_h2o_forcing_data)
+ dimensions = (horizontal_dimension,vertical_dimension_of_h2o_forcing_data,number_of_coefficients_in_h2o_forcing_data)
type = real
kind = kind_phys
[hpbl]
standard_name = atmosphere_boundary_layer_thickness
long_name = pbl height
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ud_mf]
standard_name = instantaneous_atmosphere_updraft_convective_mass_flux
long_name = (updraft mass flux) * delt
units = kg m-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = ( control_for_deep_convection_scheme .ge. 0 .or. control_for_shallow_convection_scheme .ge. 0 )
@@ -7912,28 +8003,28 @@
standard_name = ice_nucleation_number_from_climatology
long_name = ice nucleation number in MG MP
units = kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[ccn_nm]
standard_name = tendency_of_activated_cloud_condensation_nuclei_from_climatology
long_name = tendency of ccn activated number
units = kg-1 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[aer_nm]
standard_name = mass_mixing_ratio_of_aerosol_from_gocart_or_merra2
long_name = mass mixing ratio of aerosol from gocart or merra2
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_aerosol_tracers_MG)
+ dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_aerosol_tracers_MG)
type = real
kind = kind_phys
[aod_gf]
standard_name = aerosol_optical_depth_for_grell_freitas_deep_convection
long_name = aerosol optical depth used in Grell-Freitas Convective Parameterization
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection)
@@ -7941,47 +8032,47 @@
standard_name = map_of_block_column_number_to_global_i_index
long_name = map of local index ix to global index i for this block
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[jmap]
standard_name = map_of_block_column_number_to_global_j_index
long_name = map of local index ix to global index j for this block
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[rann]
standard_name = random_number
long_name = random number array (0-1)
units = none
- dimensions = (horizontal_loop_extent,number_of_random_numbers)
+ dimensions = (horizontal_dimension,number_of_random_numbers)
type = real
kind = kind_phys
[acv]
standard_name = cumulative_lwe_thickness_of_convective_precipitation_amount_between_sw_radiation_calls
long_name = accumulated convective rainfall amount for cnvc90 only
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[acvb]
standard_name = cumulative_min_vertical_index_at_cloud_base_between_sw_radiation_calls
long_name = smallest cloud base vertical index encountered thus far
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[acvt]
standard_name = cumulative_max_vertical_index_at_cloud_base_between_sw_radiation_calls
long_name = largest cloud top vertical index encountered thus far
units = index
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dtdtnp]
standard_name = tendency_of_air_temperature_to_withold_from_sppt
long_name = temp. change from physics that should not be perturbed by sppt
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_stochastic_physics_perturbations .or. flag_for_global_cellular_automata)
@@ -7989,7 +8080,7 @@
standard_name = tendency_of_lwe_thickness_of_rain_amount_on_dynamics_timestep_for_coupling
long_name = change in rain_cpl (coupling_type)
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_land_coupling)
@@ -7997,7 +8088,7 @@
standard_name = tendency_of_lwe_thickness_of_snowfall_amount_on_dynamics_timestep_for_coupling
long_name = change in show_cpl (coupling_type)
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_land_coupling)
@@ -8005,7 +8096,7 @@
standard_name = atmosphere_updraft_convective_mass_flux_at_cloud_base_by_cloud_type
long_name = cloud base mass flux for CS convection
units = kg m-2 s-1
- dimensions = (horizontal_loop_extent,number_of_cloud_types_CS)
+ dimensions = (horizontal_dimension,number_of_cloud_types_CS)
type = real
kind = kind_phys
active = (number_of_cloud_types_CS > 0 .and. flag_for_Chikira_Sugiyama_deep_convection)
@@ -8013,7 +8104,7 @@
standard_name = surface_air_pressure_two_timesteps_back
long_name = surface air pressure two timesteps back
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (index_of_surface_air_pressure_two_timesteps_back_in_xyz_dimensioned_tracer_array > 0)
@@ -8021,7 +8112,7 @@
standard_name = surface_air_pressure_on_previous_timestep
long_name = surface air pressure at previous timestep
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (index_of_surface_air_pressure_on_previous_timestep_in_xyz_dimensioned_restart_array > 0)
@@ -8029,7 +8120,7 @@
standard_name = enhancement_to_wind_speed_at_surface_adjacent_layer_due_to_convection
long_name = surface wind enhancement due to convection
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (index_of_enhancement_to_wind_speed_at_surface_adjacent_layer_due_to_convection_in_xy_dimensioned_restart_array > 0)
@@ -8037,7 +8128,7 @@
standard_name = air_temperature_two_timesteps_back
long_name = air temperature two timesteps back
units = K
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_air_temperature_two_timesteps_back_in_xyz_dimensioned_restart_array > 0)
@@ -8045,7 +8136,7 @@
standard_name = specific_humidity_two_timesteps_back
long_name = water vapor specific humidity two timesteps back
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_specific_humidity_two_timesteps_back_in_xyz_dimensioned_restart_array > 0)
@@ -8053,7 +8144,7 @@
standard_name = air_temperature_on_previous_timestep_in_xyz_dimensioned_restart_array
long_name = air temperature at previous timestep
units = K
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_air_temperature_on_previous_timestep_in_xyz_dimensioned_restart_array > 0)
@@ -8061,7 +8152,7 @@
standard_name = specific_humidity_on_previous_timestep_in_xyz_dimensioned_restart_array
long_name = water vapor specific humidity at previous timestep
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_specific_humidity_on_previous_timestep_in_xyz_dimensioned_restart_array > 0)
@@ -8069,7 +8160,7 @@
standard_name = convective_cloud_condensate_mixing_ratio
long_name = convective cloud water mixing ratio in the phy_f3d array
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_convective_cloud_condensate_mixing_ratio_in_xyz_dimensioned_restart_array > 0)
@@ -8077,7 +8168,7 @@
standard_name = convective_cloud_area_fraction
long_name = convective cloud cover in the phy_f3d array
units = frac
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_convective_cloud_area_fraction_in_xyz_dimensioned_restart_array > 0)
@@ -8085,7 +8176,7 @@
standard_name = upward_virtual_potential_temperature_flux
long_name = upward kinematic buoyancy flux from the SHOC scheme
units = K m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_upward_virtual_potential_temperature_flux_in_xyz_dimensioned_restart_array > 0)
@@ -8093,7 +8184,7 @@
standard_name = atmosphere_heat_diffusivity_from_shoc
long_name = diffusivity for heat from the SHOC scheme
units = m2 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_atmosphere_heat_diffusivity_in_xyz_dimensioned_restart_array > 0)
@@ -8101,7 +8192,7 @@
standard_name = subgrid_scale_cloud_fraction_from_shoc
long_name = subgrid-scale cloud fraction from the SHOC scheme
units = frac
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_subgrid_cloud_area_fracation_in_atmosphere_layer_in_xyz_dimensioned_restart_array > 0)
@@ -8109,7 +8200,7 @@
standard_name = cloud_fraction_for_MG
long_name = cloud fraction used by Morrison-Gettelman MP
units = frac
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_cloud_area_fraction_in_atmosphere_layer_in_xyz_dimensioned_restart_array > 0)
@@ -8117,7 +8208,7 @@
standard_name = effective_radius_of_stratiform_cloud_liquid_water_particle
long_name = eff. radius of cloud liquid water particle in micrometer
units = um
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_cloud_liquid_water_effective_radius_in_xyz_dimensioned_restart_array > 0)
@@ -8125,7 +8216,7 @@
standard_name = effective_radius_of_stratiform_cloud_ice_particle
long_name = eff. radius of cloud ice water particle in micrometer
units = um
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_cloud_ice_effective_radius_in_xyz_dimensioned_restart_array > 0)
@@ -8133,7 +8224,7 @@
standard_name = effective_radius_of_stratiform_cloud_rain_particle
long_name = effective radius of cloud rain particle in micrometers
units = um
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_rain_effective_radius_in_xyz_dimensioned_restart_array > 0)
@@ -8141,7 +8232,7 @@
standard_name = effective_radius_of_stratiform_cloud_snow_particle
long_name = effective radius of cloud snow particle in micrometers
units = um
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_snow_effective_radius_in_xyz_dimensioned_restart_array > 0)
@@ -8149,7 +8240,7 @@
standard_name = effective_radius_of_stratiform_cloud_graupel_particle
long_name = eff. radius of cloud graupel particle in micrometer
units = um
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (index_of_graupel_effective_radius_in_xyz_dimensioned_restart_array > 0)
@@ -8157,7 +8248,7 @@
standard_name = tendency_of_air_temperature_due_to_nonphysics
long_name = temperature tendency due to dynamics only
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection .or. control_for_deep_convection_scheme == identifier_for_new_tiedtke_deep_convection)
@@ -8165,7 +8256,7 @@
standard_name = tendendy_of_specific_humidity_due_to_nonphysics
long_name = moisture tendency due to dynamics only
units = kg kg-1 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection .or. control_for_deep_convection_scheme == identifier_for_new_tiedtke_deep_convection)
@@ -8173,7 +8264,7 @@
standard_name = air_temperature_on_previous_timestep
long_name = temperature from previous time step
units = K
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection .or. control_for_deep_convection_scheme == identifier_for_new_tiedtke_deep_convection)
@@ -8181,7 +8272,7 @@
standard_name = specific_humidity_on_previous_timestep
long_name = moisture from previous time step
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection .or. control_for_deep_convection_scheme == identifier_for_new_tiedtke_deep_convection .or. control_for_deep_convection_scheme == identifer_for_scale_aware_mass_flux_deep_convection .or. control_for_shallow_convection_scheme == identifier_for_scale_aware_mass_flux_shallow_convection)
@@ -8189,21 +8280,21 @@
standard_name = counter_for_grell_freitas_convection
long_name = convective activity memory
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection)
[cactiv_m]
standard_name = counter_for_grell_freitas_mid_level_convection
long_name = mid-level convective activity memory
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection)
[CLDFRA_BL]
