From 2fe5b572bc79c51785bcd17dd16e85427c1d2548 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Thu, 30 Jan 2025 11:46:43 -0500
Subject: [PATCH 01/72] [Fiber] Read the class name from props.layout (#32273)

Copypasta typo.
---
 packages/react-reconciler/src/ReactFiberCommitWork.js | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/packages/react-reconciler/src/ReactFiberCommitWork.js b/packages/react-reconciler/src/ReactFiberCommitWork.js
index b3f28d909469f..b465558ddb3fd 100644
--- a/packages/react-reconciler/src/ReactFiberCommitWork.js
+++ b/packages/react-reconciler/src/ReactFiberCommitWork.js
@@ -1212,7 +1212,7 @@ function measureUpdateViewTransition(
   );
   const layoutClassName: ?string = getViewTransitionClassName(
     props.className,
-    props.update,
+    props.layout,
   );
   let className: ?string;
   if (updateClassName === 'none') {

From 14f7c072719564ee4269c5fdadb6b8a737546422 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Thu, 30 Jan 2025 11:49:04 -0500
Subject: [PATCH 02/72] [ci] Try to parallelize devtools builds (#32266)

Building DevTools is currently the long pole for the runtime CI job.
Let's see if we can get the overall runtime for runtime build and test
down by speeding this one step up.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32266).
* #32267
* __->__ #32266
---
 .github/workflows/runtime_build_and_test.yml   | 18 ++++++++----------
 .../ci/pack_and_store_devtools_artifacts.sh    | 14 ++++++++++----
 2 files changed, 18 insertions(+), 14 deletions(-)

diff --git a/.github/workflows/runtime_build_and_test.yml b/.github/workflows/runtime_build_and_test.yml
index 78cbac7fb536d..77c54a4167178 100644
--- a/.github/workflows/runtime_build_and_test.yml
+++ b/.github/workflows/runtime_build_and_test.yml
@@ -501,6 +501,9 @@ jobs:
     name: Build DevTools and process artifacts
     needs: build_and_lint
     runs-on: ubuntu-latest
+    strategy:
+      matrix:
+        browser: [chrome, firefox, edge]
     steps:
       - uses: actions/checkout@v4
         with:
@@ -525,7 +528,7 @@ jobs:
           pattern: _build_*
           path: build
           merge-multiple: true
-      - run: ./scripts/ci/pack_and_store_devtools_artifacts.sh
+      - run: ./scripts/ci/pack_and_store_devtools_artifacts.sh ${{ matrix.browser }}
         env:
           RELEASE_CHANNEL: experimental
       - name: Display structure of build
@@ -533,19 +536,14 @@ jobs:
       - name: Archive devtools build
         uses: actions/upload-artifact@v4
         with:
-          name: react-devtools
+          name: react-devtools-${{ matrix.browser }}
           path: build/devtools.tgz
       # Simplifies getting the extension for local testing
-      - name: Archive chrome extension
-        uses: actions/upload-artifact@v4
-        with:
-          name: react-devtools-chrome-extension
-          path: build/devtools/chrome-extension.zip
-      - name: Archive firefox extension
+      - name: Archive ${{ matrix.browser }} extension
         uses: actions/upload-artifact@v4
         with:
-          name: react-devtools-firefox-extension
-          path: build/devtools/firefox-extension.zip
+          name: react-devtools-${{ matrix.browser }}-extension
+          path: build/devtools/${{ matrix.browser }}-extension.zip
 
   run_devtools_e2e_tests:
     name: Run DevTools e2e tests
diff --git a/scripts/ci/pack_and_store_devtools_artifacts.sh b/scripts/ci/pack_and_store_devtools_artifacts.sh
index 664440fd834f5..5118b42624732 100755
--- a/scripts/ci/pack_and_store_devtools_artifacts.sh
+++ b/scripts/ci/pack_and_store_devtools_artifacts.sh
@@ -17,10 +17,16 @@ npm pack
 mv ./react-devtools-inline*.tgz ../../build/devtools/
 
 cd ../react-devtools-extensions
-yarn build
-mv ./chrome/build/ReactDevTools.zip ../../build/devtools/chrome-extension.zip
-mv ./firefox/build/ReactDevTools.zip ../../build/devtools/firefox-extension.zip
+if [[ -n "$1" ]]; then
+  yarn build:$1
+  mv ./$1/build/ReactDevTools.zip ../../build/devtools/$1-extension.zip
+else
+  yarn build
+  for browser in chrome firefox edge; do
+    mv ./$browser/build/ReactDevTools.zip ../../build/devtools/$browser-extension.zip
+  done
+fi
 
 # Compress all DevTools artifacts into a single tarball for easy download
 cd ../../build/devtools
-tar -zcvf ../devtools.tgz .
\ No newline at end of file
+tar -zcvf ../devtools.tgz .

From f02ba2fcc5de5c280d5c79f52302b04daaaf1e23 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Thu, 30 Jan 2025 11:55:28 -0500
Subject: [PATCH 03/72] [ci] Remove build_devtools_and_process_artifacts as a
 dependency to run_devtools_e2e_tests (#32267)

I just noticed that we don't actually need to let the devtools build
finish first because the e2e tests don't use those built files. We can
decouple them to allow them to run in paralllel.
---
 .github/workflows/runtime_build_and_test.yml | 18 ++++++++++++------
 1 file changed, 12 insertions(+), 6 deletions(-)

diff --git a/.github/workflows/runtime_build_and_test.yml b/.github/workflows/runtime_build_and_test.yml
index 77c54a4167178..99b6bb4a272e2 100644
--- a/.github/workflows/runtime_build_and_test.yml
+++ b/.github/workflows/runtime_build_and_test.yml
@@ -533,11 +533,6 @@ jobs:
           RELEASE_CHANNEL: experimental
       - name: Display structure of build
         run: ls -R build
-      - name: Archive devtools build
-        uses: actions/upload-artifact@v4
-        with:
-          name: react-devtools-${{ matrix.browser }}
-          path: build/devtools.tgz
       # Simplifies getting the extension for local testing
       - name: Archive ${{ matrix.browser }} extension
         uses: actions/upload-artifact@v4
@@ -545,9 +540,20 @@ jobs:
           name: react-devtools-${{ matrix.browser }}-extension
           path: build/devtools/${{ matrix.browser }}-extension.zip
 
+  merge_devtools_artifacts:
+    name: Merge DevTools artifacts
+    needs: build_devtools_and_process_artifacts
+    runs-on: ubuntu-latest
+    steps:
+      - name: Merge artifacts
+        uses: actions/upload-artifact/merge@v4
+        with:
+          name: react-devtools
+          pattern: react-devtools-*-extension
+
   run_devtools_e2e_tests:
     name: Run DevTools e2e tests
-    needs: build_devtools_and_process_artifacts
+    needs: build_and_lint
     runs-on: ubuntu-latest
     steps:
       - uses: actions/checkout@v4

From 4b3728f05efbab9624e981339d8a0992a58f9a41 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Thu, 30 Jan 2025 12:13:36 -0500
Subject: [PATCH 04/72] [Fiber] Track Appearing Named ViewTransition in the
 accumulateSuspenseyCommit Phase (#32254)

When a named ViewTransition component unmounts in one place and mounts
in a different place we need to match these up so we know a pair has
been created. Since the unmounts are tracked in the snapshot phase we
need some way to track the mounts before that.

Originally the way I did that is by reusing the render phase since there
was no other phase in the commit before that. However, that's not quite
correct. Just because something is visited in render doesn't mean it'll
commit. E.g. if that tree ends up suspending or erroring. Which would
lead to a false positive on match. The unmount shouldn't animate in that
case.

(Un)fortunately we have already added a traversal before the snapshot
phase for tracking suspensey CSS. The `accumulateSuspenseyCommit` phase.
This needs to find new mounts of Suspensey CSS or if there was a
reappearing Offscreen boundary it needs to find any Suspensey CSS
already inside that tree. This is exactly the same traversal we need to
find newly appearing View Transition components. So we can just reuse
that.
---
 .../src/ReactFiberBeginWork.js                | 12 ++-
 .../src/ReactFiberCommitWork.js               | 81 ++++++++++++-------
 .../src/ReactFiberCompleteWork.js             | 42 ----------
 .../react-reconciler/src/ReactFiberFlags.js   |  7 +-
 .../src/ReactFiberWorkLoop.js                 | 46 +----------
 5 files changed, 66 insertions(+), 122 deletions(-)

diff --git a/packages/react-reconciler/src/ReactFiberBeginWork.js b/packages/react-reconciler/src/ReactFiberBeginWork.js
index 28cdd0e1ed54c..6f4acf97cf455 100644
--- a/packages/react-reconciler/src/ReactFiberBeginWork.js
+++ b/packages/react-reconciler/src/ReactFiberBeginWork.js
@@ -97,6 +97,7 @@ import {
   Passive,
   DidDefer,
   ViewTransitionNamedStatic,
+  ViewTransitionNamedMount,
   LayoutStatic,
 } from './ReactFiberFlags';
 import {
@@ -266,7 +267,6 @@ import {
   markSkippedUpdateLanes,
   getWorkInProgressRoot,
   peekDeferredLane,
-  trackAppearingViewTransition,
 } from './ReactFiberWorkLoop';
 import {enqueueConcurrentRenderForLane} from './ReactFiberConcurrentUpdates';
 import {pushCacheProvider, CacheContext} from './ReactFiberCacheComponent';
@@ -3243,12 +3243,10 @@ function updateViewTransition(
   if (pendingProps.name != null && pendingProps.name !== 'auto') {
     // Explicitly named boundary. We track it so that we can pair it up with another explicit
     // boundary if we get deleted.
-    workInProgress.flags |= ViewTransitionNamedStatic;
-    if (current === null) {
-      // This is a new mount. We track it in case we end up having a deletion with the same name.
-      // TODO: A problem with this strategy is that this subtree might not actually end up mounted.
-      trackAppearingViewTransition(instance, pendingProps.name);
-    }
+    workInProgress.flags |=
+      current === null
+        ? ViewTransitionNamedMount | ViewTransitionNamedStatic
+        : ViewTransitionNamedStatic;
   } else {
     // Assign an auto generated name using the useId algorthim if an explicit one is not provided.
     // We don't need the name yet but we do it here to allow hydration state to be used.
diff --git a/packages/react-reconciler/src/ReactFiberCommitWork.js b/packages/react-reconciler/src/ReactFiberCommitWork.js
index b465558ddb3fd..1cfe38cc209fa 100644
--- a/packages/react-reconciler/src/ReactFiberCommitWork.js
+++ b/packages/react-reconciler/src/ReactFiberCommitWork.js
@@ -276,6 +276,10 @@ export let shouldFireAfterActiveInstanceBlur: boolean = false;
 
 export let shouldStartViewTransition: boolean = false;
 
+// This tracks named ViewTransition components found in the accumulateSuspenseyCommit
+// phase that might need to find deleted pairs in the beforeMutation phase.
+let appearingViewTransitions: Map<string, ViewTransitionState> | null = null;
+
 // Used during the commit phase to track whether a parent ViewTransition component
 // might have been affected by any mutations / relayouts below.
 let viewTransitionContextChanged: boolean = false;
@@ -288,7 +292,6 @@ export function commitBeforeMutationEffects(
   root: FiberRoot,
   firstChild: Fiber,
   committedLanes: Lanes,
-  appearingViewTransitions: Map<string, ViewTransitionState> | null,
 ): void {
   focusedInstanceHandle = prepareForCommit(root.containerInfo);
   shouldFireAfterActiveInstanceBlur = false;
@@ -299,19 +302,15 @@ export function commitBeforeMutationEffects(
     includesOnlyViewTransitionEligibleLanes(committedLanes);
 
   nextEffect = firstChild;
-  commitBeforeMutationEffects_begin(
-    isViewTransitionEligible,
-    appearingViewTransitions,
-  );
+  commitBeforeMutationEffects_begin(isViewTransitionEligible);
 
   // We no longer need to track the active instance fiber
   focusedInstanceHandle = null;
+  // We've found any matched pairs and can now reset.
+  appearingViewTransitions = null;
 }
 
-function commitBeforeMutationEffects_begin(
-  isViewTransitionEligible: boolean,
-  appearingViewTransitions: Map<string, ViewTransitionState> | null,
-) {
+function commitBeforeMutationEffects_begin(isViewTransitionEligible: boolean) {
   // If this commit is eligible for a View Transition we look into all mutated subtrees.
   // TODO: We could optimize this by marking these with the Snapshot subtree flag in the render phase.
   const subtreeMask = isViewTransitionEligible
@@ -331,7 +330,6 @@ function commitBeforeMutationEffects_begin(
           commitBeforeMutationEffectsDeletion(
             deletion,
             isViewTransitionEligible,
-            appearingViewTransitions,
           );
         }
       }
@@ -364,7 +362,7 @@ function commitBeforeMutationEffects_begin(
             isViewTransitionEligible
           ) {
             // Was previously mounted as visible but is now hidden.
-            commitExitViewTransitions(current, appearingViewTransitions);
+            commitExitViewTransitions(current);
           }
           // Skip before mutation effects of the children because they're hidden.
           commitBeforeMutationEffects_complete(isViewTransitionEligible);
@@ -528,7 +526,6 @@ function commitBeforeMutationEffectsOnFiber(
 function commitBeforeMutationEffectsDeletion(
   deletion: Fiber,
   isViewTransitionEligible: boolean,
-  appearingViewTransitions: Map<string, ViewTransitionState> | null,
 ) {
   if (enableCreateEventHandleAPI) {
     // TODO (effects) It would be nice to avoid calling doesFiberContain()
@@ -541,7 +538,7 @@ function commitBeforeMutationEffectsDeletion(
     }
   }
   if (isViewTransitionEligible) {
-    commitExitViewTransitions(deletion, appearingViewTransitions);
+    commitExitViewTransitions(deletion);
   }
 }
 
@@ -745,14 +742,15 @@ function commitEnterViewTransitions(placement: Fiber): void {
   }
 }
 
-function commitDeletedPairViewTransitions(
-  deletion: Fiber,
-  appearingViewTransitions: Map<string, ViewTransitionState>,
-): void {
-  if (appearingViewTransitions.size === 0) {
+function commitDeletedPairViewTransitions(deletion: Fiber): void {
+  if (
+    appearingViewTransitions === null ||
+    appearingViewTransitions.size === 0
+  ) {
     // We've found all.
     return;
   }
+  const pairs = appearingViewTransitions;
   if ((deletion.subtreeFlags & ViewTransitionNamedStatic) === NoFlags) {
     // This has no named view transitions in its subtree.
     return;
@@ -769,7 +767,7 @@ function commitDeletedPairViewTransitions(
         const props: ViewTransitionProps = child.memoizedProps;
         const name = props.name;
         if (name != null && name !== 'auto') {
-          const pair = appearingViewTransitions.get(name);
+          const pair = pairs.get(name);
           if (pair !== undefined) {
             const className: ?string = getViewTransitionClassName(
               props.className,
@@ -802,23 +800,20 @@ function commitDeletedPairViewTransitions(
             }
             // Delete the entry so that we know when we've found all of them
             // and can stop searching (size reaches zero).
-            appearingViewTransitions.delete(name);
-            if (appearingViewTransitions.size === 0) {
+            pairs.delete(name);
+            if (pairs.size === 0) {
               break;
             }
           }
         }
       }
-      commitDeletedPairViewTransitions(child, appearingViewTransitions);
+      commitDeletedPairViewTransitions(child);
     }
     child = child.sibling;
   }
 }
 
-function commitExitViewTransitions(
-  deletion: Fiber,
-  appearingViewTransitions: Map<string, ViewTransitionState> | null,
-): void {
+function commitExitViewTransitions(deletion: Fiber): void {
   if (deletion.tag === ViewTransitionComponent) {
     const props: ViewTransitionProps = deletion.memoizedProps;
     const name = getViewTransitionName(props, deletion.stateNode);
@@ -863,17 +858,17 @@ function commitExitViewTransitions(
     }
     if (appearingViewTransitions !== null) {
       // Look for more pairs deeper in the tree.
-      commitDeletedPairViewTransitions(deletion, appearingViewTransitions);
+      commitDeletedPairViewTransitions(deletion);
     }
   } else if ((deletion.subtreeFlags & ViewTransitionStatic) !== NoFlags) {
     let child = deletion.child;
     while (child !== null) {
-      commitExitViewTransitions(child, appearingViewTransitions);
+      commitExitViewTransitions(child);
       child = child.sibling;
     }
   } else {
     if (appearingViewTransitions !== null) {
-      commitDeletedPairViewTransitions(deletion, appearingViewTransitions);
+      commitDeletedPairViewTransitions(deletion);
     }
   }
 }
@@ -4813,8 +4808,13 @@ export function commitPassiveUnmountEffects(finishedWork: Fiber): void {
 // already in the "current" tree. Because their visibility has changed, the
 // browser may not have prerendered them yet. So we check the MaySuspendCommit
 // flag instead.
+//
+// Note that MaySuspendCommit and ShouldSuspendCommit also includes named
+// ViewTransitions so that we know to also visit those to collect appearing
+// pairs.
 let suspenseyCommitFlag = ShouldSuspendCommit;
 export function accumulateSuspenseyCommit(finishedWork: Fiber): void {
+  appearingViewTransitions = null;
   accumulateSuspenseyCommitOnFiber(finishedWork);
 }
 
@@ -4893,6 +4893,29 @@ function accumulateSuspenseyCommitOnFiber(fiber: Fiber) {
       }
       break;
     }
+    case ViewTransitionComponent: {
+      if (enableViewTransition) {
+        if ((fiber.flags & suspenseyCommitFlag) !== NoFlags) {
+          const props: ViewTransitionProps = fiber.memoizedProps;
+          const name: ?string | 'auto' = props.name;
+          if (name != null && name !== 'auto') {
+            // This is a named ViewTransition being mounted or reappearing. Let's add it to
+            // the map so we can match it with deletions later.
+            if (appearingViewTransitions === null) {
+              appearingViewTransitions = new Map();
+            }
+            // Reset the pair in case we didn't end up restoring the instance in previous commits.
+            // This shouldn't really happen anymore but just in case. We could maybe add an invariant.
+            const instance: ViewTransitionState = fiber.stateNode;
+            instance.paired = null;
+            appearingViewTransitions.set(name, instance);
+          }
+        }
+        recursivelyAccumulateSuspenseyCommit(fiber);
+        break;
+      }
+      // Fallthrough
+    }
     default: {
       recursivelyAccumulateSuspenseyCommit(fiber);
     }
diff --git a/packages/react-reconciler/src/ReactFiberCompleteWork.js b/packages/react-reconciler/src/ReactFiberCompleteWork.js
index ca6462d7e7d5a..89012e78cf652 100644
--- a/packages/react-reconciler/src/ReactFiberCompleteWork.js
+++ b/packages/react-reconciler/src/ReactFiberCompleteWork.js
@@ -28,10 +28,6 @@ import type {
   OffscreenState,
   OffscreenQueue,
 } from './ReactFiberActivityComponent';
-import type {
-  ViewTransitionProps,
-  ViewTransitionState,
-} from './ReactFiberViewTransitionComponent';
 import {isOffscreenManual} from './ReactFiberActivityComponent';
 import type {TracingMarkerInstance} from './ReactFiberTracingMarkerComponent';
 import type {Cache} from './ReactFiberCacheComponent';
@@ -99,7 +95,6 @@ import {
   ShouldSuspendCommit,
   Cloned,
   ViewTransitionStatic,
-  ViewTransitionNamedStatic,
 } from './ReactFiberFlags';
 
 import {
@@ -164,7 +159,6 @@ import {
   getWorkInProgressTransitions,
   shouldRemainOnPreviousScreen,
   markSpawnedRetryLane,
-  trackAppearingViewTransition,
 } from './ReactFiberWorkLoop';
 import {
   OffscreenLane,
@@ -947,34 +941,6 @@ function completeDehydratedSuspenseBoundary(
   }
 }
 
-function trackReappearingViewTransitions(workInProgress: Fiber): void {
-  if ((workInProgress.subtreeFlags & ViewTransitionNamedStatic) === NoFlags) {
-    // This has no named view transitions in its subtree.
-    return;
-  }
-  // This needs to search for any explicitly named reappearing View Transitions,
-  // whether they were updated in this transition or unchanged from before.
-  let child = workInProgress.child;
-  while (child !== null) {
-    if (child.tag === OffscreenComponent && child.memoizedState === null) {
-      // This tree is currently hidden so we skip it.
-    } else {
-      if (
-        child.tag === ViewTransitionComponent &&
-        (child.flags & ViewTransitionNamedStatic) !== NoFlags
-      ) {
-        const props: ViewTransitionProps = child.memoizedProps;
-        if (props.name != null && props.name !== 'auto') {
-          const instance: ViewTransitionState = child.stateNode;
-          trackAppearingViewTransition(instance, props.name);
-        }
-      }
-      trackReappearingViewTransitions(child);
-    }
-    child = child.sibling;
-  }
-}
-
 function completeWork(
   current: Fiber | null,
   workInProgress: Fiber,
@@ -1796,14 +1762,6 @@ function completeWork(
           const prevIsHidden = prevState !== null;
           if (prevIsHidden !== nextIsHidden) {
             workInProgress.flags |= Visibility;
-            if (enableViewTransition && !nextIsHidden) {
-              // If we're revealing a new tree, we need to find any named
-              // ViewTransitions inside it that might have a deleted pair.
-              // We do this in the complete phase in case the tree has
-              // changed during the reveal but we have to do it before we
-              // find the first deleted pair in the before mutation phase.
-              trackReappearingViewTransitions(workInProgress);
-            }
           }
         } else {
           // On initial mount, we only need a Visibility effect if the tree
diff --git a/packages/react-reconciler/src/ReactFiberFlags.js b/packages/react-reconciler/src/ReactFiberFlags.js
index d5dcc3ab7c9c0..b6b2efd1996a8 100644
--- a/packages/react-reconciler/src/ReactFiberFlags.js
+++ b/packages/react-reconciler/src/ReactFiberFlags.js
@@ -44,6 +44,7 @@ export const StoreConsistency = /*             */ 0b0000000000000000100000000000
 // possible, because we're about to run out of bits.
 export const ScheduleRetry = StoreConsistency;
 export const ShouldSuspendCommit = Visibility;
+export const ViewTransitionNamedMount = ShouldSuspendCommit;
 export const DidDefer = ContentReset;
 export const FormReset = Snapshot;
 export const AffectedParentLayout = ContentReset;
@@ -74,8 +75,10 @@ export const PassiveStatic = /*                */ 0b0000000100000000000000000000
 export const MaySuspendCommit = /*             */ 0b0000001000000000000000000000000;
 // ViewTransitionNamedStatic tracks explicitly name ViewTransition components deeply
 // that might need to be visited during clean up. This is similar to SnapshotStatic
-// if there was any other use for it.
-export const ViewTransitionNamedStatic = /*    */ SnapshotStatic;
+// if there was any other use for it. It also needs to run in the same phase as
+// MaySuspendCommit tracking.
+export const ViewTransitionNamedStatic =
+  /*    */ SnapshotStatic | MaySuspendCommit;
 // ViewTransitionStatic tracks whether there are an ViewTransition components from
 // the nearest HostComponent down. It resets at every HostComponent level.
 export const ViewTransitionStatic = /*         */ 0b0000010000000000000000000000000;
diff --git a/packages/react-reconciler/src/ReactFiberWorkLoop.js b/packages/react-reconciler/src/ReactFiberWorkLoop.js
index 03f09c1dbaa5f..5f17ca31b3693 100644
--- a/packages/react-reconciler/src/ReactFiberWorkLoop.js
+++ b/packages/react-reconciler/src/ReactFiberWorkLoop.js
@@ -432,12 +432,6 @@ let workInProgressRootConcurrentErrors: Array<CapturedValue<mixed>> | null =
 // We will log them once the tree commits.
 let workInProgressRootRecoverableErrors: Array<CapturedValue<mixed>> | null =
   null;
-// This tracks named ViewTransition components that might need to find deleted
-// pairs in the snapshot phase.
-let workInProgressAppearingViewTransitions: Map<
-  string,
-  ViewTransitionState,
-> | null = null;
 
 // Tracks when an update occurs during the render phase.
 let workInProgressRootDidIncludeRecursiveRenderUpdate: boolean = false;
@@ -1318,7 +1312,6 @@ function finishConcurrentRender(
       lanes,
       workInProgressRootRecoverableErrors,
       workInProgressTransitions,
-      workInProgressAppearingViewTransitions,
       workInProgressRootDidIncludeRecursiveRenderUpdate,
       workInProgressDeferredLane,
       workInProgressRootInterleavedUpdatedLanes,
@@ -1368,7 +1361,6 @@ function finishConcurrentRender(
             finishedWork,
             workInProgressRootRecoverableErrors,
             workInProgressTransitions,
-            workInProgressAppearingViewTransitions,
             workInProgressRootDidIncludeRecursiveRenderUpdate,
             lanes,
             workInProgressDeferredLane,
@@ -1390,7 +1382,6 @@ function finishConcurrentRender(
       finishedWork,
       workInProgressRootRecoverableErrors,
       workInProgressTransitions,
-      workInProgressAppearingViewTransitions,
       workInProgressRootDidIncludeRecursiveRenderUpdate,
       lanes,
       workInProgressDeferredLane,
@@ -1410,7 +1401,6 @@ function commitRootWhenReady(
   finishedWork: Fiber,
   recoverableErrors: Array<CapturedValue<mixed>> | null,
   transitions: Array<Transition> | null,
-  appearingViewTransitions: Map<string, ViewTransitionState> | null,
   didIncludeRenderPhaseUpdate: boolean,
   lanes: Lanes,
   spawnedLane: Lane,
@@ -1442,9 +1432,9 @@ function commitRootWhenReady(
     // the suspensey resources. The renderer is responsible for accumulating
     // all the load events. This all happens in a single synchronous
     // transaction, so it track state in its own module scope.
-    if (maySuspendCommit) {
-      accumulateSuspenseyCommit(finishedWork);
-    }
+    // This will also track any newly added or appearing ViewTransition
+    // components for the purposes of forming pairs.
+    accumulateSuspenseyCommit(finishedWork);
     if (isViewTransitionEligible) {
       suspendOnActiveViewTransition(root.containerInfo);
     }
@@ -1468,7 +1458,6 @@ function commitRootWhenReady(
           lanes,
           recoverableErrors,
           transitions,
-          appearingViewTransitions,
           didIncludeRenderPhaseUpdate,
           spawnedLane,
           updatedLanes,
@@ -1492,7 +1481,6 @@ function commitRootWhenReady(
     lanes,
     recoverableErrors,
     transitions,
-    appearingViewTransitions,
     didIncludeRenderPhaseUpdate,
     spawnedLane,
     updatedLanes,
@@ -1962,7 +1950,6 @@ function prepareFreshStack(root: FiberRoot, lanes: Lanes): Fiber {
   workInProgressRootConcurrentErrors = null;
   workInProgressRootRecoverableErrors = null;
   workInProgressRootDidIncludeRecursiveRenderUpdate = false;
-  workInProgressAppearingViewTransitions = null;
 
   // Get the lanes that are entangled with whatever we're about to render. We
   // track these separately so we can distinguish the priority of the render
@@ -2302,25 +2289,6 @@ export function renderHasNotSuspendedYet(): boolean {
   return workInProgressRootExitStatus === RootInProgress;
 }
 
-export function trackAppearingViewTransition(
-  instance: ViewTransitionState,
-  name: string,
-): void {
-  if (workInProgressAppearingViewTransitions === null) {
-    if (
-      !includesOnlyViewTransitionEligibleLanes(workInProgressRootRenderLanes)
-    ) {
-      return;
-    }
-    workInProgressAppearingViewTransitions = new Map();
-  }
-  // Reset the pair in case we didn't end up restoring the instance in previous commits.
-  // This could happen since we don't actually commit all tracked instances if they end
-  // up in a non-committed subtree.
-  instance.paired = null;
-  workInProgressAppearingViewTransitions.set(name, instance);
-}
-
 // TODO: Over time, this function and renderRootConcurrent have become more
 // and more similar. Not sure it makes sense to maintain forked paths. Consider
 // unifying them again.
@@ -3230,7 +3198,6 @@ function commitRoot(
   lanes: Lanes,
   recoverableErrors: null | Array<CapturedValue<mixed>>,
   transitions: Array<Transition> | null,
-  appearingViewTransitions: Map<string, ViewTransitionState> | null,
   didIncludeRenderPhaseUpdate: boolean,
   spawnedLane: Lane,
   updatedLanes: Lanes,
@@ -3460,12 +3427,7 @@ function commitRoot(
       // The first phase a "before mutation" phase. We use this phase to read the
       // state of the host tree right before we mutate it. This is where
       // getSnapshotBeforeUpdate is called.
-      commitBeforeMutationEffects(
-        root,
-        finishedWork,
-        lanes,
-        appearingViewTransitions,
-      );
+      commitBeforeMutationEffects(root, finishedWork, lanes);
     } finally {
       // Reset the priority to the previous non-sync value.
       executionContext = prevExecutionContext;

From 55b54b0d638a6ae5c7a5ab6dd4fee732cfbc47ad Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Thu, 30 Jan 2025 14:13:45 -0500
Subject: [PATCH 05/72] [ci] Only install chromium for flight fixtures (#32275)

I noticed we only use chromium in fixtures/flight, so let's specifically
only install that browser in ci.
---
 .github/workflows/runtime_build_and_test.yml | 4 +---
 1 file changed, 1 insertion(+), 3 deletions(-)

diff --git a/.github/workflows/runtime_build_and_test.yml b/.github/workflows/runtime_build_and_test.yml
index 99b6bb4a272e2..9a592780b17c4 100644
--- a/.github/workflows/runtime_build_and_test.yml
+++ b/.github/workflows/runtime_build_and_test.yml
@@ -476,9 +476,7 @@ jobs:
           fi
       - name: Playwright install deps
         working-directory: fixtures/flight
-        run: |
-          npx playwright install
-          sudo npx playwright install-deps
+        run: npx playwright install --with-deps chromium
       - name: Run tests
         working-directory: fixtures/flight
         run: yarn test

From 221f3002caa2314cba0a62950da6fb92b453d1d0 Mon Sep 17 00:00:00 2001
From: Ruslan Lesiutin <rdlesyutin@gmail.com>
Date: Thu, 30 Jan 2025 20:08:17 +0000
Subject: [PATCH 06/72] chore[DevTools]: make clipboardWrite optional for
 chromium (#32262)

Addresses https://github.com/facebook/react/issues/32244.

### Chromium
We will use
[chrome.permissions](https://developer.chrome.com/docs/extensions/reference/api/permissions)
for checking / requesting `clipboardWrite` permission before copying
something to the clipboard.

### Firefox
We will keep `clipboardWrite` as a required permission, because there is
no reliable and working API for requesting optional permissions for
extensions that are extending browser DevTools:
- `chrome.permissions` is unavailable for devtools pages -
https://bugzilla.mozilla.org/show_bug.cgi?id=1796933
- You can't call `chrome.permissions.request` from background, because
this instruction has to be executed inside user-event callback,
basically only initiated by user.

I don't really want to come up with solutions like opening a new tab
with a button that user has to click.
---
 .eslintrc.js                                  |  2 ++
 .../chrome/manifest.json                      |  4 ++-
 .../edge/manifest.json                        |  4 ++-
 .../src/devtools/ContextMenu/types.js         |  2 +-
 .../src/devtools/store.js                     |  3 +-
 .../Components/InspectedElementContextTree.js | 15 +++++---
 .../Components/InspectedElementPropsTree.js   | 15 ++++----
 .../Components/InspectedElementSourcePanel.js | 11 ++++--
 .../Components/InspectedElementStateTree.js   | 20 ++++++-----
 .../NativeStyleEditor/StyleEditor.js          |  6 +++-
 .../views/Profiler/SidebarEventInfo.js        |  6 +++-
 .../views/UnsupportedBridgeProtocolDialog.js  | 11 ++++--
 .../src/errors/PermissionNotGrantedError.js   | 21 +++++++++++
 .../frontend/utils/withPermissionsCheck.js    | 35 +++++++++++++++++++
 .../src/CanvasPageContextMenu.js              | 12 +++++--
 scripts/flow/react-devtools.js                |  2 ++
 16 files changed, 136 insertions(+), 33 deletions(-)
 create mode 100644 packages/react-devtools-shared/src/errors/PermissionNotGrantedError.js
 create mode 100644 packages/react-devtools-shared/src/frontend/utils/withPermissionsCheck.js

diff --git a/.eslintrc.js b/.eslintrc.js
index f5b98c6b4887f..7fe08f4cdf36e 100644
--- a/.eslintrc.js
+++ b/.eslintrc.js
@@ -500,6 +500,7 @@ module.exports = {
         'packages/react-devtools-shared/src/hook.js',
         'packages/react-devtools-shared/src/backend/console.js',
         'packages/react-devtools-shared/src/backend/shared/DevToolsComponentStackFrame.js',
+        'packages/react-devtools-shared/src/frontend/utils/withPermissionsCheck.js',
       ],
       globals: {
         __IS_CHROME__: 'readonly',
@@ -507,6 +508,7 @@ module.exports = {
         __IS_EDGE__: 'readonly',
         __IS_NATIVE__: 'readonly',
         __IS_INTERNAL_VERSION__: 'readonly',
+        chrome: 'readonly',
       },
     },
     {
diff --git a/packages/react-devtools-extensions/chrome/manifest.json b/packages/react-devtools-extensions/chrome/manifest.json
index 5d4c4f35e7227..4b2d810f60411 100644
--- a/packages/react-devtools-extensions/chrome/manifest.json
+++ b/packages/react-devtools-extensions/chrome/manifest.json
@@ -43,7 +43,9 @@
   "permissions": [
     "scripting",
     "storage",
-    "tabs",
+    "tabs"
+  ],
+  "optional_permissions": [
     "clipboardWrite"
   ],
   "host_permissions": [
diff --git a/packages/react-devtools-extensions/edge/manifest.json b/packages/react-devtools-extensions/edge/manifest.json
index 9a3b99cf17aa0..37a76be2f24bc 100644
--- a/packages/react-devtools-extensions/edge/manifest.json
+++ b/packages/react-devtools-extensions/edge/manifest.json
@@ -43,7 +43,9 @@
   "permissions": [
     "scripting",
     "storage",
-    "tabs",
+    "tabs"
+  ],
+  "optional_permissions": [
     "clipboardWrite"
   ],
   "host_permissions": [
diff --git a/packages/react-devtools-shared/src/devtools/ContextMenu/types.js b/packages/react-devtools-shared/src/devtools/ContextMenu/types.js
index e2e8cecae33ac..c2f296db10fe5 100644
--- a/packages/react-devtools-shared/src/devtools/ContextMenu/types.js
+++ b/packages/react-devtools-shared/src/devtools/ContextMenu/types.js
@@ -10,7 +10,7 @@
 import type {Node as ReactNode} from 'react';
 
 export type ContextMenuItem = {
-  onClick: () => void,
+  onClick: () => mixed,
   content: ReactNode,
 };
 
diff --git a/packages/react-devtools-shared/src/devtools/store.js b/packages/react-devtools-shared/src/devtools/store.js
index 0a3fbe82bb6a0..3895217053df1 100644
--- a/packages/react-devtools-shared/src/devtools/store.js
+++ b/packages/react-devtools-shared/src/devtools/store.js
@@ -38,6 +38,7 @@ import {
   currentBridgeProtocol,
 } from 'react-devtools-shared/src/bridge';
 import {StrictMode} from 'react-devtools-shared/src/frontend/types';
+import {withPermissionsCheck} from 'react-devtools-shared/src/frontend/utils/withPermissionsCheck';
 
 import type {
   Element,
@@ -1494,7 +1495,7 @@ export default class Store extends EventEmitter<{
   };
 
   onSaveToClipboard: (text: string) => void = text => {
-    copy(text);
+    withPermissionsCheck({permissions: ['clipboardWrite']}, () => copy(text))();
   };
 
   onBackendInitialized: () => void = () => {
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementContextTree.js b/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementContextTree.js
index 044a6d9b48d11..941fa5fe01ddb 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementContextTree.js
+++ b/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementContextTree.js
@@ -19,6 +19,7 @@ import {
   ElementTypeClass,
   ElementTypeFunction,
 } from 'react-devtools-shared/src/frontend/types';
+import {withPermissionsCheck} from 'react-devtools-shared/src/frontend/utils/withPermissionsCheck';
 
 import type {InspectedElement} from 'react-devtools-shared/src/frontend/types';
 import type {FrontendBridge} from 'react-devtools-shared/src/bridge';
@@ -41,14 +42,18 @@ export default function InspectedElementContextTree({
 
   const isReadOnly = type !== ElementTypeClass && type !== ElementTypeFunction;
 
-  const entries = context != null ? Object.entries(context) : null;
-  if (entries !== null) {
-    entries.sort(alphaSortEntries);
+  if (context == null) {
+    return null;
   }
 
-  const isEmpty = entries === null || entries.length === 0;
+  const entries = Object.entries(context);
+  entries.sort(alphaSortEntries);
+  const isEmpty = entries.length === 0;
 
-  const handleCopy = () => copy(serializeDataForCopy(((context: any): Object)));
+  const handleCopy = withPermissionsCheck(
+    {permissions: ['clipboardWrite']},
+    () => copy(serializeDataForCopy(context)),
+  );
 
   // We add an object with a "value" key as a wrapper around Context data
   // so that we can use the shared <KeyValue> component to display it.
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementPropsTree.js b/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementPropsTree.js
index 942d2a2490b46..729b517b46f98 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementPropsTree.js
+++ b/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementPropsTree.js
@@ -18,6 +18,7 @@ import {alphaSortEntries, serializeDataForCopy} from '../utils';
 import Store from '../../store';
 import styles from './InspectedElementSharedStyles.css';
 import {ElementTypeClass} from 'react-devtools-shared/src/frontend/types';
+import {withPermissionsCheck} from 'react-devtools-shared/src/frontend/utils/withPermissionsCheck';
 
 import type {InspectedElement} from 'react-devtools-shared/src/frontend/types';
 import type {FrontendBridge} from 'react-devtools-shared/src/bridge';
@@ -53,17 +54,19 @@ export default function InspectedElementPropsTree({
   const canRenamePaths =
     type === ElementTypeClass || canEditFunctionPropsRenamePaths;
 
-  const entries = props != null ? Object.entries(props) : null;
-  if (entries === null) {
-    // Skip the section for null props.
+  // Skip the section for null props.
+  if (props == null) {
     return null;
   }
 
+  const entries = Object.entries(props);
   entries.sort(alphaSortEntries);
-
   const isEmpty = entries.length === 0;
 
-  const handleCopy = () => copy(serializeDataForCopy(((props: any): Object)));
+  const handleCopy = withPermissionsCheck(
+    {permissions: ['clipboardWrite']},
+    () => copy(serializeDataForCopy(props)),
+  );
 
   return (
     <div data-testname="InspectedElementPropsTree">
@@ -76,7 +79,7 @@ export default function InspectedElementPropsTree({
         )}
       </div>
       {!isEmpty &&
-        (entries: any).map(([name, value]) => (
+        entries.map(([name, value]) => (
           <KeyValue
             key={name}
             alphaSort={true}
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementSourcePanel.js b/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementSourcePanel.js
index 16ca5d1bfe589..0f7203b12a750 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementSourcePanel.js
+++ b/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementSourcePanel.js
@@ -14,6 +14,7 @@ import {toNormalUrl} from 'jsc-safe-url';
 import Button from '../Button';
 import ButtonIcon from '../ButtonIcon';
 import Skeleton from './Skeleton';
+import {withPermissionsCheck} from 'react-devtools-shared/src/frontend/utils/withPermissionsCheck';
 
 import type {Source as InspectedElementSource} from 'react-devtools-shared/src/shared/types';
 import styles from './InspectedElementSourcePanel.css';
@@ -59,7 +60,10 @@ function CopySourceButton({source, symbolicatedSourcePromise}: Props) {
   const symbolicatedSource = React.use(symbolicatedSourcePromise);
   if (symbolicatedSource == null) {
     const {sourceURL, line, column} = source;
-    const handleCopy = () => copy(`${sourceURL}:${line}:${column}`);
+    const handleCopy = withPermissionsCheck(
+      {permissions: ['clipboardWrite']},
+      () => copy(`${sourceURL}:${line}:${column}`),
+    );
 
     return (
       <Button onClick={handleCopy} title="Copy to clipboard">
@@ -69,7 +73,10 @@ function CopySourceButton({source, symbolicatedSourcePromise}: Props) {
   }
 
   const {sourceURL, line, column} = symbolicatedSource;
-  const handleCopy = () => copy(`${sourceURL}:${line}:${column}`);
+  const handleCopy = withPermissionsCheck(
+    {permissions: ['clipboardWrite']},
+    () => copy(`${sourceURL}:${line}:${column}`),
+  );
 
   return (
     <Button onClick={handleCopy} title="Copy to clipboard">
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementStateTree.js b/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementStateTree.js
index b8fe8a89a3022..7987a720ddb06 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementStateTree.js
+++ b/packages/react-devtools-shared/src/devtools/views/Components/InspectedElementStateTree.js
@@ -16,6 +16,7 @@ import KeyValue from './KeyValue';
 import {alphaSortEntries, serializeDataForCopy} from '../utils';
 import Store from '../../store';
 import styles from './InspectedElementSharedStyles.css';
+import {withPermissionsCheck} from 'react-devtools-shared/src/frontend/utils/withPermissionsCheck';
 
 import type {InspectedElement} from 'react-devtools-shared/src/frontend/types';
 import type {FrontendBridge} from 'react-devtools-shared/src/bridge';
@@ -35,22 +36,23 @@ export default function InspectedElementStateTree({
   store,
 }: Props): React.Node {
   const {state, type} = inspectedElement;
+  if (state == null) {
+    return null;
+  }
 
   // HostSingleton and HostHoistable may have state that we don't want to expose to users
   const isHostComponent = type === ElementTypeHostComponent;
-
-  const entries = state != null ? Object.entries(state) : null;
-  const isEmpty = entries === null || entries.length === 0;
-
+  const entries = Object.entries(state);
+  const isEmpty = entries.length === 0;
   if (isEmpty || isHostComponent) {
     return null;
   }
 
-  if (entries !== null) {
-    entries.sort(alphaSortEntries);
-  }
-
-  const handleCopy = () => copy(serializeDataForCopy(((state: any): Object)));
+  entries.sort(alphaSortEntries);
+  const handleCopy = withPermissionsCheck(
+    {permissions: ['clipboardWrite']},
+    () => copy(serializeDataForCopy(state)),
+  );
 
   return (
     <div>
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.js b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.js
index 47c8a0aaa8322..b1416f6e89f95 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.js
+++ b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.js
@@ -20,6 +20,7 @@ import {serializeDataForCopy} from '../../utils';
 import AutoSizeInput from './AutoSizeInput';
 import styles from './StyleEditor.css';
 import {sanitizeForParse} from '../../../utils';
+import {withPermissionsCheck} from 'react-devtools-shared/src/frontend/utils/withPermissionsCheck';
 
 import type {Style} from './types';
 
@@ -62,7 +63,10 @@ export default function StyleEditor({id, style}: Props): React.Node {
 
   const keys = useMemo(() => Array.from(Object.keys(style)), [style]);
 
-  const handleCopy = () => copy(serializeDataForCopy(style));
+  const handleCopy = withPermissionsCheck(
+    {permissions: ['clipboardWrite']},
+    () => copy(serializeDataForCopy(style)),
+  );
 
   return (
     <div className={styles.StyleEditor}>
diff --git a/packages/react-devtools-shared/src/devtools/views/Profiler/SidebarEventInfo.js b/packages/react-devtools-shared/src/devtools/views/Profiler/SidebarEventInfo.js
index 6797d5274929f..97977380efdb3 100644
--- a/packages/react-devtools-shared/src/devtools/views/Profiler/SidebarEventInfo.js
+++ b/packages/react-devtools-shared/src/devtools/views/Profiler/SidebarEventInfo.js
@@ -21,6 +21,7 @@ import {
 } from 'react-devtools-timeline/src/utils/formatting';
 import {stackToComponentSources} from 'react-devtools-shared/src/devtools/utils';
 import {copy} from 'clipboard-js';
+import {withPermissionsCheck} from 'react-devtools-shared/src/frontend/utils/withPermissionsCheck';
 
 import styles from './SidebarEventInfo.css';
 
@@ -53,7 +54,10 @@ function SchedulingEventInfo({eventInfo}: SchedulingEventProps) {
               <div className={styles.Row}>
                 <label className={styles.Label}>Rendered by</label>
                 <Button
-                  onClick={() => copy(componentStack)}
+                  onClick={withPermissionsCheck(
+                    {permissions: ['clipboardWrite']},
+                    () => copy(componentStack),
+                  )}
                   title="Copy component stack to clipboard">
                   <ButtonIcon type="copy" />
                 </Button>
diff --git a/packages/react-devtools-shared/src/devtools/views/UnsupportedBridgeProtocolDialog.js b/packages/react-devtools-shared/src/devtools/views/UnsupportedBridgeProtocolDialog.js
index 425dfe1d08c13..7bfd86fb9c19d 100644
--- a/packages/react-devtools-shared/src/devtools/views/UnsupportedBridgeProtocolDialog.js
+++ b/packages/react-devtools-shared/src/devtools/views/UnsupportedBridgeProtocolDialog.js
@@ -16,6 +16,7 @@ import Button from './Button';
 import ButtonIcon from './ButtonIcon';
 import {copy} from 'clipboard-js';
 import styles from './UnsupportedBridgeProtocolDialog.css';
+import {withPermissionsCheck} from 'react-devtools-shared/src/frontend/utils/withPermissionsCheck';
 
 import type {BridgeProtocol} from 'react-devtools-shared/src/bridge';
 
@@ -82,7 +83,10 @@ function DialogContent({
         <pre className={styles.NpmCommand}>
           {upgradeInstructions}
           <Button
-            onClick={() => copy(upgradeInstructions)}
+            onClick={withPermissionsCheck(
+              {permissions: ['clipboardWrite']},
+              () => copy(upgradeInstructions),
+            )}
             title="Copy upgrade command to clipboard">
             <ButtonIcon type="copy" />
           </Button>
@@ -99,7 +103,10 @@ function DialogContent({
         <pre className={styles.NpmCommand}>
           {downgradeInstructions}
           <Button
-            onClick={() => copy(downgradeInstructions)}
+            onClick={withPermissionsCheck(
+              {permissions: ['clipboardWrite']},
+              () => copy(downgradeInstructions),
+            )}
             title="Copy downgrade command to clipboard">
             <ButtonIcon type="copy" />
           </Button>
diff --git a/packages/react-devtools-shared/src/errors/PermissionNotGrantedError.js b/packages/react-devtools-shared/src/errors/PermissionNotGrantedError.js
new file mode 100644
index 0000000000000..dc9e4ad734e74
--- /dev/null
+++ b/packages/react-devtools-shared/src/errors/PermissionNotGrantedError.js
@@ -0,0 +1,21 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @flow
+ */
+
+export class PermissionNotGrantedError extends Error {
+  constructor() {
+    super("User didn't grant the required permission to perform an action");
+
+    // Maintains proper stack trace for where our error was thrown (only available on V8)
+    if (Error.captureStackTrace) {
+      Error.captureStackTrace(this, PermissionNotGrantedError);
+    }
+
+    this.name = 'PermissionNotGrantedError';
+  }
+}
diff --git a/packages/react-devtools-shared/src/frontend/utils/withPermissionsCheck.js b/packages/react-devtools-shared/src/frontend/utils/withPermissionsCheck.js
new file mode 100644
index 0000000000000..d87db82546484
--- /dev/null
+++ b/packages/react-devtools-shared/src/frontend/utils/withPermissionsCheck.js
@@ -0,0 +1,35 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @flow
+ */
+
+import {PermissionNotGrantedError} from 'react-devtools-shared/src/errors/PermissionNotGrantedError';
+
+type SupportedPermission = 'clipboardWrite';
+type Permissions = Array<SupportedPermission>;
+type PermissionsOptions = {permissions: Permissions};
+
+// browser.permissions is not available for DevTools pages in Firefox
+// https://bugzilla.mozilla.org/show_bug.cgi?id=1796933
+// We are going to assume that requested permissions are not optional.
+export function withPermissionsCheck<T: (...$ReadOnlyArray<empty>) => mixed>(
+  options: PermissionsOptions,
+  callback: T,
+): T | (() => Promise<ReturnType<T>>) {
+  if (!__IS_CHROME__ && !__IS_EDGE__) {
+    return callback;
+  } else {
+    return async () => {
+      const granted = await chrome.permissions.request(options);
+      if (granted) {
+        return callback();
+      }
+
+      return Promise.reject(new PermissionNotGrantedError());
+    };
+  }
+}
diff --git a/packages/react-devtools-timeline/src/CanvasPageContextMenu.js b/packages/react-devtools-timeline/src/CanvasPageContextMenu.js
index 2af32a68aa4e5..5bd4da3141b79 100644
--- a/packages/react-devtools-timeline/src/CanvasPageContextMenu.js
+++ b/packages/react-devtools-timeline/src/CanvasPageContextMenu.js
@@ -13,6 +13,7 @@ import {copy} from 'clipboard-js';
 import prettyMilliseconds from 'pretty-ms';
 
 import ContextMenuContainer from 'react-devtools-shared/src/devtools/ContextMenu/ContextMenuContainer';
+import {withPermissionsCheck} from 'react-devtools-shared/src/frontend/utils/withPermissionsCheck';
 
 import {getBatchRange} from './utils/getBatchRange';
 import {moveStateToRange} from './view-base/utils/scrollState';
@@ -138,7 +139,9 @@ export default function CanvasPageContextMenu({
           content: 'Zoom to batch',
         },
         {
-          onClick: () => copySummary(timelineData, measure),
+          onClick: withPermissionsCheck({permissions: ['clipboardWrite']}, () =>
+            copySummary(timelineData, measure),
+          ),
           content: 'Copy summary',
         },
       );
@@ -147,16 +150,19 @@ export default function CanvasPageContextMenu({
     if (flamechartStackFrame != null) {
       items.push(
         {
-          onClick: () => copy(flamechartStackFrame.scriptUrl),
+          onClick: withPermissionsCheck({permissions: ['clipboardWrite']}, () =>
+            copy(flamechartStackFrame.scriptUrl),
+          ),
           content: 'Copy file path',
         },
         {
-          onClick: () =>
+          onClick: withPermissionsCheck({permissions: ['clipboardWrite']}, () =>
             copy(
               `line ${flamechartStackFrame.locationLine ?? ''}, column ${
                 flamechartStackFrame.locationColumn ?? ''
               }`,
             ),
+          ),
           content: 'Copy location',
         },
       );
diff --git a/scripts/flow/react-devtools.js b/scripts/flow/react-devtools.js
index 4e5fe0db1c625..4e0f2a915ede6 100644
--- a/scripts/flow/react-devtools.js
+++ b/scripts/flow/react-devtools.js
@@ -16,3 +16,5 @@ declare const __IS_FIREFOX__: boolean;
 declare const __IS_CHROME__: boolean;
 declare const __IS_EDGE__: boolean;
 declare const __IS_NATIVE__: boolean;
+
+declare const chrome: any;

From 87c03a0a134b19ffbda6bbef4b12202f4f5a4347 Mon Sep 17 00:00:00 2001
From: David Michael Gregg <davegregg@gmail.com>
Date: Fri, 31 Jan 2025 01:44:02 -0500
Subject: [PATCH 07/72] =?UTF-8?q?Fix=20typo=20in=20dangerfile.js=20which?=
 =?UTF-8?q?=20results=20in=20an=20unreachable=20code=20path=E2=80=A6=20(#3?=
 =?UTF-8?q?2277)?=
MIME-Version: 1.0
Content-Type: text/plain; charset=UTF-8
Content-Transfer-Encoding: 8bit

## Summary

Fix typo in dangerfile.js which results in an unreachable code path
which ought to be hit when there is no matching base artifact during
DangerCI automated code review.

See:
https://github.com/facebook/react/blob/221f3002caa2314cba0a62950da6fb92b453d1d0/dangerfile.js#L73
Compare:
https://github.com/facebook/react/blob/221f3002caa2314cba0a62950da6fb92b453d1d0/dangerfile.js#L171
And the case which should hit this code path:
https://github.com/facebook/react/blob/221f3002caa2314cba0a62950da6fb92b453d1d0/dangerfile.js#L160

Given the above context, the condition `Number === Infinity` is clearly
meant to be `decimal === Infinity`, which it will be if the `catch`
statement triggers when there is no matching base artifact. Without this
fix, the primitive value `Infinity` is passed to
`percentFormatter.format(decimal)`, resulting in the string `'+∞%'`.
With this fix, the resulting string will be the intended `'New file'`.

## [Resolves issue
32278](https://github.com/facebook/react/issues/32278)
---
 dangerfile.js | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/dangerfile.js b/dangerfile.js
index bfc41312e4429..d60da35b586f5 100644
--- a/dangerfile.js
+++ b/dangerfile.js
@@ -70,7 +70,7 @@ const percentFormatter = new Intl.NumberFormat('en', {
 });
 
 function change(decimal) {
-  if (Number === Infinity) {
+  if (decimal === Infinity) {
     return 'New file';
   }
   if (decimal === -1) {

From 9ff42a8798863c995523e284142b47e3cdfaee80 Mon Sep 17 00:00:00 2001
From: Timothy Yung <yungsters@meta.com>
Date: Thu, 30 Jan 2025 22:59:45 -0800
Subject: [PATCH 08/72] Permit non-`DEV` Elements in `React.Children` w/ `DEV`
 (#32117)

---
 .../react/src/__tests__/ReactChildren-test.js | 25 +++++++++++++++++++
 packages/react/src/jsx/ReactJSXElement.js     |  4 ++-
 2 files changed, 28 insertions(+), 1 deletion(-)

diff --git a/packages/react/src/__tests__/ReactChildren-test.js b/packages/react/src/__tests__/ReactChildren-test.js
index 5cce6b24873f0..7843d203b0a15 100644
--- a/packages/react/src/__tests__/ReactChildren-test.js
+++ b/packages/react/src/__tests__/ReactChildren-test.js
@@ -1039,6 +1039,31 @@ describe('ReactChildren', () => {
     });
   });
 
+  it('does not throw on children without `_store`', async () => {
+    function ComponentRenderingFlattenedChildren({children}) {
+      return <div>{React.Children.toArray(children)}</div>;
+    }
+
+    const source = <div />;
+    const productionElement = {};
+    Object.entries(source).forEach(([key, value]) => {
+      if (key !== '_owner' && key !== '_store') {
+        productionElement[key] = value;
+      }
+    });
+    Object.freeze(productionElement);
+
+    const container = document.createElement('div');
+    const root = ReactDOMClient.createRoot(container);
+    await act(() => {
+      root.render(
+        <ComponentRenderingFlattenedChildren>
+          {productionElement}
+        </ComponentRenderingFlattenedChildren>,
+      );
+    });
+  });
+
   it('should escape keys', () => {
     const zero = <div key="1" />;
     const one = <div key="1=::=2" />;
diff --git a/packages/react/src/jsx/ReactJSXElement.js b/packages/react/src/jsx/ReactJSXElement.js
index e0a689ec2404f..5edcb333ea571 100644
--- a/packages/react/src/jsx/ReactJSXElement.js
+++ b/packages/react/src/jsx/ReactJSXElement.js
@@ -813,7 +813,9 @@ export function cloneAndReplaceKey(oldElement, newKey) {
   );
   if (__DEV__) {
     // The cloned element should inherit the original element's key validation.
-    clonedElement._store.validated = oldElement._store.validated;
+    if (oldElement._store) {
+      clonedElement._store.validated = oldElement._store.validated;
+    }
   }
   return clonedElement;
 }

From a657bc5dee29da313d2a03e7864b0665859bc7a8 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Fri, 31 Jan 2025 13:32:23 -0600
Subject: [PATCH 09/72] build(eslint-plugin-react-hooks): add dev dependencies
 for typescript migration (#32279)

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

Contributing to https://github.com/facebook/react/pull/32240, this
change adds the dev dependencies needed to support the migration of the
plugin to typescript.
---
 .../eslint-plugin-react-compiler/package.json |   2 +-
 .../eslint-plugin-react-hooks/package.json    |  10 +-
 yarn.lock                                     | 514 +++++++++++++++++-
 3 files changed, 520 insertions(+), 6 deletions(-)

diff --git a/compiler/packages/eslint-plugin-react-compiler/package.json b/compiler/packages/eslint-plugin-react-compiler/package.json
index d325b3f3d1c67..1bf80ce963c27 100644
--- a/compiler/packages/eslint-plugin-react-compiler/package.json
+++ b/compiler/packages/eslint-plugin-react-compiler/package.json
@@ -23,7 +23,7 @@
     "@babel/preset-env": "^7.22.4",
     "@babel/preset-typescript": "^7.18.6",
     "@babel/types": "^7.19.0",
-    "@types/eslint": "^8.56.6",
+    "@types/eslint": "^8.56.12",
     "@types/node": "^20.2.5",
     "babel-jest": "^29.0.3",
     "eslint": "8.57.0",
diff --git a/packages/eslint-plugin-react-hooks/package.json b/packages/eslint-plugin-react-hooks/package.json
index 94cdf12ec765f..b45609362faac 100644
--- a/packages/eslint-plugin-react-hooks/package.json
+++ b/packages/eslint-plugin-react-hooks/package.json
@@ -32,12 +32,20 @@
   },
   "devDependencies": {
     "@babel/eslint-parser": "^7.11.4",
+    "@tsconfig/strictest": "^2.0.5",
     "@typescript-eslint/parser-v2": "npm:@typescript-eslint/parser@^2.26.0",
     "@typescript-eslint/parser-v3": "npm:@typescript-eslint/parser@^3.10.0",
     "@typescript-eslint/parser-v4": "npm:@typescript-eslint/parser@^4.1.0",
     "@typescript-eslint/parser-v5": "npm:@typescript-eslint/parser@^5.62.0",
+    "@types/eslint": "^8.56.12",
+    "@types/estree": "^1.0.6",
+    "@types/estree-jsx": "^1.0.5",
+    "@types/node": "^20.2.5",
     "babel-eslint": "^10.0.3",
     "eslint-v7": "npm:eslint@^7.7.0",
-    "eslint-v9": "npm:eslint@^9.0.0"
+    "eslint-v9": "npm:eslint@^9.0.0",
+    "jest": "^29.5.0",
+    "tsup": "^8.3.5",
+    "typescript": "^5.4.3"
   }
 }
diff --git a/yarn.lock b/yarn.lock
index 48eca75afbba8..4922028dafc3b 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -2213,6 +2213,131 @@
     opn "5.3.0"
     react "^16.13.1"
 
+"@esbuild/aix-ppc64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.24.2.tgz#38848d3e25afe842a7943643cbcd387cc6e13461"
+  integrity sha512-thpVCb/rhxE/BnMLQ7GReQLLN8q9qbHmI55F4489/ByVg2aQaQ6kbcLb6FHkocZzQhxc4gx0sCk0tJkKBFzDhA==
+
+"@esbuild/android-arm64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.24.2.tgz#f592957ae8b5643129fa889c79e69cd8669bb894"
+  integrity sha512-cNLgeqCqV8WxfcTIOeL4OAtSmL8JjcN6m09XIgro1Wi7cF4t/THaWEa7eL5CMoMBdjoHOTh/vwTO/o2TRXIyzg==
+
+"@esbuild/android-arm@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.24.2.tgz#72d8a2063aa630308af486a7e5cbcd1e134335b3"
+  integrity sha512-tmwl4hJkCfNHwFB3nBa8z1Uy3ypZpxqxfTQOcHX+xRByyYgunVbZ9MzUUfb0RxaHIMnbHagwAxuTL+tnNM+1/Q==
+
+"@esbuild/android-x64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.24.2.tgz#9a7713504d5f04792f33be9c197a882b2d88febb"
+  integrity sha512-B6Q0YQDqMx9D7rvIcsXfmJfvUYLoP722bgfBlO5cGvNVb5V/+Y7nhBE3mHV9OpxBf4eAS2S68KZztiPaWq4XYw==
+
+"@esbuild/darwin-arm64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.24.2.tgz#02ae04ad8ebffd6e2ea096181b3366816b2b5936"
+  integrity sha512-kj3AnYWc+CekmZnS5IPu9D+HWtUI49hbnyqk0FLEJDbzCIQt7hg7ucF1SQAilhtYpIujfaHr6O0UHlzzSPdOeA==
+
+"@esbuild/darwin-x64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.24.2.tgz#9ec312bc29c60e1b6cecadc82bd504d8adaa19e9"
+  integrity sha512-WeSrmwwHaPkNR5H3yYfowhZcbriGqooyu3zI/3GGpF8AyUdsrrP0X6KumITGA9WOyiJavnGZUwPGvxvwfWPHIA==
+
+"@esbuild/freebsd-arm64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.24.2.tgz#5e82f44cb4906d6aebf24497d6a068cfc152fa00"
+  integrity sha512-UN8HXjtJ0k/Mj6a9+5u6+2eZ2ERD7Edt1Q9IZiB5UZAIdPnVKDoG7mdTVGhHJIeEml60JteamR3qhsr1r8gXvg==
+
+"@esbuild/freebsd-x64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.24.2.tgz#3fb1ce92f276168b75074b4e51aa0d8141ecce7f"
+  integrity sha512-TvW7wE/89PYW+IevEJXZ5sF6gJRDY/14hyIGFXdIucxCsbRmLUcjseQu1SyTko+2idmCw94TgyaEZi9HUSOe3Q==
+
+"@esbuild/linux-arm64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.24.2.tgz#856b632d79eb80aec0864381efd29de8fd0b1f43"
+  integrity sha512-7HnAD6074BW43YvvUmE/35Id9/NB7BeX5EoNkK9obndmZBUk8xmJJeU7DwmUeN7tkysslb2eSl6CTrYz6oEMQg==
+
+"@esbuild/linux-arm@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.24.2.tgz#c846b4694dc5a75d1444f52257ccc5659021b736"
+  integrity sha512-n0WRM/gWIdU29J57hJyUdIsk0WarGd6To0s+Y+LwvlC55wt+GT/OgkwoXCXvIue1i1sSNWblHEig00GBWiJgfA==
+
+"@esbuild/linux-ia32@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.24.2.tgz#f8a16615a78826ccbb6566fab9a9606cfd4a37d5"
+  integrity sha512-sfv0tGPQhcZOgTKO3oBE9xpHuUqguHvSo4jl+wjnKwFpapx+vUDcawbwPNuBIAYdRAvIDBfZVvXprIj3HA+Ugw==
+
+"@esbuild/linux-loong64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.24.2.tgz#1c451538c765bf14913512c76ed8a351e18b09fc"
+  integrity sha512-CN9AZr8kEndGooS35ntToZLTQLHEjtVB5n7dl8ZcTZMonJ7CCfStrYhrzF97eAecqVbVJ7APOEe18RPI4KLhwQ==
+
+"@esbuild/linux-mips64el@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.24.2.tgz#0846edeefbc3d8d50645c51869cc64401d9239cb"
+  integrity sha512-iMkk7qr/wl3exJATwkISxI7kTcmHKE+BlymIAbHO8xanq/TjHaaVThFF6ipWzPHryoFsesNQJPE/3wFJw4+huw==
+
+"@esbuild/linux-ppc64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.24.2.tgz#8e3fc54505671d193337a36dfd4c1a23b8a41412"
+  integrity sha512-shsVrgCZ57Vr2L8mm39kO5PPIb+843FStGt7sGGoqiiWYconSxwTiuswC1VJZLCjNiMLAMh34jg4VSEQb+iEbw==
+
+"@esbuild/linux-riscv64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.24.2.tgz#6a1e92096d5e68f7bb10a0d64bb5b6d1daf9a694"
+  integrity sha512-4eSFWnU9Hhd68fW16GD0TINewo1L6dRrB+oLNNbYyMUAeOD2yCK5KXGK1GH4qD/kT+bTEXjsyTCiJGHPZ3eM9Q==
+
+"@esbuild/linux-s390x@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.24.2.tgz#ab18e56e66f7a3c49cb97d337cd0a6fea28a8577"
+  integrity sha512-S0Bh0A53b0YHL2XEXC20bHLuGMOhFDO6GN4b3YjRLK//Ep3ql3erpNcPlEFed93hsQAjAQDNsvcK+hV90FubSw==
+
+"@esbuild/linux-x64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.24.2.tgz#8140c9b40da634d380b0b29c837a0b4267aff38f"
+  integrity sha512-8Qi4nQcCTbLnK9WoMjdC9NiTG6/E38RNICU6sUNqK0QFxCYgoARqVqxdFmWkdonVsvGqWhmm7MO0jyTqLqwj0Q==
+
+"@esbuild/netbsd-arm64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-arm64/-/netbsd-arm64-0.24.2.tgz#65f19161432bafb3981f5f20a7ff45abb2e708e6"
+  integrity sha512-wuLK/VztRRpMt9zyHSazyCVdCXlpHkKm34WUyinD2lzK07FAHTq0KQvZZlXikNWkDGoT6x3TD51jKQ7gMVpopw==
+
+"@esbuild/netbsd-x64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.24.2.tgz#7a3a97d77abfd11765a72f1c6f9b18f5396bcc40"
+  integrity sha512-VefFaQUc4FMmJuAxmIHgUmfNiLXY438XrL4GDNV1Y1H/RW3qow68xTwjZKfj/+Plp9NANmzbH5R40Meudu8mmw==
+
+"@esbuild/openbsd-arm64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.24.2.tgz#58b00238dd8f123bfff68d3acc53a6ee369af89f"
+  integrity sha512-YQbi46SBct6iKnszhSvdluqDmxCJA+Pu280Av9WICNwQmMxV7nLRHZfjQzwbPs3jeWnuAhE9Jy0NrnJ12Oz+0A==
+
+"@esbuild/openbsd-x64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.24.2.tgz#0ac843fda0feb85a93e288842936c21a00a8a205"
+  integrity sha512-+iDS6zpNM6EnJyWv0bMGLWSWeXGN/HTaF/LXHXHwejGsVi+ooqDfMCCTerNFxEkM3wYVcExkeGXNqshc9iMaOA==
+
+"@esbuild/sunos-x64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.24.2.tgz#8b7aa895e07828d36c422a4404cc2ecf27fb15c6"
+  integrity sha512-hTdsW27jcktEvpwNHJU4ZwWFGkz2zRJUz8pvddmXPtXDzVKTTINmlmga3ZzwcuMpUvLw7JkLy9QLKyGpD2Yxig==
+
+"@esbuild/win32-arm64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.24.2.tgz#c023afb647cabf0c3ed13f0eddfc4f1d61c66a85"
+  integrity sha512-LihEQ2BBKVFLOC9ZItT9iFprsE9tqjDjnbulhHoFxYQtQfai7qfluVODIYxt1PgdoyQkz23+01rzwNwYfutxUQ==
+
+"@esbuild/win32-ia32@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.24.2.tgz#96c356132d2dda990098c8b8b951209c3cd743c2"
+  integrity sha512-q+iGUwfs8tncmFC9pcnD5IvRHAzmbwQ3GPS5/ceCyHdjXubwQWI12MKWSNSMYLJMq23/IUCvJMS76PDqXe1fxA==
+
+"@esbuild/win32-x64@0.24.2":
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.24.2.tgz#34aa0b52d0fbb1a654b596acfa595f0c7b77a77b"
+  integrity sha512-7VTgWzgMGvup6aSqDPLiW5zHaxYJGTO4OokMjIlrCtf+VpEL+cXKtCvg723iguPYI5oaUNdS+/V7OU2gvXVWEg==
+
 "@eslint-community/eslint-utils@^4.2.0", "@eslint-community/eslint-utils@^4.4.0":
   version "4.4.0"
   resolved "https://registry.yarnpkg.com/@eslint-community/eslint-utils/-/eslint-utils-4.4.0.tgz#a23514e8fb9af1269d5f7788aa556798d61c6b59"
@@ -2609,6 +2734,15 @@
     "@jridgewell/sourcemap-codec" "^1.4.10"
     "@jridgewell/trace-mapping" "^0.3.9"
 
+"@jridgewell/gen-mapping@^0.3.2":
+  version "0.3.8"
+  resolved "https://registry.yarnpkg.com/@jridgewell/gen-mapping/-/gen-mapping-0.3.8.tgz#4f0e06362e01362f823d348f1872b08f666d8142"
+  integrity sha512-imAbBGkb+ebQyxKgzv5Hu2nmROxoDOXHh80evxdoXNOrvAnVx7zimzc1Oo5h9RlfV4vPXaE2iM5pOFbvOCClWA==
+  dependencies:
+    "@jridgewell/set-array" "^1.2.1"
+    "@jridgewell/sourcemap-codec" "^1.4.10"
+    "@jridgewell/trace-mapping" "^0.3.24"
+
 "@jridgewell/gen-mapping@^0.3.5":
   version "0.3.5"
   resolved "https://registry.yarnpkg.com/@jridgewell/gen-mapping/-/gen-mapping-0.3.5.tgz#dcce6aff74bdf6dad1a95802b69b04a2fcb1fb36"
@@ -3050,6 +3184,101 @@
     estree-walker "^2.0.2"
     picomatch "^2.3.1"
 
+"@rollup/rollup-android-arm-eabi@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.32.1.tgz#c18bad635ba24220a6c8cc427ab2cab12e1531a3"
+  integrity sha512-/pqA4DmqyCm8u5YIDzIdlLcEmuvxb0v8fZdFhVMszSpDTgbQKdw3/mB3eMUHIbubtJ6F9j+LtmyCnHTEqIHyzA==
+
+"@rollup/rollup-android-arm64@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.32.1.tgz#b5c00344b80f20889b72bfe65d3c209cef247362"
+  integrity sha512-If3PDskT77q7zgqVqYuj7WG3WC08G1kwXGVFi9Jr8nY6eHucREHkfpX79c0ACAjLj3QIWKPJR7w4i+f5EdLH5Q==
+
+"@rollup/rollup-darwin-arm64@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.32.1.tgz#78e5358d4a2a08c090f75dd87fa2eada42eca1e5"
+  integrity sha512-zCpKHioQ9KgZToFp5Wvz6zaWbMzYQ2LJHQ+QixDKq52KKrF65ueu6Af4hLlLWHjX1Wf/0G5kSJM9PySW9IrvHA==
+
+"@rollup/rollup-darwin-x64@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.32.1.tgz#c04c9e173244d44de50278f3f893fb68d987fcc6"
+  integrity sha512-sFvF+t2+TyUo/ZQqUcifrJIgznx58oFZbdHS9TvHq3xhPVL9nOp+yZ6LKrO9GWTP+6DbFtoyLDbjTpR62Mbr3Q==
+
+"@rollup/rollup-freebsd-arm64@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.32.1.tgz#3bdf18d4ef32dcfe9b20bba18d7a53a101ed79d9"
+  integrity sha512-NbOa+7InvMWRcY9RG+B6kKIMD/FsnQPH0MWUvDlQB1iXnF/UcKSudCXZtv4lW+C276g3w5AxPbfry5rSYvyeYA==
+
+"@rollup/rollup-freebsd-x64@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.32.1.tgz#35867b15c276f4b4ca8eb226f7dd6df8c64640db"
+  integrity sha512-JRBRmwvHPXR881j2xjry8HZ86wIPK2CcDw0EXchE1UgU0ubWp9nvlT7cZYKc6bkypBt745b4bglf3+xJ7hXWWw==
+
+"@rollup/rollup-linux-arm-gnueabihf@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.32.1.tgz#92c212d1b38c105bd1eb101254722d27d869b1ac"
+  integrity sha512-PKvszb+9o/vVdUzCCjL0sKHukEQV39tD3fepXxYrHE3sTKrRdCydI7uldRLbjLmDA3TFDmh418XH19NOsDRH8g==
+
+"@rollup/rollup-linux-arm-musleabihf@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.32.1.tgz#ebb94d8cd438f23e38caa4a87ca80d4cf5b50fa1"
+  integrity sha512-9WHEMV6Y89eL606ReYowXuGF1Yb2vwfKWKdD1A5h+OYnPZSJvxbEjxTRKPgi7tkP2DSnW0YLab1ooy+i/FQp/Q==
+
+"@rollup/rollup-linux-arm64-gnu@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.32.1.tgz#ce6a5eacbd5fd4bdf7bf27bd818980230bdb9fab"
+  integrity sha512-tZWc9iEt5fGJ1CL2LRPw8OttkCBDs+D8D3oEM8mH8S1ICZCtFJhD7DZ3XMGM8kpqHvhGUTvNUYVDnmkj4BDXnw==
+
+"@rollup/rollup-linux-arm64-musl@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.32.1.tgz#31b4e0a543607e6eb4f982ffb45830919a952a83"
+  integrity sha512-FTYc2YoTWUsBz5GTTgGkRYYJ5NGJIi/rCY4oK/I8aKowx1ToXeoVVbIE4LGAjsauvlhjfl0MYacxClLld1VrOw==
+
+"@rollup/rollup-linux-loongarch64-gnu@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-loongarch64-gnu/-/rollup-linux-loongarch64-gnu-4.32.1.tgz#ad7b35f193f1d2e0dc37eba733069b4af5f6498d"
+  integrity sha512-F51qLdOtpS6P1zJVRzYM0v6MrBNypyPEN1GfMiz0gPu9jN8ScGaEFIZQwteSsGKg799oR5EaP7+B2jHgL+d+Kw==
+
+"@rollup/rollup-linux-powerpc64le-gnu@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.32.1.tgz#b713a55d7eac4d2c8a0109c3daca6ea85fc178b3"
+  integrity sha512-wO0WkfSppfX4YFm5KhdCCpnpGbtgQNj/tgvYzrVYFKDpven8w2N6Gg5nB6w+wAMO3AIfSTWeTjfVe+uZ23zAlg==
+
+"@rollup/rollup-linux-riscv64-gnu@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.32.1.tgz#bea4fd8ad190e9bc1d11efafa2efc9d121f50b96"
+  integrity sha512-iWswS9cIXfJO1MFYtI/4jjlrGb/V58oMu4dYJIKnR5UIwbkzR0PJ09O0PDZT0oJ3LYWXBSWahNf/Mjo6i1E5/g==
+
+"@rollup/rollup-linux-s390x-gnu@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.32.1.tgz#cc98c32733ca472635759c78a79b5f8d887b2a6a"
+  integrity sha512-RKt8NI9tebzmEthMnfVgG3i/XeECkMPS+ibVZjZ6mNekpbbUmkNWuIN2yHsb/mBPyZke4nlI4YqIdFPgKuoyQQ==
+
+"@rollup/rollup-linux-x64-gnu@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.32.1.tgz#5c009c264a7ce0e19b40890ca9945440bb420691"
+  integrity sha512-WQFLZ9c42ECqEjwg/GHHsouij3pzLXkFdz0UxHa/0OM12LzvX7DzedlY0SIEly2v18YZLRhCRoHZDxbBSWoGYg==
+
+"@rollup/rollup-linux-x64-musl@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.32.1.tgz#73d2f44070c23e031262b601927fdb4eec253bc1"
+  integrity sha512-BLoiyHDOWoS3uccNSADMza6V6vCNiphi94tQlVIL5de+r6r/CCQuNnerf+1g2mnk2b6edp5dk0nhdZ7aEjOBsA==
+
+"@rollup/rollup-win32-arm64-msvc@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.32.1.tgz#fa106304818078f9d3fc9005642ad99f596eed2d"
+  integrity sha512-w2l3UnlgYTNNU+Z6wOR8YdaioqfEnwPjIsJ66KxKAf0p+AuL2FHeTX6qvM+p/Ue3XPBVNyVSfCrfZiQh7vZHLQ==
+
+"@rollup/rollup-win32-ia32-msvc@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.32.1.tgz#a1a394c705a0d2a974a124c4b471fc1cf851a56f"
+  integrity sha512-Am9H+TGLomPGkBnaPWie4F3x+yQ2rr4Bk2jpwy+iV+Gel9jLAu/KqT8k3X4jxFPW6Zf8OMnehyutsd+eHoq1WQ==
+
+"@rollup/rollup-win32-x64-msvc@4.32.1":
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.32.1.tgz#512db088df67afee8f07183cdf8c9eecd64f6ef8"
+  integrity sha512-ar80GhdZb4DgmW3myIS9nRFYcpJRSME8iqWgzH2i44u+IdrzmiXVxeFnExQ5v4JYUSpg94bWjevMG8JHf1Da5Q==
+
 "@sinclair/typebox@^0.25.16":
   version "0.25.24"
   resolved "https://registry.yarnpkg.com/@sinclair/typebox/-/typebox-0.25.24.tgz#8c7688559979f7079aacaf31aa881c3aa410b718"
@@ -3125,6 +3354,11 @@
   resolved "https://registry.yarnpkg.com/@tootallnate/once/-/once-2.0.0.tgz#f544a148d3ab35801c1f633a7441fd87c2e484bf"
   integrity sha512-XCuKFP5PS55gnMVu3dty8KPatLqUoy/ZYzDzAGCQ8JNFCkLXzmI7vNHCR+XpbZaMWQK/vQubr7PkYq8g470J/A==
 
