diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/02OJ016_UTC_mNAVD88.csv b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/02OJ016_UTC_mNAVD88.csv
new file mode 100755
index 0000000000..37bb103c58
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/02OJ016_UTC_mNAVD88.csv
@@ -0,0 +1,18173 @@
+Date and Time (GMT),Water level (m NAVD88)
+1972-04-01,29.154
+1972-04-02,29.2
+1972-04-03,29.23
+1972-04-04,29.252
+1972-04-05,29.273
+1972-04-06,29.276
+1972-04-07,29.273
+1972-04-08,29.261
+1972-04-09,29.255
+1972-04-10,29.255
+1972-04-11,29.27
+1972-04-12,29.3
+1972-04-13,29.325
+1972-04-14,29.349
+1972-04-15,29.371
+1972-04-16,29.419
+1972-04-17,29.444
+1972-04-18,29.495
+1972-04-19,29.547
+1972-04-20,29.584
+1972-04-21,29.624
+1972-04-22,29.684
+1972-04-23,29.733
+1972-04-24,29.748
+1972-04-25,29.73
+1972-04-26,29.77
+1972-04-27,29.752
+1972-04-28,29.794
+1972-04-29,29.773
+1972-04-30,29.785
+1972-05-01,29.764
+1972-05-02,29.794
+1972-05-03,29.895
+1972-05-04,29.959
+1972-05-05,30.069
+1972-05-06,30.084
+1972-05-07,30.114
+1972-05-08,30.181
+1972-05-09,30.19
+1972-05-10,30.2
+1972-05-11,30.221
+1972-05-12,30.178
+1972-05-13,30.175
+1972-05-14,30.178
+1972-05-15,30.178
+1972-05-16,30.148
+1972-05-17,30.148
+1972-05-18,30.148
+1972-05-19,30.133
+1972-05-20,30.117
+1972-05-21,30.062
+1972-05-22,30.072
+1972-05-23,30.072
+1972-05-24,29.959
+1972-05-25,29.941
+1972-05-26,29.928
+1972-05-27,29.919
+1972-05-28,29.898
+1972-05-29,29.855
+1972-05-30,29.828
+1972-05-31,29.776
+1972-06-01,29.752
+1972-06-02,29.742
+1972-06-03,29.727
+1972-06-04,29.715
+1972-06-05,29.7
+1972-06-06,29.684
+1972-06-07,29.669
+1972-06-08,29.669
+1972-06-09,29.66
+1972-06-10,29.66
+1972-06-11,29.633
+1972-06-12,29.605
+1972-06-13,29.569
+1972-06-14,29.575
+1972-06-15,29.584
+1972-06-16,29.566
+1972-06-17,29.55
+1972-06-18,29.523
+1972-06-19,29.514
+1972-06-20,29.508
+1972-06-21,29.502
+1972-06-22,29.483
+1972-06-23,29.465
+1972-06-24,29.462
+1972-06-25,29.444
+1972-06-26,29.428
+1972-06-27,29.416
+1972-06-28,29.404
+1972-06-29,29.401
+1972-06-30,29.401
+1972-07-01,29.407
+1972-07-02,29.389
+1972-07-03,29.328
+1972-07-04,29.398
+1972-07-05,29.401
+1972-07-06,29.386
+1972-07-07,29.374
+1972-07-08,29.364
+1972-07-09,29.349
+1972-07-10,29.34
+1972-07-11,29.34
+1972-07-12,29.322
+1972-07-13,29.313
+1972-07-14,29.31
+1972-07-15,29.297
+1972-07-16,29.282
+1972-07-17,29.288
+1972-07-18,29.288
+1972-07-19,29.285
+1972-07-20,29.282
+1972-07-21,29.282
+1972-07-22,29.279
+1972-07-23,29.276
+1972-07-24,29.294
+1972-07-25,29.328
+1972-07-26,29.395
+1972-07-27,29.404
+1972-07-28,29.416
+1972-07-29,29.419
+1972-07-30,29.425
+1972-07-31,29.447
+1972-08-01,29.419
+1972-08-02,29.413
+1972-08-03,29.389
+1972-08-04,29.331
+1972-08-05,29.374
+1972-08-06,29.361
+1972-08-07,29.358
+1972-08-08,29.389
+1972-08-09,29.352
+1972-08-10,29.322
+1972-08-11,29.334
+1972-08-12,29.328
+1972-08-13,29.279
+1972-08-14,29.27
+1972-08-15,29.239
+1972-08-16,29.239
+1972-08-17,29.252
+1972-08-18,29.297
+1972-08-19,29.252
+1972-08-20,29.203
+1972-08-21,29.154
+1972-08-22,29.172
+1972-08-23,29.209
+1972-08-24,29.169
+1972-08-25,29.191
+1972-08-26,29.148
+1972-08-27,29.175
+1972-08-28,29.191
+1972-08-29,29.136
+1972-08-30,29.145
+1972-08-31,29.16
+1972-09-01,29.145
+1972-09-02,29.139
+1972-09-03,29.087
+1972-09-04,29.084
+1972-09-05,29.09
+1972-09-06,29.081
+1972-09-07,29.081
+1972-09-08,29.084
+1972-09-09,28.974
+1972-09-10,28.993
+1972-09-11,29.035
+1972-09-12,29.023
+1972-09-13,29.017
+1972-09-14,28.977
+1972-09-15,28.999
+1972-09-16,28.977
+1972-09-17,28.938
+1972-09-18,28.895
+1972-09-19,28.865
+1972-09-20,28.871
+1972-09-21,28.977
+1972-09-22,28.871
+1972-09-23,28.895
+1972-09-24,28.916
+1972-09-25,28.88
+1972-09-26,28.889
+1972-09-27,28.846
+1972-09-28,28.794
+1972-09-29,28.947
+1972-09-30,28.825
+1972-10-01,28.779
+1972-10-02,28.804
+1972-10-03,28.776
+1972-10-04,28.782
+1972-10-05,28.776
+1972-10-06,28.782
+1972-10-07,28.791
+1972-10-08,28.804
+1972-10-09,28.749
+1972-10-10,28.755
+1972-10-11,28.932
+1972-10-12,28.855
+1972-10-13,28.743
+1972-10-14,28.932
+1972-10-15,28.712
+1972-10-16,28.901
+1972-10-17,28.688
+1972-10-18,28.712
+1972-10-19,28.712
+1972-10-20,28.7
+1972-10-21,28.761
+1972-10-22,28.694
+1972-10-23,28.694
+1972-10-24,28.651
+1972-10-25,28.682
+1972-10-26,28.712
+1972-10-27,28.718
+1972-10-28,28.712
+1972-10-29,28.621
+1972-10-30,28.676
+1972-10-31,28.691
+1972-11-01,28.694
+1972-11-02,28.755
+1972-11-03,28.627
+1972-11-04,28.673
+1972-11-05,28.724
+1972-11-06,28.737
+1972-11-07,28.749
+1972-11-08,28.737
+1972-11-09,28.612
+1972-11-10,28.831
+1972-11-11,28.883
+1972-11-12,28.898
+1972-11-13,28.91
+1972-11-14,28.901
+1972-11-15,28.889
+1972-11-16,28.919
+1972-11-17,28.944
+1972-11-18,28.886
+1972-11-19,28.922
+1972-11-20,28.883
+1972-11-21,28.929
+1972-11-22,28.932
+1972-11-23,28.986
+1972-11-24,28.941
+1972-11-25,28.932
+1972-11-26,29.108
+1972-11-27,29.13
+1972-11-28,29.063
+1972-11-29,29.069
+1972-11-30,29.084
+1972-12-01,29.066
+1972-12-02,29.127
+1972-12-03,29.078
+1972-12-04,29.084
+1972-12-05,29.084
+1972-12-06,29.087
+1972-12-07,29.084
+1972-12-08,29.118
+1972-12-09,29.087
+1972-12-10,29.133
+1972-12-11,29.084
+1972-12-12,29.084
+1972-12-13,29.084
+1972-12-14,29.142
+1972-12-15,29.145
+1972-12-16,29.148
+1972-12-17,29.148
+1972-12-18,29.148
+1972-12-19,29.148
+1972-12-20,29.145
+1972-12-21,29.145
+1972-12-22,29.148
+1972-12-23,29.145
+1972-12-24,29.139
+1972-12-25,29.145
+1972-12-26,29.148
+1972-12-27,29.145
+1972-12-28,29.148
+1972-12-29,29.145
+1972-12-30,29.148
+1972-12-31,29.148
+1973-01-01,29.111
+1973-01-02,29.136
+1973-01-03,29.175
+1973-01-04,29.197
+1973-01-05,29.154
+1973-01-06,29.108
+1973-01-07,29.249
+1973-01-08,29.307
+1973-01-09,29.239
+1973-01-10,29.249
+1973-01-11,29.236
+1973-01-12,29.218
+1973-01-13,29.215
+1973-01-14,29.215
+1973-01-15,29.212
+1973-01-16,29.185
+1973-01-17,29.151
+1973-01-18,29.127
+1973-01-19,29.142
+1973-01-20,29.197
+1973-01-21,29.215
+1973-01-22,29.218
+1973-01-23,29.279
+1973-01-24,29.337
+1973-01-25,29.352
+1973-01-26,29.361
+1973-01-27,29.367
+1973-01-28,29.355
+1973-01-29,29.34
+1973-01-30,29.34
+1973-01-31,29.337
+1973-02-01,29.328
+1973-02-02,29.343
+1973-02-03,29.38
+1973-02-04,29.395
+1973-02-05,29.401
+1973-02-06,29.416
+1973-02-07,29.422
+1973-02-08,29.425
+1973-02-09,29.422
+1973-02-10,29.425
+1973-02-11,29.468
+1973-02-12,29.431
+1973-02-13,29.428
+1973-02-14,29.428
+1973-02-15,29.425
+1973-02-16,29.395
+1973-02-17,29.355
+1973-02-18,29.34
+1973-02-19,29.303
+1973-02-20,29.31
+1973-02-21,29.31
+1973-02-22,29.279
+1973-02-23,29.307
+1973-02-24,29.279
+1973-02-25,29.233
+1973-02-26,29.212
+1973-02-27,29.194
+1973-02-28,29.179
+1973-03-01,29.16
+1973-03-02,29.136
+1973-03-03,29.139
+1973-03-04,29.127
+1973-03-05,29.118
+1973-03-06,29.142
+1973-03-07,29.185
+1973-03-08,29.215
+1973-03-09,29.267
+1973-03-10,29.343
+1973-03-11,29.404
+1973-03-12,29.435
+1973-03-13,29.502
+1973-03-14,29.578
+1973-03-15,29.733
+1973-03-16,29.639
+1973-03-17,29.684
+1973-03-18,29.889
+1973-03-19,29.876
+1973-03-20,29.889
+1973-03-21,29.916
+1973-03-22,29.947
+1973-03-23,29.883
+1973-03-24,29.889
+1973-03-25,29.922
+1973-03-26,29.867
+1973-03-27,29.779
+1973-03-28,29.855
+1973-03-29,29.971
+1973-03-30,29.828
+1973-03-31,29.773
+1973-04-01,29.773
+1973-04-02,29.803
+1973-04-03,29.895
+1973-04-04,29.91
+1973-04-05,29.95
+1973-04-06,29.992
+1973-04-07,29.998
+1973-04-08,29.974
+1973-04-09,29.986
+1973-04-10,29.986
+1973-04-11,29.98
+1973-04-12,29.968
+1973-04-13,29.947
+1973-04-14,29.919
+1973-04-15,29.913
+1973-04-16,29.901
+1973-04-17,29.898
+1973-04-18,29.849
+1973-04-19,29.84
+1973-04-20,29.837
+1973-04-21,29.825
+1973-04-22,29.77
+1973-04-23,29.755
+1973-04-24,29.755
+1973-04-25,29.776
+1973-04-26,29.721
+1973-04-27,29.733
+1973-04-28,29.721
+1973-04-29,29.715
+1973-04-30,29.706
+1973-05-01,29.828
+1973-05-02,29.797
+1973-05-03,29.752
+1973-05-04,29.688
+1973-05-05,29.666
+1973-05-06,29.636
+1973-05-07,29.605
+1973-05-08,29.602
+1973-05-09,29.654
+1973-05-10,29.605
+1973-05-11,29.593
+1973-05-12,29.593
+1973-05-13,29.575
+1973-05-14,29.563
+1973-05-15,29.541
+1973-05-16,29.532
+1973-05-17,29.526
+1973-05-18,29.495
+1973-05-19,29.569
+1973-05-20,29.514
+1973-05-21,29.544
+1973-05-22,29.587
+1973-05-23,29.672
+1973-05-24,29.688
+1973-05-25,29.709
+1973-05-26,29.697
+1973-05-27,29.672
+1973-05-28,29.684
+1973-05-29,29.684
+1973-05-30,29.694
+1973-05-31,29.688
+1973-06-01,29.697
+1973-06-02,29.666
+1973-06-03,29.666
+1973-06-04,29.66
+1973-06-05,29.657
+1973-06-06,29.666
+1973-06-07,29.675
+1973-06-08,29.642
+1973-06-09,29.636
+1973-06-10,29.575
+1973-06-11,29.578
+1973-06-12,29.563
+1973-06-13,29.553
+1973-06-14,29.544
+1973-06-15,29.556
+1973-06-16,29.553
+1973-06-17,29.569
+1973-06-18,29.617
+1973-06-19,29.605
+1973-06-20,29.593
+1973-06-21,29.611
+1973-06-22,29.584
+1973-06-23,29.578
+1973-06-24,29.587
+1973-06-25,29.593
+1973-06-26,29.575
+1973-06-27,29.581
+1973-06-28,29.584
+1973-06-29,29.572
+1973-06-30,29.599
+1973-07-01,29.599
+1973-07-02,29.602
+1973-07-03,29.694
+1973-07-04,29.684
+1973-07-05,29.669
+1973-07-06,29.654
+1973-07-07,29.645
+1973-07-08,29.614
+1973-07-09,29.593
+1973-07-10,29.593
+1973-07-11,29.569
+1973-07-12,29.523
+1973-07-13,29.575
+1973-07-14,29.563
+1973-07-15,29.514
+1973-07-16,29.495
+1973-07-17,29.489
+1973-07-18,29.471
+1973-07-19,29.453
+1973-07-20,29.422
+1973-07-21,29.404
+1973-07-22,29.38
+1973-07-23,29.358
+1973-07-24,29.364
+1973-07-25,29.358
+1973-07-26,29.349
+1973-07-27,29.371
+1973-07-28,29.352
+1973-07-29,29.319
+1973-07-30,29.303
+1973-07-31,29.279
+1973-08-01,29.276
+1973-08-02,29.313
+1973-08-03,29.246
+1973-08-04,29.227
+1973-08-05,29.224
+1973-08-06,29.224
+1973-08-07,29.252
+1973-08-08,29.239
+1973-08-09,29.227
+1973-08-10,29.209
+1973-08-11,29.194
+1973-08-12,29.175
+1973-08-13,29.142
+1973-08-14,29.136
+1973-08-15,29.13
+1973-08-16,29.087
+1973-08-17,29.105
+1973-08-18,29.081
+1973-08-19,29.057
+1973-08-20,29.057
+1973-08-21,29.054
+1973-08-22,29.087
+1973-08-23,29.02
+1973-08-24,28.986
+1973-08-25,29.017
+1973-08-26,28.986
+1973-08-27,29.014
+1973-08-28,28.956
+1973-08-29,28.962
+1973-08-30,28.956
+1973-08-31,28.953
+1973-09-01,28.944
+1973-09-02,28.929
+1973-09-03,28.919
+1973-09-04,28.901
+1973-09-05,28.913
+1973-09-06,28.962
+1973-09-07,28.895
+1973-09-08,28.892
+1973-09-09,28.865
+1973-09-10,28.868
+1973-09-11,28.871
+1973-09-12,28.858
+1973-09-13,28.84
+1973-09-14,28.831
+1973-09-15,28.84
+1973-09-16,28.822
+1973-09-17,28.828
+1973-09-18,28.892
+1973-09-19,28.913
+1973-09-20,28.926
+1973-09-21,28.862
+1973-09-22,28.904
+1973-09-23,28.831
+1973-09-24,28.889
+1973-09-25,28.892
+1973-09-26,28.895
+1973-09-27,28.944
+1973-09-28,28.898
+1973-09-29,28.913
+1973-09-30,28.877
+1973-10-01,28.889
+1973-10-02,28.895
+1973-10-03,28.871
+1973-10-04,28.944
+1973-10-05,28.935
+1973-10-06,28.874
+1973-10-07,28.889
+1973-10-08,28.904
+1973-10-09,28.901
+1973-10-10,28.858
+1973-10-11,28.892
+1973-10-12,28.919
+1973-10-13,28.913
+1973-10-14,28.904
+1973-10-15,28.901
+1973-10-16,28.871
+1973-10-17,28.874
+1973-10-18,28.843
+1973-10-19,28.843
+1973-10-20,28.828
+1973-10-21,28.834
+1973-10-22,28.822
+1973-10-23,28.804
+1973-10-24,28.791
+1973-10-25,28.788
+1973-10-26,28.819
+1973-10-27,28.764
+1973-10-28,28.749
+1973-10-29,28.77
+1973-10-30,28.609
+1973-10-31,28.749
+1973-11-01,28.776
+1973-11-02,28.779
+1973-11-03,28.755
+1973-11-04,28.761
+1973-11-05,28.77
+1973-11-06,28.752
+1973-11-07,28.749
+1973-11-08,28.776
+1973-11-09,28.733
+1973-11-10,28.746
+1973-11-11,28.749
+1973-11-12,28.776
+1973-11-13,28.733
+1973-11-14,28.749
+1973-11-15,28.703
+1973-11-16,28.621
+1973-11-17,28.77
+1973-11-18,28.758
+1973-11-19,28.755
+1973-11-20,28.758
+1973-11-21,28.761
+1973-11-22,28.773
+1973-11-23,28.779
+1973-11-24,28.761
+1973-11-25,28.703
+1973-11-26,28.752
+1973-11-27,28.785
+1973-11-28,28.776
+1973-11-29,28.773
+1973-11-30,28.779
+1973-12-01,28.785
+1973-12-02,28.813
+1973-12-03,29.02
+1973-12-04,28.791
+1973-12-05,28.788
+1973-12-06,28.852
+1973-12-07,28.819
+1973-12-08,28.871
+1973-12-09,28.837
+1973-12-10,28.904
+1973-12-11,28.904
+1973-12-12,28.889
+1973-12-13,28.944
+1973-12-14,28.974
+1973-12-15,28.926
+1973-12-16,28.922
+1973-12-17,28.877
+1973-12-18,28.956
+1973-12-19,28.956
+1973-12-20,28.956
+1973-12-21,28.968
+1973-12-22,29.057
+1973-12-23,29.142
+1973-12-24,29.185
+1973-12-25,29.27
+1973-12-26,29.282
+1973-12-27,29.331
+1973-12-28,29.337
+1973-12-29,29.419
+1973-12-30,29.428
+1973-12-31,29.453
+1974-01-01,29.474
+1974-01-02,29.483
+1974-01-03,29.492
+1974-01-04,29.52
+1974-01-05,29.486
+1974-01-06,29.505
+1974-01-07,29.523
+1974-01-08,29.419
+1974-01-09,29.422
+1974-01-10,29.453
+1974-01-11,29.483
+1974-01-12,29.486
+1974-01-13,29.462
+1974-01-14,29.453
+1974-01-15,29.538
+1974-01-16,29.508
+1974-01-17,29.508
+1974-01-18,29.514
+1974-01-19,29.486
+1974-01-20,29.483
+1974-01-21,29.459
+1974-01-22,29.41
+1974-01-23,29.392
+1974-01-24,29.355
+1974-01-25,29.349
+1974-01-26,29.34
+1974-01-27,29.416
+1974-01-28,29.416
+1974-01-29,29.428
+1974-01-30,29.431
+1974-01-31,29.544
+1974-02-01,29.413
+1974-02-02,29.313
+1974-02-03,29.395
+1974-02-04,29.401
+1974-02-05,29.38
+1974-02-06,29.386
+1974-02-07,29.331
+1974-02-08,29.334
+1974-02-09,29.31
+1974-02-10,29.27
+1974-02-11,29.276
+1974-02-12,29.273
+1974-02-13,29.291
+1974-02-14,29.279
+1974-02-15,29.218
+1974-02-16,29.194
+1974-02-17,29.169
+1974-02-18,29.179
+1974-02-19,29.163
+1974-02-20,29.148
+1974-02-21,29.142
+1974-02-22,29.239
+1974-02-23,29.233
+1974-02-24,29.203
+1974-02-25,29.172
+1974-02-26,29.188
+1974-02-27,29.203
+1974-02-28,29.239
+1974-03-01,29.172
+1974-03-02,29.203
+1974-03-03,29.386
+1974-03-04,29.249
+1974-03-05,29.294
+1974-03-06,29.371
+1974-03-07,29.431
+1974-03-08,29.355
+1974-03-09,29.447
+1974-03-10,29.447
+1974-03-11,29.419
+1974-03-12,29.404
+1974-03-13,29.386
+1974-03-14,29.352
+1974-03-15,29.377
+1974-03-16,29.377
+1974-03-17,29.499
+1974-03-18,29.392
+1974-03-19,29.431
+1974-03-20,29.371
+1974-03-21,29.371
+1974-03-22,29.392
+1974-03-23,29.355
+1974-03-24,29.319
+1974-03-25,29.413
+1974-03-26,29.392
+1974-03-27,29.392
+1974-03-28,29.273
+1974-03-29,29.279
+1974-03-30,29.258
+1974-03-31,29.243
+1974-04-01,29.233
+1974-04-02,29.279
+1974-04-03,29.285
+1974-04-04,29.392
+1974-04-05,29.502
+1974-04-06,29.645
+1974-04-07,29.614
+1974-04-08,29.584
+1974-04-09,29.584
+1974-04-10,29.578
+1974-04-11,29.645
+1974-04-12,29.651
+1974-04-13,29.684
+1974-04-14,29.694
+1974-04-15,29.773
+1974-04-16,29.767
+1974-04-17,29.8
+1974-04-18,29.819
+1974-04-19,29.77
+1974-04-20,29.797
+1974-04-21,29.806
+1974-04-22,29.806
+1974-04-23,29.822
+1974-04-24,29.727
+1974-04-25,29.861
+1974-04-26,29.867
+1974-04-27,29.889
+1974-04-28,29.934
+1974-04-29,29.88
+1974-04-30,29.889
+1974-05-01,29.922
+1974-05-02,29.892
+1974-05-03,29.919
+1974-05-04,29.889
+1974-05-05,29.892
+1974-05-06,29.895
+1974-05-07,29.928
+1974-05-08,29.895
+1974-05-09,29.864
+1974-05-10,29.898
+1974-05-11,29.864
+1974-05-12,29.934
+1974-05-13,29.889
+1974-05-14,29.895
+1974-05-15,29.986
+1974-05-16,29.889
+1974-05-17,29.88
+1974-05-18,29.806
+1974-05-19,29.794
+1974-05-20,29.8
+1974-05-21,29.797
+1974-05-22,29.773
+1974-05-23,29.736
+1974-05-24,29.77
+1974-05-25,29.767
+1974-05-26,29.776
+1974-05-27,29.773
+1974-05-28,29.764
+1974-05-29,29.77
+1974-05-30,29.745
+1974-05-31,29.739
+1974-06-01,29.694
+1974-06-02,29.675
+1974-06-03,29.681
+1974-06-04,29.666
+1974-06-05,29.614
+1974-06-06,29.575
+1974-06-07,29.614
+1974-06-08,29.575
+1974-06-09,29.553
+1974-06-10,29.544
+1974-06-11,29.462
+1974-06-12,29.456
+1974-06-13,29.483
+1974-06-14,29.425
+1974-06-15,29.422
+1974-06-16,29.383
+1974-06-17,29.346
+1974-06-18,29.346
+1974-06-19,29.34
+1974-06-20,29.34
+1974-06-21,29.331
+1974-06-22,29.3
+1974-06-23,29.276
+1974-06-24,29.252
+1974-06-25,29.239
+1974-06-26,29.209
+1974-06-27,29.209
+1974-06-28,29.243
+1974-06-29,29.209
+1974-06-30,29.227
+1974-07-01,29.206
+1974-07-02,29.218
+1974-07-03,29.194
+1974-07-04,29.185
+1974-07-05,29.163
+1974-07-06,29.157
+1974-07-07,29.157
+1974-07-08,29.151
+1974-07-09,29.157
+1974-07-10,29.157
+1974-07-11,29.145
+1974-07-12,29.151
+1974-07-13,29.188
+1974-07-14,29.172
+1974-07-15,29.151
+1974-07-16,29.145
+1974-07-17,29.145
+1974-07-18,29.145
+1974-07-19,29.121
+1974-07-20,29.118
+1974-07-21,29.087
+1974-07-22,29.118
+1974-07-23,29.121
+1974-07-24,29.072
+1974-07-25,29.066
+1974-07-26,29.063
+1974-07-27,29.066
+1974-07-28,29.066
+1974-07-29,29.066
+1974-07-30,29.072
+1974-07-31,29.069
+1974-08-01,29.066
+1974-08-02,29.06
+1974-08-03,29.054
+1974-08-04,29.063
+1974-08-05,29.066
+1974-08-06,29.035
+1974-08-07,29.041
+1974-08-08,29.035
+1974-08-09,29.011
+1974-08-10,28.98
+1974-08-11,29.02
+1974-08-12,29.005
+1974-08-13,29.005
+1974-08-14,28.95
+1974-08-15,28.944
+1974-08-16,28.935
+1974-08-17,28.95
+1974-08-18,28.95
+1974-08-19,28.95
+1974-08-20,28.95
+1974-08-21,28.95
+1974-08-22,28.965
+1974-08-23,28.95
+1974-08-24,28.941
+1974-08-25,28.932
+1974-08-26,28.919
+1974-08-27,28.996
+1974-08-28,28.874
+1974-08-29,28.852
+1974-08-30,28.858
+1974-08-31,28.858
+1974-09-01,28.852
+1974-09-02,28.822
+1974-09-03,28.95
+1974-09-04,28.95
+1974-09-05,28.761
+1974-09-06,28.767
+1974-09-07,28.767
+1974-09-08,28.828
+1974-09-09,28.822
+1974-09-10,28.752
+1974-09-11,28.816
+1974-09-12,28.822
+1974-09-13,28.767
+1974-09-14,28.761
+1974-09-15,28.898
+1974-09-16,28.755
+1974-09-17,28.767
+1974-09-18,28.694
+1974-09-19,28.755
+1974-09-20,28.828
+1974-09-21,28.743
+1974-09-22,28.776
+1974-09-23,28.743
+1974-09-24,28.767
+1974-09-25,28.852
+1974-09-26,28.798
+1974-09-27,28.822
+1974-09-28,28.816
+1974-09-29,28.837
+1974-09-30,28.816
+1974-10-01,28.767
+1974-10-02,28.73
+1974-10-03,28.737
+1974-10-04,28.761
+1974-10-05,28.767
+1974-10-06,28.767
+1974-10-07,28.767
+1974-10-08,28.755
+1974-10-09,28.737
+1974-10-10,28.767
+1974-10-11,28.73
+1974-10-12,28.816
+1974-10-13,28.819
+1974-10-14,28.822
+1974-10-15,28.7
+1974-10-16,28.691
+1974-10-17,28.73
+1974-10-18,28.691
+1974-10-19,28.7
+1974-10-20,28.673
+1974-10-21,28.645
+1974-10-22,28.761
+1974-10-23,28.669
+1974-10-24,28.663
+1974-10-25,28.676
+1974-10-26,28.663
+1974-10-27,28.669
+1974-10-28,28.676
+1974-10-29,28.7
+1974-10-30,28.645
+1974-10-31,28.651
+1974-11-01,28.712
+1974-11-02,28.645
+1974-11-03,28.654
+1974-11-04,28.663
+1974-11-05,28.651
+1974-11-06,28.639
+1974-11-07,28.645
+1974-11-08,28.645
+1974-11-09,28.639
+1974-11-10,28.642
+1974-11-11,28.645
+1974-11-12,28.712
+1974-11-13,28.669
+1974-11-14,28.7
+1974-11-15,28.676
+1974-11-16,28.712
+1974-11-17,28.721
+1974-11-18,28.73
+1974-11-19,28.712
+1974-11-20,28.7
+1974-11-21,28.645
+1974-11-22,28.669
+1974-11-23,28.712
+1974-11-24,28.764
+1974-11-25,28.816
+1974-11-26,28.761
+1974-11-27,28.883
+1974-11-28,28.919
+1974-11-29,28.913
+1974-11-30,28.919
+1974-12-01,28.916
+1974-12-02,28.913
+1974-12-03,28.822
+1974-12-04,28.816
+1974-12-05,28.883
+1974-12-06,28.874
+1974-12-07,28.816
+1974-12-08,28.877
+1974-12-09,28.938
+1974-12-10,28.999
+1974-12-11,28.938
+1974-12-12,29.041
+1974-12-13,29.029
+1974-12-14,29.035
+1974-12-15,29.047
+1974-12-16,29.06
+1974-12-17,29.066
+1974-12-18,29.041
+1974-12-19,29.047
+1974-12-20,29.041
+1974-12-21,29.041
+1974-12-22,29.029
+1974-12-23,29.017
+1974-12-24,29.005
+1974-12-25,28.977
+1974-12-26,28.95
+1974-12-27,29.017
+1974-12-28,28.926
+1974-12-29,28.932
+1974-12-30,28.938
+1974-12-31,28.944
+1975-01-01,28.913
+1975-01-02,28.889
+1975-01-03,28.938
+1975-01-04,28.904
+1975-01-05,28.862
+1975-01-06,28.858
+1975-01-07,28.849
+1975-01-08,28.84
+1975-01-09,28.849
+1975-01-10,28.874
+1975-01-11,28.959
+1975-01-12,28.956
+1975-01-13,28.944
+1975-01-14,28.941
+1975-01-15,28.932
+1975-01-16,28.938
+1975-01-17,28.95
+1975-01-18,28.974
+1975-01-19,28.974
+1975-01-20,28.974
+1975-01-21,28.95
+1975-01-22,28.938
+1975-01-23,28.883
+1975-01-24,28.855
+1975-01-25,28.846
+1975-01-26,28.88
+1975-01-27,28.892
+1975-01-28,28.865
+1975-01-29,28.871
+1975-01-30,28.877
+1975-01-31,28.904
+1975-02-01,28.892
+1975-02-02,28.904
+1975-02-03,28.916
+1975-02-04,28.901
+1975-02-05,28.883
+1975-02-06,28.877
+1975-02-07,28.846
+1975-02-08,28.883
+1975-02-09,28.865
+1975-02-10,28.846
+1975-02-11,28.828
+1975-02-12,28.822
+1975-02-13,28.828
+1975-02-14,28.822
+1975-02-15,28.825
+1975-02-16,28.791
+1975-02-17,28.758
+1975-02-18,28.758
+1975-02-19,28.752
+1975-02-20,28.758
+1975-02-21,28.752
+1975-02-22,28.749
+1975-02-23,28.749
+1975-02-24,28.727
+1975-02-25,28.755
+1975-02-26,28.84
+1975-02-27,28.871
+1975-02-28,28.877
+1975-03-01,28.871
+1975-03-02,28.889
+1975-03-03,28.907
+1975-03-04,28.895
+1975-03-05,28.926
+1975-03-06,28.901
+1975-03-07,28.892
+1975-03-08,28.901
+1975-03-09,28.901
+1975-03-10,28.901
+1975-03-11,28.877
+1975-03-12,28.877
+1975-03-13,28.871
+1975-03-14,28.874
+1975-03-15,28.88
+1975-03-16,28.889
+1975-03-17,28.898
+1975-03-18,28.91
+1975-03-19,28.941
+1975-03-20,28.941
+1975-03-21,28.904
+1975-03-22,29.111
+1975-03-23,29.13
+1975-03-24,29.148
+1975-03-25,29.246
+1975-03-26,29.246
+1975-03-27,29.215
+1975-03-28,29.249
+1975-03-29,29.313
+1975-03-30,29.291
+1975-03-31,29.27
+1975-04-01,29.227
+1975-04-02,29.215
+1975-04-03,29.246
+1975-04-04,29.151
+1975-04-05,29.194
+1975-04-06,29.236
+1975-04-07,29.282
+1975-04-08,29.267
+1975-04-09,29.264
+1975-04-10,29.267
+1975-04-11,29.264
+1975-04-12,29.267
+1975-04-13,29.267
+1975-04-14,29.267
+1975-04-15,29.3
+1975-04-16,29.319
+1975-04-17,29.31
+1975-04-18,29.352
+1975-04-19,29.55
+1975-04-20,29.517
+1975-04-21,29.483
+1975-04-22,29.581
+1975-04-23,29.617
+1975-04-24,29.666
+1975-04-25,29.651
+1975-04-26,29.666
+1975-04-27,29.654
+1975-04-28,29.691
+1975-04-29,29.712
+1975-04-30,29.681
+1975-05-01,29.703
+1975-05-02,29.703
+1975-05-03,29.703
+1975-05-04,29.706
+1975-05-05,29.691
+1975-05-06,29.645
+1975-05-07,29.648
+1975-05-08,29.669
+1975-05-09,29.66
+1975-05-10,29.651
+1975-05-11,29.651
+1975-05-12,29.633
+1975-05-13,29.614
+1975-05-14,29.587
+1975-05-15,29.581
+1975-05-16,29.56
+1975-05-17,29.538
+1975-05-18,29.566
+1975-05-19,29.514
+1975-05-20,29.492
+1975-05-21,29.462
+1975-05-22,29.447
+1975-05-23,29.425
+1975-05-24,29.358
+1975-05-25,29.374
+1975-05-26,29.413
+1975-05-27,29.331
+1975-05-28,29.288
+1975-05-29,29.273
+1975-05-30,29.322
+1975-05-31,29.303
+1975-06-01,29.239
+1975-06-02,29.215
+1975-06-03,29.215
+1975-06-04,29.185
+1975-06-05,29.185
+1975-06-06,29.252
+1975-06-07,29.179
+1975-06-08,29.179
+1975-06-09,29.179
+1975-06-10,29.179
+1975-06-11,29.154
+1975-06-12,29.179
+1975-06-13,29.185
+1975-06-14,29.13
+1975-06-15,29.23
+1975-06-16,29.331
+1975-06-17,29.124
+1975-06-18,29.185
+1975-06-19,29.118
+1975-06-20,29.032
+1975-06-21,29.032
+1975-06-22,29.032
+1975-06-23,29.032
+1975-06-24,29.026
+1975-06-25,28.971
+1975-06-26,28.947
+1975-06-27,28.941
+1975-06-28,28.941
+1975-06-29,28.929
+1975-06-30,28.916
+1975-07-01,28.904
+1975-07-02,28.892
+1975-07-03,28.88
+1975-07-04,28.88
+1975-07-05,28.849
+1975-07-06,28.862
+1975-07-07,28.874
+1975-07-08,28.874
+1975-07-09,28.843
+1975-07-10,28.819
+1975-07-11,28.825
+1975-07-12,28.801
+1975-07-13,28.81
+1975-07-14,28.819
+1975-07-15,28.794
+1975-07-16,28.794
+1975-07-17,28.794
+1975-07-18,28.794
+1975-07-19,28.801
+1975-07-20,28.798
+1975-07-21,28.794
+1975-07-22,28.752
+1975-07-23,28.764
+1975-07-24,28.752
+1975-07-25,28.813
+1975-07-26,28.819
+1975-07-27,28.764
+1975-07-28,28.709
+1975-07-29,28.703
+1975-07-30,28.733
+1975-07-31,28.718
+1975-08-01,28.718
+1975-08-02,28.706
+1975-08-03,28.703
+1975-08-04,28.727
+1975-08-05,28.679
+1975-08-06,28.615
+1975-08-07,28.599
+1975-08-08,28.624
+1975-08-09,28.679
+1975-08-10,28.679
+1975-08-11,28.679
+1975-08-12,28.663
+1975-08-13,28.666
+1975-08-14,28.673
+1975-08-15,28.633
+1975-08-16,28.645
+1975-08-17,28.666
+1975-08-18,28.676
+1975-08-19,28.615
+1975-08-20,28.59
+1975-08-21,28.593
+1975-08-22,28.599
+1975-08-23,28.584
+1975-08-24,28.609
+1975-08-25,28.599
+1975-08-26,28.66
+1975-08-27,28.612
+1975-08-28,28.587
+1975-08-29,28.581
+1975-08-30,28.569
+1975-08-31,28.59
+1975-09-01,28.612
+1975-09-02,28.673
+1975-09-03,28.581
+1975-09-04,28.581
+1975-09-05,28.587
+1975-09-06,28.581
+1975-09-07,28.578
+1975-09-08,28.599
+1975-09-09,28.587
+1975-09-10,28.581
+1975-09-11,28.66
+1975-09-12,28.764
+1975-09-13,28.581
+1975-09-14,28.624
+1975-09-15,28.666
+1975-09-16,28.673
+1975-09-17,28.612
+1975-09-18,28.612
+1975-09-19,28.676
+1975-09-20,28.666
+1975-09-21,28.669
+1975-09-22,28.673
+1975-09-23,28.673
+1975-09-24,28.636
+1975-09-25,28.605
+1975-09-26,28.697
+1975-09-27,28.703
+1975-09-28,28.752
+1975-09-29,28.798
+1975-09-30,28.846
+1975-10-01,28.877
+1975-10-02,28.807
+1975-10-03,28.868
+1975-10-04,28.807
+1975-10-05,28.84
+1975-10-06,28.855
+1975-10-07,28.77
+1975-10-08,28.782
+1975-10-09,28.77
+1975-10-10,28.779
+1975-10-11,28.822
+1975-10-12,28.727
+1975-10-13,28.788
+1975-10-14,28.801
+1975-10-15,28.785
+1975-10-16,28.822
+1975-10-17,28.816
+1975-10-18,28.788
+1975-10-19,28.88
+1975-10-20,28.986
+1975-10-21,29.057
+1975-10-22,29.057
+1975-10-23,29.069
+1975-10-24,29.145
+1975-10-25,29.157
+1975-10-26,29.078
+1975-10-27,29.111
+1975-10-28,29.13
+1975-10-29,29.075
+1975-10-30,28.98
+1975-10-31,29.054
+1975-11-01,29.172
+1975-11-02,29.063
+1975-11-03,29.06
+1975-11-04,29.057
+1975-11-05,29.026
+1975-11-06,29.05
+1975-11-07,29.063
+1975-11-08,29.069
+1975-11-09,29.029
+1975-11-10,29.054
+1975-11-11,29.072
+1975-11-12,29.078
+1975-11-13,29.078
+1975-11-14,29.041
+1975-11-15,29.157
+1975-11-16,29.172
+1975-11-17,29.185
+1975-11-18,29.169
+1975-11-19,29.157
+1975-11-20,29.157
+1975-11-21,29.185
+1975-11-22,29.215
+1975-11-23,29.23
+1975-11-24,29.218
+1975-11-25,29.194
+1975-11-26,29.221
+1975-11-27,29.239
+1975-11-28,29.246
+1975-11-29,29.23
+1975-11-30,29.471
+1975-12-01,29.322
+1975-12-02,29.243
+1975-12-03,29.224
+1975-12-04,29.218
+1975-12-05,29.303
+1975-12-06,29.255
+1975-12-07,29.148
+1975-12-08,29.2
+1975-12-09,29.191
+1975-12-10,29.209
+1975-12-11,29.221
+1975-12-12,29.206
+1975-12-13,29.215
+1975-12-14,29.389
+1975-12-15,29.273
+1975-12-16,29.151
+1975-12-17,29.243
+1975-12-18,29.191
+1975-12-19,29.124
+1975-12-20,29.124
+1975-12-21,29.111
+1975-12-22,29.099
+1975-12-23,29.148
+1975-12-24,29.105
+1975-12-25,29.102
+1975-12-26,29.099
+1975-12-27,29.087
+1975-12-28,29.09
+1975-12-29,29.093
+1975-12-30,29.099
+1975-12-31,29.044
+1976-01-01,29.038
+1976-01-02,29.032
+1976-01-03,29.038
+1976-01-04,29.038
+1976-01-05,29.038
+1976-01-06,29.087
+1976-01-07,29.032
+1976-01-08,29.002
+1976-01-09,29.032
+1976-01-10,28.977
+1976-01-11,28.974
+1976-01-12,28.968
+1976-01-13,28.999
+1976-01-14,28.971
+1976-01-15,28.965
+1976-01-16,28.965
+1976-01-17,28.971
+1976-01-18,29.002
+1976-01-19,29.032
+1976-01-20,29.002
+1976-01-21,28.996
+1976-01-22,28.971
+1976-01-23,28.974
+1976-01-24,28.938
+1976-01-25,29.02
+1976-01-26,29.105
+1976-01-27,29.121
+1976-01-28,29.121
+1976-01-29,29.121
+1976-01-30,29.029
+1976-01-31,29.069
+1976-02-01,29.105
+1976-02-02,29.111
+1976-02-03,29.121
+1976-02-04,29.099
+1976-02-05,29.148
+1976-02-06,29.139
+1976-02-07,29.133
+1976-02-08,29.133
+1976-02-09,29.121
+1976-02-10,29.136
+1976-02-11,29.114
+1976-02-12,29.111
+1976-02-13,29.136
+1976-02-14,29.096
+1976-02-15,29.142
+1976-02-16,29.096
+1976-02-17,29.09
+1976-02-18,29.108
+1976-02-19,29.142
+1976-02-20,29.136
+1976-02-21,29.16
+1976-02-22,29.163
+1976-02-23,29.188
+1976-02-24,29.233
+1976-02-25,29.243
+1976-02-26,29.267
+1976-02-27,29.313
+1976-02-28,29.319
+1976-02-29,29.395
+1976-03-01,29.364
+1976-03-02,29.374
+1976-03-03,29.438
+1976-03-04,29.447
+1976-03-05,29.483
+1976-03-06,29.544
+1976-03-07,29.602
+1976-03-08,29.611
+1976-03-09,29.611
+1976-03-10,29.617
+1976-03-11,29.648
+1976-03-12,29.611
+1976-03-13,29.666
+1976-03-14,29.654
+1976-03-15,29.642
+1976-03-16,29.581
+1976-03-17,29.578
+1976-03-18,29.575
+1976-03-19,29.575
+1976-03-20,29.569
+1976-03-21,29.688
+1976-03-22,29.688
+1976-03-23,29.812
+1976-03-24,29.852
+1976-03-25,29.889
+1976-03-26,29.867
+1976-03-27,29.947
+1976-03-28,29.983
+1976-03-29,29.986
+1976-03-30,30.029
+1976-03-31,30.099
+1976-04-01,30.145
+1976-04-02,30.197
+1976-04-03,30.23
+1976-04-04,30.257
+1976-04-05,30.264
+1976-04-06,30.279
+1976-04-07,30.254
+1976-04-08,30.233
+1976-04-09,30.224
+1976-04-10,30.206
+1976-04-11,30.114
+1976-04-12,30.084
+1976-04-13,30.117
+1976-04-14,30.09
+1976-04-15,30.087
+1976-04-16,30.038
+1976-04-17,30.011
+1976-04-18,30.005
+1976-04-19,29.992
+1976-04-20,29.953
+1976-04-21,29.919
+1976-04-22,29.962
+1976-04-23,29.889
+1976-04-24,29.837
+1976-04-25,29.779
+1976-04-26,29.745
+1976-04-27,29.767
+1976-04-28,29.791
+1976-04-29,29.788
+1976-04-30,29.77
+1976-05-01,29.767
+1976-05-02,29.767
+1976-05-03,29.782
+1976-05-04,29.773
+1976-05-05,29.837
+1976-05-06,29.742
+1976-05-07,29.688
+1976-05-08,29.739
+1976-05-09,29.736
+1976-05-10,29.727
+1976-05-11,29.748
+1976-05-12,29.736
+1976-05-13,29.758
+1976-05-14,29.761
+1976-05-15,29.718
+1976-05-16,29.736
+1976-05-17,29.752
+1976-05-18,29.675
+1976-05-19,29.694
+1976-05-20,29.745
+1976-05-21,29.794
+1976-05-22,29.809
+1976-05-23,29.816
+1976-05-24,29.809
+1976-05-25,29.812
+1976-05-26,29.809
+1976-05-27,29.803
+1976-05-28,29.785
+1976-05-29,29.779
+1976-05-30,29.748
+1976-05-31,29.721
+1976-06-01,29.642
+1976-06-02,29.672
+1976-06-03,29.675
+1976-06-04,29.639
+1976-06-05,29.63
+1976-06-06,29.611
+1976-06-07,29.602
+1976-06-08,29.566
+1976-06-09,29.526
+1976-06-10,29.535
+1976-06-11,29.502
+1976-06-12,29.41
+1976-06-13,29.499
+1976-06-14,29.508
+1976-06-15,29.428
+1976-06-16,29.398
+1976-06-17,29.349
+1976-06-18,29.322
+1976-06-19,29.325
+1976-06-20,29.282
+1976-06-21,29.261
+1976-06-22,29.264
+1976-06-23,29.249
+1976-06-24,29.233
+1976-06-25,29.224
+1976-06-26,29.233
+1976-06-27,29.209
+1976-06-28,29.239
+1976-06-29,29.203
+1976-06-30,29.182
+1976-07-01,29.215
+1976-07-02,29.215
+1976-07-03,29.215
+1976-07-04,29.197
+1976-07-05,29.206
+1976-07-06,29.203
+1976-07-07,29.194
+1976-07-08,29.188
+1976-07-09,29.163
+1976-07-10,29.172
+1976-07-11,29.185
+1976-07-12,29.179
+1976-07-13,29.166
+1976-07-14,29.148
+1976-07-15,29.166
+1976-07-16,29.194
+1976-07-17,29.185
+1976-07-18,29.182
+1976-07-19,29.179
+1976-07-20,29.179
+1976-07-21,29.142
+1976-07-22,29.133
+1976-07-23,29.172
+1976-07-24,29.145
+1976-07-25,29.102
+1976-07-26,29.13
+1976-07-27,29.142
+1976-07-28,29.114
+1976-07-29,29.124
+1976-07-30,29.121
+1976-07-31,29.108
+1976-08-01,29.096
+1976-08-02,29.124
+1976-08-03,29.169
+1976-08-04,29.188
+1976-08-05,29.185
+1976-08-06,29.142
+1976-08-07,29.136
+1976-08-08,29.16
+1976-08-09,29.154
+1976-08-10,29.102
+1976-08-11,29.212
+1976-08-12,29.282
+1976-08-13,29.307
+1976-08-14,29.313
+1976-08-15,29.349
+1976-08-16,29.401
+1976-08-17,29.374
+1976-08-18,29.367
+1976-08-19,29.389
+1976-08-20,29.389
+1976-08-21,29.398
+1976-08-22,29.383
+1976-08-23,29.346
+1976-08-24,29.34
+1976-08-25,29.352
+1976-08-26,29.337
+1976-08-27,29.337
+1976-08-28,29.346
+1976-08-29,29.319
+1976-08-30,29.276
+1976-08-31,29.273
+1976-09-01,29.297
+1976-09-02,29.239
+1976-09-03,29.255
+1976-09-04,29.3
+1976-09-05,29.239
+1976-09-06,29.191
+1976-09-07,29.185
+1976-09-08,29.163
+1976-09-09,29.169
+1976-09-10,29.188
+1976-09-11,29.191
+1976-09-12,29.157
+1976-09-13,29.172
+1976-09-14,29.172
+1976-09-15,29.139
+1976-09-16,29.118
+1976-09-17,29.114
+1976-09-18,29.105
+1976-09-19,29.09
+1976-09-20,29.072
+1976-09-21,29.075
+1976-09-22,29.078
+1976-09-23,29.133
+1976-09-24,29.05
+1976-09-25,29.035
+1976-09-26,29.038
+1976-09-27,29.038
+1976-09-28,29.047
+1976-09-29,29.136
+1976-09-30,29.066
+1976-10-01,29.069
+1976-10-02,29.075
+1976-10-03,29.05
+1976-10-04,29.035
+1976-10-05,29.063
+1976-10-06,29.072
+1976-10-07,29.032
+1976-10-08,28.98
+1976-10-09,29.005
+1976-10-10,29.166
+1976-10-11,29.142
+1976-10-12,29.172
+1976-10-13,29.273
+1976-10-14,29.194
+1976-10-15,29.215
+1976-10-16,29.206
+1976-10-17,29.188
+1976-10-18,29.172
+1976-10-19,29.172
+1976-10-20,29.172
+1976-10-21,29.154
+1976-10-22,29.307
+1976-10-23,29.282
+1976-10-24,29.252
+1976-10-25,29.221
+1976-10-26,29.233
+1976-10-27,29.261
+1976-10-28,29.291
+1976-10-29,29.322
+1976-10-30,29.291
+1976-10-31,29.261
+1976-11-01,29.276
+1976-11-02,29.27
+1976-11-03,29.276
+1976-11-04,29.303
+1976-11-05,29.267
+1976-11-06,29.294
+1976-11-07,29.297
+1976-11-08,29.297
+1976-11-09,29.3
+1976-11-10,29.276
+1976-11-11,29.273
+1976-11-12,29.291
+1976-11-13,29.276
+1976-11-14,29.258
+1976-11-15,29.239
+1976-11-16,29.239
+1976-11-17,29.258
+1976-11-18,29.227
+1976-11-19,29.212
+1976-11-20,29.154
+1976-11-21,29.175
+1976-11-22,29.175
+1976-11-23,29.154
+1976-11-24,29.136
+1976-11-25,29.136
+1976-11-26,29.185
+1976-11-27,29.163
+1976-11-28,29.099
+1976-11-29,29.096
+1976-11-30,29.16
+1976-12-01,29.218
+1976-12-02,29.066
+1976-12-03,29.044
+1976-12-04,29.014
+1976-12-05,29.002
+1976-12-06,29.017
+1976-12-07,29.014
+1976-12-08,29.014
+1976-12-09,29.032
+1976-12-10,29.02
+1976-12-11,29.023
+1976-12-12,29.005
+1976-12-13,29.063
+1976-12-14,29.02
+1976-12-15,28.98
+1976-12-16,28.98
+1976-12-17,28.983
+1976-12-18,28.983
+1976-12-19,28.965
+1976-12-20,28.965
+1976-12-21,28.965
+1976-12-22,28.953
+1976-12-23,28.922
+1976-12-24,28.929
+1976-12-25,28.938
+1976-12-26,28.922
+1976-12-27,28.947
+1976-12-28,28.929
+1976-12-29,28.895
+1976-12-30,28.913
+1976-12-31,28.926
+1977-01-01,28.932
+1977-01-02,28.901
+1977-01-03,28.862
+1977-01-04,28.858
+1977-01-05,28.846
+1977-01-06,28.852
+1977-01-07,28.843
+1977-01-08,28.849
+1977-01-09,28.877
+1977-01-10,28.88
+1977-01-11,28.929
+1977-01-12,28.947
+1977-01-13,28.947
+1977-01-14,28.922
+1977-01-15,28.922
+1977-01-16,28.895
+1977-01-17,28.895
+1977-01-18,28.913
+1977-01-19,28.916
+1977-01-20,28.907
+1977-01-21,28.895
+1977-01-22,28.883
+1977-01-23,28.886
+1977-01-24,28.868
+1977-01-25,28.849
+1977-01-26,28.834
+1977-01-27,28.822
+1977-01-28,28.825
+1977-01-29,28.846
+1977-01-30,28.862
+1977-01-31,28.871
+1977-02-01,28.862
+1977-02-02,28.877
+1977-02-03,28.849
+1977-02-04,28.831
+1977-02-05,28.807
+1977-02-06,28.81
+1977-02-07,28.816
+1977-02-08,28.813
+1977-02-09,28.801
+1977-02-10,28.791
+1977-02-11,28.791
+1977-02-12,28.785
+1977-02-13,28.782
+1977-02-14,28.785
+1977-02-15,28.77
+1977-02-16,28.758
+1977-02-17,28.761
+1977-02-18,28.758
+1977-02-19,28.752
+1977-02-20,28.737
+1977-02-21,28.743
+1977-02-22,28.755
+1977-02-23,28.724
+1977-02-24,28.718
+1977-02-25,28.73
+1977-02-26,28.74
+1977-02-27,28.743
+1977-02-28,28.746
+1977-03-01,28.74
+1977-03-02,28.749
+1977-03-03,28.74
+1977-03-04,28.733
+1977-03-05,28.761
+1977-03-06,28.767
+1977-03-07,28.761
+1977-03-08,28.77
+1977-03-09,28.801
+1977-03-10,28.828
+1977-03-11,28.889
+1977-03-12,28.971
+1977-03-13,29.066
+1977-03-14,29.221
+1977-03-15,29.404
+1977-03-16,29.569
+1977-03-17,29.62
+1977-03-18,29.651
+1977-03-19,29.672
+1977-03-20,29.709
+1977-03-21,29.715
+1977-03-22,29.681
+1977-03-23,29.63
+1977-03-24,29.694
+1977-03-25,29.694
+1977-03-26,29.672
+1977-03-27,29.675
+1977-03-28,29.678
+1977-03-29,29.712
+1977-03-30,29.73
+1977-03-31,29.782
+1977-04-01,29.822
+1977-04-02,29.913
+1977-04-03,29.989
+1977-04-04,29.904
+1977-04-05,29.983
+1977-04-06,29.98
+1977-04-07,29.928
+1977-04-08,29.953
+1977-04-09,29.895
+1977-04-10,29.876
+1977-04-11,29.931
+1977-04-12,29.861
+1977-04-13,29.84
+1977-04-14,29.806
+1977-04-15,29.834
+1977-04-16,29.837
+1977-04-17,29.837
+1977-04-18,29.822
+1977-04-19,29.806
+1977-04-20,29.834
+1977-04-21,29.8
+1977-04-22,29.745
+1977-04-23,29.703
+1977-04-24,29.758
+1977-04-25,29.803
+1977-04-26,29.867
+1977-04-27,29.898
+1977-04-28,29.904
+1977-04-29,29.858
+1977-04-30,29.852
+1977-05-01,29.876
+1977-05-02,29.843
+1977-05-03,29.776
+1977-05-04,29.782
+1977-05-05,29.776
+1977-05-06,29.779
+1977-05-07,29.688
+1977-05-08,29.666
+1977-05-09,29.553
+1977-05-10,29.563
+1977-05-11,29.611
+1977-05-12,29.62
+1977-05-13,29.532
+1977-05-14,29.511
+1977-05-15,29.529
+1977-05-16,29.535
+1977-05-17,29.511
+1977-05-18,29.459
+1977-05-19,29.444
+1977-05-20,29.428
+1977-05-21,29.413
+1977-05-22,29.398
+1977-05-23,29.371
+1977-05-24,29.346
+1977-05-25,29.288
+1977-05-26,29.261
+1977-05-27,29.255
+1977-05-28,29.185
+1977-05-29,29.206
+1977-05-30,29.209
+1977-05-31,29.194
+1977-06-01,29.239
+1977-06-02,29.16
+1977-06-03,29.108
+1977-06-04,29.102
+1977-06-05,29.075
+1977-06-06,29.054
+1977-06-07,29.057
+1977-06-08,29.072
+1977-06-09,29.038
+1977-06-10,28.974
+1977-06-11,28.956
+1977-06-12,28.993
+1977-06-13,28.986
+1977-06-14,28.993
+1977-06-15,28.974
+1977-06-16,28.977
+1977-06-17,28.996
+1977-06-18,28.926
+1977-06-19,28.935
+1977-06-20,28.892
+1977-06-21,28.877
+1977-06-22,28.913
+1977-06-23,28.91
+1977-06-24,28.907
+1977-06-25,28.919
+1977-06-26,28.877
+1977-06-27,28.883
+1977-06-28,28.898
+1977-06-29,28.916
+1977-06-30,28.858
+1977-07-01,28.877
+1977-07-02,28.831
+1977-07-03,28.81
+1977-07-04,28.816
+1977-07-05,28.779
+1977-07-06,28.773
+1977-07-07,28.755
+1977-07-08,28.782
+1977-07-09,28.733
+1977-07-10,28.73
+1977-07-11,28.752
+1977-07-12,28.794
+1977-07-13,28.764
+1977-07-14,28.712
+1977-07-15,28.724
+1977-07-16,28.697
+1977-07-17,28.703
+1977-07-18,28.685
+1977-07-19,28.703
+1977-07-20,28.703
+1977-07-21,28.66
+1977-07-22,28.59
+1977-07-23,28.639
+1977-07-24,28.66
+1977-07-25,28.666
+1977-07-26,28.599
+1977-07-27,28.593
+1977-07-28,28.63
+1977-07-29,28.688
+1977-07-30,28.639
+1977-07-31,28.605
+1977-08-01,28.639
+1977-08-02,28.615
+1977-08-03,28.621
+1977-08-04,28.63
+1977-08-05,28.609
+1977-08-06,28.596
+1977-08-07,28.59
+1977-08-08,28.593
+1977-08-09,28.569
+1977-08-10,28.605
+1977-08-11,28.593
+1977-08-12,28.599
+1977-08-13,28.612
+1977-08-14,28.59
+1977-08-15,28.569
+1977-08-16,28.581
+1977-08-17,28.593
+1977-08-18,28.624
+1977-08-19,28.639
+1977-08-20,28.651
+1977-08-21,28.66
+1977-08-22,28.715
+1977-08-23,28.691
+1977-08-24,28.654
+1977-08-25,28.642
+1977-08-26,28.663
+1977-08-27,28.712
+1977-08-28,28.706
+1977-08-29,28.697
+1977-08-30,28.633
+1977-08-31,28.669
+1977-09-01,28.737
+1977-09-02,28.657
+1977-09-03,28.666
+1977-09-04,28.679
+1977-09-05,28.709
+1977-09-06,28.685
+1977-09-07,28.685
+1977-09-08,28.685
+1977-09-09,28.788
+1977-09-10,28.822
+1977-09-11,28.676
+1977-09-12,28.691
+1977-09-13,28.712
+1977-09-14,28.688
+1977-09-15,28.706
+1977-09-16,28.746
+1977-09-17,28.737
+1977-09-18,28.718
+1977-09-19,28.682
+1977-09-20,28.666
+1977-09-21,28.74
+1977-09-22,28.746
+1977-09-23,28.758
+1977-09-24,28.773
+1977-09-25,28.816
+1977-09-26,28.849
+1977-09-27,28.865
+1977-09-28,28.871
+1977-09-29,28.901
+1977-09-30,28.922
+1977-10-01,28.91
+1977-10-02,29.002
+1977-10-03,29.069
+1977-10-04,29.136
+1977-10-05,29.188
+1977-10-06,29.203
+1977-10-07,29.179
+1977-10-08,29.212
+1977-10-09,29.252
+1977-10-10,29.236
+1977-10-11,29.258
+1977-10-12,29.282
+1977-10-13,29.249
+1977-10-14,29.239
+1977-10-15,29.261
+1977-10-16,29.297
+1977-10-17,29.227
+1977-10-18,29.502
+1977-10-19,29.569
+1977-10-20,29.578
+1977-10-21,29.63
+1977-10-22,29.624
+1977-10-23,29.608
+1977-10-24,29.642
+1977-10-25,29.63
+1977-10-26,29.648
+1977-10-27,29.599
+1977-10-28,29.569
+1977-10-29,29.56
+1977-10-30,29.547
+1977-10-31,29.541
+1977-11-01,29.547
+1977-11-02,29.541
+1977-11-03,29.529
+1977-11-04,29.514
+1977-11-05,29.441
+1977-11-06,29.462
+1977-11-07,29.441
+1977-11-08,29.477
+1977-11-09,29.45
+1977-11-10,29.468
+1977-11-11,29.505
+1977-11-12,29.529
+1977-11-13,29.435
+1977-11-14,29.471
+1977-11-15,29.517
+1977-11-16,29.52
+1977-11-17,29.477
+1977-11-18,29.477
+1977-11-19,29.471
+1977-11-20,29.471
+1977-11-21,29.62
+1977-11-22,29.456
+1977-11-23,29.444
+1977-11-24,29.514
+1977-11-25,29.431
+1977-11-26,29.444
+1977-11-27,29.48
+1977-11-28,29.435
+1977-11-29,29.431
+1977-11-30,29.428
+1977-12-01,29.486
+1977-12-02,29.508
+1977-12-03,29.489
+1977-12-04,29.465
+1977-12-05,29.441
+1977-12-06,29.374
+1977-12-07,29.435
+1977-12-08,29.459
+1977-12-09,29.52
+1977-12-10,29.334
+1977-12-11,29.288
+1977-12-12,29.346
+1977-12-13,29.34
+1977-12-14,29.358
+1977-12-15,29.297
+1977-12-16,29.313
+1977-12-17,29.319
+1977-12-18,29.364
+1977-12-19,29.328
+1977-12-20,29.328
+1977-12-21,29.319
+1977-12-22,29.349
+1977-12-23,29.41
+1977-12-24,29.389
+1977-12-25,29.349
+1977-12-26,29.343
+1977-12-27,29.343
+1977-12-28,29.337
+1977-12-29,29.319
+1977-12-30,29.291
+1977-12-31,29.264
+1978-01-01,29.285
+1978-01-02,29.261
+1978-01-03,29.252
+1978-01-04,29.288
+1978-01-05,29.221
+1978-01-06,29.191
+1978-01-07,29.182
+1978-01-08,29.188
+1978-01-09,29.163
+1978-01-10,29.218
+1978-01-11,29.355
+1978-01-12,29.346
+1978-01-13,29.395
+1978-01-14,29.334
+1978-01-15,29.316
+1978-01-16,29.431
+1978-01-17,29.447
+1978-01-18,29.316
+1978-01-19,29.355
+1978-01-20,29.371
+1978-01-21,29.386
+1978-01-22,29.386
+1978-01-23,29.383
+1978-01-24,29.364
+1978-01-25,29.325
+1978-01-26,29.294
+1978-01-27,29.34
+1978-01-28,29.34
+1978-01-29,29.401
+1978-01-30,29.401
+1978-01-31,29.416
+1978-02-01,29.383
+1978-02-02,29.361
+1978-02-03,29.352
+1978-02-04,29.383
+1978-02-05,29.328
+1978-02-06,29.352
+1978-02-07,29.294
+1978-02-08,29.322
+1978-02-09,29.325
+1978-02-10,29.3
+1978-02-11,29.282
+1978-02-12,29.246
+1978-02-13,29.215
+1978-02-14,29.236
+1978-02-15,29.209
+1978-02-16,29.2
+1978-02-17,29.185
+1978-02-18,29.179
+1978-02-19,29.179
+1978-02-20,29.179
+1978-02-21,29.139
+1978-02-22,29.169
+1978-02-23,29.136
+1978-02-24,29.114
+1978-02-25,29.09
+1978-02-26,29.096
+1978-02-27,29.084
+1978-02-28,29.075
+1978-03-01,29.054
+1978-03-02,29.066
+1978-03-03,29.041
+1978-03-04,29.029
+1978-03-05,29.044
+1978-03-06,29.06
+1978-03-07,29.054
+1978-03-08,29.014
+1978-03-09,28.968
+1978-03-10,28.968
+1978-03-11,28.956
+1978-03-12,28.956
+1978-03-13,28.95
+1978-03-14,29.017
+1978-03-15,28.983
+1978-03-16,29.096
+1978-03-17,29.197
+1978-03-18,29.307
+1978-03-19,29.13
+1978-03-20,28.968
+1978-03-21,29.066
+1978-03-22,29.023
+1978-03-23,29.02
+1978-03-24,29.029
+1978-03-25,29.054
+1978-03-26,29.072
+1978-03-27,29.09
+1978-03-28,29.151
+1978-03-29,29.212
+1978-03-30,29.273
+1978-03-31,29.325
+1978-04-01,29.398
+1978-04-02,29.401
+1978-04-03,29.45
+1978-04-04,29.517
+1978-04-05,29.544
+1978-04-06,29.581
+1978-04-07,29.627
+1978-04-08,29.642
+1978-04-09,29.654
+1978-04-10,29.654
+1978-04-11,29.703
+1978-04-12,29.748
+1978-04-13,29.806
+1978-04-14,29.864
+1978-04-15,29.895
+1978-04-16,29.913
+1978-04-17,29.925
+1978-04-18,29.931
+1978-04-19,29.944
+1978-04-20,29.953
+1978-04-21,29.995
+1978-04-22,30.001
+1978-04-23,30.017
+1978-04-24,30.035
+1978-04-25,30.035
+1978-04-26,30.035
+1978-04-27,30.035
+1978-04-28,30.02
+1978-04-29,30.047
+1978-04-30,30.035
+1978-05-01,30.059
+1978-05-02,30.05
+1978-05-03,30.053
+1978-05-04,29.998
+1978-05-05,29.959
+1978-05-06,29.974
+1978-05-07,29.95
+1978-05-08,29.925
+1978-05-09,30.05
+1978-05-10,29.913
+1978-05-11,29.898
+1978-05-12,29.901
+1978-05-13,29.895
+1978-05-14,29.855
+1978-05-15,29.816
+1978-05-16,29.803
+1978-05-17,29.803
+1978-05-18,29.803
+1978-05-19,29.812
+1978-05-20,29.788
+1978-05-21,29.745
+1978-05-22,29.742
+1978-05-23,29.733
+1978-05-24,29.715
+1978-05-25,29.694
+1978-05-26,29.66
+1978-05-27,29.648
+1978-05-28,29.624
+1978-05-29,29.593
+1978-05-30,29.566
+1978-05-31,29.55
+1978-06-01,29.502
+1978-06-02,29.523
+1978-06-03,29.474
+1978-06-04,29.444
+1978-06-05,29.462
+1978-06-06,29.401
+1978-06-07,29.401
+1978-06-08,29.407
+1978-06-09,29.355
+1978-06-10,29.334
+1978-06-11,29.331
+1978-06-12,29.389
+1978-06-13,29.328
+1978-06-14,29.297
+1978-06-15,29.297
+1978-06-16,29.282
+1978-06-17,29.313
+1978-06-18,29.313
+1978-06-19,29.179
+1978-06-20,29.224
+1978-06-21,29.227
+1978-06-22,29.264
+1978-06-23,29.276
+1978-06-24,29.255
+1978-06-25,29.27
+1978-06-26,29.282
+1978-06-27,29.276
+1978-06-28,29.23
+1978-06-29,29.221
+1978-06-30,29.185
+1978-07-01,29.166
+1978-07-02,29.175
+1978-07-03,29.172
+1978-07-04,29.166
+1978-07-05,29.16
+1978-07-06,29.151
+1978-07-07,29.142
+1978-07-08,29.121
+1978-07-09,29.087
+1978-07-10,29.075
+1978-07-11,29.026
+1978-07-12,29.02
+1978-07-13,29.032
+1978-07-14,29.011
+1978-07-15,28.999
+1978-07-16,28.974
+1978-07-17,28.947
+1978-07-18,28.938
+1978-07-19,28.95
+1978-07-20,28.953
+1978-07-21,28.941
+1978-07-22,28.916
+1978-07-23,28.922
+1978-07-24,28.865
+1978-07-25,28.895
+1978-07-26,28.929
+1978-07-27,28.944
+1978-07-28,28.862
+1978-07-29,28.84
+1978-07-30,28.791
+1978-07-31,28.828
+1978-08-01,28.868
+1978-08-02,28.837
+1978-08-03,28.834
+1978-08-04,28.791
+1978-08-05,28.801
+1978-08-06,28.804
+1978-08-07,28.779
+1978-08-08,28.782
+1978-08-09,28.804
+1978-08-10,28.755
+1978-08-11,28.758
+1978-08-12,28.776
+1978-08-13,28.77
+1978-08-14,28.755
+1978-08-15,28.758
+1978-08-16,28.746
+1978-08-17,28.761
+1978-08-18,28.706
+1978-08-19,28.706
+1978-08-20,28.712
+1978-08-21,28.676
+1978-08-22,28.682
+1978-08-23,28.688
+1978-08-24,28.651
+1978-08-25,28.642
+1978-08-26,28.642
+1978-08-27,28.639
+1978-08-28,28.639
+1978-08-29,28.694
+1978-08-30,28.645
+1978-08-31,28.633
+1978-09-01,28.602
+1978-09-02,28.633
+1978-09-03,28.605
+1978-09-04,28.578
+1978-09-05,28.593
+1978-09-06,28.59
+1978-09-07,28.487
+1978-09-08,28.587
+1978-09-09,28.505
+1978-09-10,28.557
+1978-09-11,28.609
+1978-09-12,28.526
+1978-09-13,28.545
+1978-09-14,28.56
+1978-09-15,28.578
+1978-09-16,28.602
+1978-09-17,28.569
+1978-09-18,28.535
+1978-09-19,28.523
+1978-09-20,28.541
+1978-09-21,28.615
+1978-09-22,28.52
+1978-09-23,28.532
+1978-09-24,28.532
+1978-09-25,28.532
+1978-09-26,28.517
+1978-09-27,28.639
+1978-09-28,28.587
+1978-09-29,28.505
+1978-09-30,28.532
+1978-10-01,28.505
+1978-10-02,28.474
+1978-10-03,28.435
+1978-10-04,28.578
+1978-10-05,28.508
+1978-10-06,28.496
+1978-10-07,28.523
+1978-10-08,28.477
+1978-10-09,28.487
+1978-10-10,28.532
+1978-10-11,28.413
+1978-10-12,28.593
+1978-10-13,28.471
+1978-10-14,28.42
+1978-10-15,28.514
+1978-10-16,28.529
+1978-10-17,28.532
+1978-10-18,28.557
+1978-10-19,28.548
+1978-10-20,28.529
+1978-10-21,28.59
+1978-10-22,28.566
+1978-10-23,28.535
+1978-10-24,28.496
+1978-10-25,28.526
+1978-10-26,28.596
+1978-10-27,28.596
+1978-10-28,28.618
+1978-10-29,28.505
+1978-10-30,28.511
+1978-10-31,28.627
+1978-11-01,28.499
+1978-11-02,28.627
+1978-11-03,28.505
+1978-11-04,28.596
+1978-11-05,28.496
+1978-11-06,28.596
+1978-11-07,28.511
+1978-11-08,28.496
+1978-11-09,28.596
+1978-11-10,28.468
+1978-11-11,28.602
+1978-11-12,28.557
+1978-11-13,28.499
+1978-11-14,28.587
+1978-11-15,28.496
+1978-11-16,28.484
+1978-11-17,28.502
+1978-11-18,28.605
+1978-11-19,28.529
+1978-11-20,28.465
+1978-11-21,28.477
+1978-11-22,28.484
+1978-11-23,28.502
+1978-11-24,28.727
+1978-11-25,28.462
+1978-11-26,28.566
+1978-11-27,28.398
+1978-11-28,28.444
+1978-11-29,28.417
+1978-11-30,28.49
+1978-12-01,28.429
+1978-12-02,28.438
+1978-12-03,28.337
+1978-12-04,28.511
+1978-12-05,28.337
+1978-12-06,28.453
+1978-12-07,28.444
+1978-12-08,28.471
+1978-12-09,28.432
+1978-12-10,28.444
+1978-12-11,28.444
+1978-12-12,28.407
+1978-12-13,28.383
+1978-12-14,28.474
+1978-12-15,28.432
+1978-12-16,28.481
+1978-12-17,28.444
+1978-12-18,28.477
+1978-12-19,28.505
+1978-12-20,28.38
+1978-12-21,28.505
+1978-12-22,28.417
+1978-12-23,28.383
+1978-12-24,28.374
+1978-12-25,28.368
+1978-12-26,28.362
+1978-12-27,28.331
+1978-12-28,28.334
+1978-12-29,28.34
+1978-12-30,28.334
+1978-12-31,28.349
+1979-01-01,28.441
+1979-01-02,28.493
+1979-01-03,28.621
+1979-01-04,28.673
+1979-01-05,28.709
+1979-01-06,28.728
+1979-01-07,28.719
+1979-01-08,28.639
+1979-01-09,28.7
+1979-01-10,28.725
+1979-01-11,28.734
+1979-01-12,28.749
+1979-01-13,28.764
+1979-01-14,28.78
+1979-01-15,28.795
+1979-01-16,28.81
+1979-01-17,28.804
+1979-01-18,28.819
+1979-01-19,28.825
+1979-01-20,28.868
+1979-01-21,28.836
+1979-01-22,28.826
+1979-01-23,28.821
+1979-01-24,28.796
+1979-01-25,28.788
+1979-01-26,28.816
+1979-01-27,28.823
+1979-01-28,28.827
+1979-01-29,28.84
+1979-01-30,28.848
+1979-01-31,28.844
+1979-02-01,28.843
+1979-02-02,28.846
+1979-02-03,28.849
+1979-02-04,28.86
+1979-02-05,28.843
+1979-02-06,28.876
+1979-02-07,28.888
+1979-02-08,28.863
+1979-02-09,28.848
+1979-02-10,28.902
+1979-02-11,28.936
+1979-02-12,28.908
+1979-02-13,28.876
+1979-02-14,28.921
+1979-02-15,28.919
+1979-02-16,28.887
+1979-02-17,28.915
+1979-02-18,28.9
+1979-02-19,28.845
+1979-02-20,28.83
+1979-02-21,28.815
+1979-02-22,28.804
+1979-02-23,28.792
+1979-02-24,28.797
+1979-02-25,28.757
+1979-02-26,28.751
+1979-02-27,28.77
+1979-02-28,28.792
+1979-03-01,28.785
+1979-03-02,28.784
+1979-03-03,28.809
+1979-03-04,28.844
+1979-03-05,28.93
+1979-03-06,29.048
+1979-03-07,29.187
+1979-03-08,29.301
+1979-03-09,29.377
+1979-03-10,29.46
+1979-03-11,29.48
+1979-03-12,29.495
+1979-03-13,29.566
+1979-03-14,29.602
+1979-03-15,29.52
+1979-03-16,29.524
+1979-03-17,29.522
+1979-03-18,29.503
+1979-03-19,29.508
+1979-03-20,29.507
+1979-03-21,29.52
+1979-03-22,29.542
+1979-03-23,29.56
+1979-03-24,29.625
+1979-03-25,29.624
+1979-03-26,29.685
+1979-03-27,29.755
+1979-03-28,29.752
+1979-03-29,29.889
+1979-03-30,29.709
+1979-03-31,29.761
+1979-04-01,29.715
+1979-04-02,29.807
+1979-04-03,29.929
+1979-04-04,29.852
+1979-04-05,29.912
+1979-04-06,29.927
+1979-04-07,29.835
+1979-04-08,29.856
+1979-04-09,29.843
+1979-04-10,29.803
+1979-04-11,29.812
+1979-04-12,29.796
+1979-04-13,29.799
+1979-04-14,29.825
+1979-04-15,29.787
+1979-04-16,29.761
+1979-04-17,29.766
+1979-04-18,29.739
+1979-04-19,29.728
+1979-04-20,29.758
+1979-04-21,29.767
+1979-04-22,29.751
+1979-04-23,29.717
+1979-04-24,29.695
+1979-04-25,29.73