standard_name = subgrid_scale_cloud_area_fraction_in_atmosphere_layer
long_name = subgrid cloud fraction from PBL scheme
units = frac
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8211,7 +8302,7 @@
standard_name = subgrid_scale_cloud_liquid_water_mixing_ratio
long_name = subgrid cloud water mixing ratio from PBL scheme
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8219,7 +8310,7 @@
standard_name = subgrid_scale_cloud_ice_mixing_ratio
long_name = subgrid cloud ice mixing ratio from PBL scheme
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8227,7 +8318,7 @@
standard_name = turbulent_mixing_length
long_name = mixing length in meters
units = m
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8235,7 +8326,7 @@
standard_name = stability_function_for_heat
long_name = stability function for heat
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8243,7 +8334,7 @@
standard_name = stability_function_for_momentum
long_name = stability function for momentum
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8251,7 +8342,7 @@
standard_name = nonadvected_turbulent_kinetic_energy_multiplied_by_2
long_name = 2 x tke at mass points
units = m2 s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8259,7 +8350,7 @@
standard_name = variance_of_air_temperature
long_name = temperature fluctuation squared
units = K2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8267,7 +8358,7 @@
standard_name = variance_of_specific_humidity
long_name = water vapor fluctuation squared
units = kg2 kg-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8275,7 +8366,7 @@
standard_name = covariance_of_air_temperature_and_specific_humidity
long_name = covariance of temperature and moisture
units = K kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -8283,7 +8374,7 @@
standard_name = surface_specific_humidity_for_MYJ_schemes
long_name = surface air saturation specific humidity for MYJ schemes
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8291,7 +8382,7 @@
standard_name = air_potential_temperature_at_top_of_viscous_sublayer
long_name = potential temperature at viscous sublayer top over water
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8299,7 +8390,7 @@
standard_name = specific_humidity_at_top_of_viscous_sublayer
long_name = specific humidity at_viscous sublayer top over water
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8307,7 +8398,7 @@
standard_name = x_wind_at_top_of_viscous_sublayer
long_name = u wind component at viscous sublayer top over water
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8315,7 +8406,7 @@
standard_name = y_wind_at_top_of_viscous_sublayer
long_name = v wind component at viscous sublayer top over water
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8323,7 +8414,7 @@
standard_name = heat_exchange_coefficient_for_MYJ_schemes
long_name = surface heat exchange_coefficient for MYJ schemes
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8331,7 +8422,7 @@
standard_name = momentum_exchange_coefficient_for_MYJ_schemes
long_name = surface momentum exchange_coefficient for MYJ schemes
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8339,7 +8430,7 @@
standard_name = control_for_surface_layer_evaporation
long_name = surface layer evaporation switch
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8347,7 +8438,7 @@
standard_name = surface_upward_specific_humidity_flux_for_mellor_yamada_janjic_surface_layer_scheme
long_name = kinematic surface latent heat flux
units = m s-1 kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8355,7 +8446,7 @@
standard_name = weight_for_momentum_at_top_of_viscous_sublayer
long_name = weight for momentum at viscous layer top
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8363,7 +8454,7 @@
standard_name = weight_for_potental_temperature_at_top_of_viscous_sublayer
long_name = weight for potental temperature at viscous layer top
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8371,7 +8462,7 @@
standard_name = weight_for_specific_humidity_at_top_of_viscous_sublayer
long_name = weight for Specfic Humidity at viscous layer top
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme)
@@ -8379,7 +8470,7 @@
standard_name = radar_derived_microphysics_temperature_tendency
long_name = radar-derived microphysics temperature tendency
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_radar_derived_temperature_or_convection_suppression_intervals)
+ dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_radar_derived_temperature_or_convection_suppression_intervals)
type = real
kind = kind_phys
active = (number_of_radar_derived_temperature_or_convection_suppression_intervals>0)
@@ -8387,7 +8478,7 @@
standard_name = radar_derived_convection_suppression
long_name = radar-derived convection suppression
units = unitless
- dimensions = (horizontal_loop_extent,number_of_radar_derived_temperature_or_convection_suppression_intervals)
+ dimensions = (horizontal_dimension,number_of_radar_derived_temperature_or_convection_suppression_intervals)
type = real
kind = kind_phys
active = (number_of_radar_derived_temperature_or_convection_suppression_intervals>0 .and. flag_for_radar_derived_convection_suppression)
@@ -8405,21 +8496,21 @@
standard_name = convective_cloud_area_fraction_between_sw_radiation_calls_from_cnvc90
long_name = fraction of convective cloud
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[cvt]
standard_name = pressure_at_convective_cloud_top_between_sw_radiation_calls_from_cnvc90
long_name = convective cloud top pressure
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[cvb]
standard_name = pressure_at_convective_cloud_base_between_sw_radiation_calls_from_cnvc90
long_name = convective cloud bottom pressure
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
@@ -8436,89 +8527,89 @@
standard_name = surface_sw_fluxes_assuming_total_and_clear_sky_on_radiation_timestep
long_name = sw radiation fluxes at sfc
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = sfcfsw_type
[sfcflw]
standard_name = surface_lw_fluxes_assuming_total_and_clear_sky_on_radiation_timestep
long_name = lw radiation fluxes at sfc
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = sfcflw_type
[htrsw]
standard_name = tendency_of_air_temperature_due_to_shortwave_heating_on_radiation_timestep
long_name = total sky sw heating rate
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[htrlw]
standard_name = tendency_of_air_temperature_due_to_longwave_heating_on_radiation_timestep
long_name = total sky lw heating rate
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[sfalb]
standard_name = surface_albedo_for_diffused_shortwave_on_radiation_timestep
long_name = mean surface diffused sw albedo
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[coszen]
standard_name = cosine_of_solar_zenith_angle_for_daytime_points_on_radiation_timestep
long_name = mean cos of zenith angle over rad call period
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[coszdg]
standard_name = cosine_of_solar_zenith_angle_on_radiation_timestep
long_name = daytime mean cosz over rad call period
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tsflw]
standard_name = air_temperature_at_surface_adjacent_layer_on_radiation_timestep
long_name = surface air temp during lw calculation
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[semis]
standard_name = surface_longwave_emissivity
long_name = surface lw emissivity in fraction
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ext550]
standard_name = aerosol_optical_depth_at_550nm
long_name = 3d optical extinction for total aerosol species
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[swhc]
standard_name = tendency_of_air_temperature_due_to_shortwave_heating_assuming_clear_sky_on_radiation_timestep
long_name = clear sky sw heating rates
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[lwhc]
standard_name = tendency_of_air_temperature_due_to_longwave_heating_assuming_clear_sky_on_radiation_timestep
long_name = clear sky lw heating rates
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[lwhd]
standard_name = tendency_of_air_temperature_due_to_integrated_dynamics_through_earths_atmosphere
long_name = idea sky lw heating rates
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension,6)
+ dimensions = (horizontal_dimension,vertical_layer_dimension,6)
type = real
kind = kind_phys
@@ -8535,54 +8626,54 @@
standard_name = cumulative_radiation_diagnostic
long_name = time-accumulated 2D radiation-related diagnostic fields
units = mixed
- dimensions = (horizontal_loop_extent,number_of_diagnostics_variables_for_radiation)
+ dimensions = (horizontal_dimension,number_of_diagnostics_variables_for_radiation)
type = real
kind = kind_phys
[topfsw]
standard_name = sw_fluxes_top_atmosphere
long_name = sw radiation fluxes at toa
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = topfsw_type
[topflw]
standard_name = lw_fluxes_top_atmosphere
long_name = lw radiation fluxes at top
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = topflw_type
[srunoff]
standard_name = surface_runoff
long_name = surface water runoff (from lsm)
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[evbsa]
standard_name = cumulative_soil_upward_latent_heat_flux_multiplied_by_timestep
long_name = cumulative soil upward latent heat flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[evcwa]
standard_name = cumulative_canopy_upward_latent_heat_flu_multiplied_by_timestep
long_name = cumulative canopy upward latent heat flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[snohfa]
standard_name = cumulative_snow_freezing_rain_upward_latent_heat_flux_multiplied_by_timestep
long_name = cumulative latent heat flux due to snow and frz rain multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[paha]
standard_name = cumulative_precipitation_advected_heat_flux_multiplied_by_timestep
long_name = cumulative precipitation advected heat flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -8590,224 +8681,224 @@
standard_name = cumulative_transpiration_flux_multiplied_by_timestep
long_name = cumulative total plant transpiration rate multiplied by timestep
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sbsnoa]
standard_name = cumulative_snow_deposition_sublimation_upward_latent_heat_flux_multiplied_by_timestep
long_name = cumulative latent heat flux from snow depo/subl multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[snowca]
standard_name = cumulative_surface_snow_area_fraction_multiplied_by_timestep
long_name = cumulative surface snow area fraction multiplied by timestep
units = s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sbsno]
standard_name = snow_deposition_sublimation_upward_latent_heat_flux
long_name = latent heat flux from snow depo/subl
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[evbs]