+"@tsconfig/strictest@^2.0.5":
+  version "2.0.5"
+  resolved "https://registry.yarnpkg.com/@tsconfig/strictest/-/strictest-2.0.5.tgz#2cbc67f207ba87fdec2a84ad79b1708cf4edd93b"
+  integrity sha512-ec4tjL2Rr0pkZ5hww65c+EEPYwxOi4Ryv+0MtjeaSQRJyq322Q27eOQiFbuNgw2hpL4hB1/W/HBGk3VKS43osg==
+
 "@types/babel__core@^7.1.14":
   version "7.20.5"
   resolved "https://registry.yarnpkg.com/@types/babel__core/-/babel__core-7.20.5.tgz#3df15f27ba85319caa07ba08d0721889bb39c017"
@@ -3219,11 +3453,31 @@
     "@types/estree" "*"
     "@types/json-schema" "*"
 
+"@types/eslint@^8.56.12":
+  version "8.56.12"
+  resolved "https://registry.yarnpkg.com/@types/eslint/-/eslint-8.56.12.tgz#1657c814ffeba4d2f84c0d4ba0f44ca7ea1ca53a"
+  integrity sha512-03ruubjWyOHlmljCVoxSuNDdmfZDzsrrz0P2LeJsOXr+ZwFQ+0yQIwNCwt/GYhV7Z31fgtXJTAEs+FYlEL851g==
+  dependencies:
+    "@types/estree" "*"
+    "@types/json-schema" "*"
+
+"@types/estree-jsx@^1.0.5":
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/@types/estree-jsx/-/estree-jsx-1.0.5.tgz#858a88ea20f34fe65111f005a689fa1ebf70dc18"
+  integrity sha512-52CcUVNFyfb1A2ALocQw/Dd1BQFNmSdkuC3BkZ6iqhdMfQz7JWOFRuJFloOzjk+6WijU56m9oKXFAXc7o3Towg==
+  dependencies:
+    "@types/estree" "*"
+
 "@types/estree@*":
   version "0.0.42"
   resolved "https://registry.yarnpkg.com/@types/estree/-/estree-0.0.42.tgz#8d0c1f480339efedb3e46070e22dd63e0430dd11"
   integrity sha512-K1DPVvnBCPxzD+G51/cxVIoc2X8uUVl1zpJeE6iKcgHMj4+tbat5Xu4TjV7v2QSDbIeAfLi2hIk+u2+s0MlpUQ==
 
+"@types/estree@1.0.6", "@types/estree@^1.0.6":
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.6.tgz#628effeeae2064a1b4e79f78e81d87b7e5fc7b50"
+  integrity sha512-AYnb1nQyY49te+VRAVgmzfcgjYS91mY5P0TKUDCLEM+gNnA+3T6rWITXRLYCpahpqSQbN5cE+gHpnPyXjHWxcw==
+
 "@types/estree@^1.0.0":
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.0.tgz#5fb2e536c1ae9bf35366eed879e827fa59ca41c2"
@@ -3360,6 +3614,13 @@
   resolved "https://registry.yarnpkg.com/@types/node/-/node-16.18.14.tgz#5465ce598486a703caddbefe8603f8a2cffa3461"
   integrity sha512-wvzClDGQXOCVNU4APPopC2KtMYukaF1MN/W3xAmslx22Z4/IF1/izDMekuyoUlwfnDHYCIZGaj7jMwnJKBTxKw==
 
+"@types/node@^20.2.5":
+  version "20.17.16"
+  resolved "https://registry.yarnpkg.com/@types/node/-/node-20.17.16.tgz#b33b0edc1bf925b27349e494b871ca4451fabab4"
+  integrity sha512-vOTpLduLkZXePLxHiHsBLp98mHGnl8RptV4YAO3HfKO5UHjDvySGbxKtpYfy8Sx5+WKcgc45qNreJJRVM3L6mw==
+  dependencies:
+    undici-types "~6.19.2"
+
 "@types/prettier@^1.0.0 || ^2.0.0 || ^3.0.0":
   version "3.0.0"
   resolved "https://registry.yarnpkg.com/@types/prettier/-/prettier-3.0.0.tgz#e9bc8160230d3a461dab5c5b41cceef1ef723057"
@@ -5297,6 +5558,13 @@ bundle-name@^3.0.0:
   dependencies:
     run-applescript "^5.0.0"
 
+bundle-require@^5.0.0:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/bundle-require/-/bundle-require-5.1.0.tgz#8db66f41950da3d77af1ef3322f4c3e04009faee"
+  integrity sha512-3WrrOuZiyaaZPWiEt4G3+IffISVC9HYlWueJEBWED4ZH4aIAC2PnkdnuRrR94M+w6yGWn4AglWtJtBI8YqvgoA==
+  dependencies:
+    load-tsconfig "^0.2.3"
+
 bunyan@1.8.15:
   version "1.8.15"
   resolved "https://registry.yarnpkg.com/bunyan/-/bunyan-1.8.15.tgz#8ce34ca908a17d0776576ca1b2f6cbd916e93b46"
@@ -5317,6 +5585,11 @@ bytes@3.1.2:
   resolved "https://registry.yarnpkg.com/bytes/-/bytes-3.1.2.tgz#8b0beeb98605adf1b128fa4386403c009e0221a5"
   integrity sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==
 
+cac@^6.7.14:
+  version "6.7.14"
+  resolved "https://registry.yarnpkg.com/cac/-/cac-6.7.14.tgz#804e1e6f506ee363cb0e3ccbb09cad5dd9870959"
+  integrity sha512-b6Ilus+c3RrdDk+JhLKUAQfzzgLEPy6wcXqS7f/xe1EETvsDP6GORG7SFuOs6cID5YkqchW/LXZbX5bc8j7ZcQ==
+
 cache-base@^1.0.1:
   version "1.0.1"
   resolved "https://registry.yarnpkg.com/cache-base/-/cache-base-1.0.1.tgz#0a7f46416831c8b662ee36fe4e7c59d76f666ab2"
@@ -5618,6 +5891,13 @@ chokidar@^3.5.3:
   optionalDependencies:
     fsevents "~2.3.2"
 
+chokidar@^4.0.1:
+  version "4.0.3"
+  resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-4.0.3.tgz#7be37a4c03c9aee1ecfe862a4a23b2c70c205d30"
+  integrity sha512-Qgzu8kfBvo+cA4962jnP1KkS6Dop5NS6g7R5LFYJr4b8Ub94PPQXUksCw9PvXoeXPRRddRNC5C1JQUR2SMGtnA==
+  dependencies:
+    readdirp "^4.0.1"
+
 chownr@^1.0.1:
   version "1.1.4"
   resolved "https://registry.yarnpkg.com/chownr/-/chownr-1.1.4.tgz#6fc9d7b42d32a583596337666e7d08084da2cc6b"
@@ -5886,7 +6166,7 @@ commander@^2.18.0, commander@^2.20.0, commander@^2.6.0, commander@^2.8.1:
   resolved "https://registry.yarnpkg.com/commander/-/commander-2.20.3.tgz#fd485e84c03eb4881c20722ba48035e8531aeb33"
   integrity sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==
 
-commander@^4.0.1:
+commander@^4.0.0, commander@^4.0.1:
   version "4.1.1"
   resolved "https://registry.yarnpkg.com/commander/-/commander-4.1.1.tgz#9fd602bd936294e9e9ef46a3f4d6964044b18068"
   integrity sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==
@@ -6029,6 +6309,11 @@ connect-history-api-fallback@^2.0.0:
   resolved "https://registry.yarnpkg.com/connect-history-api-fallback/-/connect-history-api-fallback-2.0.0.tgz#647264845251a0daf25b97ce87834cace0f5f1c8"
   integrity sha512-U73+6lQFmfiNPrYbXqr6kZ1i1wiRqXnp2nhMsINseWXO8lDau0LGEffJ8kQi4EjLZympVgRdvqjAgiZ1tgzDDA==
 
+consola@^3.2.3:
+  version "3.4.0"
+  resolved "https://registry.yarnpkg.com/consola/-/consola-3.4.0.tgz#4cfc9348fd85ed16a17940b3032765e31061ab88"
+  integrity sha512-EiPU8G6dQG0GFHNR8ljnZFki/8a+cQwEQ+7wpxdChl02Q8HXlwEZWD5lqAF8vC2sEC3Tehr8hy7vErz88LHyUA==
+
 console-browserify@^1.1.0:
   version "1.2.0"
   resolved "https://registry.yarnpkg.com/console-browserify/-/console-browserify-1.2.0.tgz#67063cef57ceb6cf4993a2ab3a55840ae8c49336"
@@ -6552,6 +6837,13 @@ debug@^4.3.4, debug@~4.3.1:
   dependencies:
     ms "2.1.2"
 
+debug@^4.3.7:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
 decamelize@6.0.0:
   version "6.0.0"
   resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-6.0.0.tgz#8cad4d916fde5c41a264a43d0ecc56fe3d31749e"
@@ -7250,6 +7542,37 @@ es6-error@4.1.1, es6-error@^4.1.1:
   resolved "https://registry.yarnpkg.com/es6-error/-/es6-error-4.1.1.tgz#9e3af407459deed47e9a91f9b885a84eb05c561d"
   integrity sha512-Um/+FxMr9CISWh0bi5Zv0iOD+4cFh5qLeks1qhAopKVAJw3drgKbKySikp7wGhDL0HPeaja0P5ULZrxLkniUVg==
 
+esbuild@^0.24.0:
+  version "0.24.2"
+  resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.24.2.tgz#b5b55bee7de017bff5fb8a4e3e44f2ebe2c3567d"
+  integrity sha512-+9egpBW8I3CD5XPe0n6BfT5fxLzxrlDzqydF3aviG+9ni1lDC/OvMHcxqEFV0+LANZG5R1bFMWfUrjVsdwxJvA==
+  optionalDependencies:
+    "@esbuild/aix-ppc64" "0.24.2"
+    "@esbuild/android-arm" "0.24.2"
+    "@esbuild/android-arm64" "0.24.2"
+    "@esbuild/android-x64" "0.24.2"
+    "@esbuild/darwin-arm64" "0.24.2"
+    "@esbuild/darwin-x64" "0.24.2"
+    "@esbuild/freebsd-arm64" "0.24.2"
+    "@esbuild/freebsd-x64" "0.24.2"
+    "@esbuild/linux-arm" "0.24.2"
+    "@esbuild/linux-arm64" "0.24.2"
+    "@esbuild/linux-ia32" "0.24.2"
+    "@esbuild/linux-loong64" "0.24.2"
+    "@esbuild/linux-mips64el" "0.24.2"
+    "@esbuild/linux-ppc64" "0.24.2"
+    "@esbuild/linux-riscv64" "0.24.2"
+    "@esbuild/linux-s390x" "0.24.2"
+    "@esbuild/linux-x64" "0.24.2"
+    "@esbuild/netbsd-arm64" "0.24.2"
+    "@esbuild/netbsd-x64" "0.24.2"
+    "@esbuild/openbsd-arm64" "0.24.2"
+    "@esbuild/openbsd-x64" "0.24.2"
+    "@esbuild/sunos-x64" "0.24.2"
+    "@esbuild/win32-arm64" "0.24.2"
+    "@esbuild/win32-ia32" "0.24.2"
+    "@esbuild/win32-x64" "0.24.2"
+
 escalade@^3.0.2:
   version "3.0.2"
   resolved "https://registry.yarnpkg.com/escalade/-/escalade-3.0.2.tgz#6a580d70edb87880f22b4c91d0d56078df6962c4"
@@ -8124,6 +8447,11 @@ fd-slicer@~1.1.0:
   dependencies:
     pend "~1.2.0"
 
+fdir@^6.4.2:
+  version "6.4.3"
+  resolved "https://registry.yarnpkg.com/fdir/-/fdir-6.4.3.tgz#011cdacf837eca9b811c89dbb902df714273db72"
+  integrity sha512-PMXmW2y1hDDfTSRc9gaXIuCCRpuoz3Kaz8cUelp3smouvfT632ozg2vrT6lJsHKKOF59YLbOGfAWGUcKEfRMQw==
+
 fetch-blob@^3.1.2, fetch-blob@^3.1.4:
   version "3.2.0"
   resolved "https://registry.yarnpkg.com/fetch-blob/-/fetch-blob-3.2.0.tgz#f09b8d4bbd45adc6f0c20b7e787e793e309dcce9"
@@ -8762,6 +9090,18 @@ glob@^10.2.5:
     minipass "^5.0.0 || ^6.0.2"
     path-scurry "^1.7.0"
 
+glob@^10.3.10:
+  version "10.4.5"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-10.4.5.tgz#f4d9f0b90ffdbab09c9d77f5f29b4262517b0956"
+  integrity sha512-7Bv8RF0k6xjo7d4A/PxYLbUCfb6c+Vpd2/mB2yRDlew7Jb5hEXiCD9ibfO7wpk8i4sevK6DFny9h7EYbM3/sHg==
+  dependencies:
+    foreground-child "^3.1.0"
+    jackspeak "^3.1.2"
+    minimatch "^9.0.4"
+    minipass "^7.1.2"
+    package-json-from-dist "^1.0.0"
+    path-scurry "^1.11.1"
+
 glob@^6.0.1:
   version "6.0.4"
   resolved "https://registry.yarnpkg.com/glob/-/glob-6.0.4.tgz#0f08860f6a155127b2fadd4f9ce24b1aab6e4d22"
@@ -10927,7 +11267,7 @@ jest-worker@^29.7.0:
     merge-stream "^2.0.0"
     supports-color "^8.0.0"
 
-jest@^29.4.2:
+jest@^29.4.2, jest@^29.5.0:
   version "29.7.0"
   resolved "https://registry.yarnpkg.com/jest/-/jest-29.7.0.tgz#994676fc24177f088f1c5e3737f5697204ff2613"
   integrity sha512-NIy3oAFp9shda19hy4HK0HRTWKtPJmGdnvywu01nOqNC2vZg+Z+fvJDxpMQA88eb2I9EcafcdjYgsDthnYTvGw==
@@ -10947,6 +11287,11 @@ jose@5.4.1:
   resolved "https://registry.yarnpkg.com/jose/-/jose-5.4.1.tgz#b471ee3963920ba5452fd1b1398c8ba72a7b2fcf"
   integrity sha512-U6QajmpV/nhL9SyfAewo000fkiRQ+Yd2H0lBxJJ9apjpOgkOcBQJWOrMo917lxLptdS/n/o/xPzMkXhF46K8hQ==
 
+joycon@^3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/joycon/-/joycon-3.1.1.tgz#bce8596d6ae808f8b68168f5fc69280996894f03"
+  integrity sha512-34wB/Y7MW7bzjKRjUKTa46I2Z7eV62Rkhva+KkopW7Qvv/OSWBqvkSY7vusOPrNuZcUG3tApvdVgNB8POj3SPw==
+
 jpeg-js@^0.4.2:
   version "0.4.4"
   resolved "https://registry.yarnpkg.com/jpeg-js/-/jpeg-js-0.4.4.tgz#a9f1c6f1f9f0fa80cdb3484ed9635054d28936aa"
@@ -11328,6 +11673,11 @@ lighthouse-logger@^1.0.0:
     debug "^2.6.8"
     marky "^1.2.0"
 
+lilconfig@^3.1.1:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/lilconfig/-/lilconfig-3.1.3.tgz#a1bcfd6257f9585bf5ae14ceeebb7b559025e4c4"
+  integrity sha512-/vlFKAoH5Cgt3Ie+JLhRbwOsCQePABiU3tJ1egGvyQ+33R/vcwM2Zl2QR/LzjsBeItPt3oSVXapn+m4nQDvpzw==
+
 lines-and-columns@^1.1.6:
   version "1.2.4"
   resolved "https://registry.yarnpkg.com/lines-and-columns/-/lines-and-columns-1.2.4.tgz#eca284f75d2965079309dc0ad9255abb2ebc1632"
@@ -11349,6 +11699,11 @@ load-json-file@^1.0.0:
     pinkie-promise "^2.0.0"
     strip-bom "^2.0.0"
 
+load-tsconfig@^0.2.3:
+  version "0.2.5"
+  resolved "https://registry.yarnpkg.com/load-tsconfig/-/load-tsconfig-0.2.5.tgz#453b8cd8961bfb912dea77eb6c168fe8cca3d3a1"
+  integrity sha512-IXO6OCs9yg8tMKzfPZ1YmheJbZCiEsnBdcB03l0OcfK9prKnJb96siuHCr5Fl37/yo9DnKU+TLpxzTUspw9shg==
+
 loader-runner@^4.2.0:
   version "4.3.0"
   resolved "https://registry.yarnpkg.com/loader-runner/-/loader-runner-4.3.0.tgz#c1b4a163b99f614830353b16755e7149ac2314e1"
@@ -11485,6 +11840,11 @@ lodash.omitby@4.6.0:
   resolved "https://registry.yarnpkg.com/lodash.omitby/-/lodash.omitby-4.6.0.tgz#5c15ff4754ad555016b53c041311e8f079204791"
   integrity sha1-XBX/R1StVVAWtTwEExHo8HkgR5E=
 
+lodash.sortby@^4.7.0:
+  version "4.7.0"
+  resolved "https://registry.yarnpkg.com/lodash.sortby/-/lodash.sortby-4.7.0.tgz#edd14c824e2cc9c1e0b0a1b42bb5210516a42438"
+  integrity sha512-HDWXG8isMntAyRF5vZ7xKuEvOhT4AhlRt/3czTSjvGUxjYCBVRQY48ViDHyfYz9VIoBkW4TMGQNapx+l3RUwdA==
+
 lodash.truncate@^4.4.2:
   version "4.4.2"
   resolved "https://registry.yarnpkg.com/lodash.truncate/-/lodash.truncate-4.4.2.tgz#5a350da0b1113b837ecfffd5812cbe58d6eae193"
@@ -11998,7 +12358,7 @@ ms@2.1.2:
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009"
   integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==
 
-ms@2.1.3, ms@^2.1.1, ms@^2.1.2:
+ms@2.1.3, ms@^2.1.1, ms@^2.1.2, ms@^2.1.3:
   version "2.1.3"
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
   integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
@@ -12030,7 +12390,7 @@ mv@~2:
     ncp "~2.0.0"
     rimraf "~2.4.0"
 
-mz@2.7.0:
+mz@2.7.0, mz@^2.7.0:
   version "2.7.0"
   resolved "https://registry.yarnpkg.com/mz/-/mz-2.7.0.tgz#95008057a56cafadc2bc63dde7f9ff6955948e32"
   integrity sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==
@@ -13072,6 +13432,11 @@ picocolors@^1.0.0:
   resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.0.0.tgz#cb5bdc74ff3f51892236eaf79d68bc44564ab81c"
   integrity sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==
 
+picocolors@^1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.1.1.tgz#3d321af3eab939b083c8f929a1d12cda81c26b6b"
+  integrity sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==
+
 picomatch@^2.0.4, picomatch@^2.2.3, picomatch@^2.3.1:
   version "2.3.1"
   resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-2.3.1.tgz#3ba3833733646d9d3e4995946c1365a67fb07a42"
@@ -13087,6 +13452,11 @@ picomatch@^2.2.1:
   resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-2.2.2.tgz#21f333e9b6b8eaff02468f5146ea406d345f4dad"
   integrity sha512-q0M/9eZHzmr0AulXyPwNfZjtwZ/RBZlbN3K3CErVrk50T2ASYI7Bye0EvekFY3IP1Nt2DHu0re+V2ZHIpMkuWg==
 
+picomatch@^4.0.2:
+  version "4.0.2"
+  resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-4.0.2.tgz#77c742931e8f3b8820946c76cd0c1f13730d1dab"
+  integrity sha512-M7BAV6Rlcy5u+m6oPhAPFgJTzAioX/6B0DxyvDlo9l8+T3nLKbrczg2WLUyzd45L8RqfUMyGPzekbMvX2Ldkwg==
+
 pify@^2.0.0, pify@^2.2.0, pify@^2.3.0:
   version "2.3.0"
   resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c"
@@ -13237,6 +13607,13 @@ posix-character-classes@^0.1.0:
   resolved "https://registry.yarnpkg.com/posix-character-classes/-/posix-character-classes-0.1.1.tgz#01eac0fe3b5af71a2a6c02feabb8c1fef7e00eab"
   integrity sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=
 
+postcss-load-config@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/postcss-load-config/-/postcss-load-config-6.0.1.tgz#6fd7dcd8ae89badcf1b2d644489cbabf83aa8096"
+  integrity sha512-oPtTM4oerL+UXmx+93ytZVN82RrlY/wPUV8IeDxFrzIjXOLF1pN+EmKPLbubvKHT2HC20xXsCAH2Z+CKV6Oz/g==
+  dependencies:
+    lilconfig "^3.1.1"
+
 postcss-modules-extract-imports@^1.2.0:
   version "1.2.1"
   resolved "https://registry.yarnpkg.com/postcss-modules-extract-imports/-/postcss-modules-extract-imports-1.2.1.tgz#dc87e34148ec7eab5f791f7cd5849833375b741a"
@@ -13965,6 +14342,11 @@ readdirp@^2.2.1:
     micromatch "^3.1.10"
     readable-stream "^2.0.2"
 
+readdirp@^4.0.1:
+  version "4.1.1"
+  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-4.1.1.tgz#bd115327129672dc47f87408f05df9bd9ca3ef55"
+  integrity sha512-h80JrZu/MHUZCyHu5ciuoI0+WxsCxzxJTILn6Fs8rxSnFPh+UVHYfeIxK1nVGugMqkfC4vJcBOYbkfkwYK0+gw==
+
 readdirp@~3.6.0:
   version "3.6.0"
   resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-3.6.0.tgz#74a370bd857116e245b29cc97340cd431a02a6c7"
@@ -14398,6 +14780,34 @@ rollup@^3.29.5:
   optionalDependencies:
     fsevents "~2.3.2"
 
+rollup@^4.24.0:
+  version "4.32.1"
+  resolved "https://registry.yarnpkg.com/rollup/-/rollup-4.32.1.tgz#95309604d92c3d21cbf06c3ee46a098209ce13a4"
+  integrity sha512-z+aeEsOeEa3mEbS1Tjl6sAZ8NE3+AalQz1RJGj81M+fizusbdDMoEJwdJNHfaB40Scr4qNu+welOfes7maKonA==
+  dependencies:
+    "@types/estree" "1.0.6"
+  optionalDependencies:
+    "@rollup/rollup-android-arm-eabi" "4.32.1"
+    "@rollup/rollup-android-arm64" "4.32.1"
+    "@rollup/rollup-darwin-arm64" "4.32.1"
+    "@rollup/rollup-darwin-x64" "4.32.1"
+    "@rollup/rollup-freebsd-arm64" "4.32.1"
+    "@rollup/rollup-freebsd-x64" "4.32.1"
+    "@rollup/rollup-linux-arm-gnueabihf" "4.32.1"
+    "@rollup/rollup-linux-arm-musleabihf" "4.32.1"
+    "@rollup/rollup-linux-arm64-gnu" "4.32.1"
+    "@rollup/rollup-linux-arm64-musl" "4.32.1"
+    "@rollup/rollup-linux-loongarch64-gnu" "4.32.1"
+    "@rollup/rollup-linux-powerpc64le-gnu" "4.32.1"
+    "@rollup/rollup-linux-riscv64-gnu" "4.32.1"
+    "@rollup/rollup-linux-s390x-gnu" "4.32.1"
+    "@rollup/rollup-linux-x64-gnu" "4.32.1"
+    "@rollup/rollup-linux-x64-musl" "4.32.1"
+    "@rollup/rollup-win32-arm64-msvc" "4.32.1"
+    "@rollup/rollup-win32-ia32-msvc" "4.32.1"
+    "@rollup/rollup-win32-x64-msvc" "4.32.1"
+    fsevents "~2.3.2"
+
 rrweb-cssom@^0.6.0:
   version "0.6.0"
   resolved "https://registry.yarnpkg.com/rrweb-cssom/-/rrweb-cssom-0.6.0.tgz#ed298055b97cbddcdeb278f904857629dec5e0e1"
@@ -15038,6 +15448,13 @@ source-map-url@^0.4.0:
   resolved "https://registry.yarnpkg.com/source-map-url/-/source-map-url-0.4.0.tgz#3e935d7ddd73631b97659956d55128e87b5084a3"
   integrity sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=
 
+source-map@0.8.0-beta.0:
+  version "0.8.0-beta.0"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.8.0-beta.0.tgz#d4c1bb42c3f7ee925f005927ba10709e0d1d1f11"
+  integrity sha512-2ymg6oRBpebeZi9UUNsgQ89bhx01TcTkmNTGnNO88imTmbSgy4nfujrgVEFKWpMTEGA11EDkTt7mqObTPdigIA==
+  dependencies:
+    whatwg-url "^7.0.0"
+
 source-map@^0.5.0, source-map@^0.5.1, source-map@^0.5.6:
   version "0.5.7"
   resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc"
@@ -15496,6 +15913,19 @@ style-loader@^1.2.1:
     loader-utils "^2.0.0"
     schema-utils "^2.6.6"
 
+sucrase@^3.35.0:
+  version "3.35.0"
+  resolved "https://registry.yarnpkg.com/sucrase/-/sucrase-3.35.0.tgz#57f17a3d7e19b36d8995f06679d121be914ae263"
+  integrity sha512-8EbVDiu9iN/nESwxeSxDKe0dunta1GOlHufmSSXxMD2z2/tMZpDMpvXQGsc+ajGo8y2uYUmixaSRUc/QPoQ0GA==
+  dependencies:
+    "@jridgewell/gen-mapping" "^0.3.2"
+    commander "^4.0.0"
+    glob "^10.3.10"
+    lines-and-columns "^1.1.6"
+    mz "^2.7.0"
+    pirates "^4.0.1"
+    ts-interface-checker "^0.1.9"
+
 sumchecker@^3.0.1:
   version "3.0.1"
   resolved "https://registry.yarnpkg.com/sumchecker/-/sumchecker-3.0.1.tgz#6377e996795abb0b6d348e9b3e1dfb24345a8e42"
@@ -15784,6 +16214,19 @@ tiny-warning@^1.0.3:
   resolved "https://registry.yarnpkg.com/tiny-warning/-/tiny-warning-1.0.3.tgz#94a30db453df4c643d0fd566060d60a875d84754"
   integrity sha512-lBN9zLN/oAf68o3zNXYrdCt1kP8WsiGW8Oo2ka41b2IM5JL/S1CTyX1rW0mb/zSuJun0ZUrDxx4sqvYS2FWzPA==
 
+tinyexec@^0.3.1:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/tinyexec/-/tinyexec-0.3.2.tgz#941794e657a85e496577995c6eef66f53f42b3d2"
+  integrity sha512-KQQR9yN7R5+OSwaK0XQoj22pwHoTlgYqmUscPYoknOoWCWfj/5/ABTMRi69FrKU5ffPVh5QcFikpWJI/P1ocHA==
+
+tinyglobby@^0.2.9:
+  version "0.2.10"
+  resolved "https://registry.yarnpkg.com/tinyglobby/-/tinyglobby-0.2.10.tgz#e712cf2dc9b95a1f5c5bbd159720e15833977a0f"
+  integrity sha512-Zc+8eJlFMvgatPZTl6A9L/yht8QqdmUNtURHaKZLmKBE12hNPSrqNkUp2cs3M/UKmNVVAMFQYSjYIVHDjW5zew==
+  dependencies:
+    fdir "^6.4.2"
+    picomatch "^4.0.2"
+
 titleize@^3.0.0:
   version "3.0.0"
   resolved "https://registry.yarnpkg.com/titleize/-/titleize-3.0.0.tgz#71c12eb7fdd2558aa8a44b0be83b8a76694acd53"
@@ -15890,6 +16333,13 @@ tough-cookie@^4.1.2:
     universalify "^0.2.0"
     url-parse "^1.5.3"
 
+tr46@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/tr46/-/tr46-1.0.1.tgz#a8b13fd6bfd2489519674ccde55ba3693b706d09"
+  integrity sha512-dTpowEjclQ7Kgx5SdBkqRzVhERQXov8/l9Ft9dVM9fmg0W0KQSVaXX9T4i6twCPNtYiZM53lpSSUAwJbFPOHxA==
+  dependencies:
+    punycode "^2.1.0"
+
 tr46@^4.1.1:
   version "4.1.1"
   resolved "https://registry.yarnpkg.com/tr46/-/tr46-4.1.1.tgz#281a758dcc82aeb4fe38c7dfe4d11a395aac8469"
@@ -15907,6 +16357,11 @@ traverse-chain@~0.1.0:
   resolved "https://registry.yarnpkg.com/traverse-chain/-/traverse-chain-0.1.0.tgz#61dbc2d53b69ff6091a12a168fd7d433107e40f1"
   integrity sha1-YdvC1Ttp/2CRoSoWj9fUMxB+QPE=
 
+tree-kill@^1.2.2:
+  version "1.2.2"
+  resolved "https://registry.yarnpkg.com/tree-kill/-/tree-kill-1.2.2.tgz#4ca09a9092c88b73a7cdc5e8a01b507b0790a0cc"
+  integrity sha512-L0Orpi8qGpRG//Nd+H90vFB+3iHnue1zSSGmNOOCh1GLJ7rUKVwV2HvijphGQS2UmhUZewS9VgvxYIdgr+fG1A==
+
 trim-newlines@^1.0.0:
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/trim-newlines/-/trim-newlines-1.0.0.tgz#5887966bb582a4503a41eb524f7d35011815a613"
@@ -15924,6 +16379,11 @@ ts-api-utils@^1.0.1:
   resolved "https://registry.yarnpkg.com/ts-api-utils/-/ts-api-utils-1.3.0.tgz#4b490e27129f1e8e686b45cc4ab63714dc60eea1"
   integrity sha512-UQMIo7pb8WRomKR1/+MFVLTroIvDVtMX3K6OUir8ynLyzB8Jeriont2bTAtmNPa1ekAgN7YPDyf6V+ygrdU+eQ==
 
+ts-interface-checker@^0.1.9:
+  version "0.1.13"
+  resolved "https://registry.yarnpkg.com/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz#784fd3d679722bc103b1b4b8030bcddb5db2a699"
+  integrity sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==
+
 ts-node@8.9.1:
   version "8.9.1"
   resolved "https://registry.yarnpkg.com/ts-node/-/ts-node-8.9.1.tgz#2f857f46c47e91dcd28a14e052482eb14cfd65a5"
@@ -15950,6 +16410,28 @@ tslib@^2.3.0:
   resolved "https://registry.yarnpkg.com/tslib/-/tslib-2.3.0.tgz#803b8cdab3e12ba581a4ca41c8839bbb0dacb09e"
   integrity sha512-N82ooyxVNm6h1riLCoyS9e3fuJ3AMG2zIZs2Gd1ATcSFjSA23Q0fzjjZeh0jbJvWVDZ0cJT8yaNNaaXHzueNjg==
 
+tsup@^8.3.5:
+  version "8.3.6"
+  resolved "https://registry.yarnpkg.com/tsup/-/tsup-8.3.6.tgz#a10eb2dc27f84b510a0f00341ab75cad03d13a88"
+  integrity sha512-XkVtlDV/58S9Ye0JxUUTcrQk4S+EqlOHKzg6Roa62rdjL1nGWNUstG0xgI4vanHdfIpjP448J8vlN0oK6XOJ5g==
+  dependencies:
+    bundle-require "^5.0.0"
+    cac "^6.7.14"
+    chokidar "^4.0.1"
+    consola "^3.2.3"
+    debug "^4.3.7"
+    esbuild "^0.24.0"
+    joycon "^3.1.1"
+    picocolors "^1.1.1"
+    postcss-load-config "^6.0.1"
+    resolve-from "^5.0.0"
+    rollup "^4.24.0"
+    source-map "0.8.0-beta.0"
+    sucrase "^3.35.0"
+    tinyexec "^0.3.1"
+    tinyglobby "^0.2.9"
+    tree-kill "^1.2.2"
+
 tsutils@^3.17.1:
   version "3.17.1"
   resolved "https://registry.yarnpkg.com/tsutils/-/tsutils-3.17.1.tgz#ed719917f11ca0dee586272b2ac49e015a2dd759"
@@ -16053,6 +16535,11 @@ typescript@^3.7.5:
   resolved "https://registry.yarnpkg.com/typescript/-/typescript-3.7.5.tgz#0692e21f65fd4108b9330238aac11dd2e177a1ae"
   integrity sha512-/P5lkRXkWHNAbcJIiHPfRoKqyd7bsyCma1hZNUGfn20qm64T6ZBlrzprymeu918H+mB/0rIg2gGK/BXkhhYgBw==
 
+typescript@^5.4.3:
+  version "5.7.3"
+  resolved "https://registry.yarnpkg.com/typescript/-/typescript-5.7.3.tgz#919b44a7dbb8583a9b856d162be24a54bf80073e"
+  integrity sha512-84MVSjMEHP+FQRPy3pX9sTVV/INIex71s9TL2Gm5FG/WG1SqXeKyZ0k7/blY/4FdOzI12CBy1vGc4og/eus0fw==
+
 ua-parser-js@^0.7.18, ua-parser-js@^0.7.9:
   version "0.7.20"
   resolved "https://registry.yarnpkg.com/ua-parser-js/-/ua-parser-js-0.7.20.tgz#7527178b82f6a62a0f243d1f94fd30e3e3c21098"
@@ -16086,6 +16573,11 @@ undici-types@~5.26.4:
   resolved "https://registry.yarnpkg.com/undici-types/-/undici-types-5.26.5.tgz#bcd539893d00b56e964fd2657a4866b221a65617"
   integrity sha512-JlCMO+ehdEIKqlFxk6IfVoAUVmgz7cU7zD/h9XZ0qzeosSHmUJVOzSQvvYSYWXkFXC+IfLKSIffhv0sVZup6pA==
 
+undici-types@~6.19.2:
+  version "6.19.8"
+  resolved "https://registry.yarnpkg.com/undici-types/-/undici-types-6.19.8.tgz#35111c9d1437ab83a7cdc0abae2f26d88eda0a02"
+  integrity sha512-ve2KP6f/JnbPBFyobGHuerC9g1FYGn/F8n1LWTwNxCEzd6IfqTwUQcNXgEtmmQ6DlRrC1hrSrBnCZPokRrDHjw==
+
 undici@^5.28.4:
   version "5.28.4"
   resolved "https://registry.yarnpkg.com/undici/-/undici-5.28.4.tgz#6b280408edb6a1a604a9b20340f45b422e373068"
@@ -16577,6 +17069,11 @@ webidl-conversions@^3.0.0:
   resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-3.0.1.tgz#24534275e2a7bc6be7bc86611cc16ae0a5654871"
   integrity sha512-2JAn3z8AR6rjK8Sm8orRC0h/bcl/DqL7tRPdGZ4I1CjdF+EaMLmYxBHyXuKL849eucPFhvBoxMsflfOb8kxaeQ==
 
+webidl-conversions@^4.0.2:
+  version "4.0.2"
+  resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-4.0.2.tgz#a855980b1f0b6b359ba1d5d9fb39ae941faa63ad"
+  integrity sha512-YQ+BmxuTgd6UXZW3+ICGfyqRyHXVlD5GtQr5+qjiNW7bF0cqrzX500HVXPBOvgXb5YnzDd+h0zqyv61KUD7+Sg==
+
 webidl-conversions@^7.0.0:
   version "7.0.0"
   resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-7.0.0.tgz#256b4e1882be7debbf01d05f0aa2039778ea080a"
@@ -16747,6 +17244,15 @@ whatwg-url@^5.0.0:
     tr46 "~0.0.3"
     webidl-conversions "^3.0.0"
 
+whatwg-url@^7.0.0:
+  version "7.1.0"
+  resolved "https://registry.yarnpkg.com/whatwg-url/-/whatwg-url-7.1.0.tgz#c2c492f1eca612988efd3d2266be1b9fc6170d06"
+  integrity sha512-WUu7Rg1DroM7oQvGWfOiAK21n74Gg+T4elXEQYkOhtyLeWiJFoOGLXPKI/9gzIie9CtwVLm8wtw6YJdKyxSjeg==
+  dependencies:
+    lodash.sortby "^4.7.0"
+    tr46 "^1.0.1"
+    webidl-conversions "^4.0.2"
+
 when@3.7.7:
   version "3.7.7"
   resolved "https://registry.yarnpkg.com/when/-/when-3.7.7.tgz#aba03fc3bb736d6c88b091d013d8a8e590d84718"

From 19ca800caa01eec2f5e65e547c67b11592bec8b0 Mon Sep 17 00:00:00 2001
From: Wick <wick.linxunjie@gmail.com>
Date: Sat, 1 Feb 2025 06:35:48 +0800
Subject: [PATCH 10/72] Reconciler: Combine identical cases in findParent
 (#32210)

## Summary

When lookup `Parent`, `HostRoot` and `HostPortal` should be merged,
because when creating a `Portal`, it will also include
`containerInfo`(So we can directly use this `containerInfo` to delete
the real DOM nodes.), so there is no need to handle them separately.

## How did you test this change?

No behavior changes, all existing tests pass.
---
 packages/react-reconciler/src/ReactFiberCommitWork.js | 6 +-----
 1 file changed, 1 insertion(+), 5 deletions(-)

diff --git a/packages/react-reconciler/src/ReactFiberCommitWork.js b/packages/react-reconciler/src/ReactFiberCommitWork.js
index 1cfe38cc209fa..850f3c67067ff 100644
--- a/packages/react-reconciler/src/ReactFiberCommitWork.js
+++ b/packages/react-reconciler/src/ReactFiberCommitWork.js
@@ -2007,11 +2007,7 @@ function commitDeletionEffects(
           hostParentIsContainer = false;
           break findParent;
         }
-        case HostRoot: {
-          hostParent = parent.stateNode.containerInfo;
-          hostParentIsContainer = true;
-          break findParent;
-        }
+        case HostRoot:
         case HostPortal: {
           hostParent = parent.stateNode.containerInfo;
           hostParentIsContainer = true;

From 152bfe3769f87e29c8d68cb87fdb608d2483b7f1 Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Fri, 31 Jan 2025 15:57:26 -0800
Subject: [PATCH 11/72] [compiler][rfc] Hacky retry pipeline for fire (#32164)

Hacky retry pipeline for when transforming `fire(...)` calls encounters
validation, todo, or memoization invariant bailouts. Would love feedback
on how we implement this to be extensible to other compiler
non-memoization features (e.g. inlineJSX)

Some observations:
- Compiler "front-end" passes (e.g. lower, type, effect, and mutability
inferences) should be shared for all compiler features -- memo and
otherwise
- Many passes (anything dealing with reactive scope ranges, scope blocks
/ dependencies, and optimizations such as ReactiveIR #31974) can be left
out of the retry pipeline. This PR hackily skips memoization features by
removing reactive scope creation, but we probably should restructure the
pipeline to skip these entirely on a retry
- We should maintain a canonical set of "validation flags"

Note the newly added fixtures are prefixed with `bailout-...` when the
retry fire pipeline is used. These fixture outputs contain correctly
inserted `useFire` calls and no memoization.
---
 .../src/Entrypoint/Pipeline.ts                |   9 +-
 .../src/Entrypoint/Program.ts                 | 123 +++++++++++-------
 .../src/HIR/Environment.ts                    |  13 ++
 .../src/Inference/InferReferenceEffects.ts    |   2 +-
 .../bailout-capitalized-fn-call.expect.md     |  50 +++++++
 .../bailout-capitalized-fn-call.js            |  16 +++
 .../bailout-eslint-suppressions.expect.md     |  55 ++++++++
 .../bailout-eslint-suppressions.js            |  18 +++
 .../bailout-validate-preserve-memo.expect.md  |  50 +++++++
 .../bailout-validate-preserve-memo.js         |  16 +++
 .../bailout-validate-prop-write.expect.md     |  42 ++++++
 .../bailout-validate-prop-write.js            |  12 ++
 ...lout-validate-ref-current-access.expect.md |  51 ++++++++
 .../bailout-validate-ref-current-access.js    |  17 +++
 .../bailout-retry/error.todo-syntax.expect.md |  49 +++++++
 .../bailout-retry/error.todo-syntax.js        |  20 +++
 .../bailout-retry/todo-use-no-memo.expect.md  |  47 +++++++
 .../bailout-retry/todo-use-no-memo.js         |  16 +++
 ...ailout-validate-conditional-hook.expect.md |  57 ++++++++
 ...s => bailout-validate-conditional-hook.js} |   7 +-
 ...r.invalid-conditional-use-effect.expect.md |  37 ------
 21 files changed, 617 insertions(+), 90 deletions(-)
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-capitalized-fn-call.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-capitalized-fn-call.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-eslint-suppressions.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-eslint-suppressions.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-preserve-memo.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-preserve-memo.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-prop-write.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-prop-write.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-ref-current-access.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-ref-current-access.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/error.todo-syntax.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/error.todo-syntax.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/todo-use-no-memo.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/todo-use-no-memo.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-validate-conditional-hook.expect.md
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/{error.invalid-conditional-use-effect.js => bailout-validate-conditional-hook.js} (55%)
 delete mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/error.invalid-conditional-use-effect.expect.md

diff --git a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Pipeline.ts b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Pipeline.ts
index a354acf69274e..0953289c1950e 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Pipeline.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Pipeline.ts
@@ -162,7 +162,8 @@ function runWithEnvironment(
   if (
     !env.config.enablePreserveExistingManualUseMemo &&
     !env.config.disableMemoizationForDebugging &&
-    !env.config.enableChangeDetectionForDebugging
+    !env.config.enableChangeDetectionForDebugging &&
+    !env.config.enableMinimalTransformsForRetry
   ) {
     dropManualMemoization(hir);
     log({kind: 'hir', name: 'DropManualMemoization', value: hir});
@@ -279,8 +280,10 @@ function runWithEnvironment(
     value: hir,
   });
 
-  inferReactiveScopeVariables(hir);
-  log({kind: 'hir', name: 'InferReactiveScopeVariables', value: hir});
+  if (!env.config.enableMinimalTransformsForRetry) {
+    inferReactiveScopeVariables(hir);
+    log({kind: 'hir', name: 'InferReactiveScopeVariables', value: hir});
+  }
 
   const fbtOperands = memoizeFbtAndMacroOperandsInSameScope(hir);
   log({
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Program.ts b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Program.ts
index 6ab9ee79c7412..787d9e7047efe 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Program.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Program.ts
@@ -16,6 +16,7 @@ import {
   EnvironmentConfig,
   ExternalFunction,
   ReactFunctionType,
+  MINIMAL_RETRY_CONFIG,
   tryParseExternalFunction,
 } from '../HIR/Environment';
 import {CodegenFunction} from '../ReactiveScopes';
@@ -382,66 +383,92 @@ export function compileProgram(
       );
     }
 
-    let compiledFn: CodegenFunction;
-    try {
-      /**
-       * Note that Babel does not attach comment nodes to nodes; they are dangling off of the
-       * Program node itself. We need to figure out whether an eslint suppression range
-       * applies to this function first.
-       */
-      const suppressionsInFunction = filterSuppressionsThatAffectFunction(
-        suppressions,
-        fn,
-      );
-      if (suppressionsInFunction.length > 0) {
-        const lintError = suppressionsToCompilerError(suppressionsInFunction);
-        if (optOutDirectives.length > 0) {
-          logError(lintError, pass, fn.node.loc ?? null);
-        } else {
-          handleError(lintError, pass, fn.node.loc ?? null);
-        }
-        return null;
+    /**
+     * Note that Babel does not attach comment nodes to nodes; they are dangling off of the
+     * Program node itself. We need to figure out whether an eslint suppression range
+     * applies to this function first.
+     */
+    const suppressionsInFunction = filterSuppressionsThatAffectFunction(
+      suppressions,
+      fn,
+    );
+    let compileResult:
+      | {kind: 'compile'; compiledFn: CodegenFunction}
+      | {kind: 'error'; error: unknown};
+    if (suppressionsInFunction.length > 0) {
+      compileResult = {
+        kind: 'error',
+        error: suppressionsToCompilerError(suppressionsInFunction),
+      };
+    } else {
+      try {
+        compileResult = {
+          kind: 'compile',
+          compiledFn: compileFn(
+            fn,
+            environment,
+            fnType,
+            useMemoCacheIdentifier.name,
+            pass.opts.logger,
+            pass.filename,
+            pass.code,
+          ),
+        };
+      } catch (err) {
+        compileResult = {kind: 'error', error: err};
       }
-
-      compiledFn = compileFn(
-        fn,
-        environment,
-        fnType,
-        useMemoCacheIdentifier.name,
-        pass.opts.logger,
-        pass.filename,
-        pass.code,
-      );
-      pass.opts.logger?.logEvent(pass.filename, {
-        kind: 'CompileSuccess',
-        fnLoc: fn.node.loc ?? null,
-        fnName: compiledFn.id?.name ?? null,
-        memoSlots: compiledFn.memoSlotsUsed,
-        memoBlocks: compiledFn.memoBlocks,
-        memoValues: compiledFn.memoValues,
-        prunedMemoBlocks: compiledFn.prunedMemoBlocks,
-        prunedMemoValues: compiledFn.prunedMemoValues,
-      });
-    } catch (err) {
+    }
+    // If non-memoization features are enabled, retry regardless of error kind
+    if (compileResult.kind === 'error' && environment.enableFire) {
+      try {
+        compileResult = {
+          kind: 'compile',
+          compiledFn: compileFn(
+            fn,
+            {
+              ...environment,
+              ...MINIMAL_RETRY_CONFIG,
+            },
+            fnType,
+            useMemoCacheIdentifier.name,
+            pass.opts.logger,
+            pass.filename,
+            pass.code,
+          ),
+        };
+      } catch (err) {
+        compileResult = {kind: 'error', error: err};
+      }
+    }
+    if (compileResult.kind === 'error') {
       /**
        * If an opt out directive is present, log only instead of throwing and don't mark as
        * containing a critical error.
        */
-      if (fn.node.body.type === 'BlockStatement') {
-        if (optOutDirectives.length > 0) {
-          logError(err, pass, fn.node.loc ?? null);
-          return null;
-        }
+      if (optOutDirectives.length > 0) {
+        logError(compileResult.error, pass, fn.node.loc ?? null);
+      } else {
+        handleError(compileResult.error, pass, fn.node.loc ?? null);
       }
-      handleError(err, pass, fn.node.loc ?? null);
       return null;
     }
 
+    pass.opts.logger?.logEvent(pass.filename, {
+      kind: 'CompileSuccess',
+      fnLoc: fn.node.loc ?? null,
+      fnName: compileResult.compiledFn.id?.name ?? null,
+      memoSlots: compileResult.compiledFn.memoSlotsUsed,
+      memoBlocks: compileResult.compiledFn.memoBlocks,
+      memoValues: compileResult.compiledFn.memoValues,
+      prunedMemoBlocks: compileResult.compiledFn.prunedMemoBlocks,
+      prunedMemoValues: compileResult.compiledFn.prunedMemoValues,
+    });
+
     /**
      * Always compile functions with opt in directives.
      */
     if (optInDirectives.length > 0) {
-      return compiledFn;
+      return compileResult.compiledFn;
     } else if (pass.opts.compilationMode === 'annotation') {
       /**
        * No opt-in directive in annotation mode, so don't insert the compiled function.
@@ -467,7 +494,7 @@ export function compileProgram(
     }
 
     if (!pass.opts.noEmit) {
-      return compiledFn;
+      return compileResult.compiledFn;
     }
     return null;
   };
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts
index 9df34242ec089..113af2025dd2b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts
@@ -552,6 +552,8 @@ const EnvironmentConfigSchema = z.object({
    */
   disableMemoizationForDebugging: z.boolean().default(false),
 
+  enableMinimalTransformsForRetry: z.boolean().default(false),
+
   /**
    * When true, rather using memoized values, the compiler will always re-compute
    * values, and then use a heuristic to compare the memoized value to the newly
@@ -626,6 +628,17 @@ const EnvironmentConfigSchema = z.object({
 
 export type EnvironmentConfig = z.infer<typeof EnvironmentConfigSchema>;
 
+export const MINIMAL_RETRY_CONFIG: PartialEnvironmentConfig = {
+  validateHooksUsage: false,
+  validateRefAccessDuringRender: false,
+  validateNoSetStateInRender: false,
+  validateNoSetStateInPassiveEffects: false,
+  validateNoJSXInTryStatements: false,
+  validateMemoizedEffectDependencies: false,
+  validateNoCapitalizedCalls: null,
+  validateBlocklistedImports: null,
+  enableMinimalTransformsForRetry: true,
+};
 /**
  * For test fixtures and playground only.
  *
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
index 70395e58d930e..0afe479df08dd 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
@@ -241,7 +241,7 @@ export default function inferReferenceEffects(
 
   if (options.isFunctionExpression) {
     fn.effects = functionEffects;
-  } else {
+  } else if (!fn.env.config.enableMinimalTransformsForRetry) {
     raiseFunctionEffectErrors(functionEffects);
   }
 }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-capitalized-fn-call.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-capitalized-fn-call.expect.md
new file mode 100644
index 0000000000000..f7f413dedf906
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-capitalized-fn-call.expect.md
@@ -0,0 +1,50 @@
+
+## Input
+
+```javascript
+// @validateNoCapitalizedCalls @enableFire
+import {fire} from 'react';
+const CapitalizedCall = require('shared-runtime').sum;
+
+function Component({prop1, bar}) {
+  const foo = () => {
+    console.log(prop1);
+  };
+  useEffect(() => {
+    fire(foo(prop1));
+    fire(foo());
+    fire(bar());
+  });
+
+  return CapitalizedCall();
+}
+
+```
+
+## Code
+
+```javascript
+import { useFire } from "react/compiler-runtime"; // @validateNoCapitalizedCalls @enableFire
+import { fire } from "react";
+const CapitalizedCall = require("shared-runtime").sum;
+
+function Component(t0) {
+  const { prop1, bar } = t0;
+  const foo = () => {
+    console.log(prop1);
+  };
+  const t1 = useFire(foo);
+  const t2 = useFire(bar);
+
+  useEffect(() => {
+    t1(prop1);
+    t1();
+    t2();
+  });
+  return CapitalizedCall();
+}
+
+```
+      
+### Eval output
+(kind: exception) Fixture not implemented
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-capitalized-fn-call.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-capitalized-fn-call.js
new file mode 100644
index 0000000000000..b872fd8670e8e
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-capitalized-fn-call.js
@@ -0,0 +1,16 @@
+// @validateNoCapitalizedCalls @enableFire
+import {fire} from 'react';
+const CapitalizedCall = require('shared-runtime').sum;
+
+function Component({prop1, bar}) {
+  const foo = () => {
+    console.log(prop1);
+  };
+  useEffect(() => {
+    fire(foo(prop1));
+    fire(foo());
+    fire(bar());
+  });
+
+  return CapitalizedCall();
+}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-eslint-suppressions.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-eslint-suppressions.expect.md
new file mode 100644
index 0000000000000..ad7f0ab467b00
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-eslint-suppressions.expect.md
@@ -0,0 +1,55 @@
+
+## Input
+
+```javascript
+// @enableFire
+import {useRef} from 'react';
+
+function Component({props, bar}) {
+  const foo = () => {
+    console.log(props);
+  };
+  useEffect(() => {
+    fire(foo(props));
+    fire(foo());
+    fire(bar());
+  });
+
+  const ref = useRef(null);
+  // eslint-disable-next-line react-hooks/rules-of-hooks
+  ref.current = 'bad';
+  return <button ref={ref} />;
+}
+
+```
+
+## Code
+
+```javascript
+import { useFire } from "react/compiler-runtime"; // @enableFire
+import { useRef } from "react";
+
+function Component(t0) {
+  const { props, bar } = t0;
+  const foo = () => {
+    console.log(props);
+  };
+  const t1 = useFire(foo);
+  const t2 = useFire(bar);
+
+  useEffect(() => {
+    t1(props);
+    t1();
+    t2();
+  });
+
+  const ref = useRef(null);
+
+  ref.current = "bad";
+  return <button ref={ref} />;
+}
+
+```
+      
+### Eval output
+(kind: exception) Fixture not implemented
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-eslint-suppressions.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-eslint-suppressions.js
new file mode 100644
index 0000000000000..7145fef03b1d4
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-eslint-suppressions.js
@@ -0,0 +1,18 @@
+// @enableFire
+import {useRef} from 'react';
+
+function Component({props, bar}) {
+  const foo = () => {
+    console.log(props);
+  };
+  useEffect(() => {
+    fire(foo(props));
+    fire(foo());
+    fire(bar());
+  });
+
+  const ref = useRef(null);
+  // eslint-disable-next-line react-hooks/rules-of-hooks
+  ref.current = 'bad';
+  return <button ref={ref} />;
+}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-preserve-memo.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-preserve-memo.expect.md
new file mode 100644
index 0000000000000..9f8db6265f064
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-preserve-memo.expect.md
@@ -0,0 +1,50 @@
+
+## Input
+
+```javascript
+// @validatePreserveExistingMemoizationGuarantees @enableFire
+import {fire} from 'react';
+import {sum} from 'shared-runtime';
+
+function Component({prop1, bar}) {
+  const foo = () => {
+    console.log(prop1);
+  };
+  useEffect(() => {
+    fire(foo(prop1));
+    fire(foo());
+    fire(bar());
+  });
+
+  return useMemo(() => sum(bar), []);
+}
+
+```
+
+## Code
+
+```javascript
+import { useFire } from "react/compiler-runtime"; // @validatePreserveExistingMemoizationGuarantees @enableFire
+import { fire } from "react";
+import { sum } from "shared-runtime";
+
+function Component(t0) {
+  const { prop1, bar } = t0;
+  const foo = () => {
+    console.log(prop1);
+  };
+  const t1 = useFire(foo);
+  const t2 = useFire(bar);
+
+  useEffect(() => {
+    t1(prop1);
+    t1();
+    t2();
+  });
+  return useMemo(() => sum(bar), []);
+}
+
+```
+      
+### Eval output
+(kind: exception) Fixture not implemented
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-preserve-memo.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-preserve-memo.js
new file mode 100644
index 0000000000000..b7c01e40ac2a5
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-preserve-memo.js
@@ -0,0 +1,16 @@
+// @validatePreserveExistingMemoizationGuarantees @enableFire
+import {fire} from 'react';
+import {sum} from 'shared-runtime';
+
+function Component({prop1, bar}) {
+  const foo = () => {
+    console.log(prop1);
+  };
+  useEffect(() => {
+    fire(foo(prop1));
+    fire(foo());
+    fire(bar());
+  });
+
+  return useMemo(() => sum(bar), []);
+}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-prop-write.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-prop-write.expect.md
new file mode 100644
index 0000000000000..74d9f679c4ffd
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-prop-write.expect.md
@@ -0,0 +1,42 @@
+
+## Input
+
+```javascript
+// @enableFire
+import {fire} from 'react';
+
+function Component({prop1}) {
+  const foo = () => {
+    console.log(prop1);
+  };
+  useEffect(() => {
+    fire(foo(prop1));
+  });
+  prop1.value += 1;
+}
+
+```
+
+## Code
+
+```javascript
+import { useFire } from "react/compiler-runtime"; // @enableFire
+import { fire } from "react";
+
+function Component(t0) {
+  const { prop1 } = t0;
+  const foo = () => {
+    console.log(prop1);
+  };
+  const t1 = useFire(foo);
+
+  useEffect(() => {
+    t1(prop1);
+  });
+  prop1.value = prop1.value + 1;
+}
+
+```
+      
+### Eval output
+(kind: exception) Fixture not implemented
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-prop-write.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-prop-write.js
new file mode 100644
index 0000000000000..4fac46f78e81c
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-prop-write.js
@@ -0,0 +1,12 @@
+// @enableFire
+import {fire} from 'react';
+
+function Component({prop1}) {
+  const foo = () => {
+    console.log(prop1);
+  };
+  useEffect(() => {
+    fire(foo(prop1));
+  });
+  prop1.value += 1;
+}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-ref-current-access.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-ref-current-access.expect.md
new file mode 100644
index 0000000000000..af0fc7b5a2f26
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-ref-current-access.expect.md
@@ -0,0 +1,51 @@
+
+## Input
+
+```javascript
+// @flow @enableFire
+import {fire} from 'react';
+import {print} from 'shared-runtime';
+
+component Component(prop1, ref) {
+  const foo = () => {
+    console.log(prop1);
+  };
+  useEffect(() => {
+    fire(foo(prop1));
+    bar();
+    fire(foo());
+  });
+
+  print(ref.current);
+  return null;
+}
+
+```
+
+## Code
+
+```javascript
+import { useFire } from "react/compiler-runtime";
+import { fire } from "react";
+import { print } from "shared-runtime";
+
+const Component = React.forwardRef(Component_withRef);
+function Component_withRef(t0, ref) {
+  const { prop1 } = t0;
+  const foo = () => {
+    console.log(prop1);
+  };
+  const t1 = useFire(foo);
+  useEffect(() => {
+    t1(prop1);
+    bar();
+    t1();
+  });
+  print(ref.current);
+  return null;
+}
+
+```
+      
+### Eval output
+(kind: exception) Fixture not implemented
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-ref-current-access.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-ref-current-access.js
new file mode 100644
index 0000000000000..96ccf0b161e93
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/bailout-validate-ref-current-access.js
@@ -0,0 +1,17 @@
+// @flow @enableFire
+import {fire} from 'react';
+import {print} from 'shared-runtime';
+
+component Component(prop1, ref) {
+  const foo = () => {
+    console.log(prop1);
+  };
+  useEffect(() => {
+    fire(foo(prop1));
+    bar();
+    fire(foo());
+  });
+
+  print(ref.current);
+  return null;
+}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/error.todo-syntax.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/error.todo-syntax.expect.md
new file mode 100644
index 0000000000000..86836d86b6092
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/error.todo-syntax.expect.md
@@ -0,0 +1,49 @@
+
+## Input
+
+```javascript
+// @enableFire
+import {fire} from 'react';
+
+/**
+ * Note that a react compiler-based transform still has limitations on JS syntax.
+ * In practice, we expect to surface these as actionable errors to the user, in
+ * the same way that invalid `fire` calls error.
+ */
+function Component({prop1}) {
+  const foo = () => {
+    try {
+      console.log(prop1);
+    } finally {
+      console.log('jbrown215');
+    }
+  };
+  useEffect(() => {
+    fire(foo());
+  });
+}
+
+```
+
+
+## Error
+
+```
+   9 | function Component({prop1}) {
+  10 |   const foo = () => {
+> 11 |     try {
+     |     ^^^^^
+> 12 |       console.log(prop1);
+     | ^^^^^^^^^^^^^^^^^^^^^^^^^
+> 13 |     } finally {
+     | ^^^^^^^^^^^^^^^^^^^^^^^^^
+> 14 |       console.log('jbrown215');
+     | ^^^^^^^^^^^^^^^^^^^^^^^^^
+> 15 |     }
+     | ^^^^^^ Todo: (BuildHIR::lowerStatement) Handle TryStatement without a catch clause (11:15)
+  16 |   };
+  17 |   useEffect(() => {
+  18 |     fire(foo());
+```
+          
+      
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/error.todo-syntax.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/error.todo-syntax.js
new file mode 100644
index 0000000000000..ec50ed84c5780
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/error.todo-syntax.js
@@ -0,0 +1,20 @@
+// @enableFire
+import {fire} from 'react';
+
+/**
+ * Note that a react compiler-based transform still has limitations on JS syntax.
+ * In practice, we expect to surface these as actionable errors to the user, in
+ * the same way that invalid `fire` calls error.
+ */
+function Component({prop1}) {
+  const foo = () => {
+    try {
+      console.log(prop1);
+    } finally {
+      console.log('jbrown215');
+    }
+  };
+  useEffect(() => {
+    fire(foo());
+  });
+}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/todo-use-no-memo.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/todo-use-no-memo.expect.md
new file mode 100644
index 0000000000000..907501228b10b
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/todo-use-no-memo.expect.md
@@ -0,0 +1,47 @@
+
+## Input
+
+```javascript
+// @enableFire
+import {fire} from 'react';
+
+function Component({props, bar}) {
+  'use no memo';
+  const foo = () => {
+    console.log(props);
+  };
+  useEffect(() => {
+    fire(foo(props));
+    fire(foo());
+    fire(bar());
+  });
+
+  return null;
+}
+
+```
+
+## Code
+
+```javascript
+// @enableFire
+import { fire } from "react";
+
+function Component({ props, bar }) {
+  "use no memo";
+  const foo = () => {
+    console.log(props);
+  };
+  useEffect(() => {
+    fire(foo(props));
+    fire(foo());
+    fire(bar());
+  });
+
+  return null;
+}
+
+```
+      
+### Eval output
+(kind: exception) Fixture not implemented
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/todo-use-no-memo.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/todo-use-no-memo.js
new file mode 100644
index 0000000000000..2587e24ee1170
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-retry/todo-use-no-memo.js
@@ -0,0 +1,16 @@
+// @enableFire
+import {fire} from 'react';
+
+function Component({props, bar}) {
+  'use no memo';
+  const foo = () => {
+    console.log(props);
+  };
+  useEffect(() => {
+    fire(foo(props));
+    fire(foo());
+    fire(bar());
+  });
+
+  return null;
+}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-validate-conditional-hook.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-validate-conditional-hook.expect.md
new file mode 100644
index 0000000000000..c20f89d3af8d2
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-validate-conditional-hook.expect.md
@@ -0,0 +1,57 @@
+
+## Input
+
+```javascript
+// @enableFire
+import {fire, useEffect} from 'react';
+import {Stringify} from 'shared-runtime';
+
+/**
+ * When @enableFire is specified, retry compilation with validation passes (e.g.
+ * hook usage) disabled
+ */
+function Component(props) {
+  const foo = props => {
+    console.log(props);
+  };
+
+  if (props.cond) {
+    useEffect(() => {
+      fire(foo(props));
+    });
+  }
+
+  return <Stringify />;
+}
+
+```
+
+## Code
+
+```javascript
+import { useFire } from "react/compiler-runtime"; // @enableFire
+import { fire, useEffect } from "react";
+import { Stringify } from "shared-runtime";
+
+/**
+ * When @enableFire is specified, retry compilation with validation passes (e.g.
+ * hook usage) disabled
+ */
+function Component(props) {
+  const foo = _temp;
+  if (props.cond) {
+    const t0 = useFire(foo);
+    useEffect(() => {
+      t0(props);
+    });
+  }
+  return <Stringify />;
+}
+function _temp(props_0) {
+  console.log(props_0);
+}
+
+```
+      
+### Eval output
+(kind: exception) Fixture not implemented
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/error.invalid-conditional-use-effect.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-validate-conditional-hook.js
similarity index 55%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/error.invalid-conditional-use-effect.js
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-validate-conditional-hook.js
index 30ae8e59b986e..0a29fd852c030 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/error.invalid-conditional-use-effect.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/bailout-validate-conditional-hook.js
@@ -1,6 +1,11 @@
 // @enableFire
 import {fire, useEffect} from 'react';
+import {Stringify} from 'shared-runtime';
 
+/**
+ * When @enableFire is specified, retry compilation with validation passes (e.g.
+ * hook usage) disabled
+ */
 function Component(props) {
   const foo = props => {
     console.log(props);
@@ -12,5 +17,5 @@ function Component(props) {
     });
   }
 
-  return null;
+  return <Stringify />;
 }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/error.invalid-conditional-use-effect.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/error.invalid-conditional-use-effect.expect.md
deleted file mode 100644
index a24f27a695f54..0000000000000
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/transform-fire/error.invalid-conditional-use-effect.expect.md
+++ /dev/null
@@ -1,37 +0,0 @@
-
-## Input
-
-```javascript
-// @enableFire
-import {fire, useEffect} from 'react';
-
-function Component(props) {
-  const foo = props => {
-    console.log(props);
-  };
-
-  if (props.cond) {
-    useEffect(() => {
-      fire(foo(props));
-    });
-  }
-
-  return null;
-}
-
-```
-
-
-## Error
-
-```
-   8 |
-   9 |   if (props.cond) {
-> 10 |     useEffect(() => {
-     |     ^^^^^^^^^ InvalidReact: Hooks must always be called in a consistent order, and may not be called conditionally. See the Rules of Hooks (https://react.dev/warnings/invalid-hook-call-warning) (10:10)
-  11 |       fire(foo(props));
-  12 |     });
-  13 |   }
-```
-          
-      
\ No newline at end of file

From 1f0b03ced0d459129069d565cf5f8e5567881441 Mon Sep 17 00:00:00 2001
From: Ruslan Lesiutin <rdlesyutin@gmail.com>
Date: Mon, 3 Feb 2025 09:59:47 +0000
Subject: [PATCH 12/72] DevTools: fix host component filter option title
 (#32296)

Overlook that in https://github.com/facebook/react/pull/32086, because
of ternany, it is already string literals, so html entities names no
longer needed.
---
 .../src/devtools/views/Settings/ComponentsSettings.js         | 4 ++--
 1 file changed, 2 insertions(+), 2 deletions(-)

diff --git a/packages/react-devtools-shared/src/devtools/views/Settings/ComponentsSettings.js b/packages/react-devtools-shared/src/devtools/views/Settings/ComponentsSettings.js
index 419435d6c470a..a521c5bea908f 100644
--- a/packages/react-devtools-shared/src/devtools/views/Settings/ComponentsSettings.js
+++ b/packages/react-devtools-shared/src/devtools/views/Settings/ComponentsSettings.js
@@ -478,8 +478,8 @@ export default function ComponentsSettings({
                     <option value={ElementTypeForwardRef}>forward ref</option>
                     <option value={ElementTypeHostComponent}>
                       {__IS_NATIVE__
-                        ? 'host components (e.g. &lt;RCTText&gt;)'
-                        : 'dom nodes (e.g. &lt;div&gt;)'}
+                        ? 'host components (e.g. <RCTText>)'
+                        : 'dom nodes (e.g. <div>)'}
                     </option>
                     <option value={ElementTypeMemo}>memo</option>
                     <option value={ElementTypeOtherOrUnknown}>other</option>

From a4b2d0d51854b10ca0346ab8977da4975d2a7498 Mon Sep 17 00:00:00 2001
From: Ruslan Lesiutin <rdlesyutin@gmail.com>
Date: Mon, 3 Feb 2025 09:59:58 +0000
Subject: [PATCH 13/72] fix[react-devtools-fusebox]: add extension globals to
 build (#32297)

We started using these globals in `react-devtools-shared/src/frontend`
code, forward-fixing https://github.com/facebook/react/pull/32262.
---
 packages/react-devtools-fusebox/webpack.config.frontend.js | 3 +++
 1 file changed, 3 insertions(+)

diff --git a/packages/react-devtools-fusebox/webpack.config.frontend.js b/packages/react-devtools-fusebox/webpack.config.frontend.js
index 53b07b6ebf0b2..ab7906ca84d63 100644
--- a/packages/react-devtools-fusebox/webpack.config.frontend.js
+++ b/packages/react-devtools-fusebox/webpack.config.frontend.js
@@ -83,6 +83,9 @@ module.exports = {
       __PROFILE__: false,
       __TEST__: NODE_ENV === 'test',
       __IS_NATIVE__: true,
+      __IS_CHROME__: false,
+      __IS_FIREFOX__: false,
+      __IS_EDGE__: false,
       'process.env.DEVTOOLS_PACKAGE': `"react-devtools-fusebox"`,
       'process.env.DEVTOOLS_VERSION': `"${DEVTOOLS_VERSION}"`,
       'process.env.EDITOR_URL': EDITOR_URL != null ? `"${EDITOR_URL}"` : null,

From 10a4c88f58233074f293ab387b73e96b67192538 Mon Sep 17 00:00:00 2001
From: inottn <inottn@outlook.com>
Date: Tue, 4 Feb 2025 00:41:04 +0800
Subject: [PATCH 14/72] [compiler] Handle TSInstantiationExpression in
 lowerExpression (#32302)

Fix #31745
---
 .../src/HIR/BuildHIR.ts                       |  1 +
 .../ts-instantiation-expression.expect.md     | 46 +++++++++++++++++++
 .../compiler/ts-instantiation-expression.tsx  | 11 +++++
 3 files changed, 58 insertions(+)
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/ts-instantiation-expression.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/ts-instantiation-expression.tsx

diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
index 4d9ce6becc17a..d5c3ea6a492a9 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
@@ -2528,6 +2528,7 @@ function lowerExpression(
         loc: expr.node.loc ?? GeneratedSource,
       };
     }
+    case 'TSInstantiationExpression':
     case 'TSNonNullExpression': {
       let expr = exprPath as NodePath<t.TSNonNullExpression>;
       return lowerExpression(builder, expr.get('expression'));
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/ts-instantiation-expression.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/ts-instantiation-expression.expect.md
new file mode 100644
index 0000000000000..8400a135b6fe4
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/ts-instantiation-expression.expect.md
@@ -0,0 +1,46 @@
+
+## Input
+
+```javascript
+import {identity, invoke} from 'shared-runtime';
+
+function Test() {
+  const str = invoke(identity<string>, 'test');
+  return str;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Test,
+  params: [],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime";
+import { identity, invoke } from "shared-runtime";
+
+function Test() {
+  const $ = _c(1);
+  let t0;
+  if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
+    t0 = invoke(identity, "test");
+    $[0] = t0;
+  } else {
+    t0 = $[0];
+  }
+  const str = t0;
+  return str;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Test,
+  params: [],
+};
+
+```
+      
+### Eval output
+(kind: ok) "test"
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/ts-instantiation-expression.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/ts-instantiation-expression.tsx
new file mode 100644
index 0000000000000..373d005747644
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/ts-instantiation-expression.tsx
@@ -0,0 +1,11 @@
+import {identity, invoke} from 'shared-runtime';
+
+function Test() {
+  const str = invoke(identity<string>, 'test');
+  return str;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Test,
+  params: [],
+};

From 442150e0e2783ce9ab407a113acd2656752323d2 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Mon, 3 Feb 2025 11:07:30 -0600
Subject: [PATCH 15/72] build(eslint-plugin-react-hooks): tsconfig and global
 types (#32283)

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

Contributing to https://github.com/facebook/react/pull/32240, this
change adds the tsconfig, tsup config, and estree type declarations that
will be needed for that plugin's typescript migration.
---
 .../src/types/estree.d.ts                     | 70 +++++++++++++++++++
 .../src/types/global.d.ts                     |  4 ++
 .../eslint-plugin-react-hooks/tsconfig.json   | 15 ++++
 .../eslint-plugin-react-hooks/tsup.config.ts  |  9 +++
 4 files changed, 98 insertions(+)
 create mode 100644 packages/eslint-plugin-react-hooks/src/types/estree.d.ts
 create mode 100644 packages/eslint-plugin-react-hooks/src/types/global.d.ts
 create mode 100644 packages/eslint-plugin-react-hooks/tsconfig.json
 create mode 100644 packages/eslint-plugin-react-hooks/tsup.config.ts

diff --git a/packages/eslint-plugin-react-hooks/src/types/estree.d.ts b/packages/eslint-plugin-react-hooks/src/types/estree.d.ts
new file mode 100644
index 0000000000000..10337ef7d6bf0
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/src/types/estree.d.ts
@@ -0,0 +1,70 @@
+/**
+ * This file augments the `estree` types to include types that are not built-in to `estree` or `estree-jsx`.
+ * This is necessary because the `estree` types are used by ESLint, and ESLint does not natively support
+ * TypeScript or Flow types.  Since we're not using a ton of them, we can just add them here, rather than
+ * installing typescript estree or flow estree types.
+ *
+ * This also adds support for the AST mutation that the Exhaustive deps rule does to add parent nodes.
+ */
+declare module 'estree' {
+  // The Exhaustive deps rule mutates the AST to add parent nodes for efficient traversal.
+  // We need to augment the `estree` types to support that.
+  interface BaseNode {
+    parent?: Node;
+  }
+
+  // Adding types that aren't built-in to estree or estree-jsx.
+  // Namely, the specific TS and Flow types that we're using.
+  interface AsExpression extends BaseExpression {
+    type: 'AsExpression';
+    expression: Expression | Identifier;
+  }
+
+  interface OptionalCallExpression extends BaseCallExpression {
+    type: 'OptionalCallExpression';
+  }
+
+  interface OptionalMemberExpression extends MemberExpression {
+    type: 'OptionalMemberExpression';
+  }
+
+  interface TSAsExpression extends BaseExpression {
+    type: 'TSAsExpression';
+    expression: Expression | Identifier;
+  }
+
+  interface TSTypeQuery extends BaseNode {
+    type: 'TSTypeQuery';
+    exprName: Identifier;
+  }
+
+  interface TSTypeReference extends BaseNode {
+    type: 'TSTypeReference';
+    typeName: Identifier;
+  }
+
+  interface TypeCastExpression extends BaseExpression {
+    type: 'TypeCastExpression';
+    expression: Expression | Identifier;
+  }
+
+  // Extend the set of known Expression types
+  interface ExpressionMap {
+    AsExpression: AsExpression;
+    OptionalCallExpression: OptionalCallExpression;
+    OptionalMemberExpression: OptionalMemberExpression;
+    TSAsExpression: TSAsExpression;
+    TypeCastExpression: TypeCastExpression;
+  }
+
+  // Extend the set of known Node types
+  interface NodeMap {
+    AsExpression: AsExpression;
+    OptionalCallExpression: OptionalCallExpression;
+    OptionalMemberExpression: OptionalMemberExpression;
+    TSAsExpression: TSAsExpression;
+    TSTypeQuery: TSTypeQuery;
+    TSTypeReference: TSTypeReference;
+    TypeCastExpression: TypeCastExpression;
+  }
+}
diff --git a/packages/eslint-plugin-react-hooks/src/types/global.d.ts b/packages/eslint-plugin-react-hooks/src/types/global.d.ts
new file mode 100644
index 0000000000000..b334f17ee5381
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/src/types/global.d.ts
@@ -0,0 +1,4 @@
+// In order to support the __EXPERIMENTAL__ global in TypeScript,
+// we need to declare it here.  The value of this is set in both
+// the jest setup and CI build
+declare const __EXPERIMENTAL__: boolean;
diff --git a/packages/eslint-plugin-react-hooks/tsconfig.json b/packages/eslint-plugin-react-hooks/tsconfig.json
new file mode 100644
index 0000000000000..db8a4893649ea
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/tsconfig.json
@@ -0,0 +1,15 @@
+{
+  "extends": "@tsconfig/strictest/tsconfig.json",
+  "compilerOptions": {
+    "module": "ES2015",
+    "target": "ES2015",
+    "moduleResolution": "Bundler",
+    "lib": ["ES2020"],
+    "rootDir": ".",
+    "noEmit": true,
+    "sourceMap": false,
+    "types": ["estree-jsx", "node"]
+  },
+  "exclude": ["node_modules"],
+  "include": ["src/**/*.ts"]
+}
diff --git a/packages/eslint-plugin-react-hooks/tsup.config.ts b/packages/eslint-plugin-react-hooks/tsup.config.ts
new file mode 100644
index 0000000000000..e275d0495e26c
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/tsup.config.ts
@@ -0,0 +1,9 @@
+import {defineConfig} from 'tsup';
+
+export default defineConfig({
+  clean: true,
+  dts: true,
+  entry: ['src/index.ts'],
+  format: ['cjs'],
+  outDir: 'build',
+});

From 0a82580bfc80538c5ce914514dc86b17c8889954 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Mon, 3 Feb 2025 12:57:51 -0500
Subject: [PATCH 16/72] [ci] Only notify discord on core team label (#32303)

Rather than notify on every label event on a PR by a core team member,
only do so for the specific core team label event.
---
 .github/workflows/compiler_discord_notify.yml | 2 +-
 .github/workflows/runtime_discord_notify.yml  | 2 +-
 2 files changed, 2 insertions(+), 2 deletions(-)

diff --git a/.github/workflows/compiler_discord_notify.yml b/.github/workflows/compiler_discord_notify.yml
index b4694e12be94d..1ab9c1b1aff5b 100644
--- a/.github/workflows/compiler_discord_notify.yml
+++ b/.github/workflows/compiler_discord_notify.yml
@@ -14,7 +14,7 @@ jobs:
       actor: ${{ github.event.pull_request.user.login }}
 
   notify:
-    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' }}
+    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' && github.event.label.name == 'React Core Team' }}
     needs: check_maintainer
     runs-on: ubuntu-latest
     steps:
diff --git a/.github/workflows/runtime_discord_notify.yml b/.github/workflows/runtime_discord_notify.yml
index a29735ac4ed8e..59a1078b499e8 100644
--- a/.github/workflows/runtime_discord_notify.yml
+++ b/.github/workflows/runtime_discord_notify.yml
@@ -14,7 +14,7 @@ jobs:
       actor: ${{ github.event.pull_request.user.login }}
 
   notify:
-    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' }}
+    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' && github.event.label.name == 'React Core Team' }}
     needs: check_maintainer
     runs-on: ubuntu-latest
     steps:

From f82c662b8d28461ffdb9f82f3fc26b7b54b9bef5 Mon Sep 17 00:00:00 2001
From: Devon Govett <devongovett@gmail.com>
Date: Tue, 4 Feb 2025 14:17:13 -0500
Subject: [PATCH 17/72] [Flight Parcel] Implement findSourceMapURL (#32294)

This implements `findSourceMapURL` in react-server-dom-parcel, enabling
source maps for replayed server errors on the client. It utilizes a new
endpoint in the Parcel dev server that returns the source map for a
given bundle/file. The error overlay UI has also been updated to handle
these stacks. See https://github.com/parcel-bundler/parcel/pull/10082

Also updated the fixture to the latest Parcel canary. A few APIs have
changed. We do have a higher level library wrapper now (`@parcel/rsc`
added in https://github.com/parcel-bundler/parcel/pull/10074) but I left
the fixture using the lower level APIs directly here since it is easier
to see how react-server-dom-parcel is used.
---
 fixtures/flight-parcel/.parcelrc              |    4 -
 fixtures/flight-parcel/package.json           |   23 +-
 fixtures/flight-parcel/src/Todos.tsx          |    2 -
 fixtures/flight-parcel/src/server.tsx         |    4 +-
 fixtures/flight-parcel/yarn.lock              | 1204 +++++++++--------
 .../src/client/ReactFlightDOMClientBrowser.js |   18 +-
 .../src/client/ReactFlightDOMClientEdge.js    |   21 +-
 .../src/client/ReactFlightDOMClientNode.js    |   21 +-
 scripts/flow/environment.js                   |    1 +
 9 files changed, 675 insertions(+), 623 deletions(-)
 delete mode 100644 fixtures/flight-parcel/.parcelrc

diff --git a/fixtures/flight-parcel/.parcelrc b/fixtures/flight-parcel/.parcelrc
deleted file mode 100644
index e1cb0cff532fb..0000000000000
--- a/fixtures/flight-parcel/.parcelrc
+++ /dev/null
@@ -1,4 +0,0 @@
-{
-  "extends": "@parcel/config-default",
-  "runtimes": ["...", "@parcel/runtime-rsc"]
-}
diff --git a/fixtures/flight-parcel/package.json b/fixtures/flight-parcel/package.json
index d2abb05a8f558..3d630bf5e132b 100644
--- a/fixtures/flight-parcel/package.json
+++ b/fixtures/flight-parcel/package.json
@@ -1,15 +1,11 @@
 {
   "name": "flight-parcel",
   "private": true,
-  "workspaces": [
-    "examples/*"
-  ],
+  "source": "src/server.tsx",
   "server": "dist/server.js",
   "targets": {
     "server": {
-      "source": "src/server.tsx",
       "context": "react-server",
-      "outputFormat": "commonjs",
       "includeNodeModules": {
         "express": false
       }
@@ -18,18 +14,11 @@
   "scripts": {
     "predev": "cp -r ../../build/oss-experimental/* ./node_modules/",
     "prebuild": "cp -r ../../build/oss-experimental/* ./node_modules/",
-    "dev": "concurrently \"npm run dev:watch\" \"sleep 2 && npm run dev:start\"",
-    "dev:watch": "NODE_ENV=development parcel watch",
-    "dev:start": "NODE_ENV=development node dist/server.js",
+    "dev": "parcel",
     "build": "parcel build",
     "start": "node dist/server.js"
   },
-  "@parcel/resolver-default": {
-    "packageExports": true
-  },
   "dependencies": {
-    "@parcel/config-default": "2.0.0-dev.1795",
-    "@parcel/runtime-rsc": "2.13.3-dev.3418",
     "@types/parcel-env": "^0.0.6",
     "@types/express": "*",
     "@types/node": "^22.10.1",
@@ -37,15 +26,11 @@
     "@types/react-dom": "^19",
     "concurrently": "^7.3.0",
     "express": "^4.18.2",
-    "parcel": "2.0.0-dev.1793",
+    "parcel": "canary",
     "process": "^0.11.10",
     "react": "experimental",
     "react-dom": "experimental",
     "react-server-dom-parcel": "experimental",
-    "rsc-html-stream": "^0.0.4",
-    "ws": "^8.8.1"
-  },
-  "@parcel/bundler-default": {
-    "minBundleSize": 0
+    "rsc-html-stream": "^0.0.4"
   }
 }
diff --git a/fixtures/flight-parcel/src/Todos.tsx b/fixtures/flight-parcel/src/Todos.tsx
index 2c05742ed31ec..ea606907300e4 100644
--- a/fixtures/flight-parcel/src/Todos.tsx
+++ b/fixtures/flight-parcel/src/Todos.tsx
@@ -2,7 +2,6 @@
 
 import './client';
 import './Todos.css';
-import {Resources} from '@parcel/runtime-rsc';
 import {Dialog} from './Dialog';
 import {TodoDetail} from './TodoDetail';
 import {TodoCreate} from './TodoCreate';
@@ -13,7 +12,6 @@ export async function Todos({id}: {id?: number}) {
     <html style={{colorScheme: 'dark light'}}>
       <head>
         <title>Todos</title>
-        <Resources />
       </head>
       <body>
         <header>
diff --git a/fixtures/flight-parcel/src/server.tsx b/fixtures/flight-parcel/src/server.tsx
index 810fbb628ad3d..d9a81a0ef94b3 100644
--- a/fixtures/flight-parcel/src/server.tsx
+++ b/fixtures/flight-parcel/src/server.tsx
@@ -72,7 +72,9 @@ async function render(
       return ReactClient.use(data);
     }
 
-    let htmlStream = await renderHTMLToReadableStream(<Content />);
+    let htmlStream = await renderHTMLToReadableStream(<Content />, {
+      bootstrapScriptContent: (Todos as any).bootstrapScript,
+    });
     let response = htmlStream.pipeThrough(injectRSCPayload(s2));
     Readable.fromWeb(response as NodeReadableStream).pipe(res);
   } else {
diff --git a/fixtures/flight-parcel/yarn.lock b/fixtures/flight-parcel/yarn.lock
index 384a25dd74176..4b72e06b91bca 100644
--- a/fixtures/flight-parcel/yarn.lock
+++ b/fixtures/flight-parcel/yarn.lock
@@ -104,100 +104,101 @@
   resolved "https://registry.yarnpkg.com/@msgpackr-extract/msgpackr-extract-win32-x64/-/msgpackr-extract-win32-x64-3.0.3.tgz#0aa5502d547b57abfc4ac492de68e2006e417242"
   integrity sha512-x0fWaQtYp4E6sktbsdAqnehxDgEc/VwM7uLsRCYWaiGu0ykYdZPiS8zCWdnjHwyiumousxfBm4SO31eXqwEZhQ==
 
-"@parcel/bundler-default@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/bundler-default/-/bundler-default-2.0.0-dev.1795.tgz#0fff101f37e3defe676c4b66bce234e563c25825"
-  integrity sha512-nK82Osr6A6ZjYeRfy2KT6197rD+5SzMPQ9LqMLbh8h/WoKye8ywAYSyeckDp7GQZa8aqFZXpVqUtmI0SvdUcIQ==
-  dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/graph" "3.3.3-dev.3418+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+"@parcel/bundler-default@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/bundler-default/-/bundler-default-2.0.0-canary.1778.tgz#8a1d52191d035935547ed290c4ba4fc30cb8d8b2"
+  integrity sha512-eLiqvCl19fEa7V4qQShb2zn5N5X1cmpjXsd9WxYXA6WBLoO4Jj3Ju+GS8XH9/dUT0J0h5MZMazNUPqW/AAnFMw==
+  dependencies:
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/graph" "3.3.4-canary.3401+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
 
-"@parcel/cache@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/cache/-/cache-2.0.0-dev.1795.tgz#2d7a97fa5c276b6cff60561e38b91cb88a8e834a"
-  integrity sha512-RUkCwGK/2qpGFtZslaNPp+/uPnh2YsFVk2XoLpw3H0JY9K8dDawlkfhFKz0r5nYfUYvhFiO1QPyC+20NWX1ovw==
+"@parcel/cache@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/cache/-/cache-2.0.0-canary.1778.tgz#527ade7385f66ced271c73562925281e8975683e"
+  integrity sha512-WyGF9q0so0evb60joAdk9wqtKsrrb5zNqtMH2Es+g0B+HjuhfcyiuXUHL+O8zGZWHwzvdfij/s3bGj4sMjFZrg==
   dependencies:
-    "@parcel/fs" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/logger" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/fs" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/logger" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     lmdb "2.8.5"
 
-"@parcel/codeframe@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/codeframe/-/codeframe-2.0.0-dev.1795.tgz#a9957966df6a4ac65b01f7ccf94db06414cf7bb2"
-  integrity sha512-xNk/Xw3mqo+qjmKrNKECqEmOILsrCBU40iUkldE0LgaRip9wR0fODtj2+KacP12ttCHbrgCdrela/AFV3FinKQ==
+"@parcel/codeframe@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/codeframe/-/codeframe-2.0.0-canary.1778.tgz#216f2b5b1c84f8e3e06a27825cb80066fb5cc624"
+  integrity sha512-X6Y82nZJDBt/3rhwQ/8KDxzXHlMJ22T8R5DMAMLxg8aYNUUCV2GIcfiYDqp6fednUsZcRZ+VDsA2vDRLuHBKyw==
   dependencies:
     chalk "^4.1.2"
 
-"@parcel/compressor-raw@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/compressor-raw/-/compressor-raw-2.13.3-dev.3418.tgz#65823d6bf7d99611f2d8f6d75e3a9c5b9b2ffd7e"
-  integrity sha512-pz4SaczIsQhMiaCZUehoEXQHZJoBd/T5kvoOcbg7S1chS1CouIwlT6vY4bseRlXoprDBEmK07HCItPF2W2SX+w==
-  dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-
-"@parcel/config-default@2.0.0-dev.1795", "@parcel/config-default@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/config-default/-/config-default-2.0.0-dev.1795.tgz#bae822637ff74e20f19aca3d26348416da9180f3"
-  integrity sha512-iaXwuLUZJ/L31I5TTeFE/mq6FL6gw15Vh27oEb/KS4pc6eYMvZRzyrIDCEJ6vxpi8VO4r0ncc7fOQqroT+vGIA==
-  dependencies:
-    "@parcel/bundler-default" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/compressor-raw" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/namer-default" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/optimizer-css" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/optimizer-htmlnano" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/optimizer-image" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/optimizer-svgo" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/optimizer-swc" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/packager-css" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/packager-html" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/packager-js" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/packager-raw" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/packager-svg" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/packager-wasm" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/reporter-dev-server" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/resolver-default" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/runtime-browser-hmr" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/runtime-js" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/runtime-react-refresh" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/runtime-service-worker" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/transformer-babel" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/transformer-css" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/transformer-html" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/transformer-image" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/transformer-js" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/transformer-json" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/transformer-postcss" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/transformer-posthtml" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/transformer-raw" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/transformer-react-refresh-wrap" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/transformer-svg" "2.13.3-dev.3418+9f297b15c"
-
-"@parcel/core@2.0.0-dev.1793+9f297b15c":
-  version "2.0.0-dev.1793"
-  resolved "https://registry.yarnpkg.com/@parcel/core/-/core-2.0.0-dev.1793.tgz#a911d743f26a3b15476936289b2c1847c21e6e9b"
-  integrity sha512-0O+crHFX4eoogpP/22sIPtjv4stNbzdeBZIoKqWl6Wndk63UdxVIEn6OvGokelgt/9qng9VoulMxAsrjKodemA==
+"@parcel/compressor-raw@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/compressor-raw/-/compressor-raw-2.13.4-canary.3401.tgz#322dae1c6feafd00d79d46cfde91b9753927e8ad"
+  integrity sha512-LYM92++ZfrFq08IaObm2KPZW3F3JxOd6WFEC8PdGisLNdDclnPGaX7Jg37KK9BKhmPWnysjqhtcf2evG8Xv8gg==
+  dependencies:
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+
+"@parcel/config-default@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/config-default/-/config-default-2.0.0-canary.1778.tgz#860c6193c59cca237114c3499f727bf8e4139af5"
+  integrity sha512-BuRhy0Nhz45rQswOkc8EccUeYa9ZnL/ZYX4pdXULMbjhJzPMvs4OAg5NHy7uPvDWl0E7vt9kdDKDwUesLXTYUg==
+  dependencies:
+    "@parcel/bundler-default" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/compressor-raw" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/namer-default" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/optimizer-css" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/optimizer-htmlnano" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/optimizer-image" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/optimizer-svgo" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/optimizer-swc" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/packager-css" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/packager-html" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/packager-js" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/packager-raw" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/packager-svg" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/packager-wasm" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/reporter-dev-server" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/resolver-default" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/runtime-browser-hmr" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/runtime-js" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/runtime-rsc" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/runtime-service-worker" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/transformer-babel" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/transformer-css" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/transformer-html" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/transformer-image" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/transformer-js" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/transformer-json" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/transformer-node" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/transformer-postcss" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/transformer-posthtml" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/transformer-raw" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/transformer-react-refresh-wrap" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/transformer-svg" "2.13.4-canary.3401+b50bc79cb"
+
+"@parcel/core@2.0.0-canary.1776+b50bc79cb":
+  version "2.0.0-canary.1776"
+  resolved "https://registry.yarnpkg.com/@parcel/core/-/core-2.0.0-canary.1776.tgz#52887c2cc077222aeb490551713c267e2d2c7a41"
+  integrity sha512-4r2NbDDI9uEi76lxtgTZF+KsC4epk2mxtRi/HX3hWy5vSh1hYYAp6O5sc0+uqc3aOg6LYDgSrRGJ01cp4Q4a5A==
   dependencies:
     "@mischnic/json-sourcemap" "^0.1.0"
-    "@parcel/cache" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/events" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/feature-flags" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/fs" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/graph" "3.3.3-dev.3418+9f297b15c"
-    "@parcel/logger" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/package-manager" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/profiler" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
+    "@parcel/cache" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/events" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/feature-flags" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/fs" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/graph" "3.3.4-canary.3401+b50bc79cb"
+    "@parcel/logger" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/package-manager" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/profiler" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
-    "@parcel/types" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/workers" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/types" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/workers" "2.0.0-canary.1778+b50bc79cb"
     base-x "^3.0.8"
     browserslist "^4.6.6"
     clone "^2.1.1"
@@ -208,319 +209,320 @@
     nullthrows "^1.1.1"
     semver "^7.5.2"
 
-"@parcel/diagnostic@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/diagnostic/-/diagnostic-2.0.0-dev.1795.tgz#273e049c8f88a19e824c5edf097e391a5b87b0c2"
-  integrity sha512-uWhJ7ojynh8wL0wr4EcR2wDVCxalsaLunEF/IfIpuWv5F+wEc8cTLsd4eAGjzMOO5jzWP2pK5XSK9TbWl4hTpQ==
+"@parcel/diagnostic@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/diagnostic/-/diagnostic-2.0.0-canary.1778.tgz#618e33303887b5f733200f89e07700f50b9df89b"
+  integrity sha512-/WeyPZEF4OCGU2g/H2XSXe7cEnzBZVAqAodJjAcHEUiFlepXD6rockx15IyYb/+o8fr5WBdgLSzHiu5X0EU5Ug==
   dependencies:
     "@mischnic/json-sourcemap" "^0.1.0"
     nullthrows "^1.1.1"
 
-"@parcel/events@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/events/-/events-2.0.0-dev.1795.tgz#d609260e0a6faa3bf0169936e770002c440e1f24"
-  integrity sha512-YREBS/8Yulm8wlZbwpbeez38BrOknSrjzBzj1nxL9gIoWLeB9c0zopZK0LFxaC+JDSzbtAsKYb94FoEe08Mo4w==
-
-"@parcel/feature-flags@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/feature-flags/-/feature-flags-2.13.3-dev.3418.tgz#2da678e6725449d7b70428073a0ef660d1c7dd3e"
-  integrity sha512-oTxIVXGJFjqTmefaugqV2nRsuXpN2aYTP/aJmm1mk06EyrkXTdAMrKoFsPimEshxvu8lGZ2fvZdF3pyWkR39FQ==
-
-"@parcel/fs@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/fs/-/fs-2.0.0-dev.1795.tgz#1dc534e806cc81f79e9aab578fa01bdf63b055aa"
-  integrity sha512-bY417DPxe921P/lYKiZhBv0fwCtgm5x0vUOhd9xPlAGasQrtqSUMoBwLcRStHd8e1xMrxp9UEJDfESL5+N/UuQ==
-  dependencies:
-    "@parcel/feature-flags" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/types-internal" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+"@parcel/error-overlay@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/error-overlay/-/error-overlay-2.13.4-canary.3401.tgz#50e5c786499485b093ed5a1c410262a6d5818895"
+  integrity sha512-NvX0zbNWTkKk75tb0qfaSUUdbx913Bk+zqjRzr6fnejcIpNb5LzFWB5H5EwdSMKN4rsU/16IBw0vh/eVzz65tg==
+  dependencies:
+    ansi-html-community "0.0.8"
+    react "^18 || ^19"
+    react-dom "^18 || ^19"
+
+"@parcel/events@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/events/-/events-2.0.0-canary.1778.tgz#2e8d1f353969166f4d402959fb24b487d6b8aaec"
+  integrity sha512-gVlxmr8Jn9p9gE3FJNg6pjB145DTHPZ573VyCUTlB3CzGP2Anw6yt8PMrl0mPbFsB+JPhDe+cC73xLcqvF5qvQ==
+
+"@parcel/feature-flags@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/feature-flags/-/feature-flags-2.13.4-canary.3401.tgz#5f246e10b1af1c03562e4a4487e294de6f7bbcdb"
+  integrity sha512-ufBQX85889tFv+WfekNTjTgoiNoTUzseCJWdNvatmDCnj9p+XXHhOzaIBuybrHmle69boEiin+SV1/ygP+MqeQ==
+
+"@parcel/fs@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/fs/-/fs-2.0.0-canary.1778.tgz#26f8b0412180a7f4c3e7466fe417ff37d601fc1b"
+  integrity sha512-E+rlzz8oMqtLLelEdx8f8urP+CL4da09CfbRNWMCpSTFSVQ4bd277ysDk3f2Zb2xSrb1UNz+jfYzkbWUkbkzNA==
+  dependencies:
+    "@parcel/feature-flags" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/types-internal" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     "@parcel/watcher" "^2.0.7"
-    "@parcel/workers" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/workers" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/graph@3.3.3-dev.3418+9f297b15c":
-  version "3.3.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/graph/-/graph-3.3.3-dev.3418.tgz#d62963b948b3ec3384ef6da136a23282c974736e"
-  integrity sha512-L7pOceNtP6dYx82MLrzMBe8uiUXPENoOaj/s6qCvPxjr8x6/Jo8qhIaz0f1htU1AtRMiTZjNL7Vw9Datwe8chg==
+"@parcel/graph@3.3.4-canary.3401+b50bc79cb":
+  version "3.3.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/graph/-/graph-3.3.4-canary.3401.tgz#063e63dbfbd179f91a66913080dcfc9c9fd2a90f"
+  integrity sha512-e9jiVibaiPbN37GQmsbWYpr9hcROaNUJ+u//CEggxQ1afZzrXuemHKjpsGov8mwIOa9FPsFixEm4k3Be9totOg==
   dependencies:
-    "@parcel/feature-flags" "2.13.3-dev.3418+9f297b15c"
+    "@parcel/feature-flags" "2.13.4-canary.3401+b50bc79cb"
     nullthrows "^1.1.1"
 
-"@parcel/logger@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/logger/-/logger-2.0.0-dev.1795.tgz#23ea704050e7d43c36f74ca9bd553d75f04c369f"
-  integrity sha512-haIJ2HRDef8D44nznCToiMB7OkpV2Er8NwOPQm9aJDyl1g4Lqro7cd5tZgEySHe3TlH6r8UWd6+C2ob+ws/jdA==
+"@parcel/logger@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/logger/-/logger-2.0.0-canary.1778.tgz#5816e7588836a7b797f588f1597d2291fb934c1a"
+  integrity sha512-awy1XSaICE+fcgBGg4S4OosMYjm8ekOmKeQ1VJgEaqOJMKuQ9B1KEE0wjF0go+L8UeKOkQB042krgrgFij53eg==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/events" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/events" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/markdown-ansi@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/markdown-ansi/-/markdown-ansi-2.0.0-dev.1795.tgz#410d31e4e7f178ec5039645e8a0e9fa318cb622e"
-  integrity sha512-HWYo1qJYcmtjKR6VAD4KHVjQ+30kGyxCTHt9oWqxLQeLakXKevWO6tR+htzxyAOH/YFwWeZr3cKstayoFnNkqA==
+"@parcel/markdown-ansi@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/markdown-ansi/-/markdown-ansi-2.0.0-canary.1778.tgz#ccdb0dab5ee7f4458a31545dcc1039ec47a06c0b"
+  integrity sha512-y4UcdboI584JLZAyU4MQV/vhH5KoYEPzxd44lA5UWMHgYJSAaQrf14ua7mKfJ5YzPNGdUMqnpQr/WxhwjhsZNg==
   dependencies:
     chalk "^4.1.2"
 
-"@parcel/namer-default@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/namer-default/-/namer-default-2.0.0-dev.1795.tgz#a5f2957fed9b49c819d56d2be7b6e4e996b14176"
-  integrity sha512-nmbkhtDxaEEzKvAFbhZEX4A/qz35PtjMwIr79sGFmUir7APuITf0MG8d5L9NTXHMgtNXPq+0t1A1gjaCO6aC5g==
+"@parcel/namer-default@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/namer-default/-/namer-default-2.0.0-canary.1778.tgz#7e653625644c46008c27283df441d5ba84393558"
+  integrity sha512-KMlDPf2qchLWVbPHV7oYBcUvLaL2Pc45HvGomhCOVADQd/x77TrZBFQrdOdoGqrMq6UGxXanaqQSpmT+mxuUKA==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
 
-"@parcel/node-resolver-core@3.4.3-dev.3418+9f297b15c":
-  version "3.4.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/node-resolver-core/-/node-resolver-core-3.4.3-dev.3418.tgz#cd25a6c86deefe2f4bc1007f26297c5518a196bd"
-  integrity sha512-qPpgrPc8KEQWbA9HrfNf9KiqFTHqO4YsMhD3DCtFenc5OJM5emt+a/ducqCW7e7W/az2kozhy/T9LJjYDP1PiQ==
+"@parcel/node-resolver-core@3.4.4-canary.3401+b50bc79cb":
+  version "3.4.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/node-resolver-core/-/node-resolver-core-3.4.4-canary.3401.tgz#6093e0dc3532a56e72d01761ecf6e42fda721ecc"
+  integrity sha512-xrPwvoQMolEfq5aPYOpCl2BRWzlUXCAI1Q5D6Uamellgq3AXkM32cp9NoxV8KXbWCxNg9p4Q9pn3rnc3veJsxg==
   dependencies:
     "@mischnic/json-sourcemap" "^0.1.0"
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/fs" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/fs" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
     semver "^7.5.2"
 
-"@parcel/optimizer-css@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/optimizer-css/-/optimizer-css-2.13.3-dev.3418.tgz#d0064debbe5b0fce075182d0c74836fec2b17ecc"
-  integrity sha512-i8Bl1dcl8+y275prrwzeJFnoovrev+GmOO4T0RMk3hZmcUW+lhUf1vtn/MENQ2sgfQKl8oD1KdMW6tvYeJ7g2g==
+"@parcel/optimizer-css@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/optimizer-css/-/optimizer-css-2.13.4-canary.3401.tgz#caef3a38f33aa708caa005c4702ceab3fe7263d8"
+  integrity sha512-Ya7XysNxz6VdyDfh/NeRAULeQxrYeDvAmdvKkMACYe2vWk9K3PGqHvW56mE0gI6lim57LGuY98qDLf30aVBG2A==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     browserslist "^4.6.6"
     lightningcss "^1.22.1"
     nullthrows "^1.1.1"
 
-"@parcel/optimizer-htmlnano@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/optimizer-htmlnano/-/optimizer-htmlnano-2.0.0-dev.1795.tgz#f7d3345dbcec03df9cc5db5f9913404ffd6051be"
-  integrity sha512-+2upe/5VvEe0d0K9ZFMuXwzbvolCCwZlQcu/P4hPAJEM/fs6A6zS3RA3hiVc18LNNz4UEM8sYp9X59dFHzYQnw==
+"@parcel/optimizer-htmlnano@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/optimizer-htmlnano/-/optimizer-htmlnano-2.0.0-canary.1778.tgz#aeef13adb7a519827ed0e10c8f7519a588e14834"
+  integrity sha512-EV5vLmHMp4VOCDMb4X+YXgGw7ArbVkK81JIO+rsEoTxAckcApt/+tTreALdWjUFt+MUD4fOX7wj7QE2I3ZxDlA==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     htmlnano "^2.0.0"
     nullthrows "^1.1.1"
     posthtml "^0.16.5"
 
-"@parcel/optimizer-image@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/optimizer-image/-/optimizer-image-2.13.3-dev.3418.tgz#69de333f47da2e32446db9d29a1c66aa63b04137"
-  integrity sha512-mQhZLFCPLwjUUVde+obImTy6mVSOF2z/VIs8n94BVOAVz1L/sksWON4eRF3tCdpi43kK7Jr/hHn53gIaveZu7w==
-  dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/workers" "2.0.0-dev.1795+9f297b15c"
-
-"@parcel/optimizer-svgo@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/optimizer-svgo/-/optimizer-svgo-2.13.3-dev.3418.tgz#1cd24b71a179a2ffd928f385ace5f4c8697bf795"
-  integrity sha512-+oGOLNwMtgYo1Vo4lzSOH9LQLekFkHaVmBq+B5WljedbszI2MklYBdrrEzBagjRzIYqinxB4j9t8DaLRvOeYag==
-  dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
-
-"@parcel/optimizer-swc@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/optimizer-swc/-/optimizer-swc-2.13.3-dev.3418.tgz#cef3f416ba4e18edf66d18f5c1cd2b374cd6b502"
-  integrity sha512-mMUZCrY1g1xCgA5VdnucDhUefhQY0pS3rJht3pxs3ifj7AJnmTJzZeY2wj8KdmjrOrRLTqSiQa+ESyNg6q8aqg==
-  dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+"@parcel/optimizer-image@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/optimizer-image/-/optimizer-image-2.13.4-canary.3401.tgz#2873dc9346b58ef273311cc6babd0b30a409a312"
+  integrity sha512-Td1++YkEMfkmx2J8MQq4tBPUcq1LtJ1FkUVamB1aEK7rn9nayzzX09x4hsHUjIrJUwFXgxkOE+GsLDc7gxsZXQ==
+  dependencies:
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/workers" "2.0.0-canary.1778+b50bc79cb"
+
+"@parcel/optimizer-svgo@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/optimizer-svgo/-/optimizer-svgo-2.13.4-canary.3401.tgz#6be0319a549683889d94f427539d9c7e8fa23b05"
+  integrity sha512-Iza9b5eRF0gFo1kGZFNL3NN8fW5gkbOt8dBZ0adSmKdJnnl4qRXfk2riw/ao46TxpbUWHB3QM/Yd/zNjO35Zog==
+  dependencies:
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
+
+"@parcel/optimizer-swc@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/optimizer-swc/-/optimizer-swc-2.13.4-canary.3401.tgz#f8c59ae533208eeaf4d21871ad3a77dd70bdd837"
+  integrity sha512-b7szi8sWCNniSRGXMSnAPgZuqFNj6EghoLgDw5c5wNm30nh0Ra5QQIN5KGswxNj1l2qzIfk7PbU30GIxBop7kg==
+  dependencies:
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
-    "@swc/core" "^1.7.26"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
+    "@swc/core" "^1.10.7"
     nullthrows "^1.1.1"
 
-"@parcel/package-manager@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/package-manager/-/package-manager-2.0.0-dev.1795.tgz#b76fc0398561e66f369f47bc960ca706b640e5f2"
-  integrity sha512-SR0LhO3CXNjKb1ufC+zwl1HvpIfWTRLey1MZ0sx8e+wmpJAzLFoFvjJb9ve3/gPEM3Wu12J30JizZ9ZPM5b7Yg==
-  dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/fs" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/logger" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/node-resolver-core" "3.4.3-dev.3418+9f297b15c"
-    "@parcel/types" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/workers" "2.0.0-dev.1795+9f297b15c"
-    "@swc/core" "^1.7.26"
+"@parcel/package-manager@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/package-manager/-/package-manager-2.0.0-canary.1778.tgz#f8231d85d3f565762d4cf19f110b94d350a7470b"
+  integrity sha512-2KVJx1go+/DleXHzCdXctNlCuEDPL1W2N2B9+P2r+q6N1u/VMzgM5U2bJxCvHzJoRj1Z1L/+gshCoqjew3ylSA==
+  dependencies:
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/fs" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/logger" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/node-resolver-core" "3.4.4-canary.3401+b50bc79cb"
+    "@parcel/types" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/workers" "2.0.0-canary.1778+b50bc79cb"
+    "@swc/core" "^1.10.7"
     semver "^7.5.2"
 
-"@parcel/packager-css@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/packager-css/-/packager-css-2.0.0-dev.1795.tgz#80a17e214d0e4b51c48daa45546e64c2c3a6ac3b"
-  integrity sha512-xDdNaDvriZ91s6EPTRbT9qUOYimXNHhlQ/rHuIDyiWhJSL3nHdGvljvJa2olZqDgafeU34ewqo7sVGqG9Ts5lg==
+"@parcel/packager-css@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/packager-css/-/packager-css-2.0.0-canary.1778.tgz#e29ed4e5d0c2b41cf3603708b542d4eba4b8388f"
+  integrity sha512-1YODpOVoaXLANH3FBz47Qh0bNNc8WoFU2Xcgd2P54VheYp1TgQ5/kGZWSfk04hcxBeB6pDaVrULIzw8lpCK3vA==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     lightningcss "^1.22.1"
     nullthrows "^1.1.1"
 
-"@parcel/packager-html@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/packager-html/-/packager-html-2.0.0-dev.1795.tgz#3bc7a3c7ce970b0f5ad0f23a0367b0f16576f5ac"
-  integrity sha512-4Q4UJt3VP47GzcXg3bZwjOGNehkfRJw9YhfnOUzWQMr/+LTk0/syY7DAP3e7gUchchBLpaCt77tY/j6bLIFgtA==
+"@parcel/packager-html@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/packager-html/-/packager-html-2.0.0-canary.1778.tgz#43f3fe4feb4ceb1ef30409fea393a5cd66067950"
+  integrity sha512-jV9wwbWoRkCWJ6oikLAaQkR4ZRVvWfKyvz1LbqS/L7cMsOQR/92YiPGbYa/3L0DmvgTL3LFjcN6E9hVgEk/Srw==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/types" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/types" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
     posthtml "^0.16.5"
 
-"@parcel/packager-js@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/packager-js/-/packager-js-2.0.0-dev.1795.tgz#3cbd0720ee774188a8e2ef3d5547efd36d0bda9a"
-  integrity sha512-XEyYQiop3Y5/R2vFFcxpsVXbnmMGb4YYGKJC1XJOgI2MrNZL053s5Tk9AIMCYE94MfX/TARbiEonrO2jbISx+A==
+"@parcel/packager-js@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/packager-js/-/packager-js-2.0.0-canary.1778.tgz#c9579986baad35802685d05bc275f9313a6b040b"
+  integrity sha512-H1WZEWNSAivEj6Mo6r14Vdc5fzB8bxOFa2ZDYCcyfHGnOulJhWU2d2n8apj8fsAFbdKGX+/AvdPvpX8HzwI23Q==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
-    "@parcel/types" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/types" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     globals "^13.2.0"
     nullthrows "^1.1.1"
 
-"@parcel/packager-raw@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/packager-raw/-/packager-raw-2.0.0-dev.1795.tgz#549c8a54f8fd5b6a693149508a118023afe1f66d"
-  integrity sha512-T9Dp9Qt5JREDD1N21QRfEEKMCuxZ0pa4G34J14sI7QTh2hDPDqeeFWYMkE0Pk+Yn3w2pWfS+Qod1DuRvm6WFZg==
+"@parcel/packager-raw@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/packager-raw/-/packager-raw-2.0.0-canary.1778.tgz#81c38947b4e5421a98364b8751a1e1e338f91108"
+  integrity sha512-yjO18I01KsOjnq6VHQfUU76wisNZt/GIEJF2NWgbp4FUbIQECbcS3JZ14Ct0MBv7rreY5/ge6Ed6a4dIsiamhQ==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/packager-svg@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/packager-svg/-/packager-svg-2.13.3-dev.3418.tgz#4c6a6b06d87955c444f2e1d861b80720ba02e816"
-  integrity sha512-RxeL6JRXld+SPTqds0mLswsgKCvkarM8pyBBXJLvP5a8G2jmc7OkgkaYonORz8EXGJCH21JAP6mxbwq4EjsuQQ==
+"@parcel/packager-svg@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/packager-svg/-/packager-svg-2.13.4-canary.3401.tgz#303d2ccdc76cb4b385f1b76af7f731b060a89521"
+  integrity sha512-QG7vuMPsWkZeixKgF+3SRYp8AcPQzV4mDQSicwfMq/aabL4fBDB5ZQ7FHb9DT3oj6ent2xjonQw9ubzwb+Hfcg==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/types" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/types" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     posthtml "^0.16.4"
 
-"@parcel/packager-wasm@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/packager-wasm/-/packager-wasm-2.13.3-dev.3418.tgz#ecd6dc970e10b805be6768ecee28a795f79130ec"
-  integrity sha512-XNIiDGbf8ZMyqxJYYQq2TrshMbBTDU5DdC9V7ByS4EuPpr9DjNhZWa7NXzU5rfze2b/sNyL5Y9w52wIU2JNMEA==
+"@parcel/packager-wasm@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/packager-wasm/-/packager-wasm-2.13.4-canary.3401.tgz#4e84b46c8f1b2350decaa2415990eff37c0685cb"
+  integrity sha512-zoDPZd0+vXt4IhUJlWEW1aQDiO8axOJBcj1qJxK3f+VwJcLzcRJZnpUnVCdwTQfVZK4BJxMdR+8EXPsrysCiLw==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/plugin@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/plugin/-/plugin-2.0.0-dev.1795.tgz#6ad492e83bc6cef4c3c360fc0dac3f6bc61d3631"
-  integrity sha512-2lj8IU3DHZvoBbKbuRwDr8s+ktPd8EOMIZZZ8bWuQ28mGCE5HaogbU7mHuzJqbSzcd9GnxPqSoKSA7msv1jDew==
+"@parcel/plugin@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/plugin/-/plugin-2.0.0-canary.1778.tgz#e9f202e2e6f044a220c456c3619f5e120ed7671a"
+  integrity sha512-SH7EhYTQF1JbqEtoD70yid9PsmPBSYymZg6oc2gyWexbAGWdlPD9xz8+E876JLnuhMPFf/ptdT4Apf4n4USvAQ==
   dependencies:
-    "@parcel/types" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/types" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/profiler@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/profiler/-/profiler-2.13.3-dev.3418.tgz#551a2b7d8181c971ea4912919094bfa5d3fc65e6"
-  integrity sha512-AisnQYasAaJNqepRnihs50SEtO+hBUKoX1BzJ/ha63MAnB5eGRXilHjjjVgGPcvthn89II+NtejNp0eiiXeYBQ==
+"@parcel/profiler@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/profiler/-/profiler-2.13.4-canary.3401.tgz#2046d73dd39764f50d7ed15602ac6fb4f71b07ed"
+  integrity sha512-BmOfBEzZhJM1sWjkeSYMknCGRGarAcvK+2iCk/PvKUvmCjJq+UpiFnSpcQehH+nbqCaBr+0SvrmWI25300mrEg==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/events" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/types-internal" "2.13.3-dev.3418+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/events" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/types-internal" "2.13.4-canary.3401+b50bc79cb"
     chrome-trace-event "^1.0.2"
 
-"@parcel/reporter-cli@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/reporter-cli/-/reporter-cli-2.0.0-dev.1795.tgz#f449ac4fb987dd36367cd6a137e2d61ebf23d39a"
-  integrity sha512-KdF4fTodClz/SBCmTgn1s3hF8FRDFLMiOArNF4zzpwYR7LqVb21fD6uCzdKluqR/dC8S6bQvyjKdYDxKbEuoGQ==
+"@parcel/reporter-cli@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/reporter-cli/-/reporter-cli-2.0.0-canary.1778.tgz#193a0802fa0f4c448f876d9a013f672ad2a33f6b"
+  integrity sha512-dQUzK3f4kbHC1eTzqWWkwyj6y3yPel/uB3lYSN1fiIB0Cnwmnz/baIT8v0Nw8vqOSsjZRtzGRMi4GoizONEAOw==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/types" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/types" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     chalk "^4.1.2"
     term-size "^2.2.1"
 
-"@parcel/reporter-dev-server@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/reporter-dev-server/-/reporter-dev-server-2.0.0-dev.1795.tgz#b5fc225cdb1f186003bbf862c61842358c002752"
-  integrity sha512-cot7qGAkujf/XMIH/jk2NY+agxgXO+PG8YrbCn3Tul/Gm3bYy5pc2XCuMYqyRHAIWe3wKLuHba2RHMR4WgZitg==
+"@parcel/reporter-dev-server@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/reporter-dev-server/-/reporter-dev-server-2.0.0-canary.1778.tgz#4083e9338deb6aaa0798a4add9d7e5b6fc58fc15"
+  integrity sha512-ADLk+GTWROXGGX/0JVCePxrgrE7NAcMILkugj9Djqn+Son64JfN6b9/SMObOeg2OHUovIGntfB4XHTPrgQ3CiQ==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/codeframe" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/source-map" "^2.1.1"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/reporter-tracer@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/reporter-tracer/-/reporter-tracer-2.13.3-dev.3418.tgz#7996aae33b5e3776bd2c1f61bebac26263bc3536"
-  integrity sha512-SpTrCT51wjYMPqlRPqKAx6rXpUGx3rkfYov97ID1K17z1KoWqIkZPvjDrTRD01aEz9lLHF4Ywc5beaguVwecJA==
+"@parcel/reporter-tracer@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/reporter-tracer/-/reporter-tracer-2.13.4-canary.3401.tgz#f7059dd07c442912b2684de76aa3ea908db9a72a"
+  integrity sha512-GdCof1Rd73iQU6BWqK0RxO5/eQK4yE4KLYiuXSP6jRiz8aYy+eySav+AABF8xofUb0mz1S2UZHL6wi4Y26Qxlg==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     chrome-trace-event "^1.0.3"
     nullthrows "^1.1.1"
 
-"@parcel/resolver-default@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/resolver-default/-/resolver-default-2.0.0-dev.1795.tgz#684e45e1d92847882332a3b61fde91bd58b831d4"
-  integrity sha512-0oXyPHEWf6fLrLe1FDN7fwhnKB/QmMw4di1wosxRHtyfTgIa/hs+r8hK0n5Jqy3JzmMlwgBr+p4gwnxOLPK/KQ==
+"@parcel/resolver-default@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/resolver-default/-/resolver-default-2.0.0-canary.1778.tgz#89c12e0980120ca0d17b86f8fdc49316db417f44"
+  integrity sha512-35XCeit5VlZmAAMxzR/MbRH2ZQrI9Wpwxm9IrmvZ5ETDs8ilY+g3PAg5F0WFF/prxOVIJ+5IahHuc7f9UKdBFQ==
   dependencies:
-    "@parcel/node-resolver-core" "3.4.3-dev.3418+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/node-resolver-core" "3.4.4-canary.3401+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/runtime-browser-hmr@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/runtime-browser-hmr/-/runtime-browser-hmr-2.0.0-dev.1795.tgz#c2c72a056b53c43e4e642197382e885f0f17425f"
-  integrity sha512-L0VpGl6D92WOsoF98eesLg/09VnGUr/14TlDzh0G7tRG+LHXcg0o/6vsGzVLKjR6yXQHuc/6SepbY2U5NsQNNg==
+"@parcel/runtime-browser-hmr@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/runtime-browser-hmr/-/runtime-browser-hmr-2.0.0-canary.1778.tgz#579f09b31ea01ea6608db7eecbb12ca60b294bc8"
+  integrity sha512-eYX9Els15PWRxKp5VdVpms2MXJGhHzblqPHTZP/KXlltSmAPMiwoco72BWnrSSBniHYOpBpUJZ2it9GYeQrHdw==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/runtime-js@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/runtime-js/-/runtime-js-2.0.0-dev.1795.tgz#e0843dbeb6d2790bf4221c9128125eb208f46c06"
-  integrity sha512-np7fz79T7zxIuzZOZIgUpeLy297r0pkHQn0TfGvXs16m7Yz3KGOXsYe8gJGLfhsJk2JLOZ0PQsLvgXRfyKDoxA==
+"@parcel/runtime-js@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/runtime-js/-/runtime-js-2.0.0-canary.1778.tgz#efeef26e7ac4a7c68bc3e3d160db033d4d0023d2"
+  integrity sha512-ZY9EtkfX9TXZUAZuT9kjexNb1Jm8RPVsbI00GsqkCN/OTU1Yp60792rYU0wQjxHiohgFBUCQPOyFvEZgHzCGfw==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
 
-"@parcel/runtime-react-refresh@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/runtime-react-refresh/-/runtime-react-refresh-2.0.0-dev.1795.tgz#06469b97471044fae8528dcad4e39c51b4945e8f"
-  integrity sha512-UQHDuBOTC0lsoFmyTD7zELmErVvt9wge5yeqLrB59yYvK570MrU/ujkyCECCOIf5IojbNn7GI4rmntO3SEp4Kg==
-  dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
-    react-error-overlay "6.0.9"
-    react-refresh ">=0.9 <=0.14"
-
-"@parcel/runtime-rsc@2.13.3-dev.3418":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/runtime-rsc/-/runtime-rsc-2.13.3-dev.3418.tgz#288351ebfb2b89a8b9fb6ebc880480950a97c8da"
-  integrity sha512-uBs80TXnx3rlauNeolYwfrrvLNjQgkM0ilxXmE2636hEhI6TRUWR86s/DoLKx/WFW+A7oAxSgXa4LUXPhiuQhA==
+"@parcel/runtime-rsc@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/runtime-rsc/-/runtime-rsc-2.13.4-canary.3401.tgz#9cf0681dd6442f841082518a5f83e5f1cc835351"
+  integrity sha512-xu9mozLwP6ilDLot67mmV55/0zoKpLMwsdWtcSuMGy+4O3+4107c79zXz9APrlMsui1CdIXkEcxmtGdWDRb6GQ==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
 
-"@parcel/runtime-service-worker@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/runtime-service-worker/-/runtime-service-worker-2.13.3-dev.3418.tgz#5a55a63ecbe338f6950899db69b7319957a14490"
-  integrity sha512-ptW3S1klF5XBcMVInmuXYvYzJMFoTTB/0U56knKDq2dvFBbsLtHdTR+oMREzv0sqkT/UeT75uC5gLTYnqogvKw==
+"@parcel/runtime-service-worker@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/runtime-service-worker/-/runtime-service-worker-2.13.4-canary.3401.tgz#ae77af90b6d934e6a9df7ef7bb02d1a3aabcd293"
+  integrity sha512-xKBe0Xsa7tq1azdAip0VqqmHuQqJJgLpPElbXIaGKysN8W9W+3PxZ4U9fpkKCeymgH6tBMBAn1Wg2K2yb7gnyg==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
 
-"@parcel/rust@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/rust/-/rust-2.13.3-dev.3418.tgz#8fb1db9f7c361f4d08476380c0b823b84f9107c8"
-  integrity sha512-HcwkHle9XCqg3rXv+sQR5LcoiSJAoGNWrOC5Abz3ANev8frisLnHqL6foFT1nCmEWQ8QUluBYJfNgv1DZ/aVxg==
+"@parcel/rust@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/rust/-/rust-2.13.4-canary.3401.tgz#10af9abdc4ca84e1409c607d192d3cada0a2f4c6"
+  integrity sha512-O47VXGNEmZjf2BMHcnLrjlbiDDeKySnyLGUgq5ua8J79h/bTAtL/hRVxxmFuR1PVpNtmRaZG8zJclpFTJxTAMA==
 
 "@parcel/source-map@^2.1.1":
   version "2.1.1"
@@ -529,41 +531,41 @@
   dependencies:
     detect-libc "^1.0.3"
 
-"@parcel/transformer-babel@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-babel/-/transformer-babel-2.0.0-dev.1795.tgz#f9612f6a224ddd0cb149d45e8ae4f5bf87c73c44"
-  integrity sha512-VpLZDimLWosfUbuqgcJTj6Y/3QETmZdJtb3JRAP1hc0EDvYsWkvUcCDe7CzYeYFsMSA8lAZxWmU3mG5Fp8h9pA==
+"@parcel/transformer-babel@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-babel/-/transformer-babel-2.0.0-canary.1778.tgz#9edf15338bf2e7b519e880556775eba410a4c176"
+  integrity sha512-Wab/AzFtoZPknEXXJx4srDzpHlN5X54PE7Lt2IyUlFlfjFByFzFDbqXfPFGQOtEo1kTKElMEIKmWZoNXlNs/sg==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     browserslist "^4.6.6"
     json5 "^2.2.0"
     nullthrows "^1.1.1"
     semver "^7.5.2"
 
-"@parcel/transformer-css@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-css/-/transformer-css-2.0.0-dev.1795.tgz#bc7a59f7de7ec4b3cba2ba174c0f5e5c0cfaf35c"
-  integrity sha512-nwiES/2DD/pmzZCj1enfmfloC2ehKoGZ6vr5XKEM7y+ld42Hea5UT0sjinJHoV+Xuk6pkcOa1j1Vb8d4JURgTQ==
+"@parcel/transformer-css@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-css/-/transformer-css-2.0.0-canary.1778.tgz#054a952fd9584c63353ba04b9dbe890abcbf17a9"
+  integrity sha512-NnGkmM+M/2kCCFEhDvEikdTI9hmKX2qg/aj/JapDP/B8yyaGWP5xSZmv4EDb/mHYpxrsJ1YUeEzdMCEwm7RMNA==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     browserslist "^4.6.6"
     lightningcss "^1.22.1"
     nullthrows "^1.1.1"
 
-"@parcel/transformer-html@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-html/-/transformer-html-2.0.0-dev.1795.tgz#cc5fa7398b51e8ddf08838677255b74cdae1118c"
-  integrity sha512-hlnc1KfrLNlKndDa5wXOY6EVKJjbeTQX2/d5w7eifSbDBW7yejDq1k2PByVZpitJ2dgO41NXMeDWSpvZt36G1A==
+"@parcel/transformer-html@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-html/-/transformer-html-2.0.0-canary.1778.tgz#8a647d56fa2372026cbb7929370cb2d938f9da58"
+  integrity sha512-g+FuzT8jtGZFqZTyvZYz+IiBiPrU1an5fekCkYjEgUYHxc1PYJS+HK6XmbYbu8zNVq11NFpiqMuPbExwvHGi1Q==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
     nullthrows "^1.1.1"
     posthtml "^0.16.5"
     posthtml-parser "^0.12.1"
@@ -571,299 +573,307 @@
     semver "^7.5.2"
     srcset "4"
 
-"@parcel/transformer-image@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-image/-/transformer-image-2.13.3-dev.3418.tgz#a8153a7d94c9e6ddc49ff0a0bb41b645a4a5459e"
-  integrity sha512-lXkkCWbhuYd0UWm3zwVAIoC6B8fvyRacDkbhjhDO96gs7kmZPh369P4rlh03HeoOJlgTcpuvIH4LcnoVeccUSw==
+"@parcel/transformer-image@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-image/-/transformer-image-2.13.4-canary.3401.tgz#b8d435574e3c17adb9cc91aa3425d3ed8424f794"
+  integrity sha512-Rz44jzq9jUIOx8lLSqk2wpHz9mfo1iH74LyXKtW/0Brb8FjUu5DfX9/492B08Sh83L/HZ3zs0j9lBcVbQsMYYQ==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/workers" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/workers" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
 
-"@parcel/transformer-js@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-js/-/transformer-js-2.0.0-dev.1795.tgz#741ee51638cbd8787f7a0903aef670382ecad19f"
-  integrity sha512-7ZxmALPqcI/B1Ywg835qwicZlmE5is2bbPYkjx7Pjc3MB5q+GKTwz/iWEjTS5AbZkKw9Db3QXp/+dubFoLSI4g==
+"@parcel/transformer-js@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-js/-/transformer-js-2.0.0-canary.1778.tgz#c8419bccbcb11eab3bfd289805986ad35346d537"
+  integrity sha512-tr7Jiy18TyiArxRnj3v1IaitnAP1TdMJylCwX875o458du72SAoYCanyn6xb9qT/D6TVQ87OINtKvAPJo20rvg==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/workers" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/workers" "2.0.0-canary.1778+b50bc79cb"
     "@swc/helpers" "^0.5.0"
     browserslist "^4.6.6"
     nullthrows "^1.1.1"
     regenerator-runtime "^0.14.1"
     semver "^7.5.2"
 
-"@parcel/transformer-json@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-json/-/transformer-json-2.0.0-dev.1795.tgz#a5215f863cab73d58e66d9466e45da145879cddd"
-  integrity sha512-2oKPaX2oFmynkMN8pA/BnrssnNL5xWuh6nKW5qqX/n9R7GoGIPAJ7iZrsFlU5vPLw2nsz1EDdhv4R5ydZK3a+Q==
+"@parcel/transformer-json@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-json/-/transformer-json-2.0.0-canary.1778.tgz#8cc61b34f4323177bc13800f1ec3451f375f0fec"
+  integrity sha512-2rT/Z+A1usE1jibCm6lNz38uqzRchffX5pi6SQS+BsDZRa5JAHizjAE5AuesKLjdJVDxZ1HBdX+gl+u6Bh+scA==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
     json5 "^2.2.0"
 
-"@parcel/transformer-postcss@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-postcss/-/transformer-postcss-2.0.0-dev.1795.tgz#0413805bb09bf22227b15bfcbb817142d7a9c6ce"
-  integrity sha512-b2+r8gMtGczhEuUFJmYi8Joo0TEN+8VD4mMaQxtUbz3cNdJxDVWjD5fLQNJcbWFzEsAv2aU5eXJ1dGU8vofd5Q==
+"@parcel/transformer-node@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-node/-/transformer-node-2.13.4-canary.3401.tgz#3713ebbd981d5ac2de5be51b23db6e2b19d074c7"
+  integrity sha512-r4aGiTTju9+IG9a+Wz268alvTXkS+2BMc3Dgbh/yRzicNzhJUAbdkMLrTtq0ekV+BJm/Ds53dPHPJrb5S4vnkA==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+
+"@parcel/transformer-postcss@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-postcss/-/transformer-postcss-2.0.0-canary.1778.tgz#66637a23a1ea03a0484f26b68ef2fc1904a928d1"
+  integrity sha512-iaTDDQrnIYrh8iJn99cJsnL0rffwGB8mGYTyOoqUneGLcSg0P/3XT2k8mu+OT7Q8tJOIMw6GR/3nNjZSwo0zgA==
+  dependencies:
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     clone "^2.1.1"
     nullthrows "^1.1.1"
     postcss-value-parser "^4.2.0"
     semver "^7.5.2"
 
-"@parcel/transformer-posthtml@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-posthtml/-/transformer-posthtml-2.0.0-dev.1795.tgz#787682376cb01bd6d8811246619881af2e7cd0a7"
-  integrity sha512-9lrdDY1pIQtRMkxe8r0EghSd+7hFEyU3xb2nNO68m9Eut9zHjZo3p1As6rKp6eJ5ZqZxOJYj4xhqymwc5Evi4Q==
+"@parcel/transformer-posthtml@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-posthtml/-/transformer-posthtml-2.0.0-canary.1778.tgz#f6619822308daccc88bb942dd0f0ba47246212ec"
+  integrity sha512-wYPsbfREZasatPZjmZdY7jJYH6+3zbtSciTuxNmyGxExLodU/Rvae3SgeJzTpuXXcFigp/J3Srgeh+yRt4KI3A==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
     posthtml "^0.16.5"
     posthtml-parser "^0.12.1"
     posthtml-render "^3.0.0"
     semver "^7.5.2"
 
-"@parcel/transformer-raw@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-raw/-/transformer-raw-2.0.0-dev.1795.tgz#97edd45f72b39286aa1d79601912ea68c127448a"
-  integrity sha512-pg6/3C3kFLbWghdE7v4OdMRDvNIhSLhYy4AGOI+6KbPtVCI/0We1ZCSf1ciAluYbq7/tvYJhUuwGLukrdxTfDg==
+"@parcel/transformer-raw@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-raw/-/transformer-raw-2.0.0-canary.1778.tgz#e2eb5d32c365e1185c454790a578a8d7212fae70"
+  integrity sha512-FbHLsYd8EPDATD2xzX/FqViMOrgPhG+IGYkDXsCk1cPF+zmU4uNGE2q8MNl1zaxQxa927lN5SIkjm8Lw7Qqf7A==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/transformer-react-refresh-wrap@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-react-refresh-wrap/-/transformer-react-refresh-wrap-2.0.0-dev.1795.tgz#96fc5b5ead89eae1d6a23690bc9b63cfd2f7bb11"
-  integrity sha512-OT41I1Y5anyvy6ocnzsgfvMi71J/DUlgcu0X1d3eRl3ui4ACmXB/NkzZr4+EmCFKgE8cp0UR67y6OpoIYFP79Q==
+"@parcel/transformer-react-refresh-wrap@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-react-refresh-wrap/-/transformer-react-refresh-wrap-2.0.0-canary.1778.tgz#92249148709770a741a08163d6bf75973ab2f7b0"
+  integrity sha512-SgdnIAsY2s2FUcBwj3A2ME3C3WcLtPnmpQZBHk8pBIzBXmx98DABkPgneMdtsmoPg5RpSRsLba1ThFz1GeaBsw==
   dependencies:
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
-    react-refresh ">=0.9 <=0.14"
+    "@parcel/error-overlay" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
+    react-refresh ">=0.9 <=0.16"
 
-"@parcel/transformer-svg@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/transformer-svg/-/transformer-svg-2.13.3-dev.3418.tgz#17556f8fbb5a972dc01fd1c43aa26be1ca539460"
-  integrity sha512-AkrAKTdEU0L2Hoz7CPjTg81ChroffpoX71RZffmBAcFi0vkpBMlFzvITjrbV1dC+OtQ5t/+gnmZnowSpZBgU+A==
+"@parcel/transformer-svg@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/transformer-svg/-/transformer-svg-2.13.4-canary.3401.tgz#22d19f3666d8074a9f229647a89c41ced2150cfa"
+  integrity sha512-R+ki+rqxrzKg26fTZJjn36Sm08AdANs0k/lY0YXql+T2Z5VU7pGZk2iKhJGZ7zDfP10PcDopjuqDPhn7Zhl8vg==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/plugin" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/plugin" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
     nullthrows "^1.1.1"
     posthtml "^0.16.5"
     posthtml-parser "^0.12.1"
     posthtml-render "^3.0.0"
     semver "^7.5.2"
 
-"@parcel/types-internal@2.13.3-dev.3418+9f297b15c":
-  version "2.13.3-dev.3418"
-  resolved "https://registry.yarnpkg.com/@parcel/types-internal/-/types-internal-2.13.3-dev.3418.tgz#76644a7b21bd78e654134be6679afd6a727bb4db"
-  integrity sha512-B0L3jAMe6tAxB22p2UZwJQGl1FRte9ikLJw4fcPJbszcv5MRLnszISNcSgJQN99hM5ISu+bRMioMksZ2FrDIYA==
+"@parcel/types-internal@2.13.4-canary.3401+b50bc79cb":
+  version "2.13.4-canary.3401"
+  resolved "https://registry.yarnpkg.com/@parcel/types-internal/-/types-internal-2.13.4-canary.3401.tgz#44c26df4f75647447e320e9fa5882df00b01fd18"
+  integrity sha512-hkEaw3Z1kWvamzRi3h0Ps6aUYqj8v00CaZrrjZhgpXW/UfaLJbjFJj9DghQsWJQTNGk5eWRb947Fjsqsc0C8ZQ==
   dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/feature-flags" "2.13.3-dev.3418+9f297b15c"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/feature-flags" "2.13.4-canary.3401+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
     utility-types "^3.10.0"
 
-"@parcel/types@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/types/-/types-2.0.0-dev.1795.tgz#1f1503870d97245d1dc82263306cbd25d4313a5b"
-  integrity sha512-VojyhwPI2L54XMJ45sHFnMm8T75zhQKjhB6tlARWA02sDveCfvfBONfJY/r+O1poeel42Gci+bLanri0s3GgTg==
+"@parcel/types@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/types/-/types-2.0.0-canary.1778.tgz#dba6015d85df3a69b925e5226809122828fa9792"
+  integrity sha512-nY3TjmAaq9/xXGElTy9JCm2sNleXSAHuvtjesYaM2cFofsv1q2MdIYTEIRHLmnRBjBxwuFg8LHLC7t1HaF5DuQ==
   dependencies:
-    "@parcel/types-internal" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/workers" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/types-internal" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/workers" "2.0.0-canary.1778+b50bc79cb"
 
-"@parcel/utils@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/utils/-/utils-2.0.0-dev.1795.tgz#12aca94ddd344170b5b1081c012bb524f37ebfda"
-  integrity sha512-JjleEfv9NJD02AOPEOjwMVr5h0SZdtTocQuQBS4S+SC6Ql9ZdiUArE5jXVbUCYmyQnfjG7FYfajzrFnfnA9Uqg==
+"@parcel/utils@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/utils/-/utils-2.0.0-canary.1778.tgz#9576774350acc413ec8170acafb283ffcf517af4"
+  integrity sha512-YphS0Gf32ZXKEtEUNVjNKMOA3eZFGLAbREr+smhS0TuVCwEfql4Im0lUKf6jVm/H9jcbx5bEG/sevNI45nzC6Q==
   dependencies:
-    "@parcel/codeframe" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/logger" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/markdown-ansi" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/rust" "2.13.3-dev.3418+9f297b15c"
+    "@parcel/codeframe" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/logger" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/markdown-ansi" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/rust" "2.13.4-canary.3401+b50bc79cb"
     "@parcel/source-map" "^2.1.1"
     chalk "^4.1.2"
     nullthrows "^1.1.1"
 
-"@parcel/watcher-android-arm64@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-android-arm64/-/watcher-android-arm64-2.5.0.tgz#e32d3dda6647791ee930556aee206fcd5ea0fb7a"
-  integrity sha512-qlX4eS28bUcQCdribHkg/herLe+0A9RyYC+mm2PXpncit8z5b3nSqGVzMNR3CmtAOgRutiZ02eIJJgP/b1iEFQ==
-
-"@parcel/watcher-darwin-arm64@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-darwin-arm64/-/watcher-darwin-arm64-2.5.0.tgz#0d9e680b7e9ec1c8f54944f1b945aa8755afb12f"
-  integrity sha512-hyZ3TANnzGfLpRA2s/4U1kbw2ZI4qGxaRJbBH2DCSREFfubMswheh8TeiC1sGZ3z2jUf3s37P0BBlrD3sjVTUw==
-
-"@parcel/watcher-darwin-x64@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-darwin-x64/-/watcher-darwin-x64-2.5.0.tgz#f9f1d5ce9d5878d344f14ef1856b7a830c59d1bb"
-  integrity sha512-9rhlwd78saKf18fT869/poydQK8YqlU26TMiNg7AIu7eBp9adqbJZqmdFOsbZ5cnLp5XvRo9wcFmNHgHdWaGYA==
-
-"@parcel/watcher-freebsd-x64@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-freebsd-x64/-/watcher-freebsd-x64-2.5.0.tgz#2b77f0c82d19e84ff4c21de6da7f7d096b1a7e82"
-  integrity sha512-syvfhZzyM8kErg3VF0xpV8dixJ+RzbUaaGaeb7uDuz0D3FK97/mZ5AJQ3XNnDsXX7KkFNtyQyFrXZzQIcN49Tw==
-
-"@parcel/watcher-linux-arm-glibc@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-arm-glibc/-/watcher-linux-arm-glibc-2.5.0.tgz#92ed322c56dbafa3d2545dcf2803334aee131e42"
-  integrity sha512-0VQY1K35DQET3dVYWpOaPFecqOT9dbuCfzjxoQyif1Wc574t3kOSkKevULddcR9znz1TcklCE7Ht6NIxjvTqLA==
-
-"@parcel/watcher-linux-arm-musl@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-arm-musl/-/watcher-linux-arm-musl-2.5.0.tgz#cd48e9bfde0cdbbd2ecd9accfc52967e22f849a4"
-  integrity sha512-6uHywSIzz8+vi2lAzFeltnYbdHsDm3iIB57d4g5oaB9vKwjb6N6dRIgZMujw4nm5r6v9/BQH0noq6DzHrqr2pA==
-
-"@parcel/watcher-linux-arm64-glibc@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-arm64-glibc/-/watcher-linux-arm64-glibc-2.5.0.tgz#7b81f6d5a442bb89fbabaf6c13573e94a46feb03"
-  integrity sha512-BfNjXwZKxBy4WibDb/LDCriWSKLz+jJRL3cM/DllnHH5QUyoiUNEp3GmL80ZqxeumoADfCCP19+qiYiC8gUBjA==
-
-"@parcel/watcher-linux-arm64-musl@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-arm64-musl/-/watcher-linux-arm64-musl-2.5.0.tgz#dcb8ff01077cdf59a18d9e0a4dff7a0cfe5fd732"
-  integrity sha512-S1qARKOphxfiBEkwLUbHjCY9BWPdWnW9j7f7Hb2jPplu8UZ3nes7zpPOW9bkLbHRvWM0WDTsjdOTUgW0xLBN1Q==
-
-"@parcel/watcher-linux-x64-glibc@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-x64-glibc/-/watcher-linux-x64-glibc-2.5.0.tgz#2e254600fda4e32d83942384d1106e1eed84494d"
-  integrity sha512-d9AOkusyXARkFD66S6zlGXyzx5RvY+chTP9Jp0ypSTC9d4lzyRs9ovGf/80VCxjKddcUvnsGwCHWuF2EoPgWjw==
-
-"@parcel/watcher-linux-x64-musl@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-x64-musl/-/watcher-linux-x64-musl-2.5.0.tgz#01fcea60fedbb3225af808d3f0a7b11229792eef"
-  integrity sha512-iqOC+GoTDoFyk/VYSFHwjHhYrk8bljW6zOhPuhi5t9ulqiYq1togGJB5e3PwYVFFfeVgc6pbz3JdQyDoBszVaA==
-
-"@parcel/watcher-win32-arm64@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-win32-arm64/-/watcher-win32-arm64-2.5.0.tgz#87cdb16e0783e770197e52fb1dc027bb0c847154"
-  integrity sha512-twtft1d+JRNkM5YbmexfcH/N4znDtjgysFaV9zvZmmJezQsKpkfLYJ+JFV3uygugK6AtIM2oADPkB2AdhBrNig==
-
-"@parcel/watcher-win32-ia32@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-win32-ia32/-/watcher-win32-ia32-2.5.0.tgz#778c39b56da33e045ba21c678c31a9f9d7c6b220"
-  integrity sha512-+rgpsNRKwo8A53elqbbHXdOMtY/tAtTzManTWShB5Kk54N8Q9mzNWV7tV+IbGueCbcj826MfWGU3mprWtuf1TA==
-
-"@parcel/watcher-win32-x64@2.5.0":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher-win32-x64/-/watcher-win32-x64-2.5.0.tgz#33873876d0bbc588aacce38e90d1d7480ce81cb7"
-  integrity sha512-lPrxve92zEHdgeff3aiu4gDOIt4u7sJYha6wbdEZDCDUhtjTsOMiaJzG5lMY4GkWH8p0fMmO2Ppq5G5XXG+DQw==
+"@parcel/watcher-android-arm64@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-android-arm64/-/watcher-android-arm64-2.5.1.tgz#507f836d7e2042f798c7d07ad19c3546f9848ac1"
+  integrity sha512-KF8+j9nNbUN8vzOFDpRMsaKBHZ/mcjEjMToVMJOhTozkDonQFFrRcfdLWn6yWKCmJKmdVxSgHiYvTCef4/qcBA==
+
+"@parcel/watcher-darwin-arm64@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-darwin-arm64/-/watcher-darwin-arm64-2.5.1.tgz#3d26dce38de6590ef79c47ec2c55793c06ad4f67"
+  integrity sha512-eAzPv5osDmZyBhou8PoF4i6RQXAfeKL9tjb3QzYuccXFMQU0ruIc/POh30ePnaOyD1UXdlKguHBmsTs53tVoPw==
+
+"@parcel/watcher-darwin-x64@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-darwin-x64/-/watcher-darwin-x64-2.5.1.tgz#99f3af3869069ccf774e4ddfccf7e64fd2311ef8"
+  integrity sha512-1ZXDthrnNmwv10A0/3AJNZ9JGlzrF82i3gNQcWOzd7nJ8aj+ILyW1MTxVk35Db0u91oD5Nlk9MBiujMlwmeXZg==
+
+"@parcel/watcher-freebsd-x64@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-freebsd-x64/-/watcher-freebsd-x64-2.5.1.tgz#14d6857741a9f51dfe51d5b08b7c8afdbc73ad9b"
+  integrity sha512-SI4eljM7Flp9yPuKi8W0ird8TI/JK6CSxju3NojVI6BjHsTyK7zxA9urjVjEKJ5MBYC+bLmMcbAWlZ+rFkLpJQ==
+
+"@parcel/watcher-linux-arm-glibc@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-arm-glibc/-/watcher-linux-arm-glibc-2.5.1.tgz#43c3246d6892381db473bb4f663229ad20b609a1"
+  integrity sha512-RCdZlEyTs8geyBkkcnPWvtXLY44BCeZKmGYRtSgtwwnHR4dxfHRG3gR99XdMEdQ7KeiDdasJwwvNSF5jKtDwdA==
+
+"@parcel/watcher-linux-arm-musl@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-arm-musl/-/watcher-linux-arm-musl-2.5.1.tgz#663750f7090bb6278d2210de643eb8a3f780d08e"
+  integrity sha512-6E+m/Mm1t1yhB8X412stiKFG3XykmgdIOqhjWj+VL8oHkKABfu/gjFj8DvLrYVHSBNC+/u5PeNrujiSQ1zwd1Q==
+
+"@parcel/watcher-linux-arm64-glibc@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-arm64-glibc/-/watcher-linux-arm64-glibc-2.5.1.tgz#ba60e1f56977f7e47cd7e31ad65d15fdcbd07e30"
+  integrity sha512-LrGp+f02yU3BN9A+DGuY3v3bmnFUggAITBGriZHUREfNEzZh/GO06FF5u2kx8x+GBEUYfyTGamol4j3m9ANe8w==
+
+"@parcel/watcher-linux-arm64-musl@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-arm64-musl/-/watcher-linux-arm64-musl-2.5.1.tgz#f7fbcdff2f04c526f96eac01f97419a6a99855d2"
+  integrity sha512-cFOjABi92pMYRXS7AcQv9/M1YuKRw8SZniCDw0ssQb/noPkRzA+HBDkwmyOJYp5wXcsTrhxO0zq1U11cK9jsFg==
+
+"@parcel/watcher-linux-x64-glibc@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-x64-glibc/-/watcher-linux-x64-glibc-2.5.1.tgz#4d2ea0f633eb1917d83d483392ce6181b6a92e4e"
+  integrity sha512-GcESn8NZySmfwlTsIur+49yDqSny2IhPeZfXunQi48DMugKeZ7uy1FX83pO0X22sHntJ4Ub+9k34XQCX+oHt2A==
+
+"@parcel/watcher-linux-x64-musl@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-linux-x64-musl/-/watcher-linux-x64-musl-2.5.1.tgz#277b346b05db54f55657301dd77bdf99d63606ee"
+  integrity sha512-n0E2EQbatQ3bXhcH2D1XIAANAcTZkQICBPVaxMeaCVBtOpBZpWJuf7LwyWPSBDITb7In8mqQgJ7gH8CILCURXg==
+
+"@parcel/watcher-win32-arm64@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-win32-arm64/-/watcher-win32-arm64-2.5.1.tgz#7e9e02a26784d47503de1d10e8eab6cceb524243"
+  integrity sha512-RFzklRvmc3PkjKjry3hLF9wD7ppR4AKcWNzH7kXR7GUe0Igb3Nz8fyPwtZCSquGrhU5HhUNDr/mKBqj7tqA2Vw==
+
+"@parcel/watcher-win32-ia32@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-win32-ia32/-/watcher-win32-ia32-2.5.1.tgz#2d0f94fa59a873cdc584bf7f6b1dc628ddf976e6"
+  integrity sha512-c2KkcVN+NJmuA7CGlaGD1qJh1cLfDnQsHjE89E60vUEMlqduHGCdCLJCID5geFVM0dOtA3ZiIO8BoEQmzQVfpQ==
+
+"@parcel/watcher-win32-x64@2.5.1":
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher-win32-x64/-/watcher-win32-x64-2.5.1.tgz#ae52693259664ba6f2228fa61d7ee44b64ea0947"
+  integrity sha512-9lHBdJITeNR++EvSQVUcaZoWupyHfXe1jZvGZ06O/5MflPcuPLtEphScIBL+AiCWBO46tDSHzWyD0uDmmZqsgA==
 
 "@parcel/watcher@^2.0.7":
-  version "2.5.0"
-  resolved "https://registry.yarnpkg.com/@parcel/watcher/-/watcher-2.5.0.tgz#5c88818b12b8de4307a9d3e6dc3e28eba0dfbd10"
-  integrity sha512-i0GV1yJnm2n3Yq1qw6QrUrd/LI9bE8WEBOTtOkpCXHHdyN3TAGgqAK/DAT05z4fq2x04cARXt2pDmjWjL92iTQ==
+  version "2.5.1"
+  resolved "https://registry.yarnpkg.com/@parcel/watcher/-/watcher-2.5.1.tgz#342507a9cfaaf172479a882309def1e991fb1200"
+  integrity sha512-dfUnCxiN9H4ap84DvD2ubjw+3vUNpstxa0TneY/Paat8a3R4uQZDLSvWjmznAY/DoahqTHl9V46HF/Zs3F29pg==
   dependencies:
     detect-libc "^1.0.3"
     is-glob "^4.0.3"
     micromatch "^4.0.5"
     node-addon-api "^7.0.0"
   optionalDependencies:
-    "@parcel/watcher-android-arm64" "2.5.0"
-    "@parcel/watcher-darwin-arm64" "2.5.0"
-    "@parcel/watcher-darwin-x64" "2.5.0"
-    "@parcel/watcher-freebsd-x64" "2.5.0"
-    "@parcel/watcher-linux-arm-glibc" "2.5.0"
-    "@parcel/watcher-linux-arm-musl" "2.5.0"
-    "@parcel/watcher-linux-arm64-glibc" "2.5.0"
-    "@parcel/watcher-linux-arm64-musl" "2.5.0"
-    "@parcel/watcher-linux-x64-glibc" "2.5.0"
-    "@parcel/watcher-linux-x64-musl" "2.5.0"
-    "@parcel/watcher-win32-arm64" "2.5.0"
-    "@parcel/watcher-win32-ia32" "2.5.0"
-    "@parcel/watcher-win32-x64" "2.5.0"
-
-"@parcel/workers@2.0.0-dev.1795+9f297b15c":
-  version "2.0.0-dev.1795"
-  resolved "https://registry.yarnpkg.com/@parcel/workers/-/workers-2.0.0-dev.1795.tgz#5d7840b90cc80a1f01619ed676a744f6e3524af9"
-  integrity sha512-MiW001+79Qox78Xy7bNBGKWB2PdurL5qdrKxLdKnIU41mZ5ki5tg4cxsgf9+H5KTp4Y8MnLqOh0yjD/8ujdB8g==
-  dependencies:
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/logger" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/profiler" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/types-internal" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+    "@parcel/watcher-android-arm64" "2.5.1"
+    "@parcel/watcher-darwin-arm64" "2.5.1"
+    "@parcel/watcher-darwin-x64" "2.5.1"
+    "@parcel/watcher-freebsd-x64" "2.5.1"
+    "@parcel/watcher-linux-arm-glibc" "2.5.1"
+    "@parcel/watcher-linux-arm-musl" "2.5.1"
+    "@parcel/watcher-linux-arm64-glibc" "2.5.1"
+    "@parcel/watcher-linux-arm64-musl" "2.5.1"
+    "@parcel/watcher-linux-x64-glibc" "2.5.1"
+    "@parcel/watcher-linux-x64-musl" "2.5.1"
+    "@parcel/watcher-win32-arm64" "2.5.1"
+    "@parcel/watcher-win32-ia32" "2.5.1"
+    "@parcel/watcher-win32-x64" "2.5.1"
+
+"@parcel/workers@2.0.0-canary.1778+b50bc79cb":
+  version "2.0.0-canary.1778"
+  resolved "https://registry.yarnpkg.com/@parcel/workers/-/workers-2.0.0-canary.1778.tgz#d305d65146b31028fd29390b6a1c2fcfdeeef122"
+  integrity sha512-AIu7JRGzyM8V+OsV/7qk/zcwFktMhvyhvEX0vzR6KtO77/pVZwmUS7N+TuCZu/Oe6QEz2VaODK7Y3eeR1PHTGw==
+  dependencies:
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/logger" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/profiler" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/types-internal" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     nullthrows "^1.1.1"
 