+1979-04-26,29.775
+1979-04-27,29.713
+1979-04-28,29.714
+1979-04-29,29.757
+1979-04-30,29.755
+1979-05-01,29.751
+1979-05-02,29.73
+1979-05-03,29.731
+1979-05-04,29.715
+1979-05-05,29.685
+1979-05-06,29.691
+1979-05-07,29.677
+1979-05-08,29.678
+1979-05-09,29.671
+1979-05-10,29.617
+1979-05-11,29.608
+1979-05-12,29.651
+1979-05-13,29.586
+1979-05-14,29.533
+1979-05-15,29.528
+1979-05-16,29.478
+1979-05-17,29.452
+1979-05-18,29.443
+1979-05-19,29.43
+1979-05-20,29.42
+1979-05-21,29.401
+1979-05-22,29.33
+1979-05-23,29.309
+1979-05-24,29.243
+1979-05-25,29.187
+1979-05-26,29.255
+1979-05-27,29.338
+1979-05-28,29.314
+1979-05-29,29.323
+1979-05-30,29.335
+1979-05-31,29.35
+1979-06-01,29.353
+1979-06-02,29.361
+1979-06-03,29.364
+1979-06-04,29.359
+1979-06-05,29.351
+1979-06-06,29.306
+1979-06-07,29.322
+1979-06-08,29.355
+1979-06-09,29.296
+1979-06-10,29.308
+1979-06-11,29.298
+1979-06-12,29.201
+1979-06-13,29.182
+1979-06-14,29.205
+1979-06-15,29.221
+1979-06-16,29.185
+1979-06-17,29.17
+1979-06-18,29.08
+1979-06-19,29.091
+1979-06-20,29.094
+1979-06-21,29.11
+1979-06-22,29.11
+1979-06-23,29.055
+1979-06-24,29.015
+1979-06-25,28.957
+1979-06-26,29.009
+1979-06-27,29.054
+1979-06-28,28.981
+1979-06-29,28.968
+1979-06-30,28.949
+1979-07-01,28.918
+1979-07-02,28.884
+1979-07-03,28.855
+1979-07-04,28.877
+1979-07-05,28.872
+1979-07-06,28.872
+1979-07-07,28.879
+1979-07-08,28.895
+1979-07-09,28.875
+1979-07-10,28.845
+1979-07-11,28.842
+1979-07-12,28.827
+1979-07-13,28.817
+1979-07-14,28.809
+1979-07-15,28.84
+1979-07-16,28.83
+1979-07-17,28.75
+1979-07-18,28.769
+1979-07-19,28.785
+1979-07-20,28.785
+1979-07-21,28.771
+1979-07-22,28.778
+1979-07-23,28.742
+1979-07-24,28.755
+1979-07-25,28.762
+1979-07-26,28.779
+1979-07-27,28.716
+1979-07-28,28.727
+1979-07-29,28.711
+1979-07-30,28.709
+1979-07-31,28.74
+1979-08-01,28.699
+1979-08-02,28.73
+1979-08-03,28.724
+1979-08-04,28.709
+1979-08-05,28.711
+1979-08-06,28.675
+1979-08-07,28.696
+1979-08-08,28.683
+1979-08-09,28.66
+1979-08-10,28.668
+1979-08-11,28.658
+1979-08-12,28.621
+1979-08-13,28.632
+1979-08-14,28.683
+1979-08-15,28.636
+1979-08-16,28.61
+1979-08-17,28.633
+1979-08-18,28.664
+1979-08-19,28.639
+1979-08-20,28.606
+1979-08-21,28.611
+1979-08-22,28.605
+1979-08-23,28.646
+1979-08-24,28.679
+1979-08-25,28.674
+1979-08-26,28.639
+1979-08-27,28.635
+1979-08-28,28.658
+1979-08-29,28.688
+1979-08-30,28.656
+1979-08-31,28.614
+1979-09-01,28.661
+1979-09-02,28.721
+1979-09-03,28.663
+1979-09-04,28.625
+1979-09-05,28.633
+1979-09-06,28.639
+1979-09-07,28.769
+1979-09-08,28.765
+1979-09-09,28.82
+1979-09-10,28.825
+1979-09-11,28.813
+1979-09-12,28.816
+1979-09-13,28.861
+1979-09-14,28.913
+1979-09-15,28.868
+1979-09-16,28.867
+1979-09-17,28.916
+1979-09-18,28.919
+1979-09-19,28.818
+1979-09-20,28.894
+1979-09-21,28.977
+1979-09-22,28.836
+1979-09-23,28.856
+1979-09-24,28.858
+1979-09-25,28.913
+1979-09-26,28.844
+1979-09-27,28.851
+1979-09-28,28.887
+1979-09-29,28.828
+1979-09-30,28.83
+1979-10-01,28.826
+1979-10-02,28.781
+1979-10-03,28.784
+1979-10-04,28.783
+1979-10-05,28.795
+1979-10-06,28.86
+1979-10-07,28.819
+1979-10-08,28.767
+1979-10-09,28.739
+1979-10-10,28.781
+1979-10-11,28.818
+1979-10-12,28.823
+1979-10-13,28.832
+1979-10-14,28.783
+1979-10-15,28.797
+1979-10-16,28.773
+1979-10-17,28.8
+1979-10-18,28.778
+1979-10-19,28.824
+1979-10-20,28.87
+1979-10-21,28.834
+1979-10-22,28.809
+1979-10-23,28.85
+1979-10-24,28.774
+1979-10-25,28.805
+1979-10-26,28.804
+1979-10-27,28.796
+1979-10-28,28.801
+1979-10-29,28.781
+1979-10-30,28.785
+1979-10-31,28.786
+1979-11-01,28.885
+1979-11-02,28.825
+1979-11-03,28.79
+1979-11-04,28.816
+1979-11-05,28.822
+1979-11-06,28.841
+1979-11-07,28.823
+1979-11-08,28.872
+1979-11-09,28.813
+1979-11-10,28.852
+1979-11-11,28.816
+1979-11-12,28.808
+1979-11-13,28.818
+1979-11-14,28.796
+1979-11-15,28.837
+1979-11-16,28.805
+1979-11-17,28.841
+1979-11-18,28.788
+1979-11-19,28.78
+1979-11-20,28.84
+1979-11-21,28.79
+1979-11-22,28.872
+1979-11-23,28.829
+1979-11-24,28.835
+1979-11-25,28.796
+1979-11-26,28.848
+1979-11-27,28.976
+1979-11-28,29.013
+1979-11-29,29.003
+1979-11-30,29.003
+1979-12-01,29.007
+1979-12-02,28.97
+1979-12-03,29.04
+1979-12-04,29.03
+1979-12-05,29.096
+1979-12-06,29.055
+1979-12-07,28.983
+1979-12-08,28.998
+1979-12-09,29.012
+1979-12-10,28.935
+1979-12-11,29.011
+1979-12-12,28.958
+1979-12-13,28.881
+1979-12-14,28.934
+1979-12-15,29.014
+1979-12-16,29.078
+1979-12-17,28.795
+1979-12-18,28.844
+1979-12-19,28.865
+1979-12-20,28.853
+1979-12-21,28.865
+1979-12-22,28.853
+1979-12-23,28.825
+1979-12-24,28.825
+1979-12-25,28.874
+1979-12-26,28.914
+1979-12-27,28.953
+1979-12-28,28.975
+1979-12-29,28.953
+1979-12-30,28.932
+1979-12-31,28.975
+1980-01-01,28.843
+1980-01-02,28.841
+1980-01-03,28.831
+1980-01-04,28.837
+1980-01-05,28.83
+1980-01-06,28.838
+1980-01-07,28.841
+1980-01-08,28.827
+1980-01-09,28.815
+1980-01-10,28.846
+1980-01-11,28.833
+1980-01-12,28.825
+1980-01-13,28.827
+1980-01-14,28.846
+1980-01-15,28.838
+1980-01-16,28.827
+1980-01-17,28.834
+1980-01-18,28.822
+1980-01-19,28.825
+1980-01-20,28.83
+1980-01-21,28.822
+1980-01-22,28.818
+1980-01-23,28.821
+1980-01-24,28.831
+1980-01-25,28.851
+1980-01-26,28.781
+1980-01-27,28.771
+1980-01-28,28.751
+1980-01-29,28.751
+1980-01-30,28.781
+1980-01-31,28.751
+1980-02-01,28.751
+1980-02-02,28.741
+1980-02-03,28.731
+1980-02-04,28.751
+1980-02-05,28.741
+1980-02-06,28.721
+1980-02-07,28.731
+1980-02-08,28.681
+1980-02-09,28.661
+1980-02-10,28.651
+1980-02-11,28.651
+1980-02-12,28.631
+1980-02-13,28.641
+1980-02-14,28.631
+1980-02-15,28.631
+1980-02-16,28.611
+1980-02-17,28.601
+1980-02-18,28.621
+1980-02-19,28.651
+1980-02-20,28.591
+1980-02-21,28.591
+1980-02-22,28.561
+1980-02-23,28.551
+1980-02-24,28.541
+1980-02-25,28.591
+1980-02-26,28.551
+1980-02-27,28.551
+1980-02-28,28.551
+1980-02-29,28.571
+1980-03-01,28.571
+1980-03-02,28.551
+1980-03-03,28.551
+1980-03-04,28.531
+1980-03-05,28.521
+1980-03-06,28.521
+1980-03-07,28.511
+1980-03-08,28.481
+1980-03-09,28.461
+1980-03-10,28.531
+1980-03-11,28.531
+1980-03-12,28.551
+1980-03-13,28.501
+1980-03-14,28.501
+1980-03-15,28.521
+1980-03-16,28.551
+1980-03-17,28.531
+1980-03-18,28.581
+1980-03-19,28.591
+1980-03-20,28.651
+1980-03-21,28.68
+1980-03-22,28.661
+1980-03-23,28.731
+1980-03-24,28.771
+1980-03-25,28.791
+1980-03-26,28.811
+1980-03-27,28.831
+1980-03-28,28.871
+1980-03-29,28.851
+1980-03-30,28.821
+1980-03-31,28.901
+1980-04-01,28.951
+1980-04-02,28.981
+1980-04-03,28.981
+1980-04-04,28.991
+1980-04-05,28.981
+1980-04-06,28.981
+1980-04-07,29.051
+1980-04-08,29.131
+1980-04-09,29.051
+1980-04-10,29.091
+1980-04-11,29.121
+1980-04-12,29.151
+1980-04-13,29.171
+1980-04-14,29.231
+1980-04-15,29.271
+1980-04-16,29.281
+1980-04-17,29.281
+1980-04-18,29.281
+1980-04-19,29.291
+1980-04-20,29.331
+1980-04-21,29.271
+1980-04-22,29.251
+1980-04-23,29.171
+1980-04-24,29.231
+1980-04-25,29.265
+1980-04-26,29.285
+1980-04-27,29.264
+1980-04-28,29.282
+1980-04-29,29.248
+1980-04-30,29.255
+1980-05-01,29.246
+1980-05-02,29.249
+1980-05-03,29.237
+1980-05-04,29.197
+1980-05-05,29.203
+1980-05-06,29.2
+1980-05-07,29.218
+1980-05-08,29.194
+1980-05-09,29.194
+1980-05-10,29.198
+1980-05-11,29.246
+1980-05-12,29.182
+1980-05-13,29.166
+1980-05-14,29.156
+1980-05-15,29.14
+1980-05-16,29.13
+1980-05-17,29.12
+1980-05-18,29.223
+1980-05-19,29.085
+1980-05-20,29.078
+1980-05-21,29.111
+1980-05-22,29.082
+1980-05-23,29.056
+1980-05-24,29.049
+1980-05-25,28.959
+1980-05-26,29.002
+1980-05-27,28.998
+1980-05-28,28.992
+1980-05-29,28.99
+1980-05-30,29.034
+1980-05-31,29.062
+1980-06-01,28.981
+1980-06-02,28.961
+1980-06-03,28.941
+1980-06-04,28.907
+1980-06-05,28.909
+1980-06-06,28.928
+1980-06-07,28.928
+1980-06-08,28.932
+1980-06-09,28.871
+1980-06-10,28.861
+1980-06-11,28.844
+1980-06-12,28.843
+1980-06-13,28.872
+1980-06-14,28.847
+1980-06-15,28.779
+1980-06-16,28.775
+1980-06-17,28.798
+1980-06-18,28.796
+1980-06-19,28.768
+1980-06-20,28.792
+1980-06-21,28.739
+1980-06-22,28.763
+1980-06-23,28.755
+1980-06-24,28.755
+1980-06-25,28.74
+1980-06-26,28.726
+1980-06-27,28.675
+1980-06-28,28.66
+1980-06-29,28.679
+1980-06-30,28.646
+1980-07-01,28.641
+1980-07-02,28.649
+1980-07-03,28.641
+1980-07-04,28.621
+1980-07-05,28.647
+1980-07-06,28.534
+1980-07-07,28.581
+1980-07-08,28.625
+1980-07-09,28.575
+1980-07-10,28.584
+1980-07-11,28.586
+1980-07-12,28.549
+1980-07-13,28.548
+1980-07-14,28.573
+1980-07-15,28.592
+1980-07-16,28.548
+1980-07-17,28.536
+1980-07-18,28.544
+1980-07-19,28.556
+1980-07-20,28.554
+1980-07-21,28.542
+1980-07-22,28.561
+1980-07-23,28.562
+1980-07-24,28.562
+1980-07-25,28.582
+1980-07-26,28.59
+1980-07-27,28.595
+1980-07-28,28.64
+1980-07-29,28.635
+1980-07-30,28.628
+1980-07-31,28.622
+1980-08-01,28.634
+1980-08-02,28.632
+1980-08-03,28.635
+1980-08-04,28.64
+1980-08-05,28.647
+1980-08-06,28.67
+1980-08-07,28.657
+1980-08-08,28.663
+1980-08-09,28.631
+1980-08-10,28.634
+1980-08-11,28.645
+1980-08-12,28.653
+1980-08-13,28.642
+1980-08-14,28.66
+1980-08-15,28.67
+1980-08-16,28.588
+1980-08-17,28.626
+1980-08-18,28.645
+1980-08-19,28.671
+1980-08-20,28.632
+1980-08-21,28.636
+1980-08-22,28.636
+1980-08-23,28.624
+1980-08-24,28.604
+1980-08-25,28.619
+1980-08-26,28.631
+1980-08-27,28.612
+1980-08-28,28.576
+1980-08-29,28.598
+1980-08-30,28.632
+1980-08-31,28.665
+1980-09-01,28.657
+1980-09-02,28.67
+1980-09-03,28.662
+1980-09-04,28.664
+1980-09-05,28.754
+1980-09-06,28.709
+1980-09-07,28.679
+1980-09-08,28.667
+1980-09-09,28.741
+1980-09-10,28.699
+1980-09-11,28.722
+1980-09-12,28.65
+1980-09-13,28.67
+1980-09-14,28.686
+1980-09-15,28.655
+1980-09-16,28.759
+1980-09-17,28.821
+1980-09-18,28.633
+1980-09-19,28.681
+1980-09-20,28.756
+1980-09-21,28.668
+1980-09-22,28.699
+1980-09-23,28.671
+1980-09-24,28.669
+1980-09-25,28.75
+1980-09-26,28.746
+1980-09-27,28.691
+1980-09-28,28.671
+1980-09-29,28.671
+1980-09-30,28.747
+1980-10-01,28.703
+1980-10-02,28.732
+1980-10-03,28.662
+1980-10-04,28.665
+1980-10-05,28.708
+1980-10-06,28.711
+1980-10-07,28.731
+1980-10-08,28.776
+1980-10-09,28.681
+1980-10-10,28.681
+1980-10-11,28.701
+1980-10-12,28.697
+1980-10-13,28.701
+1980-10-14,28.681
+1980-10-15,28.681
+1980-10-16,28.681
+1980-10-17,28.681
+1980-10-18,28.681
+1980-10-19,28.658
+1980-10-20,28.681
+1980-10-21,28.681
+1980-10-22,28.681
+1980-10-23,28.671
+1980-10-24,28.621
+1980-10-25,28.671
+1980-10-26,28.731
+1980-10-27,28.681
+1980-10-28,28.691
+1980-10-29,28.675
+1980-10-30,28.68
+1980-10-31,28.711
+1980-11-01,28.681
+1980-11-02,28.651
+1980-11-03,28.771
+1980-11-04,28.901
+1980-11-05,28.651
+1980-11-06,28.661
+1980-11-07,28.671
+1980-11-08,28.551
+1980-11-09,28.621
+1980-11-10,28.681
+1980-11-11,28.651
+1980-11-12,28.661
+1980-11-13,28.691
+1980-11-14,28.691
+1980-11-15,28.671
+1980-11-16,28.691
+1980-11-17,28.711
+1980-11-18,28.661
+1980-11-19,28.611
+1980-11-20,28.711
+1980-11-21,28.791
+1980-11-22,28.671
+1980-11-23,28.731
+1980-11-24,28.741
+1980-11-25,28.691
+1980-11-26,28.721
+1980-11-27,28.731
+1980-11-28,28.751
+1980-11-29,28.821
+1980-11-30,28.801
+1980-12-01,28.891
+1980-12-02,28.801
+1980-12-03,28.891
+1980-12-04,28.891
+1980-12-05,28.861
+1980-12-06,28.841
+1980-12-07,28.821
+1980-12-08,28.831
+1980-12-09,28.851
+1980-12-10,28.881
+1980-12-11,28.881
+1980-12-12,28.881
+1980-12-13,28.861
+1980-12-14,28.901
+1980-12-15,28.921
+1980-12-16,28.861
+1980-12-17,28.861
+1980-12-18,29.001
+1980-12-19,28.891
+1980-12-20,28.921
+1980-12-21,28.931
+1980-12-22,28.951
+1980-12-23,28.861
+1980-12-24,28.856
+1980-12-25,28.861
+1980-12-26,28.871
+1980-12-27,28.871
+1980-12-28,28.861
+1980-12-29,28.841
+1980-12-30,28.841
+1980-12-31,28.841
+1981-01-01,28.891
+1981-01-02,28.801
+1981-01-03,28.891
+1981-01-04,28.891
+1981-01-05,28.861
+1981-01-06,28.841
+1981-01-07,28.849
+1981-01-08,28.88
+1981-01-09,28.851
+1981-01-10,28.828
+1981-01-11,28.834
+1981-01-12,28.834
+1981-01-13,28.834
+1981-01-14,28.834
+1981-01-15,28.824
+1981-01-16,28.834
+1981-01-17,28.824
+1981-01-18,28.824
+1981-01-19,28.834
+1981-01-20,28.834
+1981-01-21,28.792
+1981-01-22,28.741
+1981-01-23,28.737
+1981-01-24,28.734
+1981-01-25,28.728
+1981-01-26,28.743
+1981-01-27,28.711
+1981-01-28,28.685
+1981-01-29,28.682
+1981-01-30,28.68
+1981-01-31,28.67
+1981-02-01,28.686
+1981-02-02,28.69
+1981-02-03,28.712
+1981-02-04,28.735
+1981-02-05,28.75
+1981-02-06,28.767
+1981-02-07,28.777
+1981-02-08,28.778
+1981-02-09,28.797
+1981-02-10,28.801
+1981-02-11,28.827
+1981-02-12,28.856
+1981-02-13,28.882
+1981-02-14,28.932
+1981-02-15,28.959
+1981-02-16,29.008
+1981-02-17,28.984
+1981-02-18,28.997
+1981-02-19,29.035
+1981-02-20,29.082
+1981-02-21,29.173
+1981-02-22,29.281
+1981-02-23,29.374
+1981-02-24,29.404
+1981-02-25,29.456
+1981-02-26,29.474
+1981-02-27,29.606
+1981-02-28,29.613
+1981-03-01,29.635
+1981-03-02,29.633
+1981-03-03,29.611
+1981-03-04,29.598
+1981-03-05,29.586
+1981-03-06,29.569
+1981-03-07,29.522
+1981-03-08,29.55
+1981-03-09,29.553
+1981-03-10,29.545
+1981-03-11,29.519
+1981-03-12,29.513
+1981-03-13,29.514
+1981-03-14,29.466
+1981-03-15,29.444
+1981-03-16,29.391
+1981-03-17,29.436
+1981-03-18,29.455
+1981-03-19,29.457
+1981-03-20,29.46
+1981-03-21,29.379
+1981-03-22,29.358
+1981-03-23,29.359
+1981-03-24,29.326
+1981-03-25,29.273
+1981-03-26,29.294
+1981-03-27,29.265
+1981-03-28,29.303
+1981-03-29,29.331
+1981-03-30,29.321
+1981-03-31,29.34
+1981-04-01,29.477
+1981-04-02,29.408
+1981-04-03,29.479
+1981-04-04,29.5
+1981-04-05,29.474
+1981-04-06,29.442
+1981-04-07,29.442
+1981-04-08,29.492
+1981-04-09,29.467
+1981-04-10,29.418
+1981-04-11,29.434
+1981-04-12,29.356
+1981-04-13,29.402
+1981-04-14,29.61
+1981-04-15,29.308
+1981-04-16,29.372
+1981-04-17,29.365
+1981-04-18,29.324
+1981-04-19,29.317
+1981-04-20,29.283
+1981-04-21,29.273
+1981-04-22,29.308
+1981-04-23,29.308
+1981-04-24,29.314
+1981-04-25,29.293
+1981-04-26,29.313
+1981-04-27,29.315
+1981-04-28,29.3
+1981-04-29,29.308
+1981-04-30,29.279
+1981-05-01,29.265
+1981-05-02,29.242
+1981-05-03,29.25
+1981-05-04,29.237
+1981-05-05,29.253
+1981-05-06,29.192
+1981-05-07,29.174
+1981-05-08,29.212
+1981-05-09,29.239
+1981-05-10,29.18
+1981-05-11,29.171
+1981-05-12,29.157
+1981-05-13,29.187
+1981-05-14,29.197
+1981-05-15,29.22
+1981-05-16,29.222
+1981-05-17,29.19
+1981-05-18,29.203
+1981-05-19,29.228
+1981-05-20,29.232
+1981-05-21,29.229
+1981-05-22,29.193
+1981-05-23,29.168
+1981-05-24,29.186
+1981-05-25,29.184
+1981-05-26,29.172
+1981-05-27,29.151
+1981-05-28,29.137
+1981-05-29,29.132
+1981-05-30,29.135
+1981-05-31,29.084
+1981-06-01,29.097
+1981-06-02,29.11
+1981-06-03,29.143
+1981-06-04,29.09
+1981-06-05,29.07
+1981-06-06,29.063
+1981-06-07,29.033
+1981-06-08,29.077
+1981-06-09,29.087
+1981-06-10,29.063
+1981-06-11,29.058
+1981-06-12,29.056
+1981-06-13,29.048
+1981-06-14,29.084
+1981-06-15,29.052
+1981-06-16,29.031
+1981-06-17,28.993
+1981-06-18,28.995
+1981-06-19,29
+1981-06-20,28.921
+1981-06-21,28.933
+1981-06-22,28.952
+1981-06-23,28.913
+1981-06-24,28.92
+1981-06-25,28.959
+1981-06-26,28.912
+1981-06-27,28.903
+1981-06-28,28.911
+1981-06-29,28.924
+1981-06-30,28.925
+1981-07-01,28.852
+1981-07-02,28.87
+1981-07-03,28.908
+1981-07-04,28.887
+1981-07-05,28.852
+1981-07-06,28.839
+1981-07-07,28.824
+1981-07-08,28.841
+1981-07-09,28.822
+1981-07-10,28.805
+1981-07-11,28.783
+1981-07-12,28.783
+1981-07-13,28.788
+1981-07-14,28.747
+1981-07-15,28.761
+1981-07-16,28.775
+1981-07-17,28.782
+1981-07-18,28.776
+1981-07-19,28.743
+1981-07-20,28.748
+1981-07-21,28.751
+1981-07-22,28.711
+1981-07-23,28.701
+1981-07-24,28.711
+1981-07-25,28.739
+1981-07-26,28.713
+1981-07-27,28.636
+1981-07-28,28.67
+1981-07-29,28.652
+1981-07-30,28.692
+1981-07-31,28.723
+1981-08-01,28.745
+1981-08-02,28.752
+1981-08-03,28.741
+1981-08-04,28.759
+1981-08-05,28.724
+1981-08-06,28.668
+1981-08-07,28.687
+1981-08-08,28.7
+1981-08-09,28.737
+1981-08-10,28.742
+1981-08-11,28.735
+1981-08-12,28.747
+1981-08-13,28.738
+1981-08-14,28.745
+1981-08-15,28.762
+1981-08-16,28.797
+1981-08-17,28.857
+1981-08-18,28.887
+1981-08-19,28.913
+1981-08-20,28.928
+1981-08-21,28.963
+1981-08-22,28.97
+1981-08-23,28.987
+1981-08-24,28.988
+1981-08-25,28.927
+1981-08-26,28.936
+1981-08-27,28.954
+1981-08-28,28.939
+1981-08-29,28.927
+1981-08-30,28.963
+1981-08-31,28.942
+1981-09-01,28.927
+1981-09-02,28.933
+1981-09-03,28.902
+1981-09-04,28.887
+1981-09-05,28.857
+1981-09-06,28.818
+1981-09-07,28.842
+1981-09-08,28.831
+1981-09-09,28.785
+1981-09-10,28.824
+1981-09-11,28.844
+1981-09-12,28.856
+1981-09-13,28.876
+1981-09-14,28.874
+1981-09-15,28.855
+1981-09-16,28.846
+1981-09-17,28.844
+1981-09-18,28.845
+1981-09-19,28.837
+1981-09-20,28.839
+1981-09-21,28.837
+1981-09-22,28.791
+1981-09-23,28.696
+1981-09-24,28.786
+1981-09-25,28.981
+1981-09-26,29.027
+1981-09-27,29.105
+1981-09-28,29.061
+1981-09-29,29.041
+1981-09-30,29.038
+1981-10-01,29.064
+1981-10-02,29.073
+1981-10-03,29.071
+1981-10-04,29.105
+1981-10-05,29.122
+1981-10-06,29.132
+1981-10-07,29.133
+1981-10-08,29.1
+1981-10-09,29.127
+1981-10-10,29.137
+1981-10-11,29.146
+1981-10-12,29.156
+1981-10-13,29.168
+1981-10-14,29.165
+1981-10-15,29.185
+1981-10-16,29.134
+1981-10-17,29.132
+1981-10-18,29.202
+1981-10-19,29.012
+1981-10-20,29.055
+1981-10-21,29.016
+1981-10-22,28.981
+1981-10-23,28.992
+1981-10-24,29.007
+1981-10-25,29.052
+1981-10-26,29.045
+1981-10-27,29.163
+1981-10-28,29.278
+1981-10-29,29.379
+1981-10-30,29.381
+1981-10-31,29.457
+1981-11-01,29.549
+1981-11-02,29.593
+1981-11-03,29.453
+1981-11-04,29.453
+1981-11-05,29.471
+1981-11-06,29.473
+1981-11-07,29.475
+1981-11-08,29.425
+1981-11-09,29.426
+1981-11-10,29.435
+1981-11-11,29.455
+1981-11-12,29.413
+1981-11-13,29.415
+1981-11-14,29.34
+1981-11-15,29.335
+1981-11-16,29.335
+1981-11-17,29.353
+1981-11-18,29.325
+1981-11-19,29.353
+1981-11-20,29.349
+1981-11-21,29.382
+1981-11-22,29.408
+1981-11-23,29.396
+1981-11-24,29.391
+1981-11-25,29.363
+1981-11-26,29.366
+1981-11-27,29.441
+1981-11-28,29.368
+1981-11-29,29.329
+1981-11-30,29.336
+1981-12-01,29.374
+1981-12-02,29.37
+1981-12-03,29.311
+1981-12-04,29.313
+1981-12-05,29.27
+1981-12-06,29.179
+1981-12-07,29.266
+1981-12-08,29.249
+1981-12-09,29.225
+1981-12-10,29.232
+1981-12-11,29.216
+1981-12-12,29.201
+1981-12-13,29.211
+1981-12-14,29.215
+1981-12-15,29.178
+1981-12-16,29.127
+1981-12-17,29.159
+1981-12-18,29.133
+1981-12-19,29.127
+1981-12-20,29.077
+1981-12-21,29.158
+1981-12-22,29.114
+1981-12-23,29.051
+1981-12-24,29.061
+1981-12-25,29.06
+1981-12-26,29.035
+1981-12-27,29.039
+1981-12-28,29.03
+1981-12-29,29.021
+1981-12-30,29.032
+1981-12-31,29.019
+1982-01-01,29.062
+1982-01-02,28.993
+1982-01-03,28.985
+1982-01-04,28.999
+1982-01-05,28.995
+1982-01-06,29.045
+1982-01-07,28.994
+1982-01-08,29.044
+1982-01-09,29.048
+1982-01-10,29.062
+1982-01-11,29.128
+1982-01-12,29.124
+1982-01-13,29.142
+1982-01-14,29.074
+1982-01-15,29.031
+1982-01-16,29.067
+1982-01-17,29.093
+1982-01-18,29.156
+1982-01-19,29.032
+1982-01-20,29.009
+1982-01-21,29.013
+1982-01-22,28.995
+1982-01-23,28.991
+1982-01-24,28.974
+1982-01-25,28.983
+1982-01-26,28.993
+1982-01-27,28.977
+1982-01-28,28.958
+1982-01-29,28.94
+1982-01-30,28.932
+1982-01-31,28.896
+1982-02-01,28.913
+1982-02-02,28.915
+1982-02-03,28.901
+1982-02-04,28.902
+1982-02-05,28.907
+1982-02-06,28.911
+1982-02-07,28.936
+1982-02-08,28.925
+1982-02-09,28.919
+1982-02-10,28.926
+1982-02-11,28.94
+1982-02-12,28.929
+1982-02-13,28.921
+1982-02-14,28.919
+1982-02-15,28.934
+1982-02-16,28.893
+1982-02-17,28.893
+1982-02-18,28.899
+1982-02-19,28.917
+1982-02-20,28.887
+1982-02-21,28.862
+1982-02-22,28.864
+1982-02-23,28.883
+1982-02-24,28.861
+1982-02-25,28.883
+1982-02-26,28.9
+1982-02-27,28.862
+1982-02-28,28.842
+1982-03-01,28.85
+1982-03-02,28.845
+1982-03-03,28.827
+1982-03-04,28.823
+1982-03-05,28.825
+1982-03-06,28.809
+1982-03-07,28.804
+1982-03-08,28.819
+1982-03-09,28.798
+1982-03-10,28.805
+1982-03-11,28.847
+1982-03-12,28.797
+1982-03-13,28.858
+1982-03-14,28.842
+1982-03-15,28.847
+1982-03-16,28.872
+1982-03-17,28.893
+1982-03-18,28.921
+1982-03-19,28.936
+1982-03-20,28.96
+1982-03-21,28.996
+1982-03-22,29.033
+1982-03-23,29.062
+1982-03-24,29.11
+1982-03-25,29.155
+1982-03-26,29.226
+1982-03-27,29.266
+1982-03-28,29.257
+1982-03-29,29.332
+1982-03-30,29.349
+1982-03-31,29.465
+1982-04-01,29.489
+1982-04-02,29.472
+1982-04-03,29.58
+1982-04-04,29.62
+1982-04-05,29.61
+1982-04-06,29.554
+1982-04-07,29.499
+1982-04-08,29.522
+1982-04-09,29.575
+1982-04-10,29.596
+1982-04-11,29.601
+1982-04-12,29.596
+1982-04-13,29.723
+1982-04-14,29.581
+1982-04-15,29.588
+1982-04-16,29.65
+1982-04-17,29.698
+1982-04-18,29.74
+1982-04-19,29.808
+1982-04-20,29.867
+1982-04-21,29.944
+1982-04-22,29.944
+1982-04-23,29.973
+1982-04-24,29.952
+1982-04-25,29.976
+1982-04-26,29.998
+1982-04-27,29.951
+1982-04-28,29.917
+1982-04-29,29.964
+1982-04-30,29.942
+1982-05-01,29.937
+1982-05-02,29.944
+1982-05-03,29.908
+1982-05-04,29.878
+1982-05-05,29.87
+1982-05-06,29.853
+1982-05-07,29.842
+1982-05-08,29.82
+1982-05-09,29.758
+1982-05-10,29.732
+1982-05-11,29.742
+1982-05-12,29.724
+1982-05-13,29.681
+1982-05-14,29.663
+1982-05-15,29.644
+1982-05-16,29.641
+1982-05-17,29.552
+1982-05-18,29.517
+1982-05-19,29.517
+1982-05-20,29.538
+1982-05-21,29.512
+1982-05-22,29.496
+1982-05-23,29.504
+1982-05-24,29.477
+1982-05-25,29.441
+1982-05-26,29.431
+1982-05-27,29.401
+1982-05-28,29.389
+1982-05-29,29.363
+1982-05-30,29.338
+1982-05-31,29.327
+1982-06-01,29.356
+1982-06-02,29.28
+1982-06-03,29.251
+1982-06-04,29.262
+1982-06-05,29.234
+1982-06-06,29.206
+1982-06-07,29.206
+1982-06-08,29.208
+1982-06-09,29.203
+1982-06-10,29.199
+1982-06-11,29.206
+1982-06-12,29.176
+1982-06-13,29.242
+1982-06-14,29.162
+1982-06-15,29.118
+1982-06-16,29.11
+1982-06-17,29.047
+1982-06-18,29.055
+1982-06-19,29.033
+1982-06-20,29.051
+1982-06-21,29.036
+1982-06-22,29.017
+1982-06-23,29.002
+1982-06-24,29.01
+1982-06-25,29.03
+1982-06-26,29.001
+1982-06-27,29.005
+1982-06-28,28.998
+1982-06-29,28.984
+1982-06-30,28.979
+1982-07-01,28.986
+1982-07-02,29.018
+1982-07-03,28.978
+1982-07-04,28.975
+1982-07-05,28.984
+1982-07-06,29.004
+1982-07-07,29.023
+1982-07-08,28.973
+1982-07-09,28.953
+1982-07-10,28.917
+1982-07-11,28.953
+1982-07-12,28.993
+1982-07-13,28.888
+1982-07-14,28.881
+1982-07-15,28.871
+1982-07-16,28.861
+1982-07-17,28.864
+1982-07-18,28.863
+1982-07-19,28.835
+1982-07-20,28.773
+1982-07-21,28.78
+1982-07-22,28.774
+1982-07-23,28.749
+1982-07-24,28.762
+1982-07-25,28.791
+1982-07-26,28.733
+1982-07-27,28.736
+1982-07-28,28.733
+1982-07-29,28.727
+1982-07-30,28.742
+1982-07-31,28.746
+1982-08-01,28.741
+1982-08-02,28.683
+1982-08-03,28.693
+1982-08-04,28.699
+1982-08-05,28.687
+1982-08-06,28.695
+1982-08-07,28.705
+1982-08-08,28.695
+1982-08-09,28.748
+1982-08-10,28.717
+1982-08-11,28.697
+1982-08-12,28.672
+1982-08-13,28.663
+1982-08-14,28.675
+1982-08-15,28.675
+1982-08-16,28.68
+1982-08-17,28.659
+1982-08-18,28.659
+1982-08-19,28.664
+1982-08-20,28.661
+1982-08-21,28.637
+1982-08-22,28.641
+1982-08-23,28.659
+1982-08-24,28.62
+1982-08-25,28.574
+1982-08-26,28.627
+1982-08-27,28.657
+1982-08-28,28.622
+1982-08-29,28.622
+1982-08-30,28.652
+1982-08-31,28.625
+1982-09-01,28.621
+1982-09-02,28.649
+1982-09-03,28.657
+1982-09-04,28.633
+1982-09-05,28.654
+1982-09-06,28.599
+1982-09-07,28.595
+1982-09-08,28.617
+1982-09-09,28.639
+1982-09-10,28.63
+1982-09-11,28.616
+1982-09-12,28.606
+1982-09-13,28.611
+1982-09-14,28.636
+1982-09-15,28.523
+1982-09-16,28.592
+1982-09-17,28.58
+1982-09-18,28.617
+1982-09-19,28.581
+1982-09-20,28.592
+1982-09-21,28.582
+1982-09-22,28.56
+1982-09-23,28.565
+1982-09-24,28.583
+1982-09-25,28.57
+1982-09-26,28.571
+1982-09-27,28.576
+1982-09-28,28.565
+1982-09-29,28.561
+1982-09-30,28.595
+1982-10-01,28.583
+1982-10-02,28.548
+1982-10-03,28.607
+1982-10-04,28.54
+1982-10-05,28.559
+1982-10-06,28.555
+1982-10-07,28.52
+1982-10-08,28.603
+1982-10-09,28.489
+1982-10-10,28.527
+1982-10-11,28.579
+1982-10-12,28.602
+1982-10-13,28.591
+1982-10-14,28.587
+1982-10-15,28.606
+1982-10-16,28.569
+1982-10-17,28.551
+1982-10-18,28.571
+1982-10-19,28.636
+1982-10-20,28.688
+1982-10-21,28.589
+1982-10-22,28.521
+1982-10-23,28.54
+1982-10-24,28.529
+1982-10-25,28.539
+1982-10-26,28.499
+1982-10-27,28.527
+1982-10-28,28.533
+1982-10-29,28.554
+1982-10-30,28.533
+1982-10-31,28.524
+1982-11-01,28.507
+1982-11-02,28.502
+1982-11-03,28.54
+1982-11-04,28.504
+1982-11-05,28.586
+1982-11-06,28.668
+1982-11-07,28.631
+1982-11-08,28.642
+1982-11-09,28.582
+1982-11-10,28.6
+1982-11-11,28.779
+1982-11-12,28.777
+1982-11-13,28.574
+1982-11-14,28.59
+1982-11-15,28.616
+1982-11-16,28.663
+1982-11-17,28.619
+1982-11-18,28.588
+1982-11-19,28.623
+1982-11-20,28.731
+1982-11-21,28.737
+1982-11-22,28.568
+1982-11-23,28.613
+1982-11-24,28.604
+1982-11-25,28.625
+1982-11-26,28.644
+1982-11-27,28.575
+1982-11-28,28.657
+1982-11-29,28.618
+1982-11-30,28.607
+1982-12-01,28.669
+1982-12-02,28.627
+1982-12-03,28.792
+1982-12-04,28.686
+1982-12-05,28.658
+1982-12-06,28.709
+1982-12-07,28.67
+1982-12-08,28.644
+1982-12-09,28.567
+1982-12-10,28.776
+1982-12-11,28.677
+1982-12-12,28.582
+1982-12-13,28.591
+1982-12-14,28.628
+1982-12-15,28.603
+1982-12-16,28.608
+1982-12-17,28.598
+1982-12-18,28.62
+1982-12-19,28.638
+1982-12-20,28.628
+1982-12-21,28.64
+1982-12-22,28.641
+1982-12-23,28.629
+1982-12-24,28.679
+1982-12-25,28.714
+1982-12-26,28.682
+1982-12-27,28.715
+1982-12-28,28.885
+1982-12-29,28.765
+1982-12-30,28.73
+1982-12-31,28.761
+1983-01-01,28.775
+1983-01-02,28.707
+1983-01-03,28.69
+1983-01-04,28.723
+1983-01-05,28.737
+1983-01-06,28.674
+1983-01-07,28.69
+1983-01-08,28.672
+1983-01-09,28.662
+1983-01-10,28.699
+1983-01-11,28.68
+1983-01-12,28.684
+1983-01-13,28.702
+1983-01-14,28.699
+1983-01-15,28.69
+1983-01-16,28.674
+1983-01-17,28.703
+1983-01-18,28.706
+1983-01-19,28.727
+1983-01-20,28.743
+1983-01-21,28.739
+1983-01-22,28.681
+1983-01-23,28.681
+1983-01-24,28.694
+1983-01-25,28.714
+1983-01-26,28.721
+1983-01-27,28.727
+1983-01-28,28.723
+1983-01-29,28.727
+1983-01-30,28.733
+1983-01-31,28.736
+1983-02-01,28.726
+1983-02-02,28.735
+1983-02-03,28.813
+1983-02-04,28.825
+1983-02-05,28.83
+1983-02-06,28.851
+1983-02-07,28.857
+1983-02-08,28.867
+1983-02-09,28.893
+1983-02-10,28.93
+1983-02-11,28.914
+1983-02-12,28.903
+1983-02-13,28.88
+1983-02-14,28.87
+1983-02-15,28.857
+1983-02-16,28.853
+1983-02-17,28.872
+1983-02-18,28.837
+1983-02-19,28.84
+1983-02-20,28.838
+1983-02-21,28.856
+1983-02-22,28.833
+1983-02-23,28.863
+1983-02-24,28.839
+1983-02-25,28.814
+1983-02-26,28.817
+1983-02-27,28.847
+1983-02-28,28.83
+1983-03-01,28.801
+1983-03-02,28.785
+1983-03-03,28.797
+1983-03-04,28.798
+1983-03-05,28.792
+1983-03-06,28.812
+1983-03-07,28.824
+1983-03-08,28.846
+1983-03-09,28.843
+1983-03-10,28.829
+1983-03-11,28.853
+1983-03-12,28.919
+1983-03-13,28.964
+1983-03-14,28.976
+1983-03-15,28.985
+1983-03-16,29.033
+1983-03-17,29.038
+1983-03-18,29.037
+1983-03-19,29.119
+1983-03-20,29.118
+1983-03-21,29.193
+1983-03-22,29.242
+1983-03-23,29.223
+1983-03-24,29.211
+1983-03-25,29.211
+1983-03-26,29.234
+1983-03-27,29.264
+1983-03-28,29.218
+1983-03-29,29.187
+1983-03-30,29.216
+1983-03-31,29.213
+1983-04-01,29.172
+1983-04-02,29.171
+1983-04-03,29.209
+1983-04-04,29.217
+1983-04-05,29.218
+1983-04-06,29.212
+1983-04-07,29.25
+1983-04-08,29.222
+1983-04-09,29.204
+1983-04-10,29.252
+1983-04-11,29.277
+1983-04-12,29.313
+1983-04-13,29.337
+1983-04-14,29.448
+1983-04-15,29.452
+1983-04-16,29.401
+1983-04-17,29.428
+1983-04-18,29.469
+1983-04-19,29.421
+1983-04-20,29.494
+1983-04-21,29.558
+1983-04-22,29.585
+1983-04-23,29.591
+1983-04-24,29.564
+1983-04-25,29.651
+1983-04-26,29.791
+1983-04-27,29.85
+1983-04-28,29.887
+1983-04-29,29.916
+1983-04-30,29.943
+1983-05-01,30.001
+1983-05-02,30.059
+1983-05-03,30.099
+1983-05-04,30.146
+1983-05-05,30.187
+1983-05-06,30.194
+1983-05-07,30.241
+1983-05-08,30.238
+1983-05-09,30.176
+1983-05-10,30.219
+1983-05-11,30.203
+1983-05-12,30.202
+1983-05-13,30.197
+1983-05-14,30.191
+1983-05-15,30.224
+1983-05-16,30.127
+1983-05-17,30.123
+1983-05-18,30.13
+1983-05-19,30.136
+1983-05-20,30.162
+1983-05-21,30.044
+1983-05-22,30.011
+1983-05-23,30.022
+1983-05-24,29.973
+1983-05-25,29.951
+1983-05-26,29.93
+1983-05-27,29.952
+1983-05-28,29.96
+1983-05-29,29.974
+1983-05-30,29.948
+1983-05-31,29.951
+1983-06-01,29.969
+1983-06-02,29.934
+1983-06-03,29.933
+1983-06-04,29.909
+1983-06-05,29.895
+1983-06-06,29.868
+1983-06-07,29.867
+1983-06-08,29.845
+1983-06-09,29.849
+1983-06-10,29.851
+1983-06-11,29.792
+1983-06-12,29.778
+1983-06-13,29.743
+1983-06-14,29.713
+1983-06-15,29.68
+1983-06-16,29.653
+1983-06-17,29.626
+1983-06-18,29.596
+1983-06-19,29.556
+1983-06-20,29.52
+1983-06-21,29.493
+1983-06-22,29.491
+1983-06-23,29.467
+1983-06-24,29.39
+1983-06-25,29.374
+1983-06-26,29.395
+1983-06-27,29.358
+1983-06-28,29.308
+1983-06-29,29.301
+1983-06-30,29.304
+1983-07-01,29.321
+1983-07-02,29.247
+1983-07-03,29.22
+1983-07-04,29.246
+1983-07-05,29.177
+1983-07-06,29.142
+1983-07-07,29.15
+1983-07-08,29.139
+1983-07-09,29.09
+1983-07-10,29.097
+1983-07-11,29.101
+1983-07-12,29.088
+1983-07-13,29.039
+1983-07-14,29.046
+1983-07-15,29.032
+1983-07-16,29.007
+1983-07-17,28.988
+1983-07-18,28.974
+1983-07-19,28.964
+1983-07-20,28.96
+1983-07-21,28.957
+1983-07-22,28.872
+1983-07-23,28.925
+1983-07-24,28.926
+1983-07-25,28.903
+1983-07-26,28.892
+1983-07-27,28.902
+1983-07-28,28.899
+1983-07-29,28.893
+1983-07-30,28.862
+1983-07-31,28.852
+1983-08-01,28.908
+1983-08-02,28.88
+1983-08-03,28.886
+1983-08-04,28.877
+1983-08-05,28.873
+1983-08-06,28.88
+1983-08-07,28.862
+1983-08-08,28.896
+1983-08-09,28.859
+1983-08-10,28.865
+1983-08-11,28.869
+1983-08-12,28.863
+1983-08-13,28.898
+1983-08-14,28.91
+1983-08-15,28.919
+1983-08-16,28.93
+1983-08-17,28.923
+1983-08-18,28.905
+1983-08-19,28.899
+1983-08-20,28.885
+1983-08-21,28.854
+1983-08-22,28.865
+1983-08-23,28.851
+1983-08-24,28.838
+1983-08-25,28.848
+1983-08-26,28.862
+1983-08-27,28.831
+1983-08-28,28.814
+1983-08-29,28.797
+1983-08-30,28.806
+1983-08-31,28.783
+1983-09-01,28.787
+1983-09-02,28.814
+1983-09-03,28.794
+1983-09-04,28.812
+1983-09-05,28.793
+1983-09-06,28.802
+1983-09-07,28.758
+1983-09-08,28.726
+1983-09-09,28.757
+1983-09-10,28.739
+1983-09-11,28.74
+1983-09-12,28.704
+1983-09-13,28.677
+1983-09-14,28.673
+1983-09-15,28.68
+1983-09-16,28.691
+1983-09-17,28.739
+1983-09-18,28.707
+1983-09-19,28.68
+1983-09-20,28.71
+1983-09-21,28.772
+1983-09-22,28.709
+1983-09-23,28.701
+1983-09-24,28.7
+1983-09-25,28.726
+1983-09-26,28.736
+1983-09-27,28.681
+1983-09-28,28.659
+1983-09-29,28.667
+1983-09-30,28.667
+1983-10-01,28.677
+1983-10-02,28.662
+1983-10-03,28.713
+1983-10-04,28.606
+1983-10-05,28.638
+1983-10-06,28.672
+1983-10-07,28.674
+1983-10-08,28.708
+1983-10-09,28.617
+1983-10-10,28.649
+1983-10-11,28.73
+1983-10-12,28.677
+1983-10-13,28.68
+1983-10-14,28.708
+1983-10-15,28.661
+1983-10-16,28.645
+1983-10-17,28.76
+1983-10-18,28.651
+1983-10-19,28.602
+1983-10-20,28.613
+1983-10-21,28.604
+1983-10-22,28.628
+1983-10-23,28.646
+1983-10-24,28.569
+1983-10-25,28.611
+1983-10-26,28.62
+1983-10-27,28.617
+1983-10-28,28.734
+1983-10-29,28.548
+1983-10-30,28.617
+1983-10-31,28.63
+1983-11-01,28.624
+1983-11-02,28.666
+1983-11-03,28.631
+1983-11-04,28.476
+1983-11-05,28.496
+1983-11-06,28.673
+1983-11-07,28.71
+1983-11-08,28.777
+1983-11-09,28.719
+1983-11-10,28.75
+1983-11-11,28.684
+1983-11-12,28.785
+1983-11-13,28.845
+1983-11-14,28.87
+1983-11-15,28.904
+1983-11-16,28.864
+1983-11-17,28.947
+1983-11-18,28.943
+1983-11-19,28.943
+1983-11-20,28.957
+1983-11-21,29.005
+1983-11-22,29.017
+1983-11-23,29.036
+1983-11-24,29.164
+1983-11-25,29.109
+1983-11-26,29.164
+1983-11-27,29.178
+1983-11-28,29.199
+1983-11-29,29.246
+1983-11-30,29.285
+1983-12-01,29.287
+1983-12-02,29.299
+1983-12-03,29.274
+1983-12-04,29.269
+1983-12-05,29.277
+1983-12-06,29.296
+1983-12-07,29.378
+1983-12-08,29.394
+1983-12-09,29.447
+1983-12-10,29.413
+1983-12-11,29.346
+1983-12-12,29.467
+1983-12-13,29.442
+1983-12-14,29.606
+1983-12-15,29.777
+1983-12-16,29.859
+1983-12-17,29.89
+1983-12-18,29.887
+1983-12-19,29.878
+1983-12-20,29.831
+1983-12-21,29.809
+1983-12-22,29.841
+1983-12-23,29.741
+1983-12-24,29.779
+1983-12-25,29.776
+1983-12-26,29.795
+1983-12-27,29.834
+1983-12-28,29.833
+1983-12-29,29.721
+1983-12-30,29.679
+1983-12-31,29.664
+1984-01-01,29.658
+1984-01-02,29.644
+1984-01-03,29.617
+1984-01-04,29.632
+1984-01-05,29.556
+1984-01-06,29.555
+1984-01-07,29.516
+1984-01-08,29.466
+1984-01-09,29.448
+1984-01-10,29.438
+1984-01-11,29.437
+1984-01-12,29.413
+1984-01-13,29.408
+1984-01-14,29.375
+1984-01-15,29.354
+1984-01-16,29.353
+1984-01-17,29.358
+1984-01-18,29.325
+1984-01-19,29.309
+1984-01-20,29.315
+1984-01-21,29.319
+1984-01-22,29.336
+1984-01-23,29.309
+1984-01-24,29.246
+1984-01-25,29.209
+1984-01-26,29.203
+1984-01-27,29.175
+1984-01-28,29.172
+1984-01-29,29.162
+1984-01-30,29.131
+1984-01-31,29.121
+1984-02-01,29.153
+1984-02-02,29.126
+1984-02-03,29.113
+1984-02-04,29.071
+1984-02-05,29.06
+1984-02-06,29.066
+1984-02-07,29.063
+1984-02-08,29.085
+1984-02-09,29.05
+1984-02-10,29.056
+1984-02-11,29.028
+1984-02-12,29.019
+1984-02-13,29.034
+1984-02-14,29.09
+1984-02-15,29.152
+1984-02-16,29.193
+1984-02-17,29.273
+1984-02-18,29.312
+1984-02-19,29.396
+1984-02-20,29.426
+1984-02-21,29.416
+1984-02-22,29.45
+1984-02-23,29.474
+1984-02-24,29.453
+1984-02-25,29.436
+1984-02-26,29.447
+1984-02-27,29.442
+1984-02-28,29.354
+1984-02-29,29.351
+1984-03-01,29.326
+1984-03-02,29.35
+1984-03-03,29.362
+1984-03-04,29.348
+1984-03-05,29.351
+1984-03-06,29.341
+1984-03-07,29.328
+1984-03-08,29.308
+1984-03-09,29.275
+1984-03-10,29.276
+1984-03-11,29.321
+1984-03-12,29.232
+1984-03-13,29.202
+1984-03-14,29.167
+1984-03-15,29.18
+1984-03-16,29.174
+1984-03-17,29.134
+1984-03-18,29.115
+1984-03-19,29.129
+1984-03-20,29.17
+1984-03-21,29.193
+1984-03-22,29.239
+1984-03-23,29.298
+1984-03-24,29.313
+1984-03-25,29.315
+1984-03-26,29.309
+1984-03-27,29.31
+1984-03-28,29.28
+1984-03-29,29.21
+1984-03-30,29.21
+1984-03-31,29.298
+1984-04-01,29.304
+1984-04-02,29.298
+1984-04-03,29.295
+1984-04-04,29.304
+1984-04-05,29.3
+1984-04-06,29.352
+1984-04-07,29.386
+1984-04-08,29.394
+1984-04-09,29.425
+1984-04-10,29.448
+1984-04-11,29.457
+1984-04-12,29.452
+1984-04-13,29.472
+1984-04-14,29.496
+1984-04-15,29.497
+1984-04-16,29.515
+1984-04-17,29.581
+1984-04-18,29.637
+1984-04-19,29.673
+1984-04-20,29.703
+1984-04-21,29.611
+1984-04-22,29.704
+1984-04-23,29.719
+1984-04-24,29.682
+1984-04-25,29.648
+1984-04-26,29.704
+1984-04-27,29.715
+1984-04-28,29.72
+1984-04-29,29.703
+1984-04-30,29.745
+1984-05-01,29.738
+1984-05-02,29.683
+1984-05-03,29.663
+1984-05-04,29.601
+1984-05-05,29.637
+1984-05-06,29.673
+1984-05-07,29.657
+1984-05-08,29.68
+1984-05-09,29.692
+1984-05-10,29.666
+1984-05-11,29.678
+1984-05-12,29.702
+1984-05-13,29.641
+1984-05-14,29.628
+1984-05-15,29.633
+1984-05-16,29.617
+1984-05-17,29.616
+1984-05-18,29.608
+1984-05-19,29.613
+1984-05-20,29.592
+1984-05-21,29.581
+1984-05-22,29.612
+1984-05-23,29.611
+1984-05-24,29.577
+1984-05-25,29.624
+1984-05-26,29.633
+1984-05-27,29.552
+1984-05-28,29.519
+1984-05-29,29.513
+1984-05-30,29.614
+1984-05-31,29.688
+1984-06-01,29.72
+1984-06-02,29.685
+1984-06-03,29.765
+1984-06-04,29.769
+1984-06-05,29.753
+1984-06-06,29.758
+1984-06-07,29.765
+1984-06-08,29.786
+1984-06-09,29.803
+1984-06-10,29.768
+1984-06-11,29.755
+1984-06-12,29.735
+1984-06-13,29.705
+1984-06-14,29.668
+1984-06-15,29.633
+1984-06-16,29.638
+1984-06-17,29.64
+1984-06-18,29.69
+1984-06-19,29.563
+1984-06-20,29.505
+1984-06-21,29.489
+1984-06-22,29.452
+1984-06-23,29.425
+1984-06-24,29.486
+1984-06-25,29.408
+1984-06-26,29.361
+1984-06-27,29.358
+1984-06-28,29.355
+1984-06-29,29.304
+1984-06-30,29.276
+1984-07-01,29.26
+1984-07-02,29.248
+1984-07-03,29.233
+1984-07-04,29.227
+1984-07-05,29.206
+1984-07-06,29.212
+1984-07-07,29.202
+1984-07-08,29.213
+1984-07-09,29.229
+1984-07-10,29.237
+1984-07-11,29.255
+1984-07-12,29.218
+1984-07-13,29.205
+1984-07-14,29.212
+1984-07-15,29.205
+1984-07-16,29.199
+1984-07-17,29.171
+1984-07-18,29.157
+1984-07-19,29.153
+1984-07-20,29.169
+1984-07-21,29.141
+1984-07-22,29.125
+1984-07-23,29.14
+1984-07-24,29.07
+1984-07-25,29.053
+1984-07-26,29.057
+1984-07-27,29.033
+1984-07-28,29.025
+1984-07-29,29.022
+1984-07-30,29.014
+1984-07-31,29.014
+1984-08-01,28.986
+1984-08-02,28.975
+1984-08-03,28.971
+1984-08-04,28.958
+1984-08-05,28.953
+1984-08-06,28.946
+1984-08-07,28.928
+1984-08-08,28.899
+1984-08-09,28.938
+1984-08-10,28.966
+1984-08-11,28.874
+1984-08-12,28.874
+1984-08-13,28.878
+1984-08-14,28.872
+1984-08-15,28.869
+1984-08-16,28.855
+1984-08-17,28.82
+1984-08-18,28.829
+1984-08-19,28.828
+1984-08-20,28.798
+1984-08-21,28.819
+1984-08-22,28.826
+1984-08-23,28.8
+1984-08-24,28.753
+1984-08-25,28.781
+1984-08-26,28.806
+1984-08-27,28.811
+1984-08-28,28.812
+1984-08-29,28.796
+1984-08-30,28.806
+1984-08-31,28.773
+1984-09-01,28.751
+1984-09-02,28.739
+1984-09-03,28.727
+1984-09-04,28.742
+1984-09-05,28.737
+1984-09-06,28.721
+1984-09-07,28.725
+1984-09-08,28.765
+1984-09-09,28.786
+1984-09-10,28.77
+1984-09-11,28.705
+1984-09-12,28.689
+1984-09-13,28.762
+1984-09-14,28.688
+1984-09-15,28.65
+1984-09-16,28.687
+1984-09-17,28.693
+1984-09-18,28.727
+1984-09-19,28.717
+1984-09-20,28.725
+1984-09-21,28.657
+1984-09-22,28.664
+1984-09-23,28.708
+1984-09-24,28.658
+1984-09-25,28.688
+1984-09-26,28.644
+1984-09-27,28.646
+1984-09-28,28.653
+1984-09-29,28.639
+1984-09-30,28.623
+1984-10-01,28.617
+1984-10-02,28.591
+1984-10-03,28.709
+1984-10-04,28.628
+1984-10-05,28.616
+1984-10-06,28.633
+1984-10-07,28.641
+1984-10-08,28.641
+1984-10-09,28.631
+1984-10-10,28.631
+1984-10-11,28.629
+1984-10-12,28.626
+1984-10-13,28.625
+1984-10-14,28.622
+1984-10-15,28.62
+1984-10-16,28.617
+1984-10-17,28.616
+1984-10-18,28.612
+1984-10-19,28.623
+1984-10-20,28.618
+1984-10-21,28.626
+1984-10-22,28.616
+1984-10-23,28.611
+1984-10-24,28.611
+1984-10-25,28.609
+1984-10-26,28.607
+1984-10-27,28.608
+1984-10-28,28.623
+1984-10-29,28.614
+1984-10-30,28.611
+1984-10-31,28.616
+1984-11-01,28.706
+1984-11-02,28.701
+1984-11-03,28.621
+1984-11-04,28.631
+1984-11-05,28.626
+1984-11-06,28.623
+1984-11-07,28.622
+1984-11-08,28.62
+1984-11-09,28.625
+1984-11-10,28.628
+1984-11-11,28.627
+1984-11-12,28.628
+1984-11-13,28.633
+1984-11-14,28.636
+1984-11-15,28.681
+1984-11-16,28.696
+1984-11-17,28.641
+1984-11-18,28.634
+1984-11-19,28.626
+1984-11-20,28.629
+1984-11-21,28.632
+1984-11-22,28.64
+1984-11-23,28.667
+1984-11-24,28.623
+1984-11-25,28.628
+1984-11-26,28.628
+1984-11-27,28.631
+1984-11-28,28.676
+1984-11-29,28.628
+1984-11-30,28.653
+1984-12-01,28.683
+1984-12-02,28.662
+1984-12-03,28.704
+1984-12-04,28.703
+1984-12-05,28.677
+1984-12-06,28.666
+1984-12-07,28.67
+1984-12-08,28.751
+1984-12-09,28.669
+1984-12-10,28.701
+1984-12-11,28.666
+1984-12-12,28.773
+1984-12-13,28.723
+1984-12-14,28.648
+1984-12-15,28.731
+1984-12-16,28.87
+1984-12-17,28.847
+1984-12-18,28.766
+1984-12-19,28.782
+1984-12-20,28.81
+1984-12-21,28.78
+1984-12-22,28.91
+1984-12-23,28.844
+1984-12-24,28.921
+1984-12-25,28.771
+1984-12-26,28.763
+1984-12-27,28.799
+1984-12-28,28.767
+1984-12-29,28.779
+1984-12-30,28.852
+1984-12-31,28.93
+1985-01-01,28.983
+1985-01-02,28.996
+1985-01-03,29.025
+1985-01-04,29.04
+1985-01-05,29.026
+1985-01-06,29.035
+1985-01-07,29.021
+1985-01-08,29.028
+1985-01-09,29.078
+1985-01-10,29.12
+1985-01-11,29.13
+1985-01-12,29.152
+1985-01-13,29.124
+1985-01-14,29.047
+1985-01-15,29.014
+1985-01-16,29.042
+1985-01-17,29.044
+1985-01-18,29.01
+1985-01-19,28.993
+1985-01-20,28.988
+1985-01-21,28.984
+1985-01-22,28.99
+1985-01-23,29.001
+1985-01-24,28.966
+1985-01-25,28.936
+1985-01-26,28.93
+1985-01-27,28.933
+1985-01-28,28.905
+1985-01-29,28.904
+1985-01-30,28.901
+1985-01-31,28.88
+1985-02-01,28.872
+1985-02-02,28.863
+1985-02-03,28.854
+1985-02-04,28.863
+1985-02-05,28.848
+1985-02-06,28.828
+1985-02-07,28.857
+1985-02-08,28.875
+1985-02-09,28.876
+1985-02-10,28.853
+1985-02-11,28.828
+1985-02-12,28.805
+1985-02-13,28.8
+1985-02-14,28.814
+1985-02-15,28.808
+1985-02-16,28.802
+1985-02-17,28.811
+1985-02-18,28.802
+1985-02-19,28.797
+1985-02-20,28.781
+1985-02-21,28.785
+1985-02-22,28.811
+1985-02-23,28.771
+1985-02-24,28.815
+1985-02-25,28.874
+1985-02-26,28.982
+1985-02-27,29.026
+1985-02-28,29.055
+1985-03-01,29.118
+1985-03-02,29.122
+1985-03-03,29.091
+1985-03-04,29.058
+1985-03-05,29.098
+1985-03-06,29.089
+1985-03-07,29.135
+1985-03-08,29.123
+1985-03-09,29.096
+1985-03-10,29.116
+1985-03-11,29.148
+1985-03-12,29.151
+1985-03-13,29.218
+1985-03-14,29.291
+1985-03-15,29.284
+1985-03-16,29.274
+1985-03-17,29.241
+1985-03-18,29.229
+1985-03-19,29.322
+1985-03-20,29.258
+1985-03-21,29.243
+1985-03-22,29.246
+1985-03-23,29.233
+1985-03-24,29.189
+1985-03-25,29.172
+1985-03-26,29.199
+1985-03-27,29.22
+1985-03-28,29.193
+1985-03-29,29.229
+1985-03-30,29.233
+1985-03-31,29.248
+1985-04-01,29.337
+1985-04-02,29.32
+1985-04-03,29.335
+1985-04-04,29.32
+1985-04-05,29.338
+1985-04-06,29.408
+1985-04-07,29.453
+1985-04-08,29.417
+1985-04-09,29.406
+1985-04-10,29.444
+1985-04-11,29.441
+1985-04-12,29.41
+1985-04-13,29.373
+1985-04-14,29.484
+1985-04-15,29.466
+1985-04-16,29.375
+1985-04-17,29.338
+1985-04-18,29.436
+1985-04-19,29.421
+1985-04-20,29.444
+1985-04-21,29.447
+1985-04-22,29.439
+1985-04-23,29.425
+1985-04-24,29.473
+1985-04-25,29.472
+1985-04-26,29.456
+1985-04-27,29.432
+1985-04-28,29.438
+1985-04-29,29.426
+1985-04-30,29.433
+1985-05-01,29.371
+1985-05-02,29.388
+1985-05-03,29.284
+1985-05-04,29.335
+1985-05-05,29.329
+1985-05-06,29.325
+1985-05-07,29.325
+1985-05-08,29.282
+1985-05-09,29.366
+1985-05-10,29.342
+1985-05-11,29.276
+1985-05-12,29.315
+1985-05-13,29.314
+1985-05-14,29.234
+1985-05-15,29.28
+1985-05-16,29.305
+1985-05-17,29.249
+1985-05-18,29.226
+1985-05-19,29.256
+1985-05-20,29.297
+1985-05-21,29.22
+1985-05-22,29.202
+1985-05-23,29.214
+1985-05-24,29.189
+1985-05-25,29.178
+1985-05-26,29.144
+1985-05-27,29.143
+1985-05-28,29.091
+1985-05-29,29.111
+1985-05-30,29.164
+1985-05-31,29.209
+1985-06-01,29.144
+1985-06-02,29.106
+1985-06-03,29.06
+1985-06-04,29.031
+1985-06-05,29.022
+1985-06-06,28.986
+1985-06-07,29.004
+1985-06-08,28.996
+1985-06-09,29.02
+1985-06-10,28.981
+1985-06-11,28.948
+1985-06-12,28.922
+1985-06-13,28.939
+1985-06-14,28.955
+1985-06-15,28.96
+1985-06-16,28.953
+1985-06-17,28.944
+1985-06-18,28.996
+1985-06-19,28.977
+1985-06-20,28.932
+1985-06-21,28.93
+1985-06-22,28.95
+1985-06-23,28.944
+1985-06-24,28.886
+1985-06-25,28.862
+1985-06-26,28.821
+1985-06-27,28.796
+1985-06-28,28.786
+1985-06-29,28.836
+1985-06-30,28.84
+1985-07-01,28.847
+1985-07-02,28.841
+1985-07-03,28.846
+1985-07-04,28.833
+1985-07-05,28.839
+1985-07-06,28.829
+1985-07-07,28.822
+1985-07-08,28.805
+1985-07-09,28.798
+1985-07-10,28.789
+1985-07-11,28.782
+1985-07-12,28.789
+1985-07-13,28.783
+1985-07-14,28.815
+1985-07-15,28.759
+1985-07-16,28.754
+1985-07-17,28.744
+1985-07-18,28.743
+1985-07-19,28.755
+1985-07-20,28.737
+1985-07-21,28.735
+1985-07-22,28.73
+1985-07-23,28.703
+1985-07-24,28.718
+1985-07-25,28.776
+1985-07-26,28.734
+1985-07-27,28.663
+1985-07-28,28.664
+1985-07-29,28.688
+1985-07-30,28.656
+1985-07-31,28.659
+1985-08-01,28.626
+1985-08-02,28.639
+1985-08-03,28.66
+1985-08-04,28.664
+1985-08-05,28.655
+1985-08-06,28.656
+1985-08-07,28.691
+1985-08-08,28.653
+1985-08-09,28.626
+1985-08-10,28.635
+1985-08-11,28.635
+1985-08-12,28.586
+1985-08-13,28.605
+1985-08-14,28.614
+1985-08-15,28.61
+1985-08-16,28.601
+1985-08-17,28.586
+1985-08-18,28.601
+1985-08-19,28.661
+1985-08-20,28.597
+1985-08-21,28.567
+1985-08-22,28.544
+1985-08-23,28.553
+1985-08-24,28.557
+1985-08-25,28.557
+1985-08-26,28.546
+1985-08-27,28.578
+1985-08-28,28.546
+1985-08-29,28.521
+1985-08-30,28.524
+1985-08-31,28.509
+1985-09-01,28.564
+1985-09-02,28.589
+1985-09-03,28.575
+1985-09-04,28.587
+1985-09-05,28.56
+1985-09-06,28.578
+1985-09-07,28.621
+1985-09-08,28.602
+1985-09-09,28.572
+1985-09-10,28.576
+1985-09-11,28.58
+1985-09-12,28.6
+1985-09-13,28.598
+1985-09-14,28.608
+1985-09-15,28.627
+1985-09-16,28.629
+1985-09-17,28.634
+1985-09-18,28.644
+1985-09-19,28.629
+1985-09-20,28.647
+1985-09-21,28.6
+1985-09-22,28.604
+1985-09-23,28.641
+1985-09-24,28.628
+1985-09-25,28.594
+1985-09-26,28.63
+1985-09-27,28.569
+1985-09-28,28.624
+1985-09-29,28.676
+1985-09-30,28.686
+1985-10-01,28.694
+1985-10-02,28.684
+1985-10-03,28.682
+1985-10-04,28.685
+1985-10-05,28.728
+1985-10-06,28.716
+1985-10-07,28.704
+1985-10-08,28.752
+1985-10-09,28.754
+1985-10-10,28.686
+1985-10-11,28.682
+1985-10-12,28.691
+1985-10-13,28.78
+1985-10-14,28.702
+1985-10-15,28.728
+1985-10-16,28.745
+1985-10-17,28.752
+1985-10-18,28.867
+1985-10-19,28.797
+1985-10-20,28.757
+1985-10-21,28.783
+1985-10-22,28.807
+1985-10-23,28.809
+1985-10-24,28.915
+1985-10-25,28.804
+1985-10-26,28.787
+1985-10-27,28.809
+1985-10-28,28.731
+1985-10-29,28.754
+1985-10-30,28.775
+1985-10-31,28.745
+1985-11-01,28.732
+1985-11-02,28.741
+1985-11-03,28.757
+1985-11-04,28.761
+1985-11-05,28.679
+1985-11-06,28.693
+1985-11-07,28.79
+1985-11-08,28.814
+1985-11-09,28.794
+1985-11-10,28.773
+1985-11-11,28.749
+1985-11-12,28.917
+1985-11-13,28.86
+1985-11-14,28.865
+1985-11-15,28.89
+1985-11-16,28.989
+1985-11-17,29.048
+1985-11-18,28.999
+1985-11-19,29.073
+1985-11-20,29.092
+1985-11-21,29.01
+1985-11-22,28.981
+1985-11-23,29.015
+1985-11-24,29.022
+1985-11-25,29.007
+1985-11-26,28.994
+1985-11-27,28.996
+1985-11-28,28.966
+1985-11-29,28.983
+1985-11-30,28.981
+1985-12-01,29.049
+1985-12-02,29.065
+1985-12-03,28.969
+1985-12-04,28.987
+1985-12-05,28.993
+1985-12-06,28.974
+1985-12-07,28.994
+1985-12-08,28.989
+1985-12-09,28.964
+1985-12-10,28.969
+1985-12-11,28.951
+1985-12-12,28.943
+1985-12-13,28.994
+1985-12-14,28.954
+1985-12-15,28.966
+1985-12-16,28.913
+1985-12-17,28.889
+1985-12-18,28.912
+1985-12-19,28.895
+1985-12-20,28.85
+1985-12-21,28.863
+1985-12-22,28.855
+1985-12-23,28.849
+1985-12-24,28.834
+1985-12-25,28.816
+1985-12-26,28.85
+1985-12-27,28.876
+1985-12-28,28.837
+1985-12-29,28.822
+1985-12-30,28.792
+1985-12-31,28.834
+1986-01-01,28.771
+1986-01-02,28.781
+1986-01-03,28.731
+1986-01-04,28.742
+1986-01-05,28.753
+1986-01-06,28.761
+1986-01-07,28.809
+1986-01-08,28.83
+1986-01-09,28.811
+1986-01-10,28.735
+1986-01-11,28.729
+1986-01-12,28.738
+1986-01-13,28.693
+1986-01-14,28.732
+1986-01-15,28.78
+1986-01-16,28.764
+1986-01-17,28.716
+1986-01-18,28.692
+1986-01-19,28.688
+1986-01-20,28.694
+1986-01-21,28.732
+1986-01-22,28.79
+1986-01-23,28.776
+1986-01-24,28.783
+1986-01-25,28.814
+1986-01-26,28.81
+1986-01-27,28.819
+1986-01-28,28.862
+1986-01-29,28.879
+1986-01-30,28.854
+1986-01-31,28.853
+1986-02-01,28.859
+1986-02-02,28.857
+1986-02-03,28.863
+1986-02-04,28.86
+1986-02-05,28.858
+1986-02-06,28.866
+1986-02-07,28.858
+1986-02-08,28.858
+1986-02-09,28.854
+1986-02-10,28.845
+1986-02-11,28.843
+1986-02-12,28.847
+1986-02-13,28.841
+1986-02-14,28.835
+1986-02-15,28.826
+1986-02-16,28.825
+1986-02-17,28.813
+1986-02-18,28.809
+1986-02-19,28.809
+1986-02-20,28.816
+1986-02-21,28.818
+1986-02-22,28.801
+1986-02-23,28.805
+1986-02-24,28.803
+1986-02-25,28.807
+1986-02-26,28.816
+1986-02-27,28.828
+1986-02-28,28.813
+1986-03-01,28.798
+1986-03-02,28.794
+1986-03-03,28.793
+1986-03-04,28.791
+1986-03-05,28.792
+1986-03-06,28.78
+1986-03-07,28.8
+1986-03-08,28.771
+1986-03-09,28.772
+1986-03-10,28.782
+1986-03-11,28.779
+1986-03-12,28.77
+1986-03-13,28.777
+1986-03-14,28.792
+1986-03-15,28.822
+1986-03-16,28.876
+1986-03-17,28.927
+1986-03-18,28.993
+1986-03-19,29.198
+1986-03-20,29.221
+1986-03-21,29.321
+1986-03-22,29.406
+1986-03-23,29.421
+1986-03-24,29.416
+1986-03-25,29.441
+1986-03-26,29.446
+1986-03-27,29.491
+1986-03-28,29.581
+1986-03-29,29.676
+1986-03-30,29.711
+1986-03-31,29.741
+1986-04-01,29.861
+1986-04-02,29.866
+1986-04-03,29.921
+1986-04-04,29.943
+1986-04-05,29.931
+1986-04-06,30.039
+1986-04-07,30.022
+1986-04-08,29.973
+1986-04-09,29.939
+1986-04-10,29.928
+1986-04-11,29.916
+1986-04-12,29.914
+1986-04-13,29.915
+1986-04-14,29.869
+1986-04-15,29.844
+1986-04-16,29.81
+1986-04-17,29.774
+1986-04-18,29.766
+1986-04-19,29.769
+1986-04-20,29.767
+1986-04-21,29.797
+1986-04-22,29.681
+1986-04-23,29.627
+1986-04-24,29.637
+1986-04-25,29.62
+1986-04-26,29.593
+1986-04-27,29.543
+1986-04-28,29.548
+1986-04-29,29.551
+1986-04-30,29.535
+1986-05-01,29.567
+1986-05-02,29.491
+1986-05-03,29.414
+1986-05-04,29.428
+1986-05-05,29.462
+1986-05-06,29.379
+1986-05-07,29.375
+1986-05-08,29.345
+1986-05-09,29.322
+1986-05-10,29.334
+1986-05-11,29.273
+1986-05-12,29.242
+1986-05-13,29.265
+1986-05-14,29.281
+1986-05-15,29.303
+1986-05-16,29.267
+1986-05-17,29.214
+1986-05-18,29.217
+1986-05-19,29.12
+1986-05-20,29.153
+1986-05-21,29.173
+1986-05-22,29.153
+1986-05-23,29.199
+1986-05-24,29.229
+1986-05-25,29.267
+1986-05-26,29.287
+1986-05-27,29.298
+1986-05-28,29.256
+1986-05-29,29.276
+1986-05-30,29.247
+1986-05-31,29.218
+1986-06-01,29.205
+1986-06-02,29.169
+1986-06-03,29.216
+1986-06-04,29.253
+1986-06-05,29.176
+1986-06-06,29.147
+1986-06-07,29.181