standard_name = soil_upward_latent_heat_flux
long_name = soil upward latent heat flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[evcw]
standard_name = canopy_upward_latent_heat_flux
long_name = canopy upward latent heat flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[trans]
standard_name = transpiration_flux
long_name = total plant transpiration rate
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[soilm]
standard_name = soil_moisture_content
long_name = soil moisture
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[snowmt_land]
standard_name = surface_snow_melt_over_land
long_name = snow melt during timestep over land
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[snowmt_ice]
standard_name = surface_snow_melt_over_ice
long_name = snow melt during timestep over ice
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tmpmin]
standard_name = minimum_temperature_at_2m
long_name = min temperature at 2m height
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tmpmax]
standard_name = maximum_temperature_at_2m
long_name = max temperature at 2m height
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dusfc]
standard_name = cumulative_surface_x_momentum_flux_for_diag_multiplied_by_timestep
long_name = cumulative sfc x momentum flux multiplied by timestep
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dvsfc]
standard_name = cumulative_surface_y_momentum_flux_for_diag_multiplied_by_timestep
long_name = cumulative sfc y momentum flux multiplied by timestep
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dtsfc]
standard_name = cumulative_surface_upward_sensible_heat_flux_for_diag_multiplied_by_timestep
long_name = cumulative sfc sensible heat flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dqsfc]
standard_name = cumulative_surface_upward_latent_heat_flux_for_diag_multiplied_by_timestep
long_name = cumulative sfc latent heat flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[totprcp]
standard_name = accumulated_lwe_thickness_of_precipitation_amount
long_name = accumulated total precipitation
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[totice]
standard_name = accumulated_lwe_thickness_of_ice_amount
long_name = accumulated ice precipitation
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[totsnw]
standard_name = accumulated_lwe_thickness_of_snow_amount
long_name = accumulated snow precipitation
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[totgrp]
standard_name = accumulated_lwe_thickness_of_graupel_amount
long_name = accumulated graupel precipitation
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[totprcpb]
standard_name = accumulated_lwe_thickness_of_precipitation_amount_in_bucket
long_name = accumulated total precipitation in bucket
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[toticeb]
standard_name = accumulated_lwe_thickness_of_ice_amount_in_bucket
long_name = accumulated ice precipitation in bucket
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[totsnwb]
standard_name = accumulated_lwe_thickness_of_snow_amount_in_bucket
long_name = accumulated snow precipitation in bucket
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[totgrpb]
standard_name = accumulated_lwe_thickness_of_graupel_amount_in_bucket
long_name = accumulated graupel precipitation in bucket
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[frzr]
standard_name = cumulative_lwe_thickness_of_surface_freezing_rain_amount
long_name = accumulated surface freezing rain
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[frzrb]
standard_name = cumulative_lwe_thickness_of_surface_freezing_rain_amount_in_bucket
long_name = accumulated surface freezing rain in bucket
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[frozr]
standard_name = cumulative_lwe_thickness_of_surface_graupel_amount
long_name = accumulated surface graupel
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[frozrb]
standard_name = cumulative_lwe_thickness_of_surface_graupel_amount_in_bucket
long_name = accumulated surface graupel in bucket
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tsnowp]
standard_name = cumulative_lwe_thickness_of_surface_snow_amount
long_name = accumulated surface snow
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tsnowpb]
standard_name = cumulative_lwe_thickness_of_surface_snow_amount_in_bucket
long_name = accumulated surface snow in bucket
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[rhonewsn1]
standard_name = surface_frozen_precipitation_density
long_name = density of precipitation ice
units = kg m-3
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[train]
standard_name = accumulated_change_of_air_temperature_due_to_FA_scheme
long_name = accumulated change of air temperature due to FA MP scheme
units = K
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (control_for_microphysics_scheme == identifier_for_fer_hires_microphysics_scheme)
@@ -8815,70 +8906,70 @@
standard_name = cumulative_surface_ground_heat_flux_multiplied_by_timestep
long_name = cumulative groud conductive heat flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dlwsfc]
standard_name = cumulative_surface_downwelling_longwave_flux_multiplied_by_timestep
long_name = cumulative surface downwelling LW flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ulwsfc]
standard_name = cumulative_surface_upwelling_longwave_flux_multiplied_by_timestep
long_name = cumulative surface upwelling LW flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[suntim]
standard_name = duration_of_sunshine
long_name = sunshine duration time
units = s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[runoff]
standard_name = total_runoff
long_name = total water runoff
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ep]
standard_name = cumulative_surface_upward_potential_latent_heat_flux_multiplied_by_timestep
long_name = cumulative surface upward potential latent heat flux multiplied by timestep
units = W m-2 s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tecan]
standard_name = total_evaporation_of_intercepted_water
long_name = total evaporation of intercepted water
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tetran]
standard_name = total_transpiration_rate
long_name = total transpiration rate
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tedir]
standard_name = total_soil_surface_evaporation_rate
long_name = total soil surface evaporation rate
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[twa]
standard_name = total_water_storage_in_aquifer
long_name = total water storage in aquifer
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -8886,294 +8977,294 @@
standard_name = cumulative_cloud_work_function
long_name = cumulative cloud work function (valid only with sas)
units = m2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dugwd]
standard_name = time_integral_of_x_stress_due_to_gravity_wave_drag
long_name = vertically integrated u change by OGWD
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dvgwd]
standard_name = time_integral_of_y_stress_due_to_gravity_wave_drag
long_name = vertically integrated v change by OGWD
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[psmean]
standard_name = cumulative_surface_pressure_multiplied_by_timestep
long_name = cumulative surface pressure multiplied by timestep
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[cnvprcp]
standard_name = cumulative_lwe_thickness_of_convective_precipitation_amount
long_name = cumulative convective precipitation
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[cnvprcpb]
standard_name = cumulative_lwe_thickness_of_convective_precipitation_amount_in_bucket
long_name = cumulative convective precipitation in bucket
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[spfhmin]
standard_name = minimum_specific_humidity_at_2m
long_name = minimum specific humidity at 2m height
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[spfhmax]
standard_name = maximum_specific_humidity_at_2m
long_name = maximum specific humidity at 2m height
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[u10mmax]
standard_name = maximum_x_wind_at_10m
long_name = maximum x wind at 10 m
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[v10mmax]
standard_name = maximum_y_wind_at_10m
long_name = maximum y wind at 10 m
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[wind10mmax]
standard_name = maximum_wind_at_10m
long_name = maximum wind speed at 10 m
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[u10max]
standard_name = maximum_u_wind_at_10m_over_maximum_hourly_time_interval
long_name = maximum u wind at 10m over maximum hourly time interval
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[v10max]
standard_name = maximum_v_wind_at_10m_over_maximum_hourly_time_interval
long_name = maximum v wind at 10m over maximum hourly time interval
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[spd10max]
standard_name = maximum_wind_at_10m_over_maximum_hourly_time_interval
long_name = maximum wind at 10m over maximum hourly time interval
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[rain]
standard_name = lwe_thickness_of_precipitation_amount_on_dynamics_timestep
long_name = total rain at this time step
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[rainc]
standard_name = lwe_thickness_of_convective_precipitation_amount_on_dynamics_timestep
long_name = convective rain at this time step
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ice]
standard_name = lwe_thickness_of_ice_amount_on_dynamics_timestep
long_name = ice fall at this time step
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[snow]
standard_name = lwe_thickness_of_snow_amount_on_dynamics_timestep
long_name = snow fall at this time step
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[graupel]
standard_name = lwe_thickness_of_graupel_amount_on_dynamics_timestep
long_name = graupel fall at this time step
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[u10m]
standard_name = x_wind_at_10m
long_name = 10 meter u wind speed
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[v10m]
standard_name = y_wind_at_10m
long_name = 10 meter v wind speed
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dpt2m]
standard_name = dewpoint_temperature_at_2m
long_name = 2 meter dewpoint temperature
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[zlvl]
standard_name = height_above_ground_at_lowest_model_layer
long_name = layer 1 height above ground (not MSL)
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[psurf]
standard_name = surface_air_pressure_diag
long_name = surface air pressure diagnostic
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[pwat]
standard_name = column_precipitable_water