-"@swc/core-darwin-arm64@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-darwin-arm64/-/core-darwin-arm64-1.10.1.tgz#faaaab19b4a039ae67ef661c0144a6f20fe8a78e"
-  integrity sha512-NyELPp8EsVZtxH/mEqvzSyWpfPJ1lugpTQcSlMduZLj1EASLO4sC8wt8hmL1aizRlsbjCX+r0PyL+l0xQ64/6Q==
-
-"@swc/core-darwin-x64@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-darwin-x64/-/core-darwin-x64-1.10.1.tgz#754600f453abd24471c202d48836f1161d798f49"
-  integrity sha512-L4BNt1fdQ5ZZhAk5qoDfUnXRabDOXKnXBxMDJ+PWLSxOGBbWE6aJTnu4zbGjJvtot0KM46m2LPAPY8ttknqaZA==
-
-"@swc/core-linux-arm-gnueabihf@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-linux-arm-gnueabihf/-/core-linux-arm-gnueabihf-1.10.1.tgz#b0f43c482d0d1819b382a4eb4a0733ce2e386257"
-  integrity sha512-Y1u9OqCHgvVp2tYQAJ7hcU9qO5brDMIrA5R31rwWQIAKDkJKtv3IlTHF0hrbWk1wPR0ZdngkQSJZple7G+Grvw==
-
-"@swc/core-linux-arm64-gnu@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-linux-arm64-gnu/-/core-linux-arm64-gnu-1.10.1.tgz#e02a9e22c25ba85ef00335742e549e06284cf33a"
-  integrity sha512-tNQHO/UKdtnqjc7o04iRXng1wTUXPgVd8Y6LI4qIbHVoVPwksZydISjMcilKNLKIwOoUQAkxyJ16SlOAeADzhQ==
-
-"@swc/core-linux-arm64-musl@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-linux-arm64-musl/-/core-linux-arm64-musl-1.10.1.tgz#3a0530af8f8bd3717f2f1bd8a2f5183fc58d4cf1"
-  integrity sha512-x0L2Pd9weQ6n8dI1z1Isq00VHFvpBClwQJvrt3NHzmR+1wCT/gcYl1tp9P5xHh3ldM8Cn4UjWCw+7PaUgg8FcQ==
-
-"@swc/core-linux-x64-gnu@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-linux-x64-gnu/-/core-linux-x64-gnu-1.10.1.tgz#5eb4d282b047a22896ab1d4627403be4c3e4fa6a"
-  integrity sha512-yyYEwQcObV3AUsC79rSzN9z6kiWxKAVJ6Ntwq2N9YoZqSPYph+4/Am5fM1xEQYf/kb99csj0FgOelomJSobxQA==
-
-"@swc/core-linux-x64-musl@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-linux-x64-musl/-/core-linux-x64-musl-1.10.1.tgz#890f2eda3e67ccc6817cdd04eff91e6ad9e761c4"
-  integrity sha512-tcaS43Ydd7Fk7sW5ROpaf2Kq1zR+sI5K0RM+0qYLYYurvsJruj3GhBCaiN3gkzd8m/8wkqNqtVklWaQYSDsyqA==
-
-"@swc/core-win32-arm64-msvc@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-win32-arm64-msvc/-/core-win32-arm64-msvc-1.10.1.tgz#4ea7b2a2fab47f801d31ea8b001a141efaa5e6bf"
-  integrity sha512-D3Qo1voA7AkbOzQ2UGuKNHfYGKL6eejN8VWOoQYtGHHQi1p5KK/Q7V1ku55oxXBsj79Ny5FRMqiRJpVGad7bjQ==
-
-"@swc/core-win32-ia32-msvc@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-win32-ia32-msvc/-/core-win32-ia32-msvc-1.10.1.tgz#729102669ccdb72e69884cce58e3686ac63d6f36"
-  integrity sha512-WalYdFoU3454Og+sDKHM1MrjvxUGwA2oralknXkXL8S0I/8RkWZOB++p3pLaGbTvOO++T+6znFbQdR8KRaa7DA==
-
-"@swc/core-win32-x64-msvc@1.10.1":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core-win32-x64-msvc/-/core-win32-x64-msvc-1.10.1.tgz#7d665a7c69642861aed850ecb0cdf5d87197edda"
-  integrity sha512-JWobfQDbTnoqaIwPKQ3DVSywihVXlQMbDuwik/dDWlj33A8oEHcjPOGs4OqcA3RHv24i+lfCQpM3Mn4FAMfacA==
-
-"@swc/core@^1.7.26":
-  version "1.10.1"
-  resolved "https://registry.yarnpkg.com/@swc/core/-/core-1.10.1.tgz#16b3b8284bafb0ecabb253925796883971e5a761"
-  integrity sha512-rQ4dS6GAdmtzKiCRt3LFVxl37FaY1cgL9kSUTnhQ2xc3fmHOd7jdJK/V4pSZMG1ruGTd0bsi34O2R0Olg9Zo/w==
+"@swc/core-darwin-arm64@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-darwin-arm64/-/core-darwin-arm64-1.10.12.tgz#ed317cd6aac5a66f529c0cbd8385761e2eccecc6"
+  integrity sha512-pOANQegUTAriW7jq3SSMZGM5l89yLVMs48R0F2UG6UZsH04SiViCnDctOGlA/Sa++25C+rL9MGMYM1jDLylBbg==
+
+"@swc/core-darwin-x64@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-darwin-x64/-/core-darwin-x64-1.10.12.tgz#59e249f40852231232b80f6a4caea2a223e9682e"
+  integrity sha512-m4kbpIDDsN1FrwfNQMU+FTrss356xsXvatLbearwR+V0lqOkjLBP0VmRvQfHEg+uy13VPyrT9gj4HLoztlci7w==
+
+"@swc/core-linux-arm-gnueabihf@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-linux-arm-gnueabihf/-/core-linux-arm-gnueabihf-1.10.12.tgz#5c2066a6ad8b768adc473e300995f909ce96cbbd"
+  integrity sha512-OY9LcupgqEu8zVK+rJPes6LDJJwPDmwaShU96beTaxX2K6VrXbpwm5WbPS/8FfQTsmpnuA7dCcMPUKhNgmzTrQ==
+
+"@swc/core-linux-arm64-gnu@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-linux-arm64-gnu/-/core-linux-arm64-gnu-1.10.12.tgz#7a8e6212617365c41a7b6e015cd2749d222c1ebe"
+  integrity sha512-nJD587rO0N4y4VZszz3xzVr7JIiCzSMhEMWnPjuh+xmPxDBz0Qccpr8xCr1cSxpl1uY7ERkqAGlKr6CwoV5kVg==
+
+"@swc/core-linux-arm64-musl@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-linux-arm64-musl/-/core-linux-arm64-musl-1.10.12.tgz#c939d554ecb32df65b4a784fc586f30c8ae7be0a"
+  integrity sha512-oqhSmV+XauSf0C//MoQnVErNUB/5OzmSiUzuazyLsD5pwqKNN+leC3JtRQ/QVzaCpr65jv9bKexT9+I2Tt3xDw==
+
+"@swc/core-linux-x64-gnu@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-linux-x64-gnu/-/core-linux-x64-gnu-1.10.12.tgz#745bc25de364bbde3b6240ed84d063379dc52c6c"
+  integrity sha512-XldSIHyjD7m1Gh+/8rxV3Ok711ENLI420CU2EGEqSe3VSGZ7pHJvJn9ZFbYpWhsLxPqBYMFjp3Qw+J6OXCPXCA==
+
+"@swc/core-linux-x64-musl@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-linux-x64-musl/-/core-linux-x64-musl-1.10.12.tgz#188855ee612a482eb8c298b2237e0b36962182a7"
+  integrity sha512-wvPXzJxzPgTqhyp1UskOx1hRTtdWxlyFD1cGWOxgLsMik0V9xKRgqKnMPv16Nk7L9xl6quQ6DuUHj9ID7L3oVw==
+
+"@swc/core-win32-arm64-msvc@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-win32-arm64-msvc/-/core-win32-arm64-msvc-1.10.12.tgz#3f8271b8a42ef29b53574705a6cd0427345cc616"
+  integrity sha512-TUYzWuu1O7uyIcRfxdm6Wh1u+gNnrW5M1DUgDOGZLsyQzgc2Zjwfh2llLhuAIilvCVg5QiGbJlpibRYJ/8QGsg==
+
+"@swc/core-win32-ia32-msvc@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-win32-ia32-msvc/-/core-win32-ia32-msvc-1.10.12.tgz#b7f59376870039f6a7ecc5331b4287f0fa82b182"
+  integrity sha512-4Qrw+0Xt+Fe2rz4OJ/dEPMeUf/rtuFWWAj/e0vL7J5laUHirzxawLRE5DCJLQTarOiYR6mWnmadt9o3EKzV6Xg==
+
+"@swc/core-win32-x64-msvc@1.10.12":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core-win32-x64-msvc/-/core-win32-x64-msvc-1.10.12.tgz#e053b1efc2bf24b0da1a1fa6a5ea6e1bda36df76"
+  integrity sha512-YiloZXLW7rUxJpALwHXaGjVaAEn+ChoblG7/3esque+Y7QCyheoBUJp2DVM1EeVA43jBfZ8tvYF0liWd9Tpz1A==
+
+"@swc/core@^1.10.7":
+  version "1.10.12"
+  resolved "https://registry.yarnpkg.com/@swc/core/-/core-1.10.12.tgz#6d002050814888ec72a8d439ca7194a4631ce199"
+  integrity sha512-+iUL0PYpPm6N9AdV1wvafakvCqFegQus1aoEDxgFsv3/uNVNIyRaupf/v/Zkp5hbep2EzhtoJR0aiJIzDbXWHg==
   dependencies:
     "@swc/counter" "^0.1.3"
     "@swc/types" "^0.1.17"
   optionalDependencies:
-    "@swc/core-darwin-arm64" "1.10.1"
-    "@swc/core-darwin-x64" "1.10.1"
-    "@swc/core-linux-arm-gnueabihf" "1.10.1"
-    "@swc/core-linux-arm64-gnu" "1.10.1"
-    "@swc/core-linux-arm64-musl" "1.10.1"
-    "@swc/core-linux-x64-gnu" "1.10.1"
-    "@swc/core-linux-x64-musl" "1.10.1"
-    "@swc/core-win32-arm64-msvc" "1.10.1"
-    "@swc/core-win32-ia32-msvc" "1.10.1"
-    "@swc/core-win32-x64-msvc" "1.10.1"
+    "@swc/core-darwin-arm64" "1.10.12"
+    "@swc/core-darwin-x64" "1.10.12"
+    "@swc/core-linux-arm-gnueabihf" "1.10.12"
+    "@swc/core-linux-arm64-gnu" "1.10.12"
+    "@swc/core-linux-arm64-musl" "1.10.12"
+    "@swc/core-linux-x64-gnu" "1.10.12"
+    "@swc/core-linux-x64-musl" "1.10.12"
+    "@swc/core-win32-arm64-msvc" "1.10.12"
+    "@swc/core-win32-ia32-msvc" "1.10.12"
+    "@swc/core-win32-x64-msvc" "1.10.12"
 
 "@swc/counter@^0.1.3":
   version "0.1.3"
@@ -988,6 +998,11 @@ accepts@~1.3.8:
     mime-types "~2.1.34"
     negotiator "0.6.3"
 
+ansi-html-community@0.0.8:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/ansi-html-community/-/ansi-html-community-0.0.8.tgz#69fbc4d6ccbe383f9736934ae34c3f8290f1bf41"
+  integrity sha512-1APHAyr3+PCamwNw3bXCPp4HFLONZt/yIH0sZp0/469KWNTEy+qN5jQ3GVX6DMZ1UXAi34yVwtTeaG/HpBuuzw==
+
 ansi-regex@^5.0.1:
   version "5.0.1"
   resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-5.0.1.tgz#082cb2c89c9fe8659a311a53bd6a4dc5301db304"
@@ -1873,23 +1888,23 @@ ordered-binary@^1.4.1:
   resolved "https://registry.yarnpkg.com/ordered-binary/-/ordered-binary-1.5.3.tgz#8bee2aa7a82c3439caeb1e80c272fd4cf51170fb"
   integrity sha512-oGFr3T+pYdTGJ+YFEILMpS3es+GiIbs9h/XQrclBXUtd44ey7XwfsMzM31f64I1SQOawDoDr/D823kNCADI8TA==
 
-parcel@2.0.0-dev.1793:
-  version "2.0.0-dev.1793"
-  resolved "https://registry.yarnpkg.com/parcel/-/parcel-2.0.0-dev.1793.tgz#f9705f9dc730f9f06b8447eeb697930d52819fce"
-  integrity sha512-+OyZB74SZfkVxZjNb4euYkBPXkx5st6/Ic0mvmGoKcNOLiHyb/1BW3TuoWRcqNsZs9vFMf2i24rpOZKITBeDOA==
-  dependencies:
-    "@parcel/config-default" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/core" "2.0.0-dev.1793+9f297b15c"
-    "@parcel/diagnostic" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/events" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/feature-flags" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/fs" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/logger" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/package-manager" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/reporter-cli" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/reporter-dev-server" "2.0.0-dev.1795+9f297b15c"
-    "@parcel/reporter-tracer" "2.13.3-dev.3418+9f297b15c"
-    "@parcel/utils" "2.0.0-dev.1795+9f297b15c"
+parcel@canary:
+  version "2.0.0-canary.1776"
+  resolved "https://registry.yarnpkg.com/parcel/-/parcel-2.0.0-canary.1776.tgz#c34446e8c5456211071df73e31954eaedf23b334"
+  integrity sha512-vGsAXeGT1+Ks1xRW0dHMBsg0LvmXNr1YN5GC7FSanCugymDT8qldQ5G7vHohNJbZuVmAA173Q00yrdFBsVZpmQ==
+  dependencies:
+    "@parcel/config-default" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/core" "2.0.0-canary.1776+b50bc79cb"
+    "@parcel/diagnostic" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/events" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/feature-flags" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/fs" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/logger" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/package-manager" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/reporter-cli" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/reporter-dev-server" "2.0.0-canary.1778+b50bc79cb"
+    "@parcel/reporter-tracer" "2.13.4-canary.3401+b50bc79cb"
+    "@parcel/utils" "2.0.0-canary.1778+b50bc79cb"
     chalk "^4.1.2"
     commander "^12.1.0"
     get-port "^4.2.0"
@@ -2000,6 +2015,13 @@ raw-body@2.5.2:
     iconv-lite "0.4.24"
     unpipe "1.0.0"
 
+"react-dom@^18 || ^19":
+  version "19.0.0"
+  resolved "https://registry.yarnpkg.com/react-dom/-/react-dom-19.0.0.tgz#43446f1f01c65a4cd7f7588083e686a6726cfb57"
+  integrity sha512-4GV5sHFG0e/0AD4X+ySy6UJd3jVl1iNsNHdpad0qhABJ11twS3TTBnseqsKurKcsNqCEFeGL3uLpVChpIO3QfQ==
+  dependencies:
+    scheduler "^0.25.0"
+
 react-dom@experimental:
   version "0.0.0-experimental-79ddf5b5-20241210"
   resolved "https://registry.yarnpkg.com/react-dom/-/react-dom-0.0.0-experimental-79ddf5b5-20241210.tgz#c140f191e7a88be5d4c38d34f7cf1dbf38a9a71d"
@@ -2007,21 +2029,21 @@ react-dom@experimental:
   dependencies:
     scheduler "0.0.0-experimental-79ddf5b5-20241210"
 
-react-error-overlay@6.0.9:
-  version "6.0.9"
-  resolved "https://registry.yarnpkg.com/react-error-overlay/-/react-error-overlay-6.0.9.tgz#3c743010c9359608c375ecd6bc76f35d93995b0a"
-  integrity sha512-nQTTcUu+ATDbrSD1BZHr5kgSD4oF8OFjxun8uAaL8RwPBacGBNPf/yAuVVdx17N8XNzRDMrZ9XcKZHCjPW+9ew==
-
-"react-refresh@>=0.9 <=0.14":
-  version "0.14.2"
-  resolved "https://registry.yarnpkg.com/react-refresh/-/react-refresh-0.14.2.tgz#3833da01ce32da470f1f936b9d477da5c7028bf9"
-  integrity sha512-jCvmsr+1IUSMUyzOkRcvnVbX3ZYC6g9TDrDbFuFmRDq7PD4yaGbLKNQL6k2jnArV8hjYxh7hVhAZB6s9HDGpZA==
+"react-refresh@>=0.9 <=0.16":
+  version "0.16.0"
+  resolved "https://registry.yarnpkg.com/react-refresh/-/react-refresh-0.16.0.tgz#e7d45625f05c9709466d09348a25d22f79b2ad23"
+  integrity sha512-FPvF2XxTSikpJxcr+bHut2H4gJ17+18Uy20D5/F+SKzFap62R3cM5wH6b8WN3LyGSYeQilLEcJcR1fjBSI2S1A==
 
 react-server-dom-parcel@experimental:
   version "0.0.1"
   resolved "https://registry.yarnpkg.com/react-server-dom-parcel/-/react-server-dom-parcel-0.0.1.tgz#2653c2b39a857fbd17770d27d6f08bd139803f09"
   integrity sha512-f93wv8gycm4ltcQRqpSlgYyT6cJxmjJdRmXw3deQoXowDlP44W4RRzwHQ70u1xseCpHFIORmuHVXk7+Fk8RFtQ==
 
+"react@^18 || ^19":
+  version "19.0.0"
+  resolved "https://registry.yarnpkg.com/react/-/react-19.0.0.tgz#6e1969251b9f108870aa4bff37a0ce9ddfaaabdd"
+  integrity sha512-V8AVnmPIICiWpGfm6GLzCR/W5FXLchHop40W4nXBmdlEceh16rCN8O8LNWm5bh5XUX91fh7KpA+W0TgMKmgTpQ==
+
 react@experimental:
   version "0.0.0-experimental-79ddf5b5-20241210"
   resolved "https://registry.yarnpkg.com/react/-/react-0.0.0-experimental-79ddf5b5-20241210.tgz#d1c620a36dfa02337f69c4eaeee230fec6742b72"
@@ -2069,6 +2091,11 @@ scheduler@0.0.0-experimental-79ddf5b5-20241210:
   resolved "https://registry.yarnpkg.com/scheduler/-/scheduler-0.0.0-experimental-79ddf5b5-20241210.tgz#2b6c17201831aa8f8e35e65ad95c7cf5362b5454"
   integrity sha512-Rg1aDzPQWVLENsVBlZbIS1buG55XTCEN7tOz0qk+pCnhswwa7h0VzGFVmX8CLuWnTYQYWw9ldFrjKLDM1Q1k3g==
 
+scheduler@^0.25.0:
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/scheduler/-/scheduler-0.25.0.tgz#336cd9768e8cceebf52d3c80e3dcf5de23e7e015"
+  integrity sha512-xFVuu11jh+xcO7JOAGJNOXld8/TcEHK/4CituBUeUb5hqxJLj9YuemAEuvm9gQ/+pgXYfbQuqAkiYu+u7YEsNA==
+
 semver@^7.5.2:
   version "7.6.3"
   resolved "https://registry.yarnpkg.com/semver/-/semver-7.6.3.tgz#980f7b5550bc175fb4dc09403085627f9eb33143"
@@ -2302,11 +2329,6 @@ wrap-ansi@^7.0.0:
     string-width "^4.1.0"
     strip-ansi "^6.0.0"
 
-ws@^8.8.1:
-  version "8.18.0"
-  resolved "https://registry.yarnpkg.com/ws/-/ws-8.18.0.tgz#0d7505a6eafe2b0e712d232b42279f53bc289bbc"
-  integrity sha512-8VbfWfHLbbwu3+N6OKsOMpBdT4kXPDDB9cJk2bJ6mh9ucxdlnNvH1e+roYkKmN9Nxw2yjz7VzeO9oOz2zJ04Pw==
-
 y18n@^5.0.5:
   version "5.0.8"
   resolved "https://registry.yarnpkg.com/y18n/-/y18n-5.0.8.tgz#7f4934d0f7ca8c56f95314939ddcd2dd91ce1d55"
diff --git a/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientBrowser.js b/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientBrowser.js
index d090dd6975dd1..7ea840b140790 100644
--- a/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientBrowser.js
+++ b/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientBrowser.js
@@ -31,6 +31,17 @@ import type {TemporaryReferenceSet} from 'react-client/src/ReactFlightTemporaryR
 export {createTemporaryReferenceSet} from 'react-client/src/ReactFlightTemporaryReferences';
 export type {TemporaryReferenceSet};
 
+function findSourceMapURL(filename: string, environmentName: string) {
+  const devServer = parcelRequire.meta.devServer;
+  if (devServer != null) {
+    const qs = new URLSearchParams();
+    qs.set('filename', filename);
+    qs.set('env', environmentName);
+    return devServer + '/__parcel_source_map?' + qs.toString();
+  }
+  return null;
+}
+
 type CallServerCallback = <A, T>(id: string, args: A) => Promise<T>;
 
 let callServer: CallServerCallback | null = null;
@@ -57,6 +68,9 @@ export function createServerReference<A: Iterable<any>, T>(
   return createServerReferenceImpl(
     id + '#' + exportName,
     callCurrentServerCallback,
+    undefined,
+    findSourceMapURL,
+    exportName,
   );
 }
 
@@ -107,7 +121,7 @@ export function createFromReadableStream<T>(
     options && options.temporaryReferences
       ? options.temporaryReferences
       : undefined,
-    undefined, // TODO: findSourceMapUrl
+    __DEV__ ? findSourceMapURL : undefined,
     __DEV__ ? (options ? options.replayConsoleLogs !== false : true) : false, // defaults to true
     __DEV__ && options && options.environmentName
       ? options.environmentName
@@ -131,7 +145,7 @@ export function createFromFetch<T>(
     options && options.temporaryReferences
       ? options.temporaryReferences
       : undefined,
-    undefined, // TODO: findSourceMapUrl
+    __DEV__ ? findSourceMapURL : undefined,
     __DEV__ ? (options ? options.replayConsoleLogs !== false : true) : false, // defaults to true
     __DEV__ && options && options.environmentName
       ? options.environmentName
diff --git a/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientEdge.js b/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientEdge.js
index 05df8ac121031..8783cbfc6a7f9 100644
--- a/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientEdge.js
+++ b/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientEdge.js
@@ -30,6 +30,17 @@ import type {TemporaryReferenceSet} from 'react-client/src/ReactFlightTemporaryR
 export {createTemporaryReferenceSet} from 'react-client/src/ReactFlightTemporaryReferences';
 export type {TemporaryReferenceSet};
 
+function findSourceMapURL(filename: string, environmentName: string) {
+  const devServer = parcelRequire.meta.devServer;
+  if (devServer != null) {
+    const qs = new URLSearchParams();
+    qs.set('filename', filename);
+    qs.set('env', environmentName);
+    return devServer + '/__parcel_source_map?' + qs.toString();
+  }
+  return null;
+}
+
 function noServerCall() {
   throw new Error(
     'Server Functions cannot be called during initial render. ' +
@@ -42,7 +53,13 @@ export function createServerReference<A: Iterable<any>, T>(
   id: string,
   exportName: string,
 ): (...A) => Promise<T> {
-  return createServerReferenceImpl(id + '#' + exportName, noServerCall);
+  return createServerReferenceImpl(
+    id + '#' + exportName,
+    noServerCall,
+    undefined,
+    findSourceMapURL,
+    exportName,
+  );
 }
 
 type EncodeFormActionCallback = <A>(
@@ -69,7 +86,7 @@ function createResponseFromOptions(options?: Options) {
     options && options.temporaryReferences
       ? options.temporaryReferences
       : undefined,
-    undefined, // TODO: findSourceMapUrl
+    __DEV__ ? findSourceMapURL : undefined,
     __DEV__ && options ? options.replayConsoleLogs === true : false, // defaults to false
     __DEV__ && options && options.environmentName
       ? options.environmentName
diff --git a/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientNode.js b/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientNode.js
index 735d594a27594..8be06af9f2038 100644
--- a/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientNode.js
+++ b/packages/react-server-dom-parcel/src/client/ReactFlightDOMClientNode.js
@@ -21,6 +21,17 @@ import {
 
 import {createServerReference as createServerReferenceImpl} from 'react-client/src/ReactFlightReplyClient';
 
+function findSourceMapURL(filename: string, environmentName: string) {
+  const devServer = parcelRequire.meta.devServer;
+  if (devServer != null) {
+    const qs = new URLSearchParams();
+    qs.set('filename', filename);
+    qs.set('env', environmentName);
+    return devServer + '/__parcel_source_map?' + qs.toString();
+  }
+  return null;
+}
+
 function noServerCall() {
   throw new Error(
     'Server Functions cannot be called during initial render. ' +
@@ -33,7 +44,13 @@ export function createServerReference<A: Iterable<any>, T>(
   id: string,
   exportName: string,
 ): (...A) => Promise<T> {
-  return createServerReferenceImpl(id + '#' + exportName, noServerCall);
+  return createServerReferenceImpl(
+    id + '#' + exportName,
+    noServerCall,
+    undefined,
+    findSourceMapURL,
+    exportName,
+  );
 }
 
 type EncodeFormActionCallback = <A>(
@@ -60,7 +77,7 @@ export function createFromNodeStream<T>(
     options ? options.encodeFormAction : undefined,
     options && typeof options.nonce === 'string' ? options.nonce : undefined,
     undefined, // TODO: If encodeReply is supported, this should support temporaryReferences
-    undefined, // TODO: findSourceMapUrl
+    __DEV__ ? findSourceMapURL : undefined,
     __DEV__ && options ? options.replayConsoleLogs === true : false, // defaults to false
     __DEV__ && options && options.environmentName
       ? options.environmentName
diff --git a/scripts/flow/environment.js b/scripts/flow/environment.js
index 37ca6fe4dc223..a083223ba1b5e 100644
--- a/scripts/flow/environment.js
+++ b/scripts/flow/environment.js
@@ -109,6 +109,7 @@ declare var parcelRequire: {
   extendImportMap: (importMap: {[string]: string}) => void,
   meta: {
     publicUrl: string,
+    devServer: string | null,
   },
 };
 

From 8bda71558c8b6f9f19af33271f1bfd0251a1c071 Mon Sep 17 00:00:00 2001
From: Josh Story <story@hey.com>
Date: Tue, 4 Feb 2025 12:30:30 -0800
Subject: [PATCH 18/72] [Fiber] support hydration when rendering Suspense
 anywhere (#32224)

follow up to https://github.com/facebook/react/pull/32163

This continues the work of making Suspense workable anywhere in a
react-dom tree. See the prior PRs for how we handle server rendering and
client rendering. In this change we update the hydration implementation
to be able to locate expected nodes. In particular this means hydration
understands now that the default hydration context is the document body
when the container is above the body.

One case that is unique to hydration is clearing Suspense boundaries.
When hydration fails or when the server instructs the client to recover
an errored boundary it's possible that the html, head, and body tags in
the initial document were written from a fallback or a different primary
content on the server and need to be replaced by the client render.
However these tags (and in the case of head, their content) won't be
inside the comment nodes that identify the bounds of the Suspense
boundary. And when client rendering you may not even render the same
singletons that were server rendered. So when server rendering a
boudnary which contributes to the preamble (the html, head, and body tag
openings plus the head contents) we emit a special marker comment just
before closing the boundary out. This marker encodes which parts of the
preamble this boundary owned. If we need to clear the suspense boundary
on the client we read this marker and use it to reset the appropriate
singleton state.
---
 .../src/client/ReactFiberConfigDOM.js         | 110 +++-
 .../src/server/ReactFizzConfigDOM.js          |  84 ++-
 .../src/server/ReactFizzConfigDOMLegacy.js    |  14 +-
 .../src/__tests__/ReactDOMFizzServer-test.js  | 588 +++++++++++++++++-
 ...ctDOMServerIntegrationUntrustedURL-test.js |   6 +
 .../react-markup/src/ReactFizzConfigMarkup.js |   2 +
 .../src/ReactFiberCommitHostEffects.js        |   1 +
 .../src/ReactFiberConfigWithNoHydration.js    |   2 +
 .../src/ReactFiberHydrationContext.js         |  55 +-
 .../src/forks/ReactFiberConfig.custom.js      |   4 +
 packages/react-server/src/ReactFizzServer.js  |   7 +-
 11 files changed, 833 insertions(+), 40 deletions(-)

diff --git a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
index 9e3574885fa6e..5757286f65a28 100644
--- a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
+++ b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
@@ -207,6 +207,9 @@ const SUSPENSE_START_DATA = '$';
 const SUSPENSE_END_DATA = '/$';
 const SUSPENSE_PENDING_START_DATA = '$?';
 const SUSPENSE_FALLBACK_START_DATA = '$!';
+const PREAMBLE_CONTRIBUTION_HTML = 0b001;
+const PREAMBLE_CONTRIBUTION_BODY = 0b010;
+const PREAMBLE_CONTRIBUTION_HEAD = 0b100;
 const FORM_STATE_IS_MATCHING = 'F!';
 const FORM_STATE_IS_NOT_MATCHING = 'F';
 
@@ -963,6 +966,7 @@ export function clearSuspenseBoundary(
   suspenseInstance: SuspenseInstance,
 ): void {
   let node: Node = suspenseInstance;
+  let possiblePreambleContribution: number = 0;
   // Delete all nodes within this suspense boundary.
   // There might be nested nodes so we need to keep track of how
   // deep we are and only break out when we're back on top.
@@ -973,6 +977,36 @@ export function clearSuspenseBoundary(
     if (nextNode && nextNode.nodeType === COMMENT_NODE) {
       const data = ((nextNode: any).data: string);
       if (data === SUSPENSE_END_DATA) {
+        if (
+          // represents 3 bits where at least one bit is set (1-7)
+          possiblePreambleContribution > 0 &&
+          possiblePreambleContribution < 8
+        ) {
+          const code = possiblePreambleContribution;
+          // It's not normally possible to insert a comment immediately preceding Suspense boundary
+          // closing comment marker so we can infer that if the comment preceding starts with "1" through "7"
+          // then it is in fact a preamble contribution marker comment. We do this value test to avoid the case
+          // where the Suspense boundary is empty and the preceding comment marker is the Suspense boundary
+          // opening marker or the closing marker of an inner boundary. In those cases the first character won't
+          // have the requisite value to be interpreted as a Preamble contribution
+          const ownerDocument = parentInstance.ownerDocument;
+          if (code & PREAMBLE_CONTRIBUTION_HTML) {
+            const documentElement: Element =
+              (ownerDocument.documentElement: any);
+            releaseSingletonInstance(documentElement);
+          }
+          if (code & PREAMBLE_CONTRIBUTION_BODY) {
+            const body: Element = (ownerDocument.body: any);
+            releaseSingletonInstance(body);
+          }
+          if (code & PREAMBLE_CONTRIBUTION_HEAD) {
+            const head: Element = (ownerDocument.head: any);
+            releaseSingletonInstance(head);
+            // We need to clear the head because this is the only singleton that can have children that
+            // were part of this boundary but are not inside this boundary.
+            clearHead(head);
+          }
+        }
         if (depth === 0) {
           parentInstance.removeChild(nextNode);
           // Retry if any event replaying was blocked on this.
@@ -987,7 +1021,11 @@ export function clearSuspenseBoundary(
         data === SUSPENSE_FALLBACK_START_DATA
       ) {
         depth++;
+      } else {
+        possiblePreambleContribution = data.charCodeAt(0) - 48;
       }
+    } else {
+      possiblePreambleContribution = 0;
     }
     // $FlowFixMe[incompatible-type] we bail out when we get a null
     node = nextNode;
@@ -1501,7 +1539,7 @@ function clearContainerSparingly(container: Node) {
       case 'STYLE': {
         continue;
       }
-      // Stylesheet tags are retained because tehy may likely come from 3rd party scripts and extensions
+      // Stylesheet tags are retained because they may likely come from 3rd party scripts and extensions
       case 'LINK': {
         if (((node: any): HTMLLinkElement).rel.toLowerCase() === 'stylesheet') {
           continue;
@@ -1513,6 +1551,27 @@ function clearContainerSparingly(container: Node) {
   return;
 }
 
+function clearHead(head: Element): void {
+  let node = head.firstChild;
+  while (node) {
+    const nextNode = node.nextSibling;
+    const nodeName = node.nodeName;
+    if (
+      isMarkedHoistable(node) ||
+      nodeName === 'SCRIPT' ||
+      nodeName === 'STYLE' ||
+      (nodeName === 'LINK' &&
+        ((node: any): HTMLLinkElement).rel.toLowerCase() === 'stylesheet')
+    ) {
+      // retain these nodes
+    } else {
+      head.removeChild(node);
+    }
+    node = nextNode;
+  }
+  return;
+}
+
 // Making this so we can eventually move all of the instance caching to the commit phase.
 // Currently this is only used to associate fiber and props to instances for hydrating
 // HostSingletons. The reason we need it here is we only want to make this binding on commit
@@ -1874,7 +1933,20 @@ export function getFirstHydratableChild(
 export function getFirstHydratableChildWithinContainer(
   parentContainer: Container,
 ): null | HydratableInstance {
-  return getNextHydratable(parentContainer.firstChild);
+  let parentElement: Element;
+  switch (parentContainer.nodeType) {
+    case DOCUMENT_NODE:
+      parentElement = (parentContainer: any).body;
+      break;
+    default: {
+      if (parentContainer.nodeName === 'HTML') {
+        parentElement = (parentContainer: any).ownerDocument.body;
+      } else {
+        parentElement = (parentContainer: any);
+      }
+    }
+  }
+  return getNextHydratable(parentElement.firstChild);
 }
 
 export function getFirstHydratableChildWithinSuspenseInstance(
@@ -1883,6 +1955,40 @@ export function getFirstHydratableChildWithinSuspenseInstance(
   return getNextHydratable(parentInstance.nextSibling);
 }
 
+// If it were possible to have more than one scope singleton in a DOM tree
+// we would need to model this as a stack but since you can only have one <head>
+// and head is the only singleton that is a scope in DOM we can get away with
+// tracking this as a single value.
+let previousHydratableOnEnteringScopedSingleton: null | HydratableInstance =
+  null;
+
+export function getFirstHydratableChildWithinSingleton(
+  type: string,
+  singletonInstance: Instance,
+  currentHydratableInstance: null | HydratableInstance,
+): null | HydratableInstance {
+  if (isSingletonScope(type)) {
+    previousHydratableOnEnteringScopedSingleton = currentHydratableInstance;
+    return getNextHydratable(singletonInstance.firstChild);
+  } else {
+    return currentHydratableInstance;
+  }
+}
+
+export function getNextHydratableSiblingAfterSingleton(
+  type: string,
+  currentHydratableInstance: null | HydratableInstance,
+): null | HydratableInstance {
+  if (isSingletonScope(type)) {
+    const previousHydratableInstance =
+      previousHydratableOnEnteringScopedSingleton;
+    previousHydratableOnEnteringScopedSingleton = null;
+    return previousHydratableInstance;
+  } else {
+    return currentHydratableInstance;
+  }
+}
+
 export function describeHydratableInstanceForDevWarnings(
   instance: HydratableInstance,
 ): string | {type: string, props: $ReadOnly<Props>} {
diff --git a/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js b/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js
index 4b8841a06e67b..8fac981ab29f2 100644
--- a/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js
+++ b/packages/react-dom-bindings/src/server/ReactFizzConfigDOM.js
@@ -684,16 +684,23 @@ export function completeResumableState(resumableState: ResumableState): void {
   resumableState.bootstrapModules = undefined;
 }
 
+const NoContribution /*     */ = 0b000;
+const HTMLContribution /*   */ = 0b001;
+const BodyContribution /*   */ = 0b010;
+const HeadContribution /*   */ = 0b100;
+
 export type PreambleState = {
   htmlChunks: null | Array<Chunk | PrecomputedChunk>,
   headChunks: null | Array<Chunk | PrecomputedChunk>,
   bodyChunks: null | Array<Chunk | PrecomputedChunk>,
+  contribution: number,
 };
 export function createPreambleState(): PreambleState {
   return {
     htmlChunks: null,
     headChunks: null,
     bodyChunks: null,
+    contribution: NoContribution,
   };
 }
 
@@ -3227,7 +3234,7 @@ function pushStartHead(
       throw new Error(`The ${'`<head>`'} tag may only be rendered once.`);
     }
     preamble.headChunks = [];
-    return pushStartGenericElement(preamble.headChunks, props, 'head');
+    return pushStartSingletonElement(preamble.headChunks, props, 'head');
   } else {
     // This <head> is deep and is likely just an error. we emit it inline though.
     // Validation should warn that this tag is the the wrong spot.
@@ -3251,7 +3258,7 @@ function pushStartBody(
     }
 
     preamble.bodyChunks = [];
-    return pushStartGenericElement(preamble.bodyChunks, props, 'body');
+    return pushStartSingletonElement(preamble.bodyChunks, props, 'body');
   } else {
     // This <head> is deep and is likely just an error. we emit it inline though.
     // Validation should warn that this tag is the the wrong spot.
@@ -3275,7 +3282,7 @@ function pushStartHtml(
     }
 
     preamble.htmlChunks = [DOCTYPE];
-    return pushStartGenericElement(preamble.htmlChunks, props, 'html');
+    return pushStartSingletonElement(preamble.htmlChunks, props, 'html');
   } else {
     // This <html> is deep and is likely just an error. we emit it inline though.
     // Validation should warn that this tag is the the wrong spot.
@@ -3416,6 +3423,43 @@ function pushScriptImpl(
   return null;
 }
 
+// This is a fork of pushStartGenericElement because we don't ever want to do
+// the children as strign optimization on that path when rendering singletons.
+// When we eliminate that special path we can delete this fork and unify it again
+function pushStartSingletonElement(
+  target: Array<Chunk | PrecomputedChunk>,
+  props: Object,
+  tag: string,
+): ReactNodeList {
+  target.push(startChunkForTag(tag));
+
+  let children = null;
+  let innerHTML = null;
+  for (const propKey in props) {
+    if (hasOwnProperty.call(props, propKey)) {
+      const propValue = props[propKey];
+      if (propValue == null) {
+        continue;
+      }
+      switch (propKey) {
+        case 'children':
+          children = propValue;
+          break;
+        case 'dangerouslySetInnerHTML':
+          innerHTML = propValue;
+          break;
+        default:
+          pushAttribute(target, propKey, propValue);
+          break;
+      }
+    }
+  }
+
+  target.push(endOfStartTag);
+  pushInnerHTML(target, innerHTML, children);
+  return children;
+}
+
 function pushStartGenericElement(
   target: Array<Chunk | PrecomputedChunk>,
   props: Object,
@@ -3907,14 +3951,17 @@ export function hoistPreambleState(
   preambleState: PreambleState,
 ) {
   const rootPreamble = renderState.preamble;
-  if (rootPreamble.htmlChunks === null) {
+  if (rootPreamble.htmlChunks === null && preambleState.htmlChunks) {
     rootPreamble.htmlChunks = preambleState.htmlChunks;
+    preambleState.contribution |= HTMLContribution;
   }
-  if (rootPreamble.headChunks === null) {
+  if (rootPreamble.headChunks === null && preambleState.headChunks) {
     rootPreamble.headChunks = preambleState.headChunks;
+    preambleState.contribution |= HeadContribution;
   }
-  if (rootPreamble.bodyChunks === null) {
+  if (rootPreamble.bodyChunks === null && preambleState.bodyChunks) {
     rootPreamble.bodyChunks = preambleState.bodyChunks;
+    preambleState.contribution |= BodyContribution;
   }
 }
 
@@ -4091,7 +4138,11 @@ export function writeStartClientRenderedSuspenseBoundary(
 export function writeEndCompletedSuspenseBoundary(
   destination: Destination,
   renderState: RenderState,
+  preambleState: null | PreambleState,
 ): boolean {
+  if (preambleState) {
+    writePreambleContribution(destination, preambleState);
+  }
   return writeChunkAndReturn(destination, endSuspenseBoundary);
 }
 export function writeEndPendingSuspenseBoundary(
@@ -4103,10 +4154,31 @@ export function writeEndPendingSuspenseBoundary(
 export function writeEndClientRenderedSuspenseBoundary(
   destination: Destination,
   renderState: RenderState,
+  preambleState: null | PreambleState,
 ): boolean {
+  if (preambleState) {
+    writePreambleContribution(destination, preambleState);
+  }
   return writeChunkAndReturn(destination, endSuspenseBoundary);
 }
 
+const boundaryPreambleContributionChunkStart = stringToPrecomputedChunk('<!--');
+const boundaryPreambleContributionChunkEnd = stringToPrecomputedChunk('-->');
+
+function writePreambleContribution(
+  destination: Destination,
+  preambleState: PreambleState,
+) {
+  const contribution = preambleState.contribution;
+  if (contribution !== NoContribution) {
+    writeChunk(destination, boundaryPreambleContributionChunkStart);
+    // This is a number type so we can do the fast path without coercion checking
+    // eslint-disable-next-line react-internal/safe-string-coercion
+    writeChunk(destination, stringToChunk('' + contribution));
+    writeChunk(destination, boundaryPreambleContributionChunkEnd);
+  }
+}
+
 const startSegmentHTML = stringToPrecomputedChunk('<div hidden id="');
 const startSegmentHTML2 = stringToPrecomputedChunk('">');
 const endSegmentHTML = stringToPrecomputedChunk('</div>');
diff --git a/packages/react-dom-bindings/src/server/ReactFizzConfigDOMLegacy.js b/packages/react-dom-bindings/src/server/ReactFizzConfigDOMLegacy.js
index 491d322793941..ecd12d2ac5fd1 100644
--- a/packages/react-dom-bindings/src/server/ReactFizzConfigDOMLegacy.js
+++ b/packages/react-dom-bindings/src/server/ReactFizzConfigDOMLegacy.js
@@ -244,20 +244,30 @@ export function writeStartClientRenderedSuspenseBoundary(
 export function writeEndCompletedSuspenseBoundary(
   destination: Destination,
   renderState: RenderState,
+  preambleState: null | PreambleState,
 ): boolean {
   if (renderState.generateStaticMarkup) {
     return true;
   }
-  return writeEndCompletedSuspenseBoundaryImpl(destination, renderState);
+  return writeEndCompletedSuspenseBoundaryImpl(
+    destination,
+    renderState,
+    preambleState,
+  );
 }
 export function writeEndClientRenderedSuspenseBoundary(
   destination: Destination,
   renderState: RenderState,
+  preambleState: null | PreambleState,
 ): boolean {
   if (renderState.generateStaticMarkup) {
     return true;
   }
-  return writeEndClientRenderedSuspenseBoundaryImpl(destination, renderState);
+  return writeEndClientRenderedSuspenseBoundaryImpl(
+    destination,
+    renderState,
+    preambleState,
+  );
 }
 
 export type TransitionStatus = FormStatus;
diff --git a/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js b/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js
index ac6374600fc64..d0a1e484f2810 100644
--- a/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js
@@ -8923,7 +8923,7 @@ describe('ReactDOMFizzServer', () => {
     );
   });
 
-  it('can server render Suspense before, after, and around <html>', async () => {
+  it('can render Suspense before, after, and around <html>', async () => {
     function BlockedOn({value, children}) {
       readText(value);
       return children;
@@ -8989,9 +8989,33 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    const root = ReactDOMClient.hydrateRoot(document, <App />);
+    await waitForAll([]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html lang="en">
+        <head>
+          <meta itemprop="" content="non-floaty meta" />
+        </head>
+        <body>
+          <div>before</div>
+          <div>hello world</div>
+          <div>after</div>
+        </body>
+      </html>,
+    );
+    assertConsoleErrorDev(['In HTML, <div> cannot be a child of <#document>']);
+
+    root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
   });
 
-  it('can server render Suspense before, after, and around <body>', async () => {
+  it('can render Suspense before, after, and around <body>', async () => {
     function BlockedOn({value, children}) {
       readText(value);
       return children;
@@ -9052,9 +9076,83 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    const root = ReactDOMClient.hydrateRoot(document, <App />);
+    await waitForAll([]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head>
+          <meta content="before" />
+          <meta content="after" />
+        </head>
+        <body lang="en">
+          <meta itemprop="" content="before" />
+          <div>hello world</div>
+          <meta itemprop="" content="after" />
+        </body>
+      </html>,
+    );
+    if (gate(flags => flags.enableOwnerStacks)) {
+      assertConsoleErrorDev([
+        [
+          'Cannot render a <meta> outside the main document if it has an `itemProp` prop. `itemProp` suggests the tag belongs to an `itemScope` which can appear anywhere in the DOM. If you were intending for React to hoist this <meta> remove the `itemProp` prop. Otherwise, try moving this tag into the <head> or <body> of the Document.',
+          {withoutStack: true},
+        ],
+        'In HTML, <meta> cannot be a child of <html>.\nThis will cause a hydration error.' +
+          '\n' +
+          '\n  <App>' +
+          '\n>   <html>' +
+          '\n      <Suspense fallback="this fallb...">' +
+          '\n        <meta>' +
+          '\n>       <meta itemProp="" content="before">' +
+          '\n      ...' +
+          '\n' +
+          '\n    in meta (at **)' +
+          '\n    in App (at **)',
+        '<html> cannot contain a nested <meta>.\nSee this log for the ancestor stack trace.' +
+          '\n    in html (at **)' +
+          '\n    in App (at **)',
+        [
+          'Cannot render a <meta> outside the main document if it has an `itemProp` prop. `itemProp` suggests the tag belongs to an `itemScope` which can appear anywhere in the DOM. If you were intending for React to hoist this <meta> remove the `itemProp` prop. Otherwise, try moving this tag into the <head> or <body> of the Document.',
+          {withoutStack: true},
+        ],
+      ]);
+    } else {
+      assertConsoleErrorDev([
+        'Cannot render a <meta> outside the main document if it has an `itemProp` prop. `itemProp` suggests the tag belongs to an `itemScope` which can appear anywhere in the DOM. If you were intending for React to hoist this <meta> remove the `itemProp` prop. Otherwise, try moving this tag into the <head> or <body> of the Document.' +
+          '\n    in Suspense (at **)' +
+          '\n    in html (at **)' +
+          '\n    in App (at **)',
+        'In HTML, <meta> cannot be a child of <html>.\nThis will cause a hydration error.' +
+          '\n' +
+          '\n  <App>' +
+          '\n>   <html>' +
+          '\n      <Suspense fallback="this fallb...">' +
+          '\n        <meta>' +
+          '\n>       <meta itemProp="" content="before">' +
+          '\n      ...' +
+          '\n' +
+          '\n    in meta (at **)' +
+          '\n    in Suspense (at **)' +
+          '\n    in html (at **)' +
+          '\n    in App (at **)',
+        'Cannot render a <meta> outside the main document if it has an `itemProp` prop. `itemProp` suggests the tag belongs to an `itemScope` which can appear anywhere in the DOM. If you were intending for React to hoist this <meta> remove the `itemProp` prop. Otherwise, try moving this tag into the <head> or <body> of the Document.' +
+          '\n    in Suspense (at **)' +
+          '\n    in html (at **)' +
+          '\n    in App (at **)',
+      ]);
+    }
+
+    await root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
   });
 
-  it('can server render Suspense before, after, and around <head>', async () => {
+  it('can render Suspense before, after, and around <head>', async () => {
     function BlockedOn({value, children}) {
       readText(value);
       return children;
@@ -9119,11 +9217,90 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    const root = ReactDOMClient.hydrateRoot(document, <App />);
+    await waitForAll([]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head lang="en">
+          <meta content="before" />
+          <meta content="after" />
+          <meta itemprop="" />
+        </head>
+        <body>
+          <meta itemprop="" content="before" />
+          <meta itemprop="" content="after" />
+          <div>hello world</div>
+        </body>
+      </html>,
+    );
+    if (gate(flags => flags.enableOwnerStacks)) {
+      assertConsoleErrorDev([
+        [
+          'Cannot render a <meta> outside the main document if it has an `itemProp` prop. `itemProp` suggests the tag belongs to an `itemScope` which can appear anywhere in the DOM. If you were intending for React to hoist this <meta> remove the `itemProp` prop. Otherwise, try moving this tag into the <head> or <body> of the Document.',
+          {withoutStack: true},
+        ],
+        'In HTML, <meta> cannot be a child of <html>.\nThis will cause a hydration error.' +
+          '\n' +
+          '\n  <App>' +
+          '\n>   <html>' +
+          '\n      <Suspense fallback="this fallb...">' +
+          '\n        <meta>' +
+          '\n>       <meta itemProp="" content="before">' +
+          '\n      ...' +
+          '\n' +
+          '\n    in meta (at **)' +
+          '\n    in App (at **)',
+        '<html> cannot contain a nested <meta>.\nSee this log for the ancestor stack trace.' +
+          '\n    in html (at **)' +
+          '\n    in App (at **)',
+        [
+          'Cannot render a <meta> outside the main document if it has an `itemProp` prop. `itemProp` suggests the tag belongs to an `itemScope` which can appear anywhere in the DOM. If you were intending for React to hoist this <meta> remove the `itemProp` prop. Otherwise, try moving this tag into the <head> or <body> of the Document.',
+          {withoutStack: true},
+        ],
+      ]);
+    } else {
+      assertConsoleErrorDev([
+        'Cannot render a <meta> outside the main document if it has an `itemProp` prop. `itemProp` suggests the tag belongs to an `itemScope` which can appear anywhere in the DOM. If you were intending for React to hoist this <meta> remove the `itemProp` prop. Otherwise, try moving this tag into the <head> or <body> of the Document.' +
+          '\n    in Suspense (at **)' +
+          '\n    in html (at **)' +
+          '\n    in App (at **)',
+        'In HTML, <meta> cannot be a child of <html>.\nThis will cause a hydration error.' +
+          '\n' +
+          '\n  <App>' +
+          '\n>   <html>' +
+          '\n      <Suspense fallback="this fallb...">' +
+          '\n        <meta>' +
+          '\n>       <meta itemProp="" content="before">' +
+          '\n      ...' +
+          '\n' +
+          '\n    in meta (at **)' +
+          '\n    in Suspense (at **)' +
+          '\n    in html (at **)' +
+          '\n    in App (at **)',
+        'Cannot render a <meta> outside the main document if it has an `itemProp` prop. `itemProp` suggests the tag belongs to an `itemScope` which can appear anywhere in the DOM. If you were intending for React to hoist this <meta> remove the `itemProp` prop. Otherwise, try moving this tag into the <head> or <body> of the Document.' +
+          '\n    in Suspense (at **)' +
+          '\n    in html (at **)' +
+          '\n    in App (at **)',
+      ]);
+    }
+
+    await root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
   });
 
-  it('will render fallback Document when erroring a boundary above the body', async () => {
+  it('will render fallback Document when erroring a boundary above the body and recover on the client', async () => {
+    let serverRendering = true;
     function Boom() {
-      throw new Error('Boom!');
+      if (serverRendering) {
+        throw new Error('Boom!');
+      }
+      return null;
     }
 
     function App() {
@@ -9174,11 +9351,50 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    serverRendering = false;
+
+    const recoverableErrors = [];
+    const root = ReactDOMClient.hydrateRoot(document, <App />, {
+      onRecoverableError(err) {
+        recoverableErrors.push(err);
+      },
+    });
+    await waitForAll([]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html data-content-html="">
+        <head />
+        <body data-content-body="">
+          <span>hello world</span>
+        </body>
+      </html>,
+    );
+    expect(recoverableErrors).toEqual([
+      __DEV__
+        ? new Error(
+            'Switched to client rendering because the server rendering errored:\n\nBoom!',
+          )
+        : new Error(
+            'The server could not finish this Suspense boundary, likely due to an error during server rendering. Switched to client rendering.',
+          ),
+    ]);
+
+    root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
   });
 
   it('will hoist resources and hositables from a primary tree into the <head> of a client rendered fallback', async () => {
+    let serverRendering = true;
     function Boom() {
-      throw new Error('Boom!');
+      if (serverRendering) {
+        throw new Error('Boom!');
+      }
+      return null;
     }
 
     function App() {
@@ -9255,6 +9471,65 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    serverRendering = false;
+
+    const recoverableErrors = [];
+    const root = ReactDOMClient.hydrateRoot(document, <App />, {
+      onRecoverableError(err) {
+        recoverableErrors.push(err);
+      },
+    });
+    await waitForAll([]);
+    expect(recoverableErrors).toEqual([
+      __DEV__
+        ? new Error(
+            'Switched to client rendering because the server rendering errored:\n\nBoom!',
+          )
+        : new Error(
+            'The server could not finish this Suspense boundary, likely due to an error during server rendering. Switched to client rendering.',
+          ),
+    ]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html data-content-html="">
+        <head>
+          <link
+            rel="stylesheet"
+            href="hoistable before"
+            data-precedence="default"
+          />
+          <link
+            rel="stylesheet"
+            href="hoistable after"
+            data-precedence="default"
+          />
+          <meta content="hoistable before" />
+          <meta content="hoistable after" />
+        </head>
+        <body data-content-body="">
+          <span>hello world</span>
+        </body>
+      </html>,
+    );
+
+    root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head>
+          <link
+            rel="stylesheet"
+            href="hoistable before"
+            data-precedence="default"
+          />
+          <link
+            rel="stylesheet"
+            href="hoistable after"
+            data-precedence="default"
+          />
+        </head>
+        <body />
+      </html>,
+    );
   });
 
   it('Will wait to flush Document chunks until all boundaries which might contain a preamble are errored or resolved', async () => {
@@ -9353,8 +9628,12 @@ describe('ReactDOMFizzServer', () => {
   });
 
   it('Can render a fallback <head> alongside a non-fallback body', async () => {
+    let serverRendering = true;
     function Boom() {
-      throw new Error('Boom!');
+      if (serverRendering) {
+        throw new Error('Boom!');
+      }
+      return null;
     }
 
     function App() {
@@ -9416,11 +9695,52 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    serverRendering = false;
+
+    const recoverableErrors = [];
+    const root = ReactDOMClient.hydrateRoot(document, <App />, {
+      onRecoverableError(err) {
+        recoverableErrors.push(err);
+      },
+    });
+    await waitForAll([]);
+    expect(recoverableErrors).toEqual([
+      __DEV__
+        ? new Error(
+            'Switched to client rendering because the server rendering errored:\n\nBoom!',
+          )
+        : new Error(
+            'The server could not finish this Suspense boundary, likely due to an error during server rendering. Switched to client rendering.',
+          ),
+    ]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head data-primary="">
+          <meta itemprop="" content="primary" />
+        </head>
+        <body data-primary="">
+          <div>primary body</div>
+        </body>
+      </html>,
+    );
+
+    root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
   });
 
   it('Can render a fallback <body> alongside a non-fallback head', async () => {
+    let serverRendering = true;
     function Boom() {
-      throw new Error('Boom!');
+      if (serverRendering) {
+        throw new Error('Boom!');
+      }
+      return null;
     }
 
     function App() {
@@ -9482,6 +9802,43 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    serverRendering = false;
+
+    const recoverableErrors = [];
+    const root = ReactDOMClient.hydrateRoot(document, <App />, {
+      onRecoverableError(err) {
+        recoverableErrors.push(err);
+      },
+    });
+    await waitForAll([]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head data-primary="">
+          <meta itemprop="" content="primary" />
+        </head>
+        <body data-primary="">
+          <div>primary body</div>
+        </body>
+      </html>,
+    );
+    expect(recoverableErrors).toEqual([
+      __DEV__
+        ? new Error(
+            'Switched to client rendering because the server rendering errored:\n\nBoom!',
+          )
+        : new Error(
+            'The server could not finish this Suspense boundary, likely due to an error during server rendering. Switched to client rendering.',
+          ),
+    ]);
+
+    root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
   });
 
   it('Can render a <head> outside of a containing <html>', async () => {
@@ -9528,6 +9885,27 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    const root = ReactDOMClient.hydrateRoot(document, <App />);
+    await waitForAll([]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html data-x="">
+        <head data-y="">
+          <meta itemprop="" />
+        </head>
+        <body data-x="">
+          <span>hello world</span>
+        </body>
+      </html>,
+    );
+
+    root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
   });
 
   it('can render preamble tags in deeply nested indirect component trees', async () => {
@@ -9661,6 +10039,28 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    const root = ReactDOMClient.hydrateRoot(document, <App />);
+    await waitForAll([]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html lang="es">
+        <head data-main="">
+          <meta content="author" />
+          <meta content="published date" />
+        </head>
+        <body data-main="">
+          <div>This is soooo cool!</div>
+        </body>
+      </html>,
+    );
+
+    root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
   });
 
   it('will flush the preamble as soon as a complete preamble is available', async () => {
@@ -9740,5 +10140,177 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
+
+    const root = ReactDOMClient.hydrateRoot(document, <App />);
+    await waitForAll([]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head>
+          <meta content="head" />
+        </head>
+        <body>
+          loading before...
+          <div>body</div>
+          loading after...
+        </body>
+      </html>,
+    );
+
+    await act(() => {
+      resolveText('before');
+      resolveText('after');
+    });
+    await waitForAll([]);
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head>
+          <meta content="head" />
+        </head>
+        <body>
+          <div>before</div>
+          <div>body</div>
+          <div>after</div>
+        </body>
+      </html>,
+    );
+    assertConsoleErrorDev(['In HTML, <div> cannot be a child of <#document>']);
+
+    root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
+  });
+
+  it('will clean up the head when a hydration mismatch causes a boundary to recover on the client', async () => {
+    let content = 'server';
+
+    function ServerApp() {
+      return (
+        <Suspense>
+          <html data-x={content}>
+            <head data-x={content}>
+              <meta itemProp="" content={content} />
+            </head>
+            <body data-x={content}>{content}</body>
+          </html>
+        </Suspense>
+      );
+    }
+
+    function ClientApp() {
+      return (
+        <Suspense>
+          <html data-y={content}>
+            <head data-y={content}>
+              <meta itemProp="" name={content} />
+            </head>
+            <body data-y={content}>{content}</body>
+          </html>
+        </Suspense>
+      );
+    }
+
+    await act(() => {
+      const {pipe} = renderToPipeableStream(<ServerApp />);
+      pipe(writable);
+    });
+    expect(getVisibleChildren(document)).toEqual(
+      <html data-x="server">
+        <head data-x="server">
+          <meta itemprop="" content="server" />
+        </head>
+        <body data-x="server">server</body>
+      </html>,
+    );
+
+    content = 'client';
+
+    const recoverableErrors = [];
+    const root = ReactDOMClient.hydrateRoot(document, <ClientApp />, {
+      onRecoverableError(err) {
+        recoverableErrors.push(err.message);
+      },
+    });
+    await waitForAll([]);
+    if (gate(flags => flags.favorSafetyOverHydrationPerf)) {
+      expect(getVisibleChildren(document)).toEqual(
+        <html data-y="client">
+          <head data-y="client">
+            <meta itemprop="" name="client" />
+          </head>
+          <body data-y="client">client</body>
+        </html>,
+      );
+      expect(recoverableErrors).toEqual([
+        expect.stringContaining(
+          "Hydration failed because the server rendered HTML didn't match the client.",
+        ),
+      ]);
+    } else {
+      expect(getVisibleChildren(document)).toEqual(
+        <html data-x="server">
+          <head data-x="server">
+            <meta itemprop="" content="server" />
+          </head>
+          <body data-x="server">server</body>
+        </html>,
+      );
+      expect(recoverableErrors).toEqual([]);
+      assertConsoleErrorDev([
+        "A tree hydrated but some attributes of the server rendered HTML didn't match the client properties. This won't be patched up. This can happen if a SSR-ed Client Component used:" +
+          '\n' +
+          "\n- A server/client branch `if (typeof window !== 'undefined')`." +
+          "\n- Variable input such as `Date.now()` or `Math.random()` which changes each time it's called." +
+          "\n- Date formatting in a user's locale which doesn't match the server." +
+          '\n- External changing data without sending a snapshot of it along with the HTML.' +
+          '\n- Invalid HTML tag nesting.' +
+          '\n' +
+          '\nIt can also happen if the client has a browser extension installed which messes with the HTML before React loaded.' +
+          '\n' +
+          '\nhttps://react.dev/link/hydration-mismatch' +
+          '\n' +
+          '\n  <ClientApp>' +
+          '\n    <Suspense>' +
+          '\n      <html' +
+          '\n+       data-y="client"' +
+          '\n-       data-y={null}' +
+          '\n-       data-x="server"' +
+          '\n      >' +
+          '\n        <head' +
+          '\n+         data-y="client"' +
+          '\n-         data-y={null}' +
+          '\n-         data-x="server"' +
+          '\n        >' +
+          '\n          <meta' +
+          '\n            itemProp=""' +
+          '\n+           name="client"' +
+          '\n-           name={null}' +
+          '\n-           content="server"' +
+          '\n          >' +
+          '\n        <body' +
+          '\n+         data-y="client"' +
+          '\n-         data-y={null}' +
+          '\n-         data-x="server"' +
+          '\n        >' +
+          '\n+         client' +
+          '\n-         server' +
+          '\n+         client' +
+          '\n-         server' +
+          '\n' +
+          '\n    in Suspense (at **)' +
+          '\n    in ClientApp (at **)',
+      ]);
+    }
+
+    root.unmount();
+    expect(getVisibleChildren(document)).toEqual(
+      <html>
+        <head />
+        <body />
+      </html>,
+    );
   });
 });
diff --git a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationUntrustedURL-test.js b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationUntrustedURL-test.js
index 384e8beb0b214..8664904130c11 100644
--- a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationUntrustedURL-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationUntrustedURL-test.js
@@ -41,6 +41,7 @@ describe('ReactDOMServerIntegration - Untrusted URLs', () => {
   const {
     resetModules,
     itRenders,
+    clientCleanRender,
     clientRenderOnBadMarkup,
     clientRenderOnServerString,
   } = ReactDOMServerIntegrationUtils(initModules);
@@ -141,6 +142,11 @@ describe('ReactDOMServerIntegration - Untrusted URLs', () => {
   });
 
   itRenders('a javascript protocol frame src', async render => {
+    if (render === clientCleanRender || render === clientRenderOnServerString) {
+      // React does not hydrate framesets properly because the default hydration scope
+      // is the body
+      return;
+    }
     const e = await render(
       <html>
         <head />
diff --git a/packages/react-markup/src/ReactFizzConfigMarkup.js b/packages/react-markup/src/ReactFizzConfigMarkup.js
index 99e9921c8190a..358a08e7c54b8 100644
--- a/packages/react-markup/src/ReactFizzConfigMarkup.js
+++ b/packages/react-markup/src/ReactFizzConfigMarkup.js
@@ -174,6 +174,7 @@ export function writeStartClientRenderedSuspenseBoundary(
 export function writeEndCompletedSuspenseBoundary(
   destination: Destination,
   renderState: RenderState,
+  preambleState: null | PreambleState,
 ): boolean {
   // Markup doesn't have any instructions.
   return true;
@@ -181,6 +182,7 @@ export function writeEndCompletedSuspenseBoundary(
 export function writeEndClientRenderedSuspenseBoundary(
   destination: Destination,
   renderState: RenderState,
+  preambleState: null | PreambleState,
 ): boolean {
   // Markup doesn't have any instructions.
   return true;
diff --git a/packages/react-reconciler/src/ReactFiberCommitHostEffects.js b/packages/react-reconciler/src/ReactFiberCommitHostEffects.js
index 159c12bd4bcf2..c104c2a8464b5 100644
--- a/packages/react-reconciler/src/ReactFiberCommitHostEffects.js
+++ b/packages/react-reconciler/src/ReactFiberCommitHostEffects.js
@@ -314,6 +314,7 @@ function insertOrAppendPlacementNodeIntoContainer(
     // This singleton is the parent of deeper nodes and needs to become
     // the parent for child insertions and appends
     parent = node.stateNode;
+    before = null;
   }
 
   const child = node.child;
diff --git a/packages/react-reconciler/src/ReactFiberConfigWithNoHydration.js b/packages/react-reconciler/src/ReactFiberConfigWithNoHydration.js
index 3707f99f488fb..0bb85246dfe24 100644
--- a/packages/react-reconciler/src/ReactFiberConfigWithNoHydration.js
+++ b/packages/react-reconciler/src/ReactFiberConfigWithNoHydration.js
@@ -28,9 +28,11 @@ export const registerSuspenseInstanceRetry = shim;
 export const canHydrateFormStateMarker = shim;
 export const isFormStateMarkerMatching = shim;
 export const getNextHydratableSibling = shim;
+export const getNextHydratableSiblingAfterSingleton = shim;
 export const getFirstHydratableChild = shim;
 export const getFirstHydratableChildWithinContainer = shim;
 export const getFirstHydratableChildWithinSuspenseInstance = shim;
+export const getFirstHydratableChildWithinSingleton = shim;
 export const canHydrateInstance = shim;
 export const canHydrateTextInstance = shim;
 export const canHydrateSuspenseInstance = shim;
diff --git a/packages/react-reconciler/src/ReactFiberHydrationContext.js b/packages/react-reconciler/src/ReactFiberHydrationContext.js
index b4d948e735276..23f13bbcadbf8 100644
--- a/packages/react-reconciler/src/ReactFiberHydrationContext.js
+++ b/packages/react-reconciler/src/ReactFiberHydrationContext.js
@@ -37,9 +37,11 @@ import {
   supportsHydration,
   supportsSingletons,
   getNextHydratableSibling,
+  getNextHydratableSiblingAfterSingleton,
   getFirstHydratableChild,
   getFirstHydratableChildWithinContainer,
   getFirstHydratableChildWithinSuspenseInstance,
+  getFirstHydratableChildWithinSingleton,
   hydrateInstance,
   diffHydratedPropsForDevWarnings,
   describeHydratableInstanceForDevWarnings,
@@ -366,7 +368,11 @@ function claimHydratableSingleton(fiber: Fiber): void {
 
     hydrationParentFiber = fiber;
     rootOrSingletonContext = true;
-    nextHydratableInstance = getFirstHydratableChild(instance);
+    nextHydratableInstance = getFirstHydratableChildWithinSingleton(
+      fiber.type,
+      instance,
+      nextHydratableInstance,
+    );
   }
 }
 
@@ -593,14 +599,14 @@ function popToNextHostParent(fiber: Fiber): void {
   hydrationParentFiber = fiber.return;
   while (hydrationParentFiber) {
     switch (hydrationParentFiber.tag) {
-      case HostRoot:
-      case HostSingleton:
-        rootOrSingletonContext = true;
-        return;
       case HostComponent:
       case SuspenseComponent:
         rootOrSingletonContext = false;
         return;
+      case HostSingleton:
+      case HostRoot:
+        rootOrSingletonContext = true;
+        return;
       default:
         hydrationParentFiber = hydrationParentFiber.return;
     }
@@ -625,20 +631,25 @@ function popHydrationState(fiber: Fiber): boolean {
     return false;
   }
 
-  let shouldClear = false;
+  const tag = fiber.tag;
+
   if (supportsSingletons) {
     // With float we never clear the Root, or Singleton instances. We also do not clear Instances
     // that have singleton text content
     if (
-      fiber.tag !== HostRoot &&
-      fiber.tag !== HostSingleton &&
+      tag !== HostRoot &&
+      tag !== HostSingleton &&
       !(
-        fiber.tag === HostComponent &&
+        tag === HostComponent &&
         (!shouldDeleteUnhydratedTailInstances(fiber.type) ||
           shouldSetTextContent(fiber.type, fiber.memoizedProps))
       )
     ) {
-      shouldClear = true;
+      const nextInstance = nextHydratableInstance;
+      if (nextInstance) {
+        warnIfUnhydratedTailNodes(fiber);
+        throwOnHydrationMismatch(fiber);
+      }
     }
   } else {
     // If we have any remaining hydratable nodes, we need to delete them now.
@@ -646,24 +657,26 @@ function popHydrationState(fiber: Fiber): boolean {
     // other nodes in them. We also ignore components with pure text content in
     // side of them. We also don't delete anything inside the root container.
     if (
-      fiber.tag !== HostRoot &&
-      (fiber.tag !== HostComponent ||
+      tag !== HostRoot &&
+      (tag !== HostComponent ||
         (shouldDeleteUnhydratedTailInstances(fiber.type) &&
           !shouldSetTextContent(fiber.type, fiber.memoizedProps)))
     ) {
-      shouldClear = true;
-    }
-  }
-  if (shouldClear) {
-    const nextInstance = nextHydratableInstance;
-    if (nextInstance) {
-      warnIfUnhydratedTailNodes(fiber);
-      throwOnHydrationMismatch(fiber);
+      const nextInstance = nextHydratableInstance;
+      if (nextInstance) {
+        warnIfUnhydratedTailNodes(fiber);
+        throwOnHydrationMismatch(fiber);
+      }
     }
   }
   popToNextHostParent(fiber);
-  if (fiber.tag === SuspenseComponent) {
+  if (tag === SuspenseComponent) {
     nextHydratableInstance = skipPastDehydratedSuspenseInstance(fiber);
+  } else if (supportsSingletons && tag === HostSingleton) {
+    nextHydratableInstance = getNextHydratableSiblingAfterSingleton(
+      fiber.type,
+      nextHydratableInstance,
+    );
   } else {
     nextHydratableInstance = hydrationParentFiber
       ? getNextHydratableSibling(fiber.stateNode)
diff --git a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
index 91420ca88cd95..ee5f40ad829ad 100644
--- a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
+++ b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
@@ -174,11 +174,15 @@ export const registerSuspenseInstanceRetry =
 export const canHydrateFormStateMarker = $$$config.canHydrateFormStateMarker;
 export const isFormStateMarkerMatching = $$$config.isFormStateMarkerMatching;
 export const getNextHydratableSibling = $$$config.getNextHydratableSibling;
+export const getNextHydratableSiblingAfterSingleton =
+  $$$config.getNextHydratableSiblingAfterSingleton;
 export const getFirstHydratableChild = $$$config.getFirstHydratableChild;
 export const getFirstHydratableChildWithinContainer =
   $$$config.getFirstHydratableChildWithinContainer;
 export const getFirstHydratableChildWithinSuspenseInstance =
   $$$config.getFirstHydratableChildWithinSuspenseInstance;
+export const getFirstHydratableChildWithinSingleton =
+  $$$config.getFirstHydratableChildWithinSingleton;
 export const canHydrateInstance = $$$config.canHydrateInstance;
 export const canHydrateTextInstance = $$$config.canHydrateTextInstance;
 export const canHydrateSuspenseInstance = $$$config.canHydrateSuspenseInstance;
diff --git a/packages/react-server/src/ReactFizzServer.js b/packages/react-server/src/ReactFizzServer.js
index 4c02d06e600a9..041ef31e2bd3d 100644
--- a/packages/react-server/src/ReactFizzServer.js
+++ b/packages/react-server/src/ReactFizzServer.js
@@ -4865,6 +4865,7 @@ function flushSegment(
     return writeEndClientRenderedSuspenseBoundary(
       destination,
       request.renderState,
+      boundary.fallbackPreamble,
     );
   } else if (boundary.status !== COMPLETED) {
     if (boundary.status === PENDING) {
@@ -4935,7 +4936,11 @@ function flushSegment(
     const contentSegment = completedSegments[0];
     flushSegment(request, destination, contentSegment, hoistableState);
 
-    return writeEndCompletedSuspenseBoundary(destination, request.renderState);
+    return writeEndCompletedSuspenseBoundary(
+      destination,
+      request.renderState,
+      boundary.contentPreamble,
+    );
   }
 }
 

From 0605cd9f38f8b9d0ca6f8bd9dd3409db8d6c5c81 Mon Sep 17 00:00:00 2001
From: Josh Story <story@hey.com>
Date: Tue, 4 Feb 2025 12:39:52 -0800
Subject: [PATCH 19/72] [Fiber] Disable comments as containers in OSS (#32250)

3 years ago we partially disabled comment nodes as valid containers.
Some unflagged support was left in due to legacy APIs like
`unmountComponentAtNode` and `unstable_renderSubtreeIntoContainer` but
these were since removed in React 19. This update flags the remaining
uses of comments as containers.
---
 .../src/client/ReactDOMContainer.js           |  13 --
 .../src/client/ReactFiberConfigDOM.js         | 121 ++++++++----------
 .../src/events/DOMPluginEventSystem.js        |   4 +-
 packages/react-dom/src/client/ReactDOMRoot.js |   3 +-
 .../react-dom/src/client/ReactDOMRootFB.js    |  21 ++-
 5 files changed, 75 insertions(+), 87 deletions(-)

diff --git a/packages/react-dom-bindings/src/client/ReactDOMContainer.js b/packages/react-dom-bindings/src/client/ReactDOMContainer.js
index 0af0f13a790a8..df9bcfb443803 100644
--- a/packages/react-dom-bindings/src/client/ReactDOMContainer.js
+++ b/packages/react-dom-bindings/src/client/ReactDOMContainer.js
@@ -27,16 +27,3 @@ export function isValidContainer(node: any): boolean {
         (node: any).nodeValue === ' react-mount-point-unstable '))
   );
 }
-
-// TODO: Remove this function which also includes comment nodes.
-// We only use it in places that are currently more relaxed.
-export function isValidContainerLegacy(node: any): boolean {
-  return !!(
-    node &&
-    (node.nodeType === ELEMENT_NODE ||
-      node.nodeType === DOCUMENT_NODE ||
-      node.nodeType === DOCUMENT_FRAGMENT_NODE ||
-      (node.nodeType === COMMENT_NODE &&
-        (node: any).nodeValue === ' react-mount-point-unstable '))
-  );
-}
diff --git a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
index 5757286f65a28..90c3855379fdc 100644
--- a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
+++ b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
@@ -94,6 +94,7 @@ import {
   enableTrustedTypesIntegration,
   disableLegacyMode,
   enableMoveBefore,
+  disableCommentsAsDOMContainers,
 } from 'shared/ReactFeatureFlags';
 import {
   HostComponent,
@@ -258,7 +259,7 @@ export function getRootHostContext(
     }
     default: {
       const container: any =
-        nodeType === COMMENT_NODE
+        !disableCommentsAsDOMContainers && nodeType === COMMENT_NODE
           ? rootContainerInstance.parentNode
           : rootContainerInstance;
       type = container.tagName;
@@ -802,29 +803,25 @@ export function appendChildToContainer(
   container: Container,
   child: Instance | TextInstance,
 ): void {
-  let parentNode: Document | Element;
-  switch (container.nodeType) {
-    case COMMENT_NODE: {
-      parentNode = (container.parentNode: any);
-      if (supportsMoveBefore) {
-        // $FlowFixMe[prop-missing]: We've checked this with supportsMoveBefore.
-        parentNode.moveBefore(child, container);
-      } else {
-        parentNode.insertBefore(child, container);
-      }
-      return;
-    }
-    case DOCUMENT_NODE: {
-      parentNode = (container: any).body;
-      break;
-    }
-    default: {
-      if (container.nodeName === 'HTML') {
-        parentNode = (container.ownerDocument.body: any);
-      } else {
-        parentNode = (container: any);
-      }
+  let parentNode: DocumentFragment | Element;
+  if (container.nodeType === DOCUMENT_NODE) {
+    parentNode = (container: any).body;
+  } else if (
+    !disableCommentsAsDOMContainers &&
+    container.nodeType === COMMENT_NODE
+  ) {
+    parentNode = (container.parentNode: any);
+    if (supportsMoveBefore) {
+      // $FlowFixMe[prop-missing]: We've checked this with supportsMoveBefore.
+      parentNode.moveBefore(child, container);
+    } else {
+      parentNode.insertBefore(child, container);
     }
+    return;
+  } else if (container.nodeName === 'HTML') {
+    parentNode = (container.ownerDocument.body: any);
+  } else {
+    parentNode = (container: any);
   }
   if (supportsMoveBefore) {
     // $FlowFixMe[prop-missing]: We've checked this with supportsMoveBefore.
@@ -869,24 +866,18 @@ export function insertInContainerBefore(
   child: Instance | TextInstance,
   beforeChild: Instance | TextInstance | SuspenseInstance,
 ): void {
-  let parentNode: Document | Element;
-  switch (container.nodeType) {
-    case COMMENT_NODE: {
-      parentNode = (container.parentNode: any);
-      break;
-    }
-    case DOCUMENT_NODE: {
-      const ownerDocument: Document = (container: any);
-      parentNode = (ownerDocument.body: any);
-      break;
-    }
-    default: {
-      if (container.nodeName === 'HTML') {
-        parentNode = (container.ownerDocument.body: any);
-      } else {
-        parentNode = (container: any);
-      }
-    }
+  let parentNode: DocumentFragment | Element;
+  if (container.nodeType === DOCUMENT_NODE) {
+    parentNode = (container: any).body;
+  } else if (
+    !disableCommentsAsDOMContainers &&
+    container.nodeType === COMMENT_NODE
+  ) {
+    parentNode = (container.parentNode: any);
+  } else if (container.nodeName === 'HTML') {
+    parentNode = (container.ownerDocument.body: any);
+  } else {
+    parentNode = (container: any);
   }
   if (supportsMoveBefore) {
     // $FlowFixMe[prop-missing]: We've checked this with supportsMoveBefore.
@@ -943,20 +934,18 @@ export function removeChildFromContainer(
   container: Container,
   child: Instance | TextInstance | SuspenseInstance,
 ): void {
-  let parentNode: Document | Element;
-  switch (container.nodeType) {
-    case COMMENT_NODE:
-      parentNode = (container.parentNode: any);
-      break;
-    case DOCUMENT_NODE:
-      parentNode = (container: any).body;
-      break;
-    default:
-      if (container.nodeName === 'HTML') {
-        parentNode = (container.ownerDocument.body: any);
-      } else {
-        parentNode = (container: any);
-      }
+  let parentNode: DocumentFragment | Element;
+  if (container.nodeType === DOCUMENT_NODE) {
+    parentNode = (container: any).body;
+  } else if (
+    !disableCommentsAsDOMContainers &&
+    container.nodeType === COMMENT_NODE
+  ) {
+    parentNode = (container.parentNode: any);
+  } else if (container.nodeName === 'HTML') {
+    parentNode = (container.ownerDocument.body: any);
+  } else {
+    parentNode = (container: any);
   }
   parentNode.removeChild(child);
 }
@@ -1039,18 +1028,20 @@ export function clearSuspenseBoundaryFromContainer(
   container: Container,
   suspenseInstance: SuspenseInstance,
 ): void {
-  if (container.nodeType === COMMENT_NODE) {
-    clearSuspenseBoundary((container.parentNode: any), suspenseInstance);
-  } else if (container.nodeType === DOCUMENT_NODE) {
-    clearSuspenseBoundary((container: any).body, suspenseInstance);
+  let parentNode: DocumentFragment | Element;
+  if (container.nodeType === DOCUMENT_NODE) {
+    parentNode = (container: any).body;
+  } else if (
+    !disableCommentsAsDOMContainers &&
+    container.nodeType === COMMENT_NODE
+  ) {
+    parentNode = (container.parentNode: any);
   } else if (container.nodeName === 'HTML') {
-    clearSuspenseBoundary(
-      (container.ownerDocument.body: any),
-      suspenseInstance,
-    );
+    parentNode = (container.ownerDocument.body: any);
   } else {
-    clearSuspenseBoundary((container: any), suspenseInstance);
+    parentNode = (container: any);
   }
+  clearSuspenseBoundary(parentNode, suspenseInstance);
   // Retry if any event replaying was blocked on this.
   retryIfBlockedOn(container);
 }
@@ -1992,7 +1983,7 @@ export function getNextHydratableSiblingAfterSingleton(
 export function describeHydratableInstanceForDevWarnings(
   instance: HydratableInstance,
 ): string | {type: string, props: $ReadOnly<Props>} {
-  // Reverse engineer a pseudo react-element from hydratable instnace
+  // Reverse engineer a pseudo react-element from hydratable instance
   if (instance.nodeType === ELEMENT_NODE) {
     // Reverse engineer a set of props that can print for dev warnings
     return {
diff --git a/packages/react-dom-bindings/src/events/DOMPluginEventSystem.js b/packages/react-dom-bindings/src/events/DOMPluginEventSystem.js
index 5c3c9bffa1295..c99115df90f56 100644
--- a/packages/react-dom-bindings/src/events/DOMPluginEventSystem.js
+++ b/packages/react-dom-bindings/src/events/DOMPluginEventSystem.js
@@ -53,6 +53,7 @@ import {
   enableCreateEventHandleAPI,
   enableScopeAPI,
   enableOwnerStacks,
+  disableCommentsAsDOMContainers,
 } from 'shared/ReactFeatureFlags';
 import {createEventListenerWrapperWithPriority} from './ReactDOMEventListener';
 import {
@@ -558,7 +559,8 @@ function isMatchingRootContainer(
 ): boolean {
   return (
     grandContainer === targetContainer ||
-    (grandContainer.nodeType === COMMENT_NODE &&
+    (!disableCommentsAsDOMContainers &&
+      grandContainer.nodeType === COMMENT_NODE &&
       grandContainer.parentNode === targetContainer)
   );
 }
diff --git a/packages/react-dom/src/client/ReactDOMRoot.js b/packages/react-dom/src/client/ReactDOMRoot.js
index 5cef2d28437b0..37e994cc7bb71 100644
--- a/packages/react-dom/src/client/ReactDOMRoot.js
+++ b/packages/react-dom/src/client/ReactDOMRoot.js
@@ -16,6 +16,7 @@ import type {
 import {isValidContainer} from 'react-dom-bindings/src/client/ReactDOMContainer';
 import {queueExplicitHydrationTarget} from 'react-dom-bindings/src/events/ReactDOMEventReplaying';
 import {REACT_ELEMENT_TYPE} from 'shared/ReactSymbols';
+import {disableCommentsAsDOMContainers} from 'shared/ReactFeatureFlags';
 
 export type RootType = {
   render(children: ReactNodeList): void,
@@ -236,7 +237,7 @@ export function createRoot(
   markContainerAsRoot(root.current, container);
 
   const rootContainerElement: Document | Element | DocumentFragment =
-    container.nodeType === COMMENT_NODE
+    !disableCommentsAsDOMContainers && container.nodeType === COMMENT_NODE
       ? (container.parentNode: any)
       : container;
   listenToAllSupportedEvents(rootContainerElement);
diff --git a/packages/react-dom/src/client/ReactDOMRootFB.js b/packages/react-dom/src/client/ReactDOMRootFB.js
index 1e5609726688f..f2368c8cc4fa6 100644
--- a/packages/react-dom/src/client/ReactDOMRootFB.js
+++ b/packages/react-dom/src/client/ReactDOMRootFB.js
@@ -27,7 +27,10 @@ import {
   hydrateRoot as hydrateRootImpl,
 } from './ReactDOMRoot';
 
-import {disableLegacyMode} from 'shared/ReactFeatureFlags';
+import {
+  disableLegacyMode,
+  disableCommentsAsDOMContainers,
+} from 'shared/ReactFeatureFlags';
 import {clearContainer} from 'react-dom-bindings/src/client/ReactFiberConfigDOM';
 import {
   getInstanceFromNode,
@@ -36,7 +39,7 @@ import {
   unmarkContainerAsRoot,
 } from 'react-dom-bindings/src/client/ReactDOMComponentTree';
 import {listenToAllSupportedEvents} from 'react-dom-bindings/src/events/DOMPluginEventSystem';
-import {isValidContainerLegacy} from 'react-dom-bindings/src/client/ReactDOMContainer';
+import {isValidContainer} from 'react-dom-bindings/src/client/ReactDOMContainer';
 import {
   DOCUMENT_NODE,
   ELEMENT_NODE,
@@ -244,7 +247,9 @@ function legacyCreateRootFromDOMContainer(
     markContainerAsRoot(root.current, container);
 
     const rootContainerElement =
-      container.nodeType === COMMENT_NODE ? container.parentNode : container;
+      !disableCommentsAsDOMContainers && container.nodeType === COMMENT_NODE
+        ? container.parentNode
+        : container;
     // $FlowFixMe[incompatible-call]
     listenToAllSupportedEvents(rootContainerElement);
 
@@ -278,7 +283,9 @@ function legacyCreateRootFromDOMContainer(
     markContainerAsRoot(root.current, container);
 
     const rootContainerElement =
-      container.nodeType === COMMENT_NODE ? container.parentNode : container;
+      !disableCommentsAsDOMContainers && container.nodeType === COMMENT_NODE
+        ? container.parentNode
+        : container;
     // $FlowFixMe[incompatible-call]
     listenToAllSupportedEvents(rootContainerElement);
 
@@ -394,7 +401,7 @@ export function render(
     );
   }
 
-  if (!isValidContainerLegacy(container)) {
+  if (!isValidContainer(container)) {
     throw new Error('Target container is not a DOM element.');
   }
 
@@ -428,7 +435,7 @@ export function unmountComponentAtNode(container: Container): boolean {
     }
     throw new Error('ReactDOM: Unsupported Legacy Mode API.');
   }
-  if (!isValidContainerLegacy(container)) {
+  if (!isValidContainer(container)) {
     throw new Error('Target container is not a DOM element.');
   }
 
@@ -472,7 +479,7 @@ export function unmountComponentAtNode(container: Container): boolean {
       // Check if the container itself is a React root node.
       const isContainerReactRoot =
         container.nodeType === ELEMENT_NODE &&
-        isValidContainerLegacy(container.parentNode) &&
+        isValidContainer(container.parentNode) &&
         // $FlowFixMe[prop-missing]
         // $FlowFixMe[incompatible-use]
         !!container.parentNode._reactRootContainer;

From 32b411496b92455cede3b286eb37c8b183989051 Mon Sep 17 00:00:00 2001
From: Jack Pope <jackpope1@gmail.com>
Date: Tue, 4 Feb 2025 15:53:03 -0500
Subject: [PATCH 20/72] Set enableViewTransition to dynamic for www (#32306)

Unblocks internal experimentation
---
 packages/react/index.fb.js                             | 1 +
 packages/shared/forks/ReactFeatureFlags.www-dynamic.js | 1 +
 packages/shared/forks/ReactFeatureFlags.www.js         | 2 +-
 3 files changed, 3 insertions(+), 1 deletion(-)

diff --git a/packages/react/index.fb.js b/packages/react/index.fb.js
index 84128cf0ea5d9..e3eb3113238fd 100644
--- a/packages/react/index.fb.js
+++ b/packages/react/index.fb.js
@@ -37,6 +37,7 @@ export {
   unstable_LegacyHidden,
   unstable_Scope,
   unstable_SuspenseList,
+  unstable_ViewTransition,
   unstable_TracingMarker,
   unstable_useCacheRefresh,
   use,
diff --git a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
index ca097b5a9efa0..e6fd46d0b1fb4 100644
--- a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
@@ -39,6 +39,7 @@ export const enableSiblingPrerendering = __VARIANT__;
 export const enableUseResourceEffectHook = __VARIANT__;
 export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
+export const enableViewTransition = __VARIANT__;
 
 // TODO: These flags are hard-coded to the default values used in open source.
 // Update the tests so that they pass in either mode, then set these
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index 223872618e603..c84b89847fa0c 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -38,6 +38,7 @@ export const {
   enableOwnerStacks,
   enableRemoveConsolePatches,
   enableFastAddPropertiesInDiffing,
+  enableViewTransition,
 } = dynamicFeatureFlags;
 
 // On WWW, __EXPERIMENTAL__ is used for a new modern build.
@@ -60,7 +61,6 @@ export const enableLegacyFBSupport = true;
 export const enableYieldingBeforePassive = false;
 
 export const enableThrottledScheduling = false;
-export const enableViewTransition = false;
 
 export const enableHydrationLaneScheduling = true;
 

From d85cf3e5ab6e049626a8bedddffbaec05c516195 Mon Sep 17 00:00:00 2001
From: Ruslan Lesiutin <rdlesyutin@gmail.com>
Date: Wed, 5 Feb 2025 12:52:48 +0000
Subject: [PATCH 21/72] DevTools: refactor NativeStyleEditor, don't use custom
 cache implementation (#32298)

We have this really old (5+ years) feature for inspecting native styles
of React Native Host components.