+1986-06-08,29.209
+1986-06-09,29.126
+1986-06-10,29.148
+1986-06-11,29.117
+1986-06-12,29.129
+1986-06-13,29.206
+1986-06-14,29.134
+1986-06-15,29.141
+1986-06-16,29.192
+1986-06-17,29.105
+1986-06-18,29.123
+1986-06-19,29.121
+1986-06-20,29.084
+1986-06-21,29.113
+1986-06-22,29.136
+1986-06-23,29.128
+1986-06-24,29.094
+1986-06-25,29.056
+1986-06-26,29.056
+1986-06-27,29.077
+1986-06-28,29.037
+1986-06-29,29.016
+1986-06-30,28.996
+1986-07-01,28.993
+1986-07-02,28.995
+1986-07-03,28.961
+1986-07-04,28.982
+1986-07-05,28.963
+1986-07-06,28.959
+1986-07-07,28.962
+1986-07-08,28.947
+1986-07-09,28.913
+1986-07-10,28.894
+1986-07-11,28.888
+1986-07-12,28.891
+1986-07-13,28.909
+1986-07-14,28.921
+1986-07-15,28.895
+1986-07-16,28.899
+1986-07-17,28.895
+1986-07-18,28.889
+1986-07-19,28.877
+1986-07-20,28.921
+1986-07-21,28.835
+1986-07-22,28.848
+1986-07-23,28.835
+1986-07-24,28.853
+1986-07-25,28.878
+1986-07-26,28.852
+1986-07-27,28.828
+1986-07-28,28.816
+1986-07-29,28.825
+1986-07-30,28.829
+1986-07-31,28.817
+1986-08-01,28.837
+1986-08-02,28.872
+1986-08-03,28.892
+1986-08-04,28.899
+1986-08-05,28.897
+1986-08-06,28.894
+1986-08-07,28.891
+1986-08-08,28.894
+1986-08-09,28.911
+1986-08-10,28.939
+1986-08-11,28.952
+1986-08-12,28.921
+1986-08-13,28.925
+1986-08-14,28.92
+1986-08-15,28.956
+1986-08-16,28.938
+1986-08-17,28.908
+1986-08-18,28.86
+1986-08-19,28.839
+1986-08-20,28.869
+1986-08-21,28.914
+1986-08-22,28.863
+1986-08-23,28.941
+1986-08-24,28.916
+1986-08-25,28.859
+1986-08-26,28.909
+1986-08-27,28.986
+1986-08-28,28.939
+1986-08-29,28.948
+1986-08-30,28.969
+1986-08-31,28.951
+1986-09-01,28.949
+1986-09-02,28.931
+1986-09-03,28.917
+1986-09-04,29.016
+1986-09-05,29.019
+1986-09-06,28.915
+1986-09-07,28.896
+1986-09-08,28.888
+1986-09-09,28.903
+1986-09-10,28.898
+1986-09-11,28.974
+1986-09-12,28.993
+1986-09-13,28.916
+1986-09-14,28.885
+1986-09-15,28.885
+1986-09-16,28.869
+1986-09-17,28.884
+1986-09-18,28.928
+1986-09-19,28.905
+1986-09-20,28.87
+1986-09-21,28.866
+1986-09-22,28.894
+1986-09-23,28.923
+1986-09-24,28.907
+1986-09-25,28.893
+1986-09-26,28.896
+1986-09-27,28.862
+1986-09-28,28.896
+1986-09-29,28.938
+1986-09-30,29.004
+1986-10-01,28.954
+1986-10-02,28.954
+1986-10-03,28.974
+1986-10-04,28.969
+1986-10-05,28.969
+1986-10-06,28.986
+1986-10-07,28.995
+1986-10-08,29.068
+1986-10-09,28.958
+1986-10-10,28.969
+1986-10-11,29.046
+1986-10-12,29.021
+1986-10-13,29.02
+1986-10-14,29.001
+1986-10-15,28.992
+1986-10-16,28.969
+1986-10-17,28.929
+1986-10-18,28.939
+1986-10-19,28.968
+1986-10-20,28.953
+1986-10-21,28.974
+1986-10-22,28.946
+1986-10-23,28.928
+1986-10-24,28.905
+1986-10-25,28.927
+1986-10-26,28.911
+1986-10-27,28.933
+1986-10-28,28.907
+1986-10-29,28.953
+1986-10-30,28.883
+1986-10-31,28.927
+1986-11-01,29.073
+1986-11-02,28.88
+1986-11-03,28.939
+1986-11-04,28.887
+1986-11-05,28.879
+1986-11-06,28.905
+1986-11-07,28.907
+1986-11-08,28.926
+1986-11-09,28.924
+1986-11-10,28.871
+1986-11-11,28.902
+1986-11-12,28.897
+1986-11-13,28.861
+1986-11-14,28.923
+1986-11-15,28.937
+1986-11-16,28.859
+1986-11-17,28.874
+1986-11-18,28.831
+1986-11-19,28.761
+1986-11-20,28.832
+1986-11-21,28.726
+1986-11-22,28.819
+1986-11-23,28.927
+1986-11-24,28.872
+1986-11-25,28.832
+1986-11-26,28.881
+1986-11-27,28.897
+1986-11-28,28.981
+1986-11-29,28.969
+1986-11-30,28.936
+1986-12-01,28.975
+1986-12-02,28.995
+1986-12-03,29.025
+1986-12-04,29.103
+1986-12-05,29.062
+1986-12-06,29.118
+1986-12-07,29.103
+1986-12-08,28.972
+1986-12-09,29.066
+1986-12-10,29.041
+1986-12-11,29.051
+1986-12-12,29.031
+1986-12-13,29.026
+1986-12-14,29.101
+1986-12-15,28.993
+1986-12-16,28.971
+1986-12-17,28.971
+1986-12-18,28.982
+1986-12-19,28.969
+1986-12-20,28.968
+1986-12-21,28.968
+1986-12-22,28.992
+1986-12-23,28.982
+1986-12-24,28.952
+1986-12-25,28.961
+1986-12-26,28.964
+1986-12-27,28.956
+1986-12-28,28.976
+1986-12-29,28.971
+1986-12-30,28.957
+1986-12-31,28.938
+1987-01-01,28.95
+1987-01-02,28.856
+1987-01-03,28.848
+1987-01-04,28.926
+1987-01-05,28.924
+1987-01-06,28.924
+1987-01-07,28.924
+1987-01-08,28.884
+1987-01-09,28.875
+1987-01-10,28.877
+1987-01-11,28.848
+1987-01-12,28.871
+1987-01-13,28.866
+1987-01-14,28.907
+1987-01-15,28.853
+1987-01-16,28.301
+1987-01-17,28.301
+1987-01-18,28.301
+1987-01-19,28.301
+1987-01-20,28.301
+1987-01-21,28.301
+1987-01-22,28.301
+1987-01-23,28.301
+1987-01-24,28.301
+1987-01-25,28.301
+1987-01-26,28.301
+1987-01-27,28.301
+1987-01-28,28.301
+1987-01-29,28.301
+1987-01-30,28.301
+1987-01-31,28.301
+1987-02-01,28.301
+1987-02-02,28.301
+1987-02-03,28.301
+1987-02-04,28.301
+1987-02-05,28.301
+1987-02-06,28.301
+1987-02-07,28.301
+1987-02-08,28.301
+1987-02-09,28.301
+1987-02-10,28.301
+1987-02-11,28.301
+1987-02-12,28.301
+1987-02-13,28.301
+1987-02-14,28.301
+1987-02-15,28.301
+1987-02-16,28.301
+1987-02-17,28.301
+1987-02-18,28.301
+1987-02-19,28.301
+1987-02-20,28.301
+1987-02-21,28.301
+1987-02-22,28.301
+1987-02-23,28.301
+1987-02-24,28.301
+1987-02-25,28.301
+1987-02-26,28.301
+1987-02-27,28.675
+1987-02-28,28.674
+1987-03-01,28.665
+1987-03-02,28.68
+1987-03-03,28.681
+1987-03-04,28.684
+1987-03-05,28.683
+1987-03-06,28.692
+1987-03-07,28.689
+1987-03-08,28.684
+1987-03-09,28.65
+1987-03-10,28.689
+1987-03-11,28.703
+1987-03-12,28.712
+1987-03-13,28.719
+1987-03-14,28.723
+1987-03-15,28.726
+1987-03-16,28.718
+1987-03-17,28.726
+1987-03-18,28.735
+1987-03-19,28.736
+1987-03-20,28.725
+1987-03-21,28.706
+1987-03-22,28.736
+1987-03-23,28.8
+1987-03-24,28.854
+1987-03-25,28.926
+1987-03-26,29.04
+1987-03-27,29.114
+1987-03-28,29.166
+1987-03-29,29.218
+1987-03-30,29.378
+1987-03-31,29.36
+1987-04-01,29.405
+1987-04-02,29.511
+1987-04-03,29.555
+1987-04-04,29.545
+1987-04-05,29.577
+1987-04-06,29.557
+1987-04-07,29.587
+1987-04-08,29.678
+1987-04-09,29.725
+1987-04-10,29.746
+1987-04-11,29.733
+1987-04-12,29.714
+1987-04-13,29.674
+1987-04-14,29.716
+1987-04-15,29.717
+1987-04-16,29.718
+1987-04-17,29.698
+1987-04-18,29.683
+1987-04-19,29.651
+1987-04-20,29.639
+1987-04-21,29.623
+1987-04-22,29.53
+1987-04-23,29.658
+1987-04-24,29.493
+1987-04-25,29.518
+1987-04-26,29.484
+1987-04-27,29.514
+1987-04-28,29.527
+1987-04-29,29.418
+1987-04-30,29.404
+1987-05-01,29.378
+1987-05-02,29.357
+1987-05-03,29.331
+1987-05-04,29.295
+1987-05-05,29.293
+1987-05-06,29.291
+1987-05-07,29.278
+1987-05-08,29.272
+1987-05-09,29.288
+1987-05-10,29.213
+1987-05-11,29.207
+1987-05-12,29.174
+1987-05-13,29.18
+1987-05-14,29.245
+1987-05-15,29.116
+1987-05-16,29.119
+1987-05-17,29.109
+1987-05-18,29.058
+1987-05-19,29.053
+1987-05-20,29.096
+1987-05-21,29.089
+1987-05-22,29.06
+1987-05-23,28.952
+1987-05-24,28.991
+1987-05-25,28.986
+1987-05-26,28.985
+1987-05-27,29.063
+1987-05-28,28.982
+1987-05-29,28.958
+1987-05-30,28.961
+1987-05-31,28.947
+1987-06-01,28.948
+1987-06-02,28.96
+1987-06-03,29.047
+1987-06-04,28.984
+1987-06-05,28.936
+1987-06-06,28.876
+1987-06-07,28.954
+1987-06-08,28.943
+1987-06-09,28.899
+1987-06-10,28.909
+1987-06-11,28.947
+1987-06-12,28.958
+1987-06-13,28.931
+1987-06-14,28.95
+1987-06-15,28.917
+1987-06-16,28.91
+1987-06-17,28.9
+1987-06-18,28.917
+1987-06-19,28.917
+1987-06-20,28.872
+1987-06-21,28.88
+1987-06-22,28.87
+1987-06-23,28.86
+1987-06-24,28.894
+1987-06-25,28.862
+1987-06-26,29.028
+1987-06-27,28.908
+1987-06-28,28.886
+1987-06-29,28.891
+1987-06-30,28.876
+1987-07-01,28.849
+1987-07-02,28.846
+1987-07-03,28.876
+1987-07-04,28.851
+1987-07-05,28.829
+1987-07-06,28.846
+1987-07-07,28.89
+1987-07-08,28.85
+1987-07-09,28.821
+1987-07-10,28.813
+1987-07-11,28.814
+1987-07-12,28.807
+1987-07-13,28.803
+1987-07-14,28.807
+1987-07-15,28.747
+1987-07-16,28.745
+1987-07-17,28.762
+1987-07-18,28.763
+1987-07-19,28.736
+1987-07-20,28.763
+1987-07-21,28.733
+1987-07-22,28.749
+1987-07-23,28.766
+1987-07-24,28.769
+1987-07-25,28.752
+1987-07-26,28.744
+1987-07-27,28.724
+1987-07-28,28.712
+1987-07-29,28.72
+1987-07-30,28.724
+1987-07-31,28.694
+1987-08-01,28.688
+1987-08-02,28.715
+1987-08-03,28.758
+1987-08-04,28.71
+1987-08-05,28.645
+1987-08-06,28.675
+1987-08-07,28.697
+1987-08-08,28.683
+1987-08-09,28.674
+1987-08-10,28.664
+1987-08-11,28.636
+1987-08-12,28.656
+1987-08-13,28.678
+1987-08-14,28.688
+1987-08-15,28.665
+1987-08-16,28.68
+1987-08-17,28.673
+1987-08-18,28.637
+1987-08-19,28.639
+1987-08-20,28.625
+1987-08-21,28.618
+1987-08-22,28.681
+1987-08-23,28.589
+1987-08-24,28.571
+1987-08-25,28.572
+1987-08-26,28.555
+1987-08-27,28.562
+1987-08-28,28.567
+1987-08-29,28.548
+1987-08-30,28.591
+1987-08-31,28.636
+1987-09-01,28.582
+1987-09-02,28.564
+1987-09-03,28.54
+1987-09-04,28.55
+1987-09-05,28.576
+1987-09-06,28.574
+1987-09-07,28.555
+1987-09-08,28.542
+1987-09-09,28.539
+1987-09-10,28.534
+1987-09-11,28.542
+1987-09-12,28.605
+1987-09-13,28.642
+1987-09-14,28.623
+1987-09-15,28.639
+1987-09-16,28.656
+1987-09-17,28.622
+1987-09-18,28.629
+1987-09-19,28.65
+1987-09-20,28.651
+1987-09-21,28.634
+1987-09-22,28.654
+1987-09-23,28.682
+1987-09-24,28.651
+1987-09-25,28.652
+1987-09-26,28.678
+1987-09-27,28.659
+1987-09-28,28.69
+1987-09-29,28.733
+1987-09-30,28.709
+1987-10-01,28.624
+1987-10-02,28.78
+1987-10-03,28.653
+1987-10-04,28.59
+1987-10-05,28.71
+1987-10-06,28.751
+1987-10-07,28.778
+1987-10-08,28.752
+1987-10-09,28.798
+1987-10-10,28.76
+1987-10-11,28.746
+1987-10-12,28.762
+1987-10-13,28.763
+1987-10-14,28.811
+1987-10-15,28.783
+1987-10-16,28.765
+1987-10-17,28.856
+1987-10-18,28.797
+1987-10-19,28.772
+1987-10-20,28.801
+1987-10-21,28.753
+1987-10-22,28.759
+1987-10-23,28.776
+1987-10-24,28.754
+1987-10-25,28.806
+1987-10-26,28.747
+1987-10-27,28.825
+1987-10-28,28.766
+1987-10-29,28.826
+1987-10-30,28.893
+1987-10-31,28.856
+1987-11-01,28.868
+1987-11-02,28.863
+1987-11-03,28.946
+1987-11-04,28.916
+1987-11-05,28.882
+1987-11-06,28.867
+1987-11-07,28.897
+1987-11-08,28.927
+1987-11-09,28.848
+1987-11-10,28.835
+1987-11-11,28.828
+1987-11-12,28.855
+1987-11-13,28.891
+1987-11-14,28.875
+1987-11-15,28.847
+1987-11-16,28.867
+1987-11-17,28.999
+1987-11-18,28.93
+1987-11-19,28.886
+1987-11-20,28.869
+1987-11-21,28.8
+1987-11-22,28.832
+1987-11-23,28.907
+1987-11-24,28.872
+1987-11-25,28.78
+1987-11-26,28.739
+1987-11-27,28.846
+1987-11-28,28.868
+1987-11-29,28.893
+1987-11-30,28.934
+1987-12-01,28.966
+1987-12-02,28.986
+1987-12-03,29.01
+1987-12-04,28.977
+1987-12-05,28.991
+1987-12-06,28.988
+1987-12-07,28.99
+1987-12-08,28.301
+1987-12-09,28.301
+1987-12-10,28.301
+1987-12-11,28.301
+1987-12-12,28.301
+1987-12-13,28.301
+1987-12-14,28.301
+1987-12-15,28.301
+1987-12-16,28.301
+1987-12-17,28.301
+1987-12-18,28.301
+1987-12-19,28.301
+1987-12-20,28.301
+1987-12-21,28.301
+1987-12-22,28.301
+1987-12-23,28.301
+1987-12-24,28.301
+1987-12-25,28.301
+1987-12-26,28.301
+1987-12-27,28.301
+1987-12-28,28.301
+1987-12-29,28.301
+1987-12-30,28.301
+1987-12-31,28.301
+1988-01-01,28.301
+1988-01-02,28.301
+1988-01-03,28.301
+1988-01-04,28.301
+1988-01-05,28.301
+1988-01-06,28.301
+1988-01-07,28.301
+1988-01-08,28.301
+1988-01-09,28.301
+1988-01-10,28.301
+1988-01-11,28.301
+1988-01-12,28.301
+1988-01-13,28.301
+1988-01-14,28.301
+1988-01-15,28.792
+1988-01-16,28.775
+1988-01-17,28.765
+1988-01-18,28.746
+1988-01-19,28.751
+1988-01-20,28.773
+1988-01-21,28.773
+1988-01-22,28.747
+1988-01-23,28.751
+1988-01-24,28.769
+1988-01-25,28.74
+1988-01-26,28.726
+1988-01-27,28.749
+1988-01-28,28.725
+1988-01-29,28.717
+1988-01-30,28.759
+1988-01-31,28.728
+1988-02-01,28.734
+1988-02-02,28.718
+1988-02-03,28.745
+1988-02-04,28.757
+1988-02-05,28.811
+1988-02-06,28.797
+1988-02-07,28.812
+1988-02-08,28.8
+1988-02-09,28.782
+1988-02-10,28.773
+1988-02-11,28.772
+1988-02-12,28.768
+1988-02-13,28.777
+1988-02-14,28.793
+1988-02-15,28.8
+1988-02-16,28.757
+1988-02-17,28.768
+1988-02-18,28.759
+1988-02-19,28.77
+1988-02-20,28.778
+1988-02-21,28.773
+1988-02-22,28.763
+1988-02-23,28.748
+1988-02-24,28.745
+1988-02-25,28.742
+1988-02-26,28.738
+1988-02-27,28.725
+1988-02-28,28.728
+1988-02-29,28.741
+1988-03-01,28.717
+1988-03-02,28.716
+1988-03-03,28.698
+1988-03-04,28.704
+1988-03-05,28.705
+1988-03-06,28.716
+1988-03-07,28.695
+1988-03-08,28.681
+1988-03-09,28.741
+1988-03-10,28.69
+1988-03-11,28.68
+1988-03-12,28.707
+1988-03-13,28.707
+1988-03-14,28.714
+1988-03-15,28.722
+1988-03-16,28.721
+1988-03-17,28.733
+1988-03-18,28.752
+1988-03-19,28.735
+1988-03-20,28.715
+1988-03-21,28.704
+1988-03-22,28.711
+1988-03-23,28.784
+1988-03-24,28.749
+1988-03-25,28.756
+1988-03-26,28.799
+1988-03-27,28.863
+1988-03-28,28.933
+1988-03-29,28.99
+1988-03-30,29.081
+1988-03-31,29.057
+1988-04-01,29.094
+1988-04-02,29.117
+1988-04-03,29.215
+1988-04-04,29.211
+1988-04-05,29.212
+1988-04-06,29.254
+1988-04-07,29.263
+1988-04-08,29.262
+1988-04-09,29.264
+1988-04-10,29.275
+1988-04-11,29.238
+1988-04-12,29.277
+1988-04-13,29.291
+1988-04-14,29.364
+1988-04-15,29.299
+1988-04-16,29.249
+1988-04-17,29.262
+1988-04-18,29.285
+1988-04-19,29.264
+1988-04-20,29.243
+1988-04-21,29.221
+1988-04-22,29.208
+1988-04-23,29.242
+1988-04-24,29.247
+1988-04-25,29.208
+1988-04-26,29.24
+1988-04-27,29.208
+1988-04-28,29.202
+1988-04-29,29.236
+1988-04-30,29.31
+1988-05-01,29.369
+1988-05-02,29.353
+1988-05-03,29.381
+1988-05-04,29.41
+1988-05-05,29.404
+1988-05-06,29.39
+1988-05-07,29.306
+1988-05-08,29.388
+1988-05-09,29.444
+1988-05-10,29.473
+1988-05-11,29.325
+1988-05-12,29.311
+1988-05-13,29.388
+1988-05-14,29.258
+1988-05-15,29.316
+1988-05-16,29.29
+1988-05-17,29.179
+1988-05-18,29.193
+1988-05-19,29.208
+1988-05-20,29.211
+1988-05-21,29.216
+1988-05-22,29.205
+1988-05-23,29.192
+1988-05-24,29.156
+1988-05-25,29.12
+1988-05-26,29.147
+1988-05-27,29.158
+1988-05-28,29.127
+1988-05-29,29.109
+1988-05-30,29.117
+1988-05-31,29.072
+1988-06-01,29.011
+1988-06-02,29.013
+1988-06-03,29.012
+1988-06-04,29.017
+1988-06-05,28.94
+1988-06-06,28.945
+1988-06-07,28.942
+1988-06-08,28.928
+1988-06-09,28.914
+1988-06-10,28.915
+1988-06-11,28.934
+1988-06-12,28.909
+1988-06-13,28.885
+1988-06-14,28.878
+1988-06-15,28.87
+1988-06-16,28.851
+1988-06-17,28.301
+1988-06-18,28.301
+1988-06-19,28.301
+1988-06-20,28.301
+1988-06-21,28.301
+1988-06-22,28.301
+1988-06-23,28.301
+1988-06-24,28.301
+1988-06-25,28.301
+1988-06-26,28.301
+1988-06-27,28.301
+1988-06-28,28.301
+1988-06-29,28.301
+1988-06-30,28.301
+1988-07-01,28.301
+1988-07-02,28.301
+1988-07-03,28.301
+1988-07-04,28.301
+1988-07-05,28.301
+1988-07-06,28.301
+1988-07-07,28.301
+1988-07-08,28.301
+1988-07-09,28.301
+1988-07-10,28.301
+1988-07-11,28.301
+1988-07-12,28.301
+1988-07-13,28.301
+1988-07-14,28.301
+1988-07-15,28.301
+1988-07-16,28.301
+1988-07-17,28.301
+1988-07-18,28.301
+1988-07-19,28.589
+1988-07-20,28.576
+1988-07-21,28.581
+1988-07-22,28.585
+1988-07-23,28.594
+1988-07-24,28.598
+1988-07-25,28.593
+1988-07-26,28.605
+1988-07-27,28.604
+1988-07-28,28.601
+1988-07-29,28.611
+1988-07-30,28.62
+1988-07-31,28.581
+1988-08-01,28.597
+1988-08-02,28.594
+1988-08-03,28.301
+1988-08-04,28.301
+1988-08-05,28.301
+1988-08-06,28.301
+1988-08-07,28.301
+1988-08-08,28.301
+1988-08-09,28.301
+1988-08-10,28.301
+1988-08-11,28.301
+1988-08-12,28.301
+1988-08-13,28.301
+1988-08-14,28.301
+1988-08-15,28.301
+1988-08-16,28.301
+1988-08-17,28.301
+1988-08-18,28.301
+1988-08-19,28.301
+1988-08-20,28.301
+1988-08-21,28.301
+1988-08-22,28.301
+1988-08-23,28.301
+1988-08-24,28.301
+1988-08-25,28.301
+1988-08-26,28.301
+1988-08-27,28.301
+1988-08-28,28.301
+1988-08-29,28.301
+1988-08-30,28.301
+1988-08-31,28.301
+1988-09-01,28.301
+1988-09-02,28.301
+1988-09-03,28.301
+1988-09-04,28.301
+1988-09-05,28.301
+1988-09-06,28.301
+1988-09-07,28.301
+1988-09-08,28.301
+1988-09-09,28.301
+1988-09-10,28.301
+1988-09-11,28.301
+1988-09-12,28.301
+1988-09-13,28.301
+1988-09-14,28.301
+1988-09-15,28.604
+1988-09-16,28.617
+1988-09-17,28.69
+1988-09-18,28.676
+1988-09-19,28.301
+1988-09-20,28.301
+1988-09-21,28.301
+1988-09-22,28.301
+1988-09-23,28.301
+1988-09-24,28.301
+1988-09-25,28.301
+1988-09-26,28.301
+1988-09-27,28.301
+1988-09-28,28.301
+1988-09-29,28.301
+1988-09-30,28.301
+1988-10-01,28.301
+1988-10-02,28.301
+1988-10-03,28.301
+1988-10-04,28.301
+1988-10-05,28.301
+1988-10-06,28.554
+1988-10-07,28.301
+1988-10-08,28.301
+1988-10-09,28.301
+1988-10-10,28.301
+1988-10-11,28.301
+1988-10-12,28.301
+1988-10-13,28.502
+1988-10-14,28.301
+1988-10-15,28.301
+1988-10-16,28.301
+1988-10-17,28.301
+1988-10-18,28.301
+1988-10-19,28.503
+1988-10-20,28.301
+1988-10-21,28.301
+1988-10-22,28.301
+1988-10-23,28.301
+1988-10-24,28.301
+1988-10-25,28.301
+1988-10-26,28.301
+1988-10-27,28.301
+1988-10-28,28.301
+1988-10-29,28.301
+1988-10-30,28.301
+1988-10-31,28.301
+1988-11-01,28.301
+1988-11-02,28.301
+1988-11-03,28.301
+1988-11-04,28.301
+1988-11-05,28.301
+1988-11-06,28.301
+1988-11-07,28.301
+1988-11-08,28.301
+1988-11-09,28.301
+1988-11-10,28.301
+1988-11-11,28.301
+1988-11-12,28.301
+1988-11-13,28.301
+1988-11-14,28.301
+1988-11-15,28.301
+1988-11-16,28.301
+1988-11-17,28.301
+1988-11-18,28.301
+1988-11-19,28.301
+1988-11-20,28.301
+1988-11-21,28.301
+1988-11-22,28.301
+1988-11-23,28.301
+1988-11-24,28.301
+1988-11-25,28.301
+1988-11-26,28.301
+1988-11-27,28.301
+1988-11-28,29
+1988-11-29,28.989
+1988-11-30,29.069
+1988-12-01,29.04
+1988-12-02,29.026
+1988-12-03,28.301
+1988-12-04,28.301
+1988-12-05,28.301
+1988-12-06,28.301
+1988-12-07,28.301
+1988-12-08,28.969
+1988-12-09,28.957
+1988-12-10,28.996
+1988-12-11,29.004
+1988-12-12,28.984
+1988-12-13,28.928
+1988-12-14,28.995
+1988-12-15,28.959
+1988-12-16,28.95
+1988-12-17,28.956
+1988-12-18,28.956
+1988-12-19,28.954
+1988-12-20,28.919
+1988-12-21,28.927
+1988-12-22,28.943
+1988-12-23,28.875
+1988-12-24,28.9
+1988-12-25,28.895
+1988-12-26,28.894
+1988-12-27,28.872
+1988-12-28,28.859
+1988-12-29,28.854
+1988-12-30,28.858
+1988-12-31,28.856
+1989-01-01,28.77
+1989-01-02,28.763
+1989-01-03,28.736
+1989-01-04,28.787
+1989-01-05,28.799
+1989-01-06,28.772
+1989-01-07,28.726
+1989-01-08,28.747
+1989-01-09,28.706
+1989-01-10,28.72
+1989-01-11,28.685
+1989-01-12,28.745
+1989-01-13,28.665
+1989-01-14,28.686
+1989-01-15,28.686
+1989-01-16,28.657
+1989-01-17,28.685
+1989-01-18,28.656
+1989-01-19,28.661
+1989-01-20,28.655
+1989-01-21,28.646
+1989-01-22,28.685
+1989-01-23,28.638
+1989-01-24,28.62
+1989-01-25,28.616
+1989-01-26,28.661
+1989-01-27,28.608
+1989-01-28,28.625
+1989-01-29,28.607
+1989-01-30,28.626
+1989-01-31,28.633
+1989-02-01,28.592
+1989-02-02,28.567
+1989-02-03,28.598
+1989-02-04,28.615
+1989-02-05,28.616
+1989-02-06,28.592
+1989-02-07,28.584
+1989-02-08,28.59
+1989-02-09,28.585
+1989-02-10,28.598
+1989-02-11,28.574
+1989-02-12,28.562
+1989-02-13,28.563
+1989-02-14,28.563
+1989-02-15,28.55
+1989-02-16,28.551
+1989-02-17,28.575
+1989-02-18,28.566
+1989-02-19,28.558
+1989-02-20,28.542
+1989-02-21,28.541
+1989-02-22,28.549
+1989-02-23,28.556
+1989-02-24,28.567
+1989-02-25,28.57
+1989-02-26,28.573
+1989-02-27,28.573
+1989-02-28,28.572
+1989-03-01,28.586
+1989-03-02,28.587
+1989-03-03,28.56
+1989-03-04,28.552
+1989-03-05,28.576
+1989-03-06,28.561
+1989-03-07,28.569
+1989-03-08,28.563
+1989-03-09,28.556
+1989-03-10,28.553
+1989-03-11,28.556
+1989-03-12,28.528
+1989-03-13,28.555
+1989-03-14,28.575
+1989-03-15,28.702
+1989-03-16,28.609
+1989-03-17,28.645
+1989-03-18,28.615
+1989-03-19,28.657
+1989-03-20,28.691
+1989-03-21,28.684
+1989-03-22,28.677
+1989-03-23,28.682
+1989-03-24,28.696
+1989-03-25,28.683
+1989-03-26,28.709
+1989-03-27,28.78
+1989-03-28,28.824
+1989-03-29,28.798
+1989-03-30,28.95
+1989-03-31,29.023
+1989-04-01,29.088
+1989-04-02,29.147
+1989-04-03,29.183
+1989-04-04,29.225
+1989-04-05,29.241
+1989-04-06,29.283
+1989-04-07,29.408
+1989-04-08,29.413
+1989-04-09,29.466
+1989-04-10,29.494
+1989-04-11,29.491
+1989-04-12,29.489
+1989-04-13,29.526
+1989-04-14,29.482
+1989-04-15,29.524
+1989-04-16,29.453
+1989-04-17,29.468
+1989-04-18,29.445
+1989-04-19,29.465
+1989-04-20,29.47
+1989-04-21,29.459
+1989-04-22,29.4
+1989-04-23,29.409
+1989-04-24,29.416
+1989-04-25,29.407
+1989-04-26,29.4
+1989-04-27,29.358
+1989-04-28,29.355
+1989-04-29,29.363
+1989-04-30,29.346
+1989-05-01,29.33
+1989-05-02,29.311
+1989-05-03,29.39
+1989-05-04,29.412
+1989-05-05,29.46
+1989-05-06,29.454
+1989-05-07,29.51
+1989-05-08,29.587
+1989-05-09,29.597
+1989-05-10,29.557
+1989-05-11,29.556
+1989-05-12,29.499
+1989-05-13,29.468
+1989-05-14,29.462
+1989-05-15,29.455
+1989-05-16,29.474
+1989-05-17,29.485
+1989-05-18,29.492
+1989-05-19,29.5
+1989-05-20,29.515
+1989-05-21,29.53
+1989-05-22,29.533
+1989-05-23,29.508
+1989-05-24,29.486
+1989-05-25,29.483
+1989-05-26,29.475
+1989-05-27,29.44
+1989-05-28,29.391
+1989-05-29,29.409
+1989-05-30,29.379
+1989-05-31,29.35
+1989-06-01,29.345
+1989-06-02,29.322
+1989-06-03,29.341
+1989-06-04,29.334
+1989-06-05,29.324
+1989-06-06,29.314
+1989-06-07,29.325
+1989-06-08,29.289
+1989-06-09,29.264
+1989-06-10,29.293
+1989-06-11,29.251
+1989-06-12,29.264
+1989-06-13,29.258
+1989-06-14,29.258
+1989-06-15,29.267
+1989-06-16,29.239
+1989-06-17,29.254
+1989-06-18,29.247
+1989-06-19,29.232
+1989-06-20,29.216
+1989-06-21,29.21
+1989-06-22,29.198
+1989-06-23,29.178
+1989-06-24,29.155
+1989-06-25,29.133
+1989-06-26,29.127
+1989-06-27,29.129
+1989-06-28,29.079
+1989-06-29,29.035
+1989-06-30,29.027
+1989-07-01,29.018
+1989-07-02,29.011
+1989-07-03,28.994
+1989-07-04,29.004
+1989-07-05,28.988
+1989-07-06,28.965
+1989-07-07,28.924
+1989-07-08,28.895
+1989-07-09,28.901
+1989-07-10,28.94
+1989-07-11,28.884
+1989-07-12,28.895
+1989-07-13,28.887
+1989-07-14,28.866
+1989-07-15,28.869
+1989-07-16,28.87
+1989-07-17,28.867
+1989-07-18,28.872
+1989-07-19,28.847
+1989-07-20,28.81
+1989-07-21,28.821
+1989-07-22,28.832
+1989-07-23,28.818
+1989-07-24,28.821
+1989-07-25,28.814
+1989-07-26,28.801
+1989-07-27,28.801
+1989-07-28,28.766
+1989-07-29,28.758
+1989-07-30,28.76
+1989-07-31,28.768
+1989-08-01,28.771
+1989-08-02,28.779
+1989-08-03,28.763
+1989-08-04,28.794
+1989-08-05,28.771
+1989-08-06,28.819
+1989-08-07,28.818
+1989-08-08,28.821
+1989-08-09,28.825
+1989-08-10,28.834
+1989-08-11,28.83
+1989-08-12,28.824
+1989-08-13,28.82
+1989-08-14,28.833
+1989-08-15,28.855
+1989-08-16,28.848
+1989-08-17,28.818
+1989-08-18,28.818
+1989-08-19,28.831
+1989-08-20,28.835
+1989-08-21,28.854
+1989-08-22,28.823
+1989-08-23,28.808
+1989-08-24,28.795
+1989-08-25,28.785
+1989-08-26,28.775
+1989-08-27,28.796
+1989-08-28,28.805
+1989-08-29,28.821
+1989-08-30,28.816
+1989-08-31,28.766
+1989-09-01,28.827
+1989-09-02,28.769
+1989-09-03,28.773
+1989-09-04,28.781
+1989-09-05,28.832
+1989-09-06,28.826
+1989-09-07,28.794
+1989-09-08,28.798
+1989-09-09,28.784
+1989-09-10,28.774
+1989-09-11,28.724
+1989-09-12,28.735
+1989-09-13,28.732
+1989-09-14,28.714
+1989-09-15,28.718
+1989-09-16,28.753
+1989-09-17,28.745
+1989-09-18,28.753
+1989-09-19,28.759
+1989-09-20,28.8
+1989-09-21,28.841
+1989-09-22,28.94
+1989-09-23,28.956
+1989-09-24,28.891
+1989-09-25,28.947
+1989-09-26,28.917
+1989-09-27,28.881
+1989-09-28,28.959
+1989-09-29,28.938
+1989-09-30,28.888
+1989-10-01,28.929
+1989-10-02,28.952
+1989-10-03,28.885
+1989-10-04,28.875
+1989-10-05,28.85
+1989-10-06,28.905
+1989-10-07,28.857
+1989-10-08,28.833
+1989-10-09,28.823
+1989-10-10,28.839
+1989-10-11,28.841
+1989-10-12,28.866
+1989-10-13,28.812
+1989-10-14,28.795
+1989-10-15,28.795
+1989-10-16,28.888
+1989-10-17,28.682
+1989-10-18,28.731
+1989-10-19,28.742
+1989-10-20,28.835
+1989-10-21,28.913
+1989-10-22,28.98
+1989-10-23,29.019
+1989-10-24,29.037
+1989-10-25,29.023
+1989-10-26,29.028
+1989-10-27,29.034
+1989-10-28,29.032
+1989-10-29,29.035
+1989-10-30,29.045
+1989-10-31,29.045
+1989-11-01,29.06
+1989-11-02,29.026
+1989-11-03,29.03
+1989-11-04,29.016
+1989-11-05,29.085
+1989-11-06,29.211
+1989-11-07,29.014
+1989-11-08,29.009
+1989-11-09,29.079
+1989-11-10,29.097
+1989-11-11,29.161
+1989-11-12,29.084
+1989-11-13,29.121
+1989-11-14,29.114
+1989-11-15,29.103
+1989-11-16,29.184
+1989-11-17,29.19
+1989-11-18,29.158
+1989-11-19,29.137
+1989-11-20,29.189
+1989-11-21,29.02
+1989-11-22,29.115
+1989-11-23,29.11
+1989-11-24,29.142
+1989-11-25,29.152
+1989-11-26,29.117
+1989-11-27,29.083
+1989-11-28,29.222
+1989-11-29,29.084
+1989-11-30,29.136
+1989-12-01,29.049
+1989-12-02,29.07
+1989-12-03,29.026
+1989-12-04,29.02
+1989-12-05,29.041
+1989-12-06,29.018
+1989-12-07,29.001
+1989-12-08,29.014
+1989-12-09,28.979
+1989-12-10,28.958
+1989-12-11,28.937
+1989-12-12,28.928
+1989-12-13,28.931
+1989-12-14,28.972
+1989-12-15,28.982
+1989-12-16,28.946
+1989-12-17,28.964
+1989-12-18,28.976
+1989-12-19,28.959
+1989-12-20,28.924
+1989-12-21,28.949
+1989-12-22,28.988
+1989-12-23,28.98
+1989-12-24,28.962
+1989-12-25,28.941
+1989-12-26,28.908
+1989-12-27,28.889
+1989-12-28,28.869
+1989-12-29,28.879
+1989-12-30,28.874
+1989-12-31,28.875
+1990-01-01,28.837
+1990-01-02,28.832
+1990-01-03,28.824
+1990-01-04,28.847
+1990-01-05,28.816
+1990-01-06,28.826
+1990-01-07,28.836
+1990-01-08,28.811
+1990-01-09,28.818
+1990-01-10,28.792
+1990-01-11,28.824
+1990-01-12,28.819
+1990-01-13,28.788
+1990-01-14,28.759
+1990-01-15,28.789
+1990-01-16,28.759
+1990-01-17,28.789
+1990-01-18,28.819
+1990-01-19,28.806
+1990-01-20,28.854
+1990-01-21,28.75
+1990-01-22,28.814
+1990-01-23,28.841
+1990-01-24,28.887
+1990-01-25,28.875
+1990-01-26,28.931
+1990-01-27,28.992
+1990-01-28,29.078
+1990-01-29,29.012
+1990-01-30,28.994
+1990-01-31,29.046
+1990-02-01,29.08
+1990-02-02,28.964
+1990-02-03,28.956
+1990-02-04,28.985
+1990-02-05,29.021
+1990-02-06,29.027
+1990-02-07,28.993
+1990-02-08,29.006
+1990-02-09,29.039
+1990-02-10,29.055
+1990-02-11,29.098
+1990-02-12,29.098
+1990-02-13,29.239
+1990-02-14,29.084
+1990-02-15,29.085
+1990-02-16,29.05
+1990-02-17,29.065
+1990-02-18,29.097
+1990-02-19,29.091
+1990-02-20,29.092
+1990-02-21,29.102
+1990-02-22,29.093
+1990-02-23,29.086
+1990-02-24,29.109
+1990-02-25,29.106
+1990-02-26,29.15
+1990-02-27,29.154
+1990-02-28,29.153
+1990-03-01,29.152
+1990-03-02,29.15
+1990-03-03,29.114
+1990-03-04,29.135
+1990-03-05,29.124
+1990-03-06,29.108
+1990-03-07,29.099
+1990-03-08,29.099
+1990-03-09,29.109
+1990-03-10,29.121
+1990-03-11,29.12
+1990-03-12,29.13
+1990-03-13,29.153
+1990-03-14,29.176
+1990-03-15,29.217
+1990-03-16,29.291
+1990-03-17,29.411
+1990-03-18,29.51
+1990-03-19,29.553
+1990-03-20,29.572
+1990-03-21,29.626
+1990-03-22,29.743
+1990-03-23,29.725
+1990-03-24,29.721
+1990-03-25,29.749
+1990-03-26,29.718
+1990-03-27,29.708
+1990-03-28,29.707
+1990-03-29,29.67
+1990-03-30,29.698
+1990-03-31,29.67
+1990-04-01,29.65
+1990-04-02,29.647
+1990-04-03,29.629
+1990-04-04,29.72
+1990-04-05,29.847
+1990-04-06,29.861
+1990-04-07,29.854
+1990-04-08,29.848
+1990-04-09,29.861
+1990-04-10,29.825
+1990-04-11,29.837
+1990-04-12,29.929
+1990-04-13,29.951
+1990-04-14,29.968
+1990-04-15,29.974
+1990-04-16,29.919
+1990-04-17,29.941
+1990-04-18,29.876
+1990-04-19,29.902
+1990-04-20,29.902
+1990-04-21,29.836
+1990-04-22,29.841
+1990-04-23,29.814
+1990-04-24,29.815
+1990-04-25,29.834
+1990-04-26,29.788
+1990-04-27,29.784
+1990-04-28,29.748
+1990-04-29,29.784
+1990-04-30,29.747
+1990-05-01,29.718
+1990-05-02,29.671
+1990-05-03,29.653
+1990-05-04,29.629
+1990-05-05,29.596
+1990-05-06,29.588
+1990-05-07,29.6
+1990-05-08,29.601
+1990-05-09,29.609
+1990-05-10,29.602
+1990-05-11,29.573
+1990-05-12,29.552
+1990-05-13,29.548
+1990-05-14,29.55
+1990-05-15,29.585
+1990-05-16,29.558
+1990-05-17,29.612
+1990-05-18,29.626
+1990-05-19,29.601
+1990-05-20,29.579
+1990-05-21,29.581
+1990-05-22,29.598
+1990-05-23,29.603
+1990-05-24,29.628
+1990-05-25,29.621
+1990-05-26,29.614
+1990-05-27,29.604
+1990-05-28,29.587
+1990-05-29,29.507
+1990-05-30,29.471
+1990-05-31,29.524
+1990-06-01,29.524
+1990-06-02,29.5
+1990-06-03,29.503
+1990-06-04,29.462
+1990-06-05,29.422
+1990-06-06,29.439
+1990-06-07,29.389
+1990-06-08,29.381
+1990-06-09,29.355
+1990-06-10,29.326
+1990-06-11,29.248
+1990-06-12,29.307
+1990-06-13,29.317
+1990-06-14,29.317
+1990-06-15,29.284
+1990-06-16,29.245
+1990-06-17,29.246
+1990-06-18,29.282
+1990-06-19,29.202
+1990-06-20,29.174
+1990-06-21,29.176
+1990-06-22,29.173
+1990-06-23,29.181
+1990-06-24,29.174
+1990-06-25,29.159
+1990-06-26,29.165
+1990-06-27,29.139
+1990-06-28,29.09
+1990-06-29,29.086
+1990-06-30,29.062
+1990-07-01,29.054
+1990-07-02,29.056
+1990-07-03,29.072
+1990-07-04,29.061
+1990-07-05,29.03
+1990-07-06,29.055
+1990-07-07,29.057
+1990-07-08,29.084
+1990-07-09,29.097
+1990-07-10,29.036
+1990-07-11,29.02
+1990-07-12,28.994
+1990-07-13,28.987
+1990-07-14,28.996
+1990-07-15,29.002
+1990-07-16,28.982
+1990-07-17,28.973
+1990-07-18,28.961
+1990-07-19,28.933
+1990-07-20,28.928
+1990-07-21,28.91
+1990-07-22,28.885
+1990-07-23,28.893
+1990-07-24,28.926
+1990-07-25,28.936
+1990-07-26,28.941
+1990-07-27,28.931
+1990-07-28,28.928
+1990-07-29,28.927
+1990-07-30,28.938
+1990-07-31,28.913
+1990-08-01,28.874
+1990-08-02,28.874
+1990-08-03,28.877
+1990-08-04,28.879
+1990-08-05,28.889
+1990-08-06,28.897
+1990-08-07,28.871
+1990-08-08,28.903
+1990-08-09,28.934
+1990-08-10,28.944
+1990-08-11,28.958
+1990-08-12,28.981
+1990-08-13,28.995
+1990-08-14,29.059
+1990-08-15,29.097
+1990-08-16,29.104
+1990-08-17,29.127
+1990-08-18,29.11
+1990-08-19,29.053
+1990-08-20,29.094
+1990-08-21,29.108
+1990-08-22,29.105
+1990-08-23,29.094
+1990-08-24,29.093
+1990-08-25,29.086
+1990-08-26,29.081
+1990-08-27,29.082
+1990-08-28,29.081
+1990-08-29,29.08
+1990-08-30,29.066
+1990-08-31,29.075
+1990-09-01,29.088
+1990-09-02,29.037
+1990-09-03,28.995
+1990-09-04,29.042
+1990-09-05,29.027
+1990-09-06,29.008
+1990-09-07,28.963
+1990-09-08,28.965
+1990-09-09,29.027
+1990-09-10,28.985
+1990-09-11,28.944
+1990-09-12,28.953
+1990-09-13,28.929
+1990-09-14,29.018
+1990-09-15,28.992
+1990-09-16,28.928
+1990-09-17,28.897
+1990-09-18,28.886
+1990-09-19,28.91
+1990-09-20,28.888
+1990-09-21,28.877
+1990-09-22,28.932
+1990-09-23,28.877
+1990-09-24,28.87
+1990-09-25,28.898
+1990-09-26,28.86
+1990-09-27,28.839
+1990-09-28,28.831
+1990-09-29,28.787
+1990-09-30,28.843
+1990-10-01,28.829
+1990-10-02,28.84
+1990-10-03,28.83
+1990-10-04,28.956
+1990-10-05,28.86
+1990-10-06,28.884
+1990-10-07,28.817
+1990-10-08,28.794
+1990-10-09,28.796
+1990-10-10,28.81
+1990-10-11,28.91
+1990-10-12,28.898
+1990-10-13,28.909
+1990-10-14,28.936
+1990-10-15,28.998
+1990-10-16,28.994
+1990-10-17,29.057
+1990-10-18,29.116
+1990-10-19,29.07
+1990-10-20,29.067
+1990-10-21,29.169
+1990-10-22,29.133
+1990-10-23,29.06
+1990-10-24,29.169
+1990-10-25,29.261
+1990-10-26,29.253
+1990-10-27,29.34
+1990-10-28,29.426
+1990-10-29,29.323
+1990-10-30,29.362
+1990-10-31,29.344
+1990-11-01,29.337
+1990-11-02,29.37
+1990-11-03,29.333
+1990-11-04,29.327
+1990-11-05,29.279
+1990-11-06,29.331
+1990-11-07,29.288
+1990-11-08,29.268
+1990-11-09,29.284
+1990-11-10,29.292
+1990-11-11,29.354
+1990-11-12,29.377
+1990-11-13,29.388
+1990-11-14,29.429
+1990-11-15,29.476
+1990-11-16,29.452
+1990-11-17,29.409
+1990-11-18,29.459
+1990-11-19,29.476
+1990-11-20,29.514
+1990-11-21,29.508
+1990-11-22,29.579
+1990-11-23,29.557
+1990-11-24,29.528
+1990-11-25,29.572
+1990-11-26,29.471
+1990-11-27,29.6
+1990-11-28,29.569
+1990-11-29,29.463
+1990-11-30,29.452
+1990-12-01,29.525
+1990-12-02,29.416
+1990-12-03,29.377
+1990-12-04,29.435
+1990-12-05,29.435
+1990-12-06,29.47
+1990-12-07,29.426
+1990-12-08,29.41
+1990-12-09,29.406
+1990-12-10,29.349
+1990-12-11,29.359
+1990-12-12,29.362
+1990-12-13,29.395
+1990-12-14,29.298
+1990-12-15,29.332
+1990-12-16,29.26
+1990-12-17,29.276
+1990-12-18,29.382
+1990-12-19,29.261
+1990-12-20,29.248
+1990-12-21,29.377
+1990-12-22,29.304
+1990-12-23,29.362
+1990-12-24,29.392
+1990-12-25,29.565
+1990-12-26,29.572
+1990-12-27,29.502
+1990-12-28,29.512
+1990-12-29,29.425
+1990-12-30,29.47
+1990-12-31,29.583
+1991-01-01,29.7
+1991-01-02,29.675
+1991-01-03,29.574
+1991-01-04,29.626
+1991-01-05,29.626
+1991-01-06,29.577
+1991-01-07,29.547
+1991-01-08,29.549
+1991-01-09,29.588
+1991-01-10,29.55
+1991-01-11,29.557
+1991-01-12,29.533
+1991-01-13,29.519
+1991-01-14,29.526
+1991-01-15,29.482
+1991-01-16,29.466
+1991-01-17,29.463
+1991-01-18,29.472
+1991-01-19,29.472
+1991-01-20,29.43
+1991-01-21,29.414
+1991-01-22,29.444
+1991-01-23,29.464
+1991-01-24,29.396
+1991-01-25,29.384
+1991-01-26,29.349
+1991-01-27,29.334
+1991-01-28,29.314
+1991-01-29,29.272
+1991-01-30,29.253
+1991-01-31,29.254
+1991-02-01,29.263
+1991-02-02,29.262
+1991-02-03,29.204
+1991-02-04,29.197
+1991-02-05,29.19
+1991-02-06,29.193
+1991-02-07,29.235
+1991-02-08,29.258
+1991-02-09,29.268
+1991-02-10,29.264
+1991-02-11,29.252
+1991-02-12,29.171
+1991-02-13,29.216
+1991-02-14,29.204
+1991-02-15,29.216
+1991-02-16,29.198
+1991-02-17,29.185
+1991-02-18,29.151
+1991-02-19,29.168
+1991-02-20,29.176
+1991-02-21,29.188
+1991-02-22,29.172
+1991-02-23,29.107
+1991-02-24,29.135
+1991-02-25,29.108
+1991-02-26,29.111
+1991-02-27,29.118
+1991-02-28,29.124
+1991-03-01,29.117
+1991-03-02,29.156
+1991-03-03,29.068
+1991-03-04,29.14
+1991-03-05,29.274
+1991-03-06,29.348
+1991-03-07,29.398
+1991-03-08,29.378
+1991-03-09,29.35
+1991-03-10,29.37
+1991-03-11,29.356
+1991-03-12,29.361
+1991-03-13,29.361
+1991-03-14,29.344
+1991-03-15,29.315
+1991-03-16,29.342
+1991-03-17,29.335
+1991-03-18,29.327
+1991-03-19,29.311
+1991-03-20,29.279
+1991-03-21,29.296
+1991-03-22,29.248
+1991-03-23,29.313
+1991-03-24,29.305
+1991-03-25,29.292
+1991-03-26,29.307
+1991-03-27,29.4
+1991-03-28,29.541
+1991-03-29,29.355
+1991-03-30,29.327
+1991-03-31,29.393
+1991-04-01,29.383
+1991-04-02,29.373
+1991-04-03,29.365
+1991-04-04,29.378
+1991-04-05,29.371
+1991-04-06,29.359
+1991-04-07,29.371
+1991-04-08,29.388
+1991-04-09,29.419
+1991-04-10,29.531
+1991-04-11,29.574
+1991-04-12,29.542
+1991-04-13,29.593
+1991-04-14,29.584
+1991-04-15,29.609
+1991-04-16,29.598
+1991-04-17,29.565
+1991-04-18,29.569
+1991-04-19,29.57
+1991-04-20,29.529
+1991-04-21,29.408
+1991-04-22,29.533
+1991-04-23,29.652
+1991-04-24,29.644
+1991-04-25,29.633
+1991-04-26,29.643
+1991-04-27,29.591
+1991-04-28,29.586
+1991-04-29,29.6
+1991-04-30,29.601
+1991-05-01,29.589
+1991-05-02,29.57
+1991-05-03,29.528
+1991-05-04,29.512
+1991-05-05,29.522
+1991-05-06,29.507
+1991-05-07,29.505
+1991-05-08,29.522
+1991-05-09,29.516
+1991-05-10,29.499
+1991-05-11,29.499
+1991-05-12,29.452
+1991-05-13,29.446
+1991-05-14,29.398
+1991-05-15,29.4
+1991-05-16,29.407
+1991-05-17,29.305
+1991-05-18,29.313
+1991-05-19,29.348
+1991-05-20,29.339
+1991-05-21,29.327
+1991-05-22,29.275
+1991-05-23,29.281
+1991-05-24,29.282
+1991-05-25,29.216
+1991-05-26,29.218
+1991-05-27,29.261
+1991-05-28,29.193
+1991-05-29,29.173
+1991-05-30,29.163
+1991-05-31,29.15
+1991-06-01,29.146
+1991-06-02,29.138
+1991-06-03,29.123
+1991-06-04,29.044
+1991-06-05,29.054
+1991-06-06,29.076
+1991-06-07,29.076
+1991-06-08,29.041
+1991-06-09,29.027
+1991-06-10,29.054
+1991-06-11,29.022
+1991-06-12,28.995
+1991-06-13,28.916
+1991-06-14,28.939
+1991-06-15,28.933
+1991-06-16,28.909
+1991-06-17,28.919
+1991-06-18,28.935
+1991-06-19,28.932
+1991-06-20,28.914
+1991-06-21,28.87
+1991-06-22,28.852
+1991-06-23,28.841
+1991-06-24,28.838
+1991-06-25,28.841
+1991-06-26,28.829
+1991-06-27,28.823
+1991-06-28,28.811
+1991-06-29,28.745
+1991-06-30,28.718
+1991-07-01,28.71
+1991-07-02,28.717
+1991-07-03,28.721
+1991-07-04,28.74
+1991-07-05,28.767
+1991-07-06,28.737
+1991-07-07,28.725
+1991-07-08,28.693
+1991-07-09,28.658
+1991-07-10,28.658
+1991-07-11,28.657
+1991-07-12,28.659
+1991-07-13,28.663
+1991-07-14,28.623
+1991-07-15,28.633
+1991-07-16,28.644
+1991-07-17,28.638
+1991-07-18,28.625
+1991-07-19,28.627
+1991-07-20,28.619
+1991-07-21,28.596
+1991-07-22,28.566
+1991-07-23,28.594
+1991-07-24,28.588
+1991-07-25,28.578
+1991-07-26,28.567
+1991-07-27,28.537
+1991-07-28,28.533
+1991-07-29,28.534
+1991-07-30,28.55
+1991-07-31,28.56
+1991-08-01,28.547
+1991-08-02,28.511
+1991-08-03,28.508
+1991-08-04,28.508
+1991-08-05,28.502
+1991-08-06,28.485
+1991-08-07,28.496
+1991-08-08,28.495
+1991-08-09,28.494
+1991-08-10,28.5
+1991-08-11,28.498
+1991-08-12,28.492
+1991-08-13,28.505
+1991-08-14,28.508
+1991-08-15,28.519
+1991-08-16,28.495
+1991-08-17,28.533
+1991-08-18,28.486
+1991-08-19,28.377
+1991-08-20,28.432
+1991-08-21,28.463
+1991-08-22,28.491
+1991-08-23,28.451
+1991-08-24,28.421
+1991-08-25,28.473
+1991-08-26,28.533
+1991-08-27,28.486
+1991-08-28,28.448
+1991-08-29,28.451
+1991-08-30,28.47
+1991-08-31,28.397
+1991-09-01,28.404
+1991-09-02,28.451
+1991-09-03,28.498
+1991-09-04,28.48
+1991-09-05,28.445
+1991-09-06,28.433
+1991-09-07,28.431
+1991-09-08,28.419
+1991-09-09,28.408
+1991-09-10,28.485
+1991-09-11,28.372
+1991-09-12,28.403
+1991-09-13,28.404
+1991-09-14,28.413
+1991-09-15,28.481
+1991-09-16,28.465
+1991-09-17,28.454
+1991-09-18,28.455
+1991-09-19,28.462
+1991-09-20,28.454
+1991-09-21,28.472
+1991-09-22,28.518
+1991-09-23,28.634
+1991-09-24,28.49
+1991-09-25,28.478
+1991-09-26,28.524
+1991-09-27,28.552
+1991-09-28,28.533
+1991-09-29,28.532
+1991-09-30,28.533
+1991-10-01,28.632
+1991-10-02,28.561
+1991-10-03,28.559
+1991-10-04,28.541
+1991-10-05,28.639
+1991-10-06,28.585
+1991-10-07,28.613
+1991-10-08,28.64
+1991-10-09,28.756
+1991-10-10,28.669
+1991-10-11,28.624
+1991-10-12,28.624
+1991-10-13,28.656
+1991-10-14,28.664
+1991-10-15,28.763
+1991-10-16,28.686
+1991-10-17,28.71
+1991-10-18,28.738
+1991-10-19,28.715
+1991-10-20,28.75
+1991-10-21,28.803
+1991-10-22,28.784
+1991-10-23,28.789
+1991-10-24,28.841
+1991-10-25,28.844
+1991-10-26,28.779
+1991-10-27,28.758
+1991-10-28,28.635
+1991-10-29,28.7
+1991-10-30,28.666
+1991-10-31,28.678
+1991-11-01,28.702
+1991-11-02,28.749
+1991-11-03,28.726
+1991-11-04,28.715
+1991-11-05,28.709
+1991-11-06,28.791
+1991-11-07,28.67
+1991-11-08,28.674
+1991-11-09,28.671
+1991-11-10,28.643
+1991-11-11,28.474
+1991-11-12,28.633
+1991-11-13,28.671
+1991-11-14,28.66
+1991-11-15,28.715
+1991-11-16,28.62
+1991-11-17,28.641
+1991-11-18,28.681
+1991-11-19,28.704
+1991-11-20,28.691
+1991-11-21,28.656
+1991-11-22,28.655
+1991-11-23,28.664
+1991-11-24,28.711
+1991-11-25,28.751
+1991-11-26,28.716
+1991-11-27,28.765
+1991-11-28,28.813
+1991-11-29,28.712
+1991-11-30,28.871
+1991-12-01,28.734
+1991-12-02,28.67
+1991-12-03,28.74
+1991-12-04,28.716
+1991-12-05,28.687
+1991-12-06,28.687
+1991-12-07,28.73
+1991-12-08,28.684
+1991-12-09,28.721
+1991-12-10,28.715
+1991-12-11,28.757
+1991-12-12,28.794
+1991-12-13,28.842
+1991-12-14,28.776
+1991-12-15,28.796
+1991-12-16,28.763
+1991-12-17,28.777
+1991-12-18,28.767
+1991-12-19,28.79
+1991-12-20,28.812
+1991-12-21,28.79
+1991-12-22,28.784
+1991-12-23,28.773
+1991-12-24,28.762
+1991-12-25,28.767
+1991-12-26,28.767
+1991-12-27,28.74
+1991-12-28,28.756
+1991-12-29,28.727
+1991-12-30,28.717
+1991-12-31,28.738
+1992-01-01,28.731
+1992-01-02,28.729
+1992-01-03,28.726
+1992-01-04,28.727
+1992-01-05,28.744
+1992-01-06,28.762
+1992-01-07,28.767
+1992-01-08,28.755
+1992-01-09,28.773
+1992-01-10,28.744
+1992-01-11,28.749
+1992-01-12,28.772
+1992-01-13,28.736
+1992-01-14,28.743
+1992-01-15,28.784
+1992-01-16,28.811
+1992-01-17,28.796
+1992-01-18,28.776
+1992-01-19,28.79
+1992-01-20,28.76
+1992-01-21,28.76
+1992-01-22,28.754
+1992-01-23,28.775
+1992-01-24,28.775
+1992-01-25,28.766
+1992-01-26,28.749
+1992-01-27,28.748
+1992-01-28,28.743
+1992-01-29,28.745
+1992-01-30,28.743
+1992-01-31,28.726
+1992-02-01,28.707
+1992-02-02,28.715
+1992-02-03,28.72
+1992-02-04,28.712
+1992-02-05,28.704
+1992-02-06,28.704
+1992-02-07,28.7
+1992-02-08,28.685
+1992-02-09,28.692
+1992-02-10,28.695
+1992-02-11,28.678
+1992-02-12,28.696
+1992-02-13,28.7
+1992-02-14,28.698
+1992-02-15,28.698
+1992-02-16,28.698
+1992-02-17,28.686
+1992-02-18,28.637
+1992-02-19,28.639
+1992-02-20,28.647
+1992-02-21,28.658
+1992-02-22,28.675
+1992-02-23,28.665
+1992-02-24,28.661
+1992-02-25,28.683
+1992-02-26,28.683
+1992-02-27,28.689
+1992-02-28,28.66
+1992-02-29,28.656
+1992-03-01,28.663
+1992-03-02,28.65
+1992-03-03,28.657
+1992-03-04,28.653
+1992-03-05,28.649
+1992-03-06,28.639
+1992-03-07,28.672
+1992-03-08,28.65
+1992-03-09,28.671
+1992-03-10,28.82
+1992-03-11,28.817
+1992-03-12,28.909
+1992-03-13,28.91
+1992-03-14,28.959
+1992-03-15,28.964
+1992-03-16,28.972
+1992-03-17,28.971
+1992-03-18,28.966
+1992-03-19,28.961
+1992-03-20,28.966
+1992-03-21,28.951
+1992-03-22,28.946
+1992-03-23,28.941
+1992-03-24,28.943
+1992-03-25,28.966
+1992-03-26,29.012
+1992-03-27,29.007
+1992-03-28,29.028
+1992-03-29,29.065
+1992-03-30,29.092
+1992-03-31,29.106
+1992-04-01,29.113
+1992-04-02,29.113
+1992-04-03,29.115
+1992-04-04,29.132
+1992-04-05,29.113
+1992-04-06,29.119
+1992-04-07,29.143
+1992-04-08,29.117
+1992-04-09,29.143
+1992-04-10,29.134
+1992-04-11,29.157
+1992-04-12,29.228
+1992-04-13,29.214
+1992-04-14,29.25
+1992-04-15,29.242
+1992-04-16,29.278
+1992-04-17,29.264
+1992-04-18,29.279
+1992-04-19,29.297
+1992-04-20,29.362
+1992-04-21,29.368
+1992-04-22,29.424
+1992-04-23,29.484
+1992-04-24,29.542
+1992-04-25,29.534
+1992-04-26,29.49
+1992-04-27,29.447
+1992-04-28,29.43
+1992-04-29,29.416
+1992-04-30,29.438
+1992-05-01,29.467
+1992-05-02,29.457
+1992-05-03,29.434
+1992-05-04,29.466
+1992-05-05,29.459
+1992-05-06,29.465
+1992-05-07,29.456
+1992-05-08,29.48
+1992-05-09,29.514
+1992-05-10,29.542
+1992-05-11,29.54
+1992-05-12,29.503
+1992-05-13,29.508
+1992-05-14,29.472
+1992-05-15,29.482
+1992-05-16,29.518
+1992-05-17,29.506
+1992-05-18,29.395
+1992-05-19,29.407
+1992-05-20,29.398
+1992-05-21,29.369
+1992-05-22,29.343
+1992-05-23,29.318
+1992-05-24,29.193
+1992-05-25,29.223
+1992-05-26,29.243
+1992-05-27,29.223
+1992-05-28,29.21
+1992-05-29,29.197
+1992-05-30,29.187
+1992-05-31,29.189
+1992-06-01,29.158
+1992-06-02,29.175
+1992-06-03,29.19
+1992-06-04,29.137
+1992-06-05,29.175
+1992-06-06,29.169
+1992-06-07,29.171
+1992-06-08,29.168
+1992-06-09,29.141
+1992-06-10,29.119
+1992-06-11,29.121
+1992-06-12,29.126
+1992-06-13,29.103
+1992-06-14,29.044
+1992-06-15,28.998
+1992-06-16,29.022
+1992-06-17,29.023
+1992-06-18,29.099
+1992-06-19,29.022
+1992-06-20,28.934
+1992-06-21,28.917
+1992-06-22,28.893
+1992-06-23,28.871
+1992-06-24,28.862
+1992-06-25,28.844
+1992-06-26,28.852
+1992-06-27,28.829
+1992-06-28,28.811
+1992-06-29,28.805
+1992-06-30,28.781
+1992-07-01,28.748
+1992-07-02,28.732
+1992-07-03,28.74
+1992-07-04,28.783
+1992-07-05,28.75
+1992-07-06,28.724
+1992-07-07,28.713
+1992-07-08,28.716
+1992-07-09,28.736
+1992-07-10,28.701
+1992-07-11,28.69
+1992-07-12,28.682
+1992-07-13,28.658
+1992-07-14,28.681
+1992-07-15,28.681
+1992-07-16,28.661
+1992-07-17,28.731
+1992-07-18,28.691
+1992-07-19,28.662
+1992-07-20,28.718
+1992-07-21,28.66
+1992-07-22,28.665
+1992-07-23,28.671
+1992-07-24,28.663
+1992-07-25,28.668
+1992-07-26,28.671
+1992-07-27,28.661
+1992-07-28,28.632
+1992-07-29,28.637
+1992-07-30,28.616
+1992-07-31,28.608
+1992-08-01,28.607
+1992-08-02,28.647
+1992-08-03,28.635
+1992-08-04,28.627
+1992-08-05,28.669
+1992-08-06,28.665
+1992-08-07,28.67
+1992-08-08,28.674
+1992-08-09,28.693
+1992-08-10,28.662
+1992-08-11,28.647
+1992-08-12,28.615
+1992-08-13,28.623
+1992-08-14,28.61
+1992-08-15,28.619
+1992-08-16,28.618
+1992-08-17,28.627
+1992-08-18,28.612
+1992-08-19,28.621
+1992-08-20,28.6
+1992-08-21,28.596
+1992-08-22,28.592
+1992-08-23,28.592
+1992-08-24,28.598
+1992-08-25,28.595
+1992-08-26,28.59
+1992-08-27,28.569
+1992-08-28,28.569
+1992-08-29,28.613
+1992-08-30,28.621
+1992-08-31,28.589
+1992-09-01,28.549
+1992-09-02,28.536
+1992-09-03,28.592
+1992-09-04,28.582
+1992-09-05,28.562
+1992-09-06,28.618
+1992-09-07,28.613
+1992-09-08,28.633
+1992-09-09,28.567
+1992-09-10,28.631
+1992-09-11,28.582
+1992-09-12,28.572
+1992-09-13,28.589
+1992-09-14,28.604
+1992-09-15,28.62
+1992-09-16,28.591
+1992-09-17,28.606
+1992-09-18,28.619
+1992-09-19,28.583
+1992-09-20,28.58
+1992-09-21,28.634
+1992-09-22,28.667
+1992-09-23,28.547
+1992-09-24,28.563
+1992-09-25,28.578
+1992-09-26,28.592
+1992-09-27,28.637
+1992-09-28,28.602
+1992-09-29,28.578
+1992-09-30,28.544
+1992-10-01,28.545
+1992-10-02,28.614
+1992-10-03,28.552
+1992-10-04,28.524
+1992-10-05,28.514
+1992-10-06,28.533
+1992-10-07,28.544
+1992-10-08,28.543
+1992-10-09,28.571
+1992-10-10,28.595
+1992-10-11,28.587
+1992-10-12,28.601
+1992-10-13,28.616
+1992-10-14,28.588
+1992-10-15,28.575
+1992-10-16,28.656
+1992-10-17,28.619
+1992-10-18,28.591
+1992-10-19,28.573
+1992-10-20,28.582
+1992-10-21,28.596
+1992-10-22,28.573
+1992-10-23,28.655
+1992-10-24,28.618
+1992-10-25,28.555
+1992-10-26,28.618
+1992-10-27,28.623
+1992-10-28,28.649
+1992-10-29,28.608
+1992-10-30,28.621
+1992-10-31,28.62
+1992-11-01,28.606
+1992-11-02,28.626
+1992-11-03,28.798
+1992-11-04,28.804
+1992-11-05,28.707
+1992-11-06,28.715
+1992-11-07,28.719
+1992-11-08,28.732
+1992-11-09,28.731
+1992-11-10,28.789
+1992-11-11,28.848
+1992-11-12,28.768
+1992-11-13,28.862
+1992-11-14,28.805
+1992-11-15,28.788
+1992-11-16,28.809
+1992-11-17,28.806
+1992-11-18,28.767
+1992-11-19,28.78
+1992-11-20,28.79
+1992-11-21,28.94
+1992-11-22,28.782
+1992-11-23,28.742
+1992-11-24,28.865
+1992-11-25,28.925
+1992-11-26,28.942
+1992-11-27,28.958
+1992-11-28,28.955
+1992-11-29,28.971
+1992-11-30,28.979
+1992-12-01,28.975
+1992-12-02,28.979
+1992-12-03,28.969
+1992-12-04,28.961
+1992-12-05,28.9
+1992-12-06,28.971
+1992-12-07,28.941
+1992-12-08,28.928
+1992-12-09,28.91
+1992-12-10,28.921
+1992-12-11,28.857
+1992-12-12,28.809
+1992-12-13,28.861
+1992-12-14,28.872
+1992-12-15,28.883
+1992-12-16,28.979
+1992-12-17,28.881
+1992-12-18,28.86
+1992-12-19,28.988
+1992-12-20,28.925
+1992-12-21,28.848
+1992-12-22,28.917
+1992-12-23,28.887
+1992-12-24,28.802
+1992-12-25,28.91
+1992-12-26,28.892
+1992-12-27,28.869
+1992-12-28,28.799
+1992-12-29,28.766
+1992-12-30,28.76
+1992-12-31,28.755
+1993-01-01,28.758
+1993-01-02,28.76
+1993-01-03,28.778
+1993-01-04,28.795
+1993-01-05,28.809
+1993-01-06,28.817
+1993-01-07,28.844
+1993-01-08,28.844
+1993-01-09,28.85
+1993-01-10,28.879
+1993-01-11,28.87
+1993-01-12,28.856
+1993-01-13,28.83
+1993-01-14,28.845
+1993-01-15,28.853
+1993-01-16,28.844
+1993-01-17,28.84
+1993-01-18,28.857
+1993-01-19,28.865
+1993-01-20,28.859
+1993-01-21,28.822
+1993-01-22,28.815
+1993-01-23,28.817
+1993-01-24,28.838
+1993-01-25,28.847
+1993-01-26,28.836
+1993-01-27,28.853
+1993-01-28,28.834
+1993-01-29,28.836
+1993-01-30,28.847
+1993-01-31,28.853
+1993-02-01,28.843
+1993-02-02,28.898
+1993-02-03,28.901
+1993-02-04,28.884
+1993-02-05,28.883
+1993-02-06,28.872
+1993-02-07,28.864
+1993-02-08,28.853
+1993-02-09,28.849
+1993-02-10,28.829
+1993-02-11,28.815
+1993-02-12,28.786
+1993-02-13,28.782
+1993-02-14,28.786
+1993-02-15,28.784
+1993-02-16,28.766
+1993-02-17,28.777
+1993-02-18,28.782
+1993-02-19,28.771
+1993-02-20,28.76
+1993-02-21,28.772
+1993-02-22,28.755
+1993-02-23,28.75
+1993-02-24,28.757
+1993-02-25,28.784
+1993-02-26,28.76
+1993-02-27,28.741
+1993-02-28,28.74
+1993-03-01,28.734
+1993-03-02,28.723
+1993-03-03,28.716
+1993-03-04,28.702
+1993-03-05,28.689
+1993-03-06,28.699
+1993-03-07,28.703
+1993-03-08,28.695
+1993-03-09,28.693
+1993-03-10,28.69
+1993-03-11,28.695
+1993-03-12,28.692
+1993-03-13,28.676
+1993-03-14,28.707
+1993-03-15,28.725
+1993-03-16,28.71
+1993-03-17,28.692
+1993-03-18,28.709
+1993-03-19,28.691
+1993-03-20,28.68
+1993-03-21,28.682
+1993-03-22,28.679
+1993-03-23,28.674
+1993-03-24,28.672
+1993-03-25,28.674
+1993-03-26,28.679
+1993-03-27,28.689
+1993-03-28,28.71
+1993-03-29,28.748
+1993-03-30,28.829
+1993-03-31,28.924
+1993-04-01,29.021
+1993-04-02,29.109
+1993-04-03,29.169
+1993-04-04,29.216
+1993-04-05,29.241
+1993-04-06,29.269
+1993-04-07,29.319
+1993-04-08,29.377
+1993-04-09,29.468
+1993-04-10,29.537
+1993-04-11,29.615
+1993-04-12,29.645
+1993-04-13,29.716
+1993-04-14,29.765
+1993-04-15,29.784
+1993-04-16,29.843
+1993-04-17,29.889
+1993-04-18,29.959
+1993-04-19,30.006
+1993-04-20,29.99
+1993-04-21,30.037
+1993-04-22,30.022
+1993-04-23,30.124
+1993-04-24,30.234
+1993-04-25,30.302
+1993-04-26,30.254
+1993-04-27,30.29
+1993-04-28,30.326
+1993-04-29,30.322
+1993-04-30,30.3
+1993-05-01,30.267
+1993-05-02,30.236
+1993-05-03,30.297
+1993-05-04,30.25
+1993-05-05,30.189
+1993-05-06,30.138
+1993-05-07,30.102
+1993-05-08,30.1
+1993-05-09,30.065
+1993-05-10,30.024
+1993-05-11,29.995
+1993-05-12,29.969
+1993-05-13,29.919
+1993-05-14,29.896
+1993-05-15,29.895
+1993-05-16,29.868
+1993-05-17,29.818
+1993-05-18,29.781
+1993-05-19,29.749
+1993-05-20,29.713
+1993-05-21,29.702
+1993-05-22,29.678
+1993-05-23,29.648
+1993-05-24,29.656
+1993-05-25,29.641
+1993-05-26,29.599
+1993-05-27,29.567
+1993-05-28,29.547
+1993-05-29,29.585
+1993-05-30,29.594
+1993-05-31,29.59
+1993-06-01,29.487
+1993-06-02,29.448
+1993-06-03,29.416
+1993-06-04,29.386
+1993-06-05,29.382
+1993-06-06,29.355
+1993-06-07,29.347
+1993-06-08,29.317
+1993-06-09,29.325
+1993-06-10,29.318
+1993-06-11,29.288
+1993-06-12,29.29
+1993-06-13,29.284
+1993-06-14,29.272
+1993-06-15,29.266
+1993-06-16,29.244
+1993-06-17,29.224
+1993-06-18,29.206
+1993-06-19,29.184
+1993-06-20,29.194
+1993-06-21,29.226
+1993-06-22,29.178
+1993-06-23,29.151
+1993-06-24,29.186
+1993-06-25,29.202
+1993-06-26,29.209
+1993-06-27,29.188
+1993-06-28,29.154
+1993-06-29,29.117
+1993-06-30,29.093
+1993-07-01,29.08
+1993-07-02,29.103
+1993-07-03,29.081
+1993-07-04,29.024
+1993-07-05,29.025
+1993-07-06,29.045
+1993-07-07,28.989
+1993-07-08,28.973
+1993-07-09,28.961
+1993-07-10,28.943
+1993-07-11,28.921
+1993-07-12,28.926
+1993-07-13,28.896
+1993-07-14,28.872
+1993-07-15,28.84
+1993-07-16,28.801
+1993-07-17,28.793
+1993-07-18,28.796
+1993-07-19,28.826
+1993-07-20,28.817
+1993-07-21,28.765