long_name = precipitable water
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[t1]
standard_name = air_temperature_at_lowest_model_layer_for_diag
long_name = layer 1 temperature for diag
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[q1]
standard_name = water_vapor_specific_humidity_at_lowest_model_layer_for_diag
long_name = layer 1 specific humidity for diag
units = kg kg-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[u1]
standard_name = x_wind_at_lowest_model_layer_for_diag
long_name = layer 1 x wind for diag
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[v1]
standard_name = y_wind_at_lowest_model_layer_for_diag
long_name = layer 1 y wind for diag
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[chh]
standard_name = surface_drag_mass_flux_for_heat_and_moisture_in_air
long_name = thermal exchange coefficient
units = kg m-2 s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[cmm]
standard_name = surface_drag_wind_speed_for_momentum_in_air
long_name = momentum exchange coefficient
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dlwsfci]
standard_name = surface_downwelling_longwave_flux
long_name = surface downwelling longwave flux at current time
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ulwsfci]
standard_name = surface_upwelling_longwave_flux
long_name = surface upwelling longwave flux at current time
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dswsfci]
standard_name = surface_downwelling_shortwave_flux
long_name = surface downwelling shortwave flux at current time
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[nswsfci]
standard_name = surface_net_downwelling_shortwave_flux
long_name = surface net downwelling shortwave flux at current time
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[uswsfci]
standard_name = surface_upwelling_shortwave_flux
long_name = surface upwelling shortwave flux at current time
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dusfci]
standard_name = instantaneous_surface_x_momentum_flux_for_diag
long_name = instantaneous sfc x momentum flux multiplied by timestep
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dvsfci]
standard_name = instantaneous_surface_y_momentum_flux_for_diag
long_name = instantaneous sfc y momentum flux multiplied by timestep
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dtsfci]
standard_name = instantaneous_surface_upward_sensible_heat_flux_for_diag
long_name = instantaneous sfc sensible heat flux multiplied by timestep
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dqsfci]
standard_name = instantaneous_surface_upward_latent_heat_flux_for_diag
long_name = instantaneous sfc latent heat flux multiplied by timestep
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[gfluxi]
standard_name = instantaneous_surface_ground_heat_flux
long_name = instantaneous sfc ground heat flux
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[pahi]
standard_name = instantaneous_total_precipitation_advected_heat
long_name = instantaneous precipitation advected heat - total
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme)
@@ -9181,35 +9272,35 @@
standard_name = instantaneous_surface_potential_evaporation
long_name = instantaneous sfc potential evaporation
units = W m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[smcwlt2]
standard_name = volume_fraction_of_condensed_water_in_soil_at_wilting_point
long_name = wilting point (volumetric)
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[smcref2]
standard_name = threshold_volume_fraction_of_condensed_water_in_soil
long_name = soil moisture threshold (volumetric)
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[sr]
standard_name = ratio_of_snowfall_to_rainfall
long_name = snow ratio: ratio of snow to total precipitation (explicit only)
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[wet1]
standard_name = normalized_soil_wetness
long_name = normalized soil wetness
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (.not. control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme)
@@ -9217,42 +9308,42 @@
standard_name = dominant_rain_type
long_name = dominant rain type
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tdomzr]
standard_name = dominant_freezing_rain_type
long_name = dominant freezing rain type
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tdomip]
standard_name = dominant_sleet_type
long_name = dominant sleet type
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tdoms]
standard_name = dominant_snow_type
long_name = dominant snow type
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[zmtnblck]
standard_name = level_of_dividing_streamline
long_name = level of the dividing streamline
units = none
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dtend]
standard_name = cumulative_change_of_state_variables
long_name = diagnostic tendencies for state variables
units = mixed
- dimensions = (horizontal_loop_extent,vertical_layer_dimension,cumulative_change_of_state_variables_outer_index_max)
+ dimensions = (horizontal_dimension,vertical_layer_dimension,cumulative_change_of_state_variables_outer_index_max)
type = real
kind = kind_phys
active = (flag_for_diagnostics_3D)
@@ -9260,56 +9351,56 @@
standard_name = maximum_reflectivity_at_1km_agl_over_maximum_hourly_time_interval
long_name = maximum reflectivity at 1km agl over maximum hourly time interval
units = dBZ
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[refdmax263k]
standard_name = maximum_reflectivity_at_minus10c_over_maximum_hourly_time_interval
long_name = maximum reflectivity at minus10c over maximum hourly time interval
units = dBZ
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[t02max]
standard_name = maximum_temperature_at_2m_over_maximum_hourly_time_interval
long_name = maximum temperature at 2m over maximum hourly time interval
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[t02min]
standard_name = minimum_temperature_at_2m_over_maximum_hourly_time_interval
long_name = minumum temperature at 2m over maximum hourly time interval
units = K
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[rh02max]
standard_name = maximum_relative_humidity_at_2m_over_maximum_hourly_time_interval
long_name = maximum relative humidity at 2m over maximum hourly time interval
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[rh02min]
standard_name = minimum_relative_humidity_at_2m_over_maximum_hourly_time_interval
long_name = minumum relative humidity at 2m over maximum hourly time interval
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[pratemax]
standard_name = maximum_precipitation_rate_over_maximum_hourly_time_interval
long_name = maximum precipitation rate over maximum hourly time interval
units = mm h-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[upd_mf]
standard_name = cumulative_atmosphere_updraft_convective_mass_flux
long_name = cumulative updraft mass flux
units = kg m-1 s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_tracer_diagnostics_3D)
@@ -9317,7 +9408,7 @@
standard_name = cumulative_atmosphere_downdraft_convective_mass_flux
long_name = cumulative downdraft mass flux
units = kg m-1 s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_tracer_diagnostics_3D)
@@ -9325,7 +9416,7 @@
standard_name = cumulative_atmosphere_detrainment_convective_mass_flux
long_name = cumulative detrainment mass flux
units = kg m-1 s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_tracer_diagnostics_3D)
@@ -9333,7 +9424,7 @@
standard_name = ozone_tendency_due_to_production_and_loss_rate
long_name = ozone tendency due to production and loss rate
units = kg kg-1 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_tracer_diagnostics_3D .and. flag_for_nrl_2015_ozone_scheme)
@@ -9341,7 +9432,7 @@
standard_name = ozone_tendency_due_to_ozone_mixing_ratio
long_name = ozone tendency due to ozone mixing ratio
units = kg kg-1 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_tracer_diagnostics_3D .and. flag_for_nrl_2015_ozone_scheme)
@@ -9349,7 +9440,7 @@
standard_name = ozone_tendency_due_to_temperature
long_name = ozone tendency due to temperature
units = kg kg-1 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_tracer_diagnostics_3D .and. flag_for_nrl_2015_ozone_scheme)
@@ -9357,7 +9448,7 @@
standard_name = ozone_tendency_due_to_overhead_ozone_column
long_name = ozone tendency due to overhead ozone column
units = kg kg-1 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_tracer_diagnostics_3D .and. flag_for_nrl_2015_ozone_scheme)
@@ -9365,84 +9456,84 @@
standard_name = radar_reflectivity_10cm
long_name = instantaneous refl_10cm
units = dBZ
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[max_hail_diam_sfc]
standard_name = max_hail_diameter_sfc
long_name = instantaneous maximum hail diameter at lowest model level
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[dkt]
standard_name = atmosphere_heat_diffusivity
long_name = atmospheric heat diffusivity
units = m2 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[dku]
standard_name = atmosphere_momentum_diffusivity
long_name = atmospheric momentum diffusivity
units = m2 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[cldfra]
standard_name = instantaneous_3d_cloud_fraction
long_name = instantaneous 3D cloud fraction for all MPs
units = frac
- dimensions = (horizontal_loop_extent,adjusted_vertical_layer_dimension_for_radiation)
+ dimensions = (horizontal_dimension,adjusted_vertical_layer_dimension_for_radiation)
type = real
kind = kind_phys
[cldfra2d]
standard_name = max_in_column_cloud_fraction
long_name = instantaneous 2D (max-in-column) cloud fraction
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[lwp_ex]
standard_name = liq_water_path_from_microphysics
long_name = total liquid water path from explicit microphysics
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[iwp_ex]
standard_name = ice_water_path_from_microphysics
long_name = total ice water path from explicit microphysics
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[lwp_fc]
standard_name = liq_water_path_from_cloud_fraction
long_name = total liquid water path from cloud fraction scheme
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[iwp_fc]
standard_name = ice_water_path_from_cloud_fraction
long_name = total ice water path from cloud fraction scheme
units = kg m-2
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[total_albedo]
standard_name = total_sky_albedo
long_name = total sky albedo at toa
units = frac
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[edmf_a]
standard_name = emdf_updraft_area
long_name = updraft area from mass flux scheme
units = frac
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9450,7 +9541,7 @@
standard_name = emdf_updraft_vertical_velocity
long_name = updraft vertical velocity from mass flux scheme