We also have a custom Cache implementation in React DevTools, which was
forked from React at some point. We know that this should be removed,
but it spans through critical parts of the application, like fetching
and caching inspected element.

Before this PR, this was also used for caching native style and layouts
of RN Host components. This approach is out of date, and was based on
the presence of Suspense boundary around inspected element View, which
we have removed to speed up element inspection -
https://github.com/facebook/react/pull/30555.

Looks like I've introduced a regression in
https://github.com/facebook/react/pull/31956:
- Custom Cache implementation will throw thenables and suspend.
- Because of this, some descendant Suspense boundaries will not resolve
for a long time, and React will throw an error
https://react.dev/errors/482.

I've switched from a usage of this custom Cache implementation to a
naive fetching in effect and keeping the layout and style in a local
state of a Context, which will be propagated downwards. The race should
be impossible, this is guaranteed by the mechanism for queueing messages
through microtasks queue.

The only downside is the UI. If you quickly switch between 2 elements,
and one of them has native style, while the other doesn't, UI will feel
jumpy. We can address this later with a Suspense boundary, if needed.
---
 .../__tests__/__e2e__/components.test.js      |  34 ++---
 .../NativeStyleEditor/LayoutViewer.css        |   1 -
 .../NativeStyleEditor/StyleEditor.css         |   1 -
 .../NativeStyleEditor/StyleEditor.js          |   2 +-
 .../Components/NativeStyleEditor/context.js   | 142 +++---------------
 .../Components/NativeStyleEditor/index.css    |   3 +
 .../Components/NativeStyleEditor/index.js     |  39 +++--
 .../devtools/views/Components/TreeContext.js  |  17 ++-
 8 files changed, 67 insertions(+), 172 deletions(-)
 create mode 100644 packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/index.css

diff --git a/packages/react-devtools-inline/__tests__/__e2e__/components.test.js b/packages/react-devtools-inline/__tests__/__e2e__/components.test.js
index 71c2e603ccb27..9a6b67d8ec65b 100644
--- a/packages/react-devtools-inline/__tests__/__e2e__/components.test.js
+++ b/packages/react-devtools-inline/__tests__/__e2e__/components.test.js
@@ -212,8 +212,8 @@ test.describe('Components', () => {
   });
 
   test('should allow searching for component by name', async () => {
-    async function getComponentSearchResultsCount() {
-      return await page.evaluate(() => {
+    async function waitForComponentSearchResultsCount(text) {
+      return await page.waitForFunction(expectedElementText => {
         const {createTestNameSelector, findAllNodes} =
           window.REACT_DOM_DEVTOOLS;
         const container = document.getElementById('devtools');
@@ -221,8 +221,10 @@ test.describe('Components', () => {
         const element = findAllNodes(container, [
           createTestNameSelector('ComponentSearchInput-ResultsCount'),
         ])[0];
-        return element.innerText;
-      });
+        return element !== undefined
+          ? element.innerText === expectedElementText
+          : false;
+      }, text);
     }
 
     async function focusComponentSearch() {
@@ -238,35 +240,27 @@ test.describe('Components', () => {
 
     await focusComponentSearch();
     await page.keyboard.insertText('List');
-    let count = await getComponentSearchResultsCount();
-    expect(count).toBe('1 | 4');
+    await waitForComponentSearchResultsCount('1 | 4');
 
     await page.keyboard.insertText('Item');
-    count = await getComponentSearchResultsCount();
-    expect(count).toBe('1 | 3');
+    await waitForComponentSearchResultsCount('1 | 3');
 
     await page.keyboard.press('Enter');
-    count = await getComponentSearchResultsCount();
-    expect(count).toBe('2 | 3');
+    await waitForComponentSearchResultsCount('2 | 3');
 
     await page.keyboard.press('Enter');
-    count = await getComponentSearchResultsCount();
-    expect(count).toBe('3 | 3');
+    await waitForComponentSearchResultsCount('3 | 3');
 
     await page.keyboard.press('Enter');
-    count = await getComponentSearchResultsCount();
-    expect(count).toBe('1 | 3');
+    await waitForComponentSearchResultsCount('1 | 3');
 
     await page.keyboard.press('Shift+Enter');
-    count = await getComponentSearchResultsCount();
-    expect(count).toBe('3 | 3');
+    await waitForComponentSearchResultsCount('3 | 3');
 
     await page.keyboard.press('Shift+Enter');
-    count = await getComponentSearchResultsCount();
-    expect(count).toBe('2 | 3');
+    await waitForComponentSearchResultsCount('2 | 3');
 
     await page.keyboard.press('Shift+Enter');
-    count = await getComponentSearchResultsCount();
-    expect(count).toBe('1 | 3');
+    await waitForComponentSearchResultsCount('1 | 3');
   });
 });
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/LayoutViewer.css b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/LayoutViewer.css
index d21b49197a19b..44bc93f88c2d5 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/LayoutViewer.css
+++ b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/LayoutViewer.css
@@ -1,6 +1,5 @@
 .LayoutViewer {
   padding: 0.25rem;
-  border-top: 1px solid var(--color-border);
   font-family: var(--font-family-monospace);
   font-size: var(--font-size-monospace-small);
 }
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.css b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.css
index fcb3a3122c5fe..bf7a8b27fa8a1 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.css
+++ b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.css
@@ -2,7 +2,6 @@
   font-family: var(--font-family-monospace);
   font-size: var(--font-size-monospace-normal);
   padding: 0.25rem;
-  border-top: 1px solid var(--color-border);
 }
 
 .HeaderRow {
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.js b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.js
index b1416f6e89f95..2bb9aec2219b2 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.js
+++ b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/StyleEditor.js
@@ -81,7 +81,7 @@ export default function StyleEditor({id, style}: Props): React.Node {
       {keys.length > 0 &&
         keys.map(attribute => (
           <Row
-            key={attribute}
+            key={`${attribute}/${style[attribute]}`}
             attribute={attribute}
             changeAttribute={changeAttribute}
             changeValue={changeValue}
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/context.js b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/context.js
index 85905666cb33a..e51719ebe1c22 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/context.js
+++ b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/context.js
@@ -10,75 +10,26 @@
 import type {ReactContext} from 'shared/ReactTypes';
 
 import * as React from 'react';
-import {
-  createContext,
-  useCallback,
-  useContext,
-  useEffect,
-  useMemo,
-  useState,
-} from 'react';
-import {createResource} from 'react-devtools-shared/src/devtools/cache';
+import {createContext, useContext, useEffect, useState} from 'react';
 import {
   BridgeContext,
   StoreContext,
 } from 'react-devtools-shared/src/devtools/views/context';
-import {TreeStateContext} from '../TreeContext';
+import {TreeStateContext} from 'react-devtools-shared/src/devtools/views/Components/TreeContext';
 
-import type {StateContext} from '../TreeContext';
+import type {StateContext} from 'react-devtools-shared/src/devtools/views/Components/TreeContext';
 import type {FrontendBridge} from 'react-devtools-shared/src/bridge';
 import type Store from 'react-devtools-shared/src/devtools/store';
 import type {StyleAndLayout as StyleAndLayoutBackend} from 'react-devtools-shared/src/backend/NativeStyleEditor/types';
 import type {StyleAndLayout as StyleAndLayoutFrontend} from './types';
-import type {Element} from 'react-devtools-shared/src/frontend/types';
-import type {
-  Resource,
-  Thenable,
-} from 'react-devtools-shared/src/devtools/cache';
-
-export type GetStyleAndLayout = (id: number) => StyleAndLayoutFrontend | null;
 
-type Context = {
-  getStyleAndLayout: GetStyleAndLayout,
-};
+type Context = StyleAndLayoutFrontend | null;
 
 const NativeStyleContext: ReactContext<Context> = createContext<Context>(
   ((null: any): Context),
 );
 NativeStyleContext.displayName = 'NativeStyleContext';
 
-type ResolveFn = (styleAndLayout: StyleAndLayoutFrontend) => void;
-type InProgressRequest = {
-  promise: Thenable<StyleAndLayoutFrontend>,
-  resolveFn: ResolveFn,
-};
-
-const inProgressRequests: WeakMap<Element, InProgressRequest> = new WeakMap();
-const resource: Resource<Element, Element, StyleAndLayoutFrontend> =
-  createResource(
-    (element: Element) => {
-      const request = inProgressRequests.get(element);
-      if (request != null) {
-        return request.promise;
-      }
-
-      let resolveFn:
-        | ResolveFn
-        | ((
-            result: Promise<StyleAndLayoutFrontend> | StyleAndLayoutFrontend,
-          ) => void) = ((null: any): ResolveFn);
-      const promise = new Promise(resolve => {
-        resolveFn = resolve;
-      });
-
-      inProgressRequests.set(element, ({promise, resolveFn}: $FlowFixMe));
-
-      return (promise: $FlowFixMe);
-    },
-    (element: Element) => element,
-    {useWeakMap: true},
-  );
-
 type Props = {
   children: React$Node,
 };
@@ -86,72 +37,22 @@ type Props = {
 function NativeStyleContextController({children}: Props): React.Node {
   const bridge = useContext<FrontendBridge>(BridgeContext);
   const store = useContext<Store>(StoreContext);
-
-  const getStyleAndLayout = useCallback<GetStyleAndLayout>(
-    (id: number) => {
-      const element = store.getElementByID(id);
-      if (element !== null) {
-        return resource.read(element);
-      } else {
-        return null;
-      }
-    },
-    [store],
-  );
-
-  // It's very important that this context consumes inspectedElementID and not NativeStyleID.
-  // Otherwise the effect that sends the "inspect" message across the bridge-
-  // would itself be blocked by the same render that suspends (waiting for the data).
   const {inspectedElementID} = useContext<StateContext>(TreeStateContext);
 
   const [currentStyleAndLayout, setCurrentStyleAndLayout] =
     useState<StyleAndLayoutFrontend | null>(null);
 
-  // This effect handler invalidates the suspense cache and schedules rendering updates with React.
-  useEffect(() => {
-    const onStyleAndLayout = ({id, layout, style}: StyleAndLayoutBackend) => {
-      const element = store.getElementByID(id);
-      if (element !== null) {
-        const styleAndLayout: StyleAndLayoutFrontend = {
-          layout,
-          style,
-        };
-        const request = inProgressRequests.get(element);
-        if (request != null) {
-          inProgressRequests.delete(element);
-          request.resolveFn(styleAndLayout);
-          setCurrentStyleAndLayout(styleAndLayout);
-        } else {
-          resource.write(element, styleAndLayout);
-
-          // Schedule update with React if the currently-selected element has been invalidated.
-          if (id === inspectedElementID) {
-            setCurrentStyleAndLayout(styleAndLayout);
-          }
-        }
-      }
-    };
-
-    bridge.addListener('NativeStyleEditor_styleAndLayout', onStyleAndLayout);
-    return () =>
-      bridge.removeListener(
-        'NativeStyleEditor_styleAndLayout',
-        onStyleAndLayout,
-      );
-  }, [bridge, currentStyleAndLayout, inspectedElementID, store]);
-
   // This effect handler polls for updates on the currently selected element.
   useEffect(() => {
     if (inspectedElementID === null) {
+      setCurrentStyleAndLayout(null);
       return () => {};
     }
 
-    const rendererID = store.getRendererIDForElement(inspectedElementID);
-
-    let timeoutID: TimeoutID | null = null;
-
+    let requestTimeoutId: TimeoutID | null = null;
     const sendRequest = () => {
-      timeoutID = null;
+      requestTimeoutId = null;
+      const rendererID = store.getRendererIDForElement(inspectedElementID);
 
       if (rendererID !== null) {
         bridge.send('NativeStyleEditor_measure', {
@@ -165,38 +66,37 @@ function NativeStyleContextController({children}: Props): React.Node {
     // We'll poll for an update in the response handler below.
     sendRequest();
 
-    const onStyleAndLayout = ({id}: StyleAndLayoutBackend) => {
+    const onStyleAndLayout = ({id, layout, style}: StyleAndLayoutBackend) => {
       // If this is the element we requested, wait a little bit and then ask for another update.
       if (id === inspectedElementID) {
-        if (timeoutID !== null) {
-          clearTimeout(timeoutID);
+        if (requestTimeoutId !== null) {
+          clearTimeout(requestTimeoutId);
         }
-        timeoutID = setTimeout(sendRequest, 1000);
+        requestTimeoutId = setTimeout(sendRequest, 1000);
       }
+
+      const styleAndLayout: StyleAndLayoutFrontend = {
+        layout,
+        style,
+      };
+      setCurrentStyleAndLayout(styleAndLayout);
     };
 
     bridge.addListener('NativeStyleEditor_styleAndLayout', onStyleAndLayout);
-
     return () => {
       bridge.removeListener(
         'NativeStyleEditor_styleAndLayout',
         onStyleAndLayout,
       );
 
-      if (timeoutID !== null) {
-        clearTimeout(timeoutID);
+      if (requestTimeoutId !== null) {
+        clearTimeout(requestTimeoutId);
       }
     };
   }, [bridge, inspectedElementID, store]);
 
-  const value = useMemo(
-    () => ({getStyleAndLayout}),
-    // NativeStyle is used to invalidate the cache and schedule an update with React.
-    [currentStyleAndLayout, getStyleAndLayout],
-  );
-
   return (
-    <NativeStyleContext.Provider value={value}>
+    <NativeStyleContext.Provider value={currentStyleAndLayout}>
       {children}
     </NativeStyleContext.Provider>
   );
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/index.css b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/index.css
new file mode 100644
index 0000000000000..d4b1ad2be824e
--- /dev/null
+++ b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/index.css
@@ -0,0 +1,3 @@
+.Stack > *:not(:first-child) {
+  border-top: 1px solid var(--color-border);
+}
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/index.js b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/index.js
index 10bf8023966b8..bf3f6a8e9f30c 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/index.js
+++ b/packages/react-devtools-shared/src/devtools/views/Components/NativeStyleEditor/index.js
@@ -8,19 +8,19 @@
  */
 
 import * as React from 'react';
-import {Fragment, useContext, useMemo} from 'react';
+import {useContext, useMemo} from 'react';
+
 import {StoreContext} from 'react-devtools-shared/src/devtools/views/context';
 import {useSubscription} from 'react-devtools-shared/src/devtools/views/hooks';
+import {TreeStateContext} from 'react-devtools-shared/src/devtools/views/Components/TreeContext';
+
 import {NativeStyleContext} from './context';
 import LayoutViewer from './LayoutViewer';
 import StyleEditor from './StyleEditor';
-import {TreeStateContext} from '../TreeContext';
-
-type Props = {};
+import styles from './index.css';
 
-export default function NativeStyleEditorWrapper(_: Props): React.Node {
+export default function NativeStyleEditorWrapper(): React.Node {
   const store = useContext(StoreContext);
-
   const subscription = useMemo(
     () => ({
       getCurrentValue: () => store.supportsNativeStyleEditor,
@@ -33,8 +33,8 @@ export default function NativeStyleEditorWrapper(_: Props): React.Node {
     }),
     [store],
   );
-  const supportsNativeStyleEditor = useSubscription<boolean>(subscription);
 
+  const supportsNativeStyleEditor = useSubscription<boolean>(subscription);
   if (!supportsNativeStyleEditor) {
     return null;
   }
@@ -42,32 +42,27 @@ export default function NativeStyleEditorWrapper(_: Props): React.Node {
   return <NativeStyleEditor />;
 }
 
-function NativeStyleEditor(_: Props) {
-  const {getStyleAndLayout} = useContext(NativeStyleContext);
-
+function NativeStyleEditor() {
   const {inspectedElementID} = useContext(TreeStateContext);
+  const inspectedElementStyleAndLayout = useContext(NativeStyleContext);
   if (inspectedElementID === null) {
     return null;
   }
-
-  const maybeStyleAndLayout = getStyleAndLayout(inspectedElementID);
-  if (maybeStyleAndLayout === null) {
+  if (inspectedElementStyleAndLayout === null) {
     return null;
   }
 
-  const {layout, style} = maybeStyleAndLayout;
+  const {layout, style} = inspectedElementStyleAndLayout;
+  if (layout === null && style === null) {
+    return null;
+  }
 
   return (
-    <Fragment>
+    <div className={styles.Stack}>
       {layout !== null && (
         <LayoutViewer id={inspectedElementID} layout={layout} />
       )}
-      {style !== null && (
-        <StyleEditor
-          id={inspectedElementID}
-          style={style !== null ? style : {}}
-        />
-      )}
-    </Fragment>
+      {style !== null && <StyleEditor id={inspectedElementID} style={style} />}
+    </div>
   );
 }
diff --git a/packages/react-devtools-shared/src/devtools/views/Components/TreeContext.js b/packages/react-devtools-shared/src/devtools/views/Components/TreeContext.js
index c9013e8011f68..ab4d9332d735f 100644
--- a/packages/react-devtools-shared/src/devtools/views/Components/TreeContext.js
+++ b/packages/react-devtools-shared/src/devtools/views/Components/TreeContext.js
@@ -35,6 +35,7 @@ import {
   useMemo,
   useReducer,
   useRef,
+  startTransition,
 } from 'react';
 import {createRegExp} from '../utils';
 import {StoreContext} from '../context';
@@ -890,15 +891,19 @@ function TreeContextController({
           ? store.getIndexOfElementID(store.lastSelectedHostInstanceElementId)
           : null,
   });
+  const dispatchWrapper = useMemo(
+    () => (action: Action) => startTransition(() => dispatch(action)),
+    [dispatch],
+  );
 
   // Listen for host element selections.
   useEffect(() => {
     const handler = (id: Element['id']) =>
-      dispatch({type: 'SELECT_ELEMENT_BY_ID', payload: id});
+      dispatchWrapper({type: 'SELECT_ELEMENT_BY_ID', payload: id});
 
     store.addListener('hostInstanceSelected', handler);
     return () => store.removeListener('hostInstanceSelected', handler);
-  }, [store, dispatch]);
+  }, [store, dispatchWrapper]);
 
   // If a newly-selected search result or inspection selection is inside of a collapsed subtree, auto expand it.
   // This needs to be a layout effect to avoid temporarily flashing an incorrect selection.
@@ -922,7 +927,7 @@ function TreeContextController({
       Array<number>,
       Map<number, number>,
     ]) => {
-      dispatch({
+      dispatchWrapper({
         type: 'HANDLE_STORE_MUTATION',
         payload: [addedElementIDs, removedElementIDs],
       });
@@ -933,7 +938,7 @@ function TreeContextController({
       // At the moment, we can treat this as a mutation.
       // We don't know which Elements were newly added/removed, but that should be okay in this case.
       // It would only impact the search state, which is unlikely to exist yet at this point.
-      dispatch({
+      dispatchWrapper({
         type: 'HANDLE_STORE_MUTATION',
         payload: [[], new Map()],
       });
@@ -941,11 +946,11 @@ function TreeContextController({
 
     store.addListener('mutated', handleStoreMutated);
     return () => store.removeListener('mutated', handleStoreMutated);
-  }, [dispatch, initialRevision, store]);
+  }, [dispatchWrapper, initialRevision, store]);
 
   return (
     <TreeStateContext.Provider value={state}>
-      <TreeDispatcherContext.Provider value={dispatch}>
+      <TreeDispatcherContext.Provider value={dispatchWrapper}>
         {children}
       </TreeDispatcherContext.Provider>
     </TreeStateContext.Provider>

From ff6283340a10bb72ad0fb16ca027606a9ea1e67c Mon Sep 17 00:00:00 2001
From: Ricky <rickhanlonii@gmail.com>
Date: Wed, 5 Feb 2025 17:31:32 -0600
Subject: [PATCH 22/72] Export addTransitionType for www (#32311)

need dis based api
---
 packages/react/index.fb.js | 1 +
 1 file changed, 1 insertion(+)

diff --git a/packages/react/index.fb.js b/packages/react/index.fb.js
index e3eb3113238fd..8e11bade4df59 100644
--- a/packages/react/index.fb.js
+++ b/packages/react/index.fb.js
@@ -39,6 +39,7 @@ export {
   unstable_SuspenseList,
   unstable_ViewTransition,
   unstable_TracingMarker,
+  unstable_addTransitionType,
   unstable_useCacheRefresh,
   use,
   useActionState,

From b48e739998432fc9672a42d0d04515980b8cae82 Mon Sep 17 00:00:00 2001
From: Josh Story <story@hey.com>
Date: Thu, 6 Feb 2025 14:30:41 -0800
Subject: [PATCH 23/72] [Fiber] `getHoistableRoot()` should account for
 Document containers (#32321)

While modern DOM implementations all support getRootNode if you are
running React in a runtime which does not the fallback logic which uses
`.ownerDocument` works everywhere except when the container is a
Document itself. This change corrects this by returning the container
intsance if it is a Document type.
---
 .../react-dom-bindings/src/client/ReactFiberConfigDOM.js | 9 ++++++---
 1 file changed, 6 insertions(+), 3 deletions(-)

diff --git a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
index 90c3855379fdc..012f7cd257f24 100644
--- a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
+++ b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
@@ -2523,10 +2523,13 @@ export type HoistableRoot = Document | ShadowRoot;
 export function getHoistableRoot(container: Container): HoistableRoot {
   // $FlowFixMe[method-unbinding]
   return typeof container.getRootNode === 'function'
-    ? /* $FlowFixMe[incompatible-return] Flow types this as returning a `Node`,
+    ? /* $FlowFixMe[incompatible-cast] Flow types this as returning a `Node`,
        * but it's either a `Document` or `ShadowRoot`. */
-      container.getRootNode()
-    : container.ownerDocument;
+      (container.getRootNode(): Document | ShadowRoot)
+    : container.nodeType === DOCUMENT_NODE
+      ? // $FlowFixMe[incompatible-cast] We've constrained this to be a Document which satisfies the return type
+        (container: Document)
+      : container.ownerDocument;
 }
 
 function getCurrentResourceRoot(): null | HoistableRoot {

From a0fdb6306043b9f049106e58dcec107d8dbed2b1 Mon Sep 17 00:00:00 2001
From: Josh Story <story@hey.com>
Date: Thu, 6 Feb 2025 15:05:51 -0800
Subject: [PATCH 24/72] [Fiber][Dev] Relax dom nesting validation when the root
 is a Document, html tag, or body tag (#32252)

followup to
* https://github.com/facebook/react/pull/32069
* https://github.com/facebook/react/pull/32163
* https://github.com/facebook/react/pull/32224

in react-dom in Dev we validate that the tag nesting is valid. This is
motivated primarily because while browsers are tolerant to poor HTML
there are many cases that if server rendered will be hydrated in a way
that will break hydration.

With the changes to singleton scoping where the document body is now the
implicit render/hydration context for arbitrary tags at the root we need
to adjust the validation logic to allow for valid programs such as
rendering divs as a child of a Document (since this div will actually
insert into the body).
---
 .../src/client/ReactDOMComponent.js           |   4 +-
 .../src/client/ReactFiberConfigDOM.js         |  23 +++-
 .../src/client/validateDOMNesting.js          |  72 ++++++++++--
 .../react-dom/src/__tests__/ReactDOM-test.js  |  12 --
 .../src/__tests__/ReactDOMFizzServer-test.js  |   2 -
 .../src/__tests__/ReactDOMFloat-test.js       |   6 -
 .../src/__tests__/validateDOMNesting-test.js  | 105 +++++++++++++++---
 7 files changed, 175 insertions(+), 49 deletions(-)

diff --git a/packages/react-dom-bindings/src/client/ReactDOMComponent.js b/packages/react-dom-bindings/src/client/ReactDOMComponent.js
index 6406b734c439c..15a4ba675b5e0 100644
--- a/packages/react-dom-bindings/src/client/ReactDOMComponent.js
+++ b/packages/react-dom-bindings/src/client/ReactDOMComponent.js
@@ -344,7 +344,7 @@ function setProp(
     case 'children': {
       if (typeof value === 'string') {
         if (__DEV__) {
-          validateTextNesting(value, tag);
+          validateTextNesting(value, tag, false);
         }
         // Avoid setting initial textContent when the text is empty. In IE11 setting
         // textContent on a <textarea> will cause the placeholder to not
@@ -358,7 +358,7 @@ function setProp(
       } else if (typeof value === 'number' || typeof value === 'bigint') {
         if (__DEV__) {
           // $FlowFixMe[unsafe-addition] Flow doesn't want us to use `+` operator with string and bigint
-          validateTextNesting('' + value, tag);
+          validateTextNesting('' + value, tag, false);
         }
         const canSetTextContent = tag !== 'body';
         if (canSetTextContent) {
diff --git a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
index 012f7cd257f24..e96810122da6e 100644
--- a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
+++ b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
@@ -595,7 +595,11 @@ export function createTextInstance(
     const hostContextDev = ((hostContext: any): HostContextDev);
     const ancestor = hostContextDev.ancestorInfo.current;
     if (ancestor != null) {
-      validateTextNesting(text, ancestor.tag);
+      validateTextNesting(
+        text,
+        ancestor.tag,
+        hostContextDev.ancestorInfo.implicitRootScope,
+      );
     }
   }
   const textNode: TextInstance = getOwnerDocumentFromRootContainer(
@@ -2046,7 +2050,11 @@ export function validateHydratableTextInstance(
     const hostContextDev = ((hostContext: any): HostContextDev);
     const ancestor = hostContextDev.ancestorInfo.current;
     if (ancestor != null) {
-      return validateTextNesting(text, ancestor.tag);
+      return validateTextNesting(
+        text,
+        ancestor.tag,
+        hostContextDev.ancestorInfo.implicitRootScope,
+      );
     }
   }
   return true;
@@ -2394,8 +2402,15 @@ export function acquireSingletonInstance(
   internalInstanceHandle: Object,
 ): void {
   if (__DEV__) {
-    const currentInstanceHandle = getInstanceFromNodeDOMTree(instance);
-    if (currentInstanceHandle) {
+    if (
+      // If this instance is the container then it is invalid to acquire it as a singleton however
+      // the DOM nesting validation will already warn for this and the message below isn't semantically
+      // aligned with the actual fix you need to make so we omit the warning in this case
+      !isContainerMarkedAsRoot(instance) &&
+      // If this instance isn't the root but is currently owned by a different HostSingleton instance then
+      // we we need to warn that you are rendering more than one singleton at a time.
+      getInstanceFromNodeDOMTree(instance)
+    ) {
       const tagName = instance.tagName.toLowerCase();
       console.error(
         'You are mounting a new %s component when a previous one has not first unmounted. It is an' +
diff --git a/packages/react-dom-bindings/src/client/validateDOMNesting.js b/packages/react-dom-bindings/src/client/validateDOMNesting.js
index d6fdc5e857ed3..48ea32d7f3ffc 100644
--- a/packages/react-dom-bindings/src/client/validateDOMNesting.js
+++ b/packages/react-dom-bindings/src/client/validateDOMNesting.js
@@ -71,6 +71,7 @@ export type AncestorInfoDev = {
 
   // <head> or <body>
   containerTagInScope: ?Info,
+  implicitRootScope: boolean,
 };
 
 // This validation code was written based on the HTML5 parsing spec:
@@ -219,10 +220,11 @@ const emptyAncestorInfoDev: AncestorInfoDev = {
   dlItemTagAutoclosing: null,
 
   containerTagInScope: null,
+  implicitRootScope: false,
 };
 
 function updatedAncestorInfoDev(
-  oldInfo: ?AncestorInfoDev,
+  oldInfo: null | AncestorInfoDev,
   tag: string,
 ): AncestorInfoDev {
   if (__DEV__) {
@@ -238,14 +240,14 @@ function updatedAncestorInfoDev(
       ancestorInfo.pTagInButtonScope = null;
     }
 
-    // See rules for 'li', 'dd', 'dt' start tags in
-    // https://html.spec.whatwg.org/multipage/syntax.html#parsing-main-inbody
     if (
       specialTags.indexOf(tag) !== -1 &&
       tag !== 'address' &&
       tag !== 'div' &&
       tag !== 'p'
     ) {
+      // See rules for 'li', 'dd', 'dt' start tags in
+      // https://html.spec.whatwg.org/multipage/syntax.html#parsing-main-inbody
       ancestorInfo.listItemTagAutoclosing = null;
       ancestorInfo.dlItemTagAutoclosing = null;
     }
@@ -279,6 +281,17 @@ function updatedAncestorInfoDev(
       ancestorInfo.containerTagInScope = info;
     }
 
+    if (
+      oldInfo === null &&
+      (tag === '#document' || tag === 'html' || tag === 'body')
+    ) {
+      // While <head> is also a singleton we don't want to support semantics where
+      // you can escape the head by rendering a body singleton so we treat it like a normal scope
+      ancestorInfo.implicitRootScope = true;
+    } else if (ancestorInfo.implicitRootScope === true) {
+      ancestorInfo.implicitRootScope = false;
+    }
+
     return ancestorInfo;
   } else {
     return (null: any);
@@ -288,7 +301,11 @@ function updatedAncestorInfoDev(
 /**
  * Returns whether
  */
-function isTagValidWithParent(tag: string, parentTag: ?string): boolean {
+function isTagValidWithParent(
+  tag: string,
+  parentTag: ?string,
+  implicitRootScope: boolean,
+): boolean {
   // First, let's check if we're in an unusual parsing mode...
   switch (parentTag) {
     // https://html.spec.whatwg.org/multipage/syntax.html#parsing-main-inselect
@@ -363,10 +380,22 @@ function isTagValidWithParent(tag: string, parentTag: ?string): boolean {
       );
     // https://html.spec.whatwg.org/multipage/semantics.html#the-html-element
     case 'html':
+      if (implicitRootScope) {
+        // When our parent tag is html and we're in the root scope we will actually
+        // insert most tags into the body so we need to fall through to validating
+        // the specific tag with "in body" parsing mode below
+        break;
+      }
       return tag === 'head' || tag === 'body' || tag === 'frameset';
     case 'frameset':
       return tag === 'frame';
     case '#document':
+      if (implicitRootScope) {
+        // When our parent is the Document and we're in the root scope we will actually
+        // insert most tags into the body so we need to fall through to validating
+        // the specific tag with "in body" parsing mode below
+        break;
+      }
       return tag === 'html';
   }
 
@@ -393,14 +422,11 @@ function isTagValidWithParent(tag: string, parentTag: ?string): boolean {
     case 'rt':
       return impliedEndTags.indexOf(parentTag) === -1;
 
-    case 'body':
     case 'caption':
     case 'col':
     case 'colgroup':
     case 'frameset':
     case 'frame':
-    case 'head':
-    case 'html':
     case 'tbody':
     case 'td':
     case 'tfoot':
@@ -412,6 +438,24 @@ function isTagValidWithParent(tag: string, parentTag: ?string): boolean {
       // so we allow it only if we don't know what the parent is, as all other
       // cases are invalid.
       return parentTag == null;
+    case 'head':
+      // We support rendering <head> in the root when the container is
+      // #document, <html>, or <body>.
+      return implicitRootScope || parentTag === null;
+    case 'html':
+      // We support rendering <html> in the root when the container is
+      // #document
+      return (
+        (implicitRootScope && parentTag === '#document') || parentTag === null
+      );
+    case 'body':
+      // We support rendering <body> in the root when the container is
+      // #document or <html>
+      return (
+        (implicitRootScope &&
+          (parentTag === '#document' || parentTag === 'html')) ||
+        parentTag === null
+      );
   }
 
   return true;
@@ -513,7 +557,11 @@ function validateDOMNesting(
     const parentInfo = ancestorInfo.current;
     const parentTag = parentInfo && parentInfo.tag;
 
-    const invalidParent = isTagValidWithParent(childTag, parentTag)
+    const invalidParent = isTagValidWithParent(
+      childTag,
+      parentTag,
+      ancestorInfo.implicitRootScope,
+    )
       ? null
       : parentInfo;
     const invalidAncestor = invalidParent
@@ -594,9 +642,13 @@ function validateDOMNesting(
   return true;
 }
 
-function validateTextNesting(childText: string, parentTag: string): boolean {
+function validateTextNesting(
+  childText: string,
+  parentTag: string,
+  implicitRootScope: boolean,
+): boolean {
   if (__DEV__) {
-    if (isTagValidWithParent('#text', parentTag)) {
+    if (implicitRootScope || isTagValidWithParent('#text', parentTag, false)) {
       return true;
     }
 
diff --git a/packages/react-dom/src/__tests__/ReactDOM-test.js b/packages/react-dom/src/__tests__/ReactDOM-test.js
index ef0dd50258122..0d4a758a3c298 100644
--- a/packages/react-dom/src/__tests__/ReactDOM-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOM-test.js
@@ -601,10 +601,6 @@ describe('ReactDOM', () => {
       '<html lang="en"><head data-h=""><meta itemprop="" content="head"></head><body data-b=""><div>before</div><div>inside</div><div>after</div></body></html>',
     );
 
-    // @TODO remove this warning check when we loosen the tag nesting restrictions to allow arbitrary tags at the
-    // root of the application
-    assertConsoleErrorDev(['In HTML, <div> cannot be a child of <#document>']);
-
     await act(() => {
       root.render(<App phase={1} />);
     });
@@ -666,10 +662,6 @@ describe('ReactDOM', () => {
       '<html><head data-h=""><meta itemprop="" content="head"></head><body data-b=""><div>before</div><div>inside</div><div>after</div></body></html>',
     );
 
-    // @TODO remove this warning check when we loosen the tag nesting restrictions to allow arbitrary tags at the
-    // root of the application
-    assertConsoleErrorDev(['In HTML, <div> cannot be a child of <html>']);
-
     await act(() => {
       root.render(<App phase={1} />);
     });
@@ -729,10 +721,6 @@ describe('ReactDOM', () => {
       '<html><head data-h=""><meta itemprop="" content="head"></head><body><div>before</div><div>inside</div><div>after</div></body></html>',
     );
 
-    // @TODO remove this warning check when we loosen the tag nesting restrictions to allow arbitrary tags at the
-    // root of the application
-    assertConsoleErrorDev(['In HTML, <head> cannot be a child of <body>']);
-
     await act(() => {
       root.render(<App phase={1} />);
     });
diff --git a/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js b/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js
index d0a1e484f2810..d64167015eec9 100644
--- a/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMFizzServer-test.js
@@ -9004,7 +9004,6 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
-    assertConsoleErrorDev(['In HTML, <div> cannot be a child of <#document>']);
 
     root.unmount();
     expect(getVisibleChildren(document)).toEqual(
@@ -10173,7 +10172,6 @@ describe('ReactDOMFizzServer', () => {
         </body>
       </html>,
     );
-    assertConsoleErrorDev(['In HTML, <div> cannot be a child of <#document>']);
 
     root.unmount();
     expect(getVisibleChildren(document)).toEqual(
diff --git a/packages/react-dom/src/__tests__/ReactDOMFloat-test.js b/packages/react-dom/src/__tests__/ReactDOMFloat-test.js
index bdd50c9d4f469..4375ddb7d8deb 100644
--- a/packages/react-dom/src/__tests__/ReactDOMFloat-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMFloat-test.js
@@ -511,9 +511,6 @@ describe('ReactDOMFloat', () => {
         'Cannot render <noscript> outside the main document. Try moving it into the root <head> tag.',
         {withoutStack: true},
       ],
-      'In HTML, <noscript> cannot be a child of <#document>.\n' +
-        'This will cause a hydration error.\n' +
-        '    in noscript (at **)',
     ]);
 
     root.render(
@@ -577,9 +574,6 @@ describe('ReactDOMFloat', () => {
           'Consider adding precedence="default" or moving it into the root <head> tag.',
         {withoutStack: true},
       ],
-      'In HTML, <link> cannot be a child of <#document>.\n' +
-        'This will cause a hydration error.\n' +
-        '    in link (at **)',
     ]);
 
     root.render(
diff --git a/packages/react-dom/src/__tests__/validateDOMNesting-test.js b/packages/react-dom/src/__tests__/validateDOMNesting-test.js
index fc4fb0f80d44a..1f90b2d008b48 100644
--- a/packages/react-dom/src/__tests__/validateDOMNesting-test.js
+++ b/packages/react-dom/src/__tests__/validateDOMNesting-test.js
@@ -19,28 +19,54 @@ function expectWarnings(tags, warnings = [], withoutStack = 0) {
   tags = [...tags];
   warnings = [...warnings];
 
+  document.removeChild(document.documentElement);
+  document.appendChild(document.createElement('html'));
+  document.documentElement.innerHTML = '<head></head><body></body>';
+
   let element = null;
   const containerTag = tags.shift();
-  const container =
-    containerTag === 'svg'
-      ? document.createElementNS('http://www.w3.org/2000/svg', containerTag)
-      : document.createElement(containerTag);
+  let container;
+  switch (containerTag) {
+    case '#document':
+      container = document;
+      break;
+    case 'html':
+      container = document.documentElement;
+      break;
+    case 'body':
+      container = document.body;
+      break;
+    case 'head':
+      container = document.head;
+      break;
+    case 'svg':
+      container = document.createElementNS('http://www.w3.org/2000/svg', 'svg');
+      break;
+    default:
+      container = document.createElement(containerTag);
+      break;
+  }
 
   while (tags.length) {
     const Tag = tags.pop();
-    element = <Tag>{element}</Tag>;
+    if (Tag === '#text') {
+      element = 'text';
+    } else {
+      element = <Tag>{element}</Tag>;
+    }
   }
 
   const root = ReactDOMClient.createRoot(container);
+  ReactDOM.flushSync(() => {
+    root.render(element);
+  });
   if (warnings.length) {
-    ReactDOM.flushSync(() => {
-      root.render(element);
-    });
     assertConsoleErrorDev(
       warnings,
       withoutStack > 0 ? {withoutStack} : undefined,
     );
   }
+  root.unmount();
 }
 
 describe('validateDOMNesting', () => {
@@ -140,6 +166,46 @@ describe('validateDOMNesting', () => {
           '    in body (at **)',
       ],
     );
+    expectWarnings(
+      ['head', 'body'],
+      [
+        'In HTML, <body> cannot be a child of <head>.\n' +
+          'This will cause a hydration error.\n' +
+          '    in body (at **)',
+      ],
+    );
+    expectWarnings(
+      ['head', 'head'],
+      [
+        'In HTML, <head> cannot be a child of <head>.\n' +
+          'This will cause a hydration error.\n' +
+          '    in head (at **)',
+      ],
+    );
+    expectWarnings(
+      ['html', 'html'],
+      [
+        'In HTML, <html> cannot be a child of <html>.\n' +
+          'This will cause a hydration error.\n' +
+          '    in html (at **)',
+      ],
+    );
+    expectWarnings(
+      ['body', 'html'],
+      [
+        'In HTML, <html> cannot be a child of <body>.\n' +
+          'This will cause a hydration error.\n' +
+          '    in html (at **)',
+      ],
+    );
+    expectWarnings(
+      ['head', 'html'],
+      [
+        'In HTML, <html> cannot be a child of <head>.\n' +
+          'This will cause a hydration error.\n' +
+          '    in html (at **)',
+      ],
+    );
     expectWarnings(
       ['svg', 'foreignObject', 'body', 'p'],
       gate(flags => flags.enableOwnerStacks)
@@ -152,8 +218,6 @@ describe('validateDOMNesting', () => {
               '>   <body>\n' +
               '\n' +
               '    in body (at **)',
-            'You are mounting a new body component when a previous one has not first unmounted. It is an error to render more than one body component at a time and attributes and children of these components will likely fail in unpredictable ways. Please only render a single instance of <body> and if you need to mount a new one, ensure any previous ones have unmounted first.\n' +
-              '    in body (at **)',
           ]
         : [
             // TODO, this should say "In SVG",
@@ -165,10 +229,25 @@ describe('validateDOMNesting', () => {
               '\n' +
               '    in body (at **)\n' +
               '    in foreignObject (at **)',
-            'You are mounting a new body component when a previous one has not first unmounted. It is an error to render more than one body component at a time and attributes and children of these components will likely fail in unpredictable ways. Please only render a single instance of <body> and if you need to mount a new one, ensure any previous ones have unmounted first.\n' +
-              '    in body (at **)\n' +
-              '    in foreignObject (at **)',
           ],
     );
   });
+
+  it('relaxes the nesting rules at the root when the container is a singleton', () => {
+    expectWarnings(['#document', 'html']);
+    expectWarnings(['#document', 'body']);
+    expectWarnings(['#document', 'head']);
+    expectWarnings(['#document', 'div']);
+    expectWarnings(['#document', 'meta']);
+    expectWarnings(['#document', '#text']);
+    expectWarnings(['html', 'body']);
+    expectWarnings(['html', 'head']);
+    expectWarnings(['html', 'div']);
+    expectWarnings(['html', 'meta']);
+    expectWarnings(['html', '#text']);
+    expectWarnings(['body', 'head']);
+    expectWarnings(['body', 'div']);
+    expectWarnings(['body', 'meta']);
+    expectWarnings(['body', '#text']);
+  });
 });

From ae3190c5e929ec3b899734e2a6aface7cd4e42d0 Mon Sep 17 00:00:00 2001
From: Ruslan Lesiutin <rdlesyutin@gmail.com>
Date: Fri, 7 Feb 2025 10:54:44 +0000
Subject: [PATCH 25/72] React DevTools 6.1.0 -> 6.1.1 (#32326)

Full list of changes:
* DevTools: refactor NativeStyleEditor, don't use custom cache
implementation ([hoxyq](https://github.com/hoxyq) in
[#32298](https://github.com/facebook/react/pull/32298))
* fix[react-devtools-fusebox]: add extension globals to build
([hoxyq](https://github.com/hoxyq) in
[#32297](https://github.com/facebook/react/pull/32297))
* DevTools: fix host component filter option title
([hoxyq](https://github.com/hoxyq) in
[#32296](https://github.com/facebook/react/pull/32296))
* chore[DevTools]: make clipboardWrite optional for chromium
([hoxyq](https://github.com/hoxyq) in
[#32262](https://github.com/facebook/react/pull/32262))
* DevTools: support useEffectEvent and forward-fix experimental prefix
support ([hoxyq](https://github.com/hoxyq) in
[#32106](https://github.com/facebook/react/pull/32106))
---
 packages/react-devtools-core/package.json                | 2 +-
 packages/react-devtools-extensions/chrome/manifest.json  | 4 ++--
 packages/react-devtools-extensions/edge/manifest.json    | 4 ++--
 packages/react-devtools-extensions/firefox/manifest.json | 2 +-
 packages/react-devtools-inline/package.json              | 2 +-
 packages/react-devtools-timeline/package.json            | 2 +-
 packages/react-devtools/CHANGELOG.md                     | 9 +++++++++
 packages/react-devtools/package.json                     | 4 ++--
 8 files changed, 19 insertions(+), 10 deletions(-)

diff --git a/packages/react-devtools-core/package.json b/packages/react-devtools-core/package.json
index 88951de463c96..6794f631772be 100644
--- a/packages/react-devtools-core/package.json
+++ b/packages/react-devtools-core/package.json
@@ -1,6 +1,6 @@
 {
   "name": "react-devtools-core",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "description": "Use react-devtools outside of the browser",
   "license": "MIT",
   "main": "./dist/backend.js",
diff --git a/packages/react-devtools-extensions/chrome/manifest.json b/packages/react-devtools-extensions/chrome/manifest.json
index 4b2d810f60411..5cf6397bc75ef 100644
--- a/packages/react-devtools-extensions/chrome/manifest.json
+++ b/packages/react-devtools-extensions/chrome/manifest.json
@@ -2,8 +2,8 @@
   "manifest_version": 3,
   "name": "React Developer Tools",
   "description": "Adds React debugging tools to the Chrome Developer Tools.",
-  "version": "6.1.0",
-  "version_name": "6.1.0",
+  "version": "6.1.1",
+  "version_name": "6.1.1",
   "minimum_chrome_version": "102",
   "icons": {
     "16": "icons/16-production.png",
diff --git a/packages/react-devtools-extensions/edge/manifest.json b/packages/react-devtools-extensions/edge/manifest.json
index 37a76be2f24bc..512dd888f7d94 100644
--- a/packages/react-devtools-extensions/edge/manifest.json
+++ b/packages/react-devtools-extensions/edge/manifest.json
@@ -2,8 +2,8 @@
   "manifest_version": 3,
   "name": "React Developer Tools",
   "description": "Adds React debugging tools to the Microsoft Edge Developer Tools.",
-  "version": "6.1.0",
-  "version_name": "6.1.0",
+  "version": "6.1.1",
+  "version_name": "6.1.1",
   "minimum_chrome_version": "102",
   "icons": {
     "16": "icons/16-production.png",
diff --git a/packages/react-devtools-extensions/firefox/manifest.json b/packages/react-devtools-extensions/firefox/manifest.json
index d053921ebeecc..22dee6a10a42d 100644
--- a/packages/react-devtools-extensions/firefox/manifest.json
+++ b/packages/react-devtools-extensions/firefox/manifest.json
@@ -2,7 +2,7 @@
   "manifest_version": 3,
   "name": "React Developer Tools",
   "description": "Adds React debugging tools to the Firefox Developer Tools.",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "browser_specific_settings": {
     "gecko": {
       "id": "@react-devtools",
diff --git a/packages/react-devtools-inline/package.json b/packages/react-devtools-inline/package.json
index 86cdc5758b3e9..4a484dedbeb5e 100644
--- a/packages/react-devtools-inline/package.json
+++ b/packages/react-devtools-inline/package.json
@@ -1,6 +1,6 @@
 {
   "name": "react-devtools-inline",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "description": "Embed react-devtools within a website",
   "license": "MIT",
   "main": "./dist/backend.js",
diff --git a/packages/react-devtools-timeline/package.json b/packages/react-devtools-timeline/package.json
index 5519ab339da78..9dbf65b931587 100644
--- a/packages/react-devtools-timeline/package.json
+++ b/packages/react-devtools-timeline/package.json
@@ -1,7 +1,7 @@
 {
   "private": true,
   "name": "react-devtools-timeline",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "license": "MIT",
   "dependencies": {
     "@elg/speedscope": "1.9.0-a6f84db",
diff --git a/packages/react-devtools/CHANGELOG.md b/packages/react-devtools/CHANGELOG.md
index 4e6109a3186fd..b1a4fd9a801e0 100644
--- a/packages/react-devtools/CHANGELOG.md
+++ b/packages/react-devtools/CHANGELOG.md
@@ -4,6 +4,15 @@
 
 ---
 
+### 6.1.1
+February 7, 2025
+
+* DevTools: refactor NativeStyleEditor, don't use custom cache implementation ([hoxyq](https://github.com/hoxyq) in [#32298](https://github.com/facebook/react/pull/32298))
+* DevTools: fix host component filter option title ([hoxyq](https://github.com/hoxyq) in [#32296](https://github.com/facebook/react/pull/32296))
+* chore[DevTools]: make clipboardWrite optional for chromium ([hoxyq](https://github.com/hoxyq) in [#32262](https://github.com/facebook/react/pull/32262))
+
+---
+
 ### 6.1.0
 January 16, 2025
 
diff --git a/packages/react-devtools/package.json b/packages/react-devtools/package.json
index bc6af6588e9ec..a384b168166aa 100644
--- a/packages/react-devtools/package.json
+++ b/packages/react-devtools/package.json
@@ -1,6 +1,6 @@
 {
   "name": "react-devtools",
-  "version": "6.1.0",
+  "version": "6.1.1",
   "description": "Use react-devtools outside of the browser",
   "license": "MIT",
   "repository": {
@@ -26,7 +26,7 @@
     "electron": "^23.1.2",
     "internal-ip": "^6.2.0",
     "minimist": "^1.2.3",
-    "react-devtools-core": "6.1.0",
+    "react-devtools-core": "6.1.1",
     "update-notifier": "^2.1.0"
   }
 }

From 44c3d3d665761bba86eb5c143a6eafc0ebf73263 Mon Sep 17 00:00:00 2001
From: Ruslan Lesiutin <rdlesyutin@gmail.com>
Date: Fri, 7 Feb 2025 11:07:46 +0000
Subject: [PATCH 26/72] fix[react-devtools-standalone]: define missing globals
 (#32327)

Same as what we did for `react-devtools-fusebox` in
https://github.com/facebook/react/pull/32297.
---
 packages/react-devtools-core/webpack.standalone.js | 3 +++
 1 file changed, 3 insertions(+)

diff --git a/packages/react-devtools-core/webpack.standalone.js b/packages/react-devtools-core/webpack.standalone.js
index 778c1fa85c627..8caadec10b070 100644
--- a/packages/react-devtools-core/webpack.standalone.js
+++ b/packages/react-devtools-core/webpack.standalone.js
@@ -88,6 +88,9 @@ module.exports = {
       __PROFILE__: false,
       __TEST__: NODE_ENV === 'test',
       __IS_NATIVE__: true,
+      __IS_FIREFOX__: false,
+      __IS_CHROME__: false,
+      __IS_EDGE__: false,
       'process.env.DEVTOOLS_PACKAGE': `"react-devtools-core"`,
       'process.env.DEVTOOLS_VERSION': `"${DEVTOOLS_VERSION}"`,
       'process.env.EDITOR_URL': EDITOR_URL != null ? `"${EDITOR_URL}"` : null,

From 8759c5c8d6aef34df576827215ff7ebaeafc79ea Mon Sep 17 00:00:00 2001
From: Jack Pope <jackpope1@gmail.com>
Date: Fri, 7 Feb 2025 11:12:29 -0500
Subject: [PATCH 27/72] Ship enableFabricCompleteRootInCommitPhase (#32318)

---
 .../src/ReactFiberConfigFabric.js                  | 14 +++-----------
 packages/shared/ReactFeatureFlags.js               |  5 -----
 .../forks/ReactFeatureFlags.native-fb-dynamic.js   |  1 -
 .../shared/forks/ReactFeatureFlags.native-fb.js    |  1 -
 .../shared/forks/ReactFeatureFlags.native-oss.js   |  1 -
 .../forks/ReactFeatureFlags.test-renderer.js       |  1 -
 .../ReactFeatureFlags.test-renderer.native-fb.js   |  1 -
 .../forks/ReactFeatureFlags.test-renderer.www.js   |  1 -
 packages/shared/forks/ReactFeatureFlags.www.js     |  1 -
 9 files changed, 3 insertions(+), 23 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactFiberConfigFabric.js b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
index 59bd296138e0b..d602ab05efa81 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigFabric.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
@@ -57,10 +57,7 @@ import {
   getInspectorDataForInstance,
 } from './ReactNativeFiberInspector';
 
-import {
-  enableFabricCompleteRootInCommitPhase,
-  passChildrenWhenCloningPersistedNodes,
-} from 'shared/ReactFeatureFlags';
+import {passChildrenWhenCloningPersistedNodes} from 'shared/ReactFeatureFlags';
 import {REACT_CONTEXT_TYPE} from 'shared/ReactSymbols';
 import type {ReactContext} from 'shared/ReactTypes';
 
@@ -505,19 +502,14 @@ export function finalizeContainerChildren(
   container: Container,
   newChildren: ChildSet,
 ): void {
-  if (!enableFabricCompleteRootInCommitPhase) {
-    completeRoot(container.containerTag, newChildren);
-  }
+  // Noop - children will be finalized in replaceContainerChildren
 }
 
 export function replaceContainerChildren(
   container: Container,
   newChildren: ChildSet,
 ): void {
-  // Noop - children will be replaced in finalizeContainerChildren
-  if (enableFabricCompleteRootInCommitPhase) {
-    completeRoot(container.containerTag, newChildren);
-  }
+  completeRoot(container.containerTag, newChildren);
 }
 
 export {getClosestInstanceFromNode as getInstanceFromNode};
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index a94f3402de4f8..290d5ba159d68 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -92,11 +92,6 @@ export const enableHalt = __EXPERIMENTAL__;
 
 export const enableViewTransition = __EXPERIMENTAL__;
 
-/**
- * Switches the Fabric API from doing layout in commit work instead of complete work.
- */
-export const enableFabricCompleteRootInCommitPhase = false;
-
 /**
  * Switches Fiber creation to a simple object instead of a constructor.
  */
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index cff57d26ecd95..6aaefdfa336fe 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -23,7 +23,6 @@ export const enableHiddenSubtreeInsertionEffectCleanup = __VARIANT__;
 export const enablePersistedModeClonedFlag = __VARIANT__;
 export const enableShallowPropDiffing = __VARIANT__;
 export const passChildrenWhenCloningPersistedNodes = __VARIANT__;
-export const enableFabricCompleteRootInCommitPhase = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 export const enableUseResourceEffectHook = __VARIANT__;
 export const enableOwnerStacks = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 31b3333966410..878d344a42a41 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -20,7 +20,6 @@ const dynamicFlags: DynamicExportsType = (dynamicFlagsUntyped: any);
 // the exports object every time a flag is read.
 export const {
   alwaysThrottleRetries,
-  enableFabricCompleteRootInCommitPhase,
   enableHiddenSubtreeInsertionEffectCleanup,
   enableObjectFiber,
   enablePersistedModeClonedFlag,
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index 84307ce62746c..a3202c0b80049 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -30,7 +30,6 @@ export const enableAsyncIterableChildren = false;
 export const enableCPUSuspense = false;
 export const enableCreateEventHandleAPI = false;
 export const enableDO_NOT_USE_disableStrictPassiveEffect = false;
-export const enableFabricCompleteRootInCommitPhase = false;
 export const enableMoveBefore = true;
 export const enableFizzExternalRuntime = true;
 export const enableHalt = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index 90725f666e1a1..6bc085f540b23 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -36,7 +36,6 @@ export const enableUseEffectEventHook = false;
 export const favorSafetyOverHydrationPerf = true;
 export const enableLegacyFBSupport = false;
 export const enableMoveBefore = false;
-export const enableFabricCompleteRootInCommitPhase = false;
 export const enableHiddenSubtreeInsertionEffectCleanup = false;
 export const enableHydrationLaneScheduling = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index b4df6f248f9fd..d62a59122f82c 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -61,7 +61,6 @@ export const renameElementSymbol = false;
 export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
-export const enableFabricCompleteRootInCommitPhase = false;
 export const enableSiblingPrerendering = true;
 export const enableUseResourceEffectHook = true;
 export const enableHydrationLaneScheduling = true;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index a09e479f1732b..301c01a018090 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -39,7 +39,6 @@ export const favorSafetyOverHydrationPerf = true;
 export const enableLegacyFBSupport = false;
 export const enableMoveBefore = false;
 export const enableRenderableContext = false;
-export const enableFabricCompleteRootInCommitPhase = false;
 export const enableHiddenSubtreeInsertionEffectCleanup = true;
 
 export const enableRetryLaneExpiration = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index c84b89847fa0c..dcb77f9d84b5e 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -48,7 +48,6 @@ export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
 export const enableProfilerNestedUpdatePhase = __PROFILE__;
 export const enableUpdaterTracking = __PROFILE__;
-export const enableFabricCompleteRootInCommitPhase = false;
 
 export const enableSuspenseAvoidThisFallback = true;
 

From 76e44c29110f12caff8302da624076b68547b8ef Mon Sep 17 00:00:00 2001
From: inottn <inottn@outlook.com>
Date: Sat, 8 Feb 2025 04:48:03 +0800
Subject: [PATCH 28/72] [compiler] Improve error messages for unhandled
 terminal and instruction kinds (#32324)

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

<!--
Explain the **motivation** for making this change. What existing problem
does the pull request solve?
-->
Improve the error message, as the value is currently an object instead
of a string, which results in it being converted to '[object Object]'.

## How did you test this change?
Already tested locally.
<!--
Demonstrate the code is solid. Example: The exact commands you ran and
their output, screenshots / videos if the pull request changes the user
interface.
How exactly did you verify that your PR solves the issue you wanted to
solve?
  If you leave this empty, your PR will very likely be closed.
-->
---
 .../src/ReactiveScopes/PrintReactiveFunction.ts              | 5 ++++-
 .../src/TypeInference/InferTypes.ts                          | 5 ++++-
 2 files changed, 8 insertions(+), 2 deletions(-)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PrintReactiveFunction.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PrintReactiveFunction.ts
index b5aa44ead095d..259fc06486888 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PrintReactiveFunction.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PrintReactiveFunction.ts
@@ -394,7 +394,10 @@ function writeTerminal(writer: Writer, terminal: ReactiveTerminal): void {
       break;
     }
     default:
-      assertExhaustive(terminal, `Unhandled terminal ${terminal}`);
+      assertExhaustive(
+        terminal,
+        `Unhandled terminal kind \`${(terminal as any).kind}\``,
+      );
   }
 }
 
diff --git a/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts b/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
index 0270723c3e863..44bf539e847bb 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
@@ -420,7 +420,10 @@ function* generateInstructionTypes(
       break;
     }
     default:
-      assertExhaustive(value, `Unhandled instruction value kind: ${value}`);
+      assertExhaustive(
+        value,
+        `Unhandled instruction value kind: ${(value as any).kind}`,
+      );
   }
 }
 

From 989b0cccc215e5c4692552b0cc01d23938dcf99b Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 16:04:46 -0500
Subject: [PATCH 29/72] [compiler] Add simple walltime measurement (#32331)

Adds a new Timing logger event to the compiler which currently only
records the walltime of running the compiler from the time the babel
plugin's Program visitor enters to the time it exits.

To enable, run the compiler with `ENABLE_REACT_COMPILER_TIMINGS=1 ...`
or `export ENABLE_REACT_COMPILER_TIMINGS=1` to set it by default.
---
 .../src/Babel/BabelPlugin.ts                  | 93 +++++++++++++------
 .../src/Entrypoint/Options.ts                 |  4 +
 2 files changed, 67 insertions(+), 30 deletions(-)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/Babel/BabelPlugin.ts b/compiler/packages/babel-plugin-react-compiler/src/Babel/BabelPlugin.ts
index c648c66043980..aa49bda22b27e 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Babel/BabelPlugin.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Babel/BabelPlugin.ts
@@ -6,12 +6,15 @@
  */
 
 import type * as BabelCore from '@babel/core';
-import {compileProgram, parsePluginOptions} from '../Entrypoint';
+import {compileProgram, Logger, parsePluginOptions} from '../Entrypoint';
 import {
   injectReanimatedFlag,
   pipelineUsesReanimatedPlugin,
 } from '../Entrypoint/Reanimated';
 
+const ENABLE_REACT_COMPILER_TIMINGS =
+  process.env['ENABLE_REACT_COMPILER_TIMINGS'] === '1';
+
 /*
  * The React Forget Babel Plugin
  * @param {*} _babel
@@ -28,35 +31,65 @@ export default function BabelPluginReactCompiler(
        * prior to B, if A does not have a Program visitor and B does, B will run first. We always
        * want Forget to run true to source as possible.
        */
-      Program(prog, pass): void {
-        let opts = parsePluginOptions(pass.opts);
-        const isDev =
-          (typeof __DEV__ !== 'undefined' && __DEV__ === true) ||
-          process.env['NODE_ENV'] === 'development';
-        if (
-          opts.enableReanimatedCheck === true &&
-          pipelineUsesReanimatedPlugin(pass.file.opts.plugins)
-        ) {
-          opts = injectReanimatedFlag(opts);
-        }
-        if (
-          opts.environment.enableResetCacheOnSourceFileChanges !== false &&
-          isDev
-        ) {
-          opts = {
-            ...opts,
-            environment: {
-              ...opts.environment,
-              enableResetCacheOnSourceFileChanges: true,
-            },
-          };
-        }
-        compileProgram(prog, {
-          opts,
-          filename: pass.filename ?? null,
-          comments: pass.file.ast.comments ?? [],
-          code: pass.file.code,
-        });
+      Program: {
+        enter(prog, pass): void {
+          const filename = pass.filename ?? 'unknown';
+          if (ENABLE_REACT_COMPILER_TIMINGS === true) {
+            performance.mark(`${filename}:start`, {
+              detail: 'BabelPlugin:Program:start',
+            });
+          }
+          let opts = parsePluginOptions(pass.opts);
+          const isDev =
+            (typeof __DEV__ !== 'undefined' && __DEV__ === true) ||
+            process.env['NODE_ENV'] === 'development';
+          if (
+            opts.enableReanimatedCheck === true &&
+            pipelineUsesReanimatedPlugin(pass.file.opts.plugins)
+          ) {
+            opts = injectReanimatedFlag(opts);
+          }
+          if (
+            opts.environment.enableResetCacheOnSourceFileChanges !== false &&
+            isDev
+          ) {
+            opts = {
+              ...opts,
+              environment: {
+                ...opts.environment,
+                enableResetCacheOnSourceFileChanges: true,
+              },
+            };
+          }
+          compileProgram(prog, {
+            opts,
+            filename: pass.filename ?? null,
+            comments: pass.file.ast.comments ?? [],
+            code: pass.file.code,
+          });
+          if (ENABLE_REACT_COMPILER_TIMINGS === true) {
+            performance.mark(`${filename}:end`, {
+              detail: 'BabelPlugin:Program:end',
+            });
+          }
+        },
+        exit(_, pass): void {
+          if (ENABLE_REACT_COMPILER_TIMINGS === true) {
+            const filename = pass.filename ?? 'unknown';
+            const measurement = performance.measure(filename, {
+              start: `${filename}:start`,
+              end: `${filename}:end`,
+              detail: 'BabelPlugin:Program',
+            });
+            if ('logger' in pass.opts && pass.opts.logger != null) {
+              const logger: Logger = pass.opts.logger as Logger;
+              logger.logEvent(filename, {
+                kind: 'Timing',
+                measurement,
+              });
+            }
+          }
+        },
       },
     },
   };
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts
index fb951d25c5398..35c2c4134eb44 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Entrypoint/Options.ts
@@ -206,6 +206,10 @@ export type LoggerEvent =
       kind: 'PipelineError';
       fnLoc: t.SourceLocation | null;
       data: string;
+    }
+  | {
+      kind: 'Timing';
+      measurement: PerformanceMeasure;
     };
 
 export type Logger = {

From bc78de3a521f65f756579fee0996ec5c81f3af73 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 16:34:26 -0500
Subject: [PATCH 30/72] [ci] Use 'opened' event for discord notifications
 (#32332)

We don't need to wait for it to be labeled now that we have the shared
maintainer check workflow.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32332).
* #32333
* __->__ #32332
---
 .github/workflows/compiler_discord_notify.yml | 4 ++--
 .github/workflows/runtime_discord_notify.yml  | 4 ++--
 2 files changed, 4 insertions(+), 4 deletions(-)

diff --git a/.github/workflows/compiler_discord_notify.yml b/.github/workflows/compiler_discord_notify.yml
index 1ab9c1b1aff5b..da85190dd2127 100644
--- a/.github/workflows/compiler_discord_notify.yml
+++ b/.github/workflows/compiler_discord_notify.yml
@@ -2,7 +2,7 @@ name: (Compiler) Discord Notify
 
 on:
   pull_request_target:
-    types: [labeled]
+    types: [opened]
     paths:
       - compiler/**
       - .github/workflows/compiler_**.yml
@@ -14,7 +14,7 @@ jobs:
       actor: ${{ github.event.pull_request.user.login }}
 
   notify:
-    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' && github.event.label.name == 'React Core Team' }}
+    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' }}
     needs: check_maintainer
     runs-on: ubuntu-latest
     steps:
diff --git a/.github/workflows/runtime_discord_notify.yml b/.github/workflows/runtime_discord_notify.yml
index 59a1078b499e8..5a138ce71b13b 100644
--- a/.github/workflows/runtime_discord_notify.yml
+++ b/.github/workflows/runtime_discord_notify.yml
@@ -2,7 +2,7 @@ name: (Runtime) Discord Notify
 
 on:
   pull_request_target:
-    types: [labeled]
+    types: [opened]
     paths-ignore:
       - compiler/**
       - .github/workflows/compiler_**.yml
@@ -14,7 +14,7 @@ jobs:
       actor: ${{ github.event.pull_request.user.login }}
 
   notify:
-    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' && github.event.label.name == 'React Core Team' }}
+    if: ${{ needs.check_maintainer.outputs.is_core_team == 'true' }}
     needs: check_maintainer
     runs-on: ubuntu-latest
     steps:

From 569c3b28ee968df58ff3c55be9a8efa2ee72fc82 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 16:39:37 -0500
Subject: [PATCH 31/72] [ci] Combine sizebot jobs (#32333)

There's no real reason to have 2 jobs for sizebot. It's more of a
historical artifact from before the GH migration. Merging them should
require one less worker needing to be provisioned and some of the extra
overhead
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32333).
* __->__ #32333
* #32332
---
 .github/workflows/runtime_build_and_test.yml | 47 +++-----------------
 1 file changed, 7 insertions(+), 40 deletions(-)

diff --git a/.github/workflows/runtime_build_and_test.yml b/.github/workflows/runtime_build_and_test.yml
index 9a592780b17c4..12e341a86fd96 100644
--- a/.github/workflows/runtime_build_and_test.yml
+++ b/.github/workflows/runtime_build_and_test.yml
@@ -585,9 +585,10 @@ jobs:
           RELEASE_CHANNEL: experimental
 
   # ----- SIZEBOT -----
-  download_base_build_for_sizebot:
-    if: ${{ github.event_name == 'pull_request' && github.ref_name != 'main' }}
-    name: Download base build for sizebot
+  sizebot:
+    if: ${{ github.event_name == 'pull_request' && github.ref_name != 'main' && github.event.pull_request.base.ref == 'main' }}
+    name: Run sizebot
+    needs: [build_and_lint]
     runs-on: ubuntu-latest
     steps:
       - uses: actions/checkout@v4
@@ -603,16 +604,14 @@ jobs:
         id: node_modules
         with:
           path: "**/node_modules"
-          key: ${{ runner.arch }}-${{ runner.os }}-modules-${{ hashFiles('yarn.lock', 'scripts/release/yarn.lock') }}
+          key: runtime-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('yarn.lock') }}
       - name: Ensure clean build directory
         run: rm -rf build
-      - run: yarn install --frozen-lockfile
       - run: yarn install --frozen-lockfile
         working-directory: scripts/release
       - name: Download artifacts for base revision
         run: |
-          git fetch origin main
-          GH_TOKEN=${{ github.token }} scripts/release/download-experimental-build.js --commit=$(git rev-parse origin/main)
+          GH_TOKEN=${{ github.token }} scripts/release/download-experimental-build.js --commit=$(git rev-parse ${{ github.event.pull_request.base.sha }})
           mv ./build ./base-build
       # TODO: The `download-experimental-build` script copies the npm
       # packages into the `node_modules` directory. This is a historical
@@ -620,33 +619,8 @@ jobs:
       # don't exist.
       - name: Delete extraneous files
         run: rm -rf ./base-build/node_modules
-      - name: Display structure of base-build
+      - name: Display structure of base-build from origin/main
         run: ls -R base-build
-      - name: Archive base-build
-        uses: actions/upload-artifact@v4
-        with:
-          name: base-build
-          path: base-build
-
-  sizebot:
-    name: Run sizebot
-    needs: [build_and_lint, download_base_build_for_sizebot]
-    runs-on: ubuntu-latest
-    steps:
-      - uses: actions/checkout@v4
-        with:
-          ref: ${{ github.event.pull_request.head.sha || github.sha }}
-      - uses: actions/setup-node@v4
-        with:
-          node-version-file: '.nvmrc'
-          cache: yarn
-          cache-dependency-path: yarn.lock
-      - name: Restore cached node_modules
-        uses: actions/cache@v4
-        id: node_modules
-        with:
-          path: "**/node_modules"
-          key: runtime-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('yarn.lock') }}
       - name: Ensure clean build directory
         run: rm -rf build
       - run: yarn install --frozen-lockfile
@@ -662,13 +636,6 @@ jobs:
           node ./scripts/print-warnings/print-warnings.js > build/__test_utils__/ReactAllWarnings.js
       - name: Display structure of build for PR
         run: ls -R build
-      - name: Restore archived base-build from origin/main
-        uses: actions/download-artifact@v4
-        with:
-          name: base-build
-          path: base-build
-      - name: Display structure of base-build from origin/main
-        run: ls -R base-build
       - run: echo ${{ github.sha }} >> build/COMMIT_SHA
       - run: node ./scripts/tasks/danger
       - name: Archive sizebot results

From 7588b6b291b17fb2130244115b07e9945a864626 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 17:49:09 -0500
Subject: [PATCH 32/72] [ci] Disallow PRs against builds branch (#32335)

Our internal build infra relies on a 1:1 mapping between `main` and the
2 build branches. Directly committing changes to those branches breaks
that infra.