+1993-07-22,28.757
+1993-07-23,28.735
+1993-07-24,28.729
+1993-07-25,28.705
+1993-07-26,28.798
+1993-07-27,28.818
+1993-07-28,28.724
+1993-07-29,28.74
+1993-07-30,28.76
+1993-07-31,28.761
+1993-08-01,28.765
+1993-08-02,28.771
+1993-08-03,28.771
+1993-08-04,28.751
+1993-08-05,28.723
+1993-08-06,28.72
+1993-08-07,28.717
+1993-08-08,28.702
+1993-08-09,28.698
+1993-08-10,28.699
+1993-08-11,28.731
+1993-08-12,28.702
+1993-08-13,28.668
+1993-08-14,28.655
+1993-08-15,28.649
+1993-08-16,28.657
+1993-08-17,28.659
+1993-08-18,28.607
+1993-08-19,28.618
+1993-08-20,28.625
+1993-08-21,28.56
+1993-08-22,28.606
+1993-08-23,28.614
+1993-08-24,28.64
+1993-08-25,28.627
+1993-08-26,28.629
+1993-08-27,28.637
+1993-08-28,28.622
+1993-08-29,28.6
+1993-08-30,28.604
+1993-08-31,28.674
+1993-09-01,28.581
+1993-09-02,28.614
+1993-09-03,28.669
+1993-09-04,28.603
+1993-09-05,28.618
+1993-09-06,28.587
+1993-09-07,28.614
+1993-09-08,28.624
+1993-09-09,28.663
+1993-09-10,28.642
+1993-09-11,28.612
+1993-09-12,28.648
+1993-09-13,28.694
+1993-09-14,28.696
+1993-09-15,28.633
+1993-09-16,28.573
+1993-09-17,28.629
+1993-09-18,28.614
+1993-09-19,28.557
+1993-09-20,28.575
+1993-09-21,28.576
+1993-09-22,28.579
+1993-09-23,28.653
+1993-09-24,28.574
+1993-09-25,28.593
+1993-09-26,28.59
+1993-09-27,28.591
+1993-09-28,28.644
+1993-09-29,28.609
+1993-09-30,28.575
+1993-10-01,28.691
+1993-10-02,28.721
+1993-10-03,28.614
+1993-10-04,28.674
+1993-10-05,28.612
+1993-10-06,28.641
+1993-10-07,28.694
+1993-10-08,28.563
+1993-10-09,28.615
+1993-10-10,28.631
+1993-10-11,28.658
+1993-10-12,28.728
+1993-10-13,28.64
+1993-10-14,28.664
+1993-10-15,28.656
+1993-10-16,28.72
+1993-10-17,28.728
+1993-10-18,28.689
+1993-10-19,28.651
+1993-10-20,28.663
+1993-10-21,28.839
+1993-10-22,28.724
+1993-10-23,28.672
+1993-10-24,28.765
+1993-10-25,28.653
+1993-10-26,28.751
+1993-10-27,28.749
+1993-10-28,28.686
+1993-10-29,28.743
+1993-10-30,28.667
+1993-10-31,28.577
+1993-11-01,28.542
+1993-11-02,28.688
+1993-11-03,28.758
+1993-11-04,28.73
+1993-11-05,28.757
+1993-11-06,28.758
+1993-11-07,28.754
+1993-11-08,28.834
+1993-11-09,28.818
+1993-11-10,28.771
+1993-11-11,28.812
+1993-11-12,28.756
+1993-11-13,28.888
+1993-11-14,28.813
+1993-11-15,28.748
+1993-11-16,28.779
+1993-11-17,28.801
+1993-11-18,28.777
+1993-11-19,28.894
+1993-11-20,28.813
+1993-11-21,28.852
+1993-11-22,28.822
+1993-11-23,28.722
+1993-11-24,28.686
+1993-11-25,28.737
+1993-11-26,28.752
+1993-11-27,28.814
+1993-11-28,28.78
+1993-11-29,28.803
+1993-11-30,28.779
+1993-12-01,28.839
+1993-12-02,28.944
+1993-12-03,28.851
+1993-12-04,28.825
+1993-12-05,28.792
+1993-12-06,28.825
+1993-12-07,28.856
+1993-12-08,28.852
+1993-12-09,28.9
+1993-12-10,29.008
+1993-12-11,28.824
+1993-12-12,28.837
+1993-12-13,28.837
+1993-12-14,28.814
+1993-12-15,28.787
+1993-12-16,28.712
+1993-12-17,28.842
+1993-12-18,28.858
+1993-12-19,28.841
+1993-12-20,28.862
+1993-12-21,28.79
+1993-12-22,28.888
+1993-12-23,28.807
+1993-12-24,28.85
+1993-12-25,28.824
+1993-12-26,28.814
+1993-12-27,28.81
+1993-12-28,28.781
+1993-12-29,28.777
+1993-12-30,28.765
+1993-12-31,28.789
+1994-01-01,28.771
+1994-01-02,28.739
+1994-01-03,28.732
+1994-01-04,28.716
+1994-01-05,28.745
+1994-01-06,28.777
+1994-01-07,28.788
+1994-01-08,28.827
+1994-01-09,28.843
+1994-01-10,28.866
+1994-01-11,28.853
+1994-01-12,28.796
+1994-01-13,28.784
+1994-01-14,28.768
+1994-01-15,28.782
+1994-01-16,28.804
+1994-01-17,28.819
+1994-01-18,28.806
+1994-01-19,28.825
+1994-01-20,28.846
+1994-01-21,28.849
+1994-01-22,28.831
+1994-01-23,28.817
+1994-01-24,28.797
+1994-01-25,28.781
+1994-01-26,28.774
+1994-01-27,28.775
+1994-01-28,28.795
+1994-01-29,28.77
+1994-01-30,28.762
+1994-01-31,28.766
+1994-02-01,28.77
+1994-02-02,28.772
+1994-02-03,28.783
+1994-02-04,28.781
+1994-02-05,28.775
+1994-02-06,28.771
+1994-02-07,28.763
+1994-02-08,28.757
+1994-02-09,28.752
+1994-02-10,28.755
+1994-02-11,28.75
+1994-02-12,28.749
+1994-02-13,28.748
+1994-02-14,28.74
+1994-02-15,28.74
+1994-02-16,28.735
+1994-02-17,28.737
+1994-02-18,28.726
+1994-02-19,28.737
+1994-02-20,28.741
+1994-02-21,28.751
+1994-02-22,28.753
+1994-02-23,28.748
+1994-02-24,28.779
+1994-02-25,28.81
+1994-02-26,28.843
+1994-02-27,28.875
+1994-02-28,28.901
+1994-03-01,28.87
+1994-03-02,28.836
+1994-03-03,28.823
+1994-03-04,28.833
+1994-03-05,28.836
+1994-03-06,28.829
+1994-03-07,28.837
+1994-03-08,28.827
+1994-03-09,28.82
+1994-03-10,28.815
+1994-03-11,28.822
+1994-03-12,28.831
+1994-03-13,28.848
+1994-03-14,28.839
+1994-03-15,28.853
+1994-03-16,28.861
+1994-03-17,28.872
+1994-03-18,28.868
+1994-03-19,28.87
+1994-03-20,28.875
+1994-03-21,28.877
+1994-03-22,28.905
+1994-03-23,28.905
+1994-03-24,28.921
+1994-03-25,28.962
+1994-03-26,28.984
+1994-03-27,29.032
+1994-03-28,29.055
+1994-03-29,29.077
+1994-03-30,29.103
+1994-03-31,29.159
+1994-04-01,29.14
+1994-04-02,29.2
+1994-04-03,29.287
+1994-04-04,29.257
+1994-04-05,29.311
+1994-04-06,29.308
+1994-04-07,29.376
+1994-04-08,29.472
+1994-04-09,29.554
+1994-04-10,29.612
+1994-04-11,29.633
+1994-04-12,29.689
+1994-04-13,29.747
+1994-04-14,29.825
+1994-04-15,29.884
+1994-04-16,30.002
+1994-04-17,30.121
+1994-04-18,30.171
+1994-04-19,30.243
+1994-04-20,30.221
+1994-04-21,30.224
+1994-04-22,30.219
+1994-04-23,30.252
+1994-04-24,30.206
+1994-04-25,30.164
+1994-04-26,30.214
+1994-04-27,30.242
+1994-04-28,30.18
+1994-04-29,30.26
+1994-04-30,30.205
+1994-05-01,30.219
+1994-05-02,30.201
+1994-05-03,30.19
+1994-05-04,30.173
+1994-05-05,30.142
+1994-05-06,30.119
+1994-05-07,30.093
+1994-05-08,30.047
+1994-05-09,30.056
+1994-05-10,30.029
+1994-05-11,30.023
+1994-05-12,30.015
+1994-05-13,29.893
+1994-05-14,29.886
+1994-05-15,29.878
+1994-05-16,29.872
+1994-05-17,29.858
+1994-05-18,29.826
+1994-05-19,29.806
+1994-05-20,29.828
+1994-05-21,29.825
+1994-05-22,29.802
+1994-05-23,29.748
+1994-05-24,29.74
+1994-05-25,29.724
+1994-05-26,29.598
+1994-05-27,29.673
+1994-05-28,29.74
+1994-05-29,29.708
+1994-05-30,29.697
+1994-05-31,29.705
+1994-06-01,29.657
+1994-06-02,29.62
+1994-06-03,29.609
+1994-06-04,29.584
+1994-06-05,29.584
+1994-06-06,29.561
+1994-06-07,29.532
+1994-06-08,29.497
+1994-06-09,29.507
+1994-06-10,29.479
+1994-06-11,29.476
+1994-06-12,29.514
+1994-06-13,29.451
+1994-06-14,29.427
+1994-06-15,29.391
+1994-06-16,29.384
+1994-06-17,29.363
+1994-06-18,29.338
+1994-06-19,29.266
+1994-06-20,29.285
+1994-06-21,29.365
+1994-06-22,29.212
+1994-06-23,29.201
+1994-06-24,29.187
+1994-06-25,29.175
+1994-06-26,29.171
+1994-06-27,29.119
+1994-06-28,29.191
+1994-06-29,29.171
+1994-06-30,29.164
+1994-07-01,29.145
+1994-07-02,29.164
+1994-07-03,29.12
+1994-07-04,29.09
+1994-07-05,29.152
+1994-07-06,29.058
+1994-07-07,29.055
+1994-07-08,29.041
+1994-07-09,29.078
+1994-07-10,29.053
+1994-07-11,29.009
+1994-07-12,29.019
+1994-07-13,28.979
+1994-07-14,28.955
+1994-07-15,28.976
+1994-07-16,28.948
+1994-07-17,28.932
+1994-07-18,28.951
+1994-07-19,28.927
+1994-07-20,28.906
+1994-07-21,28.915
+1994-07-22,28.943
+1994-07-23,28.99
+1994-07-24,28.942
+1994-07-25,28.899
+1994-07-26,28.916
+1994-07-27,28.882
+1994-07-28,28.861
+1994-07-29,28.875
+1994-07-30,28.857
+1994-07-31,28.871
+1994-08-01,28.881
+1994-08-02,28.852
+1994-08-03,28.848
+1994-08-04,28.871
+1994-08-05,28.812
+1994-08-06,28.821
+1994-08-07,28.831
+1994-08-08,28.846
+1994-08-09,28.855
+1994-08-10,28.8
+1994-08-11,28.807
+1994-08-12,28.812
+1994-08-13,28.821
+1994-08-14,28.835
+1994-08-15,28.809
+1994-08-16,28.806
+1994-08-17,28.814
+1994-08-18,28.776
+1994-08-19,28.792
+1994-08-20,28.859
+1994-08-21,28.839
+1994-08-22,28.805
+1994-08-23,28.836
+1994-08-24,28.865
+1994-08-25,28.901
+1994-08-26,28.873
+1994-08-27,28.867
+1994-08-28,28.924
+1994-08-29,28.872
+1994-08-30,28.844
+1994-08-31,28.824
+1994-09-01,28.801
+1994-09-02,28.815
+1994-09-03,28.805
+1994-09-04,28.793
+1994-09-05,28.76
+1994-09-06,28.765
+1994-09-07,28.798
+1994-09-08,28.79
+1994-09-09,28.788
+1994-09-10,28.758
+1994-09-11,28.737
+1994-09-12,28.737
+1994-09-13,28.739
+1994-09-14,28.737
+1994-09-15,28.754
+1994-09-16,28.8
+1994-09-17,28.769
+1994-09-18,28.727
+1994-09-19,28.735
+1994-09-20,28.77
+1994-09-21,28.729
+1994-09-22,28.734
+1994-09-23,28.704
+1994-09-24,28.699
+1994-09-25,28.706
+1994-09-26,28.714
+1994-09-27,28.741
+1994-09-28,28.741
+1994-09-29,28.715
+1994-09-30,28.693
+1994-10-01,28.693
+1994-10-02,28.682
+1994-10-03,28.681
+1994-10-04,28.666
+1994-10-05,28.656
+1994-10-06,28.674
+1994-10-07,28.692
+1994-10-08,28.7
+1994-10-09,28.73
+1994-10-10,28.652
+1994-10-11,28.645
+1994-10-12,28.649
+1994-10-13,28.648
+1994-10-14,28.591
+1994-10-15,28.598
+1994-10-16,28.599
+1994-10-17,28.6
+1994-10-18,28.603
+1994-10-19,28.614
+1994-10-20,28.64
+1994-10-21,28.602
+1994-10-22,28.591
+1994-10-23,28.61
+1994-10-24,28.605
+1994-10-25,28.603
+1994-10-26,28.594
+1994-10-27,28.58
+1994-10-28,28.635
+1994-10-29,28.666
+1994-10-30,28.574
+1994-10-31,28.559
+1994-11-01,28.56
+1994-11-02,28.588
+1994-11-03,28.629
+1994-11-04,28.646
+1994-11-05,28.633
+1994-11-06,28.686
+1994-11-07,28.623
+1994-11-08,28.678
+1994-11-09,28.648
+1994-11-10,28.636
+1994-11-11,28.632
+1994-11-12,28.667
+1994-11-13,28.642
+1994-11-14,28.745
+1994-11-15,28.644
+1994-11-16,28.638
+1994-11-17,28.641
+1994-11-18,28.732
+1994-11-19,28.628
+1994-11-20,28.606
+1994-11-21,28.804
+1994-11-22,28.626
+1994-11-23,28.572
+1994-11-24,28.597
+1994-11-25,28.636
+1994-11-26,28.542
+1994-11-27,28.565
+1994-11-28,28.657
+1994-11-29,28.634
+1994-11-30,28.568
+1994-12-01,28.603
+1994-12-02,28.667
+1994-12-03,28.598
+1994-12-04,28.606
+1994-12-05,28.613
+1994-12-06,28.658
+1994-12-07,28.647
+1994-12-08,28.692
+1994-12-09,28.788
+1994-12-10,28.721
+1994-12-11,28.74
+1994-12-12,28.708
+1994-12-13,28.714
+1994-12-14,28.712
+1994-12-15,28.71
+1994-12-16,28.718
+1994-12-17,28.781
+1994-12-18,28.722
+1994-12-19,28.707
+1994-12-20,28.737
+1994-12-21,28.745
+1994-12-22,28.721
+1994-12-23,28.679
+1994-12-24,28.619
+1994-12-25,28.681
+1994-12-26,28.697
+1994-12-27,28.719
+1994-12-28,28.727
+1994-12-29,28.589
+1994-12-30,28.636
+1994-12-31,28.665
+1995-01-01,28.649
+1995-01-02,28.649
+1995-01-03,28.658
+1995-01-04,28.651
+1995-01-05,28.665
+1995-01-06,28.667
+1995-01-07,28.626
+1995-01-08,28.632
+1995-01-09,28.62
+1995-01-10,28.626
+1995-01-11,28.647
+1995-01-12,28.651
+1995-01-13,28.625
+1995-01-14,28.637
+1995-01-15,28.765
+1995-01-16,28.778
+1995-01-17,28.818
+1995-01-18,28.878
+1995-01-19,28.943
+1995-01-20,28.894
+1995-01-21,28.952
+1995-01-22,28.997
+1995-01-23,29.043
+1995-01-24,29.06
+1995-01-25,29.076
+1995-01-26,29.066
+1995-01-27,29.045
+1995-01-28,29.013
+1995-01-29,29.011
+1995-01-30,29.01
+1995-01-31,29.012
+1995-02-01,29.009
+1995-02-02,28.997
+1995-02-03,28.98
+1995-02-04,28.971
+1995-02-05,28.963
+1995-02-06,28.969
+1995-02-07,28.975
+1995-02-08,28.944
+1995-02-09,28.944
+1995-02-10,28.918
+1995-02-11,28.932
+1995-02-12,28.93
+1995-02-13,28.905
+1995-02-14,28.896
+1995-02-15,28.917
+1995-02-16,28.883
+1995-02-17,28.856
+1995-02-18,28.858
+1995-02-19,28.868
+1995-02-20,28.829
+1995-02-21,28.833
+1995-02-22,28.83
+1995-02-23,28.839
+1995-02-24,28.854
+1995-02-25,28.84
+1995-02-26,28.826
+1995-02-27,28.806
+1995-02-28,28.787
+1995-03-01,28.796
+1995-03-02,28.792
+1995-03-03,28.794
+1995-03-04,28.773
+1995-03-05,28.763
+1995-03-06,28.775
+1995-03-07,28.785
+1995-03-08,28.92
+1995-03-09,28.815
+1995-03-10,28.847
+1995-03-11,28.855
+1995-03-12,28.908
+1995-03-13,28.948
+1995-03-14,28.941
+1995-03-15,28.957
+1995-03-16,28.997
+1995-03-17,29.057
+1995-03-18,29.106
+1995-03-19,29.149
+1995-03-20,29.211
+1995-03-21,29.248
+1995-03-22,29.219
+1995-03-23,29.221
+1995-03-24,29.201
+1995-03-25,29.226
+1995-03-26,29.226
+1995-03-27,29.221
+1995-03-28,29.223
+1995-03-29,29.23
+1995-03-30,29.245
+1995-03-31,29.235
+1995-04-01,29.193
+1995-04-02,29.193
+1995-04-03,29.191
+1995-04-04,29.246
+1995-04-05,29.102
+1995-04-06,29.102
+1995-04-07,29.123
+1995-04-08,29.125
+1995-04-09,29.143
+1995-04-10,29.073
+1995-04-11,29.079
+1995-04-12,29.137
+1995-04-13,29.14
+1995-04-14,29.068
+1995-04-15,29.032
+1995-04-16,29.046
+1995-04-17,29.038
+1995-04-18,29.026
+1995-04-19,29.069
+1995-04-20,29.094
+1995-04-21,29.001
+1995-04-22,29.11
+1995-04-23,29.005
+1995-04-24,28.998
+1995-04-25,29.003
+1995-04-26,29.011
+1995-04-27,29.002
+1995-04-28,28.99
+1995-04-29,29.004
+1995-04-30,29.008
+1995-05-01,29.005
+1995-05-02,29.004
+1995-05-03,29
+1995-05-04,29
+1995-05-05,28.99
+1995-05-06,28.903
+1995-05-07,28.877
+1995-05-08,28.895
+1995-05-09,28.929
+1995-05-10,28.934
+1995-05-11,28.953
+1995-05-12,28.941
+1995-05-13,28.885
+1995-05-14,28.881
+1995-05-15,28.928
+1995-05-16,28.971
+1995-05-17,28.873
+1995-05-18,28.879
+1995-05-19,28.913
+1995-05-20,28.871
+1995-05-21,28.881
+1995-05-22,28.868
+1995-05-23,28.894
+1995-05-24,28.872
+1995-05-25,28.865
+1995-05-26,28.868
+1995-05-27,28.845
+1995-05-28,28.825
+1995-05-29,28.85
+1995-05-30,28.804
+1995-05-31,28.84
+1995-06-01,28.96
+1995-06-02,28.839
+1995-06-03,28.796
+1995-06-04,28.825
+1995-06-05,28.823
+1995-06-06,28.808
+1995-06-07,28.798
+1995-06-08,28.793
+1995-06-09,28.833
+1995-06-10,28.831
+1995-06-11,28.836
+1995-06-12,28.845
+1995-06-13,28.714
+1995-06-14,28.789
+1995-06-15,28.793
+1995-06-16,28.851
+1995-06-17,28.868
+1995-06-18,28.778
+1995-06-19,28.788
+1995-06-20,28.744
+1995-06-21,28.737
+1995-06-22,28.759
+1995-06-23,28.764
+1995-06-24,28.761
+1995-06-25,28.758
+1995-06-26,28.751
+1995-06-27,28.683
+1995-06-28,28.691
+1995-06-29,28.691
+1995-06-30,28.7
+1995-07-01,28.699
+1995-07-02,28.694
+1995-07-03,28.689
+1995-07-04,28.616
+1995-07-05,28.627
+1995-07-06,28.681
+1995-07-07,28.663
+1995-07-08,28.65
+1995-07-09,28.634
+1995-07-10,28.626
+1995-07-11,28.617
+1995-07-12,28.591
+1995-07-13,28.589
+1995-07-14,28.608
+1995-07-15,28.612
+1995-07-16,28.642
+1995-07-17,28.648
+1995-07-18,28.592
+1995-07-19,28.561
+1995-07-20,28.558
+1995-07-21,28.547
+1995-07-22,28.559
+1995-07-23,28.593
+1995-07-24,28.549
+1995-07-25,28.542
+1995-07-26,28.548
+1995-07-27,28.523
+1995-07-28,28.53
+1995-07-29,28.573
+1995-07-30,28.524
+1995-07-31,28.543
+1995-08-01,28.539
+1995-08-02,28.473
+1995-08-03,28.513
+1995-08-04,28.556
+1995-08-05,28.535
+1995-08-06,28.554
+1995-08-07,28.628
+1995-08-08,28.68
+1995-08-09,28.69
+1995-08-10,28.697
+1995-08-11,28.719
+1995-08-12,28.734
+1995-08-13,28.699
+1995-08-14,28.709
+1995-08-15,28.771
+1995-08-16,28.733
+1995-08-17,28.711
+1995-08-18,28.653
+1995-08-19,28.684
+1995-08-20,28.739
+1995-08-21,28.71
+1995-08-22,28.643
+1995-08-23,28.649
+1995-08-24,28.619
+1995-08-25,28.607
+1995-08-26,28.623
+1995-08-27,28.587
+1995-08-28,28.611
+1995-08-29,28.613
+1995-08-30,28.57
+1995-08-31,28.621
+1995-09-01,28.564
+1995-09-02,28.559
+1995-09-03,28.558
+1995-09-04,28.557
+1995-09-05,28.562
+1995-09-06,28.529
+1995-09-07,28.575
+1995-09-08,28.509
+1995-09-09,28.526
+1995-09-10,28.488
+1995-09-11,28.528
+1995-09-12,28.564
+1995-09-13,28.606
+1995-09-14,28.504
+1995-09-15,28.493
+1995-09-16,28.602
+1995-09-17,28.607
+1995-09-18,28.445
+1995-09-19,28.484
+1995-09-20,28.492
+1995-09-21,28.476
+1995-09-22,28.499
+1995-09-23,28.481
+1995-09-24,28.479
+1995-09-25,28.5
+1995-09-26,28.501
+1995-09-27,28.507
+1995-09-28,28.453
+1995-09-29,28.494
+1995-09-30,28.507
+1995-10-01,28.496
+1995-10-02,28.498
+1995-10-03,28.446
+1995-10-04,28.44
+1995-10-05,28.439
+1995-10-06,28.462
+1995-10-07,28.595
+1995-10-08,28.556
+1995-10-09,28.544
+1995-10-10,28.546
+1995-10-11,28.559
+1995-10-12,28.569
+1995-10-13,28.571
+1995-10-14,28.572
+1995-10-15,28.631
+1995-10-16,28.623
+1995-10-17,28.587
+1995-10-18,28.716
+1995-10-19,28.574
+1995-10-20,28.643
+1995-10-21,28.639
+1995-10-22,28.75
+1995-10-23,28.783
+1995-10-24,28.868
+1995-10-25,28.828
+1995-10-26,28.842
+1995-10-27,28.907
+1995-10-28,28.877
+1995-10-29,28.911
+1995-10-30,28.931
+1995-10-31,28.957
+1995-11-01,28.954
+1995-11-02,29.061
+1995-11-03,29.046
+1995-11-04,29.033
+1995-11-05,29.069
+1995-11-06,29.07
+1995-11-07,29.162
+1995-11-08,29.034
+1995-11-09,29.05
+1995-11-10,29.136
+1995-11-11,29.224
+1995-11-12,29.114
+1995-11-13,29.133
+1995-11-14,29.14
+1995-11-15,29.177
+1995-11-16,29.31
+1995-11-17,29.27
+1995-11-18,29.278
+1995-11-19,29.274
+1995-11-20,29.313
+1995-11-21,29.352
+1995-11-22,29.302
+1995-11-23,29.33
+1995-11-24,29.271
+1995-11-25,29.277
+1995-11-26,29.266
+1995-11-27,29.218
+1995-11-28,29.219
+1995-11-29,29.209
+1995-11-30,29.224
+1995-12-01,29.314
+1995-12-02,29.174
+1995-12-03,29.198
+1995-12-04,29.161
+1995-12-05,29.152
+1995-12-06,29.227
+1995-12-07,29.141
+1995-12-08,29.077
+1995-12-09,29.084
+1995-12-10,29.075
+1995-12-11,29.075
+1995-12-12,29.082
+1995-12-13,29.047
+1995-12-14,29.007
+1995-12-15,28.992
+1995-12-16,28.979
+1995-12-17,28.971
+1995-12-18,28.977
+1995-12-19,28.999
+1995-12-20,28.971
+1995-12-21,28.971
+1995-12-22,28.964
+1995-12-23,28.941
+1995-12-24,28.932
+1995-12-25,28.926
+1995-12-26,28.917
+1995-12-27,28.917
+1995-12-28,28.911
+1995-12-29,28.912
+1995-12-30,28.897
+1995-12-31,28.885
+1996-01-01,28.854
+1996-01-02,28.851
+1996-01-03,28.849
+1996-01-04,28.902
+1996-01-05,28.907
+1996-01-06,28.964
+1996-01-07,28.925
+1996-01-08,28.862
+1996-01-09,28.87
+1996-01-10,28.835
+1996-01-11,28.831
+1996-01-12,28.821
+1996-01-13,28.812
+1996-01-14,28.817
+1996-01-15,28.784
+1996-01-16,28.798
+1996-01-17,28.833
+1996-01-18,28.816
+1996-01-19,28.927
+1996-01-20,29.086
+1996-01-21,29.225
+1996-01-22,29.338
+1996-01-23,29.376
+1996-01-24,29.399
+1996-01-25,29.415
+1996-01-26,29.437
+1996-01-27,29.49
+1996-01-28,29.516
+1996-01-29,29.527
+1996-01-30,29.569
+1996-01-31,29.517
+1996-02-01,29.516
+1996-02-02,29.503
+1996-02-03,29.522
+1996-02-04,29.479
+1996-02-05,29.462
+1996-02-06,29.443
+1996-02-07,29.461
+1996-02-08,29.462
+1996-02-09,29.395
+1996-02-10,29.374
+1996-02-11,29.359
+1996-02-12,29.332
+1996-02-13,29.278
+1996-02-14,29.294
+1996-02-15,29.311
+1996-02-16,29.263
+1996-02-17,29.248
+1996-02-18,29.232
+1996-02-19,29.221
+1996-02-20,29.215
+1996-02-21,29.19
+1996-02-22,29.199
+1996-02-23,29.235
+1996-02-24,29.309
+1996-02-25,29.295
+1996-02-26,29.281
+1996-02-27,29.298
+1996-02-28,29.301
+1996-02-29,29.286
+1996-03-01,29.31
+1996-03-02,29.294
+1996-03-03,29.304
+1996-03-04,29.238
+1996-03-05,29.185
+1996-03-06,29.186
+1996-03-07,29.163
+1996-03-08,29.149
+1996-03-09,29.159
+1996-03-10,29.142
+1996-03-11,29.123
+1996-03-12,29.118
+1996-03-13,29.121
+1996-03-14,29.142
+1996-03-15,29.126
+1996-03-16,29.092
+1996-03-17,29.122
+1996-03-18,29.121
+1996-03-19,29.108
+1996-03-20,29.058
+1996-03-21,29.102
+1996-03-22,29.121
+1996-03-23,29.12
+1996-03-24,29.104
+1996-03-25,29.158
+1996-03-26,29.139
+1996-03-27,29.09
+1996-03-28,29.104
+1996-03-29,29.096
+1996-03-30,29.083
+1996-03-31,29.088
+1996-04-01,29.082
+1996-04-02,29.064
+1996-04-03,29.058
+1996-04-04,29.049
+1996-04-05,29.058
+1996-04-06,29.054
+1996-04-07,29.055
+1996-04-08,29.05
+1996-04-09,29.046
+1996-04-10,28.989
+1996-04-11,29.009
+1996-04-12,29.047
+1996-04-13,29.034
+1996-04-14,29.086
+1996-04-15,29.115
+1996-04-16,29.218
+1996-04-17,29.264
+1996-04-18,29.317
+1996-04-19,29.365
+1996-04-20,29.396
+1996-04-21,29.466
+1996-04-22,29.505
+1996-04-23,29.569
+1996-04-24,29.632
+1996-04-25,29.719
+1996-04-26,29.8
+1996-04-27,29.812
+1996-04-28,29.84
+1996-04-29,29.864
+1996-04-30,29.883
+1996-05-01,29.913
+1996-05-02,29.926
+1996-05-03,29.947
+1996-05-04,29.947
+1996-05-05,29.928
+1996-05-06,29.92
+1996-05-07,29.925
+1996-05-08,29.924
+1996-05-09,29.914
+1996-05-10,29.921
+1996-05-11,29.848
+1996-05-12,29.839
+1996-05-13,30.021
+1996-05-14,30.098
+1996-05-15,30.109
+1996-05-16,30.121
+1996-05-17,30.11
+1996-05-18,30.102
+1996-05-19,30.126
+1996-05-20,30.101
+1996-05-21,30.093
+1996-05-22,30.086
+1996-05-23,30.068
+1996-05-24,30.016
+1996-05-25,29.996
+1996-05-26,29.981
+1996-05-27,29.962
+1996-05-28,29.945
+1996-05-29,29.884
+1996-05-30,29.853
+1996-05-31,29.849
+1996-06-01,29.83
+1996-06-02,29.807
+1996-06-03,29.802
+1996-06-04,29.742
+1996-06-05,29.724
+1996-06-06,29.694
+1996-06-07,29.673
+1996-06-08,29.639
+1996-06-09,29.627
+1996-06-10,29.629
+1996-06-11,29.62
+1996-06-12,29.609
+1996-06-13,29.604
+1996-06-14,29.611
+1996-06-15,29.6
+1996-06-16,29.572
+1996-06-17,29.561
+1996-06-18,29.513
+1996-06-19,29.527
+1996-06-20,29.502
+1996-06-21,29.463
+1996-06-22,29.427
+1996-06-23,29.408
+1996-06-24,29.387
+1996-06-25,29.371
+1996-06-26,29.34
+1996-06-27,29.332
+1996-06-28,29.325
+1996-06-29,29.339
+1996-06-30,29.408
+1996-07-01,29.327
+1996-07-02,29.263
+1996-07-03,29.232
+1996-07-04,29.185
+1996-07-05,29.224
+1996-07-06,29.289
+1996-07-07,29.293
+1996-07-08,29.294
+1996-07-09,29.285
+1996-07-10,29.273
+1996-07-11,29.266
+1996-07-12,29.253
+1996-07-13,29.232
+1996-07-14,29.212
+1996-07-15,29.232
+1996-07-16,29.28
+1996-07-17,29.277
+1996-07-18,29.269
+1996-07-19,29.275
+1996-07-20,29.233
+1996-07-21,29.235
+1996-07-22,29.261
+1996-07-23,29.266
+1996-07-24,29.279
+1996-07-25,29.291
+1996-07-26,29.265
+1996-07-27,29.246
+1996-07-28,29.225
+1996-07-29,29.217
+1996-07-30,29.225
+1996-07-31,29.223
+1996-08-01,29.202
+1996-08-02,29.195
+1996-08-03,29.185
+1996-08-04,29.179
+1996-08-05,29.169
+1996-08-06,29.158
+1996-08-07,29.154
+1996-08-08,29.161
+1996-08-09,29.128
+1996-08-10,29.086
+1996-08-11,29.064
+1996-08-12,29.082
+1996-08-13,29.09
+1996-08-14,29.027
+1996-08-15,29.028
+1996-08-16,29.042
+1996-08-17,29.004
+1996-08-18,28.981
+1996-08-19,28.958
+1996-08-20,28.971
+1996-08-21,28.966
+1996-08-22,28.952
+1996-08-23,28.961
+1996-08-24,28.928
+1996-08-25,28.966
+1996-08-26,28.896
+1996-08-27,28.875
+1996-08-28,28.871
+1996-08-29,28.875
+1996-08-30,28.861
+1996-08-31,28.876
+1996-09-01,28.851
+1996-09-02,28.824
+1996-09-03,28.806
+1996-09-04,28.818
+1996-09-05,28.827
+1996-09-06,28.79
+1996-09-07,28.776
+1996-09-08,28.813
+1996-09-09,28.797
+1996-09-10,28.763
+1996-09-11,28.757
+1996-09-12,28.787
+1996-09-13,28.738
+1996-09-14,28.712
+1996-09-15,28.714
+1996-09-16,28.707
+1996-09-17,28.698
+1996-09-18,28.645
+1996-09-19,28.674
+1996-09-20,28.694
+1996-09-21,28.7
+1996-09-22,28.628
+1996-09-23,28.596
+1996-09-24,28.674
+1996-09-25,28.652
+1996-09-26,28.666
+1996-09-27,28.716
+1996-09-28,28.816
+1996-09-29,28.681
+1996-09-30,28.659
+1996-10-01,28.695
+1996-10-02,28.797
+1996-10-03,28.635
+1996-10-04,28.623
+1996-10-05,28.634
+1996-10-06,28.702
+1996-10-07,28.692
+1996-10-08,28.596
+1996-10-09,28.596
+1996-10-10,28.569
+1996-10-11,28.583
+1996-10-12,28.637
+1996-10-13,28.647
+1996-10-14,28.575
+1996-10-15,28.573
+1996-10-16,28.6
+1996-10-17,28.551
+1996-10-18,28.596
+1996-10-19,28.582
+1996-10-20,28.513
+1996-10-21,28.552
+1996-10-22,28.653
+1996-10-23,28.715
+1996-10-24,28.758
+1996-10-25,28.777
+1996-10-26,28.767
+1996-10-27,28.775
+1996-10-28,28.771
+1996-10-29,28.744
+1996-10-30,28.836
+1996-10-31,28.8
+1996-11-01,28.799
+1996-11-02,28.769
+1996-11-03,28.752
+1996-11-04,28.783
+1996-11-05,28.714
+1996-11-06,28.746
+1996-11-07,28.891
+1996-11-08,28.848
+1996-11-09,28.958
+1996-11-10,29.067
+1996-11-11,29.119
+1996-11-12,29.116
+1996-11-13,29.117
+1996-11-14,29.112
+1996-11-15,29.088
+1996-11-16,29.106
+1996-11-17,29.094
+1996-11-18,29.084
+1996-11-19,29.098
+1996-11-20,29.113
+1996-11-21,29.108
+1996-11-22,29.094
+1996-11-23,29.111
+1996-11-24,29.063
+1996-11-25,29.066
+1996-11-26,29.002
+1996-11-27,29.02
+1996-11-28,29.064
+1996-11-29,29.058
+1996-11-30,29.147
+1996-12-01,29.191
+1996-12-02,29.203
+1996-12-03,29.314
+1996-12-04,29.357
+1996-12-05,29.394
+1996-12-06,29.411
+1996-12-07,29.456
+1996-12-08,29.426
+1996-12-09,29.427
+1996-12-10,29.431
+1996-12-11,29.411
+1996-12-12,29.38
+1996-12-13,29.403
+1996-12-14,29.403
+1996-12-15,29.405
+1996-12-16,29.492
+1996-12-17,29.42
+1996-12-18,29.394
+1996-12-19,29.385
+1996-12-20,29.402
+1996-12-21,29.425
+1996-12-22,29.455
+1996-12-23,29.378
+1996-12-24,29.478
+1996-12-25,29.369
+1996-12-26,29.401
+1996-12-27,29.38
+1996-12-28,29.433
+1996-12-29,29.399
+1996-12-30,29.341
+1996-12-31,29.292
+1997-01-01,29.318
+1997-01-02,29.302
+1997-01-03,29.286
+1997-01-04,29.288
+1997-01-05,29.353
+1997-01-06,29.357
+1997-01-07,29.306
+1997-01-08,29.211
+1997-01-09,29.227
+1997-01-10,29.23
+1997-01-11,29.234
+1997-01-12,29.234
+1997-01-13,29.223
+1997-01-14,29.222
+1997-01-15,29.215
+1997-01-16,29.253
+1997-01-17,29.127
+1997-01-18,29.126
+1997-01-19,29.192
+1997-01-20,29.215
+1997-01-21,29.142
+1997-01-22,29.146
+1997-01-23,29.072
+1997-01-24,29.092
+1997-01-25,29.085
+1997-01-26,29.108
+1997-01-27,29.076
+1997-01-28,29.059
+1997-01-29,29.069
+1997-01-30,29.083
+1997-01-31,29.054
+1997-02-01,29.011
+1997-02-02,29.004
+1997-02-03,28.996
+1997-02-04,28.992
+1997-02-05,28.997
+1997-02-06,28.983
+1997-02-07,28.977
+1997-02-08,28.958
+1997-02-09,28.948
+1997-02-10,28.945
+1997-02-11,28.938
+1997-02-12,28.927
+1997-02-13,28.928
+1997-02-14,28.939
+1997-02-15,28.9
+1997-02-16,28.923
+1997-02-17,28.917
+1997-02-18,28.908
+1997-02-19,28.881
+1997-02-20,28.877
+1997-02-21,28.915
+1997-02-22,28.909
+1997-02-23,28.965
+1997-02-24,28.996
+1997-02-25,29.045
+1997-02-26,29.03
+1997-02-27,29.027
+1997-02-28,29.054
+1997-03-01,29.145
+1997-03-02,29.229
+1997-03-03,29.195
+1997-03-04,29.244
+1997-03-05,29.245
+1997-03-06,29.217
+1997-03-07,29.262
+1997-03-08,29.247
+1997-03-09,29.239
+1997-03-10,29.356
+1997-03-11,29.259
+1997-03-12,29.231
+1997-03-13,29.195
+1997-03-14,29.193
+1997-03-15,29.202
+1997-03-16,29.194
+1997-03-17,29.207
+1997-03-18,29.153
+1997-03-19,29.164
+1997-03-20,29.158
+1997-03-21,29.143
+1997-03-22,29.105
+1997-03-23,29.125
+1997-03-24,29.115
+1997-03-25,29.171
+1997-03-26,29.175
+1997-03-27,29.11
+1997-03-28,29.097
+1997-03-29,29.151
+1997-03-30,29.209
+1997-03-31,29.172
+1997-04-01,29.229
+1997-04-02,29.324
+1997-04-03,29.375
+1997-04-04,29.392
+1997-04-05,29.413
+1997-04-06,29.529
+1997-04-07,29.549
+1997-04-08,29.563
+1997-04-09,29.538
+1997-04-10,29.562
+1997-04-11,29.58
+1997-04-12,29.572
+1997-04-13,29.567
+1997-04-14,29.557
+1997-04-15,29.567
+1997-04-16,29.577
+1997-04-17,29.544
+1997-04-18,29.455
+1997-04-19,29.5
+1997-04-20,29.591
+1997-04-21,29.596
+1997-04-22,29.6
+1997-04-23,29.603
+1997-04-24,29.574
+1997-04-25,29.604
+1997-04-26,29.599
+1997-04-27,29.599
+1997-04-28,29.625
+1997-04-29,29.613
+1997-04-30,29.659
+1997-05-01,29.712
+1997-05-02,29.632
+1997-05-03,29.662
+1997-05-04,29.663
+1997-05-05,29.683
+1997-05-06,29.719
+1997-05-07,29.606
+1997-05-08,29.657
+1997-05-09,29.669
+1997-05-10,29.663
+1997-05-11,29.678
+1997-05-12,29.708
+1997-05-13,29.675
+1997-05-14,29.665
+1997-05-15,29.655
+1997-05-16,29.643
+1997-05-17,29.665
+1997-05-18,29.613
+1997-05-19,29.603
+1997-05-20,29.606
+1997-05-21,29.578
+1997-05-22,29.529
+1997-05-23,29.523
+1997-05-24,29.535
+1997-05-25,29.509
+1997-05-26,29.471
+1997-05-27,29.479
+1997-05-28,29.469
+1997-05-29,29.451
+1997-05-30,29.477
+1997-05-31,29.418
+1997-06-01,29.379
+1997-06-02,29.355
+1997-06-03,29.344
+1997-06-04,29.34
+1997-06-05,29.313
+1997-06-06,29.303
+1997-06-07,29.28
+1997-06-08,29.262
+1997-06-09,29.255
+1997-06-10,29.233
+1997-06-11,29.203
+1997-06-12,29.18
+1997-06-13,29.167
+1997-06-14,29.117
+1997-06-15,29.112
+1997-06-16,29.228
+1997-06-17,29.157
+1997-06-18,29.058
+1997-06-19,29.05
+1997-06-20,29.051
+1997-06-21,29.052
+1997-06-22,29.037
+1997-06-23,29.014
+1997-06-24,29.014
+1997-06-25,29.038
+1997-06-26,28.991
+1997-06-27,28.958
+1997-06-28,28.967
+1997-06-29,28.952
+1997-06-30,28.934
+1997-07-01,28.92
+1997-07-02,28.905
+1997-07-03,28.931
+1997-07-04,28.9
+1997-07-05,28.868
+1997-07-06,28.874
+1997-07-07,28.858
+1997-07-08,28.835
+1997-07-09,28.815
+1997-07-10,28.818
+1997-07-11,28.825
+1997-07-12,28.825
+1997-07-13,28.818
+1997-07-14,28.814
+1997-07-15,28.858
+1997-07-16,28.878
+1997-07-17,28.908
+1997-07-18,28.906
+1997-07-19,28.879
+1997-07-20,28.877
+1997-07-21,28.884
+1997-07-22,28.86
+1997-07-23,28.857
+1997-07-24,28.87
+1997-07-25,28.847
+1997-07-26,28.847
+1997-07-27,28.83
+1997-07-28,28.819
+1997-07-29,28.785
+1997-07-30,28.791
+1997-07-31,28.795
+1997-08-01,28.794
+1997-08-02,28.781
+1997-08-03,28.742
+1997-08-04,28.743
+1997-08-05,28.721
+1997-08-06,28.728
+1997-08-07,28.745
+1997-08-08,28.736
+1997-08-09,28.723
+1997-08-10,28.724
+1997-08-11,28.719
+1997-08-12,28.696
+1997-08-13,28.739
+1997-08-14,28.733
+1997-08-15,28.754
+1997-08-16,28.797
+1997-08-17,28.742
+1997-08-18,28.731
+1997-08-19,28.728
+1997-08-20,28.735
+1997-08-21,28.746
+1997-08-22,28.758
+1997-08-23,28.772
+1997-08-24,28.784
+1997-08-25,28.79
+1997-08-26,28.784
+1997-08-27,28.804
+1997-08-28,28.808
+1997-08-29,28.795
+1997-08-30,28.786
+1997-08-31,28.797
+1997-09-01,28.799
+1997-09-02,28.811
+1997-09-03,28.766
+1997-09-04,28.766
+1997-09-05,28.786
+1997-09-06,28.817
+1997-09-07,28.767
+1997-09-08,28.75
+1997-09-09,28.757
+1997-09-10,28.764
+1997-09-11,28.775
+1997-09-12,28.765
+1997-09-13,28.751
+1997-09-14,28.746
+1997-09-15,28.752
+1997-09-16,28.721
+1997-09-17,28.764
+1997-09-18,28.743
+1997-09-19,28.763
+1997-09-20,28.701
+1997-09-21,28.714
+1997-09-22,28.755
+1997-09-23,28.723
+1997-09-24,28.708
+1997-09-25,28.783
+1997-09-26,28.695
+1997-09-27,28.701
+1997-09-28,28.742
+1997-09-29,28.737
+1997-09-30,28.768
+1997-10-01,28.698
+1997-10-02,28.728
+1997-10-03,28.758
+1997-10-04,28.766
+1997-10-05,28.789
+1997-10-06,28.756
+1997-10-07,28.741
+1997-10-08,28.732
+1997-10-09,28.77
+1997-10-10,28.744
+1997-10-11,28.709
+1997-10-12,28.718
+1997-10-13,28.732
+1997-10-14,28.761
+1997-10-15,28.696
+1997-10-16,28.654
+1997-10-17,28.674
+1997-10-18,28.683
+1997-10-19,28.673
+1997-10-20,28.671
+1997-10-21,28.659
+1997-10-22,28.649
+1997-10-23,28.669
+1997-10-24,28.642
+1997-10-25,28.621
+1997-10-26,28.609
+1997-10-27,28.66
+1997-10-28,28.652
+1997-10-29,28.674
+1997-10-30,28.654
+1997-10-31,28.718
+1997-11-01,28.664
+1997-11-02,28.685
+1997-11-03,28.779
+1997-11-04,28.73
+1997-11-05,28.765
+1997-11-06,28.772
+1997-11-07,28.772
+1997-11-08,28.765
+1997-11-09,28.745
+1997-11-10,28.826
+1997-11-11,28.849
+1997-11-12,28.865
+1997-11-13,28.858
+1997-11-14,28.816
+1997-11-15,28.846
+1997-11-16,28.869
+1997-11-17,28.896
+1997-11-18,28.881
+1997-11-19,28.931
+1997-11-20,28.885
+1997-11-21,28.914
+1997-11-22,28.779
+1997-11-23,28.902
+1997-11-24,28.856
+1997-11-25,28.964
+1997-11-26,28.882
+1997-11-27,28.808
+1997-11-28,28.924
+1997-11-29,28.882
+1997-11-30,28.875
+1997-12-01,28.843
+1997-12-02,28.86
+1997-12-03,28.885
+1997-12-04,28.874
+1997-12-05,28.889
+1997-12-06,28.897
+1997-12-07,28.893
+1997-12-08,28.875
+1997-12-09,28.888
+1997-12-10,28.852
+1997-12-11,28.839
+1997-12-12,28.845
+1997-12-13,28.875
+1997-12-14,28.819
+1997-12-15,28.817
+1997-12-16,28.857
+1997-12-17,28.812
+1997-12-18,28.803
+1997-12-19,28.824
+1997-12-20,28.782
+1997-12-21,28.786
+1997-12-22,28.767
+1997-12-23,28.776
+1997-12-24,28.759
+1997-12-25,28.785
+1997-12-26,28.773
+1997-12-27,28.776
+1997-12-28,28.767
+1997-12-29,28.766
+1997-12-30,28.723
+1997-12-31,28.773
+1998-01-01,28.837
+1998-01-02,28.787
+1998-01-03,28.763
+1998-01-04,28.737
+1998-01-05,28.778
+1998-01-06,28.802
+1998-01-07,28.853
+1998-01-08,28.877
+1998-01-09,29.232
+1998-01-10,29.552
+1998-01-11,29.629
+1998-01-12,29.693
+1998-01-13,29.708
+1998-01-14,29.738
+1998-01-15,29.75
+1998-01-16,29.766
+1998-01-17,29.766
+1998-01-18,29.767
+1998-01-19,29.672
+1998-01-20,29.614
+1998-01-21,29.595
+1998-01-22,29.603
+1998-01-23,29.599
+1998-01-24,29.572
+1998-01-25,29.555
+1998-01-26,29.59
+1998-01-27,29.576
+1998-01-28,29.549
+1998-01-29,29.493
+1998-01-30,29.469
+1998-01-31,29.454
+1998-02-01,29.451
+1998-02-02,29.45
+1998-02-03,29.438
+1998-02-04,29.418
+1998-02-05,29.4
+1998-02-06,29.411
+1998-02-07,29.36
+1998-02-08,29.347
+1998-02-09,29.336
+1998-02-10,29.322
+1998-02-11,29.325
+1998-02-12,29.331
+1998-02-13,29.32
+1998-02-14,29.297
+1998-02-15,29.291
+1998-02-16,29.289
+1998-02-17,29.282
+1998-02-18,29.276
+1998-02-19,29.278
+1998-02-20,29.294
+1998-02-21,29.283
+1998-02-22,29.273
+1998-02-23,29.262
+1998-02-24,29.196
+1998-02-25,29.191
+1998-02-26,29.249
+1998-02-27,29.252
+1998-02-28,29.25
+1998-03-01,29.258
+1998-03-02,29.271
+1998-03-03,29.279
+1998-03-04,29.298
+1998-03-05,29.298
+1998-03-06,29.316
+1998-03-07,29.32
+1998-03-08,29.315
+1998-03-09,29.371
+1998-03-10,29.422
+1998-03-11,29.466
+1998-03-12,29.465
+1998-03-13,29.493
+1998-03-14,29.487
+1998-03-15,29.484
+1998-03-16,29.488
+1998-03-17,29.504
+1998-03-18,29.493
+1998-03-19,29.464
+1998-03-20,29.464
+1998-03-21,29.383
+1998-03-22,29.384
+1998-03-23,29.47
+1998-03-24,29.473
+1998-03-25,29.481
+1998-03-26,29.536
+1998-03-27,29.508
+1998-03-28,29.576
+1998-03-29,29.732
+1998-03-30,29.904
+1998-03-31,29.975
+1998-04-01,30.066
+1998-04-02,30.182
+1998-04-03,30.253
+1998-04-04,30.274
+1998-04-05,30.292
+1998-04-06,30.305
+1998-04-07,30.302
+1998-04-08,30.287
+1998-04-09,30.23
+1998-04-10,30.184
+1998-04-11,30.206
+1998-04-12,30.198
+1998-04-13,30.169
+1998-04-14,30.136
+1998-04-15,30.099
+1998-04-16,30.08
+1998-04-17,30.084
+1998-04-18,30.039
+1998-04-19,29.996
+1998-04-20,29.958
+1998-04-21,29.964
+1998-04-22,29.949
+1998-04-23,29.924
+1998-04-24,29.885
+1998-04-25,29.851
+1998-04-26,29.824
+1998-04-27,29.788
+1998-04-28,29.777
+1998-04-29,29.771
+1998-04-30,29.739
+1998-05-01,29.71
+1998-05-02,29.655
+1998-05-03,29.647
+1998-05-04,29.639
+1998-05-05,29.635
+1998-05-06,29.612
+1998-05-07,29.6
+1998-05-08,29.576
+1998-05-09,29.502
+1998-05-10,29.501
+1998-05-11,29.516
+1998-05-12,29.533
+1998-05-13,29.524
+1998-05-14,29.502
+1998-05-15,29.476
+1998-05-16,29.455
+1998-05-17,29.478
+1998-05-18,29.401
+1998-05-19,29.369
+1998-05-20,29.376
+1998-05-21,29.324
+1998-05-22,29.279
+1998-05-23,29.261
+1998-05-24,29.256
+1998-05-25,29.255
+1998-05-26,29.214
+1998-05-27,29.196
+1998-05-28,29.193
+1998-05-29,29.176
+1998-05-30,29.138
+1998-05-31,29.166
+1998-06-01,29.11
+1998-06-02,29.179
+1998-06-03,29.136
+1998-06-04,29.08
+1998-06-05,29.045
+1998-06-06,29.026
+1998-06-07,29.029
+1998-06-08,29.023
+1998-06-09,29.015
+1998-06-10,29.014
+1998-06-11,29.008
+1998-06-12,29.027
+1998-06-13,29.038
+1998-06-14,28.969
+1998-06-15,28.992
+1998-06-16,29.028
+1998-06-17,29.045
+1998-06-18,29.068
+1998-06-19,29.108
+1998-06-20,29.141
+1998-06-21,29.157
+1998-06-22,29.195
+1998-06-23,29.193
+1998-06-24,29.175
+1998-06-25,29.171
+1998-06-26,29.193
+1998-06-27,29.207
+1998-06-28,29.32
+1998-06-29,29.392
+1998-06-30,29.414
+1998-07-01,29.4
+1998-07-02,29.486
+1998-07-03,29.523
+1998-07-04,29.525
+1998-07-05,29.511
+1998-07-06,29.544
+1998-07-07,29.541
+1998-07-08,29.554
+1998-07-09,29.564
+1998-07-10,29.561
+1998-07-11,29.557
+1998-07-12,29.576
+1998-07-13,29.603
+1998-07-14,29.604
+1998-07-15,29.574
+1998-07-16,29.562
+1998-07-17,29.546
+1998-07-18,29.522
+1998-07-19,29.529
+1998-07-20,29.52
+1998-07-21,29.487
+1998-07-22,29.463
+1998-07-23,29.441
+1998-07-24,29.419
+1998-07-25,29.395
+1998-07-26,29.383
+1998-07-27,29.388
+1998-07-28,29.363
+1998-07-29,29.35
+1998-07-30,29.323
+1998-07-31,29.29
+1998-08-01,29.276
+1998-08-02,29.278
+1998-08-03,29.254
+1998-08-04,29.23
+1998-08-05,29.214
+1998-08-06,29.2
+1998-08-07,29.193
+1998-08-08,29.183
+1998-08-09,29.194
+1998-08-10,29.178
+1998-08-11,29.142
+1998-08-12,29.124
+1998-08-13,29.211
+1998-08-14,29.255
+1998-08-15,29.295
+1998-08-16,29.221
+1998-08-17,29.235
+1998-08-18,29.182
+1998-08-19,29.162
+1998-08-20,29.174
+1998-08-21,29.17
+1998-08-22,29.143
+1998-08-23,29.136
+1998-08-24,29.173
+1998-08-25,29.157
+1998-08-26,29.173
+1998-08-27,29.154
+1998-08-28,29.145
+1998-08-29,29.156
+1998-08-30,29.137
+1998-08-31,29.114
+1998-09-01,29.095
+1998-09-02,29.111
+1998-09-03,29.107
+1998-09-04,29.08
+1998-09-05,29.049
+1998-09-06,29.074
+1998-09-07,29.032
+1998-09-08,29
+1998-09-09,28.988
+1998-09-10,29.002
+1998-09-11,29.021
+1998-09-12,29.025
+1998-09-13,28.995
+1998-09-14,28.999
+1998-09-15,29.017
+1998-09-16,28.981
+1998-09-17,29.019
+1998-09-18,29.017
+1998-09-19,29.078
+1998-09-20,29.004
+1998-09-21,29.043
+1998-09-22,28.97
+1998-09-23,28.958
+1998-09-24,28.996
+1998-09-25,29.005
+1998-09-26,28.986
+1998-09-27,29.002
+1998-09-28,28.964
+1998-09-29,28.986
+1998-09-30,29.005
+1998-10-01,28.992
+1998-10-02,28.995
+1998-10-03,28.98
+1998-10-04,28.979
+1998-10-05,28.962
+1998-10-06,28.956
+1998-10-07,29.092
+1998-10-08,29.008
+1998-10-09,28.92
+1998-10-10,28.927
+1998-10-11,28.907
+1998-10-12,28.928
+1998-10-13,28.98
+1998-10-14,28.981
+1998-10-15,28.963
+1998-10-16,28.974
+1998-10-17,29.021
+1998-10-18,29.089
+1998-10-19,29.025
+1998-10-20,28.996
+1998-10-21,28.981
+1998-10-22,28.957
+1998-10-23,28.986
+1998-10-24,28.981
+1998-10-25,28.929
+1998-10-26,28.918
+1998-10-27,29.013
+1998-10-28,29.044
+1998-10-29,28.855
+1998-10-30,28.846
+1998-10-31,28.864
+1998-11-01,28.87
+1998-11-02,28.852
+1998-11-03,28.867
+1998-11-04,28.872
+1998-11-05,28.863
+1998-11-06,28.854
+1998-11-07,28.85
+1998-11-08,28.835
+1998-11-09,28.831
+1998-11-10,28.871
+1998-11-11,28.939
+1998-11-12,28.86
+1998-11-13,28.825
+1998-11-14,28.872
+1998-11-15,28.85
+1998-11-16,28.799
+1998-11-17,28.754
+1998-11-18,28.81
+1998-11-19,28.875
+1998-11-20,28.86
+1998-11-21,28.793
+1998-11-22,28.851
+1998-11-23,28.926
+1998-11-24,28.787
+1998-11-25,28.766
+1998-11-26,28.846
+1998-11-27,28.737
+1998-11-28,28.774
+1998-11-29,28.765
+1998-11-30,28.976
+1998-12-01,28.808
+1998-12-02,28.815
+1998-12-03,28.762
+1998-12-04,28.768
+1998-12-05,28.771
+1998-12-06,28.815
+1998-12-07,28.807
+1998-12-08,28.78
+1998-12-09,28.789
+1998-12-10,28.804
+1998-12-11,28.775
+1998-12-12,28.838
+1998-12-13,28.77
+1998-12-14,28.73
+1998-12-15,28.84
+1998-12-16,28.731
+1998-12-17,28.717
+1998-12-18,28.709
+1998-12-19,28.798
+1998-12-20,28.681
+1998-12-21,28.844
+1998-12-22,28.749
+1998-12-23,28.687
+1998-12-24,28.777
+1998-12-25,28.768
+1998-12-26,28.793
+1998-12-27,28.73
+1998-12-28,28.722
+1998-12-29,28.677
+1998-12-30,28.677
+1998-12-31,28.707
+1999-01-01,28.652
+1999-01-02,28.655
+1999-01-03,28.647
+1999-01-04,28.653
+1999-01-05,28.646
+1999-01-06,28.66
+1999-01-07,28.644
+1999-01-08,28.657
+1999-01-09,28.634
+1999-01-10,28.652
+1999-01-11,28.66
+1999-01-12,28.675
+1999-01-13,28.681
+1999-01-14,28.714
+1999-01-15,28.713
+1999-01-16,28.72
+1999-01-17,28.697
+1999-01-18,28.683
+1999-01-19,28.698
+1999-01-20,28.693
+1999-01-21,28.684
+1999-01-22,28.688
+1999-01-23,28.746
+1999-01-24,28.811
+1999-01-25,28.83
+1999-01-26,28.883
+1999-01-27,28.903
+1999-01-28,28.874
+1999-01-29,28.887
+1999-01-30,28.922
+1999-01-31,28.924
+1999-02-01,28.928
+1999-02-02,28.933
+1999-02-03,28.951
+1999-02-04,28.973
+1999-02-05,28.975
+1999-02-06,28.98
+1999-02-07,28.982
+1999-02-08,28.985
+1999-02-09,28.999
+1999-02-10,28.98
+1999-02-11,28.971
+1999-02-12,29.03
+1999-02-13,29.014
+1999-02-14,29.001
+1999-02-15,29.018
+1999-02-16,29.008
+1999-02-17,29.013
+1999-02-18,29.031
+1999-02-19,29.018
+1999-02-20,29.008
+1999-02-21,28.955
+1999-02-22,28.94
+1999-02-23,28.956
+1999-02-24,28.95
+1999-02-25,28.945
+1999-02-26,28.941
+1999-02-27,28.942
+1999-02-28,28.96
+1999-03-01,28.957
+1999-03-02,28.991
+1999-03-03,28.977
+1999-03-04,29.007
+1999-03-05,28.987
+1999-03-06,28.934
+1999-03-07,28.869
+1999-03-08,28.984
+1999-03-09,28.963
+1999-03-10,28.96
+1999-03-11,28.958
+1999-03-12,28.957
+1999-03-13,28.956
+1999-03-14,28.953
+1999-03-15,28.941
+1999-03-16,28.943
+1999-03-17,28.968
+1999-03-18,28.992
+1999-03-19,28.979
+1999-03-20,28.988
+1999-03-21,29.008
+1999-03-22,29.068
+1999-03-23,29.176
+1999-03-24,29.179
+1999-03-25,29.158
+1999-03-26,29.183
+1999-03-27,29.196
+1999-03-28,29.203
+1999-03-29,29.225
+1999-03-30,29.237
+1999-03-31,29.263
+1999-04-01,29.275
+1999-04-02,29.293
+1999-04-03,29.355
+1999-04-04,29.328
+1999-04-05,29.416
+1999-04-06,29.487
+1999-04-07,29.549
+1999-04-08,29.519
+1999-04-09,29.502
+1999-04-10,29.486
+1999-04-11,29.508
+1999-04-12,29.5
+1999-04-13,29.47
+1999-04-14,29.469
+1999-04-15,29.482
+1999-04-16,29.477
+1999-04-17,29.495
+1999-04-18,29.47
+1999-04-19,29.452
+1999-04-20,29.448
+1999-04-21,29.441
+1999-04-22,29.428
+1999-04-23,29.36
+1999-04-24,29.337
+1999-04-25,29.361
+1999-04-26,29.352
+1999-04-27,29.293
+1999-04-28,29.295
+1999-04-29,29.276
+1999-04-30,29.267
+1999-05-01,29.272
+1999-05-02,29.261
+1999-05-03,29.246
+1999-05-04,29.229
+1999-05-05,29.214
+1999-05-06,29.205
+1999-05-07,29.224
+1999-05-08,29.211
+1999-05-09,29.184
+1999-05-10,29.138
+1999-05-11,29.118
+1999-05-12,29.094
+1999-05-13,29.068
+1999-05-14,29.072
+1999-05-15,29.069
+1999-05-16,29.077
+1999-05-17,29.086
+1999-05-18,29.116
+1999-05-19,29.066
+1999-05-20,29
+1999-05-21,28.991
+1999-05-22,29.009
+1999-05-23,28.992
+1999-05-24,29.001
+1999-05-25,29.012
+1999-05-26,29.013
+1999-05-27,28.976
+1999-05-28,28.961
+1999-05-29,28.959
+1999-05-30,28.96
+1999-05-31,28.948
+1999-06-01,28.938
+1999-06-02,28.915
+1999-06-03,28.896
+1999-06-04,28.858
+1999-06-05,28.866
+1999-06-06,28.932
+1999-06-07,28.856
+1999-06-08,28.844
+1999-06-09,28.804
+1999-06-10,28.838
+1999-06-11,28.84
+1999-06-12,28.827
+1999-06-13,28.816
+1999-06-14,28.84
+1999-06-15,28.772
+1999-06-16,28.74
+1999-06-17,28.727
+1999-06-18,28.717
+1999-06-19,28.711
+1999-06-20,28.708
+1999-06-21,28.693
+1999-06-22,28.686
+1999-06-23,28.677
+1999-06-24,28.671
+1999-06-25,28.683
+1999-06-26,28.671
+1999-06-27,28.645
+1999-06-28,28.643
+1999-06-29,28.641
+1999-06-30,28.628
+1999-07-01,28.62
+1999-07-02,28.683
+1999-07-03,28.623
+1999-07-04,28.614
+1999-07-05,28.601
+1999-07-06,28.605
+1999-07-07,28.631
+1999-07-08,28.618
+1999-07-09,28.617
+1999-07-10,28.618
+1999-07-11,28.611
+1999-07-12,28.618
+1999-07-13,28.626
+1999-07-14,28.632
+1999-07-15,28.654
+1999-07-16,28.629
+1999-07-17,28.619
+1999-07-18,28.603
+1999-07-19,28.586
+1999-07-20,28.571
+1999-07-21,28.575
+1999-07-22,28.583
+1999-07-23,28.581
+1999-07-24,28.578
+1999-07-25,28.574
+1999-07-26,28.564
+1999-07-27,28.558
+1999-07-28,28.561
+1999-07-29,28.565
+1999-07-30,28.573
+1999-07-31,28.573
+1999-08-01,28.56
+1999-08-02,28.523
+1999-08-03,28.518
+1999-08-04,28.528
+1999-08-05,28.539
+1999-08-06,28.521
+1999-08-07,28.505
+1999-08-08,28.508
+1999-08-09,28.496
+1999-08-10,28.489
+1999-08-11,28.493
+1999-08-12,28.496
+1999-08-13,28.498
+1999-08-14,28.496
+1999-08-15,28.45
+1999-08-16,28.456
+1999-08-17,28.483
+1999-08-18,28.474
+1999-08-19,28.454
+1999-08-20,28.454
+1999-08-21,28.467
+1999-08-22,28.468
+1999-08-23,28.466
+1999-08-24,28.466
+1999-08-25,28.469
+1999-08-26,28.466
+1999-08-27,28.463
+1999-08-28,28.465
+1999-08-29,28.429
+1999-08-30,28.39
+1999-08-31,28.39
+1999-09-01,28.406
+1999-09-02,28.413
+1999-09-03,28.412
+1999-09-04,28.407
+1999-09-05,28.416
+1999-09-06,28.425
+1999-09-07,28.434
+1999-09-08,28.429
+1999-09-09,28.434
+1999-09-10,28.424
+1999-09-11,28.415
+1999-09-12,28.41
+1999-09-13,28.425
+1999-09-14,28.47
+1999-09-15,28.414
+1999-09-16,28.38
+1999-09-17,28.243
+1999-09-18,28.45
+1999-09-19,28.574
+1999-09-20,28.678
+1999-09-21,28.647
+1999-09-22,28.619
+1999-09-23,28.66
+1999-09-24,28.716
+1999-09-25,28.703
+1999-09-26,28.718
+1999-09-27,28.747
+1999-09-28,28.747
+1999-09-29,28.77
+1999-09-30,28.824
+1999-10-01,28.792
+1999-10-02,28.756
+1999-10-03,28.736
+1999-10-04,28.706
+1999-10-05,28.711
+1999-10-06,28.759
+1999-10-07,28.739
+1999-10-08,28.792
+1999-10-09,28.863
+1999-10-10,28.767
+1999-10-11,28.747
+1999-10-12,28.736
+1999-10-13,28.814
+1999-10-14,28.677
+1999-10-15,28.755
+1999-10-16,28.841
+1999-10-17,28.836
+1999-10-18,28.707
+1999-10-19,28.721
+1999-10-20,28.778
+1999-10-21,28.774
+1999-10-22,28.799
+1999-10-23,28.785
+1999-10-24,28.802
+1999-10-25,28.832
+1999-10-26,28.907
+1999-10-27,28.868
+1999-10-28,28.897
+1999-10-29,28.905
+1999-10-30,28.904
+1999-10-31,28.956
+1999-11-01,28.9
+1999-11-02,28.947
+1999-11-03,28.948
+1999-11-04,28.951
+1999-11-05,28.935
+1999-11-06,28.902
+1999-11-07,28.845
+1999-11-08,28.821
+1999-11-09,28.875
+1999-11-10,28.836
+1999-11-11,28.716
+1999-11-12,28.81
+1999-11-13,28.84
+1999-11-14,28.897
+1999-11-15,28.787
+1999-11-16,28.749
+1999-11-17,28.738
+1999-11-18,28.775
+1999-11-19,28.8
+1999-11-20,28.872
+1999-11-21,28.817
+1999-11-22,28.813
+1999-11-23,28.829
+1999-11-24,28.863
+1999-11-25,28.862
+1999-11-26,28.853
+1999-11-27,28.895
+1999-11-28,28.928
+1999-11-29,28.958
+1999-11-30,28.941
+1999-12-01,28.947
+1999-12-02,28.982
+1999-12-03,29.002
+1999-12-04,29.027
+1999-12-05,29.037
+1999-12-06,29.067
+1999-12-07,28.996
+1999-12-08,28.991
+1999-12-09,29.004
+1999-12-10,29.03
+1999-12-11,29.01
+1999-12-12,28.968
+1999-12-13,28.977
+1999-12-14,28.967
+1999-12-15,28.955
+1999-12-16,29.012
+1999-12-17,29.013
+1999-12-18,28.987
+1999-12-19,28.976
+1999-12-20,29.032
+1999-12-21,29.048
+1999-12-22,29
+1999-12-23,28.951
+1999-12-24,28.921
+1999-12-25,28.901
+1999-12-26,28.919
+1999-12-27,28.901
+1999-12-28,28.871
+1999-12-29,28.871
+1999-12-30,28.868
+1999-12-31,28.831
+2000-01-01,28.864
+2000-01-02,28.854
+2000-01-03,28.85
+2000-01-04,28.863
+2000-01-05,28.881
+2000-01-06,28.894
+2000-01-07,28.932
+2000-01-08,28.932
+2000-01-09,28.948
+2000-01-10,28.941
+2000-01-11,28.96
+2000-01-12,28.974
+2000-01-13,28.967
+2000-01-14,28.982
+2000-01-15,29.048
+2000-01-16,29.008
+2000-01-17,28.957
+2000-01-18,28.946
+2000-01-19,28.927
+2000-01-20,28.91
+2000-01-21,28.898
+2000-01-22,28.9
+2000-01-23,28.897
+2000-01-24,28.879
+2000-01-25,28.857
+2000-01-26,28.84
+2000-01-27,28.837
+2000-01-28,28.838
+2000-01-29,28.849
+2000-01-30,28.846
+2000-01-31,28.823
+2000-02-01,28.812
+2000-02-02,28.803
+2000-02-03,28.807
+2000-02-04,28.798
+2000-02-05,28.786
+2000-02-06,28.776
+2000-02-07,28.769
+2000-02-08,28.766
+2000-02-09,28.775
+2000-02-10,28.761
+2000-02-11,28.744
+2000-02-12,28.737
+2000-02-13,28.731
+2000-02-14,28.72
+2000-02-15,28.72
+2000-02-16,28.726
+2000-02-17,28.73
+2000-02-18,28.732
+2000-02-19,28.725
+2000-02-20,28.722
+2000-02-21,28.719
+2000-02-22,28.711
+2000-02-23,28.71
+2000-02-24,28.708
+2000-02-25,28.702
+2000-02-26,28.716
+2000-02-27,28.785
+2000-02-28,28.896
+2000-02-29,28.985
+2000-03-01,29.083
+2000-03-02,29.172
+2000-03-03,29.21
+2000-03-04,29.228
+2000-03-05,29.24
+2000-03-06,29.243
+2000-03-07,29.254
+2000-03-08,29.256
+2000-03-09,29.292
+2000-03-10,29.225
+2000-03-11,29.281
+2000-03-12,29.319
+2000-03-13,29.347
+2000-03-14,29.381
+2000-03-15,29.397
+2000-03-16,29.399
+2000-03-17,29.329
+2000-03-18,29.346
+2000-03-19,29.405
+2000-03-20,29.418
+2000-03-21,29.414
+2000-03-22,29.416
+2000-03-23,29.419
+2000-03-24,29.421
+2000-03-25,29.436
+2000-03-26,29.46
+2000-03-27,29.469
+2000-03-28,29.467
+2000-03-29,29.549
+2000-03-30,29.574
+2000-03-31,29.577
+2000-04-01,29.589
+2000-04-02,29.601
+2000-04-03,29.603
+2000-04-04,29.633
+2000-04-05,29.713
+2000-04-06,29.771
+2000-04-07,29.801
+2000-04-08,29.812
+2000-04-09,29.837
+2000-04-10,29.904
+2000-04-11,29.913
+2000-04-12,29.91
+2000-04-13,29.942
+2000-04-14,29.976
+2000-04-15,30.022
+2000-04-16,29.98
+2000-04-17,29.959
+2000-04-18,29.987
+2000-04-19,30.019
+2000-04-20,30.001
+2000-04-21,29.977
+2000-04-22,29.976
+2000-04-23,29.971
+2000-04-24,29.985
+2000-04-25,30.042
+2000-04-26,30.059
+2000-04-27,30.077
+2000-04-28,30.068
+2000-04-29,30.06
+2000-04-30,30.023
+2000-05-01,30.024
+2000-05-02,29.998
+2000-05-03,29.979
+2000-05-04,29.98
+2000-05-05,29.965
+2000-05-06,29.941
+2000-05-07,29.932
+2000-05-08,29.917
+2000-05-09,29.908
+2000-05-10,29.92
+2000-05-11,30.01
+2000-05-12,30.049
+2000-05-13,30.105
+2000-05-14,30.131
+2000-05-15,30.125
+2000-05-16,30.113
+2000-05-17,30.095
+2000-05-18,30.11
+2000-05-19,30.053
+2000-05-20,30.035
+2000-05-21,30.036
+2000-05-22,30.024
+2000-05-23,30.009
+2000-05-24,29.997
+2000-05-25,29.989
+2000-05-26,29.978
+2000-05-27,29.937
+2000-05-28,29.909
+2000-05-29,29.889
+2000-05-30,29.906
+2000-05-31,29.912
+2000-06-01,29.825
+2000-06-02,29.805
+2000-06-03,29.742
+2000-06-04,29.702
+2000-06-05,29.697
+2000-06-06,29.663
+2000-06-07,29.644
+2000-06-08,29.678
+2000-06-09,29.617
+2000-06-10,29.578
+2000-06-11,29.54
+2000-06-12,29.553
+2000-06-13,29.561
+2000-06-14,29.619
+2000-06-15,29.647
+2000-06-16,29.522
+2000-06-17,29.494
+2000-06-18,29.449
+2000-06-19,29.445
+2000-06-20,29.426
+2000-06-21,29.463
+2000-06-22,29.412
+2000-06-23,29.361
+2000-06-24,29.356
+2000-06-25,29.367
+2000-06-26,29.317
+2000-06-27,29.302
+2000-06-28,29.277
+2000-06-29,29.262
+2000-06-30,29.234
+2000-07-01,29.23
+2000-07-02,29.234
+2000-07-03,29.188
+2000-07-04,29.176
+2000-07-05,29.129
+2000-07-06,29.124
+2000-07-07,29.078
+2000-07-08,29.083
+2000-07-09,29.102
+2000-07-10,29.07
+2000-07-11,29.043
+2000-07-12,29.049
+2000-07-13,29.046
+2000-07-14,29.039
+2000-07-15,29.025
+2000-07-16,29
+2000-07-17,29.036
+2000-07-18,29.043
+2000-07-19,29.021
+2000-07-20,29.01
+2000-07-21,29.027
+2000-07-22,29.004
+2000-07-23,28.982
+2000-07-24,28.982
+2000-07-25,28.971
+2000-07-26,28.979
+2000-07-27,28.955
+2000-07-28,28.939
+2000-07-29,28.916
+2000-07-30,28.904
+2000-07-31,28.916
+2000-08-01,28.956
+2000-08-02,28.983
+2000-08-03,28.957
+2000-08-04,28.935
+2000-08-05,28.895
+2000-08-06,28.919
+2000-08-07,28.903
+2000-08-08,28.887
+2000-08-09,28.901
+2000-08-10,28.873
+2000-08-11,28.854
+2000-08-12,28.835
+2000-08-13,28.851
+2000-08-14,28.851
+2000-08-15,28.87
+2000-08-16,28.882
+2000-08-17,28.823
+2000-08-18,28.833
+2000-08-19,28.823
+2000-08-20,28.802
+2000-08-21,28.795
+2000-08-22,28.804
+2000-08-23,28.828
+2000-08-24,28.803
+2000-08-25,28.809
+2000-08-26,28.817
+2000-08-27,28.794
+2000-08-28,28.777
+2000-08-29,28.792
+2000-08-30,28.804
+2000-08-31,28.8
+2000-09-01,28.789
+2000-09-02,28.742
+2000-09-03,28.745