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9458,7 +9549,7 @@
standard_name = emdf_updraft_total_water
long_name = updraft total water from mass flux scheme
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9466,7 +9557,7 @@
standard_name = emdf_updraft_theta_l
long_name = updraft theta-l from mass flux scheme
units = K
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9474,7 +9565,7 @@
standard_name = emdf_updraft_entrainment_rate
long_name = updraft entranment rate from mass flux scheme
units = s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9482,7 +9573,7 @@
standard_name = emdf_updraft_cloud_water
long_name = updraft cloud water from mass flux scheme
units = kg kg-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9490,7 +9581,7 @@
standard_name = theta_subsidence_tendency
long_name = updraft theta subsidence tendency
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9498,7 +9589,7 @@
standard_name = water_vapor_subsidence_tendency
long_name = updraft water vapor subsidence tendency
units = kg kg-1 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9506,7 +9597,7 @@
standard_name = theta_detrainment_tendency
long_name = updraft theta detrainment tendency
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9514,7 +9605,7 @@
standard_name = water_vapor_detrainment_tendency
long_name = updraft water vapor detrainment tendency
units = kg kg-1 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0))
@@ -9522,7 +9613,7 @@
standard_name = total_time_rate_of_change_of_tke
long_name = total tke tendency
units = m2 s-3
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1)
@@ -9530,7 +9621,7 @@
standard_name = tke_tendency_due_to_vertical_transport
long_name = tke tendency due to vertical transport and diffusion
units = m2 s-3
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1)
@@ -9538,7 +9629,7 @@
standard_name = tke_tendency_due_to_shear
long_name = tke tendency due to shear
units = m2 s-3
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1)
@@ -9546,7 +9637,7 @@
standard_name = tke_tendency_due_to_buoyancy
long_name = tke tendency due to buoyancy production or consumption
units = m2 s-3
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1)
@@ -9554,7 +9645,7 @@
standard_name = tke_tendency_due_to_dissipation
long_name = tke tendency due to the dissipation of tke
units = m2 s-3
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1)
@@ -9562,7 +9653,7 @@
standard_name = maximum_width_of_plumes
long_name = maximum width of plumes per grid column
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -9570,7 +9661,7 @@
standard_name = maximum_mass_flux
long_name = maximum mass flux within a column
units = m s-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -9578,7 +9669,7 @@
standard_name = height_of_tallest_plume_in_a_column
long_name = height of tallest plume in a column
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -9586,20 +9677,20 @@
standard_name = k_level_of_highest_reaching_plume
long_name = k-level of highest reaching plume
units = count
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
[ktop_plume]
standard_name = k_level_of_highest_plume
long_name = k-level of highest plume
units = count
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = integer
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
[exch_h]
standard_name = atmosphere_heat_diffusivity_for_mynnedmf
long_name = diffusivity for heat for MYNN PBL (defined for all mass levels)
units = m2 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -9607,7 +9698,7 @@
standard_name = atmosphere_momentum_diffusivity_for_mynnedmf
long_name = diffusivity for momentum for MYNN PBL (defined for all mass levels)
units = m2 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme)
@@ -9615,56 +9706,56 @@
standard_name = time_integral_of_height_of_mountain_blocking
long_name = time integral of height of mountain blocking drag
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[zlwb]
standard_name = time_integral_of_height_of_low_level_wave_breaking
long_name = time integral of height of drag due to low level wave breaking
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[zogw]
standard_name = time_integral_of_height_of_launch_level_of_orographic_gravity_wave
long_name = time integral of height of launch level of orographic gravity wave
units = m
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tau_tofd]
standard_name = time_integral_of_momentum_flux_due_to_turbulent_orographic_form_drag
long_name = time integral of momentum flux due to TOFD
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tau_mtb]
standard_name = time_integral_of_momentum_flux_due_to_mountain_blocking_drag
long_name = time integral of momentum flux due to mountain blocking drag
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tau_ogw]
standard_name = time_integral_of_momentum_flux_due_to_orographic_gravity_wave_drag
long_name = time integral of momentum flux due to orographic gravity wave drag
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[tau_ngw]
standard_name = time_integral_of_momentum_flux_due_to_nonstationary_gravity_wave
long_name = time integral of momentum flux due to nonstationary gravity waves
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[du3dt_mtb]
standard_name = time_integral_of_change_in_x_wind_due_to_mountain_blocking_drag
long_name = time integral of change in x wind due to mountain blocking drag
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9672,7 +9763,7 @@
standard_name = time_integral_of_change_in_x_wind_due_to_orographic_gravity_wave_drag
long_name = time integral of change in x wind due to orographic gw drag
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9680,7 +9771,7 @@
standard_name = cumulative_change_in_x_wind_due_to_mesoscale_orographic_gravity_wave_drag
long_name = cumulative change in x wind due to mesoscale orographic gravity wave drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9688,7 +9779,7 @@
standard_name = cumulative_change_in_x_wind_due_to_blocking_drag
long_name = cumulative change in x wind due to blocking drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9696,7 +9787,7 @@
standard_name = cumulative_change_in_x_wind_due_to_small_scale_gravity_wave_drag
long_name = cumulative change in x wind due to small scale gravity wave drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9704,7 +9795,7 @@
standard_name = cumulative_change_in_x_wind_due_to_form_drag
long_name = cumulative change in x wind due to form drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9712,7 +9803,7 @@
standard_name = time_integral_of_change_in_x_wind_due_to_turbulent_orographic_form_drag
long_name = time integral of change in x wind due to TOFD
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9720,7 +9811,7 @@
standard_name = time_integral_of_change_in_x_wind_due_to_nonstationary_gravity_wave
long_name = time integral of change in x wind due to NGW
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9728,7 +9819,7 @@
standard_name = cumulative_change_in_wind_speed_due_to_mesoscale_orographic_gravity_wave_drag
long_name = cumulative change in wind speed due to mesoscale orographic gravity wave drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9736,7 +9827,7 @@
standard_name = cumulative_change_in_wind_speed_due_to_blocking_drag
long_name = cumulative change in wind speed due to blocking drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9744,7 +9835,7 @@
standard_name = cumulative_change_in_wind_speed_due_to_small_scale_orographic_gravity_wave_drag
long_name = cumulative change in wind speed due to small scale orographic gravity wave drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9752,7 +9843,7 @@
standard_name = cumulative_change_in_wind_speed_due_to_turbulent_orographic_form_drag
long_name = cumulative change in wind speed due to turbulent orographic form drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9760,7 +9851,7 @@
standard_name = cumulative_change_in_x_wind_due_to_convective_gravity_wave_drag
long_name = cumulative change in x wind due to convective gravity wave drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9768,7 +9859,7 @@
standard_name = cumulative_change_in_y_wind_due_to_convective_gravity_wave_drag
long_name = cumulative change in y wind due to convective gravity wave drag
units = m s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9776,7 +9867,7 @@
standard_name = cumulative_change_in_temperature_due_to_convective_gravity_wave_drag
long_name = cumulative change in temperature due to convective gravity wave drag
units = K
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9784,35 +9875,35 @@
standard_name = tendency_of_x_wind_due_to_gravity_wave_drag
long_name = zonal wind tendency due to all GWs
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[dvdt_gw]
standard_name = tendency_of_y_wind_due_to_gravity_wave_drag
long_name = meridional wind tendency due to all GWs
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[dtdt_gw]
standard_name = tendency_of_air_temperature_due_to_gravity_wave_drag
long_name = air temperature tendency due to all GWs
units = K s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[kdis_gw]
standard_name = atmosphere_momentum_diffusivity_due_to_gravity_wave_drag
long_name = eddy mixing due to all GWs
units = m2 s-1
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
[dudt_ogw]
standard_name = tendency_of_x_wind_due_to_mesoscale_orographic_gravity_wave_drag
long_name = x wind tendency from meso scale ogw
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9820,7 +9911,7 @@
standard_name = tendency_of_y_wind_due_to_mesoscale_orographic_gravity_wave_drag
long_name = y wind tendency from meso scale ogw
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9828,7 +9919,7 @@
standard_name = vertically_integrated_x_momentum_flux_due_to_mesoscale_orographic_gravity_wave_drag
long_name = integrated x momentum flux from meso scale ogw
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9836,7 +9927,7 @@
standard_name = vertically_integrated_y_momentum_flux_due_to_mesoscale_orographic_gravity_wave_drag
long_name = integrated y momentum flux from meso scale ogw
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9844,7 +9935,7 @@
standard_name = tendency_of_x_wind_due_to_blocking_drag
long_name = x wind tendency from blocking drag
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9852,7 +9943,7 @@
standard_name = tendency_of_y_wind_due_to_blocking_drag
long_name = y wind tendency from blocking drag
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9860,7 +9951,7 @@
standard_name = vertically_integrated_x_momentum_flux_due_to_blocking_drag
long_name = integrated x momentum flux from blocking drag