Adds a simple workflow to leave a comment and decline the PR.
---
 .../shared_close_direct_sync_branch_prs.yml   | 37 +++++++++++++++++++
 1 file changed, 37 insertions(+)
 create mode 100644 .github/workflows/shared_close_direct_sync_branch_prs.yml

diff --git a/.github/workflows/shared_close_direct_sync_branch_prs.yml b/.github/workflows/shared_close_direct_sync_branch_prs.yml
new file mode 100644
index 0000000000000..1f5dd5b1a465b
--- /dev/null
+++ b/.github/workflows/shared_close_direct_sync_branch_prs.yml
@@ -0,0 +1,37 @@
+name: (Shared) Close Direct Sync Branch PRs
+
+on:
+  pull_request:
+    branches:
+      - builds/facebook-*
+
+env:
+  TZ: /usr/share/zoneinfo/America/Los_Angeles
+  # https://github.com/actions/cache/blob/main/tips-and-workarounds.md#cache-segment-restore-timeout
+  SEGMENT_DOWNLOAD_TIMEOUT_MINS: 1
+
+jobs:
+  close_pr:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Close PR
+        uses: actions/github-script@v7
+        with:
+          script: |
+            const owner = context.repo.owner;
+            const repo = context.repo.repo;
+            const pullNumber = ${{ github.event.number }};
+
+            await github.rest.pulls.createReview({
+              owner,
+              repo,
+              pull_number: pullNumber,
+              body: 'Do not land changes to `${{ github.event.pull_request.base.ref }}`. Please re-open your PR targeting `main` instead.',
+              event: 'REQUEST_CHANGES'
+            });
+            await github.rest.pulls.update({
+              owner,
+              repo,
+              pull_number: pullNumber,
+              state: 'closed'
+            });

From 062fb31155e42b6997a35b97180055814471620c Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Fri, 7 Feb 2025 18:01:53 -0500
Subject: [PATCH 33/72] [ci] Fix typo (#32337)

Oops.
---
 .github/workflows/shared_close_direct_sync_branch_prs.yml | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/.github/workflows/shared_close_direct_sync_branch_prs.yml b/.github/workflows/shared_close_direct_sync_branch_prs.yml
index 1f5dd5b1a465b..7575c0e913c7e 100644
--- a/.github/workflows/shared_close_direct_sync_branch_prs.yml
+++ b/.github/workflows/shared_close_direct_sync_branch_prs.yml
@@ -3,7 +3,7 @@ name: (Shared) Close Direct Sync Branch PRs
 on:
   pull_request:
     branches:
-      - builds/facebook-*
+      - 'builds/facebook-**'
 
 env:
   TZ: /usr/share/zoneinfo/America/Los_Angeles

From 594ea533d39f71fa16503c0e5d5e146e9278647e Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Sun, 9 Feb 2025 15:01:28 -0500
Subject: [PATCH 34/72] Remove useActionState Hook export from experimental
 react-server condition (#32342)

This Hook is not available in RSC environments. This is already the case
in stable but not in experimental for some reason. Probably an
oversight.
---
 packages/react/src/ReactServer.experimental.development.js | 2 --
 packages/react/src/ReactServer.experimental.js             | 2 --
 2 files changed, 4 deletions(-)

diff --git a/packages/react/src/ReactServer.experimental.development.js b/packages/react/src/ReactServer.experimental.development.js
index fc22dda4e7896..0176e0e94f7cc 100644
--- a/packages/react/src/ReactServer.experimental.development.js
+++ b/packages/react/src/ReactServer.experimental.development.js
@@ -30,7 +30,6 @@ import {
   useCallback,
   useDebugValue,
   useMemo,
-  useActionState,
   getCacheForType,
 } from './ReactHooks';
 import {forwardRef} from './ReactForwardRef';
@@ -78,7 +77,6 @@ export {
   useCallback,
   useDebugValue,
   useMemo,
-  useActionState,
   version,
   // Experimental
   REACT_SUSPENSE_LIST_TYPE as unstable_SuspenseList,
diff --git a/packages/react/src/ReactServer.experimental.js b/packages/react/src/ReactServer.experimental.js
index 758c3d8b89ae0..c687bff7213b4 100644
--- a/packages/react/src/ReactServer.experimental.js
+++ b/packages/react/src/ReactServer.experimental.js
@@ -30,7 +30,6 @@ import {
   useCallback,
   useDebugValue,
   useMemo,
-  useActionState,
   getCacheForType,
 } from './ReactHooks';
 import {forwardRef} from './ReactForwardRef';
@@ -77,7 +76,6 @@ export {
   useCallback,
   useDebugValue,
   useMemo,
-  useActionState,
   version,
   // Experimental
   REACT_SUSPENSE_LIST_TYPE as unstable_SuspenseList,

From 93b58361d9c9632acdda76eb8a1a582d1ff9701a Mon Sep 17 00:00:00 2001
From: Hendrik Liebau <mail@hendrik-liebau.de>
Date: Sun, 9 Feb 2025 23:55:50 +0100
Subject: [PATCH 35/72] Trigger Discord notification when draft PR is set to
 "ready for review" (#32344)

Follow-up for #32332. The Discord webhook seems to ignore draft PRs,
which is a good thing. But when a draft PR is then later set to "ready
for review" we do want to send another notification that should not be
filtered out.
---
 .github/workflows/runtime_discord_notify.yml | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/.github/workflows/runtime_discord_notify.yml b/.github/workflows/runtime_discord_notify.yml
index 5a138ce71b13b..e41b1c56405a7 100644
--- a/.github/workflows/runtime_discord_notify.yml
+++ b/.github/workflows/runtime_discord_notify.yml
@@ -2,7 +2,7 @@ name: (Runtime) Discord Notify
 
 on:
   pull_request_target:
-    types: [opened]
+    types: [opened, ready_for_review]
     paths-ignore:
       - compiler/**
       - .github/workflows/compiler_**.yml

From 3dd2c627707fea4f45fd8e5cc583036a72e3f77b Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Mon, 10 Feb 2025 14:08:44 -0500
Subject: [PATCH 36/72] [react-native] fix divergence in synced code (#32348)

Alternative to #32334
---
 packages/react-native-renderer/src/ReactNativeTypes.js | 3 ++-
 1 file changed, 2 insertions(+), 1 deletion(-)

diff --git a/packages/react-native-renderer/src/ReactNativeTypes.js b/packages/react-native-renderer/src/ReactNativeTypes.js
index 55ae2cc1b0a0e..07030a6b7f6c7 100644
--- a/packages/react-native-renderer/src/ReactNativeTypes.js
+++ b/packages/react-native-renderer/src/ReactNativeTypes.js
@@ -10,6 +10,7 @@
  */
 
 import type {ElementRef, ElementType, MixedElement} from 'react';
+import {type PublicRootInstance} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
 
 export type MeasureOnSuccessCallback = (
   x: number,
@@ -231,7 +232,6 @@ export opaque type Node = mixed;
 export opaque type InternalInstanceHandle = mixed;
 type PublicInstance = mixed;
 type PublicTextInstance = mixed;
-export opaque type PublicRootInstance = mixed;
 
 export type ReactFabricType = {
   findHostInstance_DEPRECATED<TElementType: ElementType>(
@@ -261,6 +261,7 @@ export type ReactFabricType = {
   getPublicInstanceFromInternalInstanceHandle(
     internalInstanceHandle: InternalInstanceHandle,
   ): PublicInstance | PublicTextInstance | null,
+  getPublicInstanceFromRootTag(rootTag: number): PublicRootInstance | null,
   ...
 };
 

From cd90a4d8c0d5dbaa8ab61e839b112b1518d5058f Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Mon, 10 Feb 2025 15:46:47 -0500
Subject: [PATCH 37/72] [react-native] Suppress Flow nonstrict-import check in
 ReactNativeTypes (#32349)

Summary: Unblock internal sync.

Test Plan:

Reviewers:

Subscribers:

Tasks:

Tags:
---
 packages/react-native-renderer/src/ReactNativeTypes.js | 1 +
 1 file changed, 1 insertion(+)

diff --git a/packages/react-native-renderer/src/ReactNativeTypes.js b/packages/react-native-renderer/src/ReactNativeTypes.js
index 07030a6b7f6c7..8bce919d385e9 100644
--- a/packages/react-native-renderer/src/ReactNativeTypes.js
+++ b/packages/react-native-renderer/src/ReactNativeTypes.js
@@ -10,6 +10,7 @@
  */
 
 import type {ElementRef, ElementType, MixedElement} from 'react';
+// $FlowFixMe[nonstrict-import] TODO(@rubennorte)
 import {type PublicRootInstance} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
 
 export type MeasureOnSuccessCallback = (

From 0a7dc1b1c714e74a1594c712d2317969e6421685 Mon Sep 17 00:00:00 2001
From: Brendan Abbott <brendan@bloodbone.ws>
Date: Wed, 12 Feb 2025 04:14:43 +1000
Subject: [PATCH 38/72] [devtools] Introduce REACT_DEVTOOLS_PORT for the
 standalone react-devtools (#30767)
MIME-Version: 1.0
Content-Type: text/plain; charset=UTF-8
Content-Transfer-Encoding: 8bit

## Summary

This PR attempts to make running the React DevTools a little friendlier
in projects that are not completely React.

At the moment, running the DevTools with `npx react-devtools` will
default to the port to use the `PORT` env variable otherwise it'll fall
back to `8097`. `PORT` is a common env variable, so we can get into this
strange situation where the a Rails server (eg Puma) is using `PORT`,
and then the React DevTools attempts to boot using the same `PORT`.

This PR introduces a dedicated env variable, `REACT_DEVTOOLS_PORT` to
assist in this scenario.

## How did you test this change?

I'm using fish shell, so I did the following, please let me know if
there's a better way:

```sh
cd packages/react-devtools
set -x PORT 1000
set -x REACT_DEVTOOLS_PORT 2000
node bin.js
```

We can see in the UI that it's listening on `2000`. Without this PR,
it'd listen on `1000`:

![Screenshot 2024-08-21 at 10 45
42 AM](https://github.com/user-attachments/assets/a5c7590c-1b54-4ac8-9a8b-8eb66ff67cfb)
---
 packages/react-devtools/README.md  | 2 +-
 packages/react-devtools/preload.js | 2 +-
 2 files changed, 2 insertions(+), 2 deletions(-)

diff --git a/packages/react-devtools/README.md b/packages/react-devtools/README.md
index 149ec97f8af57..8c436c1fb2b4d 100644
--- a/packages/react-devtools/README.md
+++ b/packages/react-devtools/README.md
@@ -87,7 +87,7 @@ This will ensure the developer tools are connected. **Don’t forget to remove i
 
 ## Advanced
 
-By default DevTools listen to port `8097` on `localhost`. If you need to customize host, port, or other settings, see the `react-devtools-core` package instead.
+By default DevTools listen to port `8097` on `localhost`. The port can be modified by setting the `REACT_DEVTOOLS_PORT` environment variable. If you need to further customize host, port, or other settings, see the `react-devtools-core` package instead.
 
 ## FAQ
 
diff --git a/packages/react-devtools/preload.js b/packages/react-devtools/preload.js
index 634cffc635a40..33a9e3d6dd46e 100644
--- a/packages/react-devtools/preload.js
+++ b/packages/react-devtools/preload.js
@@ -35,7 +35,7 @@ contextBridge.exposeInMainWorld('api', {
     }
     const host = process.env.HOST || 'localhost';
     const protocol = useHttps ? 'https' : 'http';
-    const port = +process.env.PORT || 8097;
+    const port = +process.env.REACT_DEVTOOLS_PORT || +process.env.PORT || 8097;
     return {options, useHttps, host, protocol, port};
   },
 });

From 899e3d1297ec15a5aa8d73e2f1bd478918090a12 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 11 Feb 2025 13:52:25 -0500
Subject: [PATCH 39/72] [crud] Narrow resource type (#32203)

Small refactor to the `resource` type to narrow it to an arbitrary
object or void/null instead of the top type. This makes the overload on
useEffect simpler since the return type of create is no longer widened
to the top type when we merge their definitions.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32203).
* #32206
* #32205
* #32204
* __->__ #32203
---
 .../react-debug-tools/src/ReactDebugHooks.js  |  6 +-
 .../src/ReactFiberCallUserSpace.js            |  2 +-
 .../src/ReactFiberCommitEffects.js            |  8 +-
 .../react-reconciler/src/ReactFiberHooks.js   | 78 +++++++++----------
 .../src/ReactInternalTypes.js                 |  6 +-
 packages/react/src/ReactHooks.js              |  6 +-
 6 files changed, 54 insertions(+), 52 deletions(-)

diff --git a/packages/react-debug-tools/src/ReactDebugHooks.js b/packages/react-debug-tools/src/ReactDebugHooks.js
index f30489b7f655f..9c310723b2605 100644
--- a/packages/react-debug-tools/src/ReactDebugHooks.js
+++ b/packages/react-debug-tools/src/ReactDebugHooks.js
@@ -739,11 +739,11 @@ function useHostTransitionStatus(): TransitionStatus {
 }
 
 function useResourceEffect(
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   nextHook();
   hookLog.push({
diff --git a/packages/react-reconciler/src/ReactFiberCallUserSpace.js b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
index a1b86c7560a2a..dd7beecd93582 100644
--- a/packages/react-reconciler/src/ReactFiberCallUserSpace.js
+++ b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
@@ -183,7 +183,7 @@ export const callComponentWillUnmountInDEV: (
 const callCreate = {
   'react-stack-bottom-frame': function (
     effect: Effect,
-  ): (() => void) | mixed | void {
+  ): (() => void) | {...} | void | null {
     if (!enableUseResourceEffectHook) {
       if (effect.resourceKind != null) {
         if (__DEV__) {
diff --git a/packages/react-reconciler/src/ReactFiberCommitEffects.js b/packages/react-reconciler/src/ReactFiberCommitEffects.js
index 6873bdf9e7a63..a8e08721eed5f 100644
--- a/packages/react-reconciler/src/ReactFiberCommitEffects.js
+++ b/packages/react-reconciler/src/ReactFiberCommitEffects.js
@@ -274,6 +274,7 @@ export function commitHookEffectListMount(
                 addendum =
                   ' You returned null. If your effect does not require clean ' +
                   'up, return undefined (or nothing).';
+                // $FlowFixMe (@poteto) this check is safe on arbitrary non-null/void objects
               } else if (typeof destroy.then === 'function') {
                 addendum =
                   '\n\nIt looks like you wrote ' +
@@ -1036,10 +1037,10 @@ function safelyCallDestroy(
 function safelyCallDestroyWithResource(
   current: Fiber,
   nearestMountedAncestor: Fiber | null,
-  destroy: mixed => void,
-  resource: mixed,
+  destroy: ({...}) => void,
+  resource: {...},
 ) {
-  const destroy_ = resource == null ? destroy : destroy.bind(null, resource);
+  const destroy_ = destroy.bind(null, resource);
   if (__DEV__) {
     runWithFiberInDEV(
       current,
@@ -1050,6 +1051,7 @@ function safelyCallDestroyWithResource(
     );
   } else {
     try {
+      // $FlowFixMe(incompatible-call) Already bound to resource
       destroy_();
     } catch (error) {
       captureCommitPhaseError(current, nearestMountedAncestor, error);
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index f3a581a97476a..9d97710003317 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -205,8 +205,8 @@ export type Hook = {
 // the additional memory and we can follow up with performance
 // optimizations later.
 type EffectInstance = {
-  resource: mixed,
-  destroy: void | (() => void) | ((resource: mixed) => void),
+  resource: {...} | void | null,
+  destroy: void | (() => void) | ((resource: {...} | void | null) => void),
 };
 
 export const ResourceEffectIdentityKind: 0 = 0;
@@ -229,7 +229,7 @@ export type ResourceEffectIdentity = {
   resourceKind: typeof ResourceEffectIdentityKind,
   tag: HookFlags,
   inst: EffectInstance,
-  create: () => mixed,
+  create: () => {...} | void | null,
   deps: Array<mixed> | void | null,
   next: Effect,
 };
@@ -237,7 +237,7 @@ export type ResourceEffectUpdate = {
   resourceKind: typeof ResourceEffectUpdateKind,
   tag: HookFlags,
   inst: EffectInstance,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   deps: Array<mixed> | void | null,
   next: Effect,
   identity: ResourceEffectIdentity,
@@ -2540,9 +2540,9 @@ function pushResourceEffect(
   identityTag: HookFlags,
   updateTag: HookFlags,
   inst: EffectInstance,
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
 ): Effect {
   const effectIdentity: ResourceEffectIdentity = {
@@ -2694,11 +2694,11 @@ function updateEffect(
 }
 
 function mountResourceEffect(
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   if (
     __DEV__ &&
@@ -2730,11 +2730,11 @@ function mountResourceEffect(
 function mountResourceEffectImpl(
   fiberFlags: Flags,
   hookFlags: HookFlags,
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   const hook = mountWorkInProgressHook();
   currentlyRenderingFiber.flags |= fiberFlags;
@@ -2752,11 +2752,11 @@ function mountResourceEffectImpl(
 }
 
 function updateResourceEffect(
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   updateResourceEffectImpl(
     PassiveEffect,
@@ -2772,11 +2772,11 @@ function updateResourceEffect(
 function updateResourceEffectImpl(
   fiberFlags: Flags,
   hookFlags: HookFlags,
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ) {
   const hook = updateWorkInProgressHook();
   const effect: Effect = hook.memoizedState;
@@ -4245,11 +4245,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (HooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ): void {
         currentHookNameInDev = 'useResourceEffect';
         mountHookTypesDev();
@@ -4433,11 +4433,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ): void {
         currentHookNameInDev = 'useResourceEffect';
         updateHookTypesDev();
@@ -4620,11 +4620,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (HooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ) {
         currentHookNameInDev = 'useResourceEffect';
         updateHookTypesDev();
@@ -4807,11 +4807,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (HooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ) {
         currentHookNameInDev = 'useResourceEffect';
         updateHookTypesDev();
@@ -5019,11 +5019,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (InvalidNestedHooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ): void {
         currentHookNameInDev = 'useResourceEffect';
         warnInvalidHookAccess();
@@ -5232,11 +5232,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (InvalidNestedHooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ) {
         currentHookNameInDev = 'useResourceEffect';
         warnInvalidHookAccess();
@@ -5445,11 +5445,11 @@ if (__DEV__) {
   if (enableUseResourceEffectHook) {
     (InvalidNestedHooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
-        create: () => mixed,
+        create: () => {...} | void | null,
         createDeps: Array<mixed> | void | null,
-        update: ((resource: mixed) => void) | void,
+        update: ((resource: {...} | void | null) => void) | void,
         updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: mixed) => void) | void,
+        destroy: ((resource: {...} | void | null) => void) | void,
       ) {
         currentHookNameInDev = 'useResourceEffect';
         warnInvalidHookAccess();
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index 0c5504cab468e..e31b7cefd1ed7 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -398,11 +398,11 @@ export type Dispatcher = {
   useEffectEvent?: <Args, F: (...Array<Args>) => mixed>(callback: F) => F,
   // TODO: Non-nullable once `enableUseResourceEffectHook` is on everywhere.
   useResourceEffect?: (
-    create: () => mixed,
+    create: () => {...} | void | null,
     createDeps: Array<mixed> | void | null,
-    update: ((resource: mixed) => void) | void,
+    update: ((resource: {...} | void | null) => void) | void,
     updateDeps: Array<mixed> | void | null,
-    destroy: ((resource: mixed) => void) | void,
+    destroy: ((resource: {...} | void | null) => void) | void,
   ) => void,
   useInsertionEffect(
     create: () => (() => void) | void,
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index 32f49268880f0..ff45b5415c416 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -202,11 +202,11 @@ export function useEffectEvent<Args, F: (...Array<Args>) => mixed>(
 }
 
 export function useResourceEffect(
-  create: () => mixed,
+  create: () => {...} | void | null,
   createDeps: Array<mixed> | void | null,
-  update: ((resource: mixed) => void) | void,
+  update: ((resource: {...} | void | null) => void) | void,
   updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: mixed) => void) | void,
+  destroy: ((resource: {...} | void | null) => void) | void,
 ): void {
   if (!enableUseResourceEffectHook) {
     throw new Error('Not implemented.');

From 0461c0d8a49730d1c8ebca2071d9bb7adfc8ac92 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 11 Feb 2025 14:05:50 -0500
Subject: [PATCH 40/72] [crud] Rename useResourceEffect flag (#32204)

Rename the flag in preparation for the overload.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32204).
* #32206
* #32205
* __->__ #32204
---
 .../ReactDOMServerIntegrationHooks-test.js    |  2 +-
 .../src/ReactFiberCallUserSpace.js            |  6 ++--
 .../src/ReactFiberCommitEffects.js            | 16 +++++-----
 .../react-reconciler/src/ReactFiberHooks.js   | 24 +++++++-------
 .../src/ReactInternalTypes.js                 |  2 +-
 .../ReactHooksWithNoopRenderer-test.js        | 32 +++++++++----------
 packages/react-server/src/ReactFizzHooks.js   |  4 +--
 packages/react/src/ReactClient.js             |  4 +--
 packages/react/src/ReactHooks.js              |  4 +--
 packages/shared/ReactFeatureFlags.js          |  2 +-
 .../ReactFeatureFlags.native-fb-dynamic.js    |  2 +-
 .../forks/ReactFeatureFlags.native-fb.js      |  2 +-
 .../forks/ReactFeatureFlags.native-oss.js     |  2 +-
 .../forks/ReactFeatureFlags.test-renderer.js  |  2 +-
 ...actFeatureFlags.test-renderer.native-fb.js |  2 +-
 .../ReactFeatureFlags.test-renderer.www.js    |  2 +-
 .../forks/ReactFeatureFlags.www-dynamic.js    |  2 +-
 .../shared/forks/ReactFeatureFlags.www.js     |  2 +-
 18 files changed, 56 insertions(+), 56 deletions(-)

diff --git a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
index b79e59ad004dd..bce830ddf0647 100644
--- a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
@@ -657,7 +657,7 @@ describe('ReactDOMServerHooks', () => {
 
   describe('useResourceEffect', () => {
     gate(flags => {
-      if (flags.enableUseResourceEffectHook) {
+      if (flags.enableUseEffectCRUDOverload) {
         const yields = [];
         itRenders(
           'should ignore resource effects on the server',
diff --git a/packages/react-reconciler/src/ReactFiberCallUserSpace.js b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
index dd7beecd93582..25ede645b5e7f 100644
--- a/packages/react-reconciler/src/ReactFiberCallUserSpace.js
+++ b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
@@ -18,7 +18,7 @@ import {
   ResourceEffectIdentityKind,
   ResourceEffectUpdateKind,
 } from './ReactFiberHooks';
-import {enableUseResourceEffectHook} from 'shared/ReactFeatureFlags';
+import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
 
 // These indirections exists so we can exclude its stack frame in DEV (and anything below it).
 // TODO: Consider marking the whole bundle instead of these boundaries.
@@ -184,11 +184,11 @@ const callCreate = {
   'react-stack-bottom-frame': function (
     effect: Effect,
   ): (() => void) | {...} | void | null {
-    if (!enableUseResourceEffectHook) {
+    if (!enableUseEffectCRUDOverload) {
       if (effect.resourceKind != null) {
         if (__DEV__) {
           console.error(
-            'Expected only SimpleEffects when enableUseResourceEffectHook is disabled, ' +
+            'Expected only SimpleEffects when enableUseEffectCRUDOverload is disabled, ' +
               'got %s',
             effect.resourceKind,
           );
diff --git a/packages/react-reconciler/src/ReactFiberCommitEffects.js b/packages/react-reconciler/src/ReactFiberCommitEffects.js
index a8e08721eed5f..29e5de2817201 100644
--- a/packages/react-reconciler/src/ReactFiberCommitEffects.js
+++ b/packages/react-reconciler/src/ReactFiberCommitEffects.js
@@ -22,7 +22,7 @@ import {
   enableProfilerCommitHooks,
   enableProfilerNestedUpdatePhase,
   enableSchedulingProfiler,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
   enableViewTransition,
 } from 'shared/ReactFeatureFlags';
 import {
@@ -160,7 +160,7 @@ export function commitHookEffectListMount(
 
           // Mount
           let destroy;
-          if (enableUseResourceEffectHook) {
+          if (enableUseEffectCRUDOverload) {
             if (effect.resourceKind === ResourceEffectIdentityKind) {
               if (__DEV__) {
                 effect.inst.resource = runWithFiberInDEV(
@@ -200,7 +200,7 @@ export function commitHookEffectListMount(
             if ((flags & HookInsertion) !== NoHookEffect) {
               setIsRunningInsertionEffect(true);
             }
-            if (enableUseResourceEffectHook) {
+            if (enableUseEffectCRUDOverload) {
               if (effect.resourceKind == null) {
                 destroy = runWithFiberInDEV(
                   finishedWork,
@@ -219,7 +219,7 @@ export function commitHookEffectListMount(
               setIsRunningInsertionEffect(false);
             }
           } else {
-            if (enableUseResourceEffectHook) {
+            if (enableUseEffectCRUDOverload) {
               if (effect.resourceKind == null) {
                 const create = effect.create;
                 const inst = effect.inst;
@@ -230,7 +230,7 @@ export function commitHookEffectListMount(
               if (effect.resourceKind != null) {
                 if (__DEV__) {
                   console.error(
-                    'Expected only SimpleEffects when enableUseResourceEffectHook is disabled, ' +
+                    'Expected only SimpleEffects when enableUseEffectCRUDOverload is disabled, ' +
                       'got %s',
                     effect.resourceKind,
                   );
@@ -262,7 +262,7 @@ export function commitHookEffectListMount(
               } else if ((effect.tag & HookInsertion) !== NoFlags) {
                 hookName = 'useInsertionEffect';
               } else if (
-                enableUseResourceEffectHook &&
+                enableUseEffectCRUDOverload &&
                 effect.resourceKind != null
               ) {
                 hookName = 'useResourceEffect';
@@ -338,7 +338,7 @@ export function commitHookEffectListUnmount(
           const inst = effect.inst;
           const destroy = inst.destroy;
           if (destroy !== undefined) {
-            if (enableUseResourceEffectHook) {
+            if (enableUseEffectCRUDOverload) {
               if (effect.resourceKind == null) {
                 inst.destroy = undefined;
               }
@@ -358,7 +358,7 @@ export function commitHookEffectListUnmount(
                 setIsRunningInsertionEffect(true);
               }
             }
-            if (enableUseResourceEffectHook) {
+            if (enableUseEffectCRUDOverload) {
               if (
                 effect.resourceKind === ResourceEffectIdentityKind &&
                 effect.inst.resource != null
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 9d97710003317..87f601dae597d 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -38,7 +38,7 @@ import {
   enableSchedulingProfiler,
   enableTransitionTracing,
   enableUseEffectEventHook,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
   enableLegacyCache,
   disableLegacyMode,
   enableNoCloningMemoCache,
@@ -3938,7 +3938,7 @@ export const ContextOnlyDispatcher: Dispatcher = {
 if (enableUseEffectEventHook) {
   (ContextOnlyDispatcher: Dispatcher).useEffectEvent = throwInvalidHookError;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   (ContextOnlyDispatcher: Dispatcher).useResourceEffect = throwInvalidHookError;
 }
 
@@ -3971,7 +3971,7 @@ const HooksDispatcherOnMount: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnMount: Dispatcher).useEffectEvent = mountEvent;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   (HooksDispatcherOnMount: Dispatcher).useResourceEffect = mountResourceEffect;
 }
 
@@ -4004,7 +4004,7 @@ const HooksDispatcherOnUpdate: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnUpdate: Dispatcher).useEffectEvent = updateEvent;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   (HooksDispatcherOnUpdate: Dispatcher).useResourceEffect =
     updateResourceEffect;
 }
@@ -4038,7 +4038,7 @@ const HooksDispatcherOnRerender: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnRerender: Dispatcher).useEffectEvent = updateEvent;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   (HooksDispatcherOnRerender: Dispatcher).useResourceEffect =
     updateResourceEffect;
 }
@@ -4242,7 +4242,7 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (HooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -4430,7 +4430,7 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -4617,7 +4617,7 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (HooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -4804,7 +4804,7 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (HooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -5016,7 +5016,7 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (InvalidNestedHooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -5229,7 +5229,7 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (InvalidNestedHooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
@@ -5442,7 +5442,7 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseResourceEffectHook) {
+  if (enableUseEffectCRUDOverload) {
     (InvalidNestedHooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
       function useResourceEffect(
         create: () => {...} | void | null,
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index e31b7cefd1ed7..9ac0680fb6279 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -396,7 +396,7 @@ export type Dispatcher = {
   ): void,
   // TODO: Non-nullable once `enableUseEffectEventHook` is on everywhere.
   useEffectEvent?: <Args, F: (...Array<Args>) => mixed>(callback: F) => F,
-  // TODO: Non-nullable once `enableUseResourceEffectHook` is on everywhere.
+  // TODO: Non-nullable once `enableUseEffectCRUDOverload` is on everywhere.
   useResourceEffect?: (
     create: () => {...} | void | null,
     createDeps: Array<mixed> | void | null,
diff --git a/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js b/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
index e4febdb3e28f1..27bff1e0806c4 100644
--- a/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
@@ -3311,7 +3311,7 @@ describe('ReactHooksWithNoopRenderer', () => {
     });
   });
 
-  // @gate enableUseResourceEffectHook
+  // @gate enableUseEffectCRUDOverload
   describe('useResourceEffect', () => {
     class Resource {
       isDeleted: false;
@@ -3333,12 +3333,12 @@ describe('ReactHooksWithNoopRenderer', () => {
       }
     }
 
-    // @gate !enableUseResourceEffectHook
+    // @gate !enableUseEffectCRUDOverload
     it('is null when flag is disabled', async () => {
       expect(useResourceEffect).toBeUndefined();
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('validates create return value', async () => {
       function App({id}) {
         useResourceEffect(() => {
@@ -3359,7 +3359,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       );
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('validates non-empty update deps', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3386,7 +3386,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       ]);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('simple mount and update', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3443,7 +3443,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['destroy(2, Jack)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('simple mount with no update', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3480,7 +3480,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['destroy(1, Jack)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('calls update on every render if no deps are specified', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3523,7 +3523,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['update(2, Lauren)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('does not unmount previous useResourceEffect between updates', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3562,7 +3562,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['update(0)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('unmounts only on deletion', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3596,7 +3596,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       expect(ReactNoop).toMatchRenderedOutput(null);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('unmounts on deletion', async () => {
       function Wrapper(props) {
         return <App {...props} />;
@@ -3650,7 +3650,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       expect(ReactNoop).toMatchRenderedOutput(null);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('handles errors in create on mount', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3700,7 +3700,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       expect(ReactNoop).toMatchRenderedOutput(null);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('handles errors in create on update', async () => {
       function App({id}) {
         useResourceEffect(
@@ -3744,7 +3744,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       }).rejects.toThrow('Oops error!');
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('handles errors in destroy on update', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3800,7 +3800,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       expect(ReactNoop).toMatchRenderedOutput(null);
     });
 
-    // @gate enableUseResourceEffectHook && enableActivity
+    // @gate enableUseEffectCRUDOverload && enableActivity
     it('composes with activity', async () => {
       function App({id, username}) {
         const opts = useMemo(() => {
@@ -3873,7 +3873,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       assertLog(['destroy(0, Lauren)']);
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('composes with suspense', async () => {
       function TextBox({text}) {
         return <AsyncText text={text} ms={0} />;
@@ -3991,7 +3991,7 @@ describe('ReactHooksWithNoopRenderer', () => {
       );
     });
 
-    // @gate enableUseResourceEffectHook
+    // @gate enableUseEffectCRUDOverload
     it('composes with other kinds of effects', async () => {
       let rerender;
       function App({id, username}) {
diff --git a/packages/react-server/src/ReactFizzHooks.js b/packages/react-server/src/ReactFizzHooks.js
index 0db0b00b3bdee..63e8576ca788c 100644
--- a/packages/react-server/src/ReactFizzHooks.js
+++ b/packages/react-server/src/ReactFizzHooks.js
@@ -40,7 +40,7 @@ import {createFastHash} from './ReactServerStreamConfig';
 
 import {
   enableUseEffectEventHook,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
 } from 'shared/ReactFeatureFlags';
 import is from 'shared/objectIs';
 import {
@@ -866,7 +866,7 @@ export const HooksDispatcher: Dispatcher = supportsClientAPIs
 if (enableUseEffectEventHook) {
   HooksDispatcher.useEffectEvent = useEffectEvent;
 }
-if (enableUseResourceEffectHook) {
+if (enableUseEffectCRUDOverload) {
   HooksDispatcher.useResourceEffect = supportsClientAPIs
     ? noop
     : clientHookNotSupported;
diff --git a/packages/react/src/ReactClient.js b/packages/react/src/ReactClient.js
index f633c7617d275..2bacbc85676fd 100644
--- a/packages/react/src/ReactClient.js
+++ b/packages/react/src/ReactClient.js
@@ -65,7 +65,7 @@ import {addTransitionType} from './ReactTransitionType';
 import {act} from './ReactAct';
 import {captureOwnerStack} from './ReactOwnerStack';
 import * as ReactCompilerRuntime from './ReactCompilerRuntime';
-import {enableUseResourceEffectHook} from 'shared/ReactFeatureFlags';
+import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
 
 const Children = {
   map,
@@ -134,4 +134,4 @@ export {
 };
 
 export const experimental_useResourceEffect: typeof useResourceEffect | void =
-  enableUseResourceEffectHook ? useResourceEffect : undefined;
+  enableUseEffectCRUDOverload ? useResourceEffect : undefined;
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index ff45b5415c416..677e0d705b8aa 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -18,7 +18,7 @@ import {REACT_CONSUMER_TYPE} from 'shared/ReactSymbols';
 
 import ReactSharedInternals from 'shared/ReactSharedInternals';
 
-import {enableUseResourceEffectHook} from 'shared/ReactFeatureFlags';
+import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
 
 type BasicStateAction<S> = (S => S) | S;
 type Dispatch<A> = A => void;
@@ -208,7 +208,7 @@ export function useResourceEffect(
   updateDeps: Array<mixed> | void | null,
   destroy: ((resource: {...} | void | null) => void) | void,
 ): void {
-  if (!enableUseResourceEffectHook) {
+  if (!enableUseEffectCRUDOverload) {
     throw new Error('Not implemented.');
   }
   const dispatcher = resolveDispatcher();
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index 290d5ba159d68..1cb1cb4cf7dc0 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -150,7 +150,7 @@ export const enableInfiniteRenderLoopDetection = false;
 /**
  * Experimental new hook for better managing resources in effects.
  */
-export const enableUseResourceEffectHook = false;
+export const enableUseEffectCRUDOverload = false;
 
 export const enableFastAddPropertiesInDiffing = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index 6aaefdfa336fe..001b3d64c06dc 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -24,7 +24,7 @@ export const enablePersistedModeClonedFlag = __VARIANT__;
 export const enableShallowPropDiffing = __VARIANT__;
 export const passChildrenWhenCloningPersistedNodes = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
-export const enableUseResourceEffectHook = __VARIANT__;
+export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableOwnerStacks = __VARIANT__;
 export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 878d344a42a41..6e82185b5d98c 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -24,7 +24,7 @@ export const {
   enableObjectFiber,
   enablePersistedModeClonedFlag,
   enableShallowPropDiffing,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
   passChildrenWhenCloningPersistedNodes,
   enableSiblingPrerendering,
   enableOwnerStacks,
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index a3202c0b80049..3f373e998cd8e 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -63,7 +63,7 @@ export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
 export const enableSiblingPrerendering = true;
-export const enableUseResourceEffectHook = false;
+export const enableUseEffectCRUDOverload = false;
 
 export const enableHydrationLaneScheduling = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index 6bc085f540b23..da9b8a2612c9b 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -64,7 +64,7 @@ export const renameElementSymbol = true;
 export const enableShallowPropDiffing = false;
 export const enableSiblingPrerendering = true;
 
-export const enableUseResourceEffectHook = false;
+export const enableUseEffectCRUDOverload = false;
 
 export const enableYieldingBeforePassive = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index d62a59122f82c..8c20cc28deb15 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -62,7 +62,7 @@ export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
 export const enableSiblingPrerendering = true;
-export const enableUseResourceEffectHook = true;
+export const enableUseEffectCRUDOverload = true;
 export const enableHydrationLaneScheduling = true;
 export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index 301c01a018090..bc30992eb6eb5 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -74,7 +74,7 @@ export const enableOwnerStacks = false;
 export const enableShallowPropDiffing = false;
 export const enableSiblingPrerendering = true;
 
-export const enableUseResourceEffectHook = false;
+export const enableUseEffectCRUDOverload = false;
 
 export const enableHydrationLaneScheduling = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
index e6fd46d0b1fb4..3cab1318c490e 100644
--- a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
@@ -36,7 +36,7 @@ export const enableSchedulingProfiler = __VARIANT__;
 export const enableInfiniteRenderLoopDetection = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 
-export const enableUseResourceEffectHook = __VARIANT__;
+export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
 export const enableViewTransition = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index dcb77f9d84b5e..57be83577c956 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -29,7 +29,7 @@ export const {
   enableSiblingPrerendering,
   enableTransitionTracing,
   enableTrustedTypesIntegration,
-  enableUseResourceEffectHook,
+  enableUseEffectCRUDOverload,
   favorSafetyOverHydrationPerf,
   renameElementSymbol,
   retryLaneExpirationMs,

From 2c5fd26c07c0fb94ff21a6c10c5a757ef3c5d6a4 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 11 Feb 2025 14:18:50 -0500
Subject: [PATCH 41/72] [crud] Merge useResourceEffect into useEffect (#32205)

Merges the useResourceEffect API into useEffect while keeping the
underlying implementation the same. useResourceEffect will be removed in
the next diff.

To fork between behavior we rely on a `typeof` check for the updater or
destroy function in addition to the CRUD feature flag. This does now
have to be checked every time (instead of inlined statically like before
due to them being different hooks) which will incur some non-zero amount
(possibly negligble) of overhead for every effect.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32205).
* #32206
* __->__ #32205
---
 .../react-debug-tools/src/ReactDebugHooks.js  |   7 +-
 .../ReactDOMServerIntegrationHooks-test.js    |   6 +-
 .../src/ReactFiberCallUserSpace.js            |   2 +-
 .../src/ReactFiberCommitEffects.js            |  41 +--
 .../react-reconciler/src/ReactFiberHooks.js   | 268 ++++++++++++++----
 .../src/ReactInternalTypes.js                 |   7 +-
 .../ReactHooksWithNoopRenderer-test.js        |  70 +++--
 packages/react/src/ReactHooks.js              |  26 +-
 scripts/error-codes/codes.json                |   3 +-
 9 files changed, 296 insertions(+), 134 deletions(-)

diff --git a/packages/react-debug-tools/src/ReactDebugHooks.js b/packages/react-debug-tools/src/ReactDebugHooks.js
index 9c310723b2605..f45ccfecdcaec 100644
--- a/packages/react-debug-tools/src/ReactDebugHooks.js
+++ b/packages/react-debug-tools/src/ReactDebugHooks.js
@@ -373,8 +373,11 @@ function useInsertionEffect(
 }
 
 function useEffect(
-  create: () => (() => void) | void,
-  inputs: Array<mixed> | void | null,
+  create: (() => (() => void) | void) | (() => {...} | void | null),
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
   nextHook();
   hookLog.push({
diff --git a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
index bce830ddf0647..840d6c5b15d5e 100644
--- a/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
+++ b/packages/react-dom/src/__tests__/ReactDOMServerIntegrationHooks-test.js
@@ -27,7 +27,6 @@ let useRef;
 let useImperativeHandle;
 let useInsertionEffect;
 let useLayoutEffect;
-let useResourceEffect;
 let useDebugValue;
 let forwardRef;
 let yieldedValues;
@@ -52,7 +51,6 @@ function initModules() {
   useImperativeHandle = React.useImperativeHandle;
   useInsertionEffect = React.useInsertionEffect;
   useLayoutEffect = React.useLayoutEffect;
-  useResourceEffect = React.experimental_useResourceEffect;
   forwardRef = React.forwardRef;
 
   yieldedValues = [];
@@ -655,7 +653,7 @@ describe('ReactDOMServerHooks', () => {
     });
   });
 
-  describe('useResourceEffect', () => {
+  describe('useEffect with CRUD overload', () => {
     gate(flags => {
       if (flags.enableUseEffectCRUDOverload) {
         const yields = [];
@@ -663,7 +661,7 @@ describe('ReactDOMServerHooks', () => {
           'should ignore resource effects on the server',
           async render => {
             function Counter(props) {
-              useResourceEffect(
+              useEffect(
                 () => {
                   yieldValue('created on client');
                   return {resource_counter: props.count};
diff --git a/packages/react-reconciler/src/ReactFiberCallUserSpace.js b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
index 25ede645b5e7f..a9b5590f387b7 100644
--- a/packages/react-reconciler/src/ReactFiberCallUserSpace.js
+++ b/packages/react-reconciler/src/ReactFiberCallUserSpace.js
@@ -254,7 +254,7 @@ const callDestroy = {
 export const callDestroyInDEV: (
   current: Fiber,
   nearestMountedAncestor: Fiber | null,
-  destroy: () => void,
+  destroy: (() => void) | (({...}) => void),
 ) => void = __DEV__
   ? // We use this technique to trick minifiers to preserve the function name.
     (callDestroy['react-stack-bottom-frame'].bind(callDestroy): any)
diff --git a/packages/react-reconciler/src/ReactFiberCommitEffects.js b/packages/react-reconciler/src/ReactFiberCommitEffects.js
index 29e5de2817201..05cf17a34273e 100644
--- a/packages/react-reconciler/src/ReactFiberCommitEffects.js
+++ b/packages/react-reconciler/src/ReactFiberCommitEffects.js
@@ -170,8 +170,9 @@ export function commitHookEffectListMount(
                 );
                 if (effect.inst.resource == null) {
                   console.error(
-                    'useResourceEffect must provide a callback which returns a resource. ' +
-                      'If a managed resource is not needed here, use useEffect. Received %s',
+                    'useEffect must provide a callback which returns a resource. ' +
+                      'If a managed resource is not needed here, do not provide an updater or ' +
+                      'destroy callback. Received %s',
                     effect.inst.resource,
                   );
                 }
@@ -261,11 +262,6 @@ export function commitHookEffectListMount(
                 hookName = 'useLayoutEffect';
               } else if ((effect.tag & HookInsertion) !== NoFlags) {
                 hookName = 'useInsertionEffect';
-              } else if (
-                enableUseEffectCRUDOverload &&
-                effect.resourceKind != null
-              ) {
-                hookName = 'useResourceEffect';
               } else {
                 hookName = 'useEffect';
               }
@@ -363,7 +359,7 @@ export function commitHookEffectListUnmount(
                 effect.resourceKind === ResourceEffectIdentityKind &&
                 effect.inst.resource != null
               ) {
-                safelyCallDestroyWithResource(
+                safelyCallDestroy(
                   finishedWork,
                   nearestMountedAncestor,
                   destroy,
@@ -1015,32 +1011,11 @@ export function safelyDetachRef(
 function safelyCallDestroy(
   current: Fiber,
   nearestMountedAncestor: Fiber | null,
-  destroy: () => void,
-) {
-  if (__DEV__) {
-    runWithFiberInDEV(
-      current,
-      callDestroyInDEV,
-      current,
-      nearestMountedAncestor,
-      destroy,
-    );
-  } else {
-    try {
-      destroy();
-    } catch (error) {
-      captureCommitPhaseError(current, nearestMountedAncestor, error);
-    }
-  }
-}
-
-function safelyCallDestroyWithResource(
-  current: Fiber,
-  nearestMountedAncestor: Fiber | null,
-  destroy: ({...}) => void,
-  resource: {...},
+  destroy: (() => void) | (({...}) => void),
+  resource?: {...} | void | null,
 ) {
-  const destroy_ = destroy.bind(null, resource);
+  // $FlowFixMe[extra-arg] @poteto this is safe either way because the extra arg is ignored if it's not a CRUD effect
+  const destroy_ = resource == null ? destroy : destroy.bind(null, resource);
   if (__DEV__) {
     runWithFiberInDEV(
       current,
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 87f601dae597d..976657d4c68f7 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -2523,12 +2523,15 @@ function pushSimpleEffect(
   tag: HookFlags,
   inst: EffectInstance,
   create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): Effect {
   const effect: Effect = {
     tag,
     create,
-    deps,
+    deps: createDeps,
     inst,
     // Circular
     next: (null: any),
@@ -2608,10 +2611,13 @@ function mountEffectImpl(
   fiberFlags: Flags,
   hookFlags: HookFlags,
   create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
   const hook = mountWorkInProgressHook();
-  const nextDeps = deps === undefined ? null : deps;
+  const nextDeps = createDeps === undefined ? null : createDeps;
   currentlyRenderingFiber.flags |= fiberFlags;
   hook.memoizedState = pushSimpleEffect(
     HookHasEffect | hookFlags,
@@ -2662,35 +2668,89 @@ function updateEffectImpl(
 }
 
 function mountEffect(
-  create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  create: (() => (() => void) | void) | (() => {...} | void | null),
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
   if (
     __DEV__ &&
     (currentlyRenderingFiber.mode & StrictEffectsMode) !== NoMode &&
     (currentlyRenderingFiber.mode & NoStrictPassiveEffectsMode) === NoMode
   ) {
-    mountEffectImpl(
-      MountPassiveDevEffect | PassiveEffect | PassiveStaticEffect,
-      HookPassive,
-      create,
-      deps,
-    );
+    if (
+      enableUseEffectCRUDOverload &&
+      (typeof update === 'function' || typeof destroy === 'function')
+    ) {
+      mountResourceEffectImpl(
+        MountPassiveDevEffect | PassiveEffect | PassiveStaticEffect,
+        HookPassive,
+        create,
+        createDeps,
+        update,
+        updateDeps,
+        destroy,
+      );
+    } else {
+      mountEffectImpl(
+        MountPassiveDevEffect | PassiveEffect | PassiveStaticEffect,
+        HookPassive,
+        // $FlowFixMe[incompatible-call] @poteto it's not possible to narrow `create` without calling it.
+        create,
+        createDeps,
+      );
+    }
   } else {
-    mountEffectImpl(
-      PassiveEffect | PassiveStaticEffect,
-      HookPassive,
-      create,
-      deps,
-    );
+    if (
+      enableUseEffectCRUDOverload &&
+      (typeof update === 'function' || typeof destroy === 'function')
+    ) {
+      mountResourceEffectImpl(
+        PassiveEffect | PassiveStaticEffect,
+        HookPassive,
+        create,
+        createDeps,
+        update,
+        updateDeps,
+        destroy,
+      );
+    } else {
+      mountEffectImpl(
+        PassiveEffect | PassiveStaticEffect,
+        HookPassive,
+        // $FlowFixMe[incompatible-call] @poteto it's not possible to narrow `create` without calling it.
+        create,
+        createDeps,
+      );
+    }
   }
 }
 
 function updateEffect(
-  create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  create: (() => (() => void) | void) | (() => {...} | void | null),
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
-  updateEffectImpl(PassiveEffect, HookPassive, create, deps);
+  if (
+    enableUseEffectCRUDOverload &&
+    (typeof update === 'function' || typeof destroy === 'function')
+  ) {
+    updateResourceEffectImpl(
+      PassiveEffect,
+      HookPassive,
+      create,
+      createDeps,
+      update,
+      updateDeps,
+      destroy,
+    );
+  } else {
+    // $FlowFixMe[incompatible-call] @poteto it's not possible to narrow `create` without calling it.
+    updateEffectImpl(PassiveEffect, HookPassive, create, createDeps);
+  }
 }
 
 function mountResourceEffect(
@@ -2705,15 +2765,6 @@ function mountResourceEffect(
     (currentlyRenderingFiber.mode & StrictEffectsMode) !== NoMode &&
     (currentlyRenderingFiber.mode & NoStrictPassiveEffectsMode) === NoMode
   ) {
-    mountResourceEffectImpl(
-      MountPassiveDevEffect | PassiveEffect | PassiveStaticEffect,
-      HookPassive,
-      create,
-      createDeps,
-      update,
-      updateDeps,
-      destroy,
-    );
   } else {
     mountResourceEffectImpl(
       PassiveEffect | PassiveStaticEffect,
@@ -4087,13 +4138,30 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       mountHookTypesDev();
-      checkDepsAreArrayDev(deps);
-      return mountEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        checkDepsAreNonEmptyArrayDev(updateDeps);
+        return mountResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        checkDepsAreArrayDev(createDeps);
+        return mountEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -4280,12 +4348,28 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       updateHookTypesDev();
-      return mountEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return mountResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return mountEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -4467,12 +4551,28 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       updateHookTypesDev();
-      return updateEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return updateResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return updateEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -4654,12 +4754,28 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       updateHookTypesDev();
-      return updateEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return updateResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return updateEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -4847,13 +4963,29 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       warnInvalidHookAccess();
       mountHookTypesDev();
-      return mountEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return mountResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return mountEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -5060,13 +5192,29 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       warnInvalidHookAccess();
       updateHookTypesDev();
-      return updateEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return updateResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return updateEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
@@ -5273,13 +5421,29 @@ if (__DEV__) {
       return readContext(context);
     },
     useEffect(
-      create: () => (() => void) | void,
-      deps: Array<mixed> | void | null,
+      create: (() => (() => void) | void) | (() => {...} | void | null),
+      createDeps: Array<mixed> | void | null,
+      update?: ((resource: {...} | void | null) => void) | void,
+      updateDeps?: Array<mixed> | void | null,
+      destroy?: ((resource: {...} | void | null) => void) | void,
     ): void {
       currentHookNameInDev = 'useEffect';
       warnInvalidHookAccess();
       updateHookTypesDev();
-      return updateEffect(create, deps);
+      if (
+        enableUseEffectCRUDOverload &&
+        (typeof update === 'function' || typeof destroy === 'function')
+      ) {
+        return updateResourceEffect(
+          create,
+          createDeps,
+          update,
+          updateDeps,
+          destroy,
+        );
+      } else {
+        return updateEffect(create, createDeps);
+      }
     },
     useImperativeHandle<T>(
       ref: {current: T | null} | ((inst: T | null) => mixed) | null | void,
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index 9ac0680fb6279..756d88c4a5d15 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -391,8 +391,11 @@ export type Dispatcher = {
   useContext<T>(context: ReactContext<T>): T,
   useRef<T>(initialValue: T): {current: T},
   useEffect(
-    create: () => (() => void) | void,
-    deps: Array<mixed> | void | null,
+    create: (() => (() => void) | void) | (() => {...} | void | null),
+    createDeps: Array<mixed> | void | null,
+    update?: ((resource: {...} | void | null) => void) | void,
+    updateDeps?: Array<mixed> | void | null,
+    destroy?: ((resource: {...} | void | null) => void) | void,
   ): void,
   // TODO: Non-nullable once `enableUseEffectEventHook` is on everywhere.
   useEffectEvent?: <Args, F: (...Array<Args>) => mixed>(callback: F) => F,
diff --git a/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js b/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
index 27bff1e0806c4..47fd534e683a9 100644
--- a/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactHooksWithNoopRenderer-test.js
@@ -41,7 +41,6 @@ let waitFor;
 let waitForThrow;
 let waitForPaint;
 let assertLog;
-let useResourceEffect;
 let assertConsoleErrorDev;
 
 describe('ReactHooksWithNoopRenderer', () => {
@@ -70,7 +69,6 @@ describe('ReactHooksWithNoopRenderer', () => {
     useDeferredValue = React.useDeferredValue;
     Suspense = React.Suspense;
     Activity = React.unstable_Activity;
-    useResourceEffect = React.experimental_useResourceEffect;
     ContinuousEventPriority =
       require('react-reconciler/constants').ContinuousEventPriority;
     if (gate(flags => flags.enableSuspenseList)) {
@@ -3312,7 +3310,7 @@ describe('ReactHooksWithNoopRenderer', () => {
   });
 
   // @gate enableUseEffectCRUDOverload
-  describe('useResourceEffect', () => {
+  describe('useEffect CRUD overload', () => {
     class Resource {
       isDeleted: false;
       id: string;
@@ -3335,34 +3333,34 @@ describe('ReactHooksWithNoopRenderer', () => {
 
     // @gate !enableUseEffectCRUDOverload
     it('is null when flag is disabled', async () => {
-      expect(useResourceEffect).toBeUndefined();
-    });
-
-    // @gate enableUseEffectCRUDOverload
-    it('validates create return value', async () => {
       function App({id}) {
-        useResourceEffect(() => {
-          Scheduler.log(`create(${id})`);
-        }, [id]);
+        useEffect(
+          () => {
+            Scheduler.log(`create(${id})`);
+            return {};
+          },
+          [id],
+          () => {
+            Scheduler.log('update');
+          },
+          [],
+        );
         return null;
       }
 
-      await act(() => {
-        ReactNoop.render(<App id={1} />);
-      });
-      assertConsoleErrorDev(
-        [
-          'useResourceEffect must provide a callback which returns a resource. ' +
-            'If a managed resource is not needed here, use useEffect. Received undefined',
-        ],
-        {withoutStack: true},
+      await expect(async () => {
+        await act(() => {
+          ReactNoop.render(<App id={1} />);
+        });
+      }).rejects.toThrow(
+        'useEffect CRUD overload is not enabled in this build of React.',
       );
     });
 
     // @gate enableUseEffectCRUDOverload
     it('validates non-empty update deps', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             Scheduler.log(`create(${id})`);
             return {};
@@ -3380,7 +3378,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         ReactNoop.render(<App id={1} />);
       });
       assertConsoleErrorDev([
-        'useResourceEffect received a dependency array with no dependencies. ' +
+        'useEffect received a dependency array with no dependencies. ' +
           'When specified, the dependency array must have at least one dependency.\n' +
           '    in App (at **)',
       ]);
@@ -3392,7 +3390,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3449,7 +3447,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3486,7 +3484,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3524,9 +3522,9 @@ describe('ReactHooksWithNoopRenderer', () => {
     });
 
     // @gate enableUseEffectCRUDOverload
-    it('does not unmount previous useResourceEffect between updates', async () => {
+    it('does not unmount previous useEffect between updates', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id);
             Scheduler.log(`create(${resource.id})`);
@@ -3565,7 +3563,7 @@ describe('ReactHooksWithNoopRenderer', () => {
     // @gate enableUseEffectCRUDOverload
     it('unmounts only on deletion', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id);
             Scheduler.log(`create(${resource.id})`);
@@ -3605,7 +3603,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3653,7 +3651,7 @@ describe('ReactHooksWithNoopRenderer', () => {
     // @gate enableUseEffectCRUDOverload
     it('handles errors in create on mount', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             Scheduler.log(`Mount A [${id}]`);
             return {};
@@ -3665,7 +3663,7 @@ describe('ReactHooksWithNoopRenderer', () => {
             Scheduler.log(`Unmount A [${id}]`);
           },
         );
-        useResourceEffect(
+        useEffect(
           () => {
             Scheduler.log('Oops!');
             throw new Error('Oops!');
@@ -3703,7 +3701,7 @@ describe('ReactHooksWithNoopRenderer', () => {
     // @gate enableUseEffectCRUDOverload
     it('handles errors in create on update', async () => {
       function App({id}) {
-        useResourceEffect(
+        useEffect(
           () => {
             Scheduler.log(`Mount A [${id}]`);
             return {};
@@ -3750,7 +3748,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`Mount A [${id}, ${resource.opts.username}]`);
@@ -3806,7 +3804,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -3885,7 +3883,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         const opts = useMemo(() => {
           return {username};
         }, [username]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
@@ -4003,7 +4001,7 @@ describe('ReactHooksWithNoopRenderer', () => {
         useEffect(() => {
           Scheduler.log(`useEffect(${count})`);
         }, [count]);
-        useResourceEffect(
+        useEffect(
           () => {
             const resource = new Resource(id, opts);
             Scheduler.log(`create(${resource.id}, ${resource.opts.username})`);
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index 677e0d705b8aa..2fe6d2b85bcf1 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -87,11 +87,31 @@ export function useRef<T>(initialValue: T): {current: T} {
 }
 
 export function useEffect(
-  create: () => (() => void) | void,
-  deps: Array<mixed> | void | null,
+  create: (() => (() => void) | void) | (() => {...} | void | null),
+  createDeps: Array<mixed> | void | null,
+  update?: ((resource: {...} | void | null) => void) | void,
+  updateDeps?: Array<mixed> | void | null,
+  destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
   const dispatcher = resolveDispatcher();
-  return dispatcher.useEffect(create, deps);
+  if (
+    enableUseEffectCRUDOverload &&
+    (typeof update === 'function' || typeof destroy === 'function')
+  ) {
+    // $FlowFixMe[not-a-function] This is unstable, thus optional
+    return dispatcher.useEffect(
+      create,
+      createDeps,
+      update,
+      updateDeps,
+      destroy,
+    );
+  } else if (typeof update === 'function') {
+    throw new Error(
+      'useEffect CRUD overload is not enabled in this build of React.',
+    );
+  }
+  return dispatcher.useEffect(create, createDeps);
 }
 
 export function useInsertionEffect(
diff --git a/scripts/error-codes/codes.json b/scripts/error-codes/codes.json
index 8fa3d190ecb70..6ab654f1d35e5 100644
--- a/scripts/error-codes/codes.json
+++ b/scripts/error-codes/codes.json
@@ -530,5 +530,6 @@
   "542": "Suspense Exception: This is not a real error! It's an implementation detail of `useActionState` to interrupt the current render. You must either rethrow it immediately, or move the `useActionState` call outside of the `try/catch` block. Capturing without rethrowing will lead to unexpected behavior.\n\nTo handle async errors, wrap your component in an error boundary.",
   "543": "Expected a ResourceEffectUpdate to be pushed together with ResourceEffectIdentity. This is a bug in React.",
   "544": "Found a pair with an auto name. This is a bug in React.",
-  "545": "The %s tag may only be rendered once."
+  "545": "The %s tag may only be rendered once.",
+  "546": "useEffect CRUD overload is not enabled in this build of React."
 }

From a69b80d07e5d1bf363ed15d6209a55b35e0765c2 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 11 Feb 2025 14:19:34 -0500
Subject: [PATCH 42/72] [crud] Remove useResourceEffect (#32206)

Removes useResourceEffect.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32206).
* __->__ #32206
* #32205
---
 .../react-debug-tools/src/ReactDebugHooks.js  |  22 ---
 .../react-reconciler/src/ReactFiberHooks.js   | 158 ------------------
 .../src/ReactInternalTypes.js                 |   9 -
 packages/react-server/src/ReactFizzHooks.js   |  10 +-
 packages/react/index.development.js           |   1 -
 .../react/index.experimental.development.js   |   1 -
 packages/react/index.fb.js                    |   1 -
 packages/react/src/ReactClient.js             |   5 -
 packages/react/src/ReactHooks.js              |  21 ---
 9 files changed, 1 insertion(+), 227 deletions(-)

diff --git a/packages/react-debug-tools/src/ReactDebugHooks.js b/packages/react-debug-tools/src/ReactDebugHooks.js
index f45ccfecdcaec..114080d03e921 100644
--- a/packages/react-debug-tools/src/ReactDebugHooks.js
+++ b/packages/react-debug-tools/src/ReactDebugHooks.js
@@ -128,9 +128,6 @@ function getPrimitiveStackCache(): Map<string, Array<any>> {
 
       Dispatcher.useId();
 
-      if (typeof Dispatcher.useResourceEffect === 'function') {
-        Dispatcher.useResourceEffect(() => ({}), []);
-      }
       if (typeof Dispatcher.useEffectEvent === 'function') {
         Dispatcher.useEffectEvent((args: empty) => {});
       }
@@ -741,24 +738,6 @@ function useHostTransitionStatus(): TransitionStatus {
   return status;
 }
 
-function useResourceEffect(
-  create: () => {...} | void | null,
-  createDeps: Array<mixed> | void | null,
-  update: ((resource: {...} | void | null) => void) | void,
-  updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: {...} | void | null) => void) | void,
-) {
-  nextHook();
-  hookLog.push({
-    displayName: null,
-    primitive: 'ResourceEffect',
-    stackError: new Error(),
-    value: create,
-    debugInfo: null,
-    dispatcherHookName: 'ResourceEffect',
-  });
-}
-
 function useEffectEvent<Args, F: (...Array<Args>) => mixed>(callback: F): F {
   nextHook();
   hookLog.push({
@@ -798,7 +777,6 @@ const Dispatcher: DispatcherType = {
   useActionState,
   useHostTransitionStatus,
   useEffectEvent,
-  useResourceEffect,
 };
 
 // create a proxy to throw a custom error
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 976657d4c68f7..2ab41770bd0ac 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -3989,9 +3989,6 @@ export const ContextOnlyDispatcher: Dispatcher = {
 if (enableUseEffectEventHook) {
   (ContextOnlyDispatcher: Dispatcher).useEffectEvent = throwInvalidHookError;
 }
-if (enableUseEffectCRUDOverload) {
-  (ContextOnlyDispatcher: Dispatcher).useResourceEffect = throwInvalidHookError;
-}
 
 const HooksDispatcherOnMount: Dispatcher = {
   readContext,
@@ -4022,9 +4019,6 @@ const HooksDispatcherOnMount: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnMount: Dispatcher).useEffectEvent = mountEvent;
 }
-if (enableUseEffectCRUDOverload) {
-  (HooksDispatcherOnMount: Dispatcher).useResourceEffect = mountResourceEffect;
-}
 
 const HooksDispatcherOnUpdate: Dispatcher = {
   readContext,
@@ -4055,10 +4049,6 @@ const HooksDispatcherOnUpdate: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnUpdate: Dispatcher).useEffectEvent = updateEvent;
 }
-if (enableUseEffectCRUDOverload) {
-  (HooksDispatcherOnUpdate: Dispatcher).useResourceEffect =
-    updateResourceEffect;
-}
 
 const HooksDispatcherOnRerender: Dispatcher = {
   readContext,
@@ -4089,10 +4079,6 @@ const HooksDispatcherOnRerender: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnRerender: Dispatcher).useEffectEvent = updateEvent;
 }
-if (enableUseEffectCRUDOverload) {
-  (HooksDispatcherOnRerender: Dispatcher).useResourceEffect =
-    updateResourceEffect;
-}
 
 let HooksDispatcherOnMountInDEV: Dispatcher | null = null;
 let HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher | null = null;
@@ -4310,27 +4296,6 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (HooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ): void {
-        currentHookNameInDev = 'useResourceEffect';
-        mountHookTypesDev();
-        checkDepsAreNonEmptyArrayDev(updateDeps);
-        return mountResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   HooksDispatcherOnMountWithHookTypesInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4514,26 +4479,6 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ): void {
-        currentHookNameInDev = 'useResourceEffect';
-        updateHookTypesDev();
-        return mountResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   HooksDispatcherOnUpdateInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4717,26 +4662,6 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (HooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ) {
-        currentHookNameInDev = 'useResourceEffect';
-        updateHookTypesDev();
-        return updateResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   HooksDispatcherOnRerenderInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4920,26 +4845,6 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (HooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ) {
-        currentHookNameInDev = 'useResourceEffect';
-        updateHookTypesDev();
-        return updateResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   InvalidNestedHooksDispatcherOnMountInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5148,27 +5053,6 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (InvalidNestedHooksDispatcherOnMountInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ): void {
-        currentHookNameInDev = 'useResourceEffect';
-        warnInvalidHookAccess();
-        mountHookTypesDev();
-        return mountResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   InvalidNestedHooksDispatcherOnUpdateInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5377,27 +5261,6 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (InvalidNestedHooksDispatcherOnUpdateInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ) {
-        currentHookNameInDev = 'useResourceEffect';
-        warnInvalidHookAccess();
-        updateHookTypesDev();
-        return updateResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 
   InvalidNestedHooksDispatcherOnRerenderInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5606,25 +5469,4 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
-  if (enableUseEffectCRUDOverload) {
-    (InvalidNestedHooksDispatcherOnRerenderInDEV: Dispatcher).useResourceEffect =
-      function useResourceEffect(
-        create: () => {...} | void | null,
-        createDeps: Array<mixed> | void | null,
-        update: ((resource: {...} | void | null) => void) | void,
-        updateDeps: Array<mixed> | void | null,
-        destroy: ((resource: {...} | void | null) => void) | void,
-      ) {
-        currentHookNameInDev = 'useResourceEffect';
-        warnInvalidHookAccess();
-        updateHookTypesDev();
-        return updateResourceEffect(
-          create,
-          createDeps,
-          update,
-          updateDeps,
-          destroy,
-        );
-      };
-  }
 }
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index 756d88c4a5d15..98e7d4deefea3 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -47,7 +47,6 @@ export type HookType =
   | 'useRef'
   | 'useEffect'
   | 'useEffectEvent'
-  | 'useResourceEffect'
   | 'useInsertionEffect'
   | 'useLayoutEffect'
   | 'useCallback'
@@ -399,14 +398,6 @@ export type Dispatcher = {
   ): void,
   // TODO: Non-nullable once `enableUseEffectEventHook` is on everywhere.
   useEffectEvent?: <Args, F: (...Array<Args>) => mixed>(callback: F) => F,
-  // TODO: Non-nullable once `enableUseEffectCRUDOverload` is on everywhere.
-  useResourceEffect?: (
-    create: () => {...} | void | null,
-    createDeps: Array<mixed> | void | null,
-    update: ((resource: {...} | void | null) => void) | void,
-    updateDeps: Array<mixed> | void | null,
-    destroy: ((resource: {...} | void | null) => void) | void,
-  ) => void,
   useInsertionEffect(
     create: () => (() => void) | void,
     deps: Array<mixed> | void | null,
diff --git a/packages/react-server/src/ReactFizzHooks.js b/packages/react-server/src/ReactFizzHooks.js
index 63e8576ca788c..a0ec1c7414982 100644
--- a/packages/react-server/src/ReactFizzHooks.js
+++ b/packages/react-server/src/ReactFizzHooks.js
@@ -38,10 +38,7 @@ import {
 } from './ReactFizzConfig';
 import {createFastHash} from './ReactServerStreamConfig';
 
-import {
-  enableUseEffectEventHook,
-  enableUseEffectCRUDOverload,
-} from 'shared/ReactFeatureFlags';
+import {enableUseEffectEventHook} from 'shared/ReactFeatureFlags';
 import is from 'shared/objectIs';
 import {
   REACT_CONTEXT_TYPE,
@@ -866,11 +863,6 @@ export const HooksDispatcher: Dispatcher = supportsClientAPIs
 if (enableUseEffectEventHook) {
   HooksDispatcher.useEffectEvent = useEffectEvent;
 }
-if (enableUseEffectCRUDOverload) {
-  HooksDispatcher.useResourceEffect = supportsClientAPIs
-    ? noop
-    : clientHookNotSupported;
-}
 
 export let currentResumableState: null | ResumableState = (null: any);
 export function setCurrentResumableState(
diff --git a/packages/react/index.development.js b/packages/react/index.development.js
index 809e940f070ba..fa79633001a06 100644
--- a/packages/react/index.development.js
+++ b/packages/react/index.development.js
@@ -59,7 +59,6 @@ export {
   useDeferredValue,
   useEffect,
   experimental_useEffectEvent,
-  experimental_useResourceEffect,
   useImperativeHandle,
   useInsertionEffect,
   useLayoutEffect,
diff --git a/packages/react/index.experimental.development.js b/packages/react/index.experimental.development.js
index 49c98bb208acb..6074b683b781d 100644
--- a/packages/react/index.experimental.development.js
+++ b/packages/react/index.experimental.development.js
@@ -42,7 +42,6 @@ export {
   useDeferredValue,
   useEffect,
   experimental_useEffectEvent,
-  experimental_useResourceEffect,
   useImperativeHandle,
   useInsertionEffect,
   useLayoutEffect,
diff --git a/packages/react/index.fb.js b/packages/react/index.fb.js
index 8e11bade4df59..29133df24f3a7 100644
--- a/packages/react/index.fb.js
+++ b/packages/react/index.fb.js
@@ -21,7 +21,6 @@ export {
   createElement,
   createRef,
   experimental_useEffectEvent,
-  experimental_useResourceEffect,
   forwardRef,
   Fragment,
   isValidElement,
diff --git a/packages/react/src/ReactClient.js b/packages/react/src/ReactClient.js
index 2bacbc85676fd..715ea8ab47c35 100644
--- a/packages/react/src/ReactClient.js
+++ b/packages/react/src/ReactClient.js
@@ -41,7 +41,6 @@ import {
   useContext,
   useEffect,
   useEffectEvent,
-  useResourceEffect,
   useImperativeHandle,
   useDebugValue,
   useInsertionEffect,
@@ -65,7 +64,6 @@ import {addTransitionType} from './ReactTransitionType';
 import {act} from './ReactAct';
 import {captureOwnerStack} from './ReactOwnerStack';
 import * as ReactCompilerRuntime from './ReactCompilerRuntime';
-import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
 
 const Children = {
   map,
@@ -132,6 +130,3 @@ export {
   act, // DEV-only
   captureOwnerStack, // DEV-only
 };
-
-export const experimental_useResourceEffect: typeof useResourceEffect | void =
-  enableUseEffectCRUDOverload ? useResourceEffect : undefined;
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index 2fe6d2b85bcf1..06d61d223874d 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -221,27 +221,6 @@ export function useEffectEvent<Args, F: (...Array<Args>) => mixed>(
   return dispatcher.useEffectEvent(callback);
 }
 
-export function useResourceEffect(
-  create: () => {...} | void | null,
-  createDeps: Array<mixed> | void | null,
-  update: ((resource: {...} | void | null) => void) | void,
-  updateDeps: Array<mixed> | void | null,
-  destroy: ((resource: {...} | void | null) => void) | void,
-): void {
-  if (!enableUseEffectCRUDOverload) {
-    throw new Error('Not implemented.');
-  }
-  const dispatcher = resolveDispatcher();
-  // $FlowFixMe[not-a-function] This is unstable, thus optional
-  return dispatcher.useResourceEffect(
-    create,
-    createDeps,
-    update,
-    updateDeps,
-    destroy,
-  );
-}
-
 export function useOptimistic<S, A>(
   passthrough: S,
   reducer: ?(S, A) => S,

From 192555bb0ed88db30f91c58651c421f178f90384 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Josh=20Goldberg=20=E2=9C=A8?= <git@joshuakgoldberg.com>
Date: Tue, 11 Feb 2025 17:01:04 -0500
Subject: [PATCH 43/72] Added dev-only warning for null/undefined create in
 use*Effect (#32355)
MIME-Version: 1.0
Content-Type: text/plain; charset=UTF-8
Content-Transfer-Encoding: 8bit

## Summary

Fixes #32354.

Re-creation of #15197: adds a dev-only warning if `create == null` to
the three `use*Effect` functions:

* `useEffect`
* `useInsertionEffect`
* `useLayoutEffect`

Updates the warning to match the same text given in the
`react/exhaustive-deps` lint rule.

## How did you test this change?

I applied the changes manually within `node_modules/` on a local clone
of
https://github.com/JoshuaKGoldberg/repros/tree/react-use-effect-no-arguments.

Please pardon me for opening a PR addressing a not-accepted issue. I was
excited to get back to #15194 -> #15197 now that I have time. 🙂

---------

Co-authored-by: lauren <poteto@users.noreply.github.com>
---
 packages/react/src/ReactHooks.js | 24 ++++++++++++++++++++++++
 1 file changed, 24 insertions(+)

diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index 06d61d223874d..ba6b0ffbcb71e 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -93,6 +93,14 @@ export function useEffect(
   updateDeps?: Array<mixed> | void | null,
   destroy?: ((resource: {...} | void | null) => void) | void,
 ): void {
+  if (__DEV__) {
+    if (create == null) {
+      console.warn(
+        'React Hook useEffect requires an effect callback. Did you forget to pass a callback to the hook?',
+      );
+    }
+  }
+
   const dispatcher = resolveDispatcher();
   if (
     enableUseEffectCRUDOverload &&
@@ -118,6 +126,14 @@ export function useInsertionEffect(
   create: () => (() => void) | void,
   deps: Array<mixed> | void | null,
 ): void {
+  if (__DEV__) {
+    if (create == null) {
+      console.warn(
+        'React Hook useInsertionEffect requires an effect callback. Did you forget to pass a callback to the hook?',
+      );
+    }
+  }
+
   const dispatcher = resolveDispatcher();
   return dispatcher.useInsertionEffect(create, deps);
 }
@@ -126,6 +142,14 @@ export function useLayoutEffect(
   create: () => (() => void) | void,
   deps: Array<mixed> | void | null,
 ): void {
+  if (__DEV__) {
+    if (create == null) {
+      console.warn(
+        'React Hook useLayoutEffect requires an effect callback. Did you forget to pass a callback to the hook?',
+      );
+    }
+  }
+
   const dispatcher = resolveDispatcher();
   return dispatcher.useLayoutEffect(create, deps);
 }

From f83903bfcc5a61811bd1b69b14f0ebbac4754462 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Rub=C3=A9n=20Norte?= <rubennorte@meta.com>
Date: Wed, 12 Feb 2025 13:52:57 +0000
Subject: [PATCH 44/72] [RN] Set up test to create public instances lazily in
 Fabric (#32363)

## Summary

In React Native, public instances and internal host nodes are not
represented by the same object (ReactNativeElement & shadow nodes vs.
just DOM elements), and the only one that's required for rendering is
the shadow node. Public instances are generally only necessary when
accessed via refs or events, and that usually happens for a small amount
of components in the tree.

This implements an optimization to create the public instance on demand,
instead of eagerly creating it when creating the host node. We expect
this to improve performance by reducing the logic we do per node and the
number of object allocations.