+2000-09-04,28.716
+2000-09-05,28.719
+2000-09-06,28.739
+2000-09-07,28.756
+2000-09-08,28.767
+2000-09-09,28.701
+2000-09-10,28.703
+2000-09-11,28.752
+2000-09-12,28.798
+2000-09-13,28.695
+2000-09-14,28.7
+2000-09-15,28.69
+2000-09-16,28.686
+2000-09-17,28.707
+2000-09-18,28.663
+2000-09-19,28.696
+2000-09-20,28.686
+2000-09-21,28.712
+2000-09-22,28.637
+2000-09-23,28.682
+2000-09-24,28.646
+2000-09-25,28.627
+2000-09-26,28.625
+2000-09-27,28.654
+2000-09-28,28.566
+2000-09-29,28.628
+2000-09-30,28.697
+2000-10-01,28.65
+2000-10-02,28.637
+2000-10-03,28.621
+2000-10-04,28.6
+2000-10-05,28.562
+2000-10-06,28.57
+2000-10-07,28.578
+2000-10-08,28.582
+2000-10-09,28.565
+2000-10-10,28.572
+2000-10-11,28.578
+2000-10-12,28.604
+2000-10-13,28.596
+2000-10-14,28.609
+2000-10-15,28.523
+2000-10-16,28.549
+2000-10-17,28.57
+2000-10-18,28.607
+2000-10-19,28.556
+2000-10-20,28.625
+2000-10-21,28.596
+2000-10-22,28.554
+2000-10-23,28.584
+2000-10-24,28.597
+2000-10-25,28.563
+2000-10-26,28.57
+2000-10-27,28.589
+2000-10-28,28.404
+2000-10-29,28.422
+2000-10-30,28.428
+2000-10-31,28.479
+2000-11-01,28.519
+2000-11-02,28.526
+2000-11-03,28.531
+2000-11-04,28.523
+2000-11-05,28.493
+2000-11-06,28.507
+2000-11-07,28.51
+2000-11-08,28.519
+2000-11-09,28.524
+2000-11-10,28.564
+2000-11-11,28.502
+2000-11-12,28.501
+2000-11-13,28.542
+2000-11-14,28.561
+2000-11-15,28.574
+2000-11-16,28.613
+2000-11-17,28.633
+2000-11-18,28.586
+2000-11-19,28.595
+2000-11-20,28.63
+2000-11-21,28.603
+2000-11-22,28.592
+2000-11-23,28.57
+2000-11-24,28.57
+2000-11-25,28.645
+2000-11-26,28.6
+2000-11-27,28.578
+2000-11-28,28.607
+2000-11-29,28.626
+2000-11-30,28.608
+2000-12-01,28.621
+2000-12-02,28.621
+2000-12-03,28.67
+2000-12-04,28.69
+2000-12-05,28.714
+2000-12-06,28.618
+2000-12-07,28.606
+2000-12-08,28.594
+2000-12-09,28.582
+2000-12-10,28.599
+2000-12-11,28.575
+2000-12-12,28.586
+2000-12-13,28.617
+2000-12-14,28.581
+2000-12-15,28.585
+2000-12-16,28.595
+2000-12-17,28.64
+2000-12-18,28.738
+2000-12-19,28.792
+2000-12-20,28.846
+2000-12-21,28.878
+2000-12-22,28.883
+2000-12-23,28.917
+2000-12-24,28.914
+2000-12-25,28.901
+2000-12-26,28.95
+2000-12-27,28.997
+2000-12-28,29.009
+2000-12-29,28.993
+2000-12-30,28.92
+2000-12-31,28.911
+2001-01-01,28.921
+2001-01-02,28.937
+2001-01-03,28.938
+2001-01-04,28.925
+2001-01-05,28.929
+2001-01-06,28.896
+2001-01-07,28.885
+2001-01-08,28.877
+2001-01-09,28.873
+2001-01-10,28.868
+2001-01-11,28.863
+2001-01-12,28.85
+2001-01-13,28.852
+2001-01-14,28.833
+2001-01-15,28.827
+2001-01-16,28.832
+2001-01-17,28.813
+2001-01-18,28.819
+2001-01-19,28.809
+2001-01-20,28.803
+2001-01-21,28.796
+2001-01-22,28.778
+2001-01-23,28.78
+2001-01-24,28.768
+2001-01-25,28.758
+2001-01-26,28.778
+2001-01-27,28.745
+2001-01-28,28.745
+2001-01-29,28.748
+2001-01-30,28.729
+2001-01-31,28.729
+2001-02-01,28.726
+2001-02-02,28.733
+2001-02-03,28.741
+2001-02-04,28.753
+2001-02-05,28.72
+2001-02-06,28.723
+2001-02-07,28.727
+2001-02-08,28.722
+2001-02-09,28.746
+2001-02-10,28.772
+2001-02-11,28.789
+2001-02-12,28.775
+2001-02-13,28.759
+2001-02-14,28.771
+2001-02-15,28.773
+2001-02-16,28.779
+2001-02-17,28.791
+2001-02-18,28.823
+2001-02-19,28.804
+2001-02-20,28.786
+2001-02-21,28.777
+2001-02-22,28.794
+2001-02-23,28.77
+2001-02-24,28.766
+2001-02-25,28.798
+2001-02-26,28.771
+2001-02-27,28.755
+2001-02-28,28.752
+2001-03-01,28.751
+2001-03-02,28.741
+2001-03-03,28.739
+2001-03-04,28.736
+2001-03-05,28.731
+2001-03-06,28.716
+2001-03-07,28.747
+2001-03-08,28.759
+2001-03-09,28.755
+2001-03-10,28.763
+2001-03-11,28.791
+2001-03-12,28.75
+2001-03-13,28.767
+2001-03-14,28.797
+2001-03-15,28.764
+2001-03-16,28.756
+2001-03-17,28.756
+2001-03-18,28.758
+2001-03-19,28.757
+2001-03-20,28.759
+2001-03-21,28.756
+2001-03-22,28.639
+2001-03-23,28.739
+2001-03-24,28.818
+2001-03-25,28.82
+2001-03-26,28.826
+2001-03-27,28.839
+2001-03-28,28.832
+2001-03-29,28.817
+2001-03-30,28.779
+2001-03-31,28.762
+2001-04-01,28.804
+2001-04-02,28.827
+2001-04-03,28.849
+2001-04-04,28.863
+2001-04-05,28.876
+2001-04-06,28.884
+2001-04-07,28.909
+2001-04-08,29.174
+2001-04-09,29.107
+2001-04-10,29.204
+2001-04-11,29.3
+2001-04-12,29.443
+2001-04-13,29.539
+2001-04-14,29.599
+2001-04-15,29.688
+2001-04-16,29.744
+2001-04-17,29.769
+2001-04-18,29.782
+2001-04-19,29.844
+2001-04-20,29.861
+2001-04-21,29.874
+2001-04-22,29.91
+2001-04-23,29.941
+2001-04-24,30.052
+2001-04-25,30.07
+2001-04-26,30.13
+2001-04-27,30.118
+2001-04-28,30.098
+2001-04-29,30.122
+2001-04-30,30.119
+2001-05-01,30.097
+2001-05-02,30.084
+2001-05-03,30.079
+2001-05-04,30.04
+2001-05-05,30.006
+2001-05-06,30.004
+2001-05-07,29.999
+2001-05-08,29.987
+2001-05-09,29.921
+2001-05-10,29.888
+2001-05-11,29.861
+2001-05-12,29.815
+2001-05-13,29.789
+2001-05-14,29.784
+2001-05-15,29.722
+2001-05-16,29.731
+2001-05-17,29.724
+2001-05-18,29.716
+2001-05-19,29.647
+2001-05-20,29.626
+2001-05-21,29.618
+2001-05-22,29.59
+2001-05-23,29.548
+2001-05-24,29.527
+2001-05-25,29.519
+2001-05-26,29.512
+2001-05-27,29.464
+2001-05-28,29.451
+2001-05-29,29.437
+2001-05-30,29.394
+2001-05-31,29.373
+2001-06-01,29.382
+2001-06-02,29.408
+2001-06-03,29.365
+2001-06-04,29.367
+2001-06-05,29.36
+2001-06-06,29.339
+2001-06-07,29.334
+2001-06-08,29.316
+2001-06-09,29.302
+2001-06-10,29.289
+2001-06-11,29.274
+2001-06-12,29.249
+2001-06-13,29.242
+2001-06-14,29.225
+2001-06-15,29.216
+2001-06-16,29.211
+2001-06-17,29.198
+2001-06-18,29.172
+2001-06-19,29.229
+2001-06-20,29.147
+2001-06-21,29.148
+2001-06-22,29.17
+2001-06-23,29.126
+2001-06-24,29.14
+2001-06-25,29.139
+2001-06-26,29.128
+2001-06-27,29.115
+2001-06-28,29.056
+2001-06-29,29.094
+2001-06-30,29.084
+2001-07-01,29.072
+2001-07-02,29.029
+2001-07-03,29.066
+2001-07-04,29.049
+2001-07-05,29.031
+2001-07-06,28.993
+2001-07-07,29.005
+2001-07-08,28.993
+2001-07-09,28.979
+2001-07-10,28.974
+2001-07-11,28.957
+2001-07-12,28.95
+2001-07-13,28.944
+2001-07-14,28.926
+2001-07-15,28.917
+2001-07-16,28.913
+2001-07-17,28.899
+2001-07-18,28.881
+2001-07-19,28.882
+2001-07-20,28.882
+2001-07-21,28.887
+2001-07-22,28.893
+2001-07-23,28.874
+2001-07-24,28.871
+2001-07-25,28.813
+2001-07-26,28.751
+2001-07-27,28.769
+2001-07-28,28.78
+2001-07-29,28.781
+2001-07-30,28.778
+2001-07-31,28.755
+2001-08-01,28.754
+2001-08-02,28.771
+2001-08-03,28.73
+2001-08-04,28.711
+2001-08-05,28.722
+2001-08-06,28.738
+2001-08-07,28.715
+2001-08-08,28.707
+2001-08-09,28.712
+2001-08-10,28.714
+2001-08-11,28.661
+2001-08-12,28.683
+2001-08-13,28.671
+2001-08-14,28.639
+2001-08-15,28.644
+2001-08-16,28.679
+2001-08-17,28.701
+2001-08-18,28.64
+2001-08-19,28.609
+2001-08-20,28.599
+2001-08-21,28.615
+2001-08-22,28.615
+2001-08-23,28.61
+2001-08-24,28.547
+2001-08-25,28.579
+2001-08-26,28.698
+2001-08-27,28.596
+2001-08-28,28.595
+2001-08-29,28.565
+2001-08-30,28.592
+2001-08-31,28.646
+2001-09-01,28.593
+2001-09-02,28.588
+2001-09-03,28.652
+2001-09-04,28.628
+2001-09-05,28.559
+2001-09-06,28.592
+2001-09-07,28.601
+2001-09-08,28.622
+2001-09-09,28.611
+2001-09-10,28.625
+2001-09-11,28.563
+2001-09-12,28.563
+2001-09-13,28.544
+2001-09-14,28.512
+2001-09-15,28.522
+2001-09-16,28.539
+2001-09-17,28.536
+2001-09-18,28.514
+2001-09-19,28.503
+2001-09-20,28.563
+2001-09-21,28.544
+2001-09-22,28.519
+2001-09-23,28.509
+2001-09-24,28.531
+2001-09-25,28.512
+2001-09-26,28.5
+2001-09-27,28.506
+2001-09-28,28.457
+2001-09-29,28.46
+2001-09-30,28.474
+2001-10-01,28.493
+2001-10-02,28.498
+2001-10-03,28.521
+2001-10-04,28.528
+2001-10-05,28.463
+2001-10-06,28.476
+2001-10-07,28.467
+2001-10-08,28.441
+2001-10-09,28.48
+2001-10-10,28.5
+2001-10-11,28.512
+2001-10-12,28.43
+2001-10-13,28.444
+2001-10-14,28.563
+2001-10-15,28.484
+2001-10-16,28.455
+2001-10-17,28.498
+2001-10-18,28.449
+2001-10-19,28.51
+2001-10-20,28.445
+2001-10-21,28.45
+2001-10-22,28.403
+2001-10-23,28.519
+2001-10-24,28.432
+2001-10-25,28.453
+2001-10-26,28.482
+2001-10-27,28.399
+2001-10-28,28.392
+2001-10-29,28.454
+2001-10-30,28.363
+2001-10-31,28.449
+2001-11-01,28.506
+2001-11-02,28.45
+2001-11-03,28.397
+2001-11-04,28.406
+2001-11-05,28.32
+2001-11-06,28.373
+2001-11-07,28.358
+2001-11-08,28.468
+2001-11-09,28.395
+2001-11-10,28.424
+2001-11-11,28.359
+2001-11-12,28.383
+2001-11-13,28.427
+2001-11-14,28.452
+2001-11-15,28.424
+2001-11-16,28.351
+2001-11-17,28.384
+2001-11-18,28.45
+2001-11-19,28.493
+2001-11-20,28.395
+2001-11-21,28.427
+2001-11-22,28.406
+2001-11-23,28.398
+2001-11-24,28.455
+2001-11-25,28.505
+2001-11-26,28.376
+2001-11-27,28.317
+2001-11-28,28.299
+2001-11-29,28.426
+2001-11-30,28.366
+2001-12-01,28.438
+2001-12-02,28.433
+2001-12-03,28.472
+2001-12-04,28.441
+2001-12-05,28.46
+2001-12-06,28.523
+2001-12-07,28.451
+2001-12-08,28.438
+2001-12-09,28.441
+2001-12-10,28.541
+2001-12-11,28.458
+2001-12-12,28.455
+2001-12-13,28.563
+2001-12-14,28.42
+2001-12-15,28.37
+2001-12-16,28.447
+2001-12-17,28.473
+2001-12-18,28.435
+2001-12-19,28.46
+2001-12-20,28.465
+2001-12-21,28.418
+2001-12-22,28.446
+2001-12-23,28.477
+2001-12-24,28.47
+2001-12-25,28.488
+2001-12-26,28.463
+2001-12-27,28.46
+2001-12-28,28.486
+2001-12-29,28.457
+2001-12-30,28.455
+2001-12-31,28.445
+2002-01-01,28.433
+2002-01-02,28.435
+2002-01-03,28.42
+2002-01-04,28.416
+2002-01-05,28.418
+2002-01-06,28.419
+2002-01-07,28.377
+2002-01-08,28.424
+2002-01-09,28.445
+2002-01-10,28.416
+2002-01-11,28.413
+2002-01-12,28.415
+2002-01-13,28.429
+2002-01-14,28.421
+2002-01-15,28.411
+2002-01-16,28.407
+2002-01-17,28.424
+2002-01-18,28.418
+2002-01-19,28.421
+2002-01-20,28.424
+2002-01-21,28.433
+2002-01-22,28.409
+2002-01-23,28.447
+2002-01-24,28.393
+2002-01-25,28.42
+2002-01-26,28.44
+2002-01-27,28.418
+2002-01-28,28.431
+2002-01-29,28.413
+2002-01-30,28.423
+2002-01-31,28.426
+2002-02-01,28.486
+2002-02-02,28.483
+2002-02-03,28.486
+2002-02-04,28.471
+2002-02-05,28.481
+2002-02-06,28.487
+2002-02-07,28.499
+2002-02-08,28.485
+2002-02-09,28.485
+2002-02-10,28.531
+2002-02-11,28.444
+2002-02-12,28.549
+2002-02-13,28.498
+2002-02-14,28.534
+2002-02-15,28.541
+2002-02-16,28.527
+2002-02-17,28.506
+2002-02-18,28.525
+2002-02-19,28.534
+2002-02-20,28.537
+2002-02-21,28.557
+2002-02-22,28.575
+2002-02-23,28.585
+2002-02-24,28.599
+2002-02-25,28.635
+2002-02-26,28.65
+2002-02-27,28.654
+2002-02-28,28.678
+2002-03-01,28.726
+2002-03-02,28.696
+2002-03-03,28.779
+2002-03-04,28.721
+2002-03-05,28.759
+2002-03-06,28.769
+2002-03-07,28.759
+2002-03-08,28.77
+2002-03-09,28.88
+2002-03-10,28.888
+2002-03-11,28.832
+2002-03-12,28.916
+2002-03-13,28.923
+2002-03-14,28.874
+2002-03-15,28.839
+2002-03-16,28.86
+2002-03-17,28.893
+2002-03-18,28.932
+2002-03-19,28.926
+2002-03-20,28.983
+2002-03-21,28.955
+2002-03-22,28.905
+2002-03-23,28.956
+2002-03-24,28.892
+2002-03-25,28.883
+2002-03-26,28.895
+2002-03-27,28.922
+2002-03-28,28.931
+2002-03-29,28.96
+2002-03-30,29.063
+2002-03-31,28.993
+2002-04-01,29.027
+2002-04-02,29.077
+2002-04-03,29.112
+2002-04-04,29.116
+2002-04-05,29.127
+2002-04-06,29.105
+2002-04-07,29.145
+2002-04-08,29.188
+2002-04-09,29.211
+2002-04-10,29.138
+2002-04-11,29.179
+2002-04-12,29.341
+2002-04-13,29.203
+2002-04-14,29.238
+2002-04-15,29.337
+2002-04-16,29.414
+2002-04-17,29.443
+2002-04-18,29.47
+2002-04-19,29.518
+2002-04-20,29.464
+2002-04-21,29.468
+2002-04-22,29.463
+2002-04-23,29.479
+2002-04-24,29.479
+2002-04-25,29.565
+2002-04-26,29.462
+2002-04-27,29.443
+2002-04-28,29.409
+2002-04-29,29.387
+2002-04-30,29.48
+2002-05-01,29.468
+2002-05-02,29.482
+2002-05-03,29.496
+2002-05-04,29.486
+2002-05-05,29.491
+2002-05-06,29.501
+2002-05-07,29.475
+2002-05-08,29.427
+2002-05-09,29.57
+2002-05-10,29.497
+2002-05-11,29.395
+2002-05-12,29.392
+2002-05-13,29.375
+2002-05-14,29.407
+2002-05-15,29.443
+2002-05-16,29.518
+2002-05-17,29.497
+2002-05-18,29.513
+2002-05-19,29.532
+2002-05-20,29.535
+2002-05-21,29.527
+2002-05-22,29.529
+2002-05-23,29.531
+2002-05-24,29.49
+2002-05-25,29.455
+2002-05-26,29.514
+2002-05-27,29.44
+2002-05-28,29.415
+2002-05-29,29.436
+2002-05-30,29.416
+2002-05-31,29.45
+2002-06-01,29.441
+2002-06-02,29.377
+2002-06-03,29.376
+2002-06-04,29.395
+2002-06-05,29.411
+2002-06-06,29.347
+2002-06-07,29.358
+2002-06-08,29.39
+2002-06-09,29.339
+2002-06-10,29.327
+2002-06-11,29.303
+2002-06-12,29.381
+2002-06-13,29.471
+2002-06-14,29.528
+2002-06-15,29.563
+2002-06-16,29.609
+2002-06-17,29.618
+2002-06-18,29.61
+2002-06-19,29.597
+2002-06-20,29.593
+2002-06-21,29.591
+2002-06-22,29.547
+2002-06-23,29.559
+2002-06-24,29.515
+2002-06-25,29.519
+2002-06-26,29.516
+2002-06-27,29.522
+2002-06-28,29.498
+2002-06-29,29.496
+2002-06-30,29.501
+2002-07-01,29.487
+2002-07-02,29.469
+2002-07-03,29.443
+2002-07-04,29.415
+2002-07-05,29.363
+2002-07-06,29.365
+2002-07-07,29.358
+2002-07-08,29.362
+2002-07-09,29.353
+2002-07-10,29.308
+2002-07-11,29.305
+2002-07-12,29.315
+2002-07-13,29.304
+2002-07-14,29.283
+2002-07-15,29.254
+2002-07-16,29.214
+2002-07-17,29.223
+2002-07-18,29.184
+2002-07-19,29.175
+2002-07-20,29.156
+2002-07-21,29.172
+2002-07-22,29.203
+2002-07-23,29.12
+2002-07-24,29.095
+2002-07-25,29.093
+2002-07-26,29.138
+2002-07-27,29.114
+2002-07-28,29.113
+2002-07-29,29.062
+2002-07-30,29.042
+2002-07-31,29.025
+2002-08-01,29.018
+2002-08-02,29.039
+2002-08-03,28.997
+2002-08-04,28.975
+2002-08-05,28.949
+2002-08-06,28.889
+2002-08-07,28.897
+2002-08-08,28.889
+2002-08-09,28.903
+2002-08-10,28.908
+2002-08-11,28.891
+2002-08-12,28.881
+2002-08-13,28.874
+2002-08-14,28.873
+2002-08-15,28.858
+2002-08-16,28.859
+2002-08-17,28.827
+2002-08-18,28.84
+2002-08-19,28.792
+2002-08-20,28.772
+2002-08-21,28.772
+2002-08-22,28.781
+2002-08-23,28.728
+2002-08-24,28.766
+2002-08-25,28.749
+2002-08-26,28.739
+2002-08-27,28.669
+2002-08-28,28.68
+2002-08-29,28.709
+2002-08-30,28.692
+2002-08-31,28.668
+2002-09-01,28.722
+2002-09-02,28.69
+2002-09-03,28.695
+2002-09-04,28.648
+2002-09-05,28.601
+2002-09-06,28.609
+2002-09-07,28.626
+2002-09-08,28.632
+2002-09-09,28.614
+2002-09-10,28.61
+2002-09-11,28.524
+2002-09-12,28.563
+2002-09-13,28.616
+2002-09-14,28.593
+2002-09-15,28.595
+2002-09-16,28.57
+2002-09-17,28.601
+2002-09-18,28.583
+2002-09-19,28.623
+2002-09-20,28.666
+2002-09-21,28.635
+2002-09-22,28.592
+2002-09-23,28.605
+2002-09-24,28.595
+2002-09-25,28.597
+2002-09-26,28.609
+2002-09-27,28.608
+2002-09-28,28.603
+2002-09-29,28.639
+2002-09-30,28.701
+2002-10-01,28.719
+2002-10-02,28.675
+2002-10-03,28.605
+2002-10-04,28.797
+2002-10-05,28.756
+2002-10-06,28.641
+2002-10-07,28.766
+2002-10-08,28.613
+2002-10-09,28.629
+2002-10-10,28.645
+2002-10-11,28.616
+2002-10-12,28.622
+2002-10-13,28.702
+2002-10-14,28.589
+2002-10-15,28.605
+2002-10-16,28.578
+2002-10-17,28.606
+2002-10-18,28.649
+2002-10-19,28.747
+2002-10-20,28.68
+2002-10-21,28.691
+2002-10-22,28.705
+2002-10-23,28.7
+2002-10-24,28.703
+2002-10-25,28.706
+2002-10-26,28.756
+2002-10-27,28.723
+2002-10-28,28.709
+2002-10-29,28.69
+2002-10-30,28.689
+2002-10-31,28.721
+2002-11-01,28.71
+2002-11-02,28.701
+2002-11-03,28.705
+2002-11-04,28.718
+2002-11-05,28.683
+2002-11-06,28.706
+2002-11-07,28.653
+2002-11-08,28.813
+2002-11-09,28.712
+2002-11-10,28.777
+2002-11-11,28.766
+2002-11-12,28.682
+2002-11-13,28.693
+2002-11-14,28.753
+2002-11-15,28.695
+2002-11-16,28.641
+2002-11-17,28.613
+2002-11-18,28.729
+2002-11-19,28.775
+2002-11-20,28.81
+2002-11-21,28.819
+2002-11-22,28.767
+2002-11-23,28.803
+2002-11-24,28.878
+2002-11-25,28.904
+2002-11-26,28.913
+2002-11-27,28.902
+2002-11-28,28.935
+2002-11-29,29.047
+2002-11-30,29.004
+2002-12-01,28.937
+2002-12-02,28.931
+2002-12-03,28.887
+2002-12-04,28.871
+2002-12-05,28.876
+2002-12-06,28.869
+2002-12-07,28.896
+2002-12-08,28.868
+2002-12-09,28.918
+2002-12-10,28.899
+2002-12-11,28.825
+2002-12-12,28.819
+2002-12-13,28.827
+2002-12-14,28.799
+2002-12-15,28.828
+2002-12-16,28.791
+2002-12-17,28.818
+2002-12-18,28.819
+2002-12-19,28.838
+2002-12-20,28.839
+2002-12-21,28.862
+2002-12-22,28.873
+2002-12-23,28.891
+2002-12-24,28.868
+2002-12-25,28.822
+2002-12-26,28.819
+2002-12-27,28.842
+2002-12-28,28.839
+2002-12-29,28.83
+2002-12-30,28.835
+2002-12-31,28.884
+2003-01-01,28.812
+2003-01-02,28.792
+2003-01-03,28.796
+2003-01-04,28.796
+2003-01-05,28.825
+2003-01-06,28.826
+2003-01-07,28.83
+2003-01-08,28.841
+2003-01-09,28.844
+2003-01-10,28.844
+2003-01-11,28.863
+2003-01-12,28.872
+2003-01-13,28.877
+2003-01-14,28.863
+2003-01-15,28.846
+2003-01-16,28.808
+2003-01-17,28.793
+2003-01-18,28.828
+2003-01-19,28.836
+2003-01-20,28.8
+2003-01-21,28.823
+2003-01-22,28.842
+2003-01-23,28.82
+2003-01-24,28.794
+2003-01-25,28.783
+2003-01-26,28.757
+2003-01-27,28.75
+2003-01-28,28.756
+2003-01-29,28.735
+2003-01-30,28.728
+2003-01-31,28.718
+2003-02-01,28.71
+2003-02-02,28.702
+2003-02-03,28.701
+2003-02-04,28.72
+2003-02-05,28.727
+2003-02-06,28.692
+2003-02-07,28.689
+2003-02-08,28.702
+2003-02-09,28.692
+2003-02-10,28.68
+2003-02-11,28.663
+2003-02-12,28.665
+2003-02-13,28.676
+2003-02-14,28.667
+2003-02-15,28.654
+2003-02-16,28.649
+2003-02-17,28.63
+2003-02-18,28.628
+2003-02-19,28.633
+2003-02-20,28.632
+2003-02-21,28.623
+2003-02-22,28.598
+2003-02-23,28.611
+2003-02-24,28.621
+2003-02-25,28.622
+2003-02-26,28.628
+2003-02-27,28.617
+2003-02-28,28.617
+2003-03-01,28.615
+2003-03-02,28.63
+2003-03-03,28.623
+2003-03-04,28.611
+2003-03-05,28.596
+2003-03-06,28.597
+2003-03-07,28.608
+2003-03-08,28.601
+2003-03-09,28.601
+2003-03-10,28.619
+2003-03-11,28.61
+2003-03-12,28.595
+2003-03-13,28.573
+2003-03-14,28.585
+2003-03-15,28.573
+2003-03-16,28.573
+2003-03-17,28.573
+2003-03-18,28.583
+2003-03-19,28.604
+2003-03-20,28.7
+2003-03-21,28.76
+2003-03-22,28.827
+2003-03-23,28.909
+2003-03-24,28.976
+2003-03-25,29.075
+2003-03-26,29.094
+2003-03-27,29.167
+2003-03-28,29.241
+2003-03-29,29.37
+2003-03-30,29.323
+2003-03-31,29.374
+2003-04-01,29.431
+2003-04-02,29.436
+2003-04-03,29.417
+2003-04-04,29.381
+2003-04-05,29.469
+2003-04-06,29.458
+2003-04-07,29.423
+2003-04-08,29.424
+2003-04-09,29.425
+2003-04-10,29.428
+2003-04-11,29.436
+2003-04-12,29.386
+2003-04-13,29.404
+2003-04-14,29.461
+2003-04-15,29.441
+2003-04-16,29.376
+2003-04-17,29.378
+2003-04-18,29.515
+2003-04-19,29.459
+2003-04-20,29.457
+2003-04-21,29.494
+2003-04-22,29.447
+2003-04-23,29.451
+2003-04-24,29.439
+2003-04-25,29.452
+2003-04-26,29.458
+2003-04-27,29.487
+2003-04-28,29.552
+2003-04-29,29.513
+2003-04-30,29.512
+2003-05-01,29.546
+2003-05-02,29.481
+2003-05-03,29.514
+2003-05-04,29.571
+2003-05-05,29.561
+2003-05-06,29.6
+2003-05-07,29.534
+2003-05-08,29.527
+2003-05-09,29.495
+2003-05-10,29.507
+2003-05-11,29.507
+2003-05-12,29.539
+2003-05-13,29.517
+2003-05-14,29.549
+2003-05-15,29.566
+2003-05-16,29.577
+2003-05-17,29.569
+2003-05-18,29.555
+2003-05-19,29.539
+2003-05-20,29.551
+2003-05-21,29.481
+2003-05-22,29.435
+2003-05-23,29.449
+2003-05-24,29.44
+2003-05-25,29.433
+2003-05-26,29.421
+2003-05-27,29.408
+2003-05-28,29.398
+2003-05-29,29.395
+2003-05-30,29.372
+2003-05-31,29.361
+2003-06-01,29.279
+2003-06-02,29.341
+2003-06-03,29.345
+2003-06-04,29.325
+2003-06-05,29.318
+2003-06-06,29.316
+2003-06-07,29.307
+2003-06-08,29.299
+2003-06-09,29.363
+2003-06-10,29.251
+2003-06-11,29.262
+2003-06-12,29.208
+2003-06-13,29.202
+2003-06-14,29.25
+2003-06-15,29.236
+2003-06-16,29.251
+2003-06-17,29.266
+2003-06-18,29.274
+2003-06-19,29.235
+2003-06-20,29.19
+2003-06-21,29.189
+2003-06-22,29.175
+2003-06-23,29.162
+2003-06-24,29.148
+2003-06-25,29.137
+2003-06-26,29.12
+2003-06-27,29.092
+2003-06-28,29.07
+2003-06-29,29.068
+2003-06-30,29.037
+2003-07-01,29.012
+2003-07-02,28.996
+2003-07-03,28.992
+2003-07-04,28.974
+2003-07-05,28.954
+2003-07-06,28.919
+2003-07-07,28.902
+2003-07-08,28.908
+2003-07-09,28.861
+2003-07-10,28.848
+2003-07-11,28.901
+2003-07-12,28.907
+2003-07-13,28.855
+2003-07-14,28.844
+2003-07-15,28.833
+2003-07-16,28.86
+2003-07-17,28.815
+2003-07-18,28.782
+2003-07-19,28.778
+2003-07-20,28.782
+2003-07-21,28.792
+2003-07-22,28.782
+2003-07-23,28.751
+2003-07-24,28.755
+2003-07-25,28.789
+2003-07-26,28.815
+2003-07-27,28.814
+2003-07-28,28.782
+2003-07-29,28.783
+2003-07-30,28.794
+2003-07-31,28.786
+2003-08-01,28.786
+2003-08-02,28.767
+2003-08-03,28.765
+2003-08-04,28.788
+2003-08-05,28.772
+2003-08-06,28.807
+2003-08-07,28.821
+2003-08-08,28.815
+2003-08-09,28.81
+2003-08-10,28.84
+2003-08-11,28.876
+2003-08-12,28.876
+2003-08-13,28.907
+2003-08-14,28.918
+2003-08-15,28.938
+2003-08-16,28.925
+2003-08-17,28.9
+2003-08-18,28.904
+2003-08-19,28.923
+2003-08-20,28.928
+2003-08-21,28.921
+2003-08-22,28.912
+2003-08-23,28.872
+2003-08-24,28.853
+2003-08-25,28.877
+2003-08-26,28.882
+2003-08-27,28.861
+2003-08-28,28.833
+2003-08-29,28.893
+2003-08-30,28.835
+2003-08-31,28.844
+2003-09-01,28.847
+2003-09-02,28.805
+2003-09-03,28.84
+2003-09-04,28.855
+2003-09-05,28.802
+2003-09-06,28.805
+2003-09-07,28.791
+2003-09-08,28.769
+2003-09-09,28.761
+2003-09-10,28.774
+2003-09-11,28.772
+2003-09-12,28.774
+2003-09-13,28.769
+2003-09-14,28.778
+2003-09-15,28.787
+2003-09-16,28.749
+2003-09-17,28.725
+2003-09-18,28.716
+2003-09-19,28.737
+2003-09-20,28.728
+2003-09-21,28.69
+2003-09-22,28.703
+2003-09-23,28.739
+2003-09-24,28.718
+2003-09-25,28.784
+2003-09-26,28.685
+2003-09-27,28.753
+2003-09-28,28.7
+2003-09-29,28.724
+2003-09-30,28.74
+2003-10-01,28.732
+2003-10-02,28.728
+2003-10-03,28.753
+2003-10-04,28.837
+2003-10-05,28.737
+2003-10-06,28.711
+2003-10-07,28.732
+2003-10-08,28.738
+2003-10-09,28.698
+2003-10-10,28.698
+2003-10-11,28.7
+2003-10-12,28.707
+2003-10-13,28.682
+2003-10-14,28.724
+2003-10-15,28.744
+2003-10-16,28.716
+2003-10-17,28.702
+2003-10-18,28.696
+2003-10-19,28.69
+2003-10-20,28.712
+2003-10-21,28.669
+2003-10-22,28.701
+2003-10-23,28.745
+2003-10-24,28.777
+2003-10-25,28.845
+2003-10-26,28.8
+2003-10-27,28.805
+2003-10-28,28.92
+2003-10-29,28.991
+2003-10-30,29.116
+2003-10-31,29.225
+2003-11-01,29.225
+2003-11-02,29.218
+2003-11-03,29.229
+2003-11-04,29.212
+2003-11-05,29.421
+2003-11-06,29.265
+2003-11-07,29.291
+2003-11-08,29.242
+2003-11-09,29.277
+2003-11-10,29.287
+2003-11-11,29.333
+2003-11-12,29.269
+2003-11-13,29.295
+2003-11-14,29.204
+2003-11-15,29.249
+2003-11-16,29.248
+2003-11-17,29.236
+2003-11-18,29.287
+2003-11-19,29.417
+2003-11-20,29.31
+2003-11-21,29.409
+2003-11-22,29.449
+2003-11-23,29.491
+2003-11-24,29.605
+2003-11-25,29.511
+2003-11-26,29.526
+2003-11-27,29.489
+2003-11-28,29.487
+2003-11-29,29.558
+2003-11-30,29.568
+2003-12-01,29.571
+2003-12-02,29.507
+2003-12-03,29.538
+2003-12-04,29.518
+2003-12-05,29.487
+2003-12-06,29.408
+2003-12-07,29.337
+2003-12-08,29.462
+2003-12-09,29.44
+2003-12-10,29.455
+2003-12-11,29.456
+2003-12-12,29.496
+2003-12-13,29.475
+2003-12-14,29.482
+2003-12-15,29.407
+2003-12-16,29.393
+2003-12-17,29.448
+2003-12-18,29.469
+2003-12-19,29.444
+2003-12-20,29.45
+2003-12-21,29.513
+2003-12-22,29.514
+2003-12-23,29.486
+2003-12-24,29.512
+2003-12-25,29.572
+2003-12-26,29.68
+2003-12-27,29.71
+2003-12-28,29.753
+2003-12-29,29.793
+2003-12-30,29.77
+2003-12-31,29.766
+2004-01-01,29.759
+2004-01-02,29.749
+2004-01-03,29.795
+2004-01-04,29.763
+2004-01-05,29.722
+2004-01-06,29.754
+2004-01-07,29.718
+2004-01-08,29.582
+2004-01-09,29.644
+2004-01-10,29.614
+2004-01-11,29.609
+2004-01-12,29.556
+2004-01-13,29.554
+2004-01-14,29.604
+2004-01-15,29.578
+2004-01-16,29.557
+2004-01-17,29.545
+2004-01-18,29.442
+2004-01-19,29.44
+2004-01-20,29.434
+2004-01-21,29.415
+2004-01-22,29.395
+2004-01-23,29.388
+2004-01-24,29.386
+2004-01-25,29.402
+2004-01-26,29.349
+2004-01-27,29.309
+2004-01-28,29.276
+2004-01-29,29.267
+2004-01-30,29.247
+2004-01-31,29.236
+2004-02-01,29.217
+2004-02-02,29.185
+2004-02-03,29.184
+2004-02-04,29.18
+2004-02-05,29.186
+2004-02-06,29.153
+2004-02-07,29.129
+2004-02-08,29.149
+2004-02-09,29.121
+2004-02-10,29.088
+2004-02-11,29.091
+2004-02-12,29.089
+2004-02-13,29.072
+2004-02-14,29.059
+2004-02-15,29.083
+2004-02-16,29.053
+2004-02-17,29.046
+2004-02-18,29.009
+2004-02-19,28.989
+2004-02-20,28.979
+2004-02-21,28.979
+2004-02-22,28.966
+2004-02-23,28.956
+2004-02-24,28.947
+2004-02-25,28.943
+2004-02-26,28.928
+2004-02-27,28.919
+2004-02-28,28.916
+2004-02-29,28.918
+2004-03-01,28.909
+2004-03-02,28.954
+2004-03-03,28.94
+2004-03-04,28.948
+2004-03-05,29.026
+2004-03-06,29.065
+2004-03-07,29.055
+2004-03-08,29.071
+2004-03-09,29.094
+2004-03-10,29.121
+2004-03-11,29.124
+2004-03-12,29.144
+2004-03-13,29.134
+2004-03-14,29.163
+2004-03-15,29.198
+2004-03-16,29.079
+2004-03-17,29.045
+2004-03-18,29.086
+2004-03-19,29.084
+2004-03-20,29.137
+2004-03-21,29.079
+2004-03-22,29.047
+2004-03-23,29.085
+2004-03-24,29.042
+2004-03-25,29.089
+2004-03-26,29.112
+2004-03-27,29.106
+2004-03-28,29.16
+2004-03-29,29.271
+2004-03-30,29.319
+2004-03-31,29.329
+2004-04-01,29.298
+2004-04-02,29.34
+2004-04-03,29.47
+2004-04-04,29.475
+2004-04-05,29.509
+2004-04-06,29.537
+2004-04-07,29.559
+2004-04-08,29.561
+2004-04-09,29.543
+2004-04-10,29.528
+2004-04-11,29.524
+2004-04-12,29.513
+2004-04-13,29.513
+2004-04-14,29.552
+2004-04-15,29.527
+2004-04-16,29.562
+2004-04-17,29.589
+2004-04-18,29.568
+2004-04-19,29.669
+2004-04-20,29.551
+2004-04-21,29.69
+2004-04-22,29.629
+2004-04-23,29.526
+2004-04-24,29.525
+2004-04-25,29.538
+2004-04-26,29.646
+2004-04-27,29.522
+2004-04-28,29.499
+2004-04-29,29.575
+2004-04-30,29.495
+2004-05-01,29.476
+2004-05-02,29.497
+2004-05-03,29.418
+2004-05-04,29.418
+2004-05-05,29.434
+2004-05-06,29.426
+2004-05-07,29.357
+2004-05-08,29.374
+2004-05-09,29.368
+2004-05-10,29.354
+2004-05-11,29.319
+2004-05-12,29.305
+2004-05-13,29.286
+2004-05-14,29.316
+2004-05-15,29.289
+2004-05-16,29.239
+2004-05-17,29.264
+2004-05-18,29.291
+2004-05-19,29.218
+2004-05-20,29.292
+2004-05-21,29.185
+2004-05-22,29.187
+2004-05-23,29.18
+2004-05-24,29.199
+2004-05-25,29.276
+2004-05-26,29.371
+2004-05-27,29.354
+2004-05-28,29.367
+2004-05-29,29.343
+2004-05-30,29.345
+2004-05-31,29.347
+2004-06-01,29.421
+2004-06-02,29.388
+2004-06-03,29.375
+2004-06-04,29.381
+2004-06-05,29.387
+2004-06-06,29.396
+2004-06-07,29.384
+2004-06-08,29.361
+2004-06-09,29.332
+2004-06-10,29.274
+2004-06-11,29.274
+2004-06-12,29.263
+2004-06-13,29.299
+2004-06-14,29.32
+2004-06-15,29.236
+2004-06-16,29.205
+2004-06-17,29.198
+2004-06-18,29.172
+2004-06-19,29.14
+2004-06-20,29.132
+2004-06-21,29.125
+2004-06-22,29.116
+2004-06-23,29.083
+2004-06-24,29.102
+2004-06-25,29.053
+2004-06-26,29.041
+2004-06-27,29.036
+2004-06-28,29.006
+2004-06-29,29
+2004-06-30,28.981
+2004-07-01,28.995
+2004-07-02,28.962
+2004-07-03,28.933
+2004-07-04,28.94
+2004-07-05,28.986
+2004-07-06,28.867
+2004-07-07,28.875
+2004-07-08,28.898
+2004-07-09,28.885
+2004-07-10,28.864
+2004-07-11,28.854
+2004-07-12,28.867
+2004-07-13,28.885
+2004-07-14,28.857
+2004-07-15,28.831
+2004-07-16,28.836
+2004-07-17,28.827
+2004-07-18,28.817
+2004-07-19,28.821
+2004-07-20,28.838
+2004-07-21,28.836
+2004-07-22,28.865
+2004-07-23,28.836
+2004-07-24,28.793
+2004-07-25,28.815
+2004-07-26,28.824
+2004-07-27,28.836
+2004-07-28,28.835
+2004-07-29,28.83
+2004-07-30,28.842
+2004-07-31,28.89
+2004-08-01,28.846
+2004-08-02,28.842
+2004-08-03,28.845
+2004-08-04,28.842
+2004-08-05,28.822
+2004-08-06,28.825
+2004-08-07,28.828
+2004-08-08,28.842
+2004-08-09,28.842
+2004-08-10,28.868
+2004-08-11,28.862
+2004-08-12,28.841
+2004-08-13,28.849
+2004-08-14,28.896
+2004-08-15,28.924
+2004-08-16,28.945
+2004-08-17,28.972
+2004-08-18,29.006
+2004-08-19,29.03
+2004-08-20,28.996
+2004-08-21,28.998
+2004-08-22,29.01
+2004-08-23,29.043
+2004-08-24,29.01
+2004-08-25,29.039
+2004-08-26,29.082
+2004-08-27,29.067
+2004-08-28,29.025
+2004-08-29,29.026
+2004-08-30,29.049
+2004-08-31,29.103
+2004-09-01,29.155
+2004-09-02,29.181
+2004-09-03,29.23
+2004-09-04,29.191
+2004-09-05,29.221
+2004-09-06,29.263
+2004-09-07,29.265
+2004-09-08,29.167
+2004-09-09,29.197
+2004-09-10,29.271
+2004-09-11,29.307
+2004-09-12,29.329
+2004-09-13,29.287
+2004-09-14,29.323
+2004-09-15,29.349
+2004-09-16,29.336
+2004-09-17,29.282
+2004-09-18,29.221
+2004-09-19,29.215
+2004-09-20,29.241
+2004-09-21,29.25
+2004-09-22,29.239
+2004-09-23,29.214
+2004-09-24,29.221
+2004-09-25,29.237
+2004-09-26,29.19
+2004-09-27,29.197
+2004-09-28,29.154
+2004-09-29,29.115
+2004-09-30,29.132
+2004-10-01,29.128
+2004-10-02,29.199
+2004-10-03,29.103
+2004-10-04,29.13
+2004-10-05,29.057
+2004-10-06,29.103
+2004-10-07,29.063
+2004-10-08,29.058
+2004-10-09,29.095
+2004-10-10,28.991
+2004-10-11,28.935
+2004-10-12,28.934
+2004-10-13,28.95
+2004-10-14,28.942
+2004-10-15,28.942
+2004-10-16,28.959
+2004-10-17,28.968
+2004-10-18,28.91
+2004-10-19,28.865
+2004-10-20,28.86
+2004-10-21,28.858
+2004-10-22,28.854
+2004-10-23,28.846
+2004-10-24,28.857
+2004-10-25,28.832
+2004-10-26,28.824
+2004-10-27,28.795
+2004-10-28,28.797
+2004-10-29,28.793
+2004-10-30,28.873
+2004-10-31,28.825
+2004-11-01,28.77
+2004-11-02,28.808
+2004-11-03,28.725
+2004-11-04,28.795
+2004-11-05,28.792
+2004-11-06,28.773
+2004-11-07,28.768
+2004-11-08,28.719
+2004-11-09,28.731
+2004-11-10,28.864
+2004-11-11,28.812
+2004-11-12,28.681
+2004-11-13,28.674
+2004-11-14,28.699
+2004-11-15,28.692
+2004-11-16,28.676
+2004-11-17,28.667
+2004-11-18,28.673
+2004-11-19,28.652
+2004-11-20,28.649
+2004-11-21,28.69
+2004-11-22,28.658
+2004-11-23,28.701
+2004-11-24,28.688
+2004-11-25,28.666
+2004-11-26,28.679
+2004-11-27,28.713
+2004-11-28,28.775
+2004-11-29,28.71
+2004-11-30,28.739
+2004-12-01,28.763
+2004-12-02,28.782
+2004-12-03,28.783
+2004-12-04,28.943
+2004-12-05,28.825
+2004-12-06,28.833
+2004-12-07,28.86
+2004-12-08,28.897
+2004-12-09,28.856
+2004-12-10,28.856
+2004-12-11,28.884
+2004-12-12,28.942
+2004-12-13,28.956
+2004-12-14,28.956
+2004-12-15,28.965
+2004-12-16,29.053
+2004-12-17,28.964
+2004-12-18,28.911
+2004-12-19,28.93
+2004-12-20,28.899
+2004-12-21,28.94
+2004-12-22,28.908
+2004-12-23,28.89
+2004-12-24,28.937
+2004-12-25,28.969
+2004-12-26,28.977
+2004-12-27,28.988
+2004-12-28,29.041
+2004-12-29,29.017
+2004-12-30,28.997
+2004-12-31,29.085
+2005-01-01,29.018
+2005-01-02,29.059
+2005-01-03,29.041
+2005-01-04,29.031
+2005-01-05,29.032
+2005-01-06,29.043
+2005-01-07,29.032
+2005-01-08,29.033
+2005-01-09,29.026
+2005-01-10,29.057
+2005-01-11,29.008
+2005-01-12,29.011
+2005-01-13,29.13
+2005-01-14,29.102
+2005-01-15,29.143
+2005-01-16,29.122
+2005-01-17,29.134
+2005-01-18,29.221
+2005-01-19,29.22
+2005-01-20,29.158
+2005-01-21,29.181
+2005-01-22,29.143
+2005-01-23,29.12
+2005-01-24,29.13
+2005-01-25,29.088
+2005-01-26,29.079
+2005-01-27,29.105
+2005-01-28,29.093
+2005-01-29,29.076
+2005-01-30,29.032
+2005-01-31,29.02
+2005-02-01,28.999
+2005-02-02,28.983
+2005-02-03,28.975
+2005-02-04,28.962
+2005-02-05,28.954
+2005-02-06,28.947
+2005-02-07,28.946
+2005-02-08,28.938
+2005-02-09,28.931
+2005-02-10,28.896
+2005-02-11,28.919
+2005-02-12,28.951
+2005-02-13,28.919
+2005-02-14,28.945
+2005-02-15,28.926
+2005-02-16,28.913
+2005-02-17,28.916
+2005-02-18,28.921
+2005-02-19,28.923
+2005-02-20,28.931
+2005-02-21,28.92
+2005-02-22,28.897
+2005-02-23,28.898
+2005-02-24,28.899
+2005-02-25,28.887
+2005-02-26,28.868
+2005-02-27,28.878
+2005-02-28,28.853
+2005-03-01,28.823
+2005-03-02,28.844
+2005-03-03,28.862
+2005-03-04,28.862
+2005-03-05,28.839
+2005-03-06,28.833
+2005-03-07,28.797
+2005-03-08,28.791
+2005-03-09,28.86
+2005-03-10,28.841
+2005-03-11,28.804
+2005-03-12,28.787
+2005-03-13,28.792
+2005-03-14,28.793
+2005-03-15,28.79
+2005-03-16,28.791
+2005-03-17,28.8
+2005-03-18,28.794
+2005-03-19,28.791
+2005-03-20,28.788
+2005-03-21,28.78
+2005-03-22,28.787
+2005-03-23,28.773
+2005-03-24,28.785
+2005-03-25,28.791
+2005-03-26,28.795
+2005-03-27,28.816
+2005-03-28,28.827
+2005-03-29,28.82
+2005-03-30,28.894
+2005-03-31,28.97
+2005-04-01,29.073
+2005-04-02,29.105
+2005-04-03,29.221
+2005-04-04,29.375
+2005-04-05,29.456
+2005-04-06,29.501
+2005-04-07,29.535
+2005-04-08,29.597
+2005-04-09,29.634
+2005-04-10,29.637
+2005-04-11,29.617
+2005-04-12,29.629
+2005-04-13,29.653
+2005-04-14,29.615
+2005-04-15,29.637
+2005-04-16,29.644
+2005-04-17,29.628
+2005-04-18,29.604
+2005-04-19,29.614
+2005-04-20,29.557
+2005-04-21,29.563
+2005-04-22,29.586
+2005-04-23,29.576
+2005-04-24,29.629
+2005-04-25,29.687
+2005-04-26,29.724
+2005-04-27,29.719
+2005-04-28,29.743
+2005-04-29,29.775
+2005-04-30,29.775
+2005-05-01,29.804
+2005-05-02,29.813
+2005-05-03,29.789
+2005-05-04,29.769
+2005-05-05,29.75
+2005-05-06,29.735
+2005-05-07,29.687
+2005-05-08,29.601
+2005-05-09,29.651
+2005-05-10,29.661
+2005-05-11,29.63
+2005-05-12,29.506
+2005-05-13,29.56
+2005-05-14,29.542
+2005-05-15,29.518
+2005-05-16,29.51
+2005-05-17,29.49
+2005-05-18,29.468
+2005-05-19,29.441
+2005-05-20,29.408
+2005-05-21,29.346
+2005-05-22,29.304
+2005-05-23,29.314
+2005-05-24,29.297
+2005-05-25,29.31
+2005-05-26,29.268
+2005-05-27,29.309
+2005-05-28,29.317
+2005-05-29,29.301
+2005-05-30,29.29
+2005-05-31,29.275
+2005-06-01,29.263
+2005-06-02,29.254
+2005-06-03,29.25
+2005-06-04,29.224
+2005-06-05,29.2
+2005-06-06,29.241
+2005-06-07,29.184
+2005-06-08,29.12
+2005-06-09,29.133
+2005-06-10,29.142
+2005-06-11,29.12
+2005-06-12,29.113
+2005-06-13,29.09
+2005-06-14,29.068
+2005-06-15,29.119
+2005-06-16,29.173
+2005-06-17,29.234
+2005-06-18,29.25
+2005-06-19,29.332
+2005-06-20,29.373
+2005-06-21,29.388
+2005-06-22,29.334
+2005-06-23,29.367
+2005-06-24,29.397
+2005-06-25,29.368
+2005-06-26,29.323
+2005-06-27,29.312
+2005-06-28,29.321
+2005-06-29,29.28
+2005-06-30,29.26
+2005-07-01,29.307
+2005-07-02,29.226
+2005-07-03,29.224
+2005-07-04,29.236
+2005-07-05,29.215
+2005-07-06,29.109
+2005-07-07,29.131
+2005-07-08,29.137
+2005-07-09,29.125
+2005-07-10,29.178
+2005-07-11,29.188
+2005-07-12,29.192
+2005-07-13,29.193
+2005-07-14,29.184
+2005-07-15,29.149
+2005-07-16,29.145
+2005-07-17,29.146
+2005-07-18,29.15
+2005-07-19,29.132
+2005-07-20,29.08
+2005-07-21,29.076
+2005-07-22,29.062
+2005-07-23,29.043
+2005-07-24,29.034
+2005-07-25,29.044
+2005-07-26,29.035
+2005-07-27,29.005
+2005-07-28,28.995
+2005-07-29,28.999
+2005-07-30,28.986
+2005-07-31,28.976
+2005-08-01,28.986
+2005-08-02,28.98
+2005-08-03,28.951
+2005-08-04,28.962
+2005-08-05,28.949
+2005-08-06,28.924
+2005-08-07,28.925
+2005-08-08,28.923
+2005-08-09,28.92
+2005-08-10,28.914
+2005-08-11,28.872
+2005-08-12,28.86
+2005-08-13,28.868
+2005-08-14,28.848
+2005-08-15,28.832
+2005-08-16,28.839
+2005-08-17,28.806
+2005-08-18,28.794
+2005-08-19,28.809
+2005-08-20,28.863
+2005-08-21,28.792
+2005-08-22,28.779
+2005-08-23,28.767
+2005-08-24,28.746
+2005-08-25,28.757
+2005-08-26,28.766
+2005-08-27,28.778
+2005-08-28,28.828
+2005-08-29,28.762
+2005-08-30,28.753
+2005-08-31,28.77
+2005-09-01,28.806
+2005-09-02,28.833
+2005-09-03,28.812
+2005-09-04,28.795
+2005-09-05,28.799
+2005-09-06,28.811
+2005-09-07,28.819
+2005-09-08,28.797
+2005-09-09,28.774
+2005-09-10,28.759
+2005-09-11,28.789
+2005-09-12,28.785
+2005-09-13,28.778
+2005-09-14,28.781
+2005-09-15,28.743
+2005-09-16,28.714
+2005-09-17,28.75
+2005-09-18,28.747
+2005-09-19,28.767
+2005-09-20,28.811
+2005-09-21,28.752
+2005-09-22,28.773
+2005-09-23,28.723
+2005-09-24,28.716
+2005-09-25,28.802
+2005-09-26,28.82
+2005-09-27,28.718
+2005-09-28,28.769
+2005-09-29,28.923
+2005-09-30,28.744
+2005-10-01,28.787
+2005-10-02,28.741
+2005-10-03,28.748
+2005-10-04,28.762
+2005-10-05,28.746
+2005-10-06,28.751
+2005-10-07,28.721
+2005-10-08,28.636
+2005-10-09,28.68
+2005-10-10,28.76
+2005-10-11,28.757
+2005-10-12,28.788
+2005-10-13,28.812
+2005-10-14,28.85
+2005-10-15,28.927
+2005-10-16,28.943
+2005-10-17,29.003
+2005-10-18,29.091
+2005-10-19,29.158
+2005-10-20,29.179
+2005-10-21,29.192
+2005-10-22,29.188
+2005-10-23,29.181
+2005-10-24,29.226
+2005-10-25,29.172
+2005-10-26,29.352
+2005-10-27,29.461
+2005-10-28,29.493
+2005-10-29,29.507
+2005-10-30,29.532
+2005-10-31,29.549
+2005-11-01,29.558
+2005-11-02,29.539
+2005-11-03,29.599
+2005-11-04,29.527
+2005-11-05,29.538
+2005-11-06,29.55
+2005-11-07,29.587
+2005-11-08,29.541
+2005-11-09,29.589
+2005-11-10,29.584
+2005-11-11,29.549
+2005-11-12,29.565
+2005-11-13,29.625
+2005-11-14,29.566
+2005-11-15,29.512
+2005-11-16,29.616
+2005-11-17,29.611
+2005-11-18,29.626
+2005-11-19,29.683
+2005-11-20,29.682
+2005-11-21,29.653
+2005-11-22,29.58
+2005-11-23,29.611
+2005-11-24,29.629
+2005-11-25,29.633
+2005-11-26,29.607
+2005-11-27,29.569
+2005-11-28,29.635
+2005-11-29,29.716
+2005-11-30,29.629
+2005-12-01,29.645
+2005-12-02,29.681
+2005-12-03,29.694
+2005-12-04,29.675
+2005-12-05,29.666
+2005-12-06,29.641
+2005-12-07,29.615
+2005-12-08,29.605
+2005-12-09,29.606
+2005-12-10,29.604
+2005-12-11,29.585
+2005-12-12,29.508
+2005-12-13,29.497
+2005-12-14,29.477
+2005-12-15,29.449
+2005-12-16,29.44
+2005-12-17,29.456
+2005-12-18,29.431
+2005-12-19,29.421
+2005-12-20,29.4
+2005-12-21,29.378
+2005-12-22,29.35
+2005-12-23,29.331
+2005-12-24,29.311
+2005-12-25,29.296
+2005-12-26,29.21
+2005-12-27,29.296
+2005-12-28,29.338
+2005-12-29,29.31
+2005-12-30,29.302
+2005-12-31,29.317
+2006-01-01,29.342
+2006-01-02,29.325
+2006-01-03,29.339
+2006-01-04,29.332
+2006-01-05,29.345
+2006-01-06,29.305
+2006-01-07,29.304
+2006-01-08,29.291
+2006-01-09,29.292
+2006-01-10,29.281
+2006-01-11,29.318
+2006-01-12,29.291
+2006-01-13,29.339
+2006-01-14,29.33
+2006-01-15,29.263
+2006-01-16,29.246
+2006-01-17,29.414
+2006-01-18,29.398
+2006-01-19,29.493
+2006-01-20,29.58
+2006-01-21,29.63
+2006-01-22,29.684
+2006-01-23,29.702
+2006-01-24,29.717
+2006-01-25,29.714
+2006-01-26,29.714
+2006-01-27,29.702
+2006-01-28,29.718
+2006-01-29,29.676
+2006-01-30,29.689
+2006-01-31,29.695
+2006-02-01,29.683
+2006-02-02,29.696
+2006-02-03,29.699
+2006-02-04,29.698
+2006-02-05,29.739
+2006-02-06,29.805
+2006-02-07,29.779
+2006-02-08,29.751
+2006-02-09,29.721
+2006-02-10,29.682
+2006-02-11,29.66
+2006-02-12,29.655
+2006-02-13,29.654
+2006-02-14,29.626
+2006-02-15,29.637
+2006-02-16,29.582
+2006-02-17,29.658
+2006-02-18,29.506
+2006-02-19,29.507
+2006-02-20,29.548
+2006-02-21,29.505
+2006-02-22,29.481
+2006-02-23,29.478
+2006-02-24,29.467
+2006-02-25,29.399
+2006-02-26,29.37
+2006-02-27,29.393
+2006-02-28,29.394
+2006-03-01,29.349
+2006-03-02,29.303
+2006-03-03,29.301
+2006-03-04,29.284
+2006-03-05,29.264
+2006-03-06,29.255
+2006-03-07,29.244
+2006-03-08,29.242
+2006-03-09,29.282
+2006-03-10,29.305
+2006-03-11,29.253
+2006-03-12,29.269
+2006-03-13,29.257
+2006-03-14,29.345
+2006-03-15,29.316
+2006-03-16,29.321
+2006-03-17,29.319
+2006-03-18,29.318
+2006-03-19,29.296
+2006-03-20,29.287
+2006-03-21,29.285
+2006-03-22,29.278
+2006-03-23,29.28
+2006-03-24,29.266
+2006-03-25,29.256
+2006-03-26,29.234
+2006-03-27,29.227
+2006-03-28,29.231
+2006-03-29,29.222
+2006-03-30,29.213
+2006-03-31,29.221
+2006-04-01,29.226
+2006-04-02,29.199
+2006-04-03,29.25
+2006-04-04,29.281
+2006-04-05,29.318
+2006-04-06,29.333
+2006-04-07,29.358
+2006-04-08,29.325
+2006-04-09,29.353
+2006-04-10,29.364
+2006-04-11,29.356
+2006-04-12,29.406
+2006-04-13,29.405
+2006-04-14,29.327
+2006-04-15,29.337
+2006-04-16,29.298
+2006-04-17,29.271
+2006-04-18,29.273
+2006-04-19,29.264
+2006-04-20,29.268
+2006-04-21,29.261
+2006-04-22,29.292
+2006-04-23,29.275
+2006-04-24,29.28
+2006-04-25,29.282
+2006-04-26,29.3
+2006-04-27,29.26
+2006-04-28,29.258
+2006-04-29,29.257
+2006-04-30,29.242
+2006-05-01,29.23
+2006-05-02,29.199
+2006-05-03,29.224
+2006-05-04,29.233
+2006-05-05,29.213
+2006-05-06,29.203
+2006-05-07,29.194
+2006-05-08,29.192
+2006-05-09,29.174
+2006-05-10,29.137
+2006-05-11,29.174
+2006-05-12,29.134
+2006-05-13,29.126
+2006-05-14,29.147
+2006-05-15,29.159
+2006-05-16,29.182
+2006-05-17,29.25
+2006-05-18,29.231
+2006-05-19,29.291
+2006-05-20,29.464
+2006-05-21,29.549
+2006-05-22,29.586
+2006-05-23,29.637
+2006-05-24,29.649
+2006-05-25,29.676
+2006-05-26,29.659
+2006-05-27,29.643
+2006-05-28,29.64
+2006-05-29,29.627
+2006-05-30,29.609
+2006-05-31,29.628
+2006-06-01,29.601
+2006-06-02,29.584
+2006-06-03,29.55
+2006-06-04,29.56
+2006-06-05,29.611
+2006-06-06,29.621
+2006-06-07,29.595
+2006-06-08,29.547
+2006-06-09,29.572
+2006-06-10,29.564
+2006-06-11,29.625
+2006-06-12,29.655
+2006-06-13,29.676
+2006-06-14,29.675
+2006-06-15,29.654
+2006-06-16,29.66
+2006-06-17,29.651
+2006-06-18,29.628
+2006-06-19,29.613
+2006-06-20,29.59
+2006-06-21,29.57
+2006-06-22,29.569
+2006-06-23,29.512
+2006-06-24,29.492
+2006-06-25,29.467
+2006-06-26,29.456
+2006-06-27,29.541
+2006-06-28,29.57
+2006-06-29,29.576
+2006-06-30,29.595
+2006-07-01,29.617
+2006-07-02,29.674
+2006-07-03,29.632
+2006-07-04,29.629
+2006-07-05,29.607
+2006-07-06,29.587
+2006-07-07,29.572
+2006-07-08,29.562
+2006-07-09,29.54
+2006-07-10,29.519
+2006-07-11,29.481
+2006-07-12,29.451
+2006-07-13,29.424
+2006-07-14,29.441
+2006-07-15,29.437
+2006-07-16,29.422
+2006-07-17,29.401
+2006-07-18,29.362
+2006-07-19,29.335
+2006-07-20,29.363
+2006-07-21,29.315
+2006-07-22,29.261
+2006-07-23,29.262
+2006-07-24,29.276
+2006-07-25,29.312
+2006-07-26,29.28
+2006-07-27,29.279
+2006-07-28,29.242
+2006-07-29,29.237
+2006-07-30,29.203
+2006-07-31,29.223
+2006-08-01,29.239
+2006-08-02,29.236
+2006-08-03,29.254
+2006-08-04,29.254
+2006-08-05,29.242
+2006-08-06,29.264
+2006-08-07,29.294
+2006-08-08,29.219
+2006-08-09,29.215
+2006-08-10,29.205
+2006-08-11,29.178
+2006-08-12,29.16
+2006-08-13,29.146
+2006-08-14,29.179
+2006-08-15,29.157
+2006-08-16,29.12
+2006-08-17,29.105
+2006-08-18,29.11
+2006-08-19,29.118
+2006-08-20,29.086
+2006-08-21,29.074
+2006-08-22,29.091
+2006-08-23,29.078
+2006-08-24,29.071
+2006-08-25,29.037
+2006-08-26,29.04
+2006-08-27,29.165
+2006-08-28,29.057
+2006-08-29,29.019
+2006-08-30,28.984
+2006-08-31,28.992
+2006-09-01,28.982
+2006-09-02,28.984
+2006-09-03,28.984
+2006-09-04,28.98
+2006-09-05,28.968
+2006-09-06,28.948
+2006-09-07,28.946
+2006-09-08,28.96
+2006-09-09,28.921
+2006-09-10,28.898
+2006-09-11,28.893
+2006-09-12,28.897
+2006-09-13,28.931
+2006-09-14,28.921
+2006-09-15,28.882
+2006-09-16,28.881
+2006-09-17,28.886
+2006-09-18,28.906
+2006-09-19,28.899
+2006-09-20,28.854
+2006-09-21,28.836
+2006-09-22,28.829
+2006-09-23,28.857
+2006-09-24,28.862
+2006-09-25,28.802
+2006-09-26,28.804
+2006-09-27,28.839
+2006-09-28,28.872
+2006-09-29,28.789
+2006-09-30,28.797
+2006-10-01,28.818
+2006-10-02,28.795
+2006-10-03,28.828
+2006-10-04,28.812
+2006-10-05,28.761
+2006-10-06,28.795
+2006-10-07,28.811
+2006-10-08,28.824
+2006-10-09,28.825
+2006-10-10,28.775
+2006-10-11,28.845
+2006-10-12,28.821
+2006-10-13,28.837
+2006-10-14,28.826
+2006-10-15,28.806
+2006-10-16,28.791
+2006-10-17,28.81
+2006-10-18,28.827
+2006-10-19,28.846
+2006-10-20,28.789
+2006-10-21,28.934
+2006-10-22,28.985
+2006-10-23,29.047
+2006-10-24,29.069
+2006-10-25,29.069
+2006-10-26,29.093
+2006-10-27,29.115
+2006-10-28,29.174
+2006-10-29,29.3
+2006-10-30,29.278
+2006-10-31,29.311
+2006-11-01,29.309
+2006-11-02,29.318
+2006-11-03,29.325
+2006-11-04,29.316
+2006-11-05,29.332
+2006-11-06,29.317
+2006-11-07,29.344
+2006-11-08,29.292
+2006-11-09,29.284
+2006-11-10,29.272
+2006-11-11,29.26
+2006-11-12,29.235
+2006-11-13,29.292
+2006-11-14,29.304
+2006-11-15,29.327
+2006-11-16,29.349
+2006-11-17,29.401
+2006-11-18,29.395
+2006-11-19,29.395
+2006-11-20,29.399
+2006-11-21,29.402
+2006-11-22,29.383
+2006-11-23,29.375
+2006-11-24,29.343
+2006-11-25,29.39
+2006-11-26,29.388
+2006-11-27,29.311
+2006-11-28,29.284
+2006-11-29,29.409
+2006-11-30,29.364
+2006-12-01,29.247
+2006-12-02,29.413
+2006-12-03,29.434
+2006-12-04,29.429
+2006-12-05,29.432
+2006-12-06,29.562
+2006-12-07,29.438
+2006-12-08,29.399
+2006-12-09,29.439
+2006-12-10,29.415
+2006-12-11,29.366
+2006-12-12,29.357
+2006-12-13,29.455
+2006-12-14,29.357
+2006-12-15,29.372
+2006-12-16,29.323
+2006-12-17,29.362
+2006-12-18,29.303
+2006-12-19,29.289
+2006-12-20,29.334
+2006-12-21,29.276
+2006-12-22,29.252
+2006-12-23,29.328
+2006-12-24,29.309
+2006-12-25,29.315
+2006-12-26,29.289
+2006-12-27,29.283
+2006-12-28,29.302
+2006-12-29,29.29
+2006-12-30,29.301
+2006-12-31,29.294
+2007-01-01,29.433
+2007-01-02,29.285
+2007-01-03,29.34
+2007-01-04,29.323
+2007-01-05,29.318
+2007-01-06,29.332
+2007-01-07,29.37
+2007-01-08,29.469
+2007-01-09,29.48
+2007-01-10,29.45
+2007-01-11,29.55
+2007-01-12,29.553
+2007-01-13,29.41
+2007-01-14,29.441
+2007-01-15,29.411
+2007-01-16,29.403
+2007-01-17,29.373
+2007-01-18,29.426
+2007-01-19,29.356
+2007-01-20,29.349
+2007-01-21,29.328
+2007-01-22,29.304
+2007-01-23,29.316
+2007-01-24,29.292
+2007-01-25,29.279
+2007-01-26,29.251
+2007-01-27,29.243
+2007-01-28,29.208
+2007-01-29,29.2
+2007-01-30,29.197
+2007-01-31,29.173
+2007-02-01,29.175
+2007-02-02,29.163
+2007-02-03,29.161
+2007-02-04,29.158
+2007-02-05,29.126
+2007-02-06,29.145
+2007-02-07,29.125
+2007-02-08,29.092
+2007-02-09,29.091
+2007-02-10,29.094
+2007-02-11,29.061
+2007-02-12,29.042
+2007-02-13,29.014
+2007-02-14,28.992
+2007-02-15,29.046
+2007-02-16,29.06
+2007-02-17,29.099
+2007-02-18,29.005
+2007-02-19,29.019
+2007-02-20,28.996
+2007-02-21,28.967
+2007-02-22,28.952
+2007-02-23,28.944
+2007-02-24,28.942
+2007-02-25,28.94
+2007-02-26,28.919
+2007-02-27,28.909
+2007-02-28,28.896
+2007-03-01,28.885
+2007-03-02,28.877
+2007-03-03,28.892
+2007-03-04,28.882
+2007-03-05,28.883
+2007-03-06,28.849
+2007-03-07,28.892
+2007-03-08,28.858
+2007-03-09,28.844
+2007-03-10,28.834
+2007-03-11,28.821
+2007-03-12,28.826
+2007-03-13,28.834
+2007-03-14,28.862
+2007-03-15,28.888
+2007-03-16,28.919
+2007-03-17,28.916
+2007-03-18,29.002
+2007-03-19,29.102
+2007-03-20,29.081
+2007-03-21,29.096
+2007-03-22,29.218
+2007-03-23,29.167
+2007-03-24,29.202
+2007-03-25,29.254
+2007-03-26,29.374
+2007-03-27,29.376
+2007-03-28,29.402
+2007-03-29,29.457
+2007-03-30,29.515
+2007-03-31,29.536
+2007-04-01,29.569
+2007-04-02,29.617
+2007-04-03,29.594
+2007-04-04,29.66
+2007-04-05,29.688
+2007-04-06,29.702
+2007-04-07,29.695
+2007-04-08,29.693
+2007-04-09,29.674
+2007-04-10,29.66
+2007-04-11,29.642
+2007-04-12,29.652
+2007-04-13,29.653
+2007-04-14,29.665
+2007-04-15,29.66
+2007-04-16,29.575
+2007-04-17,29.675
+2007-04-18,29.768
+2007-04-19,29.845
+2007-04-20,29.908
+2007-04-21,29.936
+2007-04-22,29.967
+2007-04-23,30.013
+2007-04-24,30
+2007-04-25,30.041
+2007-04-26,30.065
+2007-04-27,30.066
+2007-04-28,30.054
+2007-04-29,30.038
+2007-04-30,30.047
+2007-05-01,30.021
+2007-05-02,30.001
+2007-05-03,29.982
+2007-05-04,29.963
+2007-05-05,29.915
+2007-05-06,29.91
+2007-05-07,29.919
+2007-05-08,29.901
+2007-05-09,29.849
+2007-05-10,29.822
+2007-05-11,29.791
+2007-05-12,29.729
+2007-05-13,29.718
+2007-05-14,29.724
+2007-05-15,29.701
+2007-05-16,29.587
+2007-05-17,29.674
+2007-05-18,29.704
+2007-05-19,29.701
+2007-05-20,29.664
+2007-05-21,29.669
+2007-05-22,29.662
+2007-05-23,29.646
+2007-05-24,29.632
+2007-05-25,29.608
+2007-05-26,29.567
+2007-05-27,29.549
+2007-05-28,29.532
+2007-05-29,29.494
+2007-05-30,29.482
+2007-05-31,29.445
+2007-06-01,29.43
+2007-06-02,29.41
+2007-06-03,29.403
+2007-06-04,29.39
+2007-06-05,29.407
+2007-06-06,29.374
+2007-06-07,29.354
+2007-06-08,29.373
+2007-06-09,29.312
+2007-06-10,29.295
+2007-06-11,29.262
+2007-06-12,29.232
+2007-06-13,29.188
+2007-06-14,29.204
+2007-06-15,29.184
+2007-06-16,29.179
+2007-06-17,29.144
+2007-06-18,29.112
+2007-06-19,29.13
+2007-06-20,29.091
+2007-06-21,29.056
+2007-06-22,29.015
+2007-06-23,29.004
+2007-06-24,29.008
+2007-06-25,29.001
+2007-06-26,28.995
+2007-06-27,28.984
+2007-06-28,28.953
+2007-06-29,28.93
+2007-06-30,28.904
+2007-07-01,28.886
+2007-07-02,28.87
+2007-07-03,28.878
+2007-07-04,28.898
+2007-07-05,28.864
+2007-07-06,28.844
+2007-07-07,28.839
+2007-07-08,28.837
+2007-07-09,28.862
+2007-07-10,28.858
+2007-07-11,28.922
+2007-07-12,28.904
+2007-07-13,28.937
+2007-07-14,28.946
+2007-07-15,28.95
+2007-07-16,28.936
+2007-07-17,28.925
+2007-07-18,28.928
+2007-07-19,28.917
+2007-07-20,28.88
+2007-07-21,28.904
+2007-07-22,28.906
+2007-07-23,28.912
+2007-07-24,28.919
+2007-07-25,28.912
+2007-07-26,28.902
+2007-07-27,28.892
+2007-07-28,28.881
+2007-07-29,28.851
+2007-07-30,28.848
+2007-07-31,28.847
+2007-08-01,28.836
+2007-08-02,28.848
+2007-08-03,28.841
+2007-08-04,28.804
+2007-08-05,28.788
+2007-08-06,28.829
+2007-08-07,28.793
+2007-08-08,28.792
+2007-08-09,28.762
+2007-08-10,28.78
+2007-08-11,28.786
+2007-08-12,28.788
+2007-08-13,28.756
+2007-08-14,28.74
+2007-08-15,28.763
+2007-08-16,28.767
+2007-08-17,28.745
+2007-08-18,28.709
+2007-08-19,28.716
+2007-08-20,28.715
+2007-08-21,28.718
+2007-08-22,28.741
+2007-08-23,28.773
+2007-08-24,28.773
+2007-08-25,28.726
+2007-08-26,28.703
+2007-08-27,28.691
+2007-08-28,28.697
+2007-08-29,28.717
+2007-08-30,28.678
+2007-08-31,28.665
+2007-09-01,28.641
+2007-09-02,28.668
+2007-09-03,28.691
+2007-09-04,28.653
+2007-09-05,28.638
+2007-09-06,28.679
+2007-09-07,28.706
+2007-09-08,28.662
+2007-09-09,28.612
+2007-09-10,28.619
+2007-09-11,28.653
+2007-09-12,28.647
+2007-09-13,28.629
+2007-09-14,28.741
+2007-09-15,28.662
+2007-09-16,28.638
+2007-09-17,28.646
+2007-09-18,28.649
+2007-09-19,28.68
+2007-09-20,28.662
+2007-09-21,28.645
+2007-09-22,28.7
+2007-09-23,28.632
+2007-09-24,28.638
+2007-09-25,28.661
+2007-09-26,28.646
+2007-09-27,28.607
+2007-09-28,28.636
+2007-09-29,28.624
+2007-09-30,28.636
+2007-10-01,28.716
+2007-10-02,28.689
+2007-10-03,28.704
+2007-10-04,28.617
+2007-10-05,28.617
+2007-10-06,28.584
+2007-10-07,28.568
+2007-10-08,28.611
+2007-10-09,28.604
+2007-10-10,28.618
+2007-10-11,28.612
+2007-10-12,28.604
+2007-10-13,28.635
+2007-10-14,28.621
+2007-10-15,28.613
+2007-10-16,28.61
+2007-10-17,28.621
+2007-10-18,28.616