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9868,7 +9959,7 @@
standard_name = vertically_integrated_y_momentum_flux_due_to_blocking_drag
long_name = integrated y momentum flux from blocking drag
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9876,7 +9967,7 @@
standard_name = cumulative_vertically_integrated_x_momentum_flux_due_to_mesoscale_orographic_gravity_wave_drag
long_name = cumulative integrated x momentum flux from mesoscale orographic gravity wave drag
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9884,7 +9975,7 @@
standard_name = cumulative_vertically_integrated_y_momentum_flux_due_to_mesoscale_orographic_gravity_wave_drag
long_name = cumulative integrated y momentum flux from mesoscale orographic gravity wave drag
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9892,7 +9983,7 @@
standard_name = cumulative_vertically_integrated_x_momentum_flux_due_to_blocking_drag
long_name = cumulative integrated x momentum flux from blocking drag
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9900,7 +9991,7 @@
standard_name = cumulative_vertically_integrated_y_momentum_flux_due_to_blocking_drag
long_name = cumulative integrated y momentum flux from blocking drag
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9908,7 +9999,7 @@
standard_name = cumulative_vertically_integrated_x_momentum_flux_due_to_small_scale_gravity_wave_drag
long_name = cumulative integrated x momentum flux from small scale gravity wave drag
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9916,7 +10007,7 @@
standard_name = cumulative_vertically_integrated_y_momentum_flux_due_small_scale_gravity_wave_drag
long_name = cumulative integrated y momentum flux from small scale gravity wave drag
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9924,7 +10015,7 @@
standard_name = cumulative_vertically_integrated_x_momentum_flux_due_to_form_drag
long_name = cumulative integrated x momentum flux from form drag
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9932,7 +10023,7 @@
standard_name = cumulative_vertically_integrated_y_momentum_flux_due_to_form_drag
long_name = cumulative integrated y momentum flux from form drag
units = Pa s
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9940,7 +10031,7 @@
standard_name = tendency_of_x_wind_due_to_small_scale_gravity_wave_drag
long_name = x wind tendency from small scale gwd
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9948,7 +10039,7 @@
standard_name = tendency_of_y_wind_due_to_small_scale_gravity_wave_drag
long_name = y wind tendency from small scale gwd
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9956,7 +10047,7 @@
standard_name = vertically_integrated_x_momentum_flux_due_to_small_scale_gravity_wave_drag
long_name = integrated x momentum flux from small scale gwd
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9964,7 +10055,7 @@
standard_name = vertically_integrated_y_momentum_flux_due_to_small_scale_gravity_wave_drag
long_name = integrated y momentum flux from small scale gwd
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9972,7 +10063,7 @@
standard_name = tendency_of_x_wind_due_to_form_drag
long_name = x wind tendency from form drag
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9980,7 +10071,7 @@
standard_name = tendency_of_y_wind_due_to_form_drag
long_name = y wind tendency from form drag
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9988,7 +10079,7 @@
standard_name = vertically_integrated_x_momentum_flux_due_to_form_drag
long_name = integrated x momentum flux from form drag
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -9996,7 +10087,7 @@
standard_name = vertically_integrated_y_momentum_flux_due_to_form_drag
long_name = integrated y momentum flux from form drag
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics)
@@ -10004,7 +10095,7 @@
standard_name = time_integral_of_change_in_y_wind_due_to_nonstationary_gravity_wave
long_name = time integral of change in y wind due to NGW
units = m s-2
- dimensions = (horizontal_loop_extent,vertical_layer_dimension)
+ dimensions = (horizontal_dimension,vertical_layer_dimension)
type = real
kind = kind_phys
active = (flag_for_unified_gravity_wave_physics_diagnostics)
@@ -10012,7 +10103,7 @@
standard_name = extended_diagnostics_output_from_thompson_microphysics
long_name = set of 3d arrays for extended diagnostics output from thompson microphysics
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_3d_diagnostic_output_arrays_from_thompson_microphysics)
+ dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_3d_diagnostic_output_arrays_from_thompson_microphysics)
type = real
kind = kind_phys
active = (flag_for_extended_diagnostic_output_from_thompson_microphysics)
@@ -10020,7 +10111,7 @@
standard_name = auxiliary_2d_arrays
long_name = auxiliary 2d arrays to output (for debugging)
units = none
- dimensions = (horizontal_loop_extent,number_of_xyz_dimensioned_auxiliary_arrays)
+ dimensions = (horizontal_dimension,number_of_xy_dimensioned_auxiliary_arrays)
type = real
kind = kind_phys
active = (number_of_xy_dimensioned_auxiliary_arrays > 0)
@@ -10028,7 +10119,7 @@
standard_name = auxiliary_3d_arrays
long_name = auxiliary 3d arrays to output (for debugging)
units = none
- dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_xyz_dimensioned_auxiliary_arrays)
+ dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_xyz_dimensioned_auxiliary_arrays)
type = real
kind = kind_phys
active = (number_of_xyz_dimensioned_auxiliary_arrays > 0)
@@ -10036,14 +10127,14 @@
standard_name = surface_air_pressure_from_previous_timestep
long_name = surface air pressure from previous timestep
units = Pa
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
[ltg1_max]
standard_name = lightning_threat_index_1
long_name = lightning threat index 1
units = flashes min-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
intent = inout
@@ -10052,7 +10143,7 @@
standard_name = lightning_threat_index_2
long_name = lightning threat index 2
units = flashes min-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
intent = inout
@@ -10061,7 +10152,7 @@
standard_name = lightning_threat_index_3
long_name = lightning threat index 3
units = flashes min-1
- dimensions = (horizontal_loop_extent)
+ dimensions = (horizontal_dimension)
type = real
kind = kind_phys
intent = inout
@@ -10074,7 +10165,7 @@
relative_path = ../../ccpp/physics/physics
dependencies = hooks/machine.F,hooks/physcons.F90
dependencies = Radiation/RRTMG/radlw_param.f,Radiation/RRTMG/radsw_param.f
- dependencies = photochem/h2o_def.f,photochem/module_ozphys.F90
+ dependencies = photochem/module_ozphys.F90,photochem/module_h2ophys.F90
dependencies = MP/GFDL/GFDL_parse_tracers.F90
dependencies = Interstitials/UFS_SCM_NEPTUNE/GFS_ccpp_suite_sim_pre.F90
diff --git a/scm/src/scm.F90 b/scm/src/scm.F90
index b6ac80d4a..e5aab8983 100644
--- a/scm/src/scm.F90
+++ b/scm/src/scm.F90
@@ -33,7 +33,7 @@ subroutine scm_main_sub()
type(MPI_Comm) :: fcst_mpi_comm
- integer :: i, j, kdt_rad, idtend, itrac
+ integer :: i, j, kdt_rad, idtend, itrac, n_tasks, n_threads
real(kind=8) :: rinc(5) !(DAYS, HOURS, MINUTES, SECONDS, MILLISECONDS)
integer :: jdat(1:8)
@@ -48,6 +48,8 @@ subroutine scm_main_sub()
error stop
end if
fcst_mpi_comm = MPI_COMM_WORLD
+ n_tasks = 1
+ n_threads = 1
call get_config_nml(scm_state)
@@ -82,7 +84,7 @@ subroutine scm_main_sub()
call interpolate_forcing(scm_input_instance, scm_state, in_spinup)
- call physics%create(scm_state%n_cols)
+ call physics%create(scm_state%n_cols, n_threads)
!physics initialization section
@@ -131,7 +133,7 @@ subroutine scm_main_sub()
call GFS_suite_setup(physics%Model, physics%Statein, physics%Stateout, &
physics%Sfcprop, physics%Coupling, physics%Grid, &
physics%Tbd, physics%Cldprop, physics%Radtend, &
- physics%Diag, physics%Interstitial, 1, 1, &
+ physics%Diag, physics%Interstitial, n_tasks, n_threads, &
physics%Init_parm, scm_state%n_cols, scm_state%lon, &
scm_state%lat, scm_state%area)
@@ -175,6 +177,7 @@ subroutine scm_main_sub()
end if
cdata%blk_no = 1
+ cdata%chunk_no = 1
cdata%thrd_no = 1
cdata%thrd_cnt = 1
@@ -414,9 +417,9 @@ subroutine scm_main_sub()
write(*,*) "itt = ",scm_state%itt
write(*,*) "model time (s) = ",scm_state%model_time
if (scm_state%lsm_ics .or. scm_state%model_ics) then
- write(*,*) "Bowen ratio: ",physics%Interstitial%dtsfc1(1)/physics%Interstitial%dqsfc1(1)
- write(*,*) "sensible heat flux (W m-2): ",physics%Interstitial%dtsfc1(1)
- write(*,*) "latent heat flux (W m-2): ",physics%Interstitial%dqsfc1(1)
+ write(*,*) "Bowen ratio: ",physics%Interstitial(1)%dtsfc1(1)/physics%Interstitial(1)%dqsfc1(1)
+ write(*,*) "sensible heat flux (W m-2): ",physics%Interstitial(1)%dtsfc1(1)
+ write(*,*) "latent heat flux (W m-2): ",physics%Interstitial(1)%dqsfc1(1)
end if
if (.not. in_spinup) then
diff --git a/scm/src/scm_input.F90 b/scm/src/scm_input.F90
index 4bb6b3c0f..8492b3408 100644
--- a/scm/src/scm_input.F90
+++ b/scm/src/scm_input.F90
@@ -1882,6 +1882,7 @@ subroutine get_case_init_DEPHY(scm_state, scm_input)
scm_state%runtime = elapsed_sec*scm_state%runtime_mult
end if
+ scm_input%input_area = input_area(active_init_time)
scm_input%input_time = input_time
scm_input%input_pres_surf(1) = input_pres_surf(active_init_time) !perhaps input_pres_surf should only be equal to input_force_pres_surf?
scm_input%input_pres = input_pres(:,active_init_time)
@@ -2067,7 +2068,6 @@ subroutine get_case_init_DEPHY(scm_state, scm_input)
if (trim(input_surfaceForcingLSM) == "lsm") then
scm_input%input_ozone = input_ozone(:,active_init_time)
- scm_input%input_area = input_area(active_init_time)
scm_input%input_stddev = input_stddev(active_init_time)
scm_input%input_convexity= input_convexity(active_init_time)
diff --git a/scm/src/scm_output.F90 b/scm/src/scm_output.F90
index b41347c19..73a840a3b 100644
--- a/scm/src/scm_output.F90
+++ b/scm/src/scm_output.F90
@@ -90,7 +90,7 @@ subroutine output_init(scm_state, physics)
CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="hor_dim_layer",LEN=scm_state%n_cols,DIMID=hor_dim_id),"nf90_def_dim(hor_dim_layer)")
CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_layer",LEN=scm_state%n_levels,DIMID=vert_dim_id),"nf90_def_dim(vert_dim_layer)")
CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_interface",LEN=scm_state%n_levels+1,DIMID=vert_dim_i_id),"nf90_def_dim(vert_dim_interface)")
- CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_rad",LEN=physics%Interstitial%lmk,DIMID=vert_dim_rad_id),"nf90_def_dim(vert_dim_rad)")
+ CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_rad",LEN=physics%Interstitial(1)%lmk,DIMID=vert_dim_rad_id),"nf90_def_dim(vert_dim_rad)")
CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_soil",LEN=physics%Model%lsoil_lsm,DIMID=vert_dim_soil_id),"nf90_def_dim(vert_dim_soil)")
!> - Define the dimension variables.