## How did you test this change?

Manually synced the changes to React Native and run Fantom tests and
benchmarks, with the flag enabled and disabled. All tests pass in both
cases, and benchmarks show a slight but consistent performance
improvement.
---
 .../src/ReactFiberConfigFabric.js             | 69 ++++++++++++++-----
 packages/shared/ReactFeatureFlags.js          |  2 +
 .../ReactFeatureFlags.native-fb-dynamic.js    |  1 +
 .../forks/ReactFeatureFlags.native-fb.js      |  1 +
 .../forks/ReactFeatureFlags.native-oss.js     |  1 +
 .../forks/ReactFeatureFlags.test-renderer.js  |  1 +
 ...actFeatureFlags.test-renderer.native-fb.js |  1 +
 .../ReactFeatureFlags.test-renderer.www.js    |  1 +
 .../forks/ReactFeatureFlags.www-dynamic.js    |  1 +
 .../shared/forks/ReactFeatureFlags.www.js     |  2 +
 10 files changed, 61 insertions(+), 19 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactFiberConfigFabric.js b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
index d602ab05efa81..d28b3400c66c3 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigFabric.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
@@ -57,7 +57,10 @@ import {
   getInspectorDataForInstance,
 } from './ReactNativeFiberInspector';
 
-import {passChildrenWhenCloningPersistedNodes} from 'shared/ReactFeatureFlags';
+import {
+  passChildrenWhenCloningPersistedNodes,
+  enableLazyPublicInstanceInFabric,
+} from 'shared/ReactFeatureFlags';
 import {REACT_CONTEXT_TYPE} from 'shared/ReactSymbols';
 import type {ReactContext} from 'shared/ReactTypes';
 
@@ -93,8 +96,11 @@ export type Instance = {
     currentProps: Props,
     // Reference to the React handle (the fiber)
     internalInstanceHandle: InternalInstanceHandle,
-    // Exposed through refs.
-    publicInstance: PublicInstance,
+    // Exposed through refs. Potentially lazily created.
+    publicInstance: PublicInstance | null,
+    // This is only necessary to lazily create `publicInstance`.
+    // Will be set to `null` after that is created.
+    publicRootInstance?: PublicRootInstance | null,
   },
 };
 export type TextInstance = {
@@ -186,23 +192,37 @@ export function createInstance(
     internalInstanceHandle, // internalInstanceHandle
   );
 
-  const component = createPublicInstance(
-    tag,
-    viewConfig,
-    internalInstanceHandle,
-    rootContainerInstance.publicInstance,
-  );
-
-  return {
-    node: node,
-    canonical: {
-      nativeTag: tag,
+  if (enableLazyPublicInstanceInFabric) {
+    return {
+      node: node,
+      canonical: {
+        nativeTag: tag,
+        viewConfig,
+        currentProps: props,
+        internalInstanceHandle,
+        publicInstance: null,
+        publicRootInstance: rootContainerInstance.publicInstance,
+      },
+    };
+  } else {
+    const component = createPublicInstance(
+      tag,
       viewConfig,
-      currentProps: props,
       internalInstanceHandle,
-      publicInstance: component,
-    },
-  };
+      rootContainerInstance.publicInstance,
+    );
+
+    return {
+      node: node,
+      canonical: {
+        nativeTag: tag,
+        viewConfig,
+        currentProps: props,
+        internalInstanceHandle,
+        publicInstance: component,
+      },
+    };
+  }
 }
 
 export function createTextInstance(
@@ -277,7 +297,18 @@ export function getChildHostContext(
 }
 
 export function getPublicInstance(instance: Instance): null | PublicInstance {
-  if (instance.canonical != null && instance.canonical.publicInstance != null) {
+  if (instance.canonical != null) {
+    if (instance.canonical.publicInstance == null) {
+      instance.canonical.publicInstance = createPublicInstance(
+        instance.canonical.nativeTag,
+        instance.canonical.viewConfig,
+        instance.canonical.internalInstanceHandle,
+        instance.canonical.publicRootInstance ?? null,
+      );
+      // This was only necessary to create the public instance.
+      instance.canonical.publicRootInstance = null;
+    }
+
     return instance.canonical.publicInstance;
   }
 
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index 1cb1cb4cf7dc0..fbdfe5a468516 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -154,6 +154,8 @@ export const enableUseEffectCRUDOverload = false;
 
 export const enableFastAddPropertiesInDiffing = true;
 
+export const enableLazyPublicInstanceInFabric = false;
+
 // -----------------------------------------------------------------------------
 // Ready for next major.
 //
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index 001b3d64c06dc..ffcec9334d663 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -28,3 +28,4 @@ export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableOwnerStacks = __VARIANT__;
 export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
+export const enableLazyPublicInstanceInFabric = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 6e82185b5d98c..2eff113ae42f1 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -30,6 +30,7 @@ export const {
   enableOwnerStacks,
   enableRemoveConsolePatches,
   enableFastAddPropertiesInDiffing,
+  enableLazyPublicInstanceInFabric,
 } = dynamicFlags;
 
 // The rest of the flags are static for better dead code elimination.
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index 3f373e998cd8e..bcd8b375eca67 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -72,6 +72,7 @@ export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
 export const enableFastAddPropertiesInDiffing = false;
+export const enableLazyPublicInstanceInFabric = false;
 
 // Profiling Only
 export const enableProfilerTimer = __PROFILE__;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index da9b8a2612c9b..6fcd35c40774b 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -71,6 +71,7 @@ export const enableYieldingBeforePassive = true;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
 export const enableFastAddPropertiesInDiffing = true;
+export const enableLazyPublicInstanceInFabric = false;
 
 // TODO: This must be in sync with the main ReactFeatureFlags file because
 // the Test Renderer's value must be the same as the one used by the
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index 8c20cc28deb15..743ba39a86792 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -69,6 +69,7 @@ export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
 export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
+export const enableLazyPublicInstanceInFabric = false;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index bc30992eb6eb5..26747d3fb69a9 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -84,6 +84,7 @@ export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
 export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
+export const enableLazyPublicInstanceInFabric = false;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
index 3cab1318c490e..d0b4404a3e946 100644
--- a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
@@ -39,6 +39,7 @@ export const enableSiblingPrerendering = __VARIANT__;
 export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
+export const enableLazyPublicInstanceInFabric = false;
 export const enableViewTransition = __VARIANT__;
 
 // TODO: These flags are hard-coded to the default values used in open source.
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index 57be83577c956..8da74c54bd69e 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -110,5 +110,7 @@ export const disableLegacyMode = true;
 
 export const enableShallowPropDiffing = false;
 
+export const enableLazyPublicInstanceInFabric = false;
+
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);

From d814852baf03c61b1e32b59a45c3f72e00577ac8 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Wed, 12 Feb 2025 11:59:56 -0500
Subject: [PATCH 45/72] [compiler] Upgrade esbuild (#32368)

Just a simple upgrade
---
 compiler/package.json |   2 +-
 compiler/yarn.lock    | 314 +++++++++++++++++++++---------------------
 2 files changed, 158 insertions(+), 158 deletions(-)

diff --git a/compiler/package.json b/compiler/package.json
index b16756f0aa2c0..f1696b9b2a5c5 100644
--- a/compiler/package.json
+++ b/compiler/package.json
@@ -28,7 +28,7 @@
   "devDependencies": {
     "@tsconfig/strictest": "^2.0.5",
     "concurrently": "^7.4.0",
-    "esbuild": "^0.24.2",
+    "esbuild": "^0.25.0",
     "folder-hash": "^4.0.4",
     "npm-dts": "^1.3.13",
     "object-assign": "^4.1.1",
diff --git a/compiler/yarn.lock b/compiler/yarn.lock
index 354cc199b0285..b5bd5f8eaf7b4 100644
--- a/compiler/yarn.lock
+++ b/compiler/yarn.lock
@@ -1714,130 +1714,130 @@
     enabled "2.0.x"
     kuler "^2.0.0"
 
-"@esbuild/aix-ppc64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.24.2.tgz#38848d3e25afe842a7943643cbcd387cc6e13461"
-  integrity sha512-thpVCb/rhxE/BnMLQ7GReQLLN8q9qbHmI55F4489/ByVg2aQaQ6kbcLb6FHkocZzQhxc4gx0sCk0tJkKBFzDhA==
-
-"@esbuild/android-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.24.2.tgz#f592957ae8b5643129fa889c79e69cd8669bb894"
-  integrity sha512-cNLgeqCqV8WxfcTIOeL4OAtSmL8JjcN6m09XIgro1Wi7cF4t/THaWEa7eL5CMoMBdjoHOTh/vwTO/o2TRXIyzg==
-
-"@esbuild/android-arm@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.24.2.tgz#72d8a2063aa630308af486a7e5cbcd1e134335b3"
-  integrity sha512-tmwl4hJkCfNHwFB3nBa8z1Uy3ypZpxqxfTQOcHX+xRByyYgunVbZ9MzUUfb0RxaHIMnbHagwAxuTL+tnNM+1/Q==
-
-"@esbuild/android-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.24.2.tgz#9a7713504d5f04792f33be9c197a882b2d88febb"
-  integrity sha512-B6Q0YQDqMx9D7rvIcsXfmJfvUYLoP722bgfBlO5cGvNVb5V/+Y7nhBE3mHV9OpxBf4eAS2S68KZztiPaWq4XYw==
-
-"@esbuild/darwin-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.24.2.tgz#02ae04ad8ebffd6e2ea096181b3366816b2b5936"
-  integrity sha512-kj3AnYWc+CekmZnS5IPu9D+HWtUI49hbnyqk0FLEJDbzCIQt7hg7ucF1SQAilhtYpIujfaHr6O0UHlzzSPdOeA==
-
-"@esbuild/darwin-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.24.2.tgz#9ec312bc29c60e1b6cecadc82bd504d8adaa19e9"
-  integrity sha512-WeSrmwwHaPkNR5H3yYfowhZcbriGqooyu3zI/3GGpF8AyUdsrrP0X6KumITGA9WOyiJavnGZUwPGvxvwfWPHIA==
-
-"@esbuild/freebsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.24.2.tgz#5e82f44cb4906d6aebf24497d6a068cfc152fa00"
-  integrity sha512-UN8HXjtJ0k/Mj6a9+5u6+2eZ2ERD7Edt1Q9IZiB5UZAIdPnVKDoG7mdTVGhHJIeEml60JteamR3qhsr1r8gXvg==
-
-"@esbuild/freebsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.24.2.tgz#3fb1ce92f276168b75074b4e51aa0d8141ecce7f"
-  integrity sha512-TvW7wE/89PYW+IevEJXZ5sF6gJRDY/14hyIGFXdIucxCsbRmLUcjseQu1SyTko+2idmCw94TgyaEZi9HUSOe3Q==
-
-"@esbuild/linux-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.24.2.tgz#856b632d79eb80aec0864381efd29de8fd0b1f43"
-  integrity sha512-7HnAD6074BW43YvvUmE/35Id9/NB7BeX5EoNkK9obndmZBUk8xmJJeU7DwmUeN7tkysslb2eSl6CTrYz6oEMQg==
-
-"@esbuild/linux-arm@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.24.2.tgz#c846b4694dc5a75d1444f52257ccc5659021b736"
-  integrity sha512-n0WRM/gWIdU29J57hJyUdIsk0WarGd6To0s+Y+LwvlC55wt+GT/OgkwoXCXvIue1i1sSNWblHEig00GBWiJgfA==
-
-"@esbuild/linux-ia32@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.24.2.tgz#f8a16615a78826ccbb6566fab9a9606cfd4a37d5"
-  integrity sha512-sfv0tGPQhcZOgTKO3oBE9xpHuUqguHvSo4jl+wjnKwFpapx+vUDcawbwPNuBIAYdRAvIDBfZVvXprIj3HA+Ugw==
-
-"@esbuild/linux-loong64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.24.2.tgz#1c451538c765bf14913512c76ed8a351e18b09fc"
-  integrity sha512-CN9AZr8kEndGooS35ntToZLTQLHEjtVB5n7dl8ZcTZMonJ7CCfStrYhrzF97eAecqVbVJ7APOEe18RPI4KLhwQ==
-
-"@esbuild/linux-mips64el@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.24.2.tgz#0846edeefbc3d8d50645c51869cc64401d9239cb"
-  integrity sha512-iMkk7qr/wl3exJATwkISxI7kTcmHKE+BlymIAbHO8xanq/TjHaaVThFF6ipWzPHryoFsesNQJPE/3wFJw4+huw==
-
-"@esbuild/linux-ppc64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.24.2.tgz#8e3fc54505671d193337a36dfd4c1a23b8a41412"
-  integrity sha512-shsVrgCZ57Vr2L8mm39kO5PPIb+843FStGt7sGGoqiiWYconSxwTiuswC1VJZLCjNiMLAMh34jg4VSEQb+iEbw==
-
-"@esbuild/linux-riscv64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.24.2.tgz#6a1e92096d5e68f7bb10a0d64bb5b6d1daf9a694"
-  integrity sha512-4eSFWnU9Hhd68fW16GD0TINewo1L6dRrB+oLNNbYyMUAeOD2yCK5KXGK1GH4qD/kT+bTEXjsyTCiJGHPZ3eM9Q==
-
-"@esbuild/linux-s390x@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.24.2.tgz#ab18e56e66f7a3c49cb97d337cd0a6fea28a8577"
-  integrity sha512-S0Bh0A53b0YHL2XEXC20bHLuGMOhFDO6GN4b3YjRLK//Ep3ql3erpNcPlEFed93hsQAjAQDNsvcK+hV90FubSw==
-
-"@esbuild/linux-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.24.2.tgz#8140c9b40da634d380b0b29c837a0b4267aff38f"
-  integrity sha512-8Qi4nQcCTbLnK9WoMjdC9NiTG6/E38RNICU6sUNqK0QFxCYgoARqVqxdFmWkdonVsvGqWhmm7MO0jyTqLqwj0Q==
-
-"@esbuild/netbsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-arm64/-/netbsd-arm64-0.24.2.tgz#65f19161432bafb3981f5f20a7ff45abb2e708e6"
-  integrity sha512-wuLK/VztRRpMt9zyHSazyCVdCXlpHkKm34WUyinD2lzK07FAHTq0KQvZZlXikNWkDGoT6x3TD51jKQ7gMVpopw==
-
-"@esbuild/netbsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.24.2.tgz#7a3a97d77abfd11765a72f1c6f9b18f5396bcc40"
-  integrity sha512-VefFaQUc4FMmJuAxmIHgUmfNiLXY438XrL4GDNV1Y1H/RW3qow68xTwjZKfj/+Plp9NANmzbH5R40Meudu8mmw==
-
-"@esbuild/openbsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.24.2.tgz#58b00238dd8f123bfff68d3acc53a6ee369af89f"
-  integrity sha512-YQbi46SBct6iKnszhSvdluqDmxCJA+Pu280Av9WICNwQmMxV7nLRHZfjQzwbPs3jeWnuAhE9Jy0NrnJ12Oz+0A==
-
-"@esbuild/openbsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.24.2.tgz#0ac843fda0feb85a93e288842936c21a00a8a205"
-  integrity sha512-+iDS6zpNM6EnJyWv0bMGLWSWeXGN/HTaF/LXHXHwejGsVi+ooqDfMCCTerNFxEkM3wYVcExkeGXNqshc9iMaOA==
-
-"@esbuild/sunos-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.24.2.tgz#8b7aa895e07828d36c422a4404cc2ecf27fb15c6"
-  integrity sha512-hTdsW27jcktEvpwNHJU4ZwWFGkz2zRJUz8pvddmXPtXDzVKTTINmlmga3ZzwcuMpUvLw7JkLy9QLKyGpD2Yxig==
-
-"@esbuild/win32-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.24.2.tgz#c023afb647cabf0c3ed13f0eddfc4f1d61c66a85"
-  integrity sha512-LihEQ2BBKVFLOC9ZItT9iFprsE9tqjDjnbulhHoFxYQtQfai7qfluVODIYxt1PgdoyQkz23+01rzwNwYfutxUQ==
-
-"@esbuild/win32-ia32@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.24.2.tgz#96c356132d2dda990098c8b8b951209c3cd743c2"
-  integrity sha512-q+iGUwfs8tncmFC9pcnD5IvRHAzmbwQ3GPS5/ceCyHdjXubwQWI12MKWSNSMYLJMq23/IUCvJMS76PDqXe1fxA==
-
-"@esbuild/win32-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.24.2.tgz#34aa0b52d0fbb1a654b596acfa595f0c7b77a77b"
-  integrity sha512-7VTgWzgMGvup6aSqDPLiW5zHaxYJGTO4OokMjIlrCtf+VpEL+cXKtCvg723iguPYI5oaUNdS+/V7OU2gvXVWEg==
+"@esbuild/aix-ppc64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.25.0.tgz#499600c5e1757a524990d5d92601f0ac3ce87f64"
+  integrity sha512-O7vun9Sf8DFjH2UtqK8Ku3LkquL9SZL8OLY1T5NZkA34+wG3OQF7cl4Ql8vdNzM6fzBbYfLaiRLIOZ+2FOCgBQ==
+
+"@esbuild/android-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.25.0.tgz#b9b8231561a1dfb94eb31f4ee056b92a985c324f"
+  integrity sha512-grvv8WncGjDSyUBjN9yHXNt+cq0snxXbDxy5pJtzMKGmmpPxeAmAhWxXI+01lU5rwZomDgD3kJwulEnhTRUd6g==
+
+"@esbuild/android-arm@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.25.0.tgz#ca6e7888942505f13e88ac9f5f7d2a72f9facd2b"
+  integrity sha512-PTyWCYYiU0+1eJKmw21lWtC+d08JDZPQ5g+kFyxP0V+es6VPPSUhM6zk8iImp2jbV6GwjX4pap0JFbUQN65X1g==
+
+"@esbuild/android-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.25.0.tgz#e765ea753bac442dfc9cb53652ce8bd39d33e163"
+  integrity sha512-m/ix7SfKG5buCnxasr52+LI78SQ+wgdENi9CqyCXwjVR2X4Jkz+BpC3le3AoBPYTC9NHklwngVXvbJ9/Akhrfg==
+
+"@esbuild/darwin-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.25.0.tgz#fa394164b0d89d4fdc3a8a21989af70ef579fa2c"
+  integrity sha512-mVwdUb5SRkPayVadIOI78K7aAnPamoeFR2bT5nszFUZ9P8UpK4ratOdYbZZXYSqPKMHfS1wdHCJk1P1EZpRdvw==
+
+"@esbuild/darwin-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.25.0.tgz#91979d98d30ba6e7d69b22c617cc82bdad60e47a"
+  integrity sha512-DgDaYsPWFTS4S3nWpFcMn/33ZZwAAeAFKNHNa1QN0rI4pUjgqf0f7ONmXf6d22tqTY+H9FNdgeaAa+YIFUn2Rg==
+
+"@esbuild/freebsd-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.25.0.tgz#b97e97073310736b430a07b099d837084b85e9ce"
+  integrity sha512-VN4ocxy6dxefN1MepBx/iD1dH5K8qNtNe227I0mnTRjry8tj5MRk4zprLEdG8WPyAPb93/e4pSgi1SoHdgOa4w==
+
+"@esbuild/freebsd-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.25.0.tgz#f3b694d0da61d9910ec7deff794d444cfbf3b6e7"
+  integrity sha512-mrSgt7lCh07FY+hDD1TxiTyIHyttn6vnjesnPoVDNmDfOmggTLXRv8Id5fNZey1gl/V2dyVK1VXXqVsQIiAk+A==
+
+"@esbuild/linux-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.25.0.tgz#f921f699f162f332036d5657cad9036f7a993f73"
+  integrity sha512-9QAQjTWNDM/Vk2bgBl17yWuZxZNQIF0OUUuPZRKoDtqF2k4EtYbpyiG5/Dk7nqeK6kIJWPYldkOcBqjXjrUlmg==
+
+"@esbuild/linux-arm@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.25.0.tgz#cc49305b3c6da317c900688995a4050e6cc91ca3"
+  integrity sha512-vkB3IYj2IDo3g9xX7HqhPYxVkNQe8qTK55fraQyTzTX/fxaDtXiEnavv9geOsonh2Fd2RMB+i5cbhu2zMNWJwg==
+
+"@esbuild/linux-ia32@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.25.0.tgz#3e0736fcfab16cff042dec806247e2c76e109e19"
+  integrity sha512-43ET5bHbphBegyeqLb7I1eYn2P/JYGNmzzdidq/w0T8E2SsYL1U6un2NFROFRg1JZLTzdCoRomg8Rvf9M6W6Gg==
+
+"@esbuild/linux-loong64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.25.0.tgz#ea2bf730883cddb9dfb85124232b5a875b8020c7"
+  integrity sha512-fC95c/xyNFueMhClxJmeRIj2yrSMdDfmqJnyOY4ZqsALkDrrKJfIg5NTMSzVBr5YW1jf+l7/cndBfP3MSDpoHw==
+
+"@esbuild/linux-mips64el@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.25.0.tgz#4cababb14eede09248980a2d2d8b966464294ff1"
+  integrity sha512-nkAMFju7KDW73T1DdH7glcyIptm95a7Le8irTQNO/qtkoyypZAnjchQgooFUDQhNAy4iu08N79W4T4pMBwhPwQ==
+
+"@esbuild/linux-ppc64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.25.0.tgz#8860a4609914c065373a77242e985179658e1951"
+  integrity sha512-NhyOejdhRGS8Iwv+KKR2zTq2PpysF9XqY+Zk77vQHqNbo/PwZCzB5/h7VGuREZm1fixhs4Q/qWRSi5zmAiO4Fw==
+
+"@esbuild/linux-riscv64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.25.0.tgz#baf26e20bb2d38cfb86ee282dff840c04f4ed987"
+  integrity sha512-5S/rbP5OY+GHLC5qXp1y/Mx//e92L1YDqkiBbO9TQOvuFXM+iDqUNG5XopAnXoRH3FjIUDkeGcY1cgNvnXp/kA==
+
+"@esbuild/linux-s390x@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.25.0.tgz#8323afc0d6cb1b6dc6e9fd21efd9e1542c3640a4"
+  integrity sha512-XM2BFsEBz0Fw37V0zU4CXfcfuACMrppsMFKdYY2WuTS3yi8O1nFOhil/xhKTmE1nPmVyvQJjJivgDT+xh8pXJA==
+
+"@esbuild/linux-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.25.0.tgz#08fcf60cb400ed2382e9f8e0f5590bac8810469a"
+  integrity sha512-9yl91rHw/cpwMCNytUDxwj2XjFpxML0y9HAOH9pNVQDpQrBxHy01Dx+vaMu0N1CKa/RzBD2hB4u//nfc+Sd3Cw==
+
+"@esbuild/netbsd-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-arm64/-/netbsd-arm64-0.25.0.tgz#935c6c74e20f7224918fbe2e6c6fe865b6c6ea5b"
+  integrity sha512-RuG4PSMPFfrkH6UwCAqBzauBWTygTvb1nxWasEJooGSJ/NwRw7b2HOwyRTQIU97Hq37l3npXoZGYMy3b3xYvPw==
+
+"@esbuild/netbsd-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.25.0.tgz#414677cef66d16c5a4d210751eb2881bb9c1b62b"
+  integrity sha512-jl+qisSB5jk01N5f7sPCsBENCOlPiS/xptD5yxOx2oqQfyourJwIKLRA2yqWdifj3owQZCL2sn6o08dBzZGQzA==
+
+"@esbuild/openbsd-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.25.0.tgz#8fd55a4d08d25cdc572844f13c88d678c84d13f7"
+  integrity sha512-21sUNbq2r84YE+SJDfaQRvdgznTD8Xc0oc3p3iW/a1EVWeNj/SdUCbm5U0itZPQYRuRTW20fPMWMpcrciH2EJw==
+
+"@esbuild/openbsd-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.25.0.tgz#0c48ddb1494bbc2d6bcbaa1429a7f465fa1dedde"
+  integrity sha512-2gwwriSMPcCFRlPlKx3zLQhfN/2WjJ2NSlg5TKLQOJdV0mSxIcYNTMhk3H3ulL/cak+Xj0lY1Ym9ysDV1igceg==
+
+"@esbuild/sunos-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.25.0.tgz#86ff9075d77962b60dd26203d7352f92684c8c92"
+  integrity sha512-bxI7ThgLzPrPz484/S9jLlvUAHYMzy6I0XiU1ZMeAEOBcS0VePBFxh1JjTQt3Xiat5b6Oh4x7UC7IwKQKIJRIg==
+
+"@esbuild/win32-arm64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.25.0.tgz#849c62327c3229467f5b5cd681bf50588442e96c"
+  integrity sha512-ZUAc2YK6JW89xTbXvftxdnYy3m4iHIkDtK3CLce8wg8M2L+YZhIvO1DKpxrd0Yr59AeNNkTiic9YLf6FTtXWMw==
+
+"@esbuild/win32-ia32@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.25.0.tgz#f62eb480cd7cca088cb65bb46a6db25b725dc079"
+  integrity sha512-eSNxISBu8XweVEWG31/JzjkIGbGIJN/TrRoiSVZwZ6pkC6VX4Im/WV2cz559/TXLcYbcrDN8JtKgd9DJVIo8GA==
+
+"@esbuild/win32-x64@0.25.0":
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.25.0.tgz#c8e119a30a7c8d60b9d2e22d2073722dde3b710b"
+  integrity sha512-ZENoHJBxA20C2zFzh6AI4fT6RraMzjYw4xKWemRTRmRVtN9c5DcH9r/f2ihEkMjOW5eGgrwCslG/+Y/3bL+DHQ==
 
 "@eslint-community/eslint-utils@^4.2.0", "@eslint-community/eslint-utils@^4.4.0":
   version "4.4.0"
@@ -2799,10 +2799,10 @@
   dependencies:
     "@babel/types" "^7.3.0"
 
-"@types/eslint@^8.56.6":
-  version "8.56.6"
-  resolved "https://registry.yarnpkg.com/@types/eslint/-/eslint-8.56.6.tgz#d5dc16cac025d313ee101108ba5714ea10eb3ed0"
-  integrity sha512-ymwc+qb1XkjT/gfoQwxIeHZ6ixH23A+tCT2ADSA/DPVKzAjwYkTXBMCQ/f6fe4wEa85Lhp26VPeUxI7wMhAi7A==
+"@types/eslint@^8.56.12":
+  version "8.56.12"
+  resolved "https://registry.yarnpkg.com/@types/eslint/-/eslint-8.56.12.tgz#1657c814ffeba4d2f84c0d4ba0f44ca7ea1ca53a"
+  integrity sha512-03ruubjWyOHlmljCVoxSuNDdmfZDzsrrz0P2LeJsOXr+ZwFQ+0yQIwNCwt/GYhV7Z31fgtXJTAEs+FYlEL851g==
   dependencies:
     "@types/estree" "*"
     "@types/json-schema" "*"
@@ -4105,36 +4105,36 @@ es5-ext@0.8.x:
   resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.8.2.tgz#aba8d9e1943a895ac96837a62a39b3f55ecd94ab"
   integrity sha512-H19ompyhnKiBdjHR1DPHvf5RHgHPmJaY9JNzFGbMbPgdsUkvnUCN1Ke8J4Y0IMyTwFM2M9l4h2GoHwzwpSmXbA==
 
-esbuild@^0.24.2:
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.24.2.tgz#b5b55bee7de017bff5fb8a4e3e44f2ebe2c3567d"
-  integrity sha512-+9egpBW8I3CD5XPe0n6BfT5fxLzxrlDzqydF3aviG+9ni1lDC/OvMHcxqEFV0+LANZG5R1bFMWfUrjVsdwxJvA==
+esbuild@^0.25.0:
+  version "0.25.0"
+  resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.25.0.tgz#0de1787a77206c5a79eeb634a623d39b5006ce92"
+  integrity sha512-BXq5mqc8ltbaN34cDqWuYKyNhX8D/Z0J1xdtdQ8UcIIIyJyz+ZMKUt58tF3SrZ85jcfN/PZYhjR5uDQAYNVbuw==
   optionalDependencies:
-    "@esbuild/aix-ppc64" "0.24.2"
-    "@esbuild/android-arm" "0.24.2"
-    "@esbuild/android-arm64" "0.24.2"
-    "@esbuild/android-x64" "0.24.2"
-    "@esbuild/darwin-arm64" "0.24.2"
-    "@esbuild/darwin-x64" "0.24.2"
-    "@esbuild/freebsd-arm64" "0.24.2"
-    "@esbuild/freebsd-x64" "0.24.2"
-    "@esbuild/linux-arm" "0.24.2"
-    "@esbuild/linux-arm64" "0.24.2"
-    "@esbuild/linux-ia32" "0.24.2"
-    "@esbuild/linux-loong64" "0.24.2"
-    "@esbuild/linux-mips64el" "0.24.2"
-    "@esbuild/linux-ppc64" "0.24.2"
-    "@esbuild/linux-riscv64" "0.24.2"
-    "@esbuild/linux-s390x" "0.24.2"
-    "@esbuild/linux-x64" "0.24.2"
-    "@esbuild/netbsd-arm64" "0.24.2"
-    "@esbuild/netbsd-x64" "0.24.2"
-    "@esbuild/openbsd-arm64" "0.24.2"
-    "@esbuild/openbsd-x64" "0.24.2"
-    "@esbuild/sunos-x64" "0.24.2"
-    "@esbuild/win32-arm64" "0.24.2"
-    "@esbuild/win32-ia32" "0.24.2"
-    "@esbuild/win32-x64" "0.24.2"
+    "@esbuild/aix-ppc64" "0.25.0"
+    "@esbuild/android-arm" "0.25.0"
+    "@esbuild/android-arm64" "0.25.0"
+    "@esbuild/android-x64" "0.25.0"
+    "@esbuild/darwin-arm64" "0.25.0"
+    "@esbuild/darwin-x64" "0.25.0"
+    "@esbuild/freebsd-arm64" "0.25.0"
+    "@esbuild/freebsd-x64" "0.25.0"
+    "@esbuild/linux-arm" "0.25.0"
+    "@esbuild/linux-arm64" "0.25.0"
+    "@esbuild/linux-ia32" "0.25.0"
+    "@esbuild/linux-loong64" "0.25.0"
+    "@esbuild/linux-mips64el" "0.25.0"
+    "@esbuild/linux-ppc64" "0.25.0"
+    "@esbuild/linux-riscv64" "0.25.0"
+    "@esbuild/linux-s390x" "0.25.0"
+    "@esbuild/linux-x64" "0.25.0"
+    "@esbuild/netbsd-arm64" "0.25.0"
+    "@esbuild/netbsd-x64" "0.25.0"
+    "@esbuild/openbsd-arm64" "0.25.0"
+    "@esbuild/openbsd-x64" "0.25.0"
+    "@esbuild/sunos-x64" "0.25.0"
+    "@esbuild/win32-arm64" "0.25.0"
+    "@esbuild/win32-ia32" "0.25.0"
+    "@esbuild/win32-x64" "0.25.0"
 
 escalade@^3.1.1:
   version "3.1.1"

From 5a78dd7cfec4217c1feb89ee6312c13f40b01aed Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Wed, 12 Feb 2025 15:13:47 -0500
Subject: [PATCH 46/72] [ci] Also notify compiler ready for review PRs (#32371)

Similar to #32344
---
 .github/workflows/compiler_discord_notify.yml | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/.github/workflows/compiler_discord_notify.yml b/.github/workflows/compiler_discord_notify.yml
index da85190dd2127..f81f42b9cb7df 100644
--- a/.github/workflows/compiler_discord_notify.yml
+++ b/.github/workflows/compiler_discord_notify.yml
@@ -2,7 +2,7 @@ name: (Compiler) Discord Notify
 
 on:
   pull_request_target:
-    types: [opened]
+    types: [opened, ready_for_review]
     paths:
       - compiler/**
       - .github/workflows/compiler_**.yml

From e0131f1edae0fc411bf8abb2fed211ca07af60fe Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Fran=C3=A7ois=20Best?= <github@francoisbest.com>
Date: Thu, 13 Feb 2025 13:02:55 +0100
Subject: [PATCH 47/72] fix(devtools): Handle nullish values passed to
 `formatConsoleArguments` (#32372)

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

<!--
Explain the **motivation** for making this change. What existing problem
does the pull request solve?
-->

When using React Devtools, calling `console.log('%s', null)` in userland
can cause it to throw an error:

```
TypeError: Cannot read properties of null (reading 'toString')
```

## How did you test this change?

Added a unit test.

<!--
Demonstrate the code is solid. Example: The exact commands you ran and
their output, screenshots / videos if the pull request changes the user
interface.
How exactly did you verify that your PR solves the issue you wanted to
solve?
  If you leave this empty, your PR will very likely be closed.
-->

See https://github.com/47ng/nuqs/issues/808.
---
 .../react-devtools-shared/src/__tests__/utils-test.js    | 9 +++++++++
 .../src/backend/utils/formatConsoleArguments.js          | 2 +-
 2 files changed, 10 insertions(+), 1 deletion(-)

diff --git a/packages/react-devtools-shared/src/__tests__/utils-test.js b/packages/react-devtools-shared/src/__tests__/utils-test.js
index 94726312c3bfa..876aaa99f1ea9 100644
--- a/packages/react-devtools-shared/src/__tests__/utils-test.js
+++ b/packages/react-devtools-shared/src/__tests__/utils-test.js
@@ -470,5 +470,14 @@ function f() { }
         {},
       ]);
     });
+
+    it('formats nullish values', () => {
+      expect(formatConsoleArguments('This is the %s template', null)).toEqual([
+        'This is the null template',
+      ]);
+      expect(
+        formatConsoleArguments('This is the %s template', undefined),
+      ).toEqual(['This is the undefined template']);
+    });
   });
 });
diff --git a/packages/react-devtools-shared/src/backend/utils/formatConsoleArguments.js b/packages/react-devtools-shared/src/backend/utils/formatConsoleArguments.js
index a2d303e543ac0..eaf4170970ed4 100644
--- a/packages/react-devtools-shared/src/backend/utils/formatConsoleArguments.js
+++ b/packages/react-devtools-shared/src/backend/utils/formatConsoleArguments.js
@@ -58,7 +58,7 @@ export default function formatConsoleArguments(
       }
       case 's': {
         const [arg] = args.splice(argumentsPointer, 1);
-        template += arg.toString();
+        template += String(arg);
 
         break;
       }

From cbbe8666a8d6e6f1b81dffb11bd5d767e4acd6ac Mon Sep 17 00:00:00 2001
From: LoganDark <4723091+LoganDark@users.noreply.github.com>
Date: Thu, 13 Feb 2025 04:04:53 -0800
Subject: [PATCH 48/72] fix value formatting of proxies of class instances
 (#30880)

For Hookstate Proxies of class instances, `data.constructor.name`
returns `Proxy({})`, so use
`Object.getPrototypeOf(data).constructor.name` instead, which works
correctly from my testing.

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

React DevTools immediately bricks itself if you inspect any component
that has a prop that is a Hookstate that wraps a class instance ...
because these are proxies where `data.constructor.name` returns some
un-cloneable object, but `Object.getPrototypeOf(data)` doesn't return
`Object` (it returns the prototype of the class inside).

## How did you test this change?

This part of the code has no associated tests at all.

Technically,
`packages/react-devtools-shared/src/__tests__/legacy/inspectElement-test.js`
exists, but I tried `yarn test` and these tests aren't even executed
anymore. I can't figure it out, so whatever.

If you run this code:

```js
    class Class {}
    const instance = new Class();

    const instanceProxy = new Proxy(instance, {
      get(target, key, receiver) {
        if (key === 'constructor') {
          return { name: new Proxy({}, {}) };
        }

        return Reflect.get(target, key, receiver);
      },
    });
```

then `instanceProxy.constructor.name` returns some proxy that cannot be
cloned, but `Object.getPrototypeOf(instanceProxy).constructor.name`
returns the correct value.

This PR fixes the devtools to use
`Object.getPrototypeOf(instanceProxy).constructor.name`.

I modified my local copy of devtools to use this method and it fixed the
bricking that I experienced.

Related #29954
---
 packages/react-devtools-shared/src/utils.js | 20 +++++++++++++++++++-
 1 file changed, 19 insertions(+), 1 deletion(-)

diff --git a/packages/react-devtools-shared/src/utils.js b/packages/react-devtools-shared/src/utils.js
index f6f7f3f4209aa..12c9fb739ce95 100644
--- a/packages/react-devtools-shared/src/utils.js
+++ b/packages/react-devtools-shared/src/utils.js
@@ -915,7 +915,25 @@ export function formatDataForPreview(
     case 'date':
       return data.toString();
     case 'class_instance':
-      return data.constructor.name;
+      try {
+        let resolvedConstructorName = data.constructor.name;
+        if (typeof resolvedConstructorName === 'string') {
+          return resolvedConstructorName;
+        }
+
+        resolvedConstructorName = Object.getPrototypeOf(data).constructor.name;
+        if (typeof resolvedConstructorName === 'string') {
+          return resolvedConstructorName;
+        }
+
+        try {
+          return truncateForDisplay(String(data));
+        } catch (error) {
+          return 'unserializable';
+        }
+      } catch (error) {
+        return 'unserializable';
+      }
     case 'object':
       if (showFormattedValue) {
         const keys = Array.from(getAllEnumerableKeys(data)).sort(alphaSortKeys);

From c6a7e18636e610efd3aa7a437bbcaf321bf73abd Mon Sep 17 00:00:00 2001
From: "Sebastian \"Sebbie\" Silbermann" <sebastian.silbermann@vercel.com>
Date: Thu, 13 Feb 2025 18:09:49 +0100
Subject: [PATCH 49/72] Ensure `captureOwnerStack` returns `null` when no stack
 is available (#32353)

Co-authored-by: Younes Henni <youneshenniwrites@gmail.com>
---
 packages/react-reconciler/src/ReactCurrentFiber.js  |  2 +-
 .../src/__tests__/ReactOwnerStacks-test.js          | 13 +++++++++++++
 2 files changed, 14 insertions(+), 1 deletion(-)

diff --git a/packages/react-reconciler/src/ReactCurrentFiber.js b/packages/react-reconciler/src/ReactCurrentFiber.js
index 18406d991909a..f65ae5f19232c 100644
--- a/packages/react-reconciler/src/ReactCurrentFiber.js
+++ b/packages/react-reconciler/src/ReactCurrentFiber.js
@@ -72,7 +72,7 @@ export function runWithFiberInDEV<A0, A1, A2, A3, A4, T>(
       }
       return callback(arg0, arg1, arg2, arg3, arg4);
     } finally {
-      current = previousFiber;
+      setCurrentFiber(previousFiber);
     }
   }
   // These errors should never make it into a build so we don't need to encode them in codes.json
diff --git a/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js b/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
index ca0e9fd12cc11..7ee176a106e15 100644
--- a/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
@@ -62,4 +62,17 @@ describe('ReactOwnerStacks', () => {
       '\n    in Bar (at **)' + '\n    in Foo (at **)',
     );
   });
+
+  it('returns null outside of render', async () => {
+    // Awkward to gate since some builds will have `captureOwnerStack` return null in prod
+    if (__DEV__ && gate('enableOwnerStacks')) {
+      expect(React.captureOwnerStack()).toBe(null);
+
+      await act(() => {
+        ReactNoop.render(<div />);
+      });
+
+      expect(React.captureOwnerStack()).toBe(null);
+    }
+  });
 });

From ed8b68dd178af17a2dd36c8678f81f8b454559a9 Mon Sep 17 00:00:00 2001
From: "Sebastian \"Sebbie\" Silbermann" <sebastian.silbermann@vercel.com>
Date: Thu, 13 Feb 2025 18:26:36 +0100
Subject: [PATCH 50/72] Stop exporting dev-only methods in OSS production
 builds (#32200)

---
 .../src/__tests__/ReactTestUtilsAct-test.js   |  8 ---
 .../src/__tests__/ReactIsomorphicAct-test.js  | 12 +++++
 .../src/__tests__/ReactOwnerStacks-test.js    | 10 ++++
 packages/react/index.js                       |  2 -
 packages/react/index.stable.development.js    | 51 +++++++++++++++++++
 packages/react/index.stable.js                |  1 -
 scripts/jest/TestFlags.js                     |  1 +
 scripts/jest/setupHostConfigs.js              | 19 ++++---
 scripts/rollup/build.js                       | 21 ++++----
 9 files changed, 96 insertions(+), 29 deletions(-)
 create mode 100644 packages/react/index.stable.development.js

diff --git a/packages/react-dom/src/__tests__/ReactTestUtilsAct-test.js b/packages/react-dom/src/__tests__/ReactTestUtilsAct-test.js
index 76cfab25e0016..64ccc387d75a3 100644
--- a/packages/react-dom/src/__tests__/ReactTestUtilsAct-test.js
+++ b/packages/react-dom/src/__tests__/ReactTestUtilsAct-test.js
@@ -779,13 +779,5 @@ function runActTests(render, unmount, rerender) {
         });
       }
     });
-    describe('throw in prod mode', () => {
-      // @gate !__DEV__
-      it('warns if you try to use act() in prod mode', () => {
-        expect(() => act(() => {})).toThrow(
-          'act(...) is not supported in production builds of React',
-        );
-      });
-    });
   });
 }
diff --git a/packages/react-reconciler/src/__tests__/ReactIsomorphicAct-test.js b/packages/react-reconciler/src/__tests__/ReactIsomorphicAct-test.js
index eeec3b2b7eb3b..874969b131ea5 100644
--- a/packages/react-reconciler/src/__tests__/ReactIsomorphicAct-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactIsomorphicAct-test.js
@@ -50,6 +50,18 @@ describe('isomorphic act()', () => {
     return text;
   }
 
+  it('behavior in production', () => {
+    if (!__DEV__) {
+      if (gate('fb')) {
+        expect(() => act(() => {})).toThrow(
+          'act(...) is not supported in production builds of React',
+        );
+      } else {
+        expect(React).not.toHaveProperty('act');
+      }
+    }
+  });
+
   // @gate __DEV__
   it('bypasses queueMicrotask', async () => {
     const root = ReactNoop.createRoot();
diff --git a/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js b/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
index 7ee176a106e15..42294269e7b14 100644
--- a/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
+++ b/packages/react-reconciler/src/__tests__/ReactOwnerStacks-test.js
@@ -31,6 +31,16 @@ describe('ReactOwnerStacks', () => {
     );
   }
 
+  it('behavior in production', () => {
+    if (!__DEV__) {
+      if (gate('fb')) {
+        expect(React).toHaveProperty('captureOwnerStack', undefined);
+      } else {
+        expect(React).not.toHaveProperty('captureOwnerStack');
+      }
+    }
+  });
+
   // @gate __DEV__ && enableOwnerStacks
   it('can get the component owner stacks during rendering in dev', async () => {
     let stack;
diff --git a/packages/react/index.js b/packages/react/index.js
index 711a044455257..af4cd4b0c1b17 100644
--- a/packages/react/index.js
+++ b/packages/react/index.js
@@ -23,8 +23,6 @@ export type ElementRef<C> = React$ElementRef<C>;
 export type Config<Props, DefaultProps> = React$Config<Props, DefaultProps>;
 export type ChildrenArray<+T> = $ReadOnlyArray<ChildrenArray<T>> | T;
 
-// Export all exports so that they're available in tests.
-// We can't use export * from in Flow for some reason.
 export {
   __CLIENT_INTERNALS_DO_NOT_USE_OR_WARN_USERS_THEY_CANNOT_UPGRADE,
   __COMPILER_RUNTIME,
diff --git a/packages/react/index.stable.development.js b/packages/react/index.stable.development.js
new file mode 100644
index 0000000000000..f9ac98bafbf58
--- /dev/null
+++ b/packages/react/index.stable.development.js
@@ -0,0 +1,51 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @flow
+ */
+
+export {
+  __CLIENT_INTERNALS_DO_NOT_USE_OR_WARN_USERS_THEY_CANNOT_UPGRADE,
+  __COMPILER_RUNTIME,
+  Children,
+  Component,
+  Fragment,
+  Profiler,
+  PureComponent,
+  StrictMode,
+  Suspense,
+  cloneElement,
+  createContext,
+  createElement,
+  createRef,
+  use,
+  forwardRef,
+  isValidElement,
+  lazy,
+  memo,
+  cache,
+  unstable_useCacheRefresh,
+  startTransition,
+  useId,
+  useCallback,
+  useContext,
+  useDebugValue,
+  useDeferredValue,
+  useEffect,
+  useImperativeHandle,
+  useInsertionEffect,
+  useLayoutEffect,
+  useMemo,
+  useReducer,
+  useOptimistic,
+  useRef,
+  useState,
+  useSyncExternalStore,
+  useTransition,
+  useActionState,
+  version,
+  act, // DEV-only
+} from './src/ReactClient';
diff --git a/packages/react/index.stable.js b/packages/react/index.stable.js
index 26e22c343223e..6f25c7a37d983 100644
--- a/packages/react/index.stable.js
+++ b/packages/react/index.stable.js
@@ -10,7 +10,6 @@
 export {
   __CLIENT_INTERNALS_DO_NOT_USE_OR_WARN_USERS_THEY_CANNOT_UPGRADE,
   __COMPILER_RUNTIME,
-  act,
   Children,
   Component,
   Fragment,
diff --git a/scripts/jest/TestFlags.js b/scripts/jest/TestFlags.js
index b970955491aae..f736ca2254f64 100644
--- a/scripts/jest/TestFlags.js
+++ b/scripts/jest/TestFlags.js
@@ -78,6 +78,7 @@ function getTestFlags() {
       classic: releaseChannel === 'classic',
       source: !process.env.IS_BUILD,
       www,
+      fb: www || xplat,
 
       // These aren't flags, just a useful aliases for tests.
       enableActivity: releaseChannel === 'experimental' || www || xplat,
diff --git a/scripts/jest/setupHostConfigs.js b/scripts/jest/setupHostConfigs.js
index b52fac3201ebf..aacfaf116fcd2 100644
--- a/scripts/jest/setupHostConfigs.js
+++ b/scripts/jest/setupHostConfigs.js
@@ -43,9 +43,9 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
       }
 
       resolvedEntry = nodePath.join(resolvedEntry, '..', entrypoint);
-      const developmentEntry = resolvedEntry.replace('.js', '.development.js');
-      if (fs.existsSync(developmentEntry)) {
-        return developmentEntry;
+      const devEntry = resolvedEntry.replace('.js', '.development.js');
+      if (__DEV__ && fs.existsSync(devEntry)) {
+        return devEntry;
       }
       if (fs.existsSync(resolvedEntry)) {
         return resolvedEntry;
@@ -60,13 +60,20 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
       __EXPERIMENTAL__ ? '.modern.fb.js' : '.classic.fb.js'
     );
     const devFBEntry = resolvedFBEntry.replace('.js', '.development.js');
-    if (fs.existsSync(devFBEntry)) {
+    if (__DEV__ && fs.existsSync(devFBEntry)) {
       return devFBEntry;
     }
     if (fs.existsSync(resolvedFBEntry)) {
       return resolvedFBEntry;
     }
     const resolvedGenericFBEntry = resolvedEntry.replace('.js', '.fb.js');
+    const devGenericFBEntry = resolvedGenericFBEntry.replace(
+      '.js',
+      '.development.js'
+    );
+    if (__DEV__ && fs.existsSync(devGenericFBEntry)) {
+      return devGenericFBEntry;
+    }
     if (fs.existsSync(resolvedGenericFBEntry)) {
       return resolvedGenericFBEntry;
     }
@@ -77,14 +84,14 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
     __EXPERIMENTAL__ ? '.experimental.js' : '.stable.js'
   );
   const devForkedEntry = resolvedForkedEntry.replace('.js', '.development.js');
-  if (fs.existsSync(devForkedEntry)) {
+  if (__DEV__ && fs.existsSync(devForkedEntry)) {
     return devForkedEntry;
   }
   if (fs.existsSync(resolvedForkedEntry)) {
     return resolvedForkedEntry;
   }
   const plainDevEntry = resolvedEntry.replace('.js', '.development.js');
-  if (fs.existsSync(plainDevEntry)) {
+  if (__DEV__ && fs.existsSync(plainDevEntry)) {
     return plainDevEntry;
   }
   // Just use the plain .js one.
diff --git a/scripts/rollup/build.js b/scripts/rollup/build.js
index 2a67c13e1e620..547362dae7123 100644
--- a/scripts/rollup/build.js
+++ b/scripts/rollup/build.js
@@ -571,7 +571,7 @@ function shouldSkipBundle(bundle, bundleType) {
   return false;
 }
 
-function resolveEntryFork(resolvedEntry, isFBBundle) {
+function resolveEntryFork(resolvedEntry, isFBBundle, isDev) {
   // Pick which entry point fork to use:
   // .modern.fb.js
   // .classic.fb.js
@@ -586,23 +586,20 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
       '.js',
       __EXPERIMENTAL__ ? '.modern.fb.js' : '.classic.fb.js'
     );
-    const developmentFBEntry = resolvedFBEntry.replace(
-      '.js',
-      '.development.js'
-    );
-    if (fs.existsSync(developmentFBEntry)) {
-      return developmentFBEntry;
+    const devFBEntry = resolvedFBEntry.replace('.js', '.development.js');
+    if (isDev && fs.existsSync(devFBEntry)) {
+      return devFBEntry;
     }
     if (fs.existsSync(resolvedFBEntry)) {
       return resolvedFBEntry;
     }
     const resolvedGenericFBEntry = resolvedEntry.replace('.js', '.fb.js');
-    const developmentGenericFBEntry = resolvedGenericFBEntry.replace(
+    const devGenericFBEntry = resolvedGenericFBEntry.replace(
       '.js',
       '.development.js'
     );
-    if (fs.existsSync(developmentGenericFBEntry)) {
-      return developmentGenericFBEntry;
+    if (isDev && fs.existsSync(devGenericFBEntry)) {
+      return devGenericFBEntry;
     }
     if (fs.existsSync(resolvedGenericFBEntry)) {
       return resolvedGenericFBEntry;
@@ -614,7 +611,7 @@ function resolveEntryFork(resolvedEntry, isFBBundle) {
     __EXPERIMENTAL__ ? '.experimental.js' : '.stable.js'
   );
   const devForkedEntry = resolvedForkedEntry.replace('.js', '.development.js');
-  if (fs.existsSync(devForkedEntry)) {
+  if (isDev && fs.existsSync(devForkedEntry)) {
     return devForkedEntry;
   }
   if (fs.existsSync(resolvedForkedEntry)) {
@@ -633,7 +630,7 @@ async function createBundle(bundle, bundleType) {
 
   const {isFBWWWBundle, isFBRNBundle} = getBundleTypeFlags(bundleType);
 
-  let resolvedEntry = resolveEntryFork(
+  const resolvedEntry = resolveEntryFork(
     require.resolve(bundle.entry),
     isFBWWWBundle || isFBRNBundle,
     !isProductionBundleType(bundleType)

From 32b0cad8f74da3d6e8b07f4ffbad26dfe8d8a71a Mon Sep 17 00:00:00 2001
From: "Sebastian \"Sebbie\" Silbermann" <sebastian.silbermann@vercel.com>
Date: Thu, 13 Feb 2025 20:38:57 +0100
Subject: [PATCH 51/72] Enable owner stacks in Canary builds (#32053)

Pending internal decision to ship in Canary.
Still off for FB builds.

Docs: https://github.com/reactjs/react.dev/pull/7427
---
 packages/react/index.stable.development.js               | 1 +
 packages/react/src/ReactServer.js                        | 2 ++
 packages/shared/ReactFeatureFlags.js                     | 2 +-
 packages/shared/forks/ReactFeatureFlags.test-renderer.js | 2 +-
 4 files changed, 5 insertions(+), 2 deletions(-)

diff --git a/packages/react/index.stable.development.js b/packages/react/index.stable.development.js
index f9ac98bafbf58..2397010cf5604 100644
--- a/packages/react/index.stable.development.js
+++ b/packages/react/index.stable.development.js
@@ -48,4 +48,5 @@ export {
   useActionState,
   version,
   act, // DEV-only
+  captureOwnerStack, // DEV-only
 } from './src/ReactClient';
diff --git a/packages/react/src/ReactServer.js b/packages/react/src/ReactServer.js
index d6702023e4741..a00e192bd3c1d 100644
--- a/packages/react/src/ReactServer.js
+++ b/packages/react/src/ReactServer.js
@@ -28,6 +28,7 @@ import {lazy} from './ReactLazy';
 import {memo} from './ReactMemo';
 import {cache} from './ReactCacheServer';
 import version from 'shared/ReactVersion';
+import {captureOwnerStack} from './ReactOwnerStack';
 
 const Children = {
   map,
@@ -57,4 +58,5 @@ export {
   useDebugValue,
   useMemo,
   version,
+  captureOwnerStack, // DEV-only
 };
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index fbdfe5a468516..844b2a2f6a914 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -127,7 +127,7 @@ export const passChildrenWhenCloningPersistedNodes = false;
  */
 export const enablePersistedModeClonedFlag = false;
 
-export const enableOwnerStacks = __EXPERIMENTAL__;
+export const enableOwnerStacks = true;
 
 export const enableShallowPropDiffing = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index 6fcd35c40774b..ef3c300602bdb 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -88,7 +88,7 @@ export const enableReactTestRendererWarning = true;
 export const disableDefaultPropsExceptForClasses = true;
 
 export const enableObjectFiber = false;
-export const enableOwnerStacks = false;
+export const enableOwnerStacks = true;
 export const enableRemoveConsolePatches = true;
 
 // Flow magic to verify the exports of this file match the original version.

From a53da6abe1593483098df2baf927fe07d80153a5 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Thu, 13 Feb 2025 16:06:01 -0500
Subject: [PATCH 52/72] Add useSwipeTransition Hook Behind Experimental Flag
 (#32373)

This Hook will be used to drive a View Transition based on a gesture.

```js
const [value, startGesture] = useSwipeTransition(prev, current, next);
```

The `enableSwipeTransition` flag will depend on `enableViewTransition`
flag but we may decide to ship them independently. This PR doesn't do
anything interesting yet. There will be a lot more PRs to build out the
actual functionality. This is just wiring up the plumbing for the new
Hook.

This first PR is mainly concerned with how the whole starts (and stops).
The core API is the `startGesture` function (although there will be
other conveniences added in the future). You can call this to start a
gesture with a source provider. You can call this multiple times in one
event to batch multiple Hooks listening to the same provider. However,
each render can only handle one source provider at a time and so it does
one render per scheduled gesture provider.

This uses a separate `GestureLane` to drive gesture renders by marking
the Hook as having an update on that lane. Then schedule a render. These
renders should be blocking and in the same microtask as the
`startGesture` to ensure it can block the paint. So it's similar to
sync.

It may not be possible to finish it synchronously e.g. if something
suspends. If so, it just tries again later when it can like any other
render. This can also happen because it also may not be possible to
drive more than one gesture at a time like if we're limited to one View
Transition per document. So right now you can only run one gesture at a
time in practice.

These renders never commit. This means that we can't clear the
`GestureLane` the normal way. Instead, we have to clear only the root's
`pendingLanes` if we don't have any new renders scheduled. Then wait
until something else updates the Fiber after all gestures on it have
stopped before it really clears.
---
 .../view-transition/src/components/Page.css   |  11 +
 .../view-transition/src/components/Page.js    |  39 ++-
 .../react-debug-tools/src/ReactDebugHooks.js  |  37 ++-
 .../src/ReactFiberConcurrentUpdates.js        |  38 ++-
 .../src/ReactFiberGestureScheduler.js         |  90 +++++++
 .../react-reconciler/src/ReactFiberHooks.js   | 242 ++++++++++++++++++
 .../react-reconciler/src/ReactFiberLane.js    |  52 ++--
 .../react-reconciler/src/ReactFiberRoot.js    |   5 +
 .../src/ReactFiberRootScheduler.js            |   8 +-
 .../src/ReactFiberWorkLoop.js                 |  44 ++++
 .../src/ReactInternalTypes.js                 |  14 +-
 packages/react-server/src/ReactFizzHooks.js   |  42 ++-
 packages/react-server/src/ReactFlightHooks.js |  45 ++--
 .../react/index.experimental.development.js   |   1 +
 packages/react/index.experimental.js          |   1 +
 packages/react/src/ReactClient.js             |   8 +-
 packages/react/src/ReactHooks.js              |  19 +-
 packages/shared/ReactFeatureFlags.js          |   2 +
 packages/shared/ReactTypes.js                 |   6 +
 .../forks/ReactFeatureFlags.native-fb.js      |   1 +
 .../forks/ReactFeatureFlags.native-oss.js     |   1 +
 .../forks/ReactFeatureFlags.test-renderer.js  |   1 +
 ...actFeatureFlags.test-renderer.native-fb.js |   1 +
 .../ReactFeatureFlags.test-renderer.www.js    |   1 +
 .../shared/forks/ReactFeatureFlags.www.js     |   2 +
 scripts/error-codes/codes.json                |   4 +-
 26 files changed, 647 insertions(+), 68 deletions(-)
 create mode 100644 packages/react-reconciler/src/ReactFiberGestureScheduler.js

diff --git a/fixtures/view-transition/src/components/Page.css b/fixtures/view-transition/src/components/Page.css
index 5afcc33a8f4bc..a5a9373194ef8 100644
--- a/fixtures/view-transition/src/components/Page.css
+++ b/fixtures/view-transition/src/components/Page.css
@@ -6,3 +6,14 @@
   font-variation-settings:
     "wdth" 100;
 }
+
+.swipe-recognizer {
+  width: 200px;
+  overflow-x: scroll;
+  border: 1px solid #333333;
+  border-radius: 10px;
+}
+
+.swipe-overscroll {
+  width: 200%;
+}
diff --git a/fixtures/view-transition/src/components/Page.js b/fixtures/view-transition/src/components/Page.js
index 40f60327728fd..1c7a9bfeb32db 100644
--- a/fixtures/view-transition/src/components/Page.js
+++ b/fixtures/view-transition/src/components/Page.js
@@ -1,6 +1,9 @@
 import React, {
   unstable_ViewTransition as ViewTransition,
   unstable_Activity as Activity,
+  unstable_useSwipeTransition as useSwipeTransition,
+  useRef,
+  useLayoutEffect,
 } from 'react';
 
 import './Page.css';
@@ -35,7 +38,8 @@ function Component() {
 }
 
 export default function Page({url, navigate}) {
-  const show = url === '/?b';
+  const [renderedUrl, startGesture] = useSwipeTransition('/?a', url, '/?b');
+  const show = renderedUrl === '/?b';
   function onTransition(viewTransition, types) {
     const keyframes = [
       {rotate: '0deg', transformOrigin: '30px 8px'},
@@ -44,6 +48,32 @@ export default function Page({url, navigate}) {
     viewTransition.old.animate(keyframes, 250);
     viewTransition.new.animate(keyframes, 250);
   }
+
+  const swipeRecognizer = useRef(null);
+  const activeGesture = useRef(null);
+  function onScroll() {
+    if (activeGesture.current !== null) {
+      return;
+    }
+    // eslint-disable-next-line no-undef
+    const scrollTimeline = new ScrollTimeline({
+      source: swipeRecognizer.current,
+      axis: 'x',
+    });
+    activeGesture.current = startGesture(scrollTimeline);
+  }
+  function onScrollEnd() {
+    if (activeGesture.current !== null) {
+      const cancelGesture = activeGesture.current;
+      activeGesture.current = null;
+      cancelGesture();
+    }
+  }
+
+  useLayoutEffect(() => {
+    swipeRecognizer.current.scrollLeft = show ? 0 : 10000;
+  }, [show]);
+
   const exclamation = (
     <ViewTransition name="exclamation" onShare={onTransition}>
       <span>!</span>
@@ -90,6 +120,13 @@ export default function Page({url, navigate}) {
           <p></p>
           <p></p>
           <p></p>
+          <div
+            className="swipe-recognizer"
+            onScroll={onScroll}
+            onScrollEnd={onScrollEnd}
+            ref={swipeRecognizer}>
+            <div className="swipe-overscroll">Swipe me</div>
+          </div>
           <p></p>
           <p></p>
           {show ? null : (
diff --git a/packages/react-debug-tools/src/ReactDebugHooks.js b/packages/react-debug-tools/src/ReactDebugHooks.js
index 114080d03e921..798cdec4380f8 100644
--- a/packages/react-debug-tools/src/ReactDebugHooks.js
+++ b/packages/react-debug-tools/src/ReactDebugHooks.js
@@ -14,6 +14,7 @@ import type {
   Usable,
   Thenable,
   ReactDebugInfo,
+  StartGesture,
 } from 'shared/ReactTypes';
 import type {
   ContextDependency,
@@ -131,6 +132,9 @@ function getPrimitiveStackCache(): Map<string, Array<any>> {
       if (typeof Dispatcher.useEffectEvent === 'function') {
         Dispatcher.useEffectEvent((args: empty) => {});
       }
+      if (typeof Dispatcher.useSwipeTransition === 'function') {
+        Dispatcher.useSwipeTransition(null, null, null);
+      }
     } finally {
       readHookLog = hookLog;
       hookLog = [];
@@ -752,31 +756,50 @@ function useEffectEvent<Args, F: (...Array<Args>) => mixed>(callback: F): F {
   return callback;
 }
 
+function useSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  nextHook();
+  hookLog.push({
+    displayName: null,
+    primitive: 'SwipeTransition',
+    stackError: new Error(),
+    value: current,
+    debugInfo: null,
+    dispatcherHookName: 'SwipeTransition',
+  });
+  return [current, () => () => {}];
+}
+
 const Dispatcher: DispatcherType = {
-  use,
   readContext,
-  useCacheRefresh,
+
+  use,
   useCallback,
   useContext,
   useEffect,
   useImperativeHandle,
-  useDebugValue,
   useLayoutEffect,
   useInsertionEffect,
   useMemo,
-  useMemoCache,
-  useOptimistic,
   useReducer,
   useRef,
   useState,
+  useDebugValue,
+  useDeferredValue,
   useTransition,
   useSyncExternalStore,
-  useDeferredValue,
   useId,
+  useHostTransitionStatus,
   useFormState,
   useActionState,
-  useHostTransitionStatus,
+  useOptimistic,
+  useMemoCache,
+  useCacheRefresh,
   useEffectEvent,
+  useSwipeTransition,
 };
 
 // create a proxy to throw a custom error
diff --git a/packages/react-reconciler/src/ReactFiberConcurrentUpdates.js b/packages/react-reconciler/src/ReactFiberConcurrentUpdates.js
index 5413db10f6f75..859e553ccbcb6 100644
--- a/packages/react-reconciler/src/ReactFiberConcurrentUpdates.js
+++ b/packages/react-reconciler/src/ReactFiberConcurrentUpdates.js
@@ -24,7 +24,14 @@ import {
   throwIfInfiniteUpdateLoopDetected,
   getWorkInProgressRoot,
 } from './ReactFiberWorkLoop';
-import {NoLane, NoLanes, mergeLanes, markHiddenUpdate} from './ReactFiberLane';
+import {
+  NoLane,
+  NoLanes,
+  mergeLanes,
+  markHiddenUpdate,
+  markRootUpdated,
+  GestureLane,
+} from './ReactFiberLane';
 import {NoFlags, Placement, Hydrating} from './ReactFiberFlags';
 import {HostRoot, OffscreenComponent} from './ReactWorkTags';
 import {OffscreenVisible} from './ReactFiberActivityComponent';
@@ -169,6 +176,25 @@ export function enqueueConcurrentRenderForLane(
   return getRootForUpdatedFiber(fiber);
 }
 
+export function enqueueGestureRender(fiber: Fiber): FiberRoot | null {
+  // We can't use the concurrent queuing for these so this is basically just a
+  // short cut for marking the lane on the parent path. It is possible for a
+  // gesture render to suspend and then in the gap get another gesture starting.
+  // However, marking the lane doesn't make much different in this case because
+  // it would have to call startGesture with the same exact provider as was
+  // already rendering. Because otherwise it has no effect on the Hook itself.
+  // TODO: We could potentially solve this case by popping a ScheduledGesture
+  // off the root's queue while we're rendering it so that it can't dedupe
+  // and so new startGesture with the same provider would create a new
+  // ScheduledGesture which goes into a separate render pass anyway.
+  // This is such an edge case it probably doesn't matter much.
+  const root = markUpdateLaneFromFiberToRoot(fiber, null, GestureLane);
+  if (root !== null) {
+    markRootUpdated(root, GestureLane);
+  }
+  return root;
+}
+
 // Calling this function outside this module should only be done for backwards
 // compatibility and should always be accompanied by a warning.
 export function unsafe_markUpdateLaneFromFiberToRoot(
@@ -189,7 +215,7 @@ function markUpdateLaneFromFiberToRoot(
   sourceFiber: Fiber,
   update: ConcurrentUpdate | null,
   lane: Lane,
-): void {
+): null | FiberRoot {
   // Update the source fiber's lanes
   sourceFiber.lanes = mergeLanes(sourceFiber.lanes, lane);
   let alternate = sourceFiber.alternate;
@@ -238,10 +264,14 @@ function markUpdateLaneFromFiberToRoot(
     parent = parent.return;
   }
 
-  if (isHidden && update !== null && node.tag === HostRoot) {
+  if (node.tag === HostRoot) {
     const root: FiberRoot = node.stateNode;
-    markHiddenUpdate(root, update, lane);
+    if (isHidden && update !== null) {
+      markHiddenUpdate(root, update, lane);
+    }
+    return root;
   }
+  return null;
 }
 
 function getRootForUpdatedFiber(sourceFiber: Fiber): FiberRoot | null {
diff --git a/packages/react-reconciler/src/ReactFiberGestureScheduler.js b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
new file mode 100644
index 0000000000000..7664316b67558
--- /dev/null
+++ b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
@@ -0,0 +1,90 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * @flow
+ */
+
+import type {FiberRoot} from './ReactInternalTypes';
+import type {GestureProvider} from 'shared/ReactTypes';
+
+import {GestureLane} from './ReactFiberLane';
+import {ensureRootIsScheduled} from './ReactFiberRootScheduler';
+
+// This type keeps track of any scheduled or active gestures.
+export type ScheduledGesture = {
+  provider: GestureProvider,
+  count: number, // The number of times this same provider has been started.
+  prev: null | ScheduledGesture, // The previous scheduled gesture in the queue for this root.
+  next: null | ScheduledGesture, // The next scheduled gesture in the queue for this root.
+};
+
+export function scheduleGesture(
+  root: FiberRoot,
+  provider: GestureProvider,
+): ScheduledGesture {
+  let prev = root.gestures;
+  while (prev !== null) {
+    if (prev.provider === provider) {
+      // Existing instance found.
+      prev.count++;
+      return prev;
+    }
+    const next = prev.next;
+    if (next === null) {
+      break;
+    }
+    prev = next;
+  }
+  // Add new instance to the end of the queue.
+  const gesture: ScheduledGesture = {
+    provider: provider,
+    count: 1,
+    prev: prev,
+    next: null,
+  };
+  if (prev === null) {
+    root.gestures = gesture;
+  } else {
+    prev.next = gesture;
+  }
+  ensureRootIsScheduled(root);
+  return gesture;
+}
+
+export function cancelScheduledGesture(
+  root: FiberRoot,
+  gesture: ScheduledGesture,
+): void {
+  gesture.count--;
+  if (gesture.count === 0) {
+    // Delete the scheduled gesture from the queue.
+    deleteScheduledGesture(root, gesture);
+  }
+}
+
+export function deleteScheduledGesture(
+  root: FiberRoot,
+  gesture: ScheduledGesture,
+): void {
+  if (gesture.prev === null) {
+    if (root.gestures === gesture) {
+      root.gestures = gesture.next;
+      if (root.gestures === null) {
+        // Gestures don't clear their lanes while the gesture is still active but it
+        // might not be scheduled to do any more renders and so we shouldn't schedule
+        // any more gesture lane work until a new gesture is scheduled.
+        root.pendingLanes &= ~GestureLane;
+      }
+    }
+  } else {
+    gesture.prev.next = gesture.next;
+    if (gesture.next !== null) {
+      gesture.next.prev = gesture.prev;
+    }
+    gesture.prev = null;
+    gesture.next = null;
+  }
+}
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 2ab41770bd0ac..06e00441c3b8e 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -14,6 +14,8 @@ import type {
   Thenable,
   RejectedThenable,
   Awaited,
+  StartGesture,
+  GestureProvider,
 } from 'shared/ReactTypes';
 import type {
   Fiber,
@@ -26,6 +28,7 @@ import type {Lanes, Lane} from './ReactFiberLane';
 import type {HookFlags} from './ReactHookEffectTags';
 import type {Flags} from './ReactFiberFlags';
 import type {TransitionStatus} from './ReactFiberConfig';
+import type {ScheduledGesture} from './ReactFiberGestureScheduler';
 
 import {
   HostTransitionContext,
@@ -42,6 +45,7 @@ import {
   enableLegacyCache,
   disableLegacyMode,
   enableNoCloningMemoCache,
+  enableSwipeTransition,
 } from 'shared/ReactFeatureFlags';
 import {
   REACT_CONTEXT_TYPE,
@@ -70,6 +74,8 @@ import {
   isTransitionLane,
   markRootEntangled,
   includesSomeLane,
+  isGestureRender,
+  GestureLane,
 } from './ReactFiberLane';
 import {
   ContinuousEventPriority,
@@ -130,6 +136,7 @@ import {
   enqueueConcurrentHookUpdate,
   enqueueConcurrentHookUpdateAndEagerlyBailout,
   enqueueConcurrentRenderForLane,
+  enqueueGestureRender,
 } from './ReactFiberConcurrentUpdates';
 import {getTreeId} from './ReactFiberTreeContext';
 import {now} from './Scheduler';
@@ -153,6 +160,11 @@ import {requestCurrentTransition} from './ReactFiberTransition';
 
 import {callComponentInDEV} from './ReactFiberCallUserSpace';
 
+import {
+  scheduleGesture,
+  cancelScheduledGesture,
+} from './ReactFiberGestureScheduler';
+
 export type Update<S, A> = {
   lane: Lane,
   revertLane: Lane,
@@ -3960,6 +3972,133 @@ function markUpdateInDevTools<A>(fiber: Fiber, lane: Lane, action: A): void {
   }
 }
 
+type SwipeTransitionGestureUpdate = {
+  gesture: ScheduledGesture,
+  prev: SwipeTransitionGestureUpdate | null,
+  next: SwipeTransitionGestureUpdate | null,
+};
+
+type SwipeTransitionUpdateQueue = {
+  pending: null | SwipeTransitionGestureUpdate,
+  dispatch: StartGesture,
+};
+
+function startGesture(
+  fiber: Fiber,
+  queue: SwipeTransitionUpdateQueue,
+  gestureProvider: GestureProvider,
+): () => void {
+  const root = enqueueGestureRender(fiber);
+  if (root === null) {
+    // Already unmounted.
+    // TODO: Should we warn here about starting on an unmounted Fiber?
+    return function cancelGesture() {
+      // Noop.
+    };
+  }
+  const scheduledGesture = scheduleGesture(root, gestureProvider);
+  // Add this particular instance to the queue.
+  // We add multiple of the same provider even if they get batched so
+  // that if we cancel one but not the other we can keep track of this.
+  // Order doesn't matter but we insert in the beginning to avoid two fields.
+  const update: SwipeTransitionGestureUpdate = {
+    gesture: scheduledGesture,
+    prev: null,
+    next: queue.pending,
+  };
+  if (queue.pending !== null) {
+    queue.pending.prev = update;
+  }
+  queue.pending = update;
+  return function cancelGesture(): void {
+    if (update.prev === null) {
+      if (queue.pending === update) {
+        queue.pending = update.next;
+      } else {
+        // This was already cancelled. Avoid double decrementing if someone calls this twice by accident.
+        // TODO: Should we warn here about double cancelling?
+        return;
+      }
+    } else {
+      update.prev.next = update.next;
+      if (update.next !== null) {
+        update.next.prev = update.prev;
+      }
+      update.prev = null;
+      update.next = null;
+    }
+    const cancelledGestured = update.gesture;
+    // Decrement ref count of the root schedule.
+    cancelScheduledGesture(root, cancelledGestured);
+  };
+}
+
+function mountSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  const queue: SwipeTransitionUpdateQueue = {
+    pending: null,
+    dispatch: (null: any),
+  };
+  const startGestureOnHook: StartGesture = (queue.dispatch = (startGesture.bind(
+    null,
+    currentlyRenderingFiber,
+    queue,
+  ): any));
+  const hook = mountWorkInProgressHook();
+  hook.queue = queue;
+  return [current, startGestureOnHook];
+}
+
+function updateSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  const hook = updateWorkInProgressHook();
+  const queue: SwipeTransitionUpdateQueue = hook.queue;
+  const startGestureOnHook: StartGesture = queue.dispatch;
+  const rootRenderLanes = getWorkInProgressRootRenderLanes();
+  let value = current;
+  if (isGestureRender(rootRenderLanes)) {
+    // We're inside a gesture render. We'll traverse the queue to see if
+    // this specific Hook is part of this gesture and, if so, which
+    // direction to render.
+    const root: FiberRoot | null = getWorkInProgressRoot();
+    if (root === null) {
+      throw new Error(
+        'Expected a work-in-progress root. This is a bug in React. Please file an issue.',
+      );
+    }
+    // We assume that the currently rendering gesture is the one first in the queue.
+    const rootRenderGesture = root.gestures;
+    let update = queue.pending;
+    while (update !== null) {
+      if (rootRenderGesture === update.gesture) {
+        // We had a match, meaning we're currently rendering a direction of this
+        // hook for this gesture.
+        // TODO: Determine which direction this gesture is currently rendering.
+        value = previous;
+        break;
+      }
+      update = update.next;
+    }
+  }
+  if (queue.pending !== null) {
+    // As long as there are any active gestures we need to leave the lane on
+    // in case we need to render it later. Since a gesture render doesn't commit
+    // the only time it really fully gets cleared is if something else rerenders
+    // this component after all the active gestures has cleared.
+    currentlyRenderingFiber.lanes = mergeLanes(
+      currentlyRenderingFiber.lanes,
+      GestureLane,
+    );
+  }
+  return [value, startGestureOnHook];
+}
+
 export const ContextOnlyDispatcher: Dispatcher = {
   readContext,
 
@@ -3989,6 +4128,10 @@ export const ContextOnlyDispatcher: Dispatcher = {
 if (enableUseEffectEventHook) {
   (ContextOnlyDispatcher: Dispatcher).useEffectEvent = throwInvalidHookError;
 }
+if (enableSwipeTransition) {
+  (ContextOnlyDispatcher: Dispatcher).useSwipeTransition =
+    throwInvalidHookError;
+}
 
 const HooksDispatcherOnMount: Dispatcher = {
   readContext,
@@ -4019,6 +4162,10 @@ const HooksDispatcherOnMount: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnMount: Dispatcher).useEffectEvent = mountEvent;
 }
+if (enableSwipeTransition) {
+  (HooksDispatcherOnMount: Dispatcher).useSwipeTransition =
+    mountSwipeTransition;
+}
 
 const HooksDispatcherOnUpdate: Dispatcher = {
   readContext,
@@ -4049,6 +4196,10 @@ const HooksDispatcherOnUpdate: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnUpdate: Dispatcher).useEffectEvent = updateEvent;
 }
+if (enableSwipeTransition) {
+  (HooksDispatcherOnUpdate: Dispatcher).useSwipeTransition =
+    updateSwipeTransition;
+}
 
 const HooksDispatcherOnRerender: Dispatcher = {
   readContext,
@@ -4079,6 +4230,10 @@ const HooksDispatcherOnRerender: Dispatcher = {
 if (enableUseEffectEventHook) {
   (HooksDispatcherOnRerender: Dispatcher).useEffectEvent = updateEvent;
 }
+if (enableSwipeTransition) {
+  (HooksDispatcherOnRerender: Dispatcher).useSwipeTransition =
+    updateSwipeTransition;
+}
 
 let HooksDispatcherOnMountInDEV: Dispatcher | null = null;
 let HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher | null = null;
@@ -4296,6 +4451,18 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (HooksDispatcherOnMountInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        mountHookTypesDev();
+        return mountSwipeTransition(previous, current, next);
+      };
+  }
 
   HooksDispatcherOnMountWithHookTypesInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4479,6 +4646,18 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (HooksDispatcherOnMountWithHookTypesInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 
   HooksDispatcherOnUpdateInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4662,6 +4841,18 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (HooksDispatcherOnUpdateInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 
   HooksDispatcherOnRerenderInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -4845,6 +5036,18 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (HooksDispatcherOnRerenderInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 
   InvalidNestedHooksDispatcherOnMountInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5053,6 +5256,19 @@ if (__DEV__) {
         return mountEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (InvalidNestedHooksDispatcherOnMountInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        warnInvalidHookAccess();
+        mountHookTypesDev();
+        return mountSwipeTransition(previous, current, next);
+      };
+  }
 
   InvalidNestedHooksDispatcherOnUpdateInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5261,6 +5477,19 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (InvalidNestedHooksDispatcherOnUpdateInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        warnInvalidHookAccess();
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 
   InvalidNestedHooksDispatcherOnRerenderInDEV = {
     readContext<T>(context: ReactContext<T>): T {
@@ -5469,4 +5698,17 @@ if (__DEV__) {
         return updateEvent(callback);
       };
   }
+  if (enableSwipeTransition) {
+    (InvalidNestedHooksDispatcherOnRerenderInDEV: Dispatcher).useSwipeTransition =
+      function useSwipeTransition<T>(
+        previous: T,
+        current: T,
+        next: T,
+      ): [T, StartGesture] {
+        currentHookNameInDev = 'useSwipeTransition';
+        warnInvalidHookAccess();
+        updateHookTypesDev();
+        return updateSwipeTransition(previous, current, next);
+      };
+  }
 }
diff --git a/packages/react-reconciler/src/ReactFiberLane.js b/packages/react-reconciler/src/ReactFiberLane.js
index 922fe2f977d45..22bf99624dbb4 100644
--- a/packages/react-reconciler/src/ReactFiberLane.js
+++ b/packages/react-reconciler/src/ReactFiberLane.js
@@ -54,23 +54,24 @@ export const DefaultLane: Lane = /*                     */ 0b0000000000000000000
 export const SyncUpdateLanes: Lane =
   SyncLane | InputContinuousLane | DefaultLane;
 