+2007-10-19,28.673
+2007-10-20,28.72
+2007-10-21,28.713
+2007-10-22,28.721
+2007-10-23,28.716
+2007-10-24,28.714
+2007-10-25,28.722
+2007-10-26,28.767
+2007-10-27,28.855
+2007-10-28,28.833
+2007-10-29,28.878
+2007-10-30,28.863
+2007-10-31,28.949
+2007-11-01,28.907
+2007-11-02,28.857
+2007-11-03,28.833
+2007-11-04,28.847
+2007-11-05,28.858
+2007-11-06,28.892
+2007-11-07,28.871
+2007-11-08,28.858
+2007-11-09,28.846
+2007-11-10,28.806
+2007-11-11,28.84
+2007-11-12,28.882
+2007-11-13,28.86
+2007-11-14,28.954
+2007-11-15,28.828
+2007-11-16,28.837
+2007-11-17,28.923
+2007-11-18,28.911
+2007-11-19,28.935
+2007-11-20,29.058
+2007-11-21,28.921
+2007-11-22,28.912
+2007-11-23,29.013
+2007-11-24,29.064
+2007-11-25,29.118
+2007-11-26,29.06
+2007-11-27,29.076
+2007-11-28,29.086
+2007-11-29,29.246
+2007-11-30,29.164
+2007-12-01,29.094
+2007-12-02,29.106
+2007-12-03,29.153
+2007-12-04,29.11
+2007-12-05,29.092
+2007-12-06,29.084
+2007-12-07,29.098
+2007-12-08,29.084
+2007-12-09,29.053
+2007-12-10,29.046
+2007-12-11,29.054
+2007-12-12,29.037
+2007-12-13,29.027
+2007-12-14,29.038
+2007-12-15,29.021
+2007-12-16,29.022
+2007-12-17,29.055
+2007-12-18,29.088
+2007-12-19,29.052
+2007-12-20,29.023
+2007-12-21,29.008
+2007-12-22,29.001
+2007-12-23,29.003
+2007-12-24,29.011
+2007-12-25,29.037
+2007-12-26,29.056
+2007-12-27,29.072
+2007-12-28,29.087
+2007-12-29,29.135
+2007-12-30,29.122
+2007-12-31,29.127
+2008-01-01,29.138
+2008-01-02,29.049
+2008-01-03,29.138
+2008-01-04,29.191
+2008-01-05,29.154
+2008-01-06,29.117
+2008-01-07,29.136
+2008-01-08,29.203
+2008-01-09,29.451
+2008-01-10,29.409
+2008-01-11,29.465
+2008-01-12,29.522
+2008-01-13,29.503
+2008-01-14,29.5
+2008-01-15,29.521
+2008-01-16,29.526
+2008-01-17,29.544
+2008-01-18,29.582
+2008-01-19,29.526
+2008-01-20,29.426
+2008-01-21,29.418
+2008-01-22,29.417
+2008-01-23,29.384
+2008-01-24,29.38
+2008-01-25,29.362
+2008-01-26,29.337
+2008-01-27,29.333
+2008-01-28,29.324
+2008-01-29,29.311
+2008-01-30,29.345
+2008-01-31,29.368
+2008-02-01,29.296
+2008-02-02,29.277
+2008-02-03,29.281
+2008-02-04,29.27
+2008-02-05,29.291
+2008-02-06,29.253
+2008-02-07,29.238
+2008-02-08,29.252
+2008-02-09,29.28
+2008-02-10,29.309
+2008-02-11,29.232
+2008-02-12,29.225
+2008-02-13,29.224
+2008-02-14,29.251
+2008-02-15,29.238
+2008-02-16,29.233
+2008-02-17,29.264
+2008-02-18,29.279
+2008-02-19,29.288
+2008-02-20,29.292
+2008-02-21,29.286
+2008-02-22,29.287
+2008-02-23,29.283
+2008-02-24,29.301
+2008-02-25,29.292
+2008-02-26,29.286
+2008-02-27,29.252
+2008-02-28,29.222
+2008-02-29,29.233
+2008-03-01,29.234
+2008-03-02,29.224
+2008-03-03,29.287
+2008-03-04,29.218
+2008-03-05,29.199
+2008-03-06,29.226
+2008-03-07,29.256
+2008-03-08,29.186
+2008-03-09,29.318
+2008-03-10,29.348
+2008-03-11,29.399
+2008-03-12,29.409
+2008-03-13,29.393
+2008-03-14,29.4
+2008-03-15,29.403
+2008-03-16,29.396
+2008-03-17,29.39
+2008-03-18,29.407
+2008-03-19,29.445
+2008-03-20,29.412
+2008-03-21,29.435
+2008-03-22,29.406
+2008-03-23,29.436
+2008-03-24,29.441
+2008-03-25,29.479
+2008-03-26,29.499
+2008-03-27,29.458
+2008-03-28,29.432
+2008-03-29,29.428
+2008-03-30,29.43
+2008-03-31,29.482
+2008-04-01,29.517
+2008-04-02,29.53
+2008-04-03,29.572
+2008-04-04,29.588
+2008-04-05,29.63
+2008-04-06,29.658
+2008-04-07,29.694
+2008-04-08,29.766
+2008-04-09,29.783
+2008-04-10,29.79
+2008-04-11,29.814
+2008-04-12,29.883
+2008-04-13,29.939
+2008-04-14,29.983
+2008-04-15,30.009
+2008-04-16,30.028
+2008-04-17,30.024
+2008-04-18,30.013
+2008-04-19,30.019
+2008-04-20,30.056
+2008-04-21,30.061
+2008-04-22,30.079
+2008-04-23,30.083
+2008-04-24,30.061
+2008-04-25,30.068
+2008-04-26,30.07
+2008-04-27,30.062
+2008-04-28,30.043
+2008-04-29,30.004
+2008-04-30,30.013
+2008-05-01,30.009
+2008-05-02,29.99
+2008-05-03,30.013
+2008-05-04,30.007
+2008-05-05,29.933
+2008-05-06,29.911
+2008-05-07,29.884
+2008-05-08,29.861
+2008-05-09,29.812
+2008-05-10,29.79
+2008-05-11,29.763
+2008-05-12,29.736
+2008-05-13,29.713
+2008-05-14,29.705
+2008-05-15,29.667
+2008-05-16,29.623
+2008-05-17,29.608
+2008-05-18,29.596
+2008-05-19,29.571
+2008-05-20,29.533
+2008-05-21,29.506
+2008-05-22,29.483
+2008-05-23,29.436
+2008-05-24,29.409
+2008-05-25,29.41
+2008-05-26,29.402
+2008-05-27,29.346
+2008-05-28,29.321
+2008-05-29,29.315
+2008-05-30,29.276
+2008-05-31,29.299
+2008-06-01,29.299
+2008-06-02,29.272
+2008-06-03,29.257
+2008-06-04,29.237
+2008-06-05,29.244
+2008-06-06,29.298
+2008-06-07,29.272
+2008-06-08,29.248
+2008-06-09,29.233
+2008-06-10,29.215
+2008-06-11,29.214
+2008-06-12,29.185
+2008-06-13,29.195
+2008-06-14,29.187
+2008-06-15,29.174
+2008-06-16,29.185
+2008-06-17,29.172
+2008-06-18,29.179
+2008-06-19,29.175
+2008-06-20,29.167
+2008-06-21,29.168
+2008-06-22,29.156
+2008-06-23,29.134
+2008-06-24,29.125
+2008-06-25,29.128
+2008-06-26,29.143
+2008-06-27,29.102
+2008-06-28,29.096
+2008-06-29,29.108
+2008-06-30,29.088
+2008-07-01,29.07
+2008-07-02,29.077
+2008-07-03,29.088
+2008-07-04,29.045
+2008-07-05,29.028
+2008-07-06,29.012
+2008-07-07,29.011
+2008-07-08,29.006
+2008-07-09,28.989
+2008-07-10,28.967
+2008-07-11,28.945
+2008-07-12,28.935
+2008-07-13,29.028
+2008-07-14,28.947
+2008-07-15,28.922
+2008-07-16,28.924
+2008-07-17,28.899
+2008-07-18,28.906
+2008-07-19,28.905
+2008-07-20,28.902
+2008-07-21,28.924
+2008-07-22,28.955
+2008-07-23,28.988
+2008-07-24,29.039
+2008-07-25,29.1
+2008-07-26,29.156
+2008-07-27,29.192
+2008-07-28,29.184
+2008-07-29,29.168
+2008-07-30,29.17
+2008-07-31,29.2
+2008-08-01,29.189
+2008-08-02,29.188
+2008-08-03,29.203
+2008-08-04,29.226
+2008-08-05,29.239
+2008-08-06,29.298
+2008-08-07,29.322
+2008-08-08,29.356
+2008-08-09,29.403
+2008-08-10,29.42
+2008-08-11,29.433
+2008-08-12,29.436
+2008-08-13,29.451
+2008-08-14,29.449
+2008-08-15,29.453
+2008-08-16,29.445
+2008-08-17,29.442
+2008-08-18,29.452
+2008-08-19,29.4
+2008-08-20,29.404
+2008-08-21,29.417
+2008-08-22,29.416
+2008-08-23,29.427
+2008-08-24,29.43
+2008-08-25,29.366
+2008-08-26,29.329
+2008-08-27,29.32
+2008-08-28,29.316
+2008-08-29,29.314
+2008-08-30,29.29
+2008-08-31,29.251
+2008-09-01,29.235
+2008-09-02,29.229
+2008-09-03,29.224
+2008-09-04,29.201
+2008-09-05,29.227
+2008-09-06,29.212
+2008-09-07,29.137
+2008-09-08,29.136
+2008-09-09,29.125
+2008-09-10,29.102
+2008-09-11,29.101
+2008-09-12,29.14
+2008-09-13,29.075
+2008-09-14,29.106
+2008-09-15,29.095
+2008-09-16,29.04
+2008-09-17,29.055
+2008-09-18,28.996
+2008-09-19,29.034
+2008-09-20,29.081
+2008-09-21,28.966
+2008-09-22,28.958
+2008-09-23,28.959
+2008-09-24,28.965
+2008-09-25,28.958
+2008-09-26,28.947
+2008-09-27,28.928
+2008-09-28,28.901
+2008-09-29,28.887
+2008-09-30,28.909
+2008-10-01,28.909
+2008-10-02,28.904
+2008-10-03,28.913
+2008-10-04,28.886
+2008-10-05,28.878
+2008-10-06,28.858
+2008-10-07,28.856
+2008-10-08,28.875
+2008-10-09,28.909
+2008-10-10,28.851
+2008-10-11,28.838
+2008-10-12,28.831
+2008-10-13,28.828
+2008-10-14,28.87
+2008-10-15,28.802
+2008-10-16,28.801
+2008-10-17,28.77
+2008-10-18,28.771
+2008-10-19,28.772
+2008-10-20,28.783
+2008-10-21,28.729
+2008-10-22,28.625
+2008-10-23,28.753
+2008-10-24,28.782
+2008-10-25,28.817
+2008-10-26,28.836
+2008-10-27,28.846
+2008-10-28,28.811
+2008-10-29,28.917
+2008-10-30,28.925
+2008-10-31,28.988
+2008-11-01,28.911
+2008-11-02,28.94
+2008-11-03,29.035
+2008-11-04,28.994
+2008-11-05,28.97
+2008-11-06,28.942
+2008-11-07,28.936
+2008-11-08,28.948
+2008-11-09,28.962
+2008-11-10,28.962
+2008-11-11,28.952
+2008-11-12,28.945
+2008-11-13,29.007
+2008-11-14,28.967
+2008-11-15,28.945
+2008-11-16,29.004
+2008-11-17,28.978
+2008-11-18,28.932
+2008-11-19,28.926
+2008-11-20,28.944
+2008-11-21,28.955
+2008-11-22,28.925
+2008-11-23,28.939
+2008-11-24,28.966
+2008-11-25,28.918
+2008-11-26,29.012
+2008-11-27,28.986
+2008-11-28,28.994
+2008-11-29,28.967
+2008-11-30,28.972
+2008-12-01,28.991
+2008-12-02,29.013
+2008-12-03,29.034
+2008-12-04,29.052
+2008-12-05,28.964
+2008-12-06,29.034
+2008-12-07,28.966
+2008-12-08,28.898
+2008-12-09,28.946
+2008-12-10,28.913
+2008-12-11,28.916
+2008-12-12,28.918
+2008-12-13,28.964
+2008-12-14,29.029
+2008-12-15,29.009
+2008-12-16,28.978
+2008-12-17,28.994
+2008-12-18,29.006
+2008-12-19,29.029
+2008-12-20,29.076
+2008-12-21,29.117
+2008-12-22,29.12
+2008-12-23,29.146
+2008-12-24,29.122
+2008-12-25,29.05
+2008-12-26,29.038
+2008-12-27,29.072
+2008-12-28,29.159
+2008-12-29,29.166
+2008-12-30,29.212
+2008-12-31,29.191
+2009-01-01,29.256
+2009-01-02,29.262
+2009-01-03,29.235
+2009-01-04,29.282
+2009-01-05,29.244
+2009-01-06,29.212
+2009-01-07,29.185
+2009-01-08,29.192
+2009-01-09,29.225
+2009-01-10,29.239
+2009-01-11,29.228
+2009-01-12,29.226
+2009-01-13,29.244
+2009-01-14,29.221
+2009-01-15,29.242
+2009-01-16,29.224
+2009-01-17,29.216
+2009-01-18,29.193
+2009-01-19,29.176
+2009-01-20,29.144
+2009-01-21,29.162
+2009-01-22,29.141
+2009-01-23,29.132
+2009-01-24,29.149
+2009-01-25,29.174
+2009-01-26,29.141
+2009-01-27,29.101
+2009-01-28,29.106
+2009-01-29,29.113
+2009-01-30,29.089
+2009-01-31,29.084
+2009-02-01,29.112
+2009-02-02,29.095
+2009-02-03,29.073
+2009-02-04,29.103
+2009-02-05,29.106
+2009-02-06,29.086
+2009-02-07,29.082
+2009-02-08,29.019
+2009-02-09,28.997
+2009-02-10,28.989
+2009-02-11,28.984
+2009-02-12,28.986
+2009-02-13,29.009
+2009-02-14,29.026
+2009-02-15,29.042
+2009-02-16,29.05
+2009-02-17,29.049
+2009-02-18,29.052
+2009-02-19,29.049
+2009-02-20,29.053
+2009-02-21,29.031
+2009-02-22,29.023
+2009-02-23,29.021
+2009-02-24,28.995
+2009-02-25,29.005
+2009-02-26,29.01
+2009-02-27,29.067
+2009-02-28,28.998
+2009-03-01,29.02
+2009-03-02,29.017
+2009-03-03,29.055
+2009-03-04,29.049
+2009-03-05,29.034
+2009-03-06,29.088
+2009-03-07,29.054
+2009-03-08,29.093
+2009-03-09,29.101
+2009-03-10,29.171
+2009-03-11,29.336
+2009-03-12,29.226
+2009-03-13,29.264
+2009-03-14,29.275
+2009-03-15,29.27
+2009-03-16,29.247
+2009-03-17,29.284
+2009-03-18,29.349
+2009-03-19,29.298
+2009-03-20,29.289
+2009-03-21,29.338
+2009-03-22,29.31
+2009-03-23,29.267
+2009-03-24,29.294
+2009-03-25,29.315
+2009-03-26,29.325
+2009-03-27,29.316
+2009-03-28,29.316
+2009-03-29,29.33
+2009-03-30,29.368
+2009-03-31,29.398
+2009-04-01,29.522
+2009-04-02,29.48
+2009-04-03,29.446
+2009-04-04,29.525
+2009-04-05,29.552
+2009-04-06,29.563
+2009-04-07,29.622
+2009-04-08,29.661
+2009-04-09,29.664
+2009-04-10,29.628
+2009-04-11,29.585
+2009-04-12,29.56
+2009-04-13,29.597
+2009-04-14,29.588
+2009-04-15,29.545
+2009-04-16,29.552
+2009-04-17,29.559
+2009-04-18,29.524
+2009-04-19,29.485
+2009-04-20,29.516
+2009-04-21,29.488
+2009-04-22,29.467
+2009-04-23,29.443
+2009-04-24,29.454
+2009-04-25,29.476
+2009-04-26,29.377
+2009-04-27,29.432
+2009-04-28,29.383
+2009-04-29,29.378
+2009-04-30,29.427
+2009-05-01,29.487
+2009-05-02,29.351
+2009-05-03,29.353
+2009-05-04,29.321
+2009-05-05,29.301
+2009-05-06,29.295
+2009-05-07,29.278
+2009-05-08,29.291
+2009-05-09,29.293
+2009-05-10,29.316
+2009-05-11,29.345
+2009-05-12,29.356
+2009-05-13,29.374
+2009-05-14,29.588
+2009-05-15,29.333
+2009-05-16,29.352
+2009-05-17,29.352
+2009-05-18,29.354
+2009-05-19,29.399
+2009-05-20,29.336
+2009-05-21,29.378
+2009-05-22,29.321
+2009-05-23,29.315
+2009-05-24,29.304
+2009-05-25,29.245
+2009-05-26,29.239
+2009-05-27,29.28
+2009-05-28,29.243
+2009-05-29,29.334
+2009-05-30,29.255
+2009-05-31,29.263
+2009-06-01,29.252
+2009-06-02,29.227
+2009-06-03,29.224
+2009-06-04,29.2
+2009-06-05,29.201
+2009-06-06,29.194
+2009-06-07,29.15
+2009-06-08,29.121
+2009-06-09,29.157
+2009-06-10,29.109
+2009-06-11,29.101
+2009-06-12,29.084
+2009-06-13,29.113
+2009-06-14,29.108
+2009-06-15,29.099
+2009-06-16,29.104
+2009-06-17,29.124
+2009-06-18,29.111
+2009-06-19,29.061
+2009-06-20,29.059
+2009-06-21,29.017
+2009-06-22,28.976
+2009-06-23,29.003
+2009-06-24,29.015
+2009-06-25,29.047
+2009-06-26,29.033
+2009-06-27,29.022
+2009-06-28,29.007
+2009-06-29,29.014
+2009-06-30,29.027
+2009-07-01,29.057
+2009-07-02,29.056
+2009-07-03,29.064
+2009-07-04,29.071
+2009-07-05,29.073
+2009-07-06,29.099
+2009-07-07,29.107
+2009-07-08,29.111
+2009-07-09,29.12
+2009-07-10,29.137
+2009-07-11,29.2
+2009-07-12,29.143
+2009-07-13,29.137
+2009-07-14,29.13
+2009-07-15,29.114
+2009-07-16,29.13
+2009-07-17,29.131
+2009-07-18,29.132
+2009-07-19,29.133
+2009-07-20,29.121
+2009-07-21,29.106
+2009-07-22,29.089
+2009-07-23,29.093
+2009-07-24,29.095
+2009-07-25,29.084
+2009-07-26,29.11
+2009-07-27,29.131
+2009-07-28,29.114
+2009-07-29,29.131
+2009-07-30,29.145
+2009-07-31,29.1
+2009-08-01,29.106
+2009-08-02,29.134
+2009-08-03,29.125
+2009-08-04,29.168
+2009-08-05,29.133
+2009-08-06,29.125
+2009-08-07,29.106
+2009-08-08,29.105
+2009-08-09,29.134
+2009-08-10,29.121
+2009-08-11,29.092
+2009-08-12,29.091
+2009-08-13,29.097
+2009-08-14,29.101
+2009-08-15,29.089
+2009-08-16,29.078
+2009-08-17,29.075
+2009-08-18,29.079
+2009-08-19,29.049
+2009-08-20,29.034
+2009-08-21,29.046
+2009-08-22,29.038
+2009-08-23,28.992
+2009-08-24,28.988
+2009-08-25,29.003
+2009-08-26,29.017
+2009-08-27,28.961
+2009-08-28,28.931
+2009-08-29,28.959
+2009-08-30,29.024
+2009-08-31,28.976
+2009-09-01,28.976
+2009-09-02,28.985
+2009-09-03,28.966
+2009-09-04,28.948
+2009-09-05,28.911
+2009-09-06,28.909
+2009-09-07,28.934
+2009-09-08,28.921
+2009-09-09,28.869
+2009-09-10,28.892
+2009-09-11,28.897
+2009-09-12,28.872
+2009-09-13,28.854
+2009-09-14,28.858
+2009-09-15,28.837
+2009-09-16,28.799
+2009-09-17,28.835
+2009-09-18,28.826
+2009-09-19,28.803
+2009-09-20,28.821
+2009-09-21,28.817
+2009-09-22,28.851
+2009-09-23,28.832
+2009-09-24,28.778
+2009-09-25,28.743
+2009-09-26,28.819
+2009-09-27,28.823
+2009-09-28,28.815
+2009-09-29,28.824
+2009-09-30,28.805
+2009-10-01,28.796
+2009-10-02,28.805
+2009-10-03,28.817
+2009-10-04,28.795
+2009-10-05,28.801
+2009-10-06,28.79
+2009-10-07,28.821
+2009-10-08,28.788
+2009-10-09,28.815
+2009-10-10,28.782
+2009-10-11,28.825
+2009-10-12,28.807
+2009-10-13,28.79
+2009-10-14,28.793
+2009-10-15,28.781
+2009-10-16,28.759
+2009-10-17,28.773
+2009-10-18,28.767
+2009-10-19,28.779
+2009-10-20,28.805
+2009-10-21,28.753
+2009-10-22,28.726
+2009-10-23,28.736
+2009-10-24,28.882
+2009-10-25,28.83
+2009-10-26,28.824
+2009-10-27,28.881
+2009-10-28,28.823
+2009-10-29,28.843
+2009-10-30,28.928
+2009-10-31,29.075
+2009-11-01,28.853
+2009-11-02,28.858
+2009-11-03,28.895
+2009-11-04,28.85
+2009-11-05,28.851
+2009-11-06,28.821
+2009-11-07,28.93
+2009-11-08,28.877
+2009-11-09,28.872
+2009-11-10,28.812
+2009-11-11,28.797
+2009-11-12,28.8
+2009-11-13,28.795
+2009-11-14,28.794
+2009-11-15,28.838
+2009-11-16,28.84
+2009-11-17,28.844
+2009-11-18,28.864
+2009-11-19,28.868
+2009-11-20,28.892
+2009-11-21,28.89
+2009-11-22,28.882
+2009-11-23,28.922
+2009-11-24,28.905
+2009-11-25,28.917
+2009-11-26,28.941
+2009-11-27,28.889
+2009-11-28,28.873
+2009-11-29,28.979
+2009-11-30,28.986
+2009-12-01,29.046
+2009-12-02,29.078
+2009-12-03,29.072
+2009-12-04,29.13
+2009-12-05,29.146
+2009-12-06,29.171
+2009-12-07,29.174
+2009-12-08,29.165
+2009-12-09,29.185
+2009-12-10,29.219
+2009-12-11,29.201
+2009-12-12,29.164
+2009-12-13,29.239
+2009-12-14,29.138
+2009-12-15,29.135
+2009-12-16,29.113
+2009-12-17,29.071
+2009-12-18,29.082
+2009-12-19,29.049
+2009-12-20,29.03
+2009-12-21,29.043
+2009-12-22,29.057
+2009-12-23,29.026
+2009-12-24,29.007
+2009-12-25,28.999
+2009-12-26,28.999
+2009-12-27,29.012
+2009-12-28,29.04
+2009-12-29,29.001
+2009-12-30,29.005
+2009-12-31,29.021
+2010-01-01,29.006
+2010-01-02,28.996
+2010-01-03,28.958
+2010-01-04,28.985
+2010-01-05,29.002
+2010-01-06,29.015
+2010-01-07,29.003
+2010-01-08,28.977
+2010-01-09,28.999
+2010-01-10,29.049
+2010-01-11,29
+2010-01-12,28.967
+2010-01-13,29.002
+2010-01-14,28.958
+2010-01-15,28.945
+2010-01-16,28.935
+2010-01-17,28.91
+2010-01-18,28.906
+2010-01-19,28.908
+2010-01-20,28.899
+2010-01-21,28.907
+2010-01-22,28.887
+2010-01-23,28.878
+2010-01-24,28.896
+2010-01-25,28.947
+2010-01-26,29.032
+2010-01-27,29.098
+2010-01-28,29.16
+2010-01-29,29.069
+2010-01-30,29.132
+2010-01-31,29.131
+2010-02-01,29.121
+2010-02-02,29.087
+2010-02-03,29.071
+2010-02-04,29.075
+2010-02-05,29.064
+2010-02-06,29.048
+2010-02-07,29.048
+2010-02-08,29.04
+2010-02-09,29.029
+2010-02-10,29.006
+2010-02-11,29.001
+2010-02-12,29.001
+2010-02-13,28.994
+2010-02-14,28.987
+2010-02-15,28.972
+2010-02-16,28.951
+2010-02-17,28.966
+2010-02-18,28.974
+2010-02-19,28.958
+2010-02-20,28.953
+2010-02-21,28.938
+2010-02-22,28.922
+2010-02-23,28.926
+2010-02-24,28.914
+2010-02-25,28.873
+2010-02-26,28.784
+2010-02-27,28.95
+2010-02-28,28.978
+2010-03-01,28.97
+2010-03-02,28.995
+2010-03-03,28.962
+2010-03-04,28.936
+2010-03-05,28.962
+2010-03-06,29.017
+2010-03-07,29.022
+2010-03-08,29.012
+2010-03-09,29.002
+2010-03-10,29.013
+2010-03-11,29.005
+2010-03-12,29.008
+2010-03-13,28.999
+2010-03-14,28.93
+2010-03-15,28.96
+2010-03-16,29.062
+2010-03-17,29.097
+2010-03-18,29.113
+2010-03-19,29.134
+2010-03-20,29.149
+2010-03-21,29.159
+2010-03-22,29.172
+2010-03-23,29.193
+2010-03-24,29.352
+2010-03-25,29.461
+2010-03-26,29.383
+2010-03-27,29.475
+2010-03-28,29.627
+2010-03-29,29.522
+2010-03-30,29.462
+2010-03-31,29.526
+2010-04-01,29.61
+2010-04-02,29.66
+2010-04-03,29.695
+2010-04-04,29.686
+2010-04-05,29.716
+2010-04-06,29.688
+2010-04-07,29.686
+2010-04-08,29.656
+2010-04-09,29.702
+2010-04-10,29.703
+2010-04-11,29.694
+2010-04-12,29.672
+2010-04-13,29.652
+2010-04-14,29.645
+2010-04-15,29.604
+2010-04-16,29.662
+2010-04-17,29.65
+2010-04-18,29.603
+2010-04-19,29.613
+2010-04-20,29.621
+2010-04-21,29.613
+2010-04-22,29.583
+2010-04-23,29.573
+2010-04-24,29.568
+2010-04-25,29.519
+2010-04-26,29.501
+2010-04-27,29.427
+2010-04-28,29.495
+2010-04-29,29.518
+2010-04-30,29.532
+2010-05-01,29.531
+2010-05-02,29.54
+2010-05-03,29.546
+2010-05-04,29.542
+2010-05-05,29.536
+2010-05-06,29.53
+2010-05-07,29.493
+2010-05-08,29.499
+2010-05-09,29.478
+2010-05-10,29.447
+2010-05-11,29.477
+2010-05-12,29.436
+2010-05-13,29.445
+2010-05-14,29.448
+2010-05-15,29.408
+2010-05-16,29.389
+2010-05-17,29.382
+2010-05-18,29.37
+2010-05-19,29.341
+2010-05-20,29.336
+2010-05-21,29.291
+2010-05-22,29.301
+2010-05-23,29.291
+2010-05-24,29.26
+2010-05-25,29.237
+2010-05-26,29.202
+2010-05-27,29.156
+2010-05-28,29.159
+2010-05-29,29.15
+2010-05-30,29.096
+2010-05-31,29.088
+2010-06-01,29.084
+2010-06-02,29.086
+2010-06-03,29.034
+2010-06-04,29.046
+2010-06-05,29.04
+2010-06-06,28.996
+2010-06-07,29.055
+2010-06-08,29.052
+2010-06-09,29.09
+2010-06-10,29.067
+2010-06-11,29.06
+2010-06-12,29.062
+2010-06-13,29.046
+2010-06-14,29.027
+2010-06-15,29.018
+2010-06-16,29.051
+2010-06-17,29.006
+2010-06-18,29.019
+2010-06-19,29.03
+2010-06-20,28.989
+2010-06-21,28.969
+2010-06-22,28.966
+2010-06-23,28.953
+2010-06-24,28.958
+2010-06-25,28.942
+2010-06-26,28.944
+2010-06-27,28.94
+2010-06-28,28.96
+2010-06-29,28.949
+2010-06-30,28.963
+2010-07-01,28.937
+2010-07-02,28.934
+2010-07-03,28.953
+2010-07-04,28.936
+2010-07-05,28.932
+2010-07-06,28.907
+2010-07-07,28.899
+2010-07-08,28.886
+2010-07-09,28.913
+2010-07-10,28.884
+2010-07-11,28.878
+2010-07-12,28.88
+2010-07-13,28.887
+2010-07-14,28.851
+2010-07-15,28.854
+2010-07-16,28.891
+2010-07-17,28.875
+2010-07-18,28.843
+2010-07-19,28.844
+2010-07-20,28.843
+2010-07-21,28.848
+2010-07-22,28.846
+2010-07-23,28.874
+2010-07-24,28.872
+2010-07-25,28.85
+2010-07-26,28.832
+2010-07-27,28.848
+2010-07-28,28.886
+2010-07-29,28.84
+2010-07-30,28.82
+2010-07-31,28.826
+2010-08-01,28.83
+2010-08-02,28.863
+2010-08-03,28.883
+2010-08-04,28.897
+2010-08-05,28.93
+2010-08-06,28.927
+2010-08-07,28.933
+2010-08-08,28.976
+2010-08-09,28.964
+2010-08-10,28.952
+2010-08-11,28.94
+2010-08-12,28.926
+2010-08-13,28.947
+2010-08-14,28.973
+2010-08-15,29.009
+2010-08-16,29.005
+2010-08-17,28.928
+2010-08-18,28.909
+2010-08-19,28.903
+2010-08-20,28.87
+2010-08-21,28.876
+2010-08-22,28.874
+2010-08-23,28.874
+2010-08-24,28.875
+2010-08-25,28.877
+2010-08-26,28.88
+2010-08-27,28.864
+2010-08-28,28.887
+2010-08-29,28.875
+2010-08-30,28.865
+2010-08-31,28.856
+2010-09-01,28.862
+2010-09-02,28.849
+2010-09-03,28.857
+2010-09-04,28.839
+2010-09-05,28.821
+2010-09-06,28.82
+2010-09-07,28.814
+2010-09-08,28.791
+2010-09-09,28.749
+2010-09-10,28.722
+2010-09-11,28.728
+2010-09-12,28.825
+2010-09-13,28.795
+2010-09-14,28.734
+2010-09-15,28.71
+2010-09-16,28.692
+2010-09-17,28.668
+2010-09-18,28.742
+2010-09-19,28.715
+2010-09-20,28.696
+2010-09-21,28.751
+2010-09-22,28.734
+2010-09-23,28.681
+2010-09-24,28.7
+2010-09-25,28.701
+2010-09-26,28.658
+2010-09-27,28.7
+2010-09-28,28.738
+2010-09-29,28.722
+2010-09-30,28.72
+2010-10-01,28.833
+2010-10-02,28.927
+2010-10-03,28.984
+2010-10-04,29.01
+2010-10-05,29.022
+2010-10-06,29.046
+2010-10-07,29.092
+2010-10-08,29.116
+2010-10-09,29.104
+2010-10-10,29.14
+2010-10-11,29.125
+2010-10-12,29.121
+2010-10-13,29.124
+2010-10-14,29.133
+2010-10-15,28.974
+2010-10-16,29.209
+2010-10-17,29.33
+2010-10-18,29.364
+2010-10-19,29.397
+2010-10-20,29.412
+2010-10-21,29.41
+2010-10-22,29.366
+2010-10-23,29.362
+2010-10-24,29.353
+2010-10-25,29.373
+2010-10-26,29.366
+2010-10-27,29.382
+2010-10-28,29.408
+2010-10-29,29.367
+2010-10-30,29.368
+2010-10-31,29.335
+2010-11-01,29.356
+2010-11-02,29.348
+2010-11-03,29.36
+2010-11-04,29.353
+2010-11-05,29.345
+2010-11-06,29.367
+2010-11-07,29.362
+2010-11-08,29.319
+2010-11-09,29.383
+2010-11-10,29.359
+2010-11-11,29.401
+2010-11-12,29.426
+2010-11-13,29.417
+2010-11-14,29.425
+2010-11-15,29.422
+2010-11-16,29.39
+2010-11-17,29.411
+2010-11-18,29.391
+2010-11-19,29.379
+2010-11-20,29.394
+2010-11-21,29.354
+2010-11-22,29.485
+2010-11-23,29.401
+2010-11-24,29.321
+2010-11-25,29.328
+2010-11-26,29.361
+2010-11-27,29.346
+2010-11-28,29.312
+2010-11-29,29.29
+2010-11-30,29.348
+2010-12-01,29.376
+2010-12-02,29.347
+2010-12-03,29.362
+2010-12-04,29.373
+2010-12-05,29.386
+2010-12-06,29.387
+2010-12-07,29.399
+2010-12-08,29.357
+2010-12-09,29.327
+2010-12-10,29.348
+2010-12-11,29.331
+2010-12-12,29.267
+2010-12-13,29.321
+2010-12-14,29.403
+2010-12-15,29.403
+2010-12-16,29.361
+2010-12-17,29.367
+2010-12-18,29.39
+2010-12-19,29.379
+2010-12-20,29.376
+2010-12-21,29.364
+2010-12-22,29.36
+2010-12-23,29.34
+2010-12-24,29.336
+2010-12-25,29.308
+2010-12-26,29.267
+2010-12-27,29.252
+2010-12-28,29.321
+2010-12-29,29.239
+2010-12-30,29.216
+2010-12-31,29.216
+2011-01-01,29.218
+2011-01-02,29.249
+2011-01-03,29.267
+2011-01-04,29.266
+2011-01-05,29.26
+2011-01-06,29.261
+2011-01-07,29.235
+2011-01-08,29.216
+2011-01-09,29.212
+2011-01-10,29.162
+2011-01-11,29.129
+2011-01-12,29.18
+2011-01-13,29.234
+2011-01-14,29.187
+2011-01-15,29.127
+2011-01-16,29.108
+2011-01-17,29.138
+2011-01-18,29.156
+2011-01-19,29.083
+2011-01-20,29.089
+2011-01-21,29.071
+2011-01-22,29.09
+2011-01-23,29.061
+2011-01-24,29.08
+2011-01-25,29.051
+2011-01-26,29.031
+2011-01-27,29.031
+2011-01-28,29.002
+2011-01-29,28.981
+2011-01-30,28.985
+2011-01-31,28.991
+2011-02-01,28.974
+2011-02-02,28.981
+2011-02-03,28.974
+2011-02-04,29.012
+2011-02-05,28.969
+2011-02-06,28.935
+2011-02-07,28.934
+2011-02-08,28.931
+2011-02-09,28.958
+2011-02-10,28.926
+2011-02-11,28.949
+2011-02-12,28.931
+2011-02-13,28.941
+2011-02-14,28.888
+2011-02-15,28.911
+2011-02-16,28.911
+2011-02-17,28.863
+2011-02-18,28.888
+2011-02-19,28.878
+2011-02-20,28.885
+2011-02-21,28.874
+2011-02-22,28.916
+2011-02-23,28.882
+2011-02-24,28.885
+2011-02-25,28.861
+2011-02-26,28.88
+2011-02-27,28.864
+2011-02-28,28.891
+2011-03-01,28.878
+2011-03-02,28.892
+2011-03-03,28.886
+2011-03-04,28.867
+2011-03-05,28.901
+2011-03-06,28.892
+2011-03-07,28.887
+2011-03-08,28.959
+2011-03-09,29.022
+2011-03-10,29.056
+2011-03-11,29.084
+2011-03-12,29.147
+2011-03-13,29.21
+2011-03-14,29.252
+2011-03-15,29.311
+2011-03-16,29.359
+2011-03-17,29.371
+2011-03-18,29.47
+2011-03-19,29.525
+2011-03-20,29.61
+2011-03-21,29.665
+2011-03-22,29.659
+2011-03-23,29.661
+2011-03-24,29.671
+2011-03-25,29.677
+2011-03-26,29.665
+2011-03-27,29.651
+2011-03-28,29.639
+2011-03-29,29.626
+2011-03-30,29.611
+2011-03-31,29.597
+2011-04-01,29.571
+2011-04-02,29.587
+2011-04-03,29.579
+2011-04-04,29.626
+2011-04-05,29.634
+2011-04-06,29.647
+2011-04-07,29.659
+2011-04-08,29.673
+2011-04-09,29.68
+2011-04-10,29.698
+2011-04-11,29.83
+2011-04-12,29.83
+2011-04-13,29.942
+2011-04-14,30.007
+2011-04-15,30.025
+2011-04-16,30.095
+2011-04-17,30.118
+2011-04-18,30.115
+2011-04-19,30.088
+2011-04-20,30.125
+2011-04-21,30.156
+2011-04-22,30.16
+2011-04-23,30.296
+2011-04-24,30.165
+2011-04-25,30.144
+2011-04-26,30.141
+2011-04-27,30.264
+2011-04-28,30.446
+2011-04-29,30.532
+2011-04-30,30.562
+2011-05-01,30.584
+2011-05-02,30.614
+2011-05-03,30.556
+2011-05-04,30.618
+2011-05-05,30.637
+2011-05-06,30.686
+2011-05-07,30.665
+2011-05-08,30.623
+2011-05-09,30.583
+2011-05-10,30.538
+2011-05-11,30.516
+2011-05-12,30.491
+2011-05-13,30.484
+2011-05-14,30.427
+2011-05-15,30.359
+2011-05-16,30.41
+2011-05-17,30.488
+2011-05-18,30.536
+2011-05-19,30.542
+2011-05-20,30.534
+2011-05-21,30.525
+2011-05-22,30.541
+2011-05-23,30.644
+2011-05-24,30.511
+2011-05-25,30.428
+2011-05-26,30.419
+2011-05-27,30.396
+2011-05-28,30.484
+2011-05-29,30.551
+2011-05-30,30.563
+2011-05-31,30.57
+2011-06-01,30.591
+2011-06-02,30.5
+2011-06-03,30.448
+2011-06-04,30.42
+2011-06-05,30.39
+2011-06-06,30.341
+2011-06-07,30.301
+2011-06-08,30.267
+2011-06-09,30.215
+2011-06-10,30.152
+2011-06-11,30.15
+2011-06-12,30.166
+2011-06-13,30.064
+2011-06-14,30.005
+2011-06-15,30.017
+2011-06-16,29.997
+2011-06-17,29.956
+2011-06-18,29.918
+2011-06-19,29.874
+2011-06-20,29.847
+2011-06-21,29.815
+2011-06-22,29.781
+2011-06-23,29.774
+2011-06-24,29.772
+2011-06-25,29.747
+2011-06-26,29.71
+2011-06-27,29.689
+2011-06-28,29.693
+2011-06-29,29.653
+2011-06-30,29.613
+2011-07-01,29.589
+2011-07-02,29.578
+2011-07-03,29.586
+2011-07-04,29.568
+2011-07-05,29.522
+2011-07-06,29.51
+2011-07-07,29.462
+2011-07-08,29.444
+2011-07-09,29.4
+2011-07-10,29.409
+2011-07-11,29.397
+2011-07-12,29.356
+2011-07-13,29.306
+2011-07-14,29.288
+2011-07-15,29.274
+2011-07-16,29.272
+2011-07-17,29.261
+2011-07-18,29.228
+2011-07-19,29.193
+2011-07-20,29.201
+2011-07-21,29.211
+2011-07-22,29.15
+2011-07-23,29.127
+2011-07-24,29.066
+2011-07-25,29.105
+2011-07-26,29.107
+2011-07-27,29.048
+2011-07-28,29.043
+2011-07-29,29.034
+2011-07-30,29.005
+2011-07-31,29.001
+2011-08-01,28.994
+2011-08-02,28.963
+2011-08-03,28.934
+2011-08-04,28.909
+2011-08-05,28.922
+2011-08-06,28.948
+2011-08-07,28.929
+2011-08-08,28.873
+2011-08-09,28.881
+2011-08-10,28.929
+2011-08-11,28.905
+2011-08-12,28.876
+2011-08-13,28.877
+2011-08-14,28.872
+2011-08-15,28.846
+2011-08-16,28.843
+2011-08-17,28.855
+2011-08-18,28.892
+2011-08-19,28.876
+2011-08-20,28.868
+2011-08-21,28.849
+2011-08-22,28.871
+2011-08-23,28.857
+2011-08-24,28.942
+2011-08-25,28.946
+2011-08-26,28.821
+2011-08-27,28.817
+2011-08-28,28.664
+2011-08-29,29.135
+2011-08-30,29.284
+2011-08-31,29.313
+2011-09-01,29.34
+2011-09-02,29.39
+2011-09-03,29.387
+2011-09-04,29.375
+2011-09-05,29.379
+2011-09-06,29.419
+2011-09-07,29.464
+2011-09-08,29.499
+2011-09-09,29.529
+2011-09-10,29.513
+2011-09-11,29.538
+2011-09-12,29.543
+2011-09-13,29.56
+2011-09-14,29.497
+2011-09-15,29.498
+2011-09-16,29.496
+2011-09-17,29.492
+2011-09-18,29.477
+2011-09-19,29.481
+2011-09-20,29.501
+2011-09-21,29.451
+2011-09-22,29.444
+2011-09-23,29.405
+2011-09-24,29.393
+2011-09-25,29.392
+2011-09-26,29.379
+2011-09-27,29.362
+2011-09-28,29.366
+2011-09-29,29.367
+2011-09-30,29.408
+2011-10-01,29.264
+2011-10-02,29.339
+2011-10-03,29.423
+2011-10-04,29.428
+2011-10-05,29.401
+2011-10-06,29.429
+2011-10-07,29.449
+2011-10-08,29.452
+2011-10-09,29.43
+2011-10-10,29.402
+2011-10-11,29.378
+2011-10-12,29.379
+2011-10-13,29.365
+2011-10-14,29.356
+2011-10-15,29.455
+2011-10-16,29.452
+2011-10-17,29.432
+2011-10-18,29.428
+2011-10-19,29.39
+2011-10-20,29.38
+2011-10-21,29.447
+2011-10-22,29.427
+2011-10-23,29.418
+2011-10-24,29.447
+2011-10-25,29.41
+2011-10-26,29.384
+2011-10-27,29.342
+2011-10-28,29.358
+2011-10-29,29.33
+2011-10-30,29.31
+2011-10-31,29.355
+2011-11-01,29.321
+2011-11-02,29.341
+2011-11-03,29.316
+2011-11-04,29.229
+2011-11-05,29.241
+2011-11-06,29.28
+2011-11-07,29.27
+2011-11-08,29.195
+2011-11-09,29.204
+2011-11-10,29.224
+2011-11-11,29.156
+2011-11-12,29.197
+2011-11-13,29.206
+2011-11-14,29.215
+2011-11-15,29.116
+2011-11-16,29.118
+2011-11-17,29.075
+2011-11-18,29.081
+2011-11-19,29.149
+2011-11-20,29.102
+2011-11-21,28.974
+2011-11-22,28.975
+2011-11-23,28.911
+2011-11-24,28.99
+2011-11-25,29.002
+2011-11-26,28.948
+2011-11-27,29.001
+2011-11-28,28.973
+2011-11-29,28.938
+2011-11-30,28.988
+2011-12-01,28.96
+2011-12-02,29.006
+2011-12-03,28.997
+2011-12-04,29.167
+2011-12-05,29.009
+2011-12-06,28.928
+2011-12-07,28.972
+2011-12-08,29
+2011-12-09,29.052
+2011-12-10,28.99
+2011-12-11,29.045
+2011-12-12,29.045
+2011-12-13,28.979
+2011-12-14,28.967
+2011-12-15,29.227
+2011-12-16,28.966
+2011-12-17,28.95
+2011-12-18,28.987
+2011-12-19,29.13
+2011-12-20,28.94
+2011-12-21,29.005
+2011-12-22,28.966
+2011-12-23,28.941
+2011-12-24,28.948
+2011-12-25,29.056
+2011-12-26,28.972
+2011-12-27,29.042
+2011-12-28,28.998
+2011-12-29,28.941
+2011-12-30,28.962
+2011-12-31,28.945
+2012-01-01,28.963
+2012-01-02,28.982
+2012-01-03,28.96
+2012-01-04,28.982
+2012-01-05,28.966
+2012-01-06,28.943
+2012-01-07,28.939
+2012-01-08,28.941
+2012-01-09,28.968
+2012-01-10,28.942
+2012-01-11,28.936
+2012-01-12,28.925
+2012-01-13,28.927
+2012-01-14,28.913
+2012-01-15,28.945
+2012-01-16,28.968
+2012-01-17,28.93
+2012-01-18,28.908
+2012-01-19,28.907
+2012-01-20,28.867
+2012-01-21,28.87
+2012-01-22,28.854
+2012-01-23,28.864
+2012-01-24,28.859
+2012-01-25,28.854
+2012-01-26,28.849
+2012-01-27,28.876
+2012-01-28,28.911
+2012-01-29,28.949
+2012-01-30,28.92
+2012-01-31,28.918
+2012-02-01,28.919
+2012-02-02,28.913
+2012-02-03,28.941
+2012-02-04,28.931
+2012-02-05,28.938
+2012-02-06,28.957
+2012-02-07,28.928
+2012-02-08,28.955
+2012-02-09,28.94
+2012-02-10,28.943
+2012-02-11,28.881
+2012-02-12,28.884
+2012-02-13,28.882
+2012-02-14,28.887
+2012-02-15,28.877
+2012-02-16,28.895
+2012-02-17,28.915
+2012-02-18,28.881
+2012-02-19,28.861
+2012-02-20,28.851
+2012-02-21,28.897
+2012-02-22,28.884
+2012-02-23,28.847
+2012-02-24,28.855
+2012-02-25,28.871
+2012-02-26,28.826
+2012-02-27,28.824
+2012-02-28,28.805
+2012-02-29,28.794
+2012-03-01,28.8
+2012-03-02,28.854
+2012-03-03,28.911
+2012-03-04,28.797
+2012-03-05,28.8
+2012-03-06,28.779
+2012-03-07,28.887
+2012-03-08,28.93
+2012-03-09,28.831
+2012-03-10,28.861
+2012-03-11,28.963
+2012-03-12,28.926
+2012-03-13,28.962
+2012-03-14,28.978
+2012-03-15,29.012
+2012-03-16,29.116
+2012-03-17,29.115
+2012-03-18,29.171
+2012-03-19,29.175
+2012-03-20,29.206
+2012-03-21,29.238
+2012-03-22,29.254
+2012-03-23,29.245
+2012-03-24,29.228
+2012-03-25,29.279
+2012-03-26,29.144
+2012-03-27,29.203
+2012-03-28,29.279
+2012-03-29,29.19
+2012-03-30,29.189
+2012-03-31,29.185
+2012-04-01,29.188
+2012-04-02,29.132
+2012-04-03,29.142
+2012-04-04,29.115
+2012-04-05,29.099
+2012-04-06,29.078
+2012-04-07,29.074
+2012-04-08,29.076
+2012-04-09,29.089
+2012-04-10,29.08
+2012-04-11,29.057
+2012-04-12,29.05
+2012-04-13,29.066
+2012-04-14,29.065
+2012-04-15,29.059
+2012-04-16,29.084
+2012-04-17,29.038
+2012-04-18,29.003
+2012-04-19,29.035
+2012-04-20,28.958
+2012-04-21,28.938
+2012-04-22,28.872
+2012-04-23,28.91
+2012-04-24,29.192
+2012-04-25,29.131
+2012-04-26,29.135
+2012-04-27,29.097
+2012-04-28,29.12
+2012-04-29,29.112
+2012-04-30,29.13
+2012-05-01,29.158
+2012-05-02,29.138
+2012-05-03,29.166
+2012-05-04,29.15
+2012-05-05,29.105
+2012-05-06,29.128
+2012-05-07,29.146
+2012-05-08,29.261
+2012-05-09,29.185
+2012-05-10,29.196
+2012-05-11,29.196
+2012-05-12,29.23
+2012-05-13,29.227
+2012-05-14,29.241
+2012-05-15,29.257
+2012-05-16,29.267
+2012-05-17,29.252
+2012-05-18,29.272
+2012-05-19,29.266
+2012-05-20,29.26
+2012-05-21,29.271
+2012-05-22,29.234
+2012-05-23,29.214
+2012-05-24,29.266
+2012-05-25,29.315
+2012-05-26,29.184
+2012-05-27,29.154
+2012-05-28,29.123
+2012-05-29,29.166
+2012-05-30,29.169
+2012-05-31,29.142
+2012-06-01,29.146
+2012-06-02,29.17
+2012-06-03,29.139
+2012-06-04,29.096
+2012-06-05,29.111
+2012-06-06,29.122
+2012-06-07,29.123
+2012-06-08,29.129
+2012-06-09,29.114
+2012-06-10,29.107
+2012-06-11,29.134
+2012-06-12,29.207
+2012-06-13,29.074
+2012-06-14,29.025
+2012-06-15,29.03
+2012-06-16,29.028
+2012-06-17,29.075
+2012-06-18,29.087
+2012-06-19,29.052
+2012-06-20,28.977
+2012-06-21,28.959
+2012-06-22,28.938
+2012-06-23,28.89
+2012-06-24,28.907
+2012-06-25,28.908
+2012-06-26,28.878
+2012-06-27,28.876
+2012-06-28,28.896
+2012-06-29,28.929
+2012-06-30,28.913
+2012-07-01,28.873
+2012-07-02,28.865
+2012-07-03,28.864
+2012-07-04,28.875
+2012-07-05,28.85
+2012-07-06,28.878
+2012-07-07,28.85
+2012-07-08,28.818
+2012-07-09,28.812
+2012-07-10,28.822
+2012-07-11,28.81
+2012-07-12,28.811
+2012-07-13,28.798
+2012-07-14,28.797
+2012-07-15,28.779
+2012-07-16,28.761
+2012-07-17,28.767
+2012-07-18,28.725
+2012-07-19,28.717
+2012-07-20,28.709
+2012-07-21,28.722
+2012-07-22,28.747
+2012-07-23,28.75
+2012-07-24,28.694
+2012-07-25,28.698
+2012-07-26,28.719
+2012-07-27,28.696
+2012-07-28,28.674
+2012-07-29,28.683
+2012-07-30,28.715
+2012-07-31,28.757
+2012-08-01,28.699
+2012-08-02,28.688
+2012-08-03,28.669
+2012-08-04,28.672
+2012-08-05,28.786
+2012-08-06,28.643
+2012-08-07,28.657
+2012-08-08,28.631
+2012-08-09,28.601
+2012-08-10,28.626
+2012-08-11,28.657
+2012-08-12,28.66
+2012-08-13,28.66
+2012-08-14,28.659
+2012-08-15,28.642
+2012-08-16,28.63
+2012-08-17,28.661
+2012-08-18,28.625
+2012-08-19,28.618
+2012-08-20,28.616
+2012-08-21,28.598
+2012-08-22,28.606
+2012-08-23,28.598
+2012-08-24,28.574
+2012-08-25,28.587
+2012-08-26,28.604
+2012-08-27,28.607
+2012-08-28,28.52
+2012-08-29,28.524
+2012-08-30,28.301
+2012-08-31,28.544
+2012-09-01,28.477
+2012-09-02,28.487
+2012-09-03,28.507
+2012-09-04,28.544
+2012-09-05,28.522
+2012-09-06,28.6
+2012-09-07,28.614
+2012-09-08,28.736
+2012-09-09,28.604
+2012-09-10,28.572
+2012-09-11,28.599
+2012-09-12,28.648
+2012-09-13,28.623
+2012-09-14,28.613
+2012-09-15,28.555
+2012-09-16,28.553
+2012-09-17,28.587
+2012-09-18,28.624
+2012-09-19,28.564
+2012-09-20,28.61
+2012-09-21,28.652
+2012-09-22,28.66
+2012-09-23,28.586
+2012-09-24,28.59
+2012-09-25,28.649
+2012-09-26,28.62
+2012-09-27,28.537
+2012-09-28,28.563
+2012-09-29,28.516
+2012-09-30,28.534
+2012-10-01,28.582
+2012-10-02,28.59
+2012-10-03,28.581
+2012-10-04,28.598
+2012-10-05,28.637
+2012-10-06,28.632
+2012-10-07,28.638
+2012-10-08,28.646
+2012-10-09,28.68
+2012-10-10,28.703
+2012-10-11,28.663
+2012-10-12,28.627
+2012-10-13,28.651
+2012-10-14,28.735
+2012-10-15,28.721
+2012-10-16,28.647
+2012-10-17,28.656
+2012-10-18,28.689
+2012-10-19,28.666
+2012-10-20,28.751
+2012-10-21,28.836
+2012-10-22,28.814
+2012-10-23,28.831
+2012-10-24,28.825
+2012-10-25,28.871
+2012-10-26,28.922
+2012-10-27,28.85
+2012-10-28,28.823
+2012-10-29,28.72
+2012-10-30,28.814
+2012-10-31,28.907
+2012-11-01,28.922
+2012-11-02,28.895
+2012-11-03,28.881
+2012-11-04,28.873
+2012-11-05,28.871
+2012-11-06,28.881
+2012-11-07,28.825
+2012-11-08,28.779
+2012-11-09,28.861
+2012-11-10,28.846
+2012-11-11,28.886
+2012-11-12,29.004
+2012-11-13,28.858
+2012-11-14,28.835
+2012-11-15,28.838
+2012-11-16,28.846
+2012-11-17,28.826
+2012-11-18,28.832
+2012-11-19,28.829
+2012-11-20,28.816
+2012-11-21,28.814
+2012-11-22,28.839
+2012-11-23,28.88
+2012-11-24,28.802
+2012-11-25,28.778
+2012-11-26,28.766
+2012-11-27,28.759
+2012-11-28,28.772
+2012-11-29,28.735
+2012-11-30,28.702
+2012-12-01,28.724
+2012-12-02,28.886
+2012-12-03,28.713
+2012-12-04,28.842
+2012-12-05,28.721
+2012-12-06,28.759
+2012-12-07,28.861
+2012-12-08,28.777
+2012-12-09,28.761
+2012-12-10,28.827
+2012-12-11,28.786
+2012-12-12,28.846
+2012-12-13,28.862
+2012-12-14,28.878
+2012-12-15,28.789
+2012-12-16,28.845
+2012-12-17,28.902
+2012-12-18,28.834
+2012-12-19,28.861
+2012-12-20,28.885
+2012-12-21,28.909
+2012-12-22,28.982
+2012-12-23,28.942
+2012-12-24,28.942
+2012-12-25,28.923
+2012-12-26,28.919
+2012-12-27,28.836
+2012-12-28,28.901
+2012-12-29,28.917
+2012-12-30,28.916
+2012-12-31,28.96
+2013-01-01,28.932
+2013-01-02,28.926
+2013-01-03,28.92
+2013-01-04,28.909
+2013-01-05,28.882
+2013-01-06,28.881
+2013-01-07,28.865
+2013-01-08,28.892
+2013-01-09,28.889
+2013-01-10,28.876
+2013-01-11,28.89
+2013-01-12,28.905
+2013-01-13,28.95
+2013-01-14,28.982
+2013-01-15,28.982
+2013-01-16,29.025
+2013-01-17,28.992
+2013-01-18,28.971
+2013-01-19,29.016
+2013-01-20,29.021
+2013-01-21,28.964
+2013-01-22,28.94
+2013-01-23,28.978
+2013-01-24,28.987
+2013-01-25,28.974
+2013-01-26,28.901
+2013-01-27,28.885
+2013-01-28,28.877
+2013-01-29,28.871
+2013-01-30,28.938
+2013-01-31,28.968
+2013-02-01,28.968
+2013-02-02,28.949
+2013-02-03,28.958
+2013-02-04,28.991
+2013-02-05,28.976
+2013-02-06,28.961
+2013-02-07,28.95
+2013-02-08,28.917
+2013-02-09,28.913
+2013-02-10,28.949
+2013-02-11,28.949
+2013-02-12,28.935
+2013-02-13,28.922
+2013-02-14,28.919
+2013-02-15,28.947
+2013-02-16,28.909
+2013-02-17,28.888
+2013-02-18,28.876
+2013-02-19,28.869
+2013-02-20,28.883
+2013-02-21,28.866
+2013-02-22,28.852
+2013-02-23,28.866
+2013-02-24,28.849
+2013-02-25,28.847
+2013-02-26,28.842
+2013-02-27,28.813
+2013-02-28,28.827
+2013-03-01,28.827
+2013-03-02,28.839
+2013-03-03,28.848
+2013-03-04,28.845
+2013-03-05,28.827
+2013-03-06,28.788
+2013-03-07,28.765
+2013-03-08,28.771
+2013-03-09,28.805
+2013-03-10,28.854
+2013-03-11,28.946
+2013-03-12,28.915
+2013-03-13,28.961
+2013-03-14,29.038
+2013-03-15,29.079
+2013-03-16,29.064
+2013-03-17,29.077
+2013-03-18,29.075
+2013-03-19,29.101
+2013-03-20,29.098
+2013-03-21,29.107
+2013-03-22,29.079
+2013-03-23,29.066
+2013-03-24,29.049
+2013-03-25,29.015
+2013-03-26,29.023
+2013-03-27,29.042
+2013-03-28,29.047
+2013-03-29,29.049
+2013-03-30,29.043
+2013-03-31,29.115
+2013-04-01,29.107
+2013-04-02,29.067
+2013-04-03,29.055
+2013-04-04,29.091
+2013-04-05,29.044
+2013-04-06,29.022
+2013-04-07,29.217
+2013-04-08,29.023
+2013-04-09,29.041
+2013-04-10,29.063
+2013-04-11,29.033
+2013-04-12,29.108
+2013-04-13,29.185
+2013-04-14,29.171
+2013-04-15,29.189
+2013-04-16,29.33
+2013-04-17,29.193
+2013-04-18,29.364
+2013-04-19,29.453
+2013-04-20,29.32
+2013-04-21,29.307
+2013-04-22,29.356
+2013-04-23,29.38
+2013-04-24,29.385
+2013-04-25,29.351
+2013-04-26,29.332
+2013-04-27,29.332
+2013-04-28,29.326
+2013-04-29,29.346
+2013-04-30,29.333
+2013-05-01,29.298
+2013-05-02,29.278
+2013-05-03,29.276
+2013-05-04,29.256
+2013-05-05,29.256
+2013-05-06,29.244
+2013-05-07,29.218
+2013-05-08,29.21
+2013-05-09,29.182
+2013-05-10,29.138
+2013-05-11,29.176
+2013-05-12,29.15
+2013-05-13,29.147
+2013-05-14,29.09
+2013-05-15,29.162
+2013-05-16,29.049
+2013-05-17,29.038
+2013-05-18,29.036
+2013-05-19,29.064
+2013-05-20,29.038
+2013-05-21,28.964
+2013-05-22,29.018
+2013-05-23,29.071
+2013-05-24,29.021
+2013-05-25,29.044
+2013-05-26,29.263
+2013-05-27,29.442
+2013-05-28,29.496
+2013-05-29,29.541
+2013-05-30,29.524
+2013-05-31,29.534
+2013-06-01,29.525
+2013-06-02,29.535
+2013-06-03,29.513
+2013-06-04,29.493
+2013-06-05,29.479
+2013-06-06,29.455
+2013-06-07,29.468
+2013-06-08,29.458
+2013-06-09,29.472
+2013-06-10,29.475
+2013-06-11,29.469
+2013-06-12,29.528
+2013-06-13,29.623
+2013-06-14,29.628
+2013-06-15,29.642
+2013-06-16,29.64
+2013-06-17,29.624
+2013-06-18,29.612
+2013-06-19,29.586
+2013-06-20,29.587
+2013-06-21,29.57
+2013-06-22,29.537
+2013-06-23,29.526
+2013-06-24,29.529
+2013-06-25,29.541
+2013-06-26,29.546
+2013-06-27,29.541
+2013-06-28,29.549
+2013-06-29,29.623
+2013-06-30,29.661
+2013-07-01,29.65
+2013-07-02,29.678
+2013-07-03,29.708
+2013-07-04,29.744
+2013-07-05,29.773
+2013-07-06,29.789
+2013-07-07,29.791
+2013-07-08,29.761
+2013-07-09,29.765
+2013-07-10,29.808
+2013-07-11,29.75
+2013-07-12,29.721
+2013-07-13,29.725
+2013-07-14,29.712
+2013-07-15,29.689
+2013-07-16,29.658
+2013-07-17,29.649
+2013-07-18,29.614
+2013-07-19,29.627
+2013-07-20,29.585
+2013-07-21,29.523
+2013-07-22,29.513
+2013-07-23,29.513
+2013-07-24,29.487
+2013-07-25,29.459
+2013-07-26,29.433
+2013-07-27,29.433
+2013-07-28,29.447
+2013-07-29,29.398
+2013-07-30,29.386
+2013-07-31,29.375
+2013-08-01,29.394
+2013-08-02,29.353
+2013-08-03,29.327
+2013-08-04,29.291
+2013-08-05,29.265
+2013-08-06,29.273
+2013-08-07,29.298
+2013-08-08,29.273
+2013-08-09,29.227
+2013-08-10,29.206
+2013-08-11,29.203
+2013-08-12,29.198
+2013-08-13,29.184
+2013-08-14,29.155
+2013-08-15,29.157
+2013-08-16,29.139
+2013-08-17,29.108
+2013-08-18,29.109
+2013-08-19,29.091
+2013-08-20,29.083
+2013-08-21,29.073
+2013-08-22,29.059
+2013-08-23,29.004
+2013-08-24,29.009
+2013-08-25,29.015
+2013-08-26,29.018
+2013-08-27,28.986
+2013-08-28,28.965
+2013-08-29,28.942
+2013-08-30,28.956
+2013-08-31,28.937
+2013-09-01,28.915
+2013-09-02,28.914
+2013-09-03,28.934
+2013-09-04,28.919
+2013-09-05,28.881
+2013-09-06,28.899
+2013-09-07,28.923
+2013-09-08,28.838
+2013-09-09,28.882
+2013-09-10,28.899
+2013-09-11,28.879
+2013-09-12,28.889
+2013-09-13,28.86
+2013-09-14,28.887
+2013-09-15,28.938
+2013-09-16,28.866
+2013-09-17,28.904
+2013-09-18,28.913
+2013-09-19,28.908
+2013-09-20,28.917
+2013-09-21,29.021
+2013-09-22,28.882
+2013-09-23,28.861
+2013-09-24,28.847
+2013-09-25,28.836
+2013-09-26,28.837
+2013-09-27,28.836
+2013-09-28,28.837
+2013-09-29,28.84
+2013-09-30,28.829
+2013-10-01,28.818
+2013-10-02,28.816
+2013-10-03,28.794
+2013-10-04,28.764
+2013-10-05,28.743
+2013-10-06,28.778
+2013-10-07,28.908
+2013-10-08,28.773
+2013-10-09,28.785
+2013-10-10,28.779
+2013-10-11,28.765
+2013-10-12,28.768
+2013-10-13,28.8
+2013-10-14,28.799
+2013-10-15,28.744
+2013-10-16,28.842
+2013-10-17,28.75
+2013-10-18,28.743
+2013-10-19,28.772
+2013-10-20,28.757
+2013-10-21,28.751
+2013-10-22,28.766
+2013-10-23,28.708
+2013-10-24,28.705
+2013-10-25,28.683
+2013-10-26,28.761
+2013-10-27,28.686
+2013-10-28,28.648
+2013-10-29,28.646
+2013-10-30,28.649
+2013-10-31,28.761
+2013-11-01,28.806
+2013-11-02,28.615
+2013-11-03,28.623
+2013-11-04,28.671
+2013-11-05,28.766
+2013-11-06,28.811
+2013-11-07,28.723
+2013-11-08,28.679
+2013-11-09,28.689
+2013-11-10,28.728
+2013-11-11,28.717
+2013-11-12,28.672
+2013-11-13,28.711
+2013-11-14,28.734
+2013-11-15,28.719
+2013-11-16,28.688
+2013-11-17,28.759
+2013-11-18,28.767
+2013-11-19,28.671
+2013-11-20,28.698
+2013-11-21,28.745
+2013-11-22,28.725
+2013-11-23,28.685
+2013-11-24,28.646
+2013-11-25,28.743
+2013-11-26,28.756
+2013-11-27,28.698
+2013-11-28,28.739
+2013-11-29,28.735
+2013-11-30,28.764
+2013-12-01,28.757
+2013-12-02,28.739
+2013-12-03,28.746
+2013-12-04,28.755
+2013-12-05,28.851
+2013-12-06,28.78
+2013-12-07,28.785
+2013-12-08,28.803
+2013-12-09,28.885
+2013-12-10,28.808
+2013-12-11,28.801
+2013-12-12,28.783
+2013-12-13,28.767
+2013-12-14,28.759
+2013-12-15,28.739
+2013-12-16,28.753
+2013-12-17,28.76
+2013-12-18,28.735
+2013-12-19,28.731
+2013-12-20,28.717
+2013-12-21,28.717
+2013-12-22,28.736
+2013-12-23,28.762
+2013-12-24,28.794
+2013-12-25,28.834
+2013-12-26,28.836
+2013-12-27,28.835
+2013-12-28,28.857
+2013-12-29,28.835
+2013-12-30,28.837
+2013-12-31,28.838
+2014-01-01,28.831
+2014-01-02,28.854
+2014-01-03,28.865
+2014-01-04,28.934
+2014-01-05,28.914
+2014-01-06,28.841
+2014-01-07,28.873
+2014-01-08,28.869
+2014-01-09,28.859
+2014-01-10,28.868
+2014-01-11,28.874
+2014-01-12,28.919
+2014-01-13,29.006
+2014-01-14,29.032
+2014-01-15,29.077
+2014-01-16,29.114
+2014-01-17,29.166
+2014-01-18,29.164
+2014-01-19,29.19
+2014-01-20,29.129
+2014-01-21,29.118
+2014-01-22,29.113
+2014-01-23,29.146
+2014-01-24,29.153
+2014-01-25,29.148
+2014-01-26,29.123
+2014-01-27,29.088
+2014-01-28,29.073
+2014-01-29,29.068
+2014-01-30,29.05
+2014-01-31,29.037
+2014-02-01,29.012
+2014-02-02,29.01
+2014-02-03,28.99
+2014-02-04,28.982
+2014-02-05,28.963
+2014-02-06,28.968
+2014-02-07,28.977
+2014-02-08,28.965
+2014-02-09,28.934
+2014-02-10,28.927
+2014-02-11,28.927
+2014-02-12,28.914
+2014-02-13,28.9
+2014-02-14,28.879
+2014-02-15,28.879
+2014-02-16,28.892
+2014-02-17,28.902
+2014-02-18,28.87
+2014-02-19,28.856
+2014-02-20,28.843
+2014-02-21,28.847
+2014-02-22,28.873
+2014-02-23,28.853
+2014-02-24,28.857
+2014-02-25,28.849
+2014-02-26,28.852
+2014-02-27,28.852
+2014-02-28,28.846
+2014-03-01,28.837
+2014-03-02,28.815
+2014-03-03,28.824
+2014-03-04,28.815
+2014-03-05,28.787
+2014-03-06,28.786
+2014-03-07,28.789
+2014-03-08,28.775
+2014-03-09,28.765
+2014-03-10,28.772
+2014-03-11,28.773
+2014-03-12,28.682
+2014-03-13,28.702
+2014-03-14,28.775
+2014-03-15,28.753
+2014-03-16,28.769
+2014-03-17,28.744
+2014-03-18,28.732
+2014-03-19,28.746
+2014-03-20,28.753
+2014-03-21,28.74
+2014-03-22,28.737
+2014-03-23,28.721
+2014-03-24,28.72
+2014-03-25,28.741
+2014-03-26,28.71
+2014-03-27,28.715
+2014-03-28,28.809
+2014-03-29,28.677
+2014-03-30,28.602
+2014-03-31,28.738
+2014-04-01,28.82
+2014-04-02,28.883
+2014-04-03,28.923
+2014-04-04,28.975
+2014-04-05,29.098
+2014-04-06,29.088
+2014-04-07,29.142
+2014-04-08,29.231
+2014-04-09,29.288
+2014-04-10,29.447
+2014-04-11,29.428
+2014-04-12,29.489
+2014-04-13,29.546
+2014-04-14,29.676
+2014-04-15,29.757
+2014-04-16,29.854
+2014-04-17,29.982
+2014-04-18,30.067
+2014-04-19,30.032
+2014-04-20,30.043
+2014-04-21,30.064
+2014-04-22,30.03
+2014-04-23,30.001
+2014-04-24,29.991
+2014-04-25,30.002
+2014-04-26,30.004
+2014-04-27,29.967
+2014-04-28,29.952
+2014-04-29,29.961
+2014-04-30,29.981
+2014-05-01,29.998
+2014-05-02,29.985
+2014-05-03,29.977
+2014-05-04,29.965
+2014-05-05,29.955
+2014-05-06,29.953
+2014-05-07,29.947
+2014-05-08,29.918
+2014-05-09,29.941
+2014-05-10,29.95
+2014-05-11,29.889
+2014-05-12,29.842
+2014-05-13,29.819
+2014-05-14,29.857
+2014-05-15,29.901
+2014-05-16,29.79
+2014-05-17,29.785
+2014-05-18,29.789
+2014-05-19,29.771
+2014-05-20,29.754
+2014-05-21,29.74
+2014-05-22,29.721
+2014-05-23,29.706
+2014-05-24,29.711
+2014-05-25,29.714
+2014-05-26,29.704
+2014-05-27,29.651
+2014-05-28,29.659
+2014-05-29,29.661
+2014-05-30,29.64
+2014-05-31,29.603
+2014-06-01,29.614
+2014-06-02,29.613
+2014-06-03,29.588
+2014-06-04,29.566
+2014-06-05,29.526
+2014-06-06,29.512
+2014-06-07,29.491
+2014-06-08,29.473
+2014-06-09,29.427
+2014-06-10,29.397
+2014-06-11,29.415
+2014-06-12,29.445
+2014-06-13,29.441
+2014-06-14,29.438
+2014-06-15,29.423
+2014-06-16,29.433
+2014-06-17,29.424
+2014-06-18,29.41
+2014-06-19,29.382
+2014-06-20,29.354
+2014-06-21,29.36
+2014-06-22,29.347
+2014-06-23,29.34
+2014-06-24,29.373
+2014-06-25,29.308
+2014-06-26,29.286
+2014-06-27,29.321
+2014-06-28,29.316
+2014-06-29,29.322
+2014-06-30,29.314
+2014-07-01,29.317
+2014-07-02,29.268
+2014-07-03,29.222
+2014-07-04,29.214
+2014-07-05,29.2
+2014-07-06,29.224
+2014-07-07,29.231
+2014-07-08,29.222
+2014-07-09,29.202
+2014-07-10,29.16
+2014-07-11,29.147
+2014-07-12,29.132
+2014-07-13,29.18
+2014-07-14,29.106
+2014-07-15,29.081
+2014-07-16,29.073
+2014-07-17,29.064
+2014-07-18,29.053
+2014-07-19,29.039
+2014-07-20,29.033
+2014-07-21,29.021
+2014-07-22,28.997
+2014-07-23,28.986
+2014-07-24,28.939
+2014-07-25,28.964
+2014-07-26,28.968
+2014-07-27,28.974
+2014-07-28,28.884
+2014-07-29,28.95
+2014-07-30,28.981
+2014-07-31,28.992
+2014-08-01,28.986
+2014-08-02,28.973
+2014-08-03,28.957
+2014-08-04,28.957
+2014-08-05,28.946
+2014-08-06,28.928
+2014-08-07,28.927
+2014-08-08,28.925
+2014-08-09,28.923
+2014-08-10,28.92
+2014-08-11,28.911
+2014-08-12,28.928
+2014-08-13,28.934
+2014-08-14,28.929
+2014-08-15,28.922
+2014-08-16,28.952
+2014-08-17,28.913
+2014-08-18,28.886
+2014-08-19,28.888
+2014-08-20,28.887
+2014-08-21,28.886
+2014-08-22,28.882
+2014-08-23,28.861
+2014-08-24,28.861
+2014-08-25,28.865
+2014-08-26,28.875
+2014-08-27,28.843
+2014-08-28,28.805
+2014-08-29,28.801
+2014-08-30,28.886
+2014-08-31,28.877
+2014-09-01,28.792
+2014-09-02,28.797
+2014-09-03,28.78
+2014-09-04,28.797
+2014-09-05,28.82
+2014-09-06,28.776
+2014-09-07,28.747
+2014-09-08,28.752
+2014-09-09,28.776
+2014-09-10,28.764
+2014-09-11,28.861
+2014-09-12,28.684
+2014-09-13,28.711
+2014-09-14,28.667
+2014-09-15,28.688
+2014-09-16,28.677
+2014-09-17,28.678
+2014-09-18,28.618
+2014-09-19,28.638
+2014-09-20,28.81
+2014-09-21,28.724
+2014-09-22,28.628
+2014-09-23,28.616
+2014-09-24,28.609
+2014-09-25,28.619
+2014-09-26,28.602
+2014-09-27,28.597
+2014-09-28,28.598
+2014-09-29,28.552
+2014-09-30,28.543
+2014-10-01,28.54
+2014-10-02,28.548
+2014-10-03,28.587
+2014-10-04,28.612
+2014-10-05,28.574
+2014-10-06,28.613
+2014-10-07,28.628
+2014-10-08,28.601
+2014-10-09,28.574
+2014-10-10,28.557
+2014-10-11,28.539
+2014-10-12,28.535
+2014-10-13,28.591
+2014-10-14,28.637
+2014-10-15,28.569
+2014-10-16,28.532
+2014-10-17,28.559
+2014-10-18,28.559
+2014-10-19,28.52
+2014-10-20,28.556
+2014-10-21,28.497
+2014-10-22,28.428
+2014-10-23,28.416
+2014-10-24,28.513
+2014-10-25,28.618
+2014-10-26,28.599
+2014-10-27,28.594
+2014-10-28,28.63
+2014-10-29,28.635
+2014-10-30,28.611
+2014-10-31,28.59
+2014-11-01,28.517
+2014-11-02,28.476
+2014-11-03,28.59
+2014-11-04,28.63
+2014-11-05,28.625
+2014-11-06,28.57
+2014-11-07,28.514
+2014-11-08,28.607
+2014-11-09,28.626
+2014-11-10,28.605
+2014-11-11,28.65
+2014-11-12,28.617
+2014-11-13,28.582
+2014-11-14,28.567
+2014-11-15,28.57
+2014-11-16,28.614
+2014-11-17,28.555
+2014-11-18,28.622
+2014-11-19,28.574
+2014-11-20,28.626
+2014-11-21,28.539
+2014-11-22,28.645
+2014-11-23,28.541
+2014-11-24,28.597
+2014-11-25,28.595
+2014-11-26,28.545
+2014-11-27,28.552
+2014-11-28,28.59
+2014-11-29,28.658
+2014-11-30,28.82
+2014-12-01,28.583