@@ -248,7 +248,7 @@ subroutine output_init_sfcprop(ncid, time_inst_id, hor_dim_id, vert_dim_soil_id,
call NetCDF_def_var(ncid, 't2m', NF90_FLOAT, "2-m temperature", "K", dummy_id, (/ hor_dim_id, time_inst_id /))
call NetCDF_def_var(ncid, 'q2m', NF90_FLOAT, "2-m specific humidity", "kg kg-1", dummy_id, (/ hor_dim_id, time_inst_id /))
call NetCDF_def_var(ncid, 'ustar', NF90_FLOAT, "surface friction velocity", "m s-1", dummy_id, (/ hor_dim_id, time_inst_id /))
- call NetCDF_def_var(ncid, 'tsfc', NF90_FLOAT, "surface skin temperature", "m s-1K", dummy_id, (/ hor_dim_id, time_inst_id /))
+ call NetCDF_def_var(ncid, 'tsfc', NF90_FLOAT, "surface skin temperature", "K", dummy_id, (/ hor_dim_id, time_inst_id /))
end subroutine output_init_sfcprop
@@ -600,29 +600,29 @@ subroutine output_append_interstitial_inst(ncid, scm_state, physics)
type(scm_state_type), intent(in) :: scm_state
type(physics_type), intent(in) :: physics
- call NetCDF_put_var(ncid, "tau_u", physics%Interstitial%dusfc1(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "tau_v", physics%Interstitial%dvsfc1(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "tau_u", physics%Interstitial(1)%dusfc1(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "tau_v", physics%Interstitial(1)%dvsfc1(:), scm_state%itt_out)
if (physics%model%imfdeepcnv >= 0 .or. physics%model%imfshalcnv >= 0) then
call NetCDF_put_var(ncid, "upd_mf", physics%Tbd%ud_mf(:,:), scm_state%itt_out)
end if
- call NetCDF_put_var(ncid, "dwn_mf", physics%Interstitial%dd_mf(:,:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "det_mf", physics%Interstitial%dt_mf(:,:), scm_state%itt_out)
-
- call NetCDF_put_var(ncid, "sfc_up_lw_land", physics%Interstitial%adjsfculw_land(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_up_lw_ice", physics%Interstitial%adjsfculw_ice(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_up_lw_water", physics%Interstitial%adjsfculw_water(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_up_sw_dir_nir", physics%Interstitial%adjnirbmu(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_up_sw_dif_nir", physics%Interstitial%adjnirdfu(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_up_sw_dir_vis", physics%Interstitial%adjvisbmu(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_up_sw_dif_vis", physics%Interstitial%adjvisdfu(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_dwn_sw_dir_nir", physics%Interstitial%adjnirbmd(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_dwn_sw_dif_nir", physics%Interstitial%adjnirdfd(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_dwn_sw_dir_vis", physics%Interstitial%adjvisbmd(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "sfc_dwn_sw_dif_vis", physics%Interstitial%adjvisdfd(:), scm_state%itt_out)
-
- call NetCDF_put_var(ncid, "mp_prcp_inst", physics%Interstitial%prcpmp(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "dcnv_prcp_inst", physics%Interstitial%raincd(:), scm_state%itt_out)
- call NetCDF_put_var(ncid, "scnv_prcp_inst", physics%Interstitial%raincs(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "dwn_mf", physics%Interstitial(1)%dd_mf(:,:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "det_mf", physics%Interstitial(1)%dt_mf(:,:), scm_state%itt_out)
+
+ call NetCDF_put_var(ncid, "sfc_up_lw_land", physics%Interstitial(1)%adjsfculw_land(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_up_lw_ice", physics%Interstitial(1)%adjsfculw_ice(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_up_lw_water", physics%Interstitial(1)%adjsfculw_water(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_up_sw_dir_nir", physics%Interstitial(1)%adjnirbmu(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_up_sw_dif_nir", physics%Interstitial(1)%adjnirdfu(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_up_sw_dir_vis", physics%Interstitial(1)%adjvisbmu(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_up_sw_dif_vis", physics%Interstitial(1)%adjvisdfu(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_dwn_sw_dir_nir", physics%Interstitial(1)%adjnirbmd(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_dwn_sw_dif_nir", physics%Interstitial(1)%adjnirdfd(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_dwn_sw_dir_vis", physics%Interstitial(1)%adjvisbmd(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "sfc_dwn_sw_dif_vis", physics%Interstitial(1)%adjvisdfd(:), scm_state%itt_out)
+
+ call NetCDF_put_var(ncid, "mp_prcp_inst", physics%Interstitial(1)%prcpmp(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "dcnv_prcp_inst", physics%Interstitial(1)%raincd(:), scm_state%itt_out)
+ call NetCDF_put_var(ncid, "scnv_prcp_inst", physics%Interstitial(1)%raincs(:), scm_state%itt_out)
end subroutine output_append_interstitial_inst
@@ -634,15 +634,15 @@ subroutine output_append_interstitial_rad(ncid, scm_state, physics)
type(scm_state_type), intent(in) :: scm_state
type(physics_type), intent(in) :: physics
- call NetCDF_put_var(ncid, "rad_cloud_fraction", physics%Interstitial%clouds(:,:,1), scm_state%itt_rad)
- call NetCDF_put_var(ncid, "rad_cloud_lwp", physics%Interstitial%clouds(:,:,2), scm_state%itt_rad)
- call NetCDF_put_var(ncid, "rad_eff_rad_ql", physics%Interstitial%clouds(:,:,3), scm_state%itt_rad)
- call NetCDF_put_var(ncid, "rad_cloud_iwp", physics%Interstitial%clouds(:,:,4), scm_state%itt_rad)
- call NetCDF_put_var(ncid, "rad_eff_rad_qi", physics%Interstitial%clouds(:,:,5), scm_state%itt_rad)
- call NetCDF_put_var(ncid, "rad_cloud_rwp", physics%Interstitial%clouds(:,:,6), scm_state%itt_rad)
- call NetCDF_put_var(ncid, "rad_eff_rad_qr", physics%Interstitial%clouds(:,:,7), scm_state%itt_rad)
- call NetCDF_put_var(ncid, "rad_cloud_swp", physics%Interstitial%clouds(:,:,8), scm_state%itt_rad)
- call NetCDF_put_var(ncid, "rad_eff_rad_qs", physics%Interstitial%clouds(:,:,9), scm_state%itt_rad)
+ call NetCDF_put_var(ncid, "rad_cloud_fraction", physics%Interstitial(1)%clouds(:,:,1), scm_state%itt_rad)
+ call NetCDF_put_var(ncid, "rad_cloud_lwp", physics%Interstitial(1)%clouds(:,:,2), scm_state%itt_rad)
+ call NetCDF_put_var(ncid, "rad_eff_rad_ql", physics%Interstitial(1)%clouds(:,:,3), scm_state%itt_rad)
+ call NetCDF_put_var(ncid, "rad_cloud_iwp", physics%Interstitial(1)%clouds(:,:,4), scm_state%itt_rad)
+ call NetCDF_put_var(ncid, "rad_eff_rad_qi", physics%Interstitial(1)%clouds(:,:,5), scm_state%itt_rad)
+ call NetCDF_put_var(ncid, "rad_cloud_rwp", physics%Interstitial(1)%clouds(:,:,6), scm_state%itt_rad)
+ call NetCDF_put_var(ncid, "rad_eff_rad_qr", physics%Interstitial(1)%clouds(:,:,7), scm_state%itt_rad)
+ call NetCDF_put_var(ncid, "rad_cloud_swp", physics%Interstitial(1)%clouds(:,:,8), scm_state%itt_rad)
+ call NetCDF_put_var(ncid, "rad_eff_rad_qs", physics%Interstitial(1)%clouds(:,:,9), scm_state%itt_rad)
end subroutine output_append_interstitial_rad
diff --git a/scm/src/scm_setup.F90 b/scm/src/scm_setup.F90
index 811844dc0..2d9f21739 100644
--- a/scm/src/scm_setup.F90
+++ b/scm/src/scm_setup.F90
@@ -43,7 +43,11 @@ subroutine set_state(scm_input, scm_reference, scm_state)
scm_state%lat(i) = scm_input%input_lat*deg_to_rad_const
end do
-
+ do i=1, scm_state%n_cols
+ if (scm_state%area(i) == 0) then
+ scm_state%area(i) = scm_input%input_area
+ end if
+ end do
!> - \todo When patching in a reference sounding, need to handle the case when the reference sounding is too short; patch_in_ref
!! checks for the case, but as of now, it just extrapolates where it needs to and returns an error code; error should be handled
@@ -160,7 +164,6 @@ subroutine set_state(scm_input, scm_reference, scm_state)
scm_state%state_T(i,:,1) = scm_input%input_temp(:)