+2014-12-02,28.543
+2014-12-03,28.685
+2014-12-04,28.579
+2014-12-05,28.603
+2014-12-06,28.609
+2014-12-07,28.552
+2014-12-08,28.619
+2014-12-09,28.581
+2014-12-10,28.485
+2014-12-11,28.619
+2014-12-12,28.643
+2014-12-13,28.646
+2014-12-14,28.653
+2014-12-15,28.653
+2014-12-16,28.663
+2014-12-17,28.665
+2014-12-18,28.668
+2014-12-19,28.677
+2014-12-20,28.691
+2014-12-21,28.685
+2014-12-22,28.687
+2014-12-23,28.705
+2014-12-24,28.764
+2014-12-25,28.891
+2014-12-26,28.953
+2014-12-27,29.013
+2014-12-28,29.056
+2014-12-29,29.046
+2014-12-30,29.062
+2014-12-31,29.073
+2015-01-01,29.127
+2015-01-02,29.04
+2015-01-03,29.073
+2015-01-04,29.046
+2015-01-05,29.052
+2015-01-06,29.071
+2015-01-07,29.019
+2015-01-08,29.043
+2015-01-09,29.047
+2015-01-10,29.035
+2015-01-11,29.027
+2015-01-12,28.988
+2015-01-13,28.997
+2015-01-14,28.96
+2015-01-15,28.947
+2015-01-16,28.941
+2015-01-17,28.96
+2015-01-18,28.948
+2015-01-19,28.909
+2015-01-20,28.937
+2015-01-21,28.915
+2015-01-22,28.881
+2015-01-23,28.888
+2015-01-24,28.871
+2015-01-25,28.865
+2015-01-26,28.857
+2015-01-27,28.842
+2015-01-28,28.84
+2015-01-29,28.826
+2015-01-30,28.819
+2015-01-31,28.844
+2015-02-01,28.826
+2015-02-02,28.818
+2015-02-03,28.83
+2015-02-04,28.796
+2015-02-05,28.777
+2015-02-06,28.793
+2015-02-07,28.76
+2015-02-08,28.748
+2015-02-09,28.762
+2015-02-10,28.763
+2015-02-11,28.752
+2015-02-12,28.737
+2015-02-13,28.746
+2015-02-14,28.743
+2015-02-15,28.748
+2015-02-16,28.779
+2015-02-17,28.761
+2015-02-18,28.723
+2015-02-19,28.714
+2015-02-20,28.733
+2015-02-21,28.727
+2015-02-22,28.701
+2015-02-23,28.7
+2015-02-24,28.717
+2015-02-25,28.715
+2015-02-26,28.686
+2015-02-27,28.682
+2015-02-28,28.678
+2015-03-01,28.664
+2015-03-02,28.656
+2015-03-03,28.652
+2015-03-04,28.65
+2015-03-05,28.637
+2015-03-06,28.643
+2015-03-07,28.634
+2015-03-08,28.624
+2015-03-09,28.621
+2015-03-10,28.624
+2015-03-11,28.628
+2015-03-12,28.613
+2015-03-13,28.624
+2015-03-14,28.622
+2015-03-15,28.609
+2015-03-16,28.635
+2015-03-17,28.626
+2015-03-18,28.628
+2015-03-19,28.631
+2015-03-20,28.657
+2015-03-21,28.662
+2015-03-22,28.615
+2015-03-23,28.618
+2015-03-24,28.616
+2015-03-25,28.661
+2015-03-26,28.658
+2015-03-27,28.645
+2015-03-28,28.649
+2015-03-29,28.705
+2015-03-30,28.773
+2015-03-31,28.685
+2015-04-01,28.69
+2015-04-02,28.751
+2015-04-03,28.725
+2015-04-04,28.724
+2015-04-05,28.812
+2015-04-06,28.852
+2015-04-07,28.848
+2015-04-08,28.865
+2015-04-09,28.92
+2015-04-10,29.104
+2015-04-11,28.978
+2015-04-12,29.006
+2015-04-13,29.082
+2015-04-14,29.087
+2015-04-15,29.122
+2015-04-16,29.195
+2015-04-17,29.24
+2015-04-18,29.222
+2015-04-19,29.258
+2015-04-20,29.347
+2015-04-21,29.342
+2015-04-22,29.384
+2015-04-23,29.407
+2015-04-24,29.405
+2015-04-25,29.426
+2015-04-26,29.425
+2015-04-27,29.412
+2015-04-28,29.404
+2015-04-29,29.411
+2015-04-30,29.405
+2015-05-01,29.406
+2015-05-02,29.412
+2015-05-03,29.404
+2015-05-04,29.407
+2015-05-05,29.368
+2015-05-06,29.367
+2015-05-07,29.355
+2015-05-08,29.338
+2015-05-09,29.357
+2015-05-10,29.307
+2015-05-11,29.255
+2015-05-12,29.328
+2015-05-13,29.278
+2015-05-14,29.302
+2015-05-15,29.31
+2015-05-16,29.299
+2015-05-17,29.27
+2015-05-18,29.294
+2015-05-19,29.311
+2015-05-20,29.211
+2015-05-21,29.241
+2015-05-22,29.157
+2015-05-23,29.172
+2015-05-24,29.174
+2015-05-25,29.139
+2015-05-26,29.135
+2015-05-27,29.129
+2015-05-28,29.102
+2015-05-29,29.08
+2015-05-30,29.139
+2015-05-31,28.997
+2015-06-01,29.083
+2015-06-02,29.138
+2015-06-03,29.184
+2015-06-04,29.218
+2015-06-05,29.244
+2015-06-06,29.137
+2015-06-07,29.219
+2015-06-08,29.339
+2015-06-09,29.192
+2015-06-10,29.275
+2015-06-11,29.328
+2015-06-12,29.331
+2015-06-13,29.365
+2015-06-14,29.396
+2015-06-15,29.451
+2015-06-16,29.457
+2015-06-17,29.436
+2015-06-18,29.489
+2015-06-19,29.42
+2015-06-20,29.464
+2015-06-21,29.458
+2015-06-22,29.46
+2015-06-23,29.549
+2015-06-24,29.518
+2015-06-25,29.525
+2015-06-26,29.514
+2015-06-27,29.513
+2015-06-28,29.506
+2015-06-29,29.522
+2015-06-30,29.546
+2015-07-01,29.554
+2015-07-02,29.562
+2015-07-03,29.556
+2015-07-04,29.556
+2015-07-05,29.551
+2015-07-06,29.537
+2015-07-07,29.559
+2015-07-08,29.484
+2015-07-09,29.472
+2015-07-10,29.446
+2015-07-11,29.439
+2015-07-12,29.416
+2015-07-13,29.393
+2015-07-14,29.399
+2015-07-15,29.287
+2015-07-16,29.302
+2015-07-17,29.306
+2015-07-18,29.32
+2015-07-19,29.306
+2015-07-20,29.294
+2015-07-21,29.304
+2015-07-22,29.295
+2015-07-23,29.279
+2015-07-24,29.264
+2015-07-25,29.26
+2015-07-26,29.258
+2015-07-27,29.246
+2015-07-28,29.234
+2015-07-29,29.218
+2015-07-30,29.217
+2015-07-31,29.19
+2015-08-01,29.166
+2015-08-02,29.173
+2015-08-03,29.174
+2015-08-04,29.126
+2015-08-05,29.098
+2015-08-06,29.074
+2015-08-07,29.056
+2015-08-08,29.042
+2015-08-09,29.024
+2015-08-10,29.034
+2015-08-11,29.084
+2015-08-12,29.044
+2015-08-13,29.033
+2015-08-14,29.061
+2015-08-15,29.036
+2015-08-16,29.032
+2015-08-17,29.029
+2015-08-18,29.013
+2015-08-19,29.014
+2015-08-20,29.055
+2015-08-21,28.991
+2015-08-22,28.95
+2015-08-23,28.932
+2015-08-24,28.959
+2015-08-25,28.92
+2015-08-26,28.902
+2015-08-27,28.895
+2015-08-28,28.884
+2015-08-29,28.881
+2015-08-30,28.866
+2015-08-31,28.854
+2015-09-01,28.841
+2015-09-02,28.839
+2015-09-03,28.809
+2015-09-04,28.786
+2015-09-05,28.799
+2015-09-06,28.82
+2015-09-07,28.818
+2015-09-08,28.781
+2015-09-09,28.805
+2015-09-10,28.763
+2015-09-11,28.743
+2015-09-12,28.723
+2015-09-13,28.745
+2015-09-14,28.758
+2015-09-15,28.753
+2015-09-16,28.756
+2015-09-17,28.758
+2015-09-18,28.758
+2015-09-19,28.811
+2015-09-20,28.701
+2015-09-21,28.698
+2015-09-22,28.708
+2015-09-23,28.7
+2015-09-24,28.643
+2015-09-25,28.636
+2015-09-26,28.648
+2015-09-27,28.706
+2015-09-28,28.723
+2015-09-29,28.664
+2015-09-30,28.547
+2015-10-01,28.631
+2015-10-02,28.627
+2015-10-03,28.651
+2015-10-04,28.707
+2015-10-05,28.729
+2015-10-06,28.714
+2015-10-07,28.712
+2015-10-08,28.69
+2015-10-09,28.69
+2015-10-10,28.696
+2015-10-11,28.756
+2015-10-12,28.739
+2015-10-13,28.735
+2015-10-14,28.695
+2015-10-15,28.715
+2015-10-16,28.682
+2015-10-17,28.651
+2015-10-18,28.648
+2015-10-19,28.709
+2015-10-20,28.716
+2015-10-21,28.615
+2015-10-22,28.673
+2015-10-23,28.593
+2015-10-24,28.786
+2015-10-25,28.724
+2015-10-26,28.595
+2015-10-27,28.609
+2015-10-28,28.648
+2015-10-29,28.697
+2015-10-30,28.689
+2015-10-31,28.709
+2015-11-01,28.778
+2015-11-02,28.715
+2015-11-03,28.721
+2015-11-04,28.717
+2015-11-05,28.73
+2015-11-06,28.789
+2015-11-07,28.708
+2015-11-08,28.699
+2015-11-09,28.724
+2015-11-10,28.681
+2015-11-11,28.674
+2015-11-12,28.756
+2015-11-13,28.714
+2015-11-14,28.666
+2015-11-15,28.703
+2015-11-16,28.664
+2015-11-17,28.685
+2015-11-18,28.788
+2015-11-19,28.882
+2015-11-20,28.704
+2015-11-21,28.703
+2015-11-22,28.776
+2015-11-23,28.675
+2015-11-24,28.692
+2015-11-25,28.717
+2015-11-26,28.909
+2015-11-27,28.777
+2015-11-28,28.635
+2015-11-29,28.659
+2015-11-30,28.66
+2015-12-01,28.705
+2015-12-02,28.715
+2015-12-03,28.706
+2015-12-04,28.759
+2015-12-05,28.768
+2015-12-06,28.793
+2015-12-07,28.773
+2015-12-08,28.764
+2015-12-09,28.83
+2015-12-10,28.815
+2015-12-11,28.83
+2015-12-12,28.764
+2015-12-13,28.738
+2015-12-14,28.781
+2015-12-15,28.746
+2015-12-16,28.74
+2015-12-17,28.847
+2015-12-18,28.783
+2015-12-19,28.805
+2015-12-20,28.788
+2015-12-21,28.904
+2015-12-22,28.801
+2015-12-23,28.819
+2015-12-24,28.912
+2015-12-25,28.862
+2015-12-26,28.869
+2015-12-27,28.85
+2015-12-28,28.829
+2015-12-29,28.896
+2015-12-30,28.942
+2015-12-31,28.964
+2016-01-01,28.983
+2016-01-02,29.01
+2016-01-03,29.003
+2016-01-04,28.907
+2016-01-05,28.942
+2016-01-06,28.966
+2016-01-07,28.928
+2016-01-08,28.92
+2016-01-09,29.01
+2016-01-10,28.962
+2016-01-11,29.03
+2016-01-12,29.047
+2016-01-13,28.979
+2016-01-14,28.979
+2016-01-15,28.968
+2016-01-16,28.999
+2016-01-17,28.975
+2016-01-18,28.98
+2016-01-19,29.003
+2016-01-20,29.017
+2016-01-21,28.966
+2016-01-22,28.95
+2016-01-23,28.914
+2016-01-24,28.912
+2016-01-25,28.906
+2016-01-26,28.942
+2016-01-27,28.889
+2016-01-28,28.905
+2016-01-29,28.882
+2016-01-30,28.897
+2016-01-31,28.895
+2016-02-01,28.897
+2016-02-02,28.86
+2016-02-03,29.005
+2016-02-04,28.941
+2016-02-05,28.931
+2016-02-06,28.999
+2016-02-07,28.931
+2016-02-08,28.907
+2016-02-09,28.942
+2016-02-10,28.938
+2016-02-11,28.933
+2016-02-12,28.928
+2016-02-13,28.89
+2016-02-14,28.894
+2016-02-15,28.88
+2016-02-16,28.866
+2016-02-17,28.88
+2016-02-18,28.891
+2016-02-19,28.914
+2016-02-20,28.947
+2016-02-21,28.911
+2016-02-22,28.91
+2016-02-23,28.914
+2016-02-24,28.925
+2016-02-25,29.065
+2016-02-26,29.166
+2016-02-27,29.26
+2016-02-28,29.226
+2016-02-29,29.291
+2016-03-01,29.283
+2016-03-02,29.308
+2016-03-03,29.31
+2016-03-04,29.287
+2016-03-05,29.294
+2016-03-06,29.304
+2016-03-07,29.33
+2016-03-08,29.272
+2016-03-09,29.308
+2016-03-10,29.276
+2016-03-11,29.316
+2016-03-12,29.392
+2016-03-13,29.366
+2016-03-14,29.417
+2016-03-15,29.438
+2016-03-16,29.386
+2016-03-17,29.435
+2016-03-18,29.415
+2016-03-19,29.43
+2016-03-20,29.431
+2016-03-21,29.433
+2016-03-22,29.433
+2016-03-23,29.403
+2016-03-24,29.364
+2016-03-25,29.448
+2016-03-26,29.396
+2016-03-27,29.429
+2016-03-28,29.47
+2016-03-29,29.399
+2016-03-30,29.485
+2016-03-31,29.533
+2016-04-01,29.499
+2016-04-02,29.482
+2016-04-03,29.417
+2016-04-04,29.446
+2016-04-05,29.439
+2016-04-06,29.514
+2016-04-07,29.458
+2016-04-08,29.475
+2016-04-09,29.455
+2016-04-10,29.451
+2016-04-11,29.557
+2016-04-12,29.498
+2016-04-13,29.475
+2016-04-14,29.479
+2016-04-15,29.471
+2016-04-16,29.463
+2016-04-17,29.466
+2016-04-18,29.423
+2016-04-19,29.414
+2016-04-20,29.41
+2016-04-21,29.429
+2016-04-22,29.409
+2016-04-23,29.348
+2016-04-24,29.369
+2016-04-25,29.345
+2016-04-26,29.333
+2016-04-27,29.324
+2016-04-28,29.296
+2016-04-29,29.287
+2016-04-30,29.274
+2016-05-01,29.274
+2016-05-02,29.262
+2016-05-03,29.258
+2016-05-04,29.262
+2016-05-05,29.236
+2016-05-06,29.224
+2016-05-07,29.283
+2016-05-08,29.241
+2016-05-09,29.222
+2016-05-10,29.214
+2016-05-11,29.198
+2016-05-12,29.192
+2016-05-13,29.23
+2016-05-14,29.181
+2016-05-15,29.153
+2016-05-16,29.137
+2016-05-17,29.124
+2016-05-18,29.125
+2016-05-19,29.112
+2016-05-20,29.113
+2016-05-21,29.106
+2016-05-22,29.068
+2016-05-23,29.057
+2016-05-24,29.067
+2016-05-25,29.046
+2016-05-26,29.015
+2016-05-27,29.029
+2016-05-28,28.983
+2016-05-29,28.992
+2016-05-30,29.023
+2016-05-31,28.964
+2016-06-01,28.926
+2016-06-02,28.989
+2016-06-03,28.93
+2016-06-04,28.902
+2016-06-05,28.923
+2016-06-06,28.964
+2016-06-07,28.954
+2016-06-08,28.922
+2016-06-09,28.895
+2016-06-10,28.9
+2016-06-11,28.938
+2016-06-12,28.874
+2016-06-13,28.859
+2016-06-14,28.875
+2016-06-15,28.873
+2016-06-16,28.85
+2016-06-17,28.86
+2016-06-18,28.861
+2016-06-19,28.867
+2016-06-20,28.873
+2016-06-21,28.816
+2016-06-22,28.81
+2016-06-23,28.785
+2016-06-24,28.772
+2016-06-25,28.767
+2016-06-26,28.777
+2016-06-27,28.818
+2016-06-28,28.767
+2016-06-29,28.724
+2016-06-30,28.727
+2016-07-01,28.74
+2016-07-02,28.73
+2016-07-03,28.706
+2016-07-04,28.707
+2016-07-05,28.697
+2016-07-06,28.681
+2016-07-07,28.64
+2016-07-08,28.625
+2016-07-09,28.686
+2016-07-10,28.658
+2016-07-11,28.669
+2016-07-12,28.681
+2016-07-13,28.715
+2016-07-14,28.739
+2016-07-15,28.676
+2016-07-16,28.646
+2016-07-17,28.644
+2016-07-18,28.679
+2016-07-19,28.629
+2016-07-20,28.636
+2016-07-21,28.662
+2016-07-22,28.659
+2016-07-23,28.627
+2016-07-24,28.617
+2016-07-25,28.648
+2016-07-26,28.634
+2016-07-27,28.637
+2016-07-28,28.624
+2016-07-29,28.589
+2016-07-30,28.588
+2016-07-31,28.597
+2016-08-01,28.604
+2016-08-02,28.593
+2016-08-03,28.603
+2016-08-04,28.635
+2016-08-05,28.654
+2016-08-06,28.577
+2016-08-07,28.552
+2016-08-08,28.548
+2016-08-09,28.555
+2016-08-10,28.593
+2016-08-11,28.551
+2016-08-12,28.515
+2016-08-13,28.529
+2016-08-14,28.575
+2016-08-15,28.558
+2016-08-16,28.573
+2016-08-17,28.56
+2016-08-18,28.582
+2016-08-19,28.574
+2016-08-20,28.6
+2016-08-21,28.682
+2016-08-22,28.564
+2016-08-23,28.584
+2016-08-24,28.605
+2016-08-25,28.618
+2016-08-26,28.568
+2016-08-27,28.526
+2016-08-28,28.564
+2016-08-29,28.537
+2016-08-30,28.554
+2016-08-31,28.569
+2016-09-01,28.532
+2016-09-02,28.511
+2016-09-03,28.524
+2016-09-04,28.532
+2016-09-05,28.523
+2016-09-06,28.515
+2016-09-07,28.531
+2016-09-08,28.554
+2016-09-09,28.51
+2016-09-10,28.541
+2016-09-11,28.52
+2016-09-12,28.506
+2016-09-13,28.523
+2016-09-14,28.471
+2016-09-15,28.458
+2016-09-16,28.465
+2016-09-17,28.572
+2016-09-18,28.505
+2016-09-19,28.464
+2016-09-20,28.474
+2016-09-21,28.461
+2016-09-22,28.421
+2016-09-23,28.405
+2016-09-24,28.413
+2016-09-25,28.408
+2016-09-26,28.455
+2016-09-27,28.443
+2016-09-28,28.393
+2016-09-29,28.37
+2016-09-30,28.396
+2016-10-01,28.414
+2016-10-02,28.435
+2016-10-03,28.379
+2016-10-04,28.379
+2016-10-05,28.387
+2016-10-06,28.406
+2016-10-07,28.4
+2016-10-08,28.436
+2016-10-09,28.333
+2016-10-10,28.301
+2016-10-11,28.36
+2016-10-12,28.43
+2016-10-13,28.44
+2016-10-14,28.324
+2016-10-15,28.394
+2016-10-16,28.448
+2016-10-17,28.281
+2016-10-18,28.403
+2016-10-19,28.297
+2016-10-20,28.303
+2016-10-21,28.289
+2016-10-22,28.349
+2016-10-23,28.423
+2016-10-24,28.397
+2016-10-25,28.4
+2016-10-26,28.404
+2016-10-27,28.431
+2016-10-28,28.422
+2016-10-29,28.506
+2016-10-30,28.429
+2016-10-31,28.445
+2016-11-01,28.566
+2016-11-02,28.5
+2016-11-03,28.464
+2016-11-04,28.469
+2016-11-05,28.528
+2016-11-06,28.489
+2016-11-07,28.536
+2016-11-08,28.56
+2016-11-09,28.494
+2016-11-10,28.604
+2016-11-11,28.466
+2016-11-12,28.55
+2016-11-13,28.545
+2016-11-14,28.537
+2016-11-15,28.509
+2016-11-16,28.509
+2016-11-17,28.514
+2016-11-18,28.518
+2016-11-19,28.521
+2016-11-20,28.531
+2016-11-21,28.579
+2016-11-22,28.518
+2016-11-23,28.512
+2016-11-24,28.52
+2016-11-25,28.518
+2016-11-26,28.519
+2016-11-27,28.525
+2016-11-28,28.518
+2016-11-29,28.547
+2016-11-30,28.539
+2016-12-01,28.628
+2016-12-02,28.625
+2016-12-03,28.607
+2016-12-04,28.629
+2016-12-05,28.666
+2016-12-06,28.658
+2016-12-07,28.697
+2016-12-08,28.693
+2016-12-09,28.648
+2016-12-10,28.657
+2016-12-11,28.666
+2016-12-12,28.677
+2016-12-13,28.678
+2016-12-14,28.682
+2016-12-15,28.622
+2016-12-16,28.63
+2016-12-17,28.62
+2016-12-18,28.597
+2016-12-19,28.612
+2016-12-20,28.651
+2016-12-21,28.634
+2016-12-22,28.626
+2016-12-23,28.632
+2016-12-24,28.645
+2016-12-25,28.615
+2016-12-26,28.694
+2016-12-27,28.686
+2016-12-28,28.656
+2016-12-29,28.687
+2016-12-30,28.692
+2016-12-31,28.715
+2017-01-01,28.703
+2017-01-02,28.687
+2017-01-03,28.684
+2017-01-04,28.718
+2017-01-05,28.737
+2017-01-06,28.695
+2017-01-07,28.689
+2017-01-08,28.693
+2017-01-09,28.721
+2017-01-10,28.73
+2017-01-11,28.73
+2017-01-12,28.73
+2017-01-13,28.691
+2017-01-14,28.716
+2017-01-15,28.705
+2017-01-16,28.734
+2017-01-17,28.712
+2017-01-18,28.736
+2017-01-19,28.731
+2017-01-20,28.746
+2017-01-21,28.752
+2017-01-22,28.714
+2017-01-23,28.723
+2017-01-24,28.668
+2017-01-25,28.774
+2017-01-26,28.783
+2017-01-27,28.797
+2017-01-28,28.792
+2017-01-29,28.8
+2017-01-30,28.775
+2017-01-31,28.756
+2017-02-01,28.744
+2017-02-02,28.749
+2017-02-03,28.751
+2017-02-04,28.758
+2017-02-05,28.762
+2017-02-06,28.731
+2017-02-07,28.716
+2017-02-08,28.759
+2017-02-09,28.704
+2017-02-10,28.729
+2017-02-11,28.71
+2017-02-12,28.723
+2017-02-13,28.711
+2017-02-14,28.726
+2017-02-15,28.723
+2017-02-16,28.725
+2017-02-17,28.732
+2017-02-18,28.75
+2017-02-19,28.73
+2017-02-20,28.722
+2017-02-21,28.781
+2017-02-22,28.757
+2017-02-23,28.818
+2017-02-24,28.805
+2017-02-25,28.898
+2017-02-26,29.027
+2017-02-27,29.161
+2017-02-28,29.169
+2017-03-01,29.254
+2017-03-02,29.258
+2017-03-03,29.258
+2017-03-04,29.23
+2017-03-05,29.246
+2017-03-06,29.252
+2017-03-07,29.351
+2017-03-08,29.347
+2017-03-09,29.311
+2017-03-10,29.254
+2017-03-11,29.22
+2017-03-12,29.243
+2017-03-13,29.215
+2017-03-14,29.171
+2017-03-15,29.243
+2017-03-16,29.217
+2017-03-17,29.201
+2017-03-18,29.189
+2017-03-19,29.178
+2017-03-20,29.172
+2017-03-21,29.172
+2017-03-22,29.141
+2017-03-23,29.141
+2017-03-24,29.172
+2017-03-25,29.129
+2017-03-26,29.135
+2017-03-27,29.184
+2017-03-28,29.153
+2017-03-29,29.16
+2017-03-30,29.181
+2017-03-31,29.205
+2017-04-01,29.222
+2017-04-02,29.258
+2017-04-03,29.262
+2017-04-04,29.347
+2017-04-05,29.393
+2017-04-06,29.427
+2017-04-07,29.552
+2017-04-08,29.612
+2017-04-09,29.683
+2017-04-10,29.743
+2017-04-11,29.707
+2017-04-12,29.771
+2017-04-13,29.8
+2017-04-14,29.825
+2017-04-15,29.854
+2017-04-16,29.847
+2017-04-17,29.853
+2017-04-18,29.86
+2017-04-19,30.009
+2017-04-20,29.869
+2017-04-21,29.933
+2017-04-22,29.886
+2017-04-23,29.883
+2017-04-24,29.825
+2017-04-25,29.846
+2017-04-26,29.836
+2017-04-27,29.834
+2017-04-28,29.828
+2017-04-29,29.78
+2017-04-30,29.749
+2017-05-01,29.774
+2017-05-02,29.793
+2017-05-03,29.782
+2017-05-04,29.781
+2017-05-05,29.776
+2017-05-06,29.784
+2017-05-07,29.783
+2017-05-08,29.783
+2017-05-09,29.769
+2017-05-10,29.745
+2017-05-11,29.72
+2017-05-12,29.72
+2017-05-13,29.721
+2017-05-14,29.695
+2017-05-15,29.638
+2017-05-16,29.665
+2017-05-17,29.678
+2017-05-18,29.663
+2017-05-19,29.597
+2017-05-20,29.565
+2017-05-21,29.57
+2017-05-22,29.624
+2017-05-23,29.554
+2017-05-24,29.525
+2017-05-25,29.503
+2017-05-26,29.457
+2017-05-27,29.488
+2017-05-28,29.487
+2017-05-29,29.507
+2017-05-30,29.557
+2017-05-31,29.497
+2017-06-01,29.456
+2017-06-02,29.434
+2017-06-03,29.408
+2017-06-04,29.408
+2017-06-05,29.381
+2017-06-06,29.361
+2017-06-07,29.404
+2017-06-08,29.416
+2017-06-09,29.4
+2017-06-10,29.385
+2017-06-11,29.407
+2017-06-12,29.372
+2017-06-13,29.324
+2017-06-14,29.28
+2017-06-15,29.279
+2017-06-16,29.413
+2017-06-17,29.291
+2017-06-18,29.314
+2017-06-19,29.252
+2017-06-20,29.253
+2017-06-21,29.234
+2017-06-22,29.214
+2017-06-23,29.235
+2017-06-24,29.235
+2017-06-25,29.257
+2017-06-26,29.263
+2017-06-27,29.272
+2017-06-28,29.26
+2017-06-29,29.265
+2017-06-30,29.295
+2017-07-01,29.377
+2017-07-02,29.426
+2017-07-03,29.465
+2017-07-04,29.467
+2017-07-05,29.475
+2017-07-06,29.513
+2017-07-07,29.484
+2017-07-08,29.458
+2017-07-09,29.453
+2017-07-10,29.446
+2017-07-11,29.44
+2017-07-12,29.375
+2017-07-13,29.365
+2017-07-14,29.384
+2017-07-15,29.4
+2017-07-16,29.387
+2017-07-17,29.371
+2017-07-18,29.376
+2017-07-19,29.365
+2017-07-20,29.344
+2017-07-21,29.339
+2017-07-22,29.292
+2017-07-23,29.257
+2017-07-24,29.26
+2017-07-25,29.255
+2017-07-26,29.264
+2017-07-27,29.259
+2017-07-28,29.208
+2017-07-29,29.184
+2017-07-30,29.18
+2017-07-31,29.179
+2017-08-01,29.155
+2017-08-02,29.146
+2017-08-03,29.127
+2017-08-04,29.138
+2017-08-05,29.117
+2017-08-06,29.083
+2017-08-07,29.051
+2017-08-08,29.053
+2017-08-09,29.06
+2017-08-10,29.037
+2017-08-11,29.043
+2017-08-12,29.043
+2017-08-13,29.01
+2017-08-14,29.008
+2017-08-15,28.998
+2017-08-16,28.951
+2017-08-17,28.953
+2017-08-18,28.982
+2017-08-19,28.967
+2017-08-20,28.942
+2017-08-21,28.948
+2017-08-22,28.976
+2017-08-23,28.942
+2017-08-24,28.908
+2017-08-25,28.892
+2017-08-26,28.883
+2017-08-27,28.879
+2017-08-28,28.869
+2017-08-29,28.868
+2017-08-30,28.847
+2017-08-31,28.81
+2017-09-01,28.79
+2017-09-02,28.795
+2017-09-03,28.827
+2017-09-04,28.845
+2017-09-05,28.844
+2017-09-06,28.818
+2017-09-07,28.828
+2017-09-08,28.848
+2017-09-09,28.83
+2017-09-10,28.827
+2017-09-11,28.84
+2017-09-12,28.85
+2017-09-13,28.838
+2017-09-14,28.826
+2017-09-15,28.809
+2017-09-16,28.811
+2017-09-17,28.806
+2017-09-18,28.796
+2017-09-19,28.808
+2017-09-20,28.75
+2017-09-21,28.734
+2017-09-22,28.734
+2017-09-23,28.755
+2017-09-24,28.753
+2017-09-25,28.743
+2017-09-26,28.733
+2017-09-27,28.744
+2017-09-28,28.677
+2017-09-29,28.667
+2017-09-30,28.635
+2017-10-01,28.67
+2017-10-02,28.659
+2017-10-03,28.693
+2017-10-04,28.733
+2017-10-05,28.639
+2017-10-06,28.637
+2017-10-07,28.669
+2017-10-08,28.69
+2017-10-09,28.614
+2017-10-10,28.645
+2017-10-11,28.598
+2017-10-12,28.631
+2017-10-13,28.74
+2017-10-14,28.662
+2017-10-15,28.735
+2017-10-16,28.581
+2017-10-17,28.668
+2017-10-18,28.623
+2017-10-19,28.666
+2017-10-20,28.58
+2017-10-21,28.587
+2017-10-22,28.585
+2017-10-23,28.627
+2017-10-24,28.58
+2017-10-25,28.554
+2017-10-26,28.554
+2017-10-27,28.588
+2017-10-28,28.69
+2017-10-29,28.575
+2017-10-30,28.676
+2017-10-31,28.703
+2017-11-01,28.674
+2017-11-02,28.731
+2017-11-03,28.698
+2017-11-04,28.694
+2017-11-05,28.901
+2017-11-06,28.767
+2017-11-07,28.737
+2017-11-08,28.772
+2017-11-09,28.862
+2017-11-10,28.73
+2017-11-11,28.734
+2017-11-12,28.745
+2017-11-13,28.725
+2017-11-14,28.716
+2017-11-15,28.737
+2017-11-16,28.838
+2017-11-17,28.68
+2017-11-18,28.733
+2017-11-19,28.715
+2017-11-20,28.704
+2017-11-21,28.822
+2017-11-22,28.701
+2017-11-23,28.731
+2017-11-24,28.781
+2017-11-25,28.779
+2017-11-26,28.684
+2017-11-27,28.681
+2017-11-28,28.864
+2017-11-29,28.702
+2017-11-30,28.78
+2017-12-01,28.682
+2017-12-02,28.686
+2017-12-03,28.677
+2017-12-04,28.685
+2017-12-05,28.926
+2017-12-06,28.719
+2017-12-07,28.705
+2017-12-08,28.726
+2017-12-09,28.695
+2017-12-10,28.699
+2017-12-11,28.65
+2017-12-12,28.663
+2017-12-13,28.682
+2017-12-14,28.641
+2017-12-15,28.656
+2017-12-16,28.634
+2017-12-17,28.625
+2017-12-18,28.623
+2017-12-19,28.631
+2017-12-20,28.622
+2017-12-21,28.618
+2017-12-22,28.615
+2017-12-23,28.62
+2017-12-24,28.629
+2017-12-25,28.637
+2017-12-26,28.652
+2017-12-27,28.656
+2017-12-28,28.692
+2017-12-29,28.687
+2017-12-30,28.653
+2017-12-31,28.642
+2018-01-01,28.642
+2018-01-02,28.641
+2018-01-03,28.637
+2018-01-04,28.609
+2018-01-05,28.632
+2018-01-06,28.629
+2018-01-07,28.648
+2018-01-08,28.65
+2018-01-09,28.616
+2018-01-10,28.611
+2018-01-11,28.64
+2018-01-12,28.665
+2018-01-13,28.709
+2018-01-14,28.814
+2018-01-15,28.871
+2018-01-16,28.905
+2018-01-17,28.917
+2018-01-18,28.94
+2018-01-19,28.949
+2018-01-20,28.969
+2018-01-21,28.939
+2018-01-22,28.934
+2018-01-23,28.979
+2018-01-24,28.999
+2018-01-25,28.979
+2018-01-26,28.995
+2018-01-27,29.059
+2018-01-28,29.025
+2018-01-29,29
+2018-01-30,29.01
+2018-01-31,29.024
+2018-02-01,29.056
+2018-02-02,28.991
+2018-02-03,28.982
+2018-02-04,29.013
+2018-02-05,28.969
+2018-02-06,28.976
+2018-02-07,28.949
+2018-02-08,28.95
+2018-02-09,28.951
+2018-02-10,28.938
+2018-02-11,28.937
+2018-02-12,28.928
+2018-02-13,28.924
+2018-02-14,28.957
+2018-02-15,28.93
+2018-02-16,28.913
+2018-02-17,28.935
+2018-02-18,28.936
+2018-02-19,28.986
+2018-02-20,28.951
+2018-02-21,29.036
+2018-02-22,29.057
+2018-02-23,29.185
+2018-02-24,29.187
+2018-02-25,29.268
+2018-02-26,29.241
+2018-02-27,29.241
+2018-02-28,29.236
+2018-03-01,29.222
+2018-03-02,29.155
+2018-03-03,29.219
+2018-03-04,29.25
+2018-03-05,29.229
+2018-03-06,29.256
+2018-03-07,29.256
+2018-03-08,29.223
+2018-03-09,29.265
+2018-03-10,29.259
+2018-03-11,29.249
+2018-03-12,29.231
+2018-03-13,29.197
+2018-03-14,29.206
+2018-03-15,29.234
+2018-03-16,29.215
+2018-03-17,29.175
+2018-03-18,29.169
+2018-03-19,29.157
+2018-03-20,29.149
+2018-03-21,29.13
+2018-03-22,29.119
+2018-03-23,29.128
+2018-03-24,29.098
+2018-03-25,29.075
+2018-03-26,29.096
+2018-03-27,29.129
+2018-03-28,29.126
+2018-03-29,29.103
+2018-03-30,29.147
+2018-03-31,29.212
+2018-04-01,29.266
+2018-04-02,29.272
+2018-04-03,29.287
+2018-04-04,29.371
+2018-04-05,29.351
+2018-04-06,29.415
+2018-04-07,29.405
+2018-04-08,29.375
+2018-04-09,29.36
+2018-04-10,29.376
+2018-04-11,29.385
+2018-04-12,29.374
+2018-04-13,29.351
+2018-04-14,29.304
+2018-04-15,29.363
+2018-04-16,29.425
+2018-04-17,29.477
+2018-04-18,29.522
+2018-04-19,29.509
+2018-04-20,29.508
+2018-04-21,29.509
+2018-04-22,29.51
+2018-04-23,29.518
+2018-04-24,29.539
+2018-04-25,29.523
+2018-04-26,29.577
+2018-04-27,29.647
+2018-04-28,29.677
+2018-04-29,29.704
+2018-04-30,29.768
+2018-05-01,29.83
+2018-05-02,29.879
+2018-05-03,29.876
+2018-05-04,29.906
+2018-05-05,29.949
+2018-05-06,29.932
+2018-05-07,29.913
+2018-05-08,29.94
+2018-05-09,29.922
+2018-05-10,29.972
+2018-05-11,29.846
+2018-05-12,29.856
+2018-05-13,29.838
+2018-05-14,29.829
+2018-05-15,29.777
+2018-05-16,29.76
+2018-05-17,29.71
+2018-05-18,29.68
+2018-05-19,29.724
+2018-05-20,29.675
+2018-05-21,29.638
+2018-05-22,29.624
+2018-05-23,29.586
+2018-05-24,29.568
+2018-05-25,29.569
+2018-05-26,29.522
+2018-05-27,29.53
+2018-05-28,29.531
+2018-05-29,29.442
+2018-05-30,29.437
+2018-05-31,29.484
+2018-06-01,29.403
+2018-06-02,29.316
+2018-06-03,29.34
+2018-06-04,29.429
+2018-06-05,29.323
+2018-06-06,29.279
+2018-06-07,29.282
+2018-06-08,29.239
+2018-06-09,29.211
+2018-06-10,29.185
+2018-06-11,29.166
+2018-06-12,29.182
+2018-06-13,29.182
+2018-06-14,29.116
+2018-06-15,29.102
+2018-06-16,29.095
+2018-06-17,29.088
+2018-06-18,29.083
+2018-06-19,29.039
+2018-06-20,29.065
+2018-06-21,28.997
+2018-06-22,29.023
+2018-06-23,29.031
+2018-06-24,28.986
+2018-06-25,28.943
+2018-06-26,28.968
+2018-06-27,29.005
+2018-06-28,28.966
+2018-06-29,28.951
+2018-06-30,28.953
+2018-07-01,28.928
+2018-07-02,28.938
+2018-07-03,28.904
+2018-07-04,28.898
+2018-07-05,28.908
+2018-07-06,28.828
+2018-07-07,28.845
+2018-07-08,28.855
+2018-07-09,28.851
+2018-07-10,28.801
+2018-07-11,28.762
+2018-07-12,28.765
+2018-07-13,28.768
+2018-07-14,28.794
+2018-07-15,28.742
+2018-07-16,28.739
+2018-07-17,28.731
+2018-07-18,28.688
+2018-07-19,28.7
+2018-07-20,28.703
+2018-07-21,28.704
+2018-07-22,28.677
+2018-07-23,28.69
+2018-07-24,28.737
+2018-07-25,28.747
+2018-07-26,28.685
+2018-07-27,28.686
+2018-07-28,28.684
+2018-07-29,28.667
+2018-07-30,28.679
+2018-07-31,28.668
+2018-08-01,28.703
+2018-08-02,28.668
+2018-08-03,28.643
+2018-08-04,28.637
+2018-08-05,28.66
+2018-08-06,28.662
+2018-08-07,28.641
+2018-08-08,28.629
+2018-08-09,28.633
+2018-08-10,28.621
+2018-08-11,28.636
+2018-08-12,28.627
+2018-08-13,28.623
+2018-08-14,28.621
+2018-08-15,28.619
+2018-08-16,28.596
+2018-08-17,28.625
+2018-08-18,28.566
+2018-08-19,28.59
+2018-08-20,28.617
+2018-08-21,28.649
+2018-08-22,28.68
+2018-08-23,28.58
+2018-08-24,28.596
+2018-08-25,28.61
+2018-08-26,28.613
+2018-08-27,28.559
+2018-08-28,28.587
+2018-08-29,28.569
+2018-08-30,28.5
+2018-08-31,28.525
+2018-09-01,28.622
+2018-09-02,28.591
+2018-09-03,28.539
+2018-09-04,28.495
+2018-09-05,28.541
+2018-09-06,28.486
+2018-09-07,28.487
+2018-09-08,28.434
+2018-09-09,28.44
+2018-09-10,28.479
+2018-09-11,28.502
+2018-09-12,28.48
+2018-09-13,28.478
+2018-09-14,28.492
+2018-09-15,28.5
+2018-09-16,28.472
+2018-09-17,28.516
+2018-09-18,28.453
+2018-09-19,28.413
+2018-09-20,28.429
+2018-09-21,28.729
+2018-09-22,28.429
+2018-09-23,28.419
+2018-09-24,28.4
+2018-09-25,28.588
+2018-09-26,28.504
+2018-09-27,28.441
+2018-09-28,28.507
+2018-09-29,28.456
+2018-09-30,28.456
+2018-10-01,28.442
+2018-10-02,28.446
+2018-10-03,28.469
+2018-10-04,28.595
+2018-10-05,28.472
+2018-10-06,28.526
+2018-10-07,28.461
+2018-10-08,28.525
+2018-10-09,28.617
+2018-10-10,28.501
+2018-10-11,28.515
+2018-10-12,28.54
+2018-10-13,28.557
+2018-10-14,28.569
+2018-10-15,28.627
+2018-10-16,28.576
+2018-10-17,28.584
+2018-10-18,28.54
+2018-10-19,28.632
+2018-10-20,28.59
+2018-10-21,28.509
+2018-10-22,28.533
+2018-10-23,28.507
+2018-10-24,28.482
+2018-10-25,28.5
+2018-10-26,28.516
+2018-10-27,28.452
+2018-10-28,28.498
+2018-10-29,28.538
+2018-10-30,28.545
+2018-10-31,28.579
+2018-11-01,28.542
+2018-11-02,28.545
+2018-11-03,28.647
+2018-11-04,28.71
+2018-11-05,28.789
+2018-11-06,28.827
+2018-11-07,28.869
+2018-11-08,28.844
+2018-11-09,28.837
+2018-11-10,28.905
+2018-11-11,28.88
+2018-11-12,28.898
+2018-11-13,28.902
+2018-11-14,28.875
+2018-11-15,28.913
+2018-11-16,28.91
+2018-11-17,28.923
+2018-11-18,28.921
+2018-11-19,28.936
+2018-11-20,28.89
+2018-11-21,28.914
+2018-11-22,28.88
+2018-11-23,28.926
+2018-11-24,28.965
+2018-11-25,28.882
+2018-11-26,28.898
+2018-11-27,28.877
+2018-11-28,28.94
+2018-11-29,28.975
+2018-11-30,28.995
+2018-12-01,28.998
+2018-12-02,29.056
+2018-12-03,29.067
+2018-12-04,29.066
+2018-12-05,29.121
+2018-12-06,29.158
+2018-12-07,29.124
+2018-12-08,29.123
+2018-12-09,29.152
+2018-12-10,29.095
+2018-12-11,29.108
+2018-12-12,29.07
+2018-12-13,29.068
+2018-12-14,29.114
+2018-12-15,29.071
+2018-12-16,29.065
+2018-12-17,29.054
+2018-12-18,29.018
+2018-12-19,29.055
+2018-12-20,29.051
+2018-12-21,29.079
+2018-12-22,29.158
+2018-12-23,29.241
+2018-12-24,29.291
+2018-12-25,29.309
+2018-12-26,29.308
+2018-12-27,29.295
+2018-12-28,29.412
+2018-12-29,29.344
+2018-12-30,29.353
+2018-12-31,29.397
+2019-01-01,29.403
+2019-01-02,29.361
+2019-01-03,29.36
+2019-01-04,29.391
+2019-01-05,29.364
+2019-01-06,29.332
+2019-01-07,29.319
+2019-01-08,29.395
+2019-01-09,29.175
+2019-01-10,29.141
+2019-01-11,29.106
+2019-01-12,29.176
+2019-01-13,29.171
+2019-01-14,29.169
+2019-01-15,29.155
+2019-01-16,29.157
+2019-01-17,29.197
+2019-01-18,29.16
+2019-01-19,29.196
+2019-01-20,29.228
+2019-01-21,29.275
+2019-01-22,29.28
+2019-01-23,29.249
+2019-01-24,29.185
+2019-01-25,29.187
+2019-01-26,29.216
+2019-01-27,29.241
+2019-01-28,29.24
+2019-01-29,29.256
+2019-01-30,29.239
+2019-01-31,29.279
+2019-02-01,29.275
+2019-02-02,29.277
+2019-02-03,29.222
+2019-02-04,29.21
+2019-02-05,29.216
+2019-02-06,29.211
+2019-02-07,29.234
+2019-02-08,29.307
+2019-02-09,29.295
+2019-02-10,29.275
+2019-02-11,29.293
+2019-02-12,29.291
+2019-02-13,29.29
+2019-02-14,29.298
+2019-02-15,29.297
+2019-02-16,29.284
+2019-02-17,29.262
+2019-02-18,29.247
+2019-02-19,29.252
+2019-02-20,29.235
+2019-02-21,29.229
+2019-02-22,29.214
+2019-02-23,29.203
+2019-02-24,29.222
+2019-02-25,29.245
+2019-02-26,29.148
+2019-02-27,29.219
+2019-02-28,29.177
+2019-03-01,29.155
+2019-03-02,29.145
+2019-03-03,29.14
+2019-03-04,29.132
+2019-03-05,29.131
+2019-03-06,29.114
+2019-03-07,29.103
+2019-03-08,29.093
+2019-03-09,29.066
+2019-03-10,29.091
+2019-03-11,29.085
+2019-03-12,29.061
+2019-03-13,29.079
+2019-03-14,29.074
+2019-03-15,29.162
+2019-03-16,29.172
+2019-03-17,29.181
+2019-03-18,29.188
+2019-03-19,29.19
+2019-03-20,29.211
+2019-03-21,29.237
+2019-03-22,29.212
+2019-03-23,29.253
+2019-03-24,29.272
+2019-03-25,29.268
+2019-03-26,29.257
+2019-03-27,29.275
+2019-03-28,29.351
+2019-03-29,29.268
+2019-03-30,29.279
+2019-03-31,29.303
+2019-04-01,29.344
+2019-04-02,29.428
+2019-04-03,29.432
+2019-04-04,29.403
+2019-04-05,29.444
+2019-04-06,29.45
+2019-04-07,29.43
+2019-04-08,29.455
+2019-04-09,29.474
+2019-04-10,29.515
+2019-04-11,29.544
+2019-04-12,29.596
+2019-04-13,29.609
+2019-04-14,29.584
+2019-04-15,29.638
+2019-04-16,29.697
+2019-04-17,29.767
+2019-04-18,29.946
+2019-04-19,29.818
+2019-04-20,29.854
+2019-04-21,29.96
+2019-04-22,30.005
+2019-04-23,30.049
+2019-04-24,30.1
+2019-04-25,30.099
+2019-04-26,30.125
+2019-04-27,30.15
+2019-04-28,30.144
+2019-04-29,30.151
+2019-04-30,30.142
+2019-05-01,30.119
+2019-05-02,30.102
+2019-05-03,30.112
+2019-05-04,30.108
+2019-05-05,30.104
+2019-05-06,30.096
+2019-05-07,30.07
+2019-05-08,30.029
+2019-05-09,30.033
+2019-05-10,30.156
+2019-05-11,30.059
+2019-05-12,30.076
+2019-05-13,30.075
+2019-05-14,30.063
+2019-05-15,30.06
+2019-05-16,30.052
+2019-05-17,30.038
+2019-05-18,30.016
+2019-05-19,29.993
+2019-05-20,30.034
+2019-05-21,29.993
+2019-05-22,30.011
+2019-05-23,30.022
+2019-05-24,29.971
+2019-05-25,30.005
+2019-05-26,29.989
+2019-05-27,29.954
+2019-05-28,29.967
+2019-05-29,29.961
+2019-05-30,29.963
+2019-05-31,29.914
+2019-06-01,29.903
+2019-06-02,29.896
+2019-06-03,29.882
+2019-06-04,29.854
+2019-06-05,29.83
+2019-06-06,29.808
+2019-06-07,29.817
+2019-06-08,29.793
+2019-06-09,29.789
+2019-06-10,29.777
+2019-06-11,29.748
+2019-06-12,29.732
+2019-06-13,29.724
+2019-06-14,29.707
+2019-06-15,29.693
+2019-06-16,29.616
+2019-06-17,29.587
+2019-06-18,29.57
+2019-06-19,29.551
+2019-06-20,29.491
+2019-06-21,29.504
+2019-06-22,29.526
+2019-06-23,29.537
+2019-06-24,29.527
+2019-06-25,29.535
+2019-06-26,29.523
+2019-06-27,29.512
+2019-06-28,29.491
+2019-06-29,29.478
+2019-06-30,29.441
+2019-07-01,29.433
+2019-07-02,29.423
+2019-07-03,29.406
+2019-07-04,29.393
+2019-07-05,29.377
+2019-07-06,29.326
+2019-07-07,29.289
+2019-07-08,29.284
+2019-07-09,29.265
+2019-07-10,29.254
+2019-07-11,29.236
+2019-07-12,29.214
+2019-07-13,29.202
+2019-07-14,29.156
+2019-07-15,29.141
+2019-07-16,29.169
+2019-07-17,29.127
+2019-07-18,29.088
+2019-07-19,29.128
+2019-07-20,29.083
+2019-07-21,29.044
+2019-07-22,29.012
+2019-07-23,29.006
+2019-07-24,28.984
+2019-07-25,28.987
+2019-07-26,28.982
+2019-07-27,28.963
+2019-07-28,28.962
+2019-07-29,28.932
+2019-07-30,28.934
+2019-07-31,28.918
+2019-08-01,28.88
+2019-08-02,28.877
+2019-08-03,28.862
+2019-08-04,28.809
+2019-08-05,28.822
+2019-08-06,28.847
+2019-08-07,28.811
+2019-08-08,28.817
+2019-08-09,28.815
+2019-08-10,28.798
+2019-08-11,28.795
+2019-08-12,28.799
+2019-08-13,28.769
+2019-08-14,28.729
+2019-08-15,28.727
+2019-08-16,28.734
+2019-08-17,28.758
+2019-08-18,28.751
+2019-08-19,28.764
+2019-08-20,28.721
+2019-08-21,28.733
+2019-08-22,28.728
+2019-08-23,28.68
+2019-08-24,28.661
+2019-08-25,28.659
+2019-08-26,28.667
+2019-08-27,28.691
+2019-08-28,28.68
+2019-08-29,28.654
+2019-08-30,28.666
+2019-08-31,28.619
+2019-09-01,28.625
+2019-09-02,28.679
+2019-09-03,28.611
+2019-09-04,28.703
+2019-09-05,28.631
+2019-09-06,28.627
+2019-09-07,28.617
+2019-09-08,28.617
+2019-09-09,28.607
+2019-09-10,28.619
+2019-09-11,28.613
+2019-09-12,28.564
+2019-09-13,28.619
+2019-09-14,28.793
+2019-09-15,28.574
+2019-09-16,28.561
+2019-09-17,28.54
+2019-09-18,28.534
+2019-09-19,28.552
+2019-09-20,28.558
+2019-09-21,28.542
+2019-09-22,28.574
+2019-09-23,28.551
+2019-09-24,28.525
+2019-09-25,28.532
+2019-09-26,28.575
+2019-09-27,28.546
+2019-09-28,28.573
+2019-09-29,28.47
+2019-09-30,28.498
+2019-10-01,28.55
+2019-10-02,28.487
+2019-10-03,28.547
+2019-10-04,28.502
+2019-10-05,28.573
+2019-10-06,28.692
+2019-10-07,28.606
+2019-10-08,28.614
+2019-10-09,28.622
+2019-10-10,28.615
+2019-10-11,28.614
+2019-10-12,28.636
+2019-10-13,28.649
+2019-10-14,28.661
+2019-10-15,28.636
+2019-10-16,28.648
+2019-10-17,28.454
+2019-10-18,28.725
+2019-10-19,28.765
+2019-10-20,28.803
+2019-10-21,28.794
+2019-10-22,28.833
+2019-10-23,28.836
+2019-10-24,28.867
+2019-10-25,28.827
+2019-10-26,28.83
+2019-10-27,28.909
+2019-10-28,28.899
+2019-10-29,28.996
+2019-10-30,28.929
+2019-10-31,28.959
+2019-11-01,29.164
+2019-11-02,29.24
+2019-11-03,29.338
+2019-11-04,29.4
+2019-11-05,29.423
+2019-11-06,29.367
+2019-11-07,29.346
+2019-11-08,29.337
+2019-11-09,29.402
+2019-11-10,29.413
+2019-11-11,29.258
+2019-11-12,29.286
+2019-11-13,29.311
+2019-11-14,29.356
+2019-11-15,29.304
+2019-11-16,29.245
+2019-11-17,29.248
+2019-11-18,29.217
+2019-11-19,29.215
+2019-11-20,29.212
+2019-11-21,29.223
+2019-11-22,29.275
+2019-11-23,29.236
+2019-11-24,29.208
+2019-11-25,29.215
+2019-11-26,29.24
+2019-11-27,29.203
+2019-11-28,29.164
+2019-11-29,29.251
+2019-11-30,29.258
+2019-12-01,29.268
+2019-12-02,29.204
+2019-12-03,29.227
+2019-12-04,29.293
+2019-12-05,29.26
+2019-12-06,29.245
+2019-12-07,29.233
+2019-12-08,29.358
+2019-12-09,29.33
+2019-12-10,29.24
+2019-12-11,29.223
+2019-12-12,29.217
+2019-12-13,29.318
+2019-12-14,29.199
+2019-12-15,29.244
+2019-12-16,29.235
+2019-12-17,29.234
+2019-12-18,29.23
+2019-12-19,29.159
+2019-12-20,29.152
+2019-12-21,29.138
+2019-12-22,29.144
+2019-12-23,29.129
+2019-12-24,29.118
+2019-12-25,29.12
+2019-12-26,29.115
+2019-12-27,29.175
+2019-12-28,29.138
+2019-12-29,29.119
+2019-12-30,29.132
+2019-12-31,29.157
+2020-01-01,29.163
+2020-01-02,29.189
+2020-01-03,29.156
+2020-01-04,29.115
+2020-01-05,29.108
+2020-01-06,29.13
+2020-01-07,29.124
+2020-01-08,29.121
+2020-01-09,29.059
+2020-01-10,29.172
+2020-01-11,29.074
+2020-01-12,29.092
+2020-01-13,29.196
+2020-01-14,29.253
+2020-01-15,29.285
+2020-01-16,29.29
+2020-01-17,29.329
+2020-01-18,29.302
+2020-01-19,29.243
+2020-01-20,29.288
+2020-01-21,29.304
+2020-01-22,29.259
+2020-01-23,29.23
+2020-01-24,29.22
+2020-01-25,29.218
+2020-01-26,29.234
+2020-01-27,29.237
+2020-01-28,29.245
+2020-01-29,29.242
+2020-01-30,29.233
+2020-01-31,29.217
+2020-02-01,29.21
+2020-02-02,29.219
+2020-02-03,29.217
+2020-02-04,29.193
+2020-02-05,29.167
+2020-02-06,29.147
+2020-02-07,29.095
+2020-02-08,29.084
+2020-02-09,29.103
+2020-02-10,29.101
+2020-02-11,29.098
+2020-02-12,29.112
+2020-02-13,29.087
+2020-02-14,29.062
+2020-02-15,29.089
+2020-02-16,29.094
+2020-02-17,29.033
+2020-02-18,29.097
+2020-02-19,29.037
+2020-02-20,29.017
+2020-02-21,29.011
+2020-02-22,28.999
+2020-02-23,28.996
+2020-02-24,29
+2020-02-25,28.968
+2020-02-26,28.946
+2020-02-27,28.993
+2020-02-28,29.011
+2020-02-29,28.974
+2020-03-01,28.982
+2020-03-02,29.033
+2020-03-03,28.993
+2020-03-04,29.049
+2020-03-05,29.057
+2020-03-06,29.006
+2020-03-07,29.062
+2020-03-08,29.12
+2020-03-09,29.116
+2020-03-10,29.156
+2020-03-11,29.197
+2020-03-12,29.249
+2020-03-13,29.386
+2020-03-14,29.377
+2020-03-15,29.349
+2020-03-16,29.386
+2020-03-17,29.511
+2020-03-18,29.373
+2020-03-19,29.395
+2020-03-20,29.484
+2020-03-21,29.359
+2020-03-22,29.386
+2020-03-23,29.461
+2020-03-24,29.402
+2020-03-25,29.415
+2020-03-26,29.434
+2020-03-27,29.379
+2020-03-28,29.385
+2020-03-29,29.434
+2020-03-30,29.488
+2020-03-31,29.409
+2020-04-01,29.427
+2020-04-02,29.434
+2020-04-03,29.421
+2020-04-04,29.506
+2020-04-05,29.534
+2020-04-06,29.538
+2020-04-07,29.532
+2020-04-08,29.514
+2020-04-09,29.533
+2020-04-10,29.518
+2020-04-11,29.546
+2020-04-12,29.587
+2020-04-13,29.625
+2020-04-14,29.596
+2020-04-15,29.612
+2020-04-16,29.61
+2020-04-17,29.607
+2020-04-18,29.585
+2020-04-19,29.612
+2020-04-20,29.534
+2020-04-21,29.58
+2020-04-22,29.51
+2020-04-23,29.499
+2020-04-24,29.462
+2020-04-25,29.46
+2020-04-26,29.42
+2020-04-27,29.397
+2020-04-28,29.429
+2020-04-29,29.458
+2020-04-30,29.487
+2020-05-01,29.437
+2020-05-02,29.423
+2020-05-03,29.433
+2020-05-04,29.396
+2020-05-05,29.378
+2020-05-06,29.385
+2020-05-07,29.375
+2020-05-08,29.347
+2020-05-09,29.317
+2020-05-10,29.34
+2020-05-11,29.306
+2020-05-12,29.283
+2020-05-13,29.288
+2020-05-14,29.299
+2020-05-15,29.272
+2020-05-16,29.283
+2020-05-17,29.291
+2020-05-18,29.247
+2020-05-19,29.251
+2020-05-20,29.276
+2020-05-21,29.28
+2020-05-22,29.26
+2020-05-23,29.18
+2020-05-24,29.246
+2020-05-25,29.25
+2020-05-26,29.196
+2020-05-27,29.182
+2020-05-28,29.199
+2020-05-29,29.187
+2020-05-30,29.144
+2020-05-31,29.092
+2020-06-01,29.101
+2020-06-02,29.093
+2020-06-03,29.072
+2020-06-04,29.071
+2020-06-05,29.052
+2020-06-06,29.019
+2020-06-07,28.996
+2020-06-08,28.997
+2020-06-09,28.995
+2020-06-10,29.033
+2020-06-11,29.032
+2020-06-12,28.976
+2020-06-13,28.931
+2020-06-14,28.909
+2020-06-15,28.906
+2020-06-16,28.904
+2020-06-17,28.894
+2020-06-18,28.888
+2020-06-19,28.874
+2020-06-20,28.859
+2020-06-21,28.845
+2020-06-22,28.837
+2020-06-23,28.841
+2020-06-24,28.829
+2020-06-25,28.826
+2020-06-26,28.791
+2020-06-27,28.799
+2020-06-28,28.765
+2020-06-29,28.694
+2020-06-30,28.665
+2020-07-01,28.709
+2020-07-02,28.738
+2020-07-03,28.706
+2020-07-04,28.712
+2020-07-05,28.694
+2020-07-06,28.697
+2020-07-07,28.747
+2020-07-08,28.723
+2020-07-09,28.704
+2020-07-10,28.702
+2020-07-11,28.681
+2020-07-12,28.679
+2020-07-13,28.668
+2020-07-14,28.63
+2020-07-15,28.634
+2020-07-16,28.761
+2020-07-17,28.772
+2020-07-18,28.666
+2020-07-19,28.683
+2020-07-20,28.654
+2020-07-21,28.61
+2020-07-22,28.62
+2020-07-23,28.605
+2020-07-24,28.615
+2020-07-25,28.626
+2020-07-26,28.636
+2020-07-27,28.626
+2020-07-28,28.615
+2020-07-29,28.605
+2020-07-30,28.599
+2020-07-31,28.582
+2020-08-01,28.579
+2020-08-02,28.609
+2020-08-03,28.615
+2020-08-04,28.54
+2020-08-05,28.681
+2020-08-06,28.673
+2020-08-07,28.673
+2020-08-08,28.666
+2020-08-09,28.672
+2020-08-10,28.671
+2020-08-11,28.717
+2020-08-12,28.661
+2020-08-13,28.649
+2020-08-14,28.606
+2020-08-15,28.617
+2020-08-16,28.669
+2020-08-17,28.646
+2020-08-18,28.612
+2020-08-19,28.59
+2020-08-20,28.595
+2020-08-21,28.605
+2020-08-22,28.578
+2020-08-23,28.588
+2020-08-24,28.592
+2020-08-25,28.571
+2020-08-26,28.549
+2020-08-27,28.556
+2020-08-28,28.557
+2020-08-29,28.59
+2020-08-30,28.544
+2020-08-31,28.555
+2020-09-01,28.607
+2020-09-02,28.718
+2020-09-03,28.555
+2020-09-04,28.552
+2020-09-05,28.543
+2020-09-06,28.525
+2020-09-07,28.669
+2020-09-08,28.498
+2020-09-09,28.465
+2020-09-10,28.461
+2020-09-11,28.456
+2020-09-12,28.499
+2020-09-13,28.635
+2020-09-14,28.438
+2020-09-15,28.455
+2020-09-16,28.614
+2020-09-17,28.413
+2020-09-18,28.391
+2020-09-19,28.404
+2020-09-20,28.394
+2020-09-21,28.407
+2020-09-22,28.393
+2020-09-23,28.404
+2020-09-24,28.395
+2020-09-25,28.372
+2020-09-26,28.429
+2020-09-27,28.475
+2020-09-28,28.416
+2020-09-29,28.444
+2020-09-30,28.44
+2020-10-01,28.471
+2020-10-02,28.454
+2020-10-03,28.447
+2020-10-04,28.47
+2020-10-05,28.468
+2020-10-06,28.51
+2020-10-07,28.499
+2020-10-08,28.405
+2020-10-09,28.459
+2020-10-10,28.531
+2020-10-11,28.379
+2020-10-12,28.452
+2020-10-13,28.496
+2020-10-14,28.439
+2020-10-15,28.515
+2020-10-16,28.449
+2020-10-17,28.447
+2020-10-18,28.55
+2020-10-19,28.532
+2020-10-20,28.473
+2020-10-21,28.529
+2020-10-22,28.492
+2020-10-23,28.585
+2020-10-24,28.535
+2020-10-25,28.458
+2020-10-26,28.525
+2020-10-27,28.482
+2020-10-28,28.525
+2020-10-29,28.46
+2020-10-30,28.418
+2020-10-31,28.539
+2020-11-01,28.706
+2020-11-02,28.466
+2020-11-03,28.48
+2020-11-04,28.593
+2020-11-05,28.598
+2020-11-06,28.521
+2020-11-07,28.514
+2020-11-08,28.511
+2020-11-09,28.517
+2020-11-10,28.55
+2020-11-11,28.575
+2020-11-12,28.486
+2020-11-13,28.508
+2020-11-14,28.495
+2020-11-15,28.583
+2020-11-16,28.553
+2020-11-17,28.477
+2020-11-18,28.473
+2020-11-19,28.671
+2020-11-20,28.58
+2020-11-21,28.464
+2020-11-22,28.471
+2020-11-23,28.513
+2020-11-24,28.444
+2020-11-25,28.544
+2020-11-26,28.506
+2020-11-27,28.513
+2020-11-28,28.53
+2020-11-29,28.555
+2020-11-30,28.537
+2020-12-01,28.572
+2020-12-02,28.672
+2020-12-03,28.698
+2020-12-04,28.678
+2020-12-05,28.557
+2020-12-06,28.616
+2020-12-07,28.654
+2020-12-08,28.643
+2020-12-09,28.722
+2020-12-10,28.661
+2020-12-11,28.687
+2020-12-12,28.642
+2020-12-13,28.693
+2020-12-14,28.65
+2020-12-15,28.618
+2020-12-16,28.612
+2020-12-17,28.61
+2020-12-18,28.612
+2020-12-19,28.623
+2020-12-20,28.639
+2020-12-21,28.619
+2020-12-22,28.615
+2020-12-23,28.634
+2020-12-24,28.711
+2020-12-25,28.637
+2020-12-26,28.735
+2020-12-27,28.75
+2020-12-28,28.961
+2020-12-29,28.76
+2020-12-30,28.839
+2020-12-31,28.778
+2021-01-01,28.749
+2021-01-02,28.744
+2021-01-03,28.769
+2021-01-04,28.768
+2021-01-05,28.759
+2021-01-06,28.767
+2021-01-07,28.767
+2021-01-08,28.761
+2021-01-09,28.765
+2021-01-10,28.747
+2021-01-11,28.765
+2021-01-12,28.745
+2021-01-13,28.746
+2021-01-14,28.735
+2021-01-15,28.726
+2021-01-16,28.726
+2021-01-17,28.754
+2021-01-18,28.747
+2021-01-19,28.737
+2021-01-20,28.734
+2021-01-21,28.775
+2021-01-22,28.731
+2021-01-23,28.724
+2021-01-24,28.757
+2021-01-25,28.721
+2021-01-26,28.693
+2021-01-27,28.691
+2021-01-28,28.695
+2021-01-29,28.679
+2021-01-30,28.67
+2021-01-31,28.66
+2021-02-01,28.654
+2021-02-02,28.622
+2021-02-03,28.645
+2021-02-04,28.653
+2021-02-05,28.659
+2021-02-06,28.655
+2021-02-07,28.647
+2021-02-08,28.637
+2021-02-09,28.628
+2021-02-10,28.627
+2021-02-11,28.622
+2021-02-12,28.619
+2021-02-13,28.607
+2021-02-14,28.602
+2021-02-15,28.599
+2021-02-16,28.601
+2021-02-17,28.615
+2021-02-18,28.597
+2021-02-19,28.592
+2021-02-20,28.595
+2021-02-21,28.592
+2021-02-22,28.614
+2021-02-23,28.595
+2021-02-24,28.595
+2021-02-25,28.573
+2021-02-26,28.586
+2021-02-27,28.626
+2021-02-28,28.586
+2021-03-01,28.62
+2021-03-02,28.579
+2021-03-03,28.577
+2021-03-04,28.579
+2021-03-05,28.586
+2021-03-06,28.582
+2021-03-07,28.573
+2021-03-08,28.574
+2021-03-09,28.575
+2021-03-10,28.609
+2021-03-11,28.7
+2021-03-12,28.663
+2021-03-13,28.69
+2021-03-14,28.673
+2021-03-15,28.698
+2021-03-16,28.76
+2021-03-17,28.772
+2021-03-18,28.728
+2021-03-19,28.714
+2021-03-20,28.797
+2021-03-21,28.788
+2021-03-22,28.797
+2021-03-23,28.803
+2021-03-24,28.848
+2021-03-25,28.885
+2021-03-26,28.863
+2021-03-27,28.943
+2021-03-28,29.073
+2021-03-29,29.027
+2021-03-30,29.175
+2021-03-31,29.189
+2021-04-01,29.016
+2021-04-02,29.079
+2021-04-03,29.125
+2021-04-04,29.117
+2021-04-05,29.073
+2021-04-06,29.111
+2021-04-07,29.1
+2021-04-08,29.113
+2021-04-09,29.13
+2021-04-10,29.112
+2021-04-11,29.052
+2021-04-12,29.068
+2021-04-13,29.072
+2021-04-14,29.068
+2021-04-15,29.083
+2021-04-16,29.068
+2021-04-17,29.104
+2021-04-18,29.143
+2021-04-19,29.157
+2021-04-20,29.174
+2021-04-21,29.112
+2021-04-22,29.139
+2021-04-23,29.157
+2021-04-24,29.161
+2021-04-25,29.146
+2021-04-26,29.105
+2021-04-27,29.132
+2021-04-28,29.125
+2021-04-29,29.127
+2021-04-30,29.147
+2021-05-01,29.215
+2021-05-02,29.277
+2021-05-03,29.267
+2021-05-04,29.289
+2021-05-05,29.312
+2021-05-06,29.302
+2021-05-07,29.331
+2021-05-08,29.335
+2021-05-09,29.34
+2021-05-10,29.339
+2021-05-11,29.338
+2021-05-12,29.309
+2021-05-13,29.305
+2021-05-14,29.299
+2021-05-15,29.29
+2021-05-16,29.268
+2021-05-17,29.259
+2021-05-18,29.233
+2021-05-19,29.218
+2021-05-20,29.208
+2021-05-21,29.199
+2021-05-22,29.172
+2021-05-23,29.095
+2021-05-24,29.114
+2021-05-25,29.168
+2021-05-26,29.145
+2021-05-27,29.011
+2021-05-28,29.032
+2021-05-29,28.989
+2021-05-30,29
+2021-05-31,28.984
+2021-06-01,29.007
+2021-06-02,28.989
+2021-06-03,28.983
+2021-06-04,28.957
+2021-06-05,28.96
+2021-06-06,28.939
+2021-06-07,28.935
+2021-06-08,28.922
+2021-06-09,28.866
+2021-06-10,28.842
+2021-06-11,28.87
+2021-06-12,28.848
+2021-06-13,28.847
+2021-06-14,28.881
+2021-06-15,28.829
+2021-06-16,28.804
+2021-06-17,28.803
+2021-06-18,28.832
+2021-06-19,28.797
+2021-06-20,28.779
+2021-06-21,28.812
+2021-06-22,28.754
+2021-06-23,28.753
+2021-06-24,28.813
+2021-06-25,28.795
+2021-06-26,28.787
+2021-06-27,28.794
+2021-06-28,28.72
+2021-06-29,28.699
+2021-06-30,28.701
+2021-07-01,28.67
+2021-07-02,28.611
+2021-07-03,28.655
+2021-07-04,28.644
+2021-07-05,28.689
+2021-07-06,28.693
+2021-07-07,28.651
+2021-07-08,28.648
+2021-07-09,28.648
+2021-07-10,28.654
+2021-07-11,28.667
+2021-07-12,28.655
+2021-07-13,28.709
+2021-07-14,28.726
+2021-07-15,28.693
+2021-07-16,28.66
+2021-07-17,28.651
+2021-07-18,28.647
+2021-07-19,28.702
+2021-07-20,28.713
+2021-07-21,28.73
+2021-07-22,28.763
+2021-07-23,28.766
+2021-07-24,28.792
+2021-07-25,28.848
+2021-07-26,28.787
+2021-07-27,28.764
+2021-07-28,28.758
+2021-07-29,28.773
+2021-07-30,28.744
+2021-07-31,28.763
+2021-08-01,28.776
+2021-08-02,28.776
+2021-08-03,28.815
+2021-08-04,28.795
+2021-08-05,28.785
+2021-08-06,28.796
+2021-08-07,28.79
+2021-08-08,28.757
+2021-08-09,28.785
+2021-08-10,28.806
+2021-08-11,28.798
+2021-08-12,28.779
+2021-08-13,28.766
+2021-08-14,28.741
+2021-08-15,28.717
+2021-08-16,28.727
+2021-08-17,28.746
+2021-08-18,28.742
+2021-08-19,28.702
+2021-08-20,28.716
+2021-08-21,28.738
+2021-08-22,28.739
+2021-08-23,28.733
+2021-08-24,28.738
+2021-08-25,28.743
+2021-08-26,28.735
+2021-08-27,28.66
+2021-08-28,28.689
+2021-08-29,28.769
+2021-08-30,28.739
+2021-08-31,28.688
+2021-09-01,28.67
+2021-09-02,28.626
+2021-09-03,28.636
+2021-09-04,28.636
+2021-09-05,28.68
+2021-09-06,28.653
+2021-09-07,28.631
+2021-09-08,28.672
+2021-09-09,28.649
+2021-09-10,28.616
+2021-09-11,28.656
+2021-09-12,28.674
+2021-09-13,28.597
+2021-09-14,28.617
+2021-09-15,28.648
+2021-09-16,28.6
+2021-09-17,28.639
+2021-09-18,28.589
+2021-09-19,28.565
+2021-09-20,28.589
+2021-09-21,28.676
+2021-09-22,28.616
+2021-09-23,28.596
+2021-09-24,28.6
+2021-09-25,28.594
+2021-09-26,28.587
+2021-09-27,28.61
+2021-09-28,28.551
+2021-09-29,28.555
+2021-09-30,28.538
+2021-10-01,28.552
+2021-10-02,28.566
+2021-10-03,28.548
+2021-10-04,28.538
+2021-10-05,28.558
+2021-10-06,28.561
+2021-10-07,28.563
+2021-10-08,28.554
+2021-10-09,28.611
+2021-10-10,28.594
+2021-10-11,28.563
+2021-10-12,28.555
+2021-10-13,28.54
+2021-10-14,28.525
+2021-10-15,28.535
+2021-10-16,28.57
+2021-10-17,28.547
+2021-10-18,28.544
+2021-10-19,28.55
+2021-10-20,28.557
+2021-10-21,28.588
+2021-10-22,28.58
+2021-10-23,28.557
+2021-10-24,28.565
+2021-10-25,28.542
+2021-10-26,28.507
+2021-10-27,28.492
+2021-10-28,28.563
+2021-10-29,28.606
+2021-10-30,28.606
+2021-10-31,28.671
+2021-11-01,28.808
+2021-11-02,28.836
+2021-11-03,28.836
+2021-11-04,28.856
+2021-11-05,28.861
+2021-11-06,28.887
+2021-11-07,28.884
+2021-11-08,28.864
+2021-11-09,28.859
+2021-11-10,28.844
+2021-11-11,28.839
+2021-11-12,28.891
+2021-11-13,28.879
+2021-11-14,28.895
+2021-11-15,28.906
+2021-11-16,28.907
+2021-11-17,28.941
+2021-11-18,28.996
+2021-11-19,28.941
+2021-11-20,28.976
+2021-11-21,28.99
+2021-11-22,28.99
+2021-11-23,28.937
+2021-11-24,28.952
+2021-11-25,28.966
+2021-11-26,28.945
+2021-11-27,28.937
+2021-11-28,28.946
+2021-11-29,28.923
+2021-11-30,28.94
+2021-12-01,28.939
+2021-12-02,29.008
+2021-12-03,28.896
+2021-12-04,28.928
+2021-12-05,28.904
+2021-12-06,29.015
+2021-12-07,28.936
+2021-12-08,28.917
+2021-12-09,28.937
+2021-12-10,28.998
+2021-12-11,29.058
+2021-12-12,29.009
+2021-12-13,29.019
+2021-12-14,28.971
+2021-12-15,29.029
+2021-12-16,29.105
+2021-12-17,29.038
+2021-12-18,28.965
+2021-12-19,28.997
+2021-12-20,29.078
+2021-12-21,29.028
+2021-12-22,29.039
+2021-12-23,28.976
+2021-12-24,28.972
+2021-12-25,28.949
+2021-12-26,28.957
+2021-12-27,28.945
+2021-12-28,28.956
+2021-12-29,28.936
+2021-12-30,28.94
+2021-12-31,28.94
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/README.md b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/README.md
new file mode 100755
index 0000000000..206618abe6
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/README.md
@@ -0,0 +1,24 @@
+# Testing BMI Python modules.