scm_state%state_tracer(i,:,scm_state%water_vapor_index,1)=scm_input%input_qt
scm_state%state_tracer(i,:,scm_state%ozone_index,1)=scm_input%input_ozone
- scm_state%area(i) = scm_input%input_area
if (scm_input%input_pres_i(1).GT. 0.0) then ! pressure are read in, overwrite values
scm_state%pres_i(i,:)=scm_input%input_pres_i
@@ -308,7 +311,7 @@ subroutine GFS_suite_setup (Model, Statein, Stateout, Sfcprop,
type(GFS_cldprop_type), intent(inout) :: Cldprop
type(GFS_radtend_type), intent(inout) :: Radtend
type(GFS_diag_type), intent(inout) :: Diag
- type(GFS_interstitial_type), intent(inout) :: Interstitial
+ type(GFS_interstitial_type), intent(inout) :: Interstitial(:)
type(GFS_init_type), intent(in) :: Init_parm
integer, intent(in) :: ntasks, nthreads, n_cols
@@ -337,18 +340,23 @@ subroutine GFS_suite_setup (Model, Statein, Stateout, Sfcprop,
!--- initialize DDTs
- call Statein%create(n_cols, Model)
- call Stateout%create(n_cols, Model)
- call Sfcprop%create(n_cols, Model)
- call Coupling%create(n_cols, Model)
- call Grid%create(n_cols, Model)
- call Tbd%create(n_cols, Model)
- call Cldprop%create(n_cols, Model)
- call Radtend%create(n_cols, Model)
+ call Statein%create(Model)
+ call Stateout%create(Model)
+ call Sfcprop%create(Model)
+ call Coupling%create(Model)
+ call Grid%create(Model)
+ call Tbd%create(Model)
+ call Cldprop%create(Model)
+ call Radtend%create(Model)
!--- internal representation of diagnostics
- call Diag%create(n_cols, Model)
+ call Diag%create(Model)
!--- internal representation of interstitials for CCPP physics
- call Interstitial%create(n_cols, Model)
+ if (nthreads == 1) then
+ call Interstitial(1)%create(n_cols, Model)
+ else
+ print *,' CCPP SCM is only set up to use one thread - shutting down'
+ error stop
+ end if
!--- populate the grid components
!call GFS_grid_populate (Grid(i), Init_parm%xlon, Init_parm%xlat, Init_parm%area)
diff --git a/scm/src/scm_type_defs.F90 b/scm/src/scm_type_defs.F90
index 49a8c71da..23e1cc112 100644
--- a/scm/src/scm_type_defs.F90
+++ b/scm/src/scm_type_defs.F90
@@ -427,7 +427,7 @@ module scm_type_defs
type(GFS_cldprop_type) :: Cldprop
type(GFS_radtend_type) :: Radtend
type(GFS_diag_type) :: Diag
- type(GFS_interstitial_type) :: Interstitial
+ type(GFS_interstitial_type), allocatable :: Interstitial(:)
type(GFS_init_type) :: Init_parm
contains
@@ -947,15 +947,17 @@ subroutine scm_reference_create(scm_reference, nlev)
end subroutine scm_reference_create
- subroutine physics_create(physics, n_columns)
+ subroutine physics_create(physics, n_columns, n_threads)
class(physics_type) :: physics
- integer, intent(in) :: n_columns
+ integer, intent(in) :: n_columns, n_threads
real(kind=kind_phys) :: kind_phys_zero
integer :: i
integer, dimension(8) :: zeroes_8
-
+
+ allocate(physics%Interstitial(n_threads))
+
zeroes_8(:) = int_zero
kind_phys_zero = real_zero
@@ -1129,7 +1131,7 @@ subroutine physics_set(physics, scm_input, scm_state)
call conditionally_set_var(scm_input%input_facwf, physics%Sfcprop%facwf(i), "facwf", .true., missing_var(11))
call conditionally_set_var(scm_input%input_vegfrac, physics%Sfcprop%vfrac(i), "vegfrac", .true., missing_var(12))
!GJF: is this needed anymore (not in FV3GFS_io)?
- physics%Interstitial%sigmaf(i) = min(physics%Sfcprop%vfrac(i),0.01)
+ physics%Interstitial(1)%sigmaf(i) = min(physics%Sfcprop%vfrac(i),0.01)
call conditionally_set_var(scm_input%input_canopy, physics%Sfcprop%canopy(i), "canopy", .true., missing_var(13))
call conditionally_set_var(scm_input%input_f10m, physics%Sfcprop%f10m(i), "f10m", .false., missing_var(14))
call conditionally_set_var(scm_input%input_t2m, physics%Sfcprop%t2m(i), "t2m", physics%Model%cplflx, missing_var(15))
diff --git a/scm/src/scm_type_defs.meta b/scm/src/scm_type_defs.meta
index dce3cb400..0950d4568 100644
--- a/scm/src/scm_type_defs.meta
+++ b/scm/src/scm_type_defs.meta
@@ -66,12 +66,18 @@
units = DDT
dimensions = ()
type = GFS_tbd_type
-[Interstitial]
+[Interstitial(ccpp_thread_number)]
standard_name = GFS_interstitial_type_instance
long_name = instance of derived type GFS_interstitial_type
units = DDT
dimensions = ()
type = GFS_interstitial_type
+[Interstitial]
+ standard_name = GFS_interstitial_type_instance_all_threads
+ long_name = instance of derived type GFS_interstitial_type
+ units = DDT
+ dimensions = (number_of_openmp_threads)
+ type = GFS_interstitial_type
########################################################################
[ccpp-table-properties]
diff --git a/scm/src/suite_info.py b/scm/src/suite_info.py
index 494b5dffb..56de9bbcd 100755
--- a/scm/src/suite_info.py
+++ b/scm/src/suite_info.py
@@ -72,6 +72,7 @@ def timestep(self, value):
suite_list.append(suite('SCM_GSD_v1', 'tracers_gsd.txt', 'input_GSD_v1.nml', 600.0, 600.0 , False))
suite_list.append(suite('SCM_RRFS_v1nssl', 'tracers_RRFS_v1nssl_nohail_noccn.txt', 'input_RRFS_v1nssl_nohailnoccn.nml', 600.0, 600.0 , False))
suite_list.append(suite('SCM_csawmg', 'tracers_csawmg.txt', 'input_csawmg.nml', 600.0, 1800.0, False))
+suite_list.append(suite('SCM_GFS_v16_debug', 'tracers_GFS_v16.txt', 'input_GFS_v16.nml', 600.0, 1800.0, False))
def main():
diff --git a/test/cmp_rt2bl.py b/test/cmp_rt2bl.py
index f29ed5218..7560d1b61 100755
--- a/test/cmp_rt2bl.py
+++ b/test/cmp_rt2bl.py
@@ -14,20 +14,22 @@
#
parser = argparse.ArgumentParser()
-parser.add_argument('-drt', '--dir_rt', help='Directory containing SCM RT output', required=True)
-parser.add_argument('-dbl', '--dir_bl', help='Directory containing SCM RT baselines', required=True)
+parser.add_argument('-drt', '--dir_rt', help='Directory containing SCM RT output', required=True)
+parser.add_argument('-dbl', '--dir_bl', help='Directory containing SCM RT baselines', required=True)
+parser.add_argument('-np', '--no_plots', help='flag to turn off generation of difference plots', required=False, action='store_true')
#
def parse_args():
args = parser.parse_args()
dir_rt = args.dir_rt
dir_bl = args.dir_bl
- return (dir_rt, dir_bl)
+ no_plots = args.no_plots
+ return (dir_rt, dir_bl, no_plots)
#
def main():
#
- (dir_rt, dir_bl) = parse_args()
+ (dir_rt, dir_bl, no_plots) = parse_args()
#
error_count = 0
@@ -38,14 +40,17 @@ def main():
com = "cmp "+file_rt+" "+file_bl+" > logfile.txt"
result = os.system(com)
if (result != 0):
- print("Output for "+run["case"]+"_"+run["suite"]+ " DIFFERS from baseline. Difference plots will be created")
+ message = "Output for "+run["case"]+"_"+run["suite"]+ " DIFFERS from baseline."
+ if (not no_plots):
+ message += " Difference plots will be created."
+ print(message)
error_count = error_count + 1
else:
print("Output for "+run["case"]+"_"+run["suite"]+ " is IDENTICAL to baseline")
# end if
# Create plots between RTs and baselines (only if differences exist)
- if (result != 0):
+ if (result != 0 and not no_plots):
plot_files = plot_results(file_bl, file_rt)
# Setup output directories for plots.
@@ -71,7 +76,8 @@ def main():
# end for
# Create tarball with plots.
- result = os.system('tar -cvf scm_rt_out.tar scm_rt_out/*')
+ if (not no_plots):
+ result = os.system('tar -cvf scm_rt_out.tar scm_rt_out/*')
#
if error_count == 0:
diff --git a/test/rt_test_cases.py b/test/rt_test_cases.py
index 1660b48c9..2fba45bfb 100644
--- a/test/rt_test_cases.py
+++ b/test/rt_test_cases.py
@@ -56,6 +56,7 @@
{"case": "bomex", "suite": "SCM_RRFS_v1beta"}, \
{"case": "bomex", "suite": "SCM_RAP"}, \
{"case": "bomex", "suite": "SCM_GFS_v15p2"}, \
+ {"case": "bomex", "suite": "SCM_GFS_v16_debug"}, \
{"case": "astex", "suite": "SCM_GFS_v17_p8"}, \
{"case": "astex", "suite": "SCM_HRRR"}, \
{"case": "astex", "suite": "SCM_RRFS_v1beta"}, \