+ - model.py: This file is the "model" it takes inputs and gives an output
+ - bmi_model.py: This is the Basic Model Interface that talks with the model. This is what we are testing.
+ - run_bmi_model.py: This is a file that mimics the framework, in the sense that it initializes the model with the BMI function. Then it runs the model with the BMI Update function, etc.
+ - run_bmi_unit_test.py: This is a file that runs each BMI unit test to make sure that the BMI is complete and functioning as expected.
+ - config.yml: This is a configuration file that the BMI reads to set inital_time (initial value of current_model_time) and time_step_seconds (time_step_size).
+ - environment.yml: Environment file with the required Python libraries needed to run the model with BMI. Create the environment with this command: `conda env create -f environment.yml`, then activate it with `conda activate bmi_test`
+
+# About
+This is an implementation of a Python-based model that fulfills the Python language BMI interface and can be used in the Framework. This Python BMI interface servers as a USGS water level observation station data provider to force NextGen coastal models (SCHISM, DFlowFM) with a single offshore water level boundary upstream of the Lake Champlain domain.
+
+# Implementation Details
+The USGS data provider BMI here serves to provide USGS station water level data to coastal models all the up until 2023-01-01 00:00:00. Any time beyond the last observation time of the USGS station data will serve as a constant value over future forecast times for a given coastal model application for the Lake Champlain domain. We will be updating the USGS observation csv dataset in the near future with close to realtime values.
+## Test the complete BMI functionality
+`python run_bmi_unit_test.py`
+
+## Run the model
+`python run_bmi_model.py`
+
+## Sample output
+model time, ETA2_bnd
+3600.00, 29.84
+7200.00, 30.45
+10800.00, 30.89
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/__init__.py b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/__init__.py
new file mode 100755
index 0000000000..896edc66a8
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/__init__.py
@@ -0,0 +1 @@
+from .bmi_model import bmi_model
\ No newline at end of file
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/__main__.py b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/__main__.py
new file mode 100755
index 0000000000..729246e248
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/__main__.py
@@ -0,0 +1,5 @@
+from run_bmi_model import execute
+
+# TODO: maybe add something for running tests also
+if __name__ == '__main__':
+    execute()
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/bmi_grid.py b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/bmi_grid.py
new file mode 100755
index 0000000000..3dddcd2238
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/bmi_grid.py
@@ -0,0 +1,310 @@
+"""bmi_grid.py
+Module for supporting BMI grid meta data and functionality
+
+@author Nels Frazier
+@version 0.1
+"""
+
+from enum import Enum
+from functools import reduce
+from typing import TYPE_CHECKING
+import numpy as np
+
+if TYPE_CHECKING:
+    from typing import Tuple
+    from numpy.typing import NDArray
+
+_error_on_grid_type: bool = False
+
+def error_on_grid_type(flag: bool = False) -> None:
+    """Set the behavior of the module to throw an error on grid functions that are not applicable.
+
+    Args:
+        flag (bool): 
+            True will enable exceptions to be thrown for access to grid functions that are not applicable to the grid type.
+            
+            False will attempt to provide reasonable default semantics for returning information from those functions.
+
+    Returns:
+        None
+    """
+    global _error_on_grid_type
+    _error_on_grid_type = flag
+
+class GridTypeAccessError(TypeError):
+    """Grid meta data not accessible for grid type"""
+
+class GridType(str, Enum):
+    """
+        Enumeration of supported BMI grid types (https://bmi.readthedocs.io/en/stable/#get-grid-type)
+    """
+    scalar = "scalar", #0 dim
+    points = "points", #1 dim
+    vector = "vector", #1 dim
+    unstructured = "unstructured", #1-N
+    structured_quadrilateral = "structured_quadrilaterl", #2 dim
+    rectilinear = "rectilinear", #2 dim dx != dy
+    uniform_rectilinear = "uniform_rectilinear" #2 dim -- dx = dy
+
+class GridUnits(Enum):
+    """
+        Enumeration of supported Grid Units to facilitate framework interactions
+    """
+    none = -1
+    m = 0
+    km = 1
+
+class Grid():
+    """
+        Structure for holding required BMI meta data for any grid intended to be used via BMI
+    """
+    def __init__(self, id: int, rank: int , type: GridType, units: GridUnits = GridUnits.none) :
+        """_summary_
+
+        Args:
+            id (int): User defined identifier for this grid
+            rank (int): The number of dimensions of the grid
+            type (GridType): The type of BMI grid this meta data represents
+        """
+        self._id: int = id
+        self._rank: int = rank
+        self._size: int = 0
+        self._type: GridType = type #FIXME validate type/rank?
+        self._shape: 'NDArray[np.int32]' = None #array of size rank
+        self._spacing: 'NDArray[np.float64]' = None #array of size rank
+        self._origin: 'NDArray[np.float64]' = None #array of size rank
+        self._grid_x: 'NDArray[np.float64]' = None #array of size rank
+        self._grid_y: 'NDArray[np.float64]' = None #array of size rank
+        self._grid_z: 'NDArray[np.float64]' = None #array of size rank
+        self._units: 'NDArray[np.int16]' = None #array of size rank
+
+        if( rank == 0 ):
+            # We have to use a 1 dim representation for a scalar cause numpy initialization is weird
+            # np.zeros( [1] ) gives you an array([0.])
+            # np.zeros( [0] ) gives you an emptty array([])
+            # np.zeros( () ) gives a scalar wrapped in an array array(0.)
+            # This latter is really what we want, but then it is hard to communicate the actual size
+            # (as a numerical value...)
+            self._shape = np.zeros( (), np.int32 ) #note, int32 is important here -- assumed by ngen
+            self._spacing = np.zeros( (), np.float64 )
+            self._origin = np.zeros( (), np.float64 )
+            self._units = np.ones( (), dtype=np.int16)
+            self._units[()] = units.value
+            #self._shape[...] = 1
+        else:
+            self._shape = np.zeros( rank, np.int32) #set the shape rank, with 0 allocated values
+            self._spacing = np.zeros( rank, np.float64 )
+            self._origin = np.zeros( rank, np.float64 )
+            self._units = np.array( [units.value]*rank, dtype=np.int16)
+        #Make the array "immutable", can only modify via setting
+        self._shape.flags.writeable = False
+ 
+    # TODO consider restricting resetting of grid values after they have been initialized
+
+    @property
+    def units(self) -> 'NDArray[np.int16]':
+        """The grid units, specifically the units of grid spacing in each rank
+
+        Raises:
+            GridTypeAccessError: When error_on_grid_type is toggled on, this exeption is raised when called on a scalar grid.
+
+        Returns:
+            NDArray[np.int16]: array of GridUnit enum VALUES denoting the grid unit for each rank.
+        """
+        if _error_on_grid_type and self.type == GridType.scalar:
+            raise GridTypeAccessError("Scalar has no grid units")
+        return self._units
+    
+    @units.setter
+    def units(self, units: 'NDArray[np.int16]'):
+        """Set the grid spacing units for each dimension.
+
+        Args:
+            units (NDArray[np.int16]): the GridUnit enum VALUES denoting the grid spacing units in each dimension.
+        """
+
+        if self.rank > 0:
+            self._units = np.array(units, dtype=np.int16)
+            self._units.flags.writeable = False
+        #noop for scalar or grids with rank < 1
+
+    @property
+    def id(self) -> int:
+        """The unique grid identifer.
+
+        Returns:
+            int: grid identifier
+        """
+        return self._id
+
+    @property
+    def rank(self) -> int:
+        """The dimensionality of the grid.
+
+        Returns:
+            int: Number of dimensions of the grid.
+        """
+        return self._rank
+
+    @property
+    def size(self) -> int:
+        """The total number of elements in the grid
+
+        Returns:
+            int: number of grid elements
+        """
+        return self._size
+        #if _error_on_grid_type and self.type == GridType.scalar:
+        #    raise GridTypeAccessError("Scalar has no grid size")
+
+        #if self.shape is None or self.shape.ndim == 0: #it is None or np.array( () )
+        #    return 0
+        #else:
+        #    #multiply the shape of each dimension together
+        #    return reduce( lambda x, y: x*y, self._shape)
+
+    @property
+    def type(self) -> GridType:
+        """The type of BMI grid.
+
+        Returns:
+            GridType: bmi grid type
+        """
+        return self._type
+    
+    @property
+    def shape(self) -> 'NDArray[np.int32]':
+        """The shape of the grid (the size of each dimension)
+
+        Returns:
+            NDArray[np.int32]: size of each dimension
+        """
+        """
+            From the BMI docs:
+            The grid shape is the number of rows and columns of nodes,
+            as opposed to other types of element (such as cells or faces). 
+            It is possible for grid values to be associated with the nodes or with the cells.
+        """
+        if _error_on_grid_type and self.type == GridType.scalar:
+            raise GridTypeAccessError("Scalar has no shape")
+        return self._shape
+    
+    @shape.setter
+    def shape(self, shape: 'NDArray[np.int32]') -> None:
+        """Set the shape of the grid to the provided shape
+
+        Args:
+            shape (NDArray[np.int32]): the size of each dimension of the grid
+        """
+        #Create a new shape array and replace the old one, make it immutable
+        if self.rank > 0:
+            self._shape = np.array(shape, dtype=np.int32)
+            self._shape.flags.writeable = False
+        #noop for scalar or grids with rank < 1
+
+    @property
+    def spacing(self) -> 'NDArray[np.float64]':
+        """The spacing of the grid
+
+        Returns:
+            NDArray[np.float64]: Tuple of size rank with the spacing in each of rank dimensions
+        """
+        if _error_on_grid_type and self.type == GridType.scalar:
+            raise GridTypeAccessError("Scalar has no grid spacing")
+        return self._spacing
+    
+    @spacing.setter
+    def spacing(self, spacing: 'NDArray[np.float64]') -> None:
+        """Set the spacing of each grid dimension.
+
+        Args:
+            spacing (NDArray[np.float64]): Tuple of size rank with the spacing for each dimension
+        """
+        if self.rank > 0:
+            self._spacing = np.array(spacing, dtype=np.float64)
+            self._spacing.flags.writeable = False
+        #noop for scalar or grids with rank < 1
+
+    @property
+    def origin(self) -> 'NDArray[np.float64]':
+        """The origin point of the grid
+
+        Returns:
+            NDArray[np.float64]: Tuple of size rank with the coordinates of the the grid origin
+        """
+        if _error_on_grid_type and self.type == GridType.scalar:
+            raise GridTypeAccessError("Scalar has no grid origin")
+        return self._origin
+    
+    @origin.setter
+    def origin(self, origin: 'NDArray[np.float64]') -> None:
+        """Set the grid origin location
+
+        Args:
+            origin (NDArray[np.float64]): Tuple of size rank with grid origin coordinates.
+        """
+        if self.rank > 0:
+            self._origin = np.array(origin, dtype=np.float64)
+            self._origin.flags.writeable = False
+        #noop for scalar or grids with rank < 1
+
+    @property
+    def grid_x(self) -> 'NDArray[np.float64]':
+        """Coordinates of the x components of the grid
+
+        Returns:
+            NDArray[np.float64]: array of cooridnate values in the x direction
+        """
+        if _error_on_grid_type and self.type == GridType.scalar:
+            raise GridTypeAccessError("Scalar has no grid x value")
+        else:
+            return self._grid_x
+        #TODO refactor this -- not generic to grid, this works for structured/quads, not for unstructured
+        #if (self.type == GridType.rectilinear or self.type == GridType.uniform_rectilinear) and len(self.shape) > 0:
+        #    # https://bmi.readthedocs.io/en/stable/model_grids.html#model-grids
+        #    # bmi states dimension info in `ij` form (last dimension indexed first...) in the shape meta
+        #    # so x would at index rank, y at rank-1, z at rank-2 ect...
+        #    idx = self.rank-1 #index is 0 based, rank is 1 based, adjust...
+        #    return np.array( [ self.origin[idx] + self.spacing[idx]*x for x in range(self.shape[idx]) ], dtype=np.float64 )
+        #else:    
+        #    #TODO should this raise an error or return an empty array?
+        #    #raise RuntimeError(f"Cannot get x coordinates of grid with shape {self.shape}")
+        #    return np.array((), dtype=np.float64)
+    
+    @property
+    def grid_y(self) -> 'NDArray[np.float64]':
+        """Coordinates of the y components of the grid
+
+        Returns:
+            NDArray[np.float64]: array of coordinate values in the y direction
+        """
+        if _error_on_grid_type and self.type == GridType.scalar:
+            raise GridTypeAccessError("Scalar has no grid y value")
+        else:
+            return self._grid_y
+        #if (self.type == GridType.rectilinear or self.type == GridType.uniform_rectilinear) and len(self.shape) > 1:
+        #    idx = self.rank-2 #index is 0 based, rank is 1 based, adjust...
+        #    return np.array( [ self.origin[idx] + self.spacing[idx]*y for y in range(self.shape[idx]) ], dtype=np.float64 )
+        #else:    
+        #    #TODO should this raise an error or return an empty array?
+        #    #raise RuntimeError(f"Cannot get y coordinates of grid with shape {self.shape}")
+        #    return np.array((), dtype=np.float64)
+    
+    @property
+    def grid_z(self) -> 'NDArray[np.float64]':
+        """Coordinates of the z components of the grid
+
+        Returns:
+            NDArray[np.float64]: array of coordinate values in the z direction
+        """
+        if _error_on_grid_type and self.type == GridType.scalar:
+            raise GridTypeAccessError("Scalar has no grid z value")
+        else:
+            return self._grid_z
+        #if (self.type == GridType.rectilinear or self.type == GridType.uniform_rectilinear) and len(self.shape) > 2:
+        #    idx = self.rank-3 #index is 0 based, rank is 1 based, adjust...
+        #    return np.array( [ self.origin[idx] + self.spacing[idx]*z for z in range(self.shape[idx]) ], dtype=np.float64 )
+        #else:    
+        #    #TODO should this raise an error or return an empty array?
+        #    #raise RuntimeError(f"Cannot get z coordinates of grid with shape {self.shape}")
+        #    return np.array((), dtype=np.float64)
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/bmi_model.py b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/bmi_model.py
new file mode 100755
index 0000000000..4b22c79ad2
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/bmi_model.py
@@ -0,0 +1,576 @@
+# Need these for BMI
+# This is needed for get_var_bytes
+from pathlib import Path
+import os
+# import data_tools
+# Basic utilities
+import numpy as np
+import pandas as pd
+# Configuration file functionality
+import yaml
+from bmipy import Bmi
+import datetime
+from bmi_grid import Grid, GridType
+# Here is the model we want to run
+from model import usgs_lake_champlain_model
+
+class UnknownBMIVariable(RuntimeError):
+    pass
+
+class bmi_model(Bmi):
+
+    def __init__(self):
+        """Create a model that is ready for initialization."""
+        super(bmi_model, self).__init__()
+        self._values = {}
+        self._start_time = 0.0
+        self._end_time = np.finfo(float).max
+        self._model = None
+        self.var_array_lengths = 1
+
+    #----------------------------------------------
+    # Required, static attributes of the model
+    #----------------------------------------------
+    _att_map = {
+        'model_name':         'Lake Champlain USGS Observation Water level Forcing BMI',
+        'version':            '1.0',
+        'author_name':        'Jason Ducker',
+        'grid_type':          'points',
+        'time_units':         'seconds',
+               }
+
+    #---------------------------------------------
+    # Input variable names (CSDMS standard names)
+    #---------------------------------------------
+    _input_var_names = []
+    _input_var_types = {}
+
+    #---------------------------------------------
+    # Output variable names (CSDMS standard names)
+    #---------------------------------------------
+    _output_var_names = ['ETA2_bnd']
+
+    #------------------------------------------------------
+    # Create a Python dictionary that maps CSDMS Standard
+    # Names to the model's internal variable names.
+    # This is going to get long, 
+    #     since the input variable names could come from any forcing...
+    #------------------------------------------------------
+    #_var_name_map_long_first = {
+    _var_name_units_map = {'ETA2_bnd':['ETA2_bnd','m']}
+
+    #------------------------------------------------------
+    # A list of static attributes/parameters.
+    #------------------------------------------------------
+    _model_parameters_list = []
+
+    #------------------------------------------------------------
+    #------------------------------------------------------------
+    # BMI: Model Control Functions
+    #------------------------------------------------------------ 
+    #------------------------------------------------------------
+
+    #-------------------------------------------------------------------
+    def initialize( self, bmi_cfg_file_name: str ):
+
+        # ----- Create some lookup tabels from the long variable names --------#
+        self._var_name_map_long_first = {long_name:self._var_name_units_map[long_name][0] for long_name in self._var_name_units_map.keys()}
+        self._var_name_map_short_first = {self._var_name_units_map[long_name][0]:long_name for long_name in self._var_name_units_map.keys()}
+        self._var_units_map = {long_name:self._var_name_units_map[long_name][1] for long_name in self._var_name_units_map.keys()}
+        
+        # -------------- Read in the BMI configuration -------------------------#
+        if not isinstance(bmi_cfg_file_name, str) or len(bmi_cfg_file_name) == 0:
+            raise RuntimeError("No BMI initialize configuration provided, nothing to do...")
+
+        bmi_cfg_file = Path(bmi_cfg_file_name).resolve()
+        if not bmi_cfg_file.is_file():
+            raise RuntimeError("No configuration provided, nothing to do...")
+
+        with bmi_cfg_file.open('r') as fp:
+            cfg = yaml.safe_load(fp)
+        self.cfg_bmi = self._parse_config(cfg)
+
+        self.grid_0: Grid = Grid(0, 1, GridType.points) #Grid 0 is a 2 dimension "grid" for points
+        self.grid_0._grid_x = np.array([self.cfg_bmi['Obs_Lon']],dtype=float)
+        self.grid_0._grid_y = np.array([self.cfg_bmi['Obs_Lat']],dtype=float)
+        self.grid_0._shape = self.grid_0._grid_x.shape
+        self.grid_0._size = 1
+        self._grids = [self.grid_0]
+
+        # Assign input and output variables to their respective grid class
+        self._grid_map = {'ETA2_bnd': self.grid_0}
+
+        # ------------- Initialize the parameters, inputs and outputs ----------#
+        for parm in self._model_parameters_list:
+            self._values[self._var_name_map_short_first[parm]] = self.cfg_bmi[parm]
+        for model_input in self.get_input_var_names():
+            #This won't actually allocate the size, just the rank...
+            if self._grid_map[model_input].type == GridType.scalar:
+                self._values[model_input] = np.zeros( (), dtype=float)
+            else: 
+                self._values[model_input] = np.zeros(self._grid_map[model_input].shape, dtype=float)        
+        #for model_input in self._input_var_types:
+        #    self._values[model_input] = np.zeros(self.var_array_lengths, dtype=self._input_var_types[model_input])
+        for model_output in self.get_output_var_names():
+            #TODO why is output var 3 an arange?  should this be a unique "grid"?
+            if self._grid_map[model_output].type == GridType.scalar:
+                self._values[model_output] = np.zeros( (), dtype=float)
+            else:
+                self._values[model_output] = np.zeros(self._grid_map[model_output].shape, dtype=float)
+
+        # ------------- Set time to initial value -----------------------#
+        self._values['current_model_time'] = self.cfg_bmi['initial_time']
+        
+        # ------------- Set time step size -----------------------#
+        self._values['time_step_size'] = self.cfg_bmi['time_step_seconds']
+
+        # ------------- Set forecast start time -----------------------#
+        self._values['start_timestamp'] = self.cfg_bmi['start_timestamp']
+
+        # ------------- Set SCHISM boundary coordinates -----------------------#
+
+        # Extract observation data and interpolate down to hourly data using
+        # pandas dataframe then assign to BMI model class
+        obs_df = pd.read_csv(self.cfg_bmi['Obs_Data'])
+        obs_df.index = pd.to_datetime(obs_df[obs_df.columns[0]])
+        obs_df = obs_df.resample('H').interpolate()
+
+        # Set datetime stamps from USGS observation dataset to the model
+        # class for use during data provider model execution
+        self._values['Obs_Data'] = obs_df[obs_df.columns[1]].values
+        self._values['Obs_datetimes'] = obs_df.index.to_pydatetime()
+
+        # ------------- Initialize a model ------------------------------#
+        self._model = usgs_lake_champlain_model()
+
+    #------------------------------------------------------------ 
+    def update(self):
+        """
+        Update/advance the model by one time step.
+        """
+        self._values['current_model_time'] += self._values['time_step_size']
+        self.update_until(self._values['current_model_time'])
+    
+    #------------------------------------------------------------ 
+    def update_until(self, future_time: float):
+        """
+        Update the model to a particular time
+
+        Parameters
+        ----------
+        future_time : float
+            The future time to when the model should be advanced.
+        """
+        # Flag to see if update is just a single model time step
+        # otherwise we must perform a time loop to iterate data until
+        # requested time stamp
+        if(future_time != self._values['current_model_time']):
+            while(self._values['current_model_time'] < future_time):
+                self._values['current_model_time'] += self._values['time_step_size']
+                self._model.run(self._values, self._values['current_model_time'])
+        # This is just a single model time step (1 hour) update
+        else:
+            self._model.run(self._values, future_time)
+
+    #------------------------------------------------------------    
+    def finalize( self ):
+        """Finalize model."""
+        self._model = None
+    #-------------------------------------------------------------------
+    #-------------------------------------------------------------------
+    # BMI: Model Information Functions
+    #-------------------------------------------------------------------
+    #-------------------------------------------------------------------
+    
+    def get_attribute(self, att_name):
+    
+        try:
+            return self._att_map[ att_name.lower() ]
+        except:
+            print(' ERROR: Could not find attribute: ' + att_name)
+
+    #--------------------------------------------------------
+    # Note: These are currently variables needed from other
+    #       components vs. those read from files or GUI.
+    #--------------------------------------------------------   
+    def get_input_var_names(self):
+
+        return self._input_var_names
+
+    def get_output_var_names(self):
+ 
+        return self._output_var_names
+
+    #------------------------------------------------------------ 
+    def get_component_name(self):
+        """Name of the component."""
+        return self.get_attribute( 'model_name' ) #JG Edit
+
+    #------------------------------------------------------------ 
+    def get_input_item_count(self):
+        """Get names of input variables."""
+        return len(self._input_var_names)
+
+    #------------------------------------------------------------ 
+    def get_output_item_count(self):
+        """Get names of output variables."""
+        return len(self._output_var_names)
+
+    #------------------------------------------------------------ 
+    def get_value(self, var_name: str, dest: np.ndarray) -> np.ndarray:
+        """Copy of values.
+        Parameters
+        ----------
+        var_name : str
+            Name of variable as CSDMS Standard Name.
+        dest : ndarray
+            A numpy array into which to place the values.
+        Returns
+        -------
+        array_like
+            Copy of values.
+        """
+        if var_name == "grid:count":
+            dest[...] = 2
+        elif var_name == "grid:ids":
+            dest[:] = [self.grid_0.id]
+        elif var_name == "grid:ranks":
+            dest[:] = [self.grid_0.rank]
+        else:
+            dest[:] = self.get_value_ptr(var_name)
+        return dest
+
+    #-------------------------------------------------------------------
+    def get_value_ptr(self, var_name: str) -> np.ndarray:
+        """Reference to values.
+        Parameters
+        ----------
+        var_name : str
+            Name of variable as CSDMS Standard Name.
+        Returns
+        -------
+        array_like
+            Value array.
+        """
+
+        #Make sure to return a flattened array
+        if(var_name == "grid_0_shape"): # FIXME cannot expose shape as ptr, because it has to side affect variable construction...
+            return self.grid_0.shape
+        if(var_name == "grid_0_spacing"):
+            return self.grid_0.spacing
+        if(var_name == "grid_0_origin"):
+            return self.grid_0.origin
+        if(var_name == "grid_0_units"):
+            return self.grid_0.units
+
+        if var_name not in self._values.keys():
+            raise(UnknownBMIVariable(f"No known variable in BMI model: {var_name}"))
+
+        shape = self._values[var_name].shape
+
+        try:
+            #see if raveling is possible without a copy
+            self._values[var_name].shape = (-1,)
+            #reset original shape
+            self._values[var_name].shape = shape
+        except ValueError as e:
+            raise RuntimeError("Cannot flatten array without copying -- "+str(e).split(": ")[-1])
+
+        return self._values[var_name].ravel()#.reshape((-1,))
+
+    #-------------------------------------------------------------------
+    #-------------------------------------------------------------------
+    # BMI: Variable Information Functions
+    #-------------------------------------------------------------------
+    #-------------------------------------------------------------------
+    def get_var_name(self, long_var_name):
+                              
+        return self._var_name_map_long_first[ long_var_name ]
+
+    #-------------------------------------------------------------------
+    def get_var_units(self, long_var_name):
+
+        return self._var_units_map[ long_var_name ]
+                                                             
+    #-------------------------------------------------------------------
+    def get_var_type(self, var_name: str) -> str:
+        """Data type of variable.
+
+        Parameters
+        ----------
+        var_name : str
+            Name of variable as CSDMS Standard Name.
+
+        Returns
+        -------
+        str
+            Data type.
+        """
+        return str(self.get_value_ptr(var_name).dtype)
+    
+    #------------------------------------------------------------ 
+    def get_var_grid(self, name):
+        
+        # all vars have grid 0 but check if its in names list first
+        if name in (self._output_var_names + self._input_var_names):
+            if(name== "ETA2_bnd"):
+                return 0 
+            else:
+                return self._var_grid_id
+        raise(UnknownBMIVariable(f"No known variable in BMI model: {name}"))
+
+    #------------------------------------------------------------ 
+    def get_var_itemsize(self, name):
+        return self.get_value_ptr(name).itemsize
+
+    #------------------------------------------------------------ 
+    def get_var_location(self, name):
+        #FIXME what about grid vars?
+        #if name in (self._output_var_names + self._input_var_names):
+        #    return self._var_loc
+        if(name == 'ETA2_bnd'):
+            return "node"
+        else:
+            return None
+
+    #-------------------------------------------------------------------
+    def get_var_rank(self, long_var_name):
+        if(long_var_name == "ETA2_bnd"):
+            return np.int16(0)
+
+    #-------------------------------------------------------------------
+    def get_start_time( self ):
+    
+        return self._start_time 
+
+    #-------------------------------------------------------------------
+    def get_end_time( self ) -> float:
+
+        return self._end_time 
+
+
+    #-------------------------------------------------------------------
+    def get_current_time( self ):
+
+        return self._values['current_model_time']
+
+    #-------------------------------------------------------------------
+    def get_time_step( self ):
+
+        return self._values['time_step_size']
+
+    #-------------------------------------------------------------------
+    def get_time_units( self ):
+
+        return self.get_attribute( 'time_units' ) 
+       
+    #-------------------------------------------------------------------
+    def set_value(self, var_name, values: np.ndarray):
+        """
+        Set model values for the provided BMI variable.
+
+        Parameters
+        ----------
+        var_name : str
+            Name of model variable for which to set values.
+        values : np.ndarray
+              Array of new values.
+        """ 
+        self._values[var_name][:] = values
+
+    #------------------------------------------------------------ 
+    def set_value_at_indices(self, var_name: str, indices: np.ndarray, src: np.ndarray):
+        """
+        Set model values for the provided BMI variable at particular indices.
+
+        Parameters
+        ----------
+        var_name : str
+            Name of model variable for which to set values.
+        indices : array_like
+            Array of indices of the variable into which analogous provided values should be set.
+        src : array_like
+            Array of new values.
+        """
+        # This is not particularly efficient, but it is functionally correct.
+        for i in range(indices.shape[0]):
+            bmi_var_value_index = indices[i]
+            self.get_value_ptr(var_name)[bmi_var_value_index] = src[i]
+
+    #------------------------------------------------------------ 
+    def get_var_nbytes(self, var_name) -> int:
+        """
+        Get the number of bytes required for a variable.
+        Parameters
+        ----------
+        var_name : str
+            Name of variable.
+        Returns
+        -------
+        int
+            Size of data array in bytes.
+        """
+        return self.get_value_ptr(var_name).nbytes
+
+    #------------------------------------------------------------ 
+    def get_value_at_indices(self, var_name: str, dest: np.ndarray, indices: np.ndarray) -> np.ndarray:
+        """Get values at particular indices.
+        Parameters
+        ----------
+        var_name : str
+            Name of variable as CSDMS Standard Name.
+        dest : np.ndarray
+            A numpy array into which to place the values.
+        indices : np.ndarray
+            Array of indices.
+        Returns
+        -------
+        np.ndarray
+            Values at indices.
+        """
+        original: np.ndarray = self.get_value_ptr(var_name)
+        for i in range(indices.shape[0]):
+            value_index = indices[i]
+            dest[i] = original[value_index]
+        return dest
+
+    # JG Note: remaining grid funcs do not apply for type 'scalar'
+    #   Yet all functions in the BMI must be implemented 
+    #   See https://bmi.readthedocs.io/en/latest/bmi.best_practices.html          
+    #------------------------------------------------------------ 
+    def get_grid_edge_count(self, grid):
+        raise NotImplementedError("get_grid_edge_count")
+
+    #------------------------------------------------------------ 
+    def get_grid_edge_nodes(self, grid, edge_nodes):
+        raise NotImplementedError("get_grid_edge_nodes")
+
+    #------------------------------------------------------------ 
+    def get_grid_face_count(self, grid):
+        raise NotImplementedError("get_grid_face_count")
+    
+    #------------------------------------------------------------ 
+    def get_grid_face_edges(self, grid, face_edges):
+        raise NotImplementedError("get_grid_face_edges")
+
+    #------------------------------------------------------------ 
+    def get_grid_face_nodes(self, grid, face_nodes):
+        raise NotImplementedError("get_grid_face_nodes")
+    
+    #------------------------------------------------------------ /get_value
+    def get_grid_node_count(self, grid):
+        raise NotImplementedError("get_grid_node_count")
+
+    #------------------------------------------------------------ 
+    def get_grid_nodes_per_face(self, grid, nodes_per_face):
+        raise NotImplementedError("get_grid_nodes_per_face") 
+    
+    #------------------------------------------------------------ 
+    def get_grid_origin(self, grid_id, origin):
+
+        for grid in self._grids:
+            if grid_id == grid.id: 
+                origin[:] = grid.origin
+                return
+        raise ValueError(f"get_grid_origin: grid_id {grid_id} unknown")
+
+
+    #------------------------------------------------------------ 
+    def get_grid_rank(self, grid_id):
+ 
+        for grid in self._grids:
+            if grid_id == grid.id: 
+                return grid.rank
+        raise ValueError(f"get_grid_rank: grid_id {grid_id} unknown")
+
+    #------------------------------------------------------------ 
+    def get_grid_shape(self, grid_id):
+
+        for grid in self._grids:
+            if grid_id == grid.id:
+                return grid.shape
+        raise ValueError(f"get_grid_shape: grid_id {grid_id} unknown")
+
+    #------------------------------------------------------------ 
+    def get_grid_size(self, grid_id):
+       
+        for grid in self._grids:
+            if grid_id == grid.id: 
+                return grid.size
+        raise ValueError(f"get_grid_size: grid_id {grid_id} unknown")
+
+    #------------------------------------------------------------ 
+    def get_grid_spacing(self, grid_id):
+
+        for grid in self._grids:
+            if grid_id == grid.id: 
+                return grid.spacing
+        raise ValueError(f"get_grid_spacing: grid_id {grid_id} unknown") 
+
+    #------------------------------------------------------------ 
+    def get_grid_type(self, grid_id):
+
+        for grid in self._grids:
+            if grid_id == grid.id: 
+                return grid.type
+        raise ValueError(f"get_grid_type: grid_id {grid_id} unknown")
+
+    #------------------------------------------------------------ 
+    def get_grid_x(self, grid_id: int):
+        for grid in self._grids:
+            if grid_id == grid.id: 
+                return grid.grid_x
+        raise ValueError(f"get_grid_x: grid_id {grid_id} unknown")
+
+    #------------------------------------------------------------ 
+    def get_grid_y(self, grid_id: int):
+        for grid in self._grids:
+            if grid_id == grid.id: 
+                return grid.grid_y
+        raise ValueError(f"get_grid_y: grid_id {grid_id} unknown")
+
+    #------------------------------------------------------------ 
+    def get_grid_z(self, grid_id: int):
+        for grid in self._grids:
+            if grid_id == grid.id: 
+                return grid.grid_z
+        raise ValueError(f"get_grid_z: grid_id {grid_id} unknown")
+
+
+    #------------------------------------------------------------ 
+    #------------------------------------------------------------ 
+    #-- Random utility functions
+    #------------------------------------------------------------ 
+    #------------------------------------------------------------ 
+
+    def _parse_config(self, cfg):
+        for key, val in cfg.items():
+            # convert all path strings to PosixPath objects
+            if any([key.endswith(x) for x in ['_dir', '_path', '_file', '_files']]):
+                if (val is not None) and (val != "None"):
+                    if isinstance(val, list):
+                        temp_list = []
+                        for element in val:
+                            temp_list.append(Path(element))
+                        cfg[key] = temp_list
+                    else:
+                        cfg[key] = Path(val)
+                else:
+                    cfg[key] = None
+
+            # convert Dates to pandas Datetime indexs
+            elif key.endswith('_date'):
+                if isinstance(val, list):
+                    temp_list = []
+                    for elem in val:
+                        temp_list.append(pd.to_datetime(elem, format='%d/%m/%Y'))
+                    cfg[key] = temp_list
+                else:
+                    cfg[key] = pd.to_datetime(val, format='%d/%m/%Y')
+            #elif key.endswith('_timestamp'):
+            #    cfg[key] = pd.to_datetime(val)
+            else:
+                pass
+
+        # Add more config parsing if necessary
+        return cfg
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/config.yml b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/config.yml
new file mode 100755
index 0000000000..aa8b62db0b
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/config.yml
@@ -0,0 +1,6 @@
+time_step_seconds: 3600
+initial_time: 0
+start_timestamp: "2023-01-01 00:00:00"
+Obs_Data: "./02OJ016_UTC_mNAVD88.csv"
+Obs_Lat: 46.990329
+Obs_Lon: -70.766700
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/environment.yml b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/environment.yml
new file mode 100755
index 0000000000..f43dd87c75
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/environment.yml
@@ -0,0 +1,19 @@
+name: bmi_test
+channels:
+  - defaults
+  - anaconda
+  - conda-forge
+dependencies:
+  - bmipy
+  - bokeh
+  - pandas
+  - python=3.7
+  - ruamel.yaml
+  - netCDF4
+  - mpi4py
+  - ESMF
+  - datetime
+  - netCDF4
+  - os
+  - time
+  - pathlib
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/model.py b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/model.py
new file mode 100755
index 0000000000..9d1be793e4
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/model.py
@@ -0,0 +1,44 @@
+from datetime import datetime
+import pandas as pd
+import numpy as np
+
+class usgs_lake_champlain_model():
+
+    def run(self, model: dict, future_time: float):
+        """
+        Run this model into the future.
+
+        Run this model into the future, updating the state stored in the provided model dict appropriately.
+
+        Note that the model assumes the current values set for input variables are appropriately for the time
+        duration of this update (i.e., ``dt``) and do not need to be interpolated any here.
+
+        Parameters
+        ----------
+        model: dict
+            The model state data structure.
+        dt: int
+            The number of seconds into the future to advance the model.
+
+        Returns
+        -------
+
+        """
+
+        current_time = pd.Timestamp(model['start_timestamp']) + pd.TimedeltaIndex(np.array([future_time],dtype=float),'s')[0]
+
+        fdate = datetime.strptime(current_time.strftime("%Y-%m-%d %H:%M:%S"), "%Y-%m-%d %H:%M:%S")
+
+        edates = model['Obs_datetimes']
+
+        # Find time index for BMI timestamp to extract waterlevels
+        time_diff = np.abs([date - fdate for date in edates])
+
+        index = time_diff.argmin(0)
+
+        print(f"Forecast date is {fdate}")
+    
+        #Update ETA2 water level boundary fields for SCHISM
+        model['ETA2_bnd'] = np.array([model['Obs_Data'][index]],dtype=float)
+        print('model output')
+        print(model['ETA2_bnd'])
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/requirements.txt b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/requirements.txt
new file mode 100755
index 0000000000..b84265bb6f
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/requirements.txt
@@ -0,0 +1,7 @@
+numpy
+pandas
+pyyaml
+bmipy
+os
+datetime
+pathlib
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/run_bmi_model.py b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/run_bmi_model.py
new file mode 100755
index 0000000000..3533e5ecb6
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/run_bmi_model.py
@@ -0,0 +1,57 @@
+from pathlib import Path
+
+import numpy as np
+np.set_printoptions(precision=20)
+# This is the BMI model that we will be running
+from bmi_model import bmi_model
+import time
+
+from typing import TYPE_CHECKING
+if TYPE_CHECKING:
+    from bmipy import Bmi
+
+def execute():
+    # creating an instance of a model
+    print('creating an instance of an BMI_MODEL model object')
+    model = bmi_model()
+
+    # Initializing the BMI
+    print('Initializing the BMI')
+    current_dir = Path(__file__).parent.resolve()
+    model.initialize(bmi_cfg_file_name=str(current_dir.joinpath('config.yml')))
+
+    ETA2_BND = np.zeros(model.grid_0._size,dtype=float)
+    # Now loop through the inputs, set the forcing values, and update the model
+    print('Now loop through the inputs, set the values, and update the model')
+    print('\n')
+    print('model time', 'ETA2_bnd')
+    start = time.time()
+    for x in range(24):
+
+        # Create test case inputs from random values ###########
+        #model.set_value('INPUT_VAR_1', np.random.uniform(2, 10, model.var_array_lengths))  ##
+        #model.set_value('INPUT_VAR_2', np.random.uniform(1, 4, model.var_array_lengths))   ##
+        
+        #########################################
+        # UPDATE THE MODEL WITH THE NEW INPUTS ##
+        model.update()     ######################
+        #########################################
+
+        # Get value for ETA2 BND and print data
+        ETA2_BND = model.get_value('ETA2_bnd',ETA2_BND)
+
+        # PRINT THE MODEL RESULTS FOR THIS TIME STEP#################################################
+        print('model time','ETA2_bnd')
+        print(model.get_current_time(), ETA2_BND)
+
+    print('BMI module time to loop through NWM Medium range (120 hours) operational configuration')
+    print(time.time() - start)
+
+    # Finalizing the BMI
+    print('Finalizing the BMI')
+    model.finalize()
+
+
+
+if __name__ == '__main__':
+    execute()
diff --git a/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/run_bmi_unit_test.py b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/run_bmi_unit_test.py
new file mode 100755
index 0000000000..ee53bfeccc
--- /dev/null
+++ b/extern/Coastal_model_waterlevel_data_providers/Lake_Champlain_USGS_Waterlevel_BMI/run_bmi_unit_test.py
@@ -0,0 +1,416 @@
+"""Run BMI Unit Testing.
+Author: jgarrett, modified by jmframe for general/simple nextgen python BMI model
+Date: 08/31/2021"""
+
+# TODO: formalize unit tests via typical "unittest" or "pytest" setup
+
+import os
+import sys
+# import torch
+# from torch import nn
+from pathlib import Path
+
+import numpy as np
+
+import bmi_model  # This is the BMI that we will be running
+
+# setup a "success counter" for number of passing and failing bmi functions
+# keep track of function def fails (vs function call)
+pass_count = 0
+fail_count = 0
+var_name_counter = 0
+fail_list = []
+
+def bmi_except(fstring):
+    """Prints message and updates counter and list
+
+    Parameters
+    ----------
+    fstring : str
+        Name of failing BMI function 
+    """
+    
+    global fail_count, fail_list, var_name_counter
+    print("**BMI ERROR** in " + fstring)
+    if (var_name_counter == 0):
+        fail_count += 1
+        fail_list.append(fstring)
+
+bmi=bmi_model.bmi_model()
+
+print("\nBEGIN BMI UNIT TEST\n*******************\n");
+
+# Define config path
+cfg_file=Path('./config.yml')
+
+if os.path.exists(cfg_file):
+    print(" configuration found: " + str(cfg_file))
+else:
+    print(" no configuration found, exiting...")
+    sys.exit()
+
+#-------------------------------------------------------------------
+# initialize()
+try: 
+    bmi.initialize('./config.yml')
+    print(" initializing...")
+    pass_count += 1
+except:
+    bmi_except('initialize()')
+
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+# BMI: Model Information Functions
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+print("\nMODEL INFORMATION\n*****************")
+
+#-------------------------------------------------------------------
+# get_component_name()
+try:
+    print (" component name: " + bmi.get_component_name())
+    pass_count += 1
+except:
+    bmi_except('get_component_name()')
+
+#-------------------------------------------------------------------
+# get_input_item_count()
+try:
+    print (" input item count: " + str(bmi.get_input_item_count()))
+    pass_count += 1
+except:
+    bmi_except('get_input_item_count()')
+
+#-------------------------------------------------------------------
+# get_output_item_count()
+try:
+    print (" output item count: " + str(bmi.get_output_item_count()))
+    pass_count += 1
+except:
+    bmi_except('get_output_item_count()')
+
+#-------------------------------------------------------------------
+# get_input_var_names()
+try:    
+    # only print statement if names exist
+    test_get_input_var_names = bmi.get_input_var_names()
+    if len(test_get_input_var_names) > 0:
+        print (" input var names: ")
+        for var_in in test_get_input_var_names:
+            print ("  " + var_in)
+    pass_count += 1
+except:
+    bmi_except('get_input_var_names()')
+
+#-------------------------------------------------------------------
+# get_input_var_names()
+try:    
+    # only print statement if out var list not null
+    test_get_output_var_names =  bmi.get_output_var_names()
+    if len(test_get_output_var_names) > 0:
+        print (" output var names: ")
+        for var_out in test_get_output_var_names:
+            print ("  " + var_out)
+    pass_count += 1
+except:
+    bmi_except('get_output_item_count()')
+    
+
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+# BMI: Variable Information Functions
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+print("\nVARIABLE INFORMATION\n********************")
+
+for var_name in (bmi.get_output_var_names() + bmi.get_input_var_names()):  
+    print (" " + var_name + ":")
+
+    #-------------------------------------------------------------------
+    # get_var_units()
+    try: 
+        print ("  units: " + bmi.get_var_units(var_name))
+        if var_name_counter == 0:
+            pass_count += 1
+    except:
+        bmi_except('get_var_units()')
+    
+    #-------------------------------------------------------------------
+    # get_var_itemsize()
+    # JG NOTE: 09.16.2021 AttributeError: 'float' object has no attribute 'dtype'
+    try:
+        print ("  itemsize: " + str(bmi.get_var_itemsize(var_name)))
+        if var_name_counter == 0:
+            pass_count += 1
+    except:
+        bmi_except('get_var_itemsize()')
+
+    #-------------------------------------------------------------------
+    # get_var_type()
+    # JG NOTE: 09.16.2021 AttributeError: 'float' object has no attribute 'dtype'
+    
+    # JF NOTE: the print statement needs a string to concatonate
+    # JF NOTE: and the type is a native python command.
+
+    try:
+        print ("  type: " + str(bmi.get_var_type(var_name)))
+        if var_name_counter == 0:
+            pass_count += 1
+    except:
+        bmi_except('get_var_type()')
+
+    #-------------------------------------------------------------------
+    # get_var_nbytes()
+    # JG NOTE: 09.16.2021 AttributeError: 'float' object has no attribute 'nbytes'
+    try:
+        print ("  nbytes: " + str(bmi.get_var_nbytes(var_name)))
+        if var_name_counter == 0:
+            pass_count += 1
+    except:
+        bmi_except('get_var_nbytes()')
+
+    #-------------------------------------------------------------------
+    # get_var_grid
+    try:
+        print ("  grid id: " + str(bmi.get_var_grid(var_name)))
+        if var_name_counter == 0:
+            pass_count += 1
+    except:
+        bmi_except('get_var_grid()')
+
+    #-------------------------------------------------------------------
+    # get_var_location
+    try:
+        print ("  location: " + bmi.get_var_location(var_name))
+        if var_name_counter == 0:
+            pass_count += 1
+    except:
+        bmi_except('get_var_location()')
+
+    var_name_counter += 1
+
+# reset back to zero
+var_name_counter = 0
+
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+# BMI: Time Functions
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+print("\nTIME INFORMATION\n****************")
+
+#-------------------------------------------------------------------
+# get_start_time()
+try:
+    print (" start time: " + str(bmi.get_start_time()))
+    pass_count += 1
+except:
+    bmi_except('get_start_time()')
+
+#-------------------------------------------------------------------
+# get_end_time()
+try:
+    print (" end time: " + str(bmi.get_end_time()))
+    pass_count += 1
+except:
+    bmi_except('get_end_time()')
+
+#-------------------------------------------------------------------
+# get_current_time()
+try:
+    print (" current time: " + str(bmi.get_current_time()))
+    pass_count += 1
+except:
+    bmi_except('get_current_time()')
+
+#-------------------------------------------------------------------
+# get_time_step()
+try:
+    print (" time step: " + str(bmi.get_time_step()))
+    pass_count += 1
+except:
+    bmi_except('get_time_step()')
+
+#-------------------------------------------------------------------
+# get_time_units()
+try:
+    print (" time units: " + bmi.get_time_units())
+    pass_count += 1
+except:
+    bmi_except('get_time_units()')
+
+
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+# BMI: Model Grid Functions
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+print("\nGRID INFORMATION\n****************")
+for grid in bmi._grids:
+
+    grid_id = grid._id
+
+    print (" grid id: " + str(grid_id))
+
+    #-------------------------------------------------------------------
+    # get_grid_rank()
+    try:
+        print ("  rank: " + str(bmi.get_grid_rank(grid_id)))
+        pass_count += 1
+    except:
+        bmi_except('get_grid_rank()')
+
+    #-------------------------------------------------------------------
+    # get_grid_size()
+    try:
+        print ("  size: " + str(bmi.get_grid_size(grid_id)))
+        pass_count += 1
+    except:
+        bmi_except('get_grid_size()')
+
+    #-------------------------------------------------------------------
+    # get_grid_type()
+    try:
+        print ("  type: " + bmi.get_grid_type(grid_id))
+        pass_count += 1
+    except:
+        bmi_except('get_grid_type()')
+
+    #-------------------------------------------------------------------
+    # get_grid_x()
+    try:
+        print ("  grid x: " + str(bmi.get_grid_x(grid_id)))
+        pass_count += 1
+    except:
+        bmi_except('get_grid_x()')
+
+    #-------------------------------------------------------------------
+    # get_grid_y()
+    try:
+        print ("  grid y: " + str(bmi.get_grid_y(grid_id)))
+        pass_count += 1
+    except:
+        bmi_except('get_grid_y()')
+
+
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+# BMI: Variable Getter and Setter Functions
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------    
+print ("\nGET AND SET VALUES\n******************")
+
+# TODO: 09.16.2021 this is a band-aid fix for how lstm handles input vars rn
+for var_name in (bmi.get_input_var_names() + bmi.get_output_var_names()):     
+    print (" " + var_name + ":" )
+
+    #-------------------------------------------------------------------
+    # set_value()
+    try:
+        dest0 = np.empty(bmi.get_grid_size(bmi.get_var_grid(var_name)), dtype=float)
+        dest0[:] = 5.0
+        bmi.set_value(var_name,dest0)
+        dest0 = np.empty(bmi.get_grid_size(bmi.get_var_grid(var_name)), dtype=float)
+        print ("  set value: 5.0 and got value: ", bmi.get_value(var_name,dest0))        
+        if var_name_counter == 0: 
+            pass_count += 1
+    except:
+        bmi_except('set_value()')
+
+    #-------------------------------------------------------------------
+    # set_value_at_indices()
+    # JG Note: 09.16.2021 this passes but values do not match?
+    #   either definition or way I am calling it here is no go       
+    try:
+        dest0 = np.empty(bmi.get_grid_size(bmi.get_var_grid(var_name)), dtype=float)
+        bmi.set_value_at_indices(var_name,np.array([0]), np.array([-9.0]))
+        print ("  set value at indices: -9.0, and got value:", bmi.get_value(var_name,dest0)[0])      
+        if var_name_counter == 0: 
+            pass_count += 1
+    except:
+        bmi_except('set_value_at_indices()')
+
+    #-------------------------------------------------------------------
+    # get_value_ptr()
+    try:
+        #print ("  get value ptr: {:.2f}".format(bmi.get_value_ptr(var_name)))
+        print ("  get value ptr: " + str(bmi.get_value_ptr(var_name)))
+        if var_name_counter == 0:
+            pass_count += 1
+    except:
+        bmi_except('get_value_ptr()')
+
+    #-------------------------------------------------------------------
+    # get_value()
+    try:
+        dest0 = np.empty(bmi.get_grid_size(bmi.get_var_grid(var_name)), dtype=float)
+        #print ("  get value: {:.2f}".format(bmi.get_value(var_name)))
+        print ("  get value: " + str(bmi.get_value(var_name,dest0)))
+        if var_name_counter == 0:
+            pass_count += 1
+    except:
+        bmi_except('get_value()')
+
+    #-------------------------------------------------------------------
+    # get_value_at_indices()
+    try:
+        dest0 = np.empty(bmi.get_grid_size(bmi.get_var_grid(var_name)), dtype=float)
+        # JMFrame NOTE: converting a list/array to a string probably won't work
+        #print ("  get value at indices: " + str(bmi.get_value_at_indices(var_name, dest0, [0])))
+
+        print ("  get value at indices: ", bmi.get_value_at_indices(var_name, dest0, np.array([0])))
+
+        if var_name_counter == 0:
+            pass_count += 1
+    except:
+        bmi_except('get_value_at_indices()')
+
+
+    var_name_counter += 1
+
+# set back to zero
+var_name_counter = 0
+
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------
+# BMI: Control Functions
+#-------------------------------------------------------------------
+#-------------------------------------------------------------------   
+print ("\nCONTROL FUNCTIONS\n*****************")    
+    
+#-------------------------------------------------------------------
+# update()
+try:
+    bmi.update()
+    # go ahead and print time to show iteration
+    # TODO: this will fail if get_current_time() does
+    print (" updating...        time " + str(bmi.get_current_time()))
+    pass_count += 1
+except:
+    bmi_except('update()')
+
+#-------------------------------------------------------------------
+# update_until()
+try:
+    bmi.update_until(future_time=36000)
+    # go ahead and print time to show iteration
+    # TODO: this will fail if get_current_time() does
+    print (" updating until...  time ", bmi.get_current_time())
+    pass_count += 1
+except:
+    bmi_except('update_until()')          
+
+#-------------------------------------------------------------------
+# finalize()
+try:
+    bmi.finalize()
+    print (" finalizing...")
+    pass_count += 1
+except:
+    bmi_except('finalize()')
+
+# lastly - print test summary
+print ("\n Total BMI function PASS: " + str(pass_count))
+print (" Total BMI function FAIL: " + str(fail_count))
+for ff in fail_list:
+    print ("  " + ff)