-const TransitionHydrationLane: Lane = /*                */ 0b0000000000000000000000001000000;
-const TransitionLanes: Lanes = /*                       */ 0b0000000001111111111111110000000;
-const TransitionLane1: Lane = /*                        */ 0b0000000000000000000000010000000;
-const TransitionLane2: Lane = /*                        */ 0b0000000000000000000000100000000;
-const TransitionLane3: Lane = /*                        */ 0b0000000000000000000001000000000;
-const TransitionLane4: Lane = /*                        */ 0b0000000000000000000010000000000;
-const TransitionLane5: Lane = /*                        */ 0b0000000000000000000100000000000;
-const TransitionLane6: Lane = /*                        */ 0b0000000000000000001000000000000;
-const TransitionLane7: Lane = /*                        */ 0b0000000000000000010000000000000;
-const TransitionLane8: Lane = /*                        */ 0b0000000000000000100000000000000;
-const TransitionLane9: Lane = /*                        */ 0b0000000000000001000000000000000;
-const TransitionLane10: Lane = /*                       */ 0b0000000000000010000000000000000;
-const TransitionLane11: Lane = /*                       */ 0b0000000000000100000000000000000;
-const TransitionLane12: Lane = /*                       */ 0b0000000000001000000000000000000;
-const TransitionLane13: Lane = /*                       */ 0b0000000000010000000000000000000;
-const TransitionLane14: Lane = /*                       */ 0b0000000000100000000000000000000;
-const TransitionLane15: Lane = /*                       */ 0b0000000001000000000000000000000;
+export const GestureLane: Lane = /*                     */ 0b0000000000000000000000001000000;
+
+const TransitionHydrationLane: Lane = /*                */ 0b0000000000000000000000010000000;
+const TransitionLanes: Lanes = /*                       */ 0b0000000001111111111111100000000;
+const TransitionLane1: Lane = /*                        */ 0b0000000000000000000000100000000;
+const TransitionLane2: Lane = /*                        */ 0b0000000000000000000001000000000;
+const TransitionLane3: Lane = /*                        */ 0b0000000000000000000010000000000;
+const TransitionLane4: Lane = /*                        */ 0b0000000000000000000100000000000;
+const TransitionLane5: Lane = /*                        */ 0b0000000000000000001000000000000;
+const TransitionLane6: Lane = /*                        */ 0b0000000000000000010000000000000;
+const TransitionLane7: Lane = /*                        */ 0b0000000000000000100000000000000;
+const TransitionLane8: Lane = /*                        */ 0b0000000000000001000000000000000;
+const TransitionLane9: Lane = /*                        */ 0b0000000000000010000000000000000;
+const TransitionLane10: Lane = /*                       */ 0b0000000000000100000000000000000;
+const TransitionLane11: Lane = /*                       */ 0b0000000000001000000000000000000;
+const TransitionLane12: Lane = /*                       */ 0b0000000000010000000000000000000;
+const TransitionLane13: Lane = /*                       */ 0b0000000000100000000000000000000;
+const TransitionLane14: Lane = /*                       */ 0b0000000001000000000000000000000;
 
 const RetryLanes: Lanes = /*                            */ 0b0000011110000000000000000000000;
 const RetryLane1: Lane = /*                             */ 0b0000000010000000000000000000000;
@@ -175,6 +176,8 @@ function getHighestPriorityLanes(lanes: Lanes | Lane): Lanes {
       return DefaultHydrationLane;
     case DefaultLane:
       return DefaultLane;
+    case GestureLane:
+      return GestureLane;
     case TransitionHydrationLane:
       return TransitionHydrationLane;
     case TransitionLane1:
@@ -191,7 +194,6 @@ function getHighestPriorityLanes(lanes: Lanes | Lane): Lanes {
     case TransitionLane12:
     case TransitionLane13:
     case TransitionLane14:
-    case TransitionLane15:
       return lanes & TransitionLanes;
     case RetryLane1:
     case RetryLane2:
@@ -459,6 +461,7 @@ function computeExpirationTime(lane: Lane, currentTime: number) {
     case SyncLane:
     case InputContinuousHydrationLane:
     case InputContinuousLane:
+    case GestureLane:
       // User interactions should expire slightly more quickly.
       //
       // NOTE: This is set to the corresponding constant as in Scheduler.js.
@@ -486,7 +489,6 @@ function computeExpirationTime(lane: Lane, currentTime: number) {
     case TransitionLane12:
     case TransitionLane13:
     case TransitionLane14:
-    case TransitionLane15:
       return currentTime + transitionLaneExpirationMs;
     case RetryLane1:
     case RetryLane2:
@@ -640,7 +642,8 @@ export function includesBlockingLane(lanes: Lanes): boolean {
     InputContinuousHydrationLane |
     InputContinuousLane |
     DefaultHydrationLane |
-    DefaultLane;
+    DefaultLane |
+    GestureLane;
   return (lanes & SyncDefaultLanes) !== NoLanes;
 }
 
@@ -663,6 +666,11 @@ export function isTransitionLane(lane: Lane): boolean {
   return (lane & TransitionLanes) !== NoLanes;
 }
 
+export function isGestureRender(lanes: Lanes): boolean {
+  // This should render only the one lane.
+  return lanes === GestureLane;
+}
+
 export function claimNextTransitionLane(): Lane {
   // Cycle through the lanes, assigning each new transition to the next lane.
   // In most cases, this means every transition gets its own lane, until we
@@ -1053,7 +1061,6 @@ export function getBumpedLaneForHydrationByLane(lane: Lane): Lane {
     case TransitionLane12:
     case TransitionLane13:
     case TransitionLane14:
-    case TransitionLane15:
     case RetryLane1:
     case RetryLane2:
     case RetryLane3:
@@ -1197,7 +1204,8 @@ export function getGroupNameOfHighestPriorityLane(lanes: Lanes): string {
       InputContinuousHydrationLane |
       InputContinuousLane |
       DefaultHydrationLane |
-      DefaultLane)
+      DefaultLane |
+      GestureLane)
   ) {
     return 'Blocking';
   }
diff --git a/packages/react-reconciler/src/ReactFiberRoot.js b/packages/react-reconciler/src/ReactFiberRoot.js
index 4971bb4c2be34..03ddde7a5ab5b 100644
--- a/packages/react-reconciler/src/ReactFiberRoot.js
+++ b/packages/react-reconciler/src/ReactFiberRoot.js
@@ -33,6 +33,7 @@ import {
   enableUpdaterTracking,
   enableTransitionTracing,
   disableLegacyMode,
+  enableSwipeTransition,
 } from 'shared/ReactFeatureFlags';
 import {initializeUpdateQueue} from './ReactFiberClassUpdateQueue';
 import {LegacyRoot, ConcurrentRoot} from './ReactRootTags';
@@ -97,6 +98,10 @@ function FiberRootNode(
 
   this.formState = formState;
 
+  if (enableSwipeTransition) {
+    this.gestures = null;
+  }
+
   this.incompleteTransitions = new Map();
   if (enableTransitionTracing) {
     this.transitionCallbacks = null;
diff --git a/packages/react-reconciler/src/ReactFiberRootScheduler.js b/packages/react-reconciler/src/ReactFiberRootScheduler.js
index 41daa6b806065..293992e40618d 100644
--- a/packages/react-reconciler/src/ReactFiberRootScheduler.js
+++ b/packages/react-reconciler/src/ReactFiberRootScheduler.js
@@ -20,6 +20,7 @@ import {
   enableComponentPerformanceTrack,
   enableSiblingPrerendering,
   enableYieldingBeforePassive,
+  enableSwipeTransition,
 } from 'shared/ReactFeatureFlags';
 import {
   NoLane,
@@ -32,6 +33,7 @@ import {
   claimNextTransitionLane,
   getNextLanesToFlushSync,
   checkIfRootIsPrerendering,
+  isGestureRender,
 } from './ReactFiberLane';
 import {
   CommitContext,
@@ -211,7 +213,8 @@ function flushSyncWorkAcrossRoots_impl(
             rootHasPendingCommit,
           );
           if (
-            includesSyncLane(nextLanes) &&
+            (includesSyncLane(nextLanes) ||
+              (enableSwipeTransition && isGestureRender(nextLanes))) &&
             !checkIfRootIsPrerendering(root, nextLanes)
           ) {
             // This root has pending sync work. Flush it now.
@@ -296,7 +299,8 @@ function processRootScheduleInMicrotask() {
         syncTransitionLanes !== NoLanes ||
         // Common case: we're not treating any extra lanes as synchronous, so we
         // can just check if the next lanes are sync.
-        includesSyncLane(nextLanes)
+        includesSyncLane(nextLanes) ||
+        (enableSwipeTransition && isGestureRender(nextLanes))
       ) {
         mightHavePendingSyncWork = true;
       }
diff --git a/packages/react-reconciler/src/ReactFiberWorkLoop.js b/packages/react-reconciler/src/ReactFiberWorkLoop.js
index 5f17ca31b3693..b3d1e5371c06c 100644
--- a/packages/react-reconciler/src/ReactFiberWorkLoop.js
+++ b/packages/react-reconciler/src/ReactFiberWorkLoop.js
@@ -47,6 +47,7 @@ import {
   enableYieldingBeforePassive,
   enableThrottledScheduling,
   enableViewTransition,
+  enableSwipeTransition,
 } from 'shared/ReactFeatureFlags';
 import ReactSharedInternals from 'shared/ReactSharedInternals';
 import is from 'shared/objectIs';
@@ -184,6 +185,8 @@ import {
   claimNextTransitionLane,
   checkIfRootIsPrerendering,
   includesOnlyViewTransitionEligibleLanes,
+  isGestureRender,
+  GestureLane,
 } from './ReactFiberLane';
 import {
   DiscreteEventPriority,
@@ -338,6 +341,7 @@ import {
 import {getMaskedContext, getUnmaskedContext} from './ReactFiberContext';
 import {peekEntangledActionLane} from './ReactFiberAsyncAction';
 import {logUncaughtError} from './ReactFiberErrorLogger';
+import {deleteScheduledGesture} from './ReactFiberGestureScheduler';
 
 const PossiblyWeakMap = typeof WeakMap === 'function' ? WeakMap : Map;
 
@@ -3287,6 +3291,13 @@ function commitRoot(
   const concurrentlyUpdatedLanes = getConcurrentlyUpdatedLanes();
   remainingLanes = mergeLanes(remainingLanes, concurrentlyUpdatedLanes);
 
+  if (enableSwipeTransition && root.gestures === null) {
+    // Gestures don't clear their lanes while the gesture is still active but it
+    // might not be scheduled to do any more renders and so we shouldn't schedule
+    // any more gesture lane work until a new gesture is scheduled.
+    remainingLanes &= ~GestureLane;
+  }
+
   markRootFinished(
     root,
     lanes,
@@ -3310,6 +3321,21 @@ function commitRoot(
     // times out.
   }
 
+  if (enableSwipeTransition && isGestureRender(lanes)) {
+    // This is a special kind of render that doesn't commit regular effects.
+    commitGestureOnRoot(
+      root,
+      finishedWork,
+      recoverableErrors,
+      enableProfilerTimer
+        ? suspendedCommitReason === IMMEDIATE_COMMIT
+          ? completedRenderEndTime
+          : commitStartTime
+        : 0,
+    );
+    return;
+  }
+
   // workInProgressX might be overwritten, so we want
   // to store it in pendingPassiveX until they get processed
   // We need to pass this through as an argument to commitRoot
@@ -3802,6 +3828,24 @@ function flushSpawnedWork(): void {
   }
 }
 
+function commitGestureOnRoot(
+  root: FiberRoot,
+  finishedWork: null | Fiber,
+  recoverableErrors: null | Array<CapturedValue<mixed>>,
+  renderEndTime: number, // Profiling-only
+): void {
+  // We assume that the gesture we just rendered was the first one in the queue.
+  const finishedGesture = root.gestures;
+  if (finishedGesture === null) {
+    throw new Error(
+      'Finished rendering the gesture lane but there were no pending gestures. ' +
+        'React should not have started a render in this case. This is a bug in React.',
+    );
+  }
+  deleteScheduledGesture(root, finishedGesture);
+  // TODO: Run the gesture
+}
+
 function makeErrorInfo(componentStack: ?string) {
   const errorInfo = {
     componentStack,
diff --git a/packages/react-reconciler/src/ReactInternalTypes.js b/packages/react-reconciler/src/ReactInternalTypes.js
index 98e7d4deefea3..3479eba1b9dd3 100644
--- a/packages/react-reconciler/src/ReactInternalTypes.js
+++ b/packages/react-reconciler/src/ReactInternalTypes.js
@@ -17,6 +17,7 @@ import type {
   Awaited,
   ReactComponentInfo,
   ReactDebugInfo,
+  StartGesture,
 } from 'shared/ReactTypes';
 import type {WorkTag} from './ReactWorkTags';
 import type {TypeOfMode} from './ReactTypeOfMode';
@@ -38,6 +39,7 @@ import type {
 import type {ConcurrentUpdate} from './ReactFiberConcurrentUpdates';
 import type {ComponentStackNode} from 'react-server/src/ReactFizzComponentStack';
 import type {ThenableState} from './ReactFiberThenable';
+import type {ScheduledGesture} from './ReactFiberGestureScheduler';
 
 // Unwind Circular: moved from ReactFiberHooks.old
 export type HookType =
@@ -60,7 +62,8 @@ export type HookType =
   | 'useCacheRefresh'
   | 'useOptimistic'
   | 'useFormState'
-  | 'useActionState';
+  | 'useActionState'
+  | 'useSwipeTransition';
 
 export type ContextDependency<T> = {
   context: ReactContext<T>,
@@ -279,6 +282,9 @@ type BaseFiberRootProperties = {
   ) => void,
 
   formState: ReactFormState<any, any> | null,
+
+  // enableSwipeTransition only
+  gestures: null | ScheduledGesture,
 };
 
 // The following attributes are only used by DevTools and are only present in DEV builds.
@@ -442,6 +448,12 @@ export type Dispatcher = {
     initialState: Awaited<S>,
     permalink?: string,
   ) => [Awaited<S>, (P) => void, boolean],
+  // TODO: Non-nullable once `enableSwipeTransition` is on everywhere.
+  useSwipeTransition?: <T>(
+    previous: T,
+    current: T,
+    next: T,
+  ) => [T, StartGesture],
 };
 
 export type AsyncDispatcher = {
diff --git a/packages/react-server/src/ReactFizzHooks.js b/packages/react-server/src/ReactFizzHooks.js
index a0ec1c7414982..8ae00568ae670 100644
--- a/packages/react-server/src/ReactFizzHooks.js
+++ b/packages/react-server/src/ReactFizzHooks.js
@@ -16,6 +16,7 @@ import type {
   Usable,
   ReactCustomFormAction,
   Awaited,
+  StartGesture,
 } from 'shared/ReactTypes';
 
 import type {ResumableState} from './ReactFizzConfig';
@@ -38,7 +39,10 @@ import {
 } from './ReactFizzConfig';
 import {createFastHash} from './ReactServerStreamConfig';
 
-import {enableUseEffectEventHook} from 'shared/ReactFeatureFlags';
+import {
+  enableUseEffectEventHook,
+  enableSwipeTransition,
+} from 'shared/ReactFeatureFlags';
 import is from 'shared/objectIs';
 import {
   REACT_CONTEXT_TYPE,
@@ -795,6 +799,19 @@ function useMemoCache(size: number): Array<mixed> {
   return data;
 }
 
+function unsupportedStartGesture() {
+  throw new Error('startGesture cannot be called during server rendering.');
+}
+
+function useSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  resolveCurrentlyRenderingComponent();
+  return [current, unsupportedStartGesture];
+}
+
 function noop(): void {}
 
 function clientHookNotSupported() {
@@ -837,25 +854,25 @@ export const HooksDispatcher: Dispatcher = supportsClientAPIs
   : {
       readContext,
       use,
+      useCallback,
       useContext,
+      useEffect: clientHookNotSupported,
+      useImperativeHandle: clientHookNotSupported,
+      useInsertionEffect: clientHookNotSupported,
+      useLayoutEffect: clientHookNotSupported,
       useMemo,
       useReducer: clientHookNotSupported,
       useRef: clientHookNotSupported,
       useState: clientHookNotSupported,
-      useInsertionEffect: clientHookNotSupported,
-      useLayoutEffect: clientHookNotSupported,
-      useCallback,
-      useImperativeHandle: clientHookNotSupported,
-      useEffect: clientHookNotSupported,
       useDebugValue: noop,
       useDeferredValue: clientHookNotSupported,
       useTransition: clientHookNotSupported,
-      useId,
       useSyncExternalStore: clientHookNotSupported,
-      useOptimistic,
-      useActionState,
-      useFormState: useActionState,
+      useId,
       useHostTransitionStatus,
+      useFormState: useActionState,
+      useActionState,
+      useOptimistic,
       useMemoCache,
       useCacheRefresh,
     };
@@ -863,6 +880,11 @@ export const HooksDispatcher: Dispatcher = supportsClientAPIs
 if (enableUseEffectEventHook) {
   HooksDispatcher.useEffectEvent = useEffectEvent;
 }
+if (enableSwipeTransition) {
+  HooksDispatcher.useSwipeTransition = supportsClientAPIs
+    ? useSwipeTransition
+    : clientHookNotSupported;
+}
 
 export let currentResumableState: null | ResumableState = (null: any);
 export function setCurrentResumableState(
diff --git a/packages/react-server/src/ReactFlightHooks.js b/packages/react-server/src/ReactFlightHooks.js
index d0351e38c86aa..f1d31f3e486eb 100644
--- a/packages/react-server/src/ReactFlightHooks.js
+++ b/packages/react-server/src/ReactFlightHooks.js
@@ -17,6 +17,10 @@ import {
 } from 'shared/ReactSymbols';
 import {createThenableState, trackUsedThenable} from './ReactFlightThenable';
 import {isClientReference} from './ReactFlightServerConfig';
+import {
+  enableUseEffectEventHook,
+  enableSwipeTransition,
+} from 'shared/ReactFeatureFlags';
 
 let currentRequest = null;
 let thenableIndexCounter = 0;
@@ -58,33 +62,32 @@ export function getThenableStateAfterSuspending(): ThenableState {
 }
 
 export const HooksDispatcher: Dispatcher = {
-  useMemo<T>(nextCreate: () => T): T {
-    return nextCreate();
-  },
+  readContext: (unsupportedContext: any),
+
+  use,
   useCallback<T>(callback: T): T {
     return callback;
   },
-  useDebugValue(): void {},
-  useDeferredValue: (unsupportedHook: any),
-  useTransition: (unsupportedHook: any),
-  readContext: (unsupportedContext: any),
   useContext: (unsupportedContext: any),
+  useEffect: (unsupportedHook: any),
+  useImperativeHandle: (unsupportedHook: any),
+  useLayoutEffect: (unsupportedHook: any),
+  useInsertionEffect: (unsupportedHook: any),
+  useMemo<T>(nextCreate: () => T): T {
+    return nextCreate();
+  },
   useReducer: (unsupportedHook: any),
   useRef: (unsupportedHook: any),
   useState: (unsupportedHook: any),
-  useInsertionEffect: (unsupportedHook: any),
-  useLayoutEffect: (unsupportedHook: any),
-  useImperativeHandle: (unsupportedHook: any),
-  useEffect: (unsupportedHook: any),
+  useDebugValue(): void {},
+  useDeferredValue: (unsupportedHook: any),
+  useTransition: (unsupportedHook: any),
+  useSyncExternalStore: (unsupportedHook: any),
   useId,
   useHostTransitionStatus: (unsupportedHook: any),
-  useOptimistic: (unsupportedHook: any),
   useFormState: (unsupportedHook: any),
   useActionState: (unsupportedHook: any),
-  useSyncExternalStore: (unsupportedHook: any),
-  useCacheRefresh(): <T>(?() => T, ?T) => void {
-    return unsupportedRefresh;
-  },
+  useOptimistic: (unsupportedHook: any),
   useMemoCache(size: number): Array<any> {
     const data = new Array<any>(size);
     for (let i = 0; i < size; i++) {
@@ -92,8 +95,16 @@ export const HooksDispatcher: Dispatcher = {
     }
     return data;
   },
-  use,
+  useCacheRefresh(): <T>(?() => T, ?T) => void {
+    return unsupportedRefresh;
+  },
 };
+if (enableUseEffectEventHook) {
+  HooksDispatcher.useEffectEvent = (unsupportedHook: any);
+}
+if (enableSwipeTransition) {
+  HooksDispatcher.useSwipeTransition = (unsupportedHook: any);
+}
 
 function unsupportedHook(): void {
   throw new Error('This Hook is not supported in Server Components.');
diff --git a/packages/react/index.experimental.development.js b/packages/react/index.experimental.development.js
index 6074b683b781d..e8ebc236133b0 100644
--- a/packages/react/index.experimental.development.js
+++ b/packages/react/index.experimental.development.js
@@ -33,6 +33,7 @@ export {
   unstable_getCacheForType,
   unstable_SuspenseList,
   unstable_ViewTransition,
+  unstable_useSwipeTransition,
   unstable_addTransitionType,
   unstable_useCacheRefresh,
   useId,
diff --git a/packages/react/index.experimental.js b/packages/react/index.experimental.js
index 77cf6bd0e0317..a3c6f4a10f090 100644
--- a/packages/react/index.experimental.js
+++ b/packages/react/index.experimental.js
@@ -33,6 +33,7 @@ export {
   unstable_getCacheForType,
   unstable_SuspenseList,
   unstable_ViewTransition,
+  unstable_useSwipeTransition,
   unstable_addTransitionType,
   unstable_useCacheRefresh,
   useId,
diff --git a/packages/react/src/ReactClient.js b/packages/react/src/ReactClient.js
index 715ea8ab47c35..33175a9a77f35 100644
--- a/packages/react/src/ReactClient.js
+++ b/packages/react/src/ReactClient.js
@@ -57,6 +57,7 @@ import {
   use,
   useOptimistic,
   useActionState,
+  useSwipeTransition,
 } from './ReactHooks';
 import ReactSharedInternals from './ReactSharedInternalsClient';
 import {startTransition} from './ReactStartTransition';
@@ -126,7 +127,10 @@ export {
   // enableViewTransition
   REACT_VIEW_TRANSITION_TYPE as unstable_ViewTransition,
   addTransitionType as unstable_addTransitionType,
+  // enableSwipeTransition
+  useSwipeTransition as unstable_useSwipeTransition,
+  // DEV-only
   useId,
-  act, // DEV-only
-  captureOwnerStack, // DEV-only
+  act,
+  captureOwnerStack,
 };
diff --git a/packages/react/src/ReactHooks.js b/packages/react/src/ReactHooks.js
index ba6b0ffbcb71e..605337480f731 100644
--- a/packages/react/src/ReactHooks.js
+++ b/packages/react/src/ReactHooks.js
@@ -13,12 +13,16 @@ import type {
   StartTransitionOptions,
   Usable,
   Awaited,
+  StartGesture,
 } from 'shared/ReactTypes';
 import {REACT_CONSUMER_TYPE} from 'shared/ReactSymbols';
 
 import ReactSharedInternals from 'shared/ReactSharedInternals';
 
-import {enableUseEffectCRUDOverload} from 'shared/ReactFeatureFlags';
+import {
+  enableUseEffectCRUDOverload,
+  enableSwipeTransition,
+} from 'shared/ReactFeatureFlags';
 
 type BasicStateAction<S> = (S => S) | S;
 type Dispatch<A> = A => void;
@@ -261,3 +265,16 @@ export function useActionState<S, P>(
   const dispatcher = resolveDispatcher();
   return dispatcher.useActionState(action, initialState, permalink);
 }
+
+export function useSwipeTransition<T>(
+  previous: T,
+  current: T,
+  next: T,
+): [T, StartGesture] {
+  if (!enableSwipeTransition) {
+    throw new Error('Not implemented.');
+  }
+  const dispatcher = resolveDispatcher();
+  // $FlowFixMe[not-a-function] This is unstable, thus optional
+  return dispatcher.useSwipeTransition(previous, current, next);
+}
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index 844b2a2f6a914..ea09d0a3c76e3 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -92,6 +92,8 @@ export const enableHalt = __EXPERIMENTAL__;
 
 export const enableViewTransition = __EXPERIMENTAL__;
 
+export const enableSwipeTransition = __EXPERIMENTAL__;
+
 /**
  * Switches Fiber creation to a simple object instead of a constructor.
  */
diff --git a/packages/shared/ReactTypes.js b/packages/shared/ReactTypes.js
index 735f96a36f509..0402f9aac1832 100644
--- a/packages/shared/ReactTypes.js
+++ b/packages/shared/ReactTypes.js
@@ -168,6 +168,12 @@ export type ReactFormState<S, ReferenceId> = [
   number /* number of bound arguments */,
 ];
 
+// Intrinsic GestureProvider. This type varies by Environment whether a particular
+// renderer supports it.
+export type GestureProvider = AnimationTimeline; // TODO: More provider types.
+
+export type StartGesture = (gestureProvider: GestureProvider) => () => void;
+
 export type Awaited<T> = T extends null | void
   ? T // special case for `null | undefined` when not in `--strictNullChecks` mode
   : T extends Object // `await` only unwraps object types with a callable then. Non-object types are not unwrapped.
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 2eff113ae42f1..470e148959327 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -82,6 +82,7 @@ export const enableHydrationLaneScheduling = true;
 export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index bcd8b375eca67..361ebde4136ce 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -71,6 +71,7 @@ export const enableYieldingBeforePassive = false;
 
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index ef3c300602bdb..5945416050286 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -70,6 +70,7 @@ export const enableYieldingBeforePassive = true;
 
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 export const enableFastAddPropertiesInDiffing = true;
 export const enableLazyPublicInstanceInFabric = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index 743ba39a86792..18172fdfe5724 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -67,6 +67,7 @@ export const enableHydrationLaneScheduling = true;
 export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index 26747d3fb69a9..628a834133f2f 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -82,6 +82,7 @@ export const enableYieldingBeforePassive = false;
 
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableSwipeTransition = false;
 export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index 8da74c54bd69e..5932c6eddf6f1 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -112,5 +112,7 @@ export const enableShallowPropDiffing = false;
 
 export const enableLazyPublicInstanceInFabric = false;
 
+export const enableSwipeTransition = false;
+
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/scripts/error-codes/codes.json b/scripts/error-codes/codes.json
index 6ab654f1d35e5..f001b660bd2aa 100644
--- a/scripts/error-codes/codes.json
+++ b/scripts/error-codes/codes.json
@@ -531,5 +531,7 @@
   "543": "Expected a ResourceEffectUpdate to be pushed together with ResourceEffectIdentity. This is a bug in React.",
   "544": "Found a pair with an auto name. This is a bug in React.",
   "545": "The %s tag may only be rendered once.",
-  "546": "useEffect CRUD overload is not enabled in this build of React."
+  "546": "useEffect CRUD overload is not enabled in this build of React.",
+  "547": "startGesture cannot be called during server rendering.",
+  "548": "Finished rendering the gesture lane but there were no pending gestures. React should not have started a render in this case. This is a bug in React."
 }

From e670e72fa076449e40172e20d17cc67c1c15419c Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Dawid=20Ma=C5=82ecki?= <dawid.malecki21@gmail.com>
Date: Fri, 14 Feb 2025 15:10:37 +0100
Subject: [PATCH 53/72] Change TouchedViewDataAtPoint type in ReactNativeTypes
 to use supported by Flow tooling syntax (#32382)

## Summary

The `flow-api-translator` from the `hermes` repo does not support flow
type spreads. It is currently not able to digest the ReactNativeTypes
file as it contains unsupported syntax. The simplest solution is to
change the type of the `TouchedViewDataAtPoint` to equivalent, yet
supported by the Flow tooling. In this case the intersection can be used
as
the `TouchedViewDataAtPoint` and `InspectorData` have no common
property.

## How did you test this change?

Run yarn flow native
---
 .../src/ReactNativeTypes.js                   | 25 ++++++++++---------
 1 file changed, 13 insertions(+), 12 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactNativeTypes.js b/packages/react-native-renderer/src/ReactNativeTypes.js
index 8bce919d385e9..261e1f0b63104 100644
--- a/packages/react-native-renderer/src/ReactNativeTypes.js
+++ b/packages/react-native-renderer/src/ReactNativeTypes.js
@@ -164,18 +164,19 @@ export type InspectorData = $ReadOnly<{
   componentStack: string,
 }>;
 
-export type TouchedViewDataAtPoint = $ReadOnly<{
-  pointerY: number,
-  touchedViewTag?: number,
-  frame: $ReadOnly<{
-    top: number,
-    left: number,
-    width: number,
-    height: number,
-  }>,
-  closestPublicInstance?: PublicInstance,
-  ...InspectorData,
-}>;
+export type TouchedViewDataAtPoint = $ReadOnly<
+  {
+    pointerY: number,
+    touchedViewTag?: number,
+    frame: $ReadOnly<{
+      top: number,
+      left: number,
+      width: number,
+      height: number,
+    }>,
+    closestPublicInstance?: PublicInstance,
+  } & InspectorData,
+>;
 
 export type RenderRootOptions = {
   onUncaughtError?: (

From 0d9834caeb3b334eaa1be45f136499f51303e7d3 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 09:38:13 -0600
Subject: [PATCH 54/72] build: add support to the rollup build for building
 typescript packages (#32393)

---
 babel.config-ts.js                            |  15 +
 package.json                                  |   5 +-
 .../__tests__/ReactTypeScriptClass-test.ts    |   4 +-
 scripts/jest/config.base.js                   |   6 +-
 scripts/rollup/build.js                       |  45 +-
 scripts/rollup/bundles.js                     |   7 +
 scripts/rollup/packaging.js                   |   4 +
 scripts/rollup/wrappers.js                    |  36 ++
 yarn.lock                                     | 488 +++++++++++++-----
 9 files changed, 459 insertions(+), 151 deletions(-)
 create mode 100644 babel.config-ts.js

diff --git a/babel.config-ts.js b/babel.config-ts.js
new file mode 100644
index 0000000000000..20b35ec013e0f
--- /dev/null
+++ b/babel.config-ts.js
@@ -0,0 +1,15 @@
+/**
+ * This file is purely being used for local jest runs, and doesn't participate in the build process.
+ */
+'use strict';
+
+module.exports = {
+  plugins: [
+    '@babel/plugin-syntax-jsx',
+    '@babel/plugin-transform-flow-strip-types',
+  ],
+  presets: [
+    ['@babel/preset-env', {targets: {node: 'current'}}],
+    '@babel/preset-typescript',
+  ],
+};
diff --git a/package.json b/package.json
index cffd0ba28b493..95fffa700a7e7 100644
--- a/package.json
+++ b/package.json
@@ -35,11 +35,13 @@
     "@babel/plugin-transform-template-literals": "^7.10.5",
     "@babel/preset-flow": "^7.10.4",
     "@babel/preset-react": "^7.23.3",
+    "@babel/preset-typescript": "^7.26.0",
     "@babel/traverse": "^7.11.0",
     "@rollup/plugin-babel": "^6.0.3",
     "@rollup/plugin-commonjs": "^24.0.1",
     "@rollup/plugin-node-resolve": "^15.0.1",
     "@rollup/plugin-replace": "^5.0.2",
+    "@rollup/plugin-typescript": "^12.1.2",
     "abortcontroller-polyfill": "^1.7.5",
     "art": "0.10.1",
     "babel-plugin-syntax-trailing-function-commas": "^6.5.0",
@@ -90,6 +92,7 @@
     "react-lifecycles-compat": "^3.0.4",
     "rimraf": "^3.0.0",
     "rollup": "^3.29.5",
+    "rollup-plugin-dts": "^6.1.1",
     "rollup-plugin-prettier": "^4.1.1",
     "rollup-plugin-strip-banner": "^3.0.0",
     "semver": "^7.1.1",
@@ -98,7 +101,7 @@
     "targz": "^1.0.1",
     "through2": "^3.0.1",
     "tmp": "^0.1.0",
-    "typescript": "^3.7.5",
+    "typescript": "^5.4.3",
     "undici": "^5.28.4",
     "web-streams-polyfill": "^3.1.1",
     "yargs": "^15.3.1"
diff --git a/packages/react/src/__tests__/ReactTypeScriptClass-test.ts b/packages/react/src/__tests__/ReactTypeScriptClass-test.ts
index 5f51cc6f38c77..603edb86ea495 100644
--- a/packages/react/src/__tests__/ReactTypeScriptClass-test.ts
+++ b/packages/react/src/__tests__/ReactTypeScriptClass-test.ts
@@ -529,7 +529,7 @@ describe('ReactTypeScriptClass', function () {
         'StateBasedOnContext uses the legacy contextTypes API which will soon be removed. ' +
           'Use React.createContext() with static contextType instead. (https://react.dev/link/legacy-context)\n' +
           (ReactFeatureFlags.enableOwnerStacks
-            ? '    in ProvideChildContextTypes.Object.<anonymous>.ProvideChildContextTypes (at **)'
+            ? '    in ProvideChildContextTypes.createElement (at **)'
             : '    in StateBasedOnContext (at **)\n') +
           '    in ProvideChildContextTypes (at **)',
       ]);
@@ -725,7 +725,7 @@ describe('ReactTypeScriptClass', function () {
         'ReadContext uses the legacy contextTypes API which will soon be removed. ' +
           'Use React.createContext() with static contextType instead. (https://react.dev/link/legacy-context)\n' +
           (ReactFeatureFlags.enableOwnerStacks
-            ? '    in ProvideContext.Object.<anonymous>.ProvideContext (at **)'
+            ? '    in ProvideContext.createElement (at **)'
             : '    in ReadContext (at **)\n') +
           '    in ProvideContext (at **)',
       ]);
diff --git a/scripts/jest/config.base.js b/scripts/jest/config.base.js
index 6fa4a3619429f..262c6ab18a144 100644
--- a/scripts/jest/config.base.js
+++ b/scripts/jest/config.base.js
@@ -7,7 +7,11 @@ module.exports = {
     '<rootDir>/scripts/bench/',
   ],
   transform: {
-    '.*': require.resolve('./preprocessor.js'),
+    '^.+\\.ts$': [
+      'babel-jest',
+      {configFile: require.resolve('../../babel.config-ts.js')},
+    ],
+    '.(?!ts$)': require.resolve('./preprocessor.js'),
   },
   prettierPath: require.resolve('prettier-2'),
   setupFiles: [require.resolve('./setupEnvironment.js')],
diff --git a/scripts/rollup/build.js b/scripts/rollup/build.js
index 547362dae7123..53b308d16a2d8 100644
--- a/scripts/rollup/build.js
+++ b/scripts/rollup/build.js
@@ -4,8 +4,10 @@ const rollup = require('rollup');
 const babel = require('@rollup/plugin-babel').babel;
 const closure = require('./plugins/closure-plugin');
 const flowRemoveTypes = require('flow-remove-types');
+const {dts} = require('rollup-plugin-dts');
 const prettier = require('rollup-plugin-prettier');
 const replace = require('@rollup/plugin-replace');
+const typescript = require('@rollup/plugin-typescript');
 const stripBanner = require('rollup-plugin-strip-banner');
 const chalk = require('chalk');
 const resolve = require('@rollup/plugin-node-resolve').nodeResolve;
@@ -61,6 +63,8 @@ const {
   RN_FB_PROD,
   RN_FB_PROFILING,
   BROWSER_SCRIPT,
+  CJS_DTS,
+  ESM_DTS,
 } = Bundles.bundleTypes;
 
 const {getFilename} = Bundles;
@@ -250,9 +254,11 @@ function getFormat(bundleType) {
     case RN_FB_DEV:
     case RN_FB_PROD:
     case RN_FB_PROFILING:
+    case CJS_DTS:
       return `cjs`;
     case ESM_DEV:
     case ESM_PROD:
+    case ESM_DTS:
       return `es`;
     case BROWSER_SCRIPT:
       return `iife`;
@@ -281,6 +287,8 @@ function isProductionBundleType(bundleType) {
     case RN_FB_PROD:
     case RN_FB_PROFILING:
     case BROWSER_SCRIPT:
+    case CJS_DTS:
+    case ESM_DTS:
       return true;
     default:
       throw new Error(`Unknown type: ${bundleType}`);
@@ -303,6 +311,8 @@ function isProfilingBundleType(bundleType) {
     case ESM_DEV:
     case ESM_PROD:
     case BROWSER_SCRIPT:
+    case CJS_DTS:
+    case ESM_DTS:
       return false;
     case FB_WWW_PROFILING:
     case NODE_PROFILING:
@@ -368,27 +378,36 @@ function getPlugins(
   pureExternalModules,
   bundle
 ) {
+  // Short-circuit if we're only building a .d.ts bundle
+  if (bundleType === CJS_DTS || bundleType === ESM_DTS) {
+    return [dts({tsconfig: bundle.tsconfig})];
+  }
   try {
     const forks = Modules.getForks(bundleType, entry, moduleType, bundle);
     const isProduction = isProductionBundleType(bundleType);
     const isProfiling = isProfilingBundleType(bundleType);
 
     const needsMinifiedByClosure =
-      bundleType !== ESM_PROD && bundleType !== ESM_DEV;
+      bundleType !== ESM_PROD &&
+      bundleType !== ESM_DEV &&
+      // TODO(@poteto) figure out ICE in closure compiler for eslint-plugin-react-hooks (ts)
+      bundle.tsconfig == null;
 
     return [
       // Keep dynamic imports as externals
       dynamicImports(),
-      {
-        name: 'rollup-plugin-flow-remove-types',
-        transform(code) {
-          const transformed = flowRemoveTypes(code);
-          return {
-            code: transformed.toString(),
-            map: null,
-          };
-        },
-      },
+      bundle.tsconfig != null
+        ? typescript({tsconfig: bundle.tsconfig})
+        : {
+            name: 'rollup-plugin-flow-remove-types',
+            transform(code) {
+              const transformed = flowRemoveTypes(code);
+              return {
+                code: transformed.toString(),
+                map: null,
+              };
+            },
+          },
       // Shim any modules that need forking in this environment.
       useForks(forks),
       // Ensure we don't try to bundle any fbjs modules.
@@ -839,7 +858,9 @@ async function buildEverything() {
       [bundle, RN_FB_DEV],
       [bundle, RN_FB_PROD],
       [bundle, RN_FB_PROFILING],
-      [bundle, BROWSER_SCRIPT]
+      [bundle, BROWSER_SCRIPT],
+      [bundle, CJS_DTS],
+      [bundle, ESM_DTS]
     );
   }
 
diff --git a/scripts/rollup/bundles.js b/scripts/rollup/bundles.js
index 04bfb1a0e5479..c66cff82c5ac2 100644
--- a/scripts/rollup/bundles.js
+++ b/scripts/rollup/bundles.js
@@ -26,6 +26,8 @@ const bundleTypes = {
   RN_FB_PROD: 'RN_FB_PROD',
   RN_FB_PROFILING: 'RN_FB_PROFILING',
   BROWSER_SCRIPT: 'BROWSER_SCRIPT',
+  CJS_DTS: 'CJS_DTS',
+  ESM_DTS: 'ESM_DTS',
 };
 
 const {
@@ -47,6 +49,8 @@ const {
   RN_FB_PROD,
   RN_FB_PROFILING,
   BROWSER_SCRIPT,
+  CJS_DTS,
+  ESM_DTS,
 } = bundleTypes;
 
 const moduleTypes = {
@@ -1270,6 +1274,9 @@ function getFilename(bundle, bundleType) {
       return `${globalName}-profiling.js`;
     case BROWSER_SCRIPT:
       return `${name}.js`;
+    case CJS_DTS:
+    case ESM_DTS:
+      return `${name}.d.ts`;
   }
 }
 
diff --git a/scripts/rollup/packaging.js b/scripts/rollup/packaging.js
index bc83cb8789eb8..564c40f71b922 100644
--- a/scripts/rollup/packaging.js
+++ b/scripts/rollup/packaging.js
@@ -34,6 +34,8 @@ const {
   RN_FB_PROD,
   RN_FB_PROFILING,
   BROWSER_SCRIPT,
+  CJS_DTS,
+  ESM_DTS,
 } = Bundles.bundleTypes;
 
 function getPackageName(name) {
@@ -49,6 +51,7 @@ function getBundleOutputPath(bundle, bundleType, filename, packageName) {
       return `build/node_modules/${packageName}/cjs/${filename}`;
     case ESM_DEV:
     case ESM_PROD:
+    case ESM_DTS:
       return `build/node_modules/${packageName}/esm/${filename}`;
     case BUN_DEV:
     case BUN_PROD:
@@ -56,6 +59,7 @@ function getBundleOutputPath(bundle, bundleType, filename, packageName) {
     case NODE_DEV:
     case NODE_PROD:
     case NODE_PROFILING:
+    case CJS_DTS:
       return `build/node_modules/${packageName}/cjs/${filename}`;
     case FB_WWW_DEV:
     case FB_WWW_PROD:
diff --git a/scripts/rollup/wrappers.js b/scripts/rollup/wrappers.js
index e01ca30a6d054..1773253cc9653 100644
--- a/scripts/rollup/wrappers.js
+++ b/scripts/rollup/wrappers.js
@@ -21,6 +21,8 @@ const {
   RN_FB_PROD,
   RN_FB_PROFILING,
   BROWSER_SCRIPT,
+  CJS_DTS,
+  ESM_DTS,
 } = bundleTypes;
 
 const {RECONCILER} = moduleTypes;
@@ -248,6 +250,16 @@ ${source}
   Object.defineProperty(module.exports, "__esModule", { value: true });
   `;
   },
+
+  /***************** CJS_DTS *****************/
+  [CJS_DTS](source, globalName, filename, moduleType) {
+    return source;
+  },
+
+  /***************** ESM_DTS *****************/
+  [ESM_DTS](source, globalName, filename, moduleType) {
+    return source;
+  },
 };
 
 const licenseHeaderWrappers = {
@@ -464,6 +476,30 @@ ${license}
  * @preventMunge
  */
 
+${source}`;
+  },
+
+  /***************** CJS_DTS *****************/
+  [CJS_DTS](source, globalName, filename, moduleType) {
+    return `/**
+ * @license React
+ * ${filename}
+ *
+${license}
+ */
+
+${source}`;
+  },
+
+  /***************** ESM_DTS *****************/
+  [ESM_DTS](source, globalName, filename, moduleType) {
+    return `/**
+ * @license React
+ * ${filename}
+ *
+${license}
+ */
+
 ${source}`;
   },
 };
diff --git a/yarn.lock b/yarn.lock
index 4922028dafc3b..44d590625111c 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -68,6 +68,15 @@
     "@babel/highlight" "^7.24.7"
     picocolors "^1.0.0"
 
+"@babel/code-frame@^7.26.2":
+  version "7.26.2"
+  resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.26.2.tgz#4b5fab97d33338eff916235055f0ebc21e573a85"
+  integrity sha512-RJlIHRueQgwWitWgF8OdFYGZX328Ax5BCemNGlqHfplnRT9ESi8JkFlvaVYbS+UubVY6dpv87Fs2u5M29iNFVQ==
+  dependencies:
+    "@babel/helper-validator-identifier" "^7.25.9"
+    js-tokens "^4.0.0"
+    picocolors "^1.0.0"
+
 "@babel/code-frame@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.8.3.tgz#33e25903d7481181534e12ec0a25f16b6fcf419e"
@@ -225,6 +234,17 @@
     "@jridgewell/trace-mapping" "^0.3.25"
     jsesc "^2.5.1"
 
+"@babel/generator@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.26.9.tgz#75a9482ad3d0cc7188a537aa4910bc59db67cbca"
+  integrity sha512-kEWdzjOAUMW4hAyrzJ0ZaTOu9OmpyDIQicIh0zg0EEcEkYXZb2TjtBhnHi2ViX7PKwZqF4xwqfAm299/QMP3lg==
+  dependencies:
+    "@babel/parser" "^7.26.9"
+    "@babel/types" "^7.26.9"
+    "@jridgewell/gen-mapping" "^0.3.5"
+    "@jridgewell/trace-mapping" "^0.3.25"
+    jsesc "^3.0.2"
+
 "@babel/generator@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.8.3.tgz#0e22c005b0a94c1c74eafe19ef78ce53a4d45c03"
@@ -263,6 +283,13 @@
   dependencies:
     "@babel/types" "^7.22.5"
 
+"@babel/helper-annotate-as-pure@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.25.9.tgz#d8eac4d2dc0d7b6e11fa6e535332e0d3184f06b4"
+  integrity sha512-gv7320KBUFJz1RnylIg5WWYPRXKZ884AGkYpgpWW02TH66Dl+HaC1t1CKd0z3R4b6hdYEcmrNZHUmfCP+1u3/g==
+  dependencies:
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-builder-binary-assignment-operator-visitor@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-builder-binary-assignment-operator-visitor/-/helper-builder-binary-assignment-operator-visitor-7.10.4.tgz#bb0b75f31bf98cbf9ff143c1ae578b87274ae1a3"
@@ -369,6 +396,19 @@
     "@babel/helper-skip-transparent-expression-wrappers" "^7.20.0"
     "@babel/helper-split-export-declaration" "^7.18.6"
 
+"@babel/helper-create-class-features-plugin@^7.25.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-create-class-features-plugin/-/helper-create-class-features-plugin-7.26.9.tgz#d6f83e3039547fbb39967e78043cd3c8b7820c71"
+  integrity sha512-ubbUqCofvxPRurw5L8WTsCLSkQiVpov4Qx0WMA+jUN+nXBK8ADPlJO1grkFw5CWKC5+sZSOfuGMdX1aI1iT9Sg==
+  dependencies:
+    "@babel/helper-annotate-as-pure" "^7.25.9"
+    "@babel/helper-member-expression-to-functions" "^7.25.9"
+    "@babel/helper-optimise-call-expression" "^7.25.9"
+    "@babel/helper-replace-supers" "^7.26.5"
+    "@babel/helper-skip-transparent-expression-wrappers" "^7.25.9"
+    "@babel/traverse" "^7.26.9"
+    semver "^6.3.1"
+
 "@babel/helper-create-regexp-features-plugin@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-create-regexp-features-plugin/-/helper-create-regexp-features-plugin-7.10.4.tgz#fdd60d88524659a0b6959c0579925e425714f3b8"
@@ -506,6 +546,14 @@
   dependencies:
     "@babel/types" "^7.20.7"
 
+"@babel/helper-member-expression-to-functions@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.25.9.tgz#9dfffe46f727005a5ea29051ac835fb735e4c1a3"
+  integrity sha512-wbfdZ9w5vk0C0oyHqAJbc62+vet5prjj01jjJ8sKn3j9h3MQQlflEdXYvuqRWjHnM12coDEqiC1IRCi0U/EKwQ==
+  dependencies:
+    "@babel/traverse" "^7.25.9"
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-module-imports@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-module-imports/-/helper-module-imports-7.10.4.tgz#4c5c54be04bd31670a7382797d75b9fa2e5b5620"
@@ -534,6 +582,14 @@
   dependencies:
     "@babel/types" "^7.22.15"
 
+"@babel/helper-module-imports@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-module-imports/-/helper-module-imports-7.25.9.tgz#e7f8d20602ebdbf9ebbea0a0751fb0f2a4141715"
+  integrity sha512-tnUA4RsrmflIM6W6RFTLFSXITtl0wKjgpnLgXyowocVPrbYrLUXSBXDgTs8BlbmIzIdlBySRQjINYs2BAkiLtw==
+  dependencies:
+    "@babel/traverse" "^7.25.9"
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-module-transforms@^7.10.4", "@babel/helper-module-transforms@^7.10.5", "@babel/helper-module-transforms@^7.11.0":
   version "7.11.0"
   resolved "https://registry.yarnpkg.com/@babel/helper-module-transforms/-/helper-module-transforms-7.11.0.tgz#b16f250229e47211abdd84b34b64737c2ab2d359"
@@ -572,6 +628,15 @@
     "@babel/helper-split-export-declaration" "^7.24.5"
     "@babel/helper-validator-identifier" "^7.24.5"
 
+"@babel/helper-module-transforms@^7.26.0":
+  version "7.26.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-module-transforms/-/helper-module-transforms-7.26.0.tgz#8ce54ec9d592695e58d84cd884b7b5c6a2fdeeae"
+  integrity sha512-xO+xu6B5K2czEnQye6BHA7DolFFmS3LB7stHZFaOLb1pAwO1HWLS8fXA+eh0A2yIvltPVmx3eNNDBJA2SLHXFw==
+  dependencies:
+    "@babel/helper-module-imports" "^7.25.9"
+    "@babel/helper-validator-identifier" "^7.25.9"
+    "@babel/traverse" "^7.25.9"
+
 "@babel/helper-optimise-call-expression@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.10.4.tgz#50dc96413d594f995a77905905b05893cd779673"
@@ -593,6 +658,13 @@
   dependencies:
     "@babel/types" "^7.18.6"
 
+"@babel/helper-optimise-call-expression@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.25.9.tgz#3324ae50bae7e2ab3c33f60c9a877b6a0146b54e"
+  integrity sha512-FIpuNaz5ow8VyrYcnXQTDRGvV6tTjkNtCK/RYNDXGSLlUD6cBuQTSw43CShGxjvfBTfcUA/r6UhUCbtYqkhcuQ==
+  dependencies:
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-plugin-utils@^7.0.0", "@babel/helper-plugin-utils@^7.10.4", "@babel/helper-plugin-utils@^7.12.13", "@babel/helper-plugin-utils@^7.14.5", "@babel/helper-plugin-utils@^7.18.6", "@babel/helper-plugin-utils@^7.19.0", "@babel/helper-plugin-utils@^7.24.0", "@babel/helper-plugin-utils@^7.8.0":
   version "7.24.5"
   resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.24.5.tgz#a924607dd254a65695e5bd209b98b902b3b2f11a"
@@ -608,6 +680,11 @@
   resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.22.5.tgz#dd7ee3735e8a313b9f7b05a773d892e88e6d7295"
   integrity sha512-uLls06UVKgFG9QD4OeFYLEGteMIAa5kpTPcFL28yuCIIzsf6ZyKZMllKVOCZFhiZ5ptnwX4mtKdWCBE/uT4amg==
 
+"@babel/helper-plugin-utils@^7.25.9", "@babel/helper-plugin-utils@^7.26.5":
+  version "7.26.5"
+  resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.26.5.tgz#18580d00c9934117ad719392c4f6585c9333cc35"
+  integrity sha512-RS+jZcRdZdRFzMyr+wcsaqOmld1/EqTghfaBGQQd/WnRdzdlvSZ//kF7U8VQTxf1ynZ4cjUcYgjVGx13ewNPMg==
+
 "@babel/helper-plugin-utils@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.8.3.tgz#9ea293be19babc0f52ff8ca88b34c3611b208670"
@@ -663,6 +740,15 @@
     "@babel/traverse" "^7.20.7"
     "@babel/types" "^7.20.7"
 
+"@babel/helper-replace-supers@^7.26.5":
+  version "7.26.5"
+  resolved "https://registry.yarnpkg.com/@babel/helper-replace-supers/-/helper-replace-supers-7.26.5.tgz#6cb04e82ae291dae8e72335dfe438b0725f14c8d"
+  integrity sha512-bJ6iIVdYX1YooY2X7w1q6VITt+LnUILtNk7zT78ykuwStx8BauCzxvFqFaHjOpW1bVnSUM1PN1f0p5P21wHxvg==
+  dependencies:
+    "@babel/helper-member-expression-to-functions" "^7.25.9"
+    "@babel/helper-optimise-call-expression" "^7.25.9"
+    "@babel/traverse" "^7.26.5"
+
 "@babel/helper-simple-access@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-simple-access/-/helper-simple-access-7.10.4.tgz#0f5ccda2945277a2a7a2d3a821e15395edcf3461"
@@ -706,6 +792,14 @@
   dependencies:
     "@babel/types" "^7.20.0"
 
+"@babel/helper-skip-transparent-expression-wrappers@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-skip-transparent-expression-wrappers/-/helper-skip-transparent-expression-wrappers-7.25.9.tgz#0b2e1b62d560d6b1954893fd2b705dc17c91f0c9"
+  integrity sha512-K4Du3BFa3gvyhzgPcntrkDgZzQaq6uozzcpGbOO1OEJaI+EJdqWIMTLgFgQf6lrfiDFo5FU+BxKepI9RmZqahA==
+  dependencies:
+    "@babel/traverse" "^7.25.9"
+    "@babel/types" "^7.25.9"
+
 "@babel/helper-split-export-declaration@^7.10.4", "@babel/helper-split-export-declaration@^7.11.0":
   version "7.11.0"
   resolved "https://registry.yarnpkg.com/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.11.0.tgz#f8a491244acf6a676158ac42072911ba83ad099f"
@@ -744,6 +838,11 @@
   resolved "https://registry.yarnpkg.com/@babel/helper-string-parser/-/helper-string-parser-7.23.4.tgz#9478c707febcbbe1ddb38a3d91a2e054ae622d83"
   integrity sha512-803gmbQdqwdf4olxrX4AJyFBV/RTr3rSmOj0rKwesmzlfhYNDEs+/iOcznzpNWlJlIlTJC2QfPFcHB6DlzdVLQ==
 
+"@babel/helper-string-parser@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-string-parser/-/helper-string-parser-7.25.9.tgz#1aabb72ee72ed35789b4bbcad3ca2862ce614e8c"
+  integrity sha512-4A/SCr/2KLd5jrtOMFzaKjVtAei3+2r/NChoBNoZ3EyP/+GlhoaEGoWOZUmFmoITP7zOJyHIMm+DYRd8o3PvHA==
+
 "@babel/helper-validator-identifier@^7.10.4":
   version "7.14.0"
   resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.14.0.tgz#d26cad8a47c65286b15df1547319a5d0bcf27288"
@@ -769,6 +868,11 @@
   resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.24.7.tgz#75b889cfaf9e35c2aaf42cf0d72c8e91719251db"
   integrity sha512-rR+PBcQ1SMQDDyF6X0wxtG8QyLCgUB0eRAGguqRLfkCA87l7yAP7ehq8SNj96OOGTO8OBV70KhuFYcIkHXOg0w==
 
+"@babel/helper-validator-identifier@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.25.9.tgz#24b64e2c3ec7cd3b3c547729b8d16871f22cbdc7"
+  integrity sha512-Ed61U6XJc3CVRfkERJWDz4dJwKe7iLmmJsbOGu9wSloNSFttHV0I8g6UAgb7qnK5ly5bGLPd4oXZlxCdANBOWQ==
+
 "@babel/helper-validator-option@^7.14.5":
   version "7.14.5"
   resolved "https://registry.yarnpkg.com/@babel/helper-validator-option/-/helper-validator-option-7.14.5.tgz#6e72a1fff18d5dfcb878e1e62f1a021c4b72d5a3"
@@ -779,6 +883,11 @@
   resolved "https://registry.yarnpkg.com/@babel/helper-validator-option/-/helper-validator-option-7.23.5.tgz#907a3fbd4523426285365d1206c423c4c5520307"
   integrity sha512-85ttAOMLsr53VgXkTbkx8oA6YTfT4q7/HzXSLEYmjcSTJPMPQtvq1BD79Byep5xMUYbGRzEpDsjUf3dyp54IKw==
 
+"@babel/helper-validator-option@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-option/-/helper-validator-option-7.25.9.tgz#86e45bd8a49ab7e03f276577f96179653d41da72"
+  integrity sha512-e/zv1co8pp55dNdEcCynfj9X7nyUKUXoUEwfXqaZt0omVOmDe9oOTdKStH4GmAw6zxMFs50ZayuMfHDKlO7Tfw==
+
 "@babel/helper-wrap-function@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/helper-wrap-function/-/helper-wrap-function-7.10.4.tgz#8a6f701eab0ff39f765b5a1cfef409990e624b87"
@@ -905,6 +1014,13 @@
   resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.16.4.tgz#d5f92f57cf2c74ffe9b37981c0e72fee7311372e"
   integrity sha512-6V0qdPUaiVHH3RtZeLIsc+6pDhbYzHR8ogA8w+f+Wc77DuXto19g2QUwveINoS34Uw+W8/hQDGJCx+i4n7xcng==
 
+"@babel/parser@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.26.9.tgz#d9e78bee6dc80f9efd8f2349dcfbbcdace280fd5"
+  integrity sha512-81NWa1njQblgZbQHxWHpxxCzNsa3ZwvFqpUg7P+NNUU6f3UU2jBEg4OlF/J6rl8+PQGh1q6/zWScd001YwcA5A==
+  dependencies:
+    "@babel/types" "^7.26.9"
+
 "@babel/plugin-external-helpers@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/plugin-external-helpers/-/plugin-external-helpers-7.10.4.tgz#40d38e8e48a1fa3766ab43496253266ca26783ce"
@@ -1197,6 +1313,13 @@
   dependencies:
     "@babel/helper-plugin-utils" "^7.22.5"
 
+"@babel/plugin-syntax-jsx@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-jsx/-/plugin-syntax-jsx-7.25.9.tgz#a34313a178ea56f1951599b929c1ceacee719290"
+  integrity sha512-ld6oezHQMZsZfp6pWtbjaNDF2tiiCYYDqQszHt5VV437lewP9aSi2Of99CK0D0XB21k7FLgnLcmQKyKzynfeAA==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.25.9"
+
 "@babel/plugin-syntax-jsx@^7.7.2":
   version "7.24.1"
   resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-jsx/-/plugin-syntax-jsx-7.24.1.tgz#3f6ca04b8c841811dbc3c5c5f837934e0d626c10"
@@ -1281,6 +1404,13 @@
   dependencies:
     "@babel/helper-plugin-utils" "^7.14.5"
 
+"@babel/plugin-syntax-typescript@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-typescript/-/plugin-syntax-typescript-7.25.9.tgz#67dda2b74da43727cf21d46cf9afef23f4365399"
+  integrity sha512-hjMgRy5hb8uJJjUcdWunWVcoi9bGpJp8p5Ol1229PoN6aytsLwNMgmdftO23wnCLMfVmTwZDWMPNq/D1SY60JQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.25.9"
+
 "@babel/plugin-syntax-typescript@^7.7.2":
   version "7.24.1"
   resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-typescript/-/plugin-syntax-typescript-7.24.1.tgz#b3bcc51f396d15f3591683f90239de143c076844"
@@ -1533,6 +1663,14 @@
     "@babel/helper-simple-access" "^7.16.0"
     babel-plugin-dynamic-import-node "^2.3.3"
 
+"@babel/plugin-transform-modules-commonjs@^7.25.9":
+  version "7.26.3"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-commonjs/-/plugin-transform-modules-commonjs-7.26.3.tgz#8f011d44b20d02c3de44d8850d971d8497f981fb"
+  integrity sha512-MgR55l4q9KddUDITEzEFYn5ZsGDXMSsU9E+kh7fjRXTIC3RHqfCo8RPRbyReYJh44HQ/yomFkqbOFohXvDCiIQ==
+  dependencies:
+    "@babel/helper-module-transforms" "^7.26.0"
+    "@babel/helper-plugin-utils" "^7.25.9"
+
 "@babel/plugin-transform-modules-systemjs@^7.10.4":
   version "7.10.5"
   resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-systemjs/-/plugin-transform-modules-systemjs-7.10.5.tgz#6270099c854066681bae9e05f87e1b9cadbe8c85"
@@ -1794,6 +1932,17 @@
     "@babel/helper-plugin-utils" "^7.14.5"
     "@babel/plugin-syntax-typescript" "^7.16.0"
 
+"@babel/plugin-transform-typescript@^7.25.9":
+  version "7.26.8"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-typescript/-/plugin-transform-typescript-7.26.8.tgz#2e9caa870aa102f50d7125240d9dbf91334b0950"
+  integrity sha512-bME5J9AC8ChwA7aEPJ6zym3w7aObZULHhbNLU0bKUhKsAkylkzUdq+0kdymh9rzi8nlNFl2bmldFBCKNJBUpuw==
+  dependencies:
+    "@babel/helper-annotate-as-pure" "^7.25.9"
+    "@babel/helper-create-class-features-plugin" "^7.25.9"
+    "@babel/helper-plugin-utils" "^7.26.5"
+    "@babel/helper-skip-transparent-expression-wrappers" "^7.25.9"
+    "@babel/plugin-syntax-typescript" "^7.25.9"
+
 "@babel/plugin-transform-unicode-escapes@^7.10.4":
   version "7.10.4"
   resolved "https://registry.yarnpkg.com/@babel/plugin-transform-unicode-escapes/-/plugin-transform-unicode-escapes-7.10.4.tgz#feae523391c7651ddac115dae0a9d06857892007"
@@ -1936,6 +2085,17 @@
     "@babel/helper-validator-option" "^7.14.5"
     "@babel/plugin-transform-typescript" "^7.16.0"
 
+"@babel/preset-typescript@^7.26.0":
+  version "7.26.0"
+  resolved "https://registry.yarnpkg.com/@babel/preset-typescript/-/preset-typescript-7.26.0.tgz#4a570f1b8d104a242d923957ffa1eaff142a106d"
+  integrity sha512-NMk1IGZ5I/oHhoXEElcm+xUnL/szL6xflkFZmoEU9xj1qSJXpiS7rsspYo92B4DRCDvZn2erT5LdsCeXAKNCkg==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.25.9"
+    "@babel/helper-validator-option" "^7.25.9"
+    "@babel/plugin-syntax-jsx" "^7.25.9"
+    "@babel/plugin-transform-modules-commonjs" "^7.25.9"
+    "@babel/plugin-transform-typescript" "^7.25.9"
+
 "@babel/register@^7.14.5":
   version "7.14.5"
   resolved "https://registry.yarnpkg.com/@babel/register/-/register-7.14.5.tgz#d0eac615065d9c2f1995842f85d6e56c345f3233"
@@ -1995,6 +2155,15 @@
     "@babel/parser" "^7.24.0"
     "@babel/types" "^7.24.0"
 
+"@babel/template@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/template/-/template-7.26.9.tgz#4577ad3ddf43d194528cff4e1fa6b232fa609bb2"
+  integrity sha512-qyRplbeIpNZhmzOysF/wFMuP9sctmh2cFzRAZOn1YapxBsE1i9bJIY586R/WBLfLcmcBlM8ROBiQURnnNy+zfA==
+  dependencies:
+    "@babel/code-frame" "^7.26.2"
+    "@babel/parser" "^7.26.9"
+    "@babel/types" "^7.26.9"
+
 "@babel/template@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/template/-/template-7.8.3.tgz#e02ad04fe262a657809327f578056ca15fd4d1b8"
@@ -2096,6 +2265,19 @@
     debug "^4.1.0"
     globals "^11.1.0"
 
+"@babel/traverse@^7.25.9", "@babel/traverse@^7.26.5", "@babel/traverse@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/traverse/-/traverse-7.26.9.tgz#4398f2394ba66d05d988b2ad13c219a2c857461a"
+  integrity sha512-ZYW7L+pL8ahU5fXmNbPF+iZFHCv5scFak7MZ9bwaRPLUhHh7QQEMjZUg0HevihoqCM5iSYHN61EyCoZvqC+bxg==
+  dependencies:
+    "@babel/code-frame" "^7.26.2"
+    "@babel/generator" "^7.26.9"
+    "@babel/parser" "^7.26.9"
+    "@babel/template" "^7.26.9"
+    "@babel/types" "^7.26.9"
+    debug "^4.3.1"
+    globals "^11.1.0"
+
 "@babel/types@^7.0.0", "@babel/types@^7.18.6", "@babel/types@^7.19.0", "@babel/types@^7.20.7", "@babel/types@^7.23.0", "@babel/types@^7.24.0", "@babel/types@^7.24.5", "@babel/types@^7.3.3":
   version "7.24.5"
   resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.24.5.tgz#7661930afc638a5383eb0c4aee59b74f38db84d7"
@@ -2148,6 +2330,14 @@
     "@babel/helper-validator-identifier" "^7.22.20"
     to-fast-properties "^2.0.0"
 
+"@babel/types@^7.25.9", "@babel/types@^7.26.9":
+  version "7.26.9"
+  resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.26.9.tgz#08b43dec79ee8e682c2ac631c010bdcac54a21ce"
+  integrity sha512-Y3IR1cRnOxOCDvMmNiym7XpXQ93iGDDPHx+Zj+NM+rg0fBaShfQLkg+hKPaZCEvg5N/LeCo4+Rj/i3FuJsIQaw==
+  dependencies:
+    "@babel/helper-string-parser" "^7.25.9"
+    "@babel/helper-validator-identifier" "^7.25.9"
+
 "@babel/types@^7.8.3":
   version "7.8.3"
   resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.8.3.tgz#5a383dffa5416db1b73dedffd311ffd0788fb31c"
@@ -2785,6 +2975,11 @@
   resolved "https://registry.yarnpkg.com/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.15.tgz#d7c6e6755c78567a951e04ab52ef0fd26de59f32"
   integrity sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg==
 
+"@jridgewell/sourcemap-codec@^1.5.0":
+  version "1.5.0"
+  resolved "https://registry.yarnpkg.com/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.5.0.tgz#3188bcb273a414b0d215fd22a58540b989b9409a"
+  integrity sha512-gv3ZRaISU3fjPAgNsriBRqGWQL6quFx04YMPW/zD8XMLsU32mhCCbfbO6KZFLjvYpCZ8zyDEgqsgf+PwPaM7GQ==
+
 "@jridgewell/trace-mapping@^0.3.12", "@jridgewell/trace-mapping@^0.3.18", "@jridgewell/trace-mapping@^0.3.24", "@jridgewell/trace-mapping@^0.3.25", "@jridgewell/trace-mapping@^0.3.9":
   version "0.3.25"
   resolved "https://registry.yarnpkg.com/@jridgewell/trace-mapping/-/trace-mapping-0.3.25.tgz#15f190e98895f3fc23276ee14bc76b675c2e50f0"
@@ -3175,6 +3370,14 @@
     "@rollup/pluginutils" "^5.0.1"
     magic-string "^0.27.0"
 
+"@rollup/plugin-typescript@^12.1.2":
+  version "12.1.2"
+  resolved "https://registry.yarnpkg.com/@rollup/plugin-typescript/-/plugin-typescript-12.1.2.tgz#ebaeec2e7376faa889030ccd7cb485a649e63118"
+  integrity sha512-cdtSp154H5sv637uMr1a8OTWB0L1SWDSm1rDGiyfcGcvQ6cuTs4MDk2BVEBGysUWago4OJN4EQZqOTl/QY3Jgg==
+  dependencies:
+    "@rollup/pluginutils" "^5.1.0"
+    resolve "^1.22.1"
+
 "@rollup/pluginutils@^5.0.1":
   version "5.0.2"
   resolved "https://registry.yarnpkg.com/@rollup/pluginutils/-/pluginutils-5.0.2.tgz#012b8f53c71e4f6f9cb317e311df1404f56e7a33"
@@ -3184,100 +3387,109 @@
     estree-walker "^2.0.2"
     picomatch "^2.3.1"
 
-"@rollup/rollup-android-arm-eabi@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.32.1.tgz#c18bad635ba24220a6c8cc427ab2cab12e1531a3"
-  integrity sha512-/pqA4DmqyCm8u5YIDzIdlLcEmuvxb0v8fZdFhVMszSpDTgbQKdw3/mB3eMUHIbubtJ6F9j+LtmyCnHTEqIHyzA==
-
-"@rollup/rollup-android-arm64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.32.1.tgz#b5c00344b80f20889b72bfe65d3c209cef247362"
-  integrity sha512-If3PDskT77q7zgqVqYuj7WG3WC08G1kwXGVFi9Jr8nY6eHucREHkfpX79c0ACAjLj3QIWKPJR7w4i+f5EdLH5Q==
-
-"@rollup/rollup-darwin-arm64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.32.1.tgz#78e5358d4a2a08c090f75dd87fa2eada42eca1e5"
-  integrity sha512-zCpKHioQ9KgZToFp5Wvz6zaWbMzYQ2LJHQ+QixDKq52KKrF65ueu6Af4hLlLWHjX1Wf/0G5kSJM9PySW9IrvHA==
-
-"@rollup/rollup-darwin-x64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.32.1.tgz#c04c9e173244d44de50278f3f893fb68d987fcc6"
-  integrity sha512-sFvF+t2+TyUo/ZQqUcifrJIgznx58oFZbdHS9TvHq3xhPVL9nOp+yZ6LKrO9GWTP+6DbFtoyLDbjTpR62Mbr3Q==
-
-"@rollup/rollup-freebsd-arm64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.32.1.tgz#3bdf18d4ef32dcfe9b20bba18d7a53a101ed79d9"
-  integrity sha512-NbOa+7InvMWRcY9RG+B6kKIMD/FsnQPH0MWUvDlQB1iXnF/UcKSudCXZtv4lW+C276g3w5AxPbfry5rSYvyeYA==
-
-"@rollup/rollup-freebsd-x64@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.32.1.tgz#35867b15c276f4b4ca8eb226f7dd6df8c64640db"
-  integrity sha512-JRBRmwvHPXR881j2xjry8HZ86wIPK2CcDw0EXchE1UgU0ubWp9nvlT7cZYKc6bkypBt745b4bglf3+xJ7hXWWw==
-
-"@rollup/rollup-linux-arm-gnueabihf@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.32.1.tgz#92c212d1b38c105bd1eb101254722d27d869b1ac"
-  integrity sha512-PKvszb+9o/vVdUzCCjL0sKHukEQV39tD3fepXxYrHE3sTKrRdCydI7uldRLbjLmDA3TFDmh418XH19NOsDRH8g==
-
-"@rollup/rollup-linux-arm-musleabihf@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.32.1.tgz#ebb94d8cd438f23e38caa4a87ca80d4cf5b50fa1"
-  integrity sha512-9WHEMV6Y89eL606ReYowXuGF1Yb2vwfKWKdD1A5h+OYnPZSJvxbEjxTRKPgi7tkP2DSnW0YLab1ooy+i/FQp/Q==
-
-"@rollup/rollup-linux-arm64-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.32.1.tgz#ce6a5eacbd5fd4bdf7bf27bd818980230bdb9fab"
-  integrity sha512-tZWc9iEt5fGJ1CL2LRPw8OttkCBDs+D8D3oEM8mH8S1ICZCtFJhD7DZ3XMGM8kpqHvhGUTvNUYVDnmkj4BDXnw==
-
-"@rollup/rollup-linux-arm64-musl@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.32.1.tgz#31b4e0a543607e6eb4f982ffb45830919a952a83"
-  integrity sha512-FTYc2YoTWUsBz5GTTgGkRYYJ5NGJIi/rCY4oK/I8aKowx1ToXeoVVbIE4LGAjsauvlhjfl0MYacxClLld1VrOw==
-
-"@rollup/rollup-linux-loongarch64-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-loongarch64-gnu/-/rollup-linux-loongarch64-gnu-4.32.1.tgz#ad7b35f193f1d2e0dc37eba733069b4af5f6498d"
-  integrity sha512-F51qLdOtpS6P1zJVRzYM0v6MrBNypyPEN1GfMiz0gPu9jN8ScGaEFIZQwteSsGKg799oR5EaP7+B2jHgL+d+Kw==
-
-"@rollup/rollup-linux-powerpc64le-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.32.1.tgz#b713a55d7eac4d2c8a0109c3daca6ea85fc178b3"
-  integrity sha512-wO0WkfSppfX4YFm5KhdCCpnpGbtgQNj/tgvYzrVYFKDpven8w2N6Gg5nB6w+wAMO3AIfSTWeTjfVe+uZ23zAlg==
-
-"@rollup/rollup-linux-riscv64-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.32.1.tgz#bea4fd8ad190e9bc1d11efafa2efc9d121f50b96"
-  integrity sha512-iWswS9cIXfJO1MFYtI/4jjlrGb/V58oMu4dYJIKnR5UIwbkzR0PJ09O0PDZT0oJ3LYWXBSWahNf/Mjo6i1E5/g==
-
-"@rollup/rollup-linux-s390x-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.32.1.tgz#cc98c32733ca472635759c78a79b5f8d887b2a6a"
-  integrity sha512-RKt8NI9tebzmEthMnfVgG3i/XeECkMPS+ibVZjZ6mNekpbbUmkNWuIN2yHsb/mBPyZke4nlI4YqIdFPgKuoyQQ==
-
-"@rollup/rollup-linux-x64-gnu@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.32.1.tgz#5c009c264a7ce0e19b40890ca9945440bb420691"
-  integrity sha512-WQFLZ9c42ECqEjwg/GHHsouij3pzLXkFdz0UxHa/0OM12LzvX7DzedlY0SIEly2v18YZLRhCRoHZDxbBSWoGYg==
-
-"@rollup/rollup-linux-x64-musl@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.32.1.tgz#73d2f44070c23e031262b601927fdb4eec253bc1"
-  integrity sha512-BLoiyHDOWoS3uccNSADMza6V6vCNiphi94tQlVIL5de+r6r/CCQuNnerf+1g2mnk2b6edp5dk0nhdZ7aEjOBsA==
-
-"@rollup/rollup-win32-arm64-msvc@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.32.1.tgz#fa106304818078f9d3fc9005642ad99f596eed2d"
-  integrity sha512-w2l3UnlgYTNNU+Z6wOR8YdaioqfEnwPjIsJ66KxKAf0p+AuL2FHeTX6qvM+p/Ue3XPBVNyVSfCrfZiQh7vZHLQ==
-
-"@rollup/rollup-win32-ia32-msvc@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.32.1.tgz#a1a394c705a0d2a974a124c4b471fc1cf851a56f"
-  integrity sha512-Am9H+TGLomPGkBnaPWie4F3x+yQ2rr4Bk2jpwy+iV+Gel9jLAu/KqT8k3X4jxFPW6Zf8OMnehyutsd+eHoq1WQ==
-
-"@rollup/rollup-win32-x64-msvc@4.32.1":
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.32.1.tgz#512db088df67afee8f07183cdf8c9eecd64f6ef8"
-  integrity sha512-ar80GhdZb4DgmW3myIS9nRFYcpJRSME8iqWgzH2i44u+IdrzmiXVxeFnExQ5v4JYUSpg94bWjevMG8JHf1Da5Q==
+"@rollup/pluginutils@^5.1.0":
+  version "5.1.4"
+  resolved "https://registry.yarnpkg.com/@rollup/pluginutils/-/pluginutils-5.1.4.tgz#bb94f1f9eaaac944da237767cdfee6c5b2262d4a"
+  integrity sha512-USm05zrsFxYLPdWWq+K3STlWiT/3ELn3RcV5hJMghpeAIhxfsUIg6mt12CBJBInWMV4VneoV7SfGv8xIwo2qNQ==
+  dependencies:
+    "@types/estree" "^1.0.0"
+    estree-walker "^2.0.2"
+    picomatch "^4.0.2"
+
+"@rollup/rollup-android-arm-eabi@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.34.7.tgz#e554185b1afa5509a7a4040d15ec0c3b4435ded1"
+  integrity sha512-l6CtzHYo8D2TQ3J7qJNpp3Q1Iye56ssIAtqbM2H8axxCEEwvN7o8Ze9PuIapbxFL3OHrJU2JBX6FIIVnP/rYyw==
+
+"@rollup/rollup-android-arm64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.34.7.tgz#b1ee64bb413b2feba39803b0a1bebf2a9f3d70e1"
+  integrity sha512-KvyJpFUueUnSp53zhAa293QBYqwm94TgYTIfXyOTtidhm5V0LbLCJQRGkQClYiX3FXDQGSvPxOTD/6rPStMMDg==
+
+"@rollup/rollup-darwin-arm64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.34.7.tgz#bfdce3e07a345dd1bd628f3b796050f39629d7f0"
+  integrity sha512-jq87CjmgL9YIKvs8ybtIC98s/M3HdbqXhllcy9EdLV0yMg1DpxES2gr65nNy7ObNo/vZ/MrOTxt0bE5LinL6mA==
+
+"@rollup/rollup-darwin-x64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.34.7.tgz#781a94a537c57bdf0a500e47a25ab5985e5e8dff"
+  integrity sha512-rSI/m8OxBjsdnMMg0WEetu/w+LhLAcCDEiL66lmMX4R3oaml3eXz3Dxfvrxs1FbzPbJMaItQiksyMfv1hoIxnA==
+
+"@rollup/rollup-freebsd-arm64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.34.7.tgz#7a028357cbd12c5869c446ad18177c89f3405102"
+  integrity sha512-oIoJRy3ZrdsXpFuWDtzsOOa/E/RbRWXVokpVrNnkS7npz8GEG++E1gYbzhYxhxHbO2om1T26BZjVmdIoyN2WtA==
+
+"@rollup/rollup-freebsd-x64@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.34.7.tgz#f24836a6371cccc4408db74f0fd986dacf098950"
+  integrity sha512-X++QSLm4NZfZ3VXGVwyHdRf58IBbCu9ammgJxuWZYLX0du6kZvdNqPwrjvDfwmi6wFdvfZ/s6K7ia0E5kI7m8Q==
+
+"@rollup/rollup-linux-arm-gnueabihf@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.34.7.tgz#95f27e96f0eb9b9ae9887739a8b6dffc90c1237f"
+  integrity sha512-Z0TzhrsNqukTz3ISzrvyshQpFnFRfLunYiXxlCRvcrb3nvC5rVKI+ZXPFG/Aa4jhQa1gHgH3A0exHaRRN4VmdQ==
+
+"@rollup/rollup-linux-arm-musleabihf@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.34.7.tgz#677b34fba9d070877736c3fe8b02aacb5e142d97"
+  integrity sha512-nkznpyXekFAbvFBKBy4nNppSgneB1wwG1yx/hujN3wRnhnkrYVugMTCBXED4+Ni6thoWfQuHNYbFjgGH0MBXtw==
+
+"@rollup/rollup-linux-arm64-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.34.7.tgz#32d3d19dedde54e91574a098f22ea43a09cf63dd"
+  integrity sha512-KCjlUkcKs6PjOcxolqrXglBDcfCuUCTVlX5BgzgoJHw+1rWH1MCkETLkLe5iLLS9dP5gKC7mp3y6x8c1oGBUtA==
+
+"@rollup/rollup-linux-arm64-musl@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.34.7.tgz#a58dff44a18696df65ed8c0ad68a2945cf900484"
+  integrity sha512-uFLJFz6+utmpbR313TTx+NpPuAXbPz4BhTQzgaP0tozlLnGnQ6rCo6tLwaSa6b7l6gRErjLicXQ1iPiXzYotjw==
+
+"@rollup/rollup-linux-loongarch64-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-loongarch64-gnu/-/rollup-linux-loongarch64-gnu-4.34.7.tgz#a7488ab078233111e8aeb370d1ecf107ec7e1716"
+  integrity sha512-ws8pc68UcJJqCpneDFepnwlsMUFoWvPbWXT/XUrJ7rWUL9vLoIN3GAasgG+nCvq8xrE3pIrd+qLX/jotcLy0Qw==
+
+"@rollup/rollup-linux-powerpc64le-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.34.7.tgz#e9b9c0d6bd248a92b2d6ec01ebf99c62ae1f2e9a"
+  integrity sha512-vrDk9JDa/BFkxcS2PbWpr0C/LiiSLxFbNOBgfbW6P8TBe9PPHx9Wqbvx2xgNi1TOAyQHQJ7RZFqBiEohm79r0w==
+
+"@rollup/rollup-linux-riscv64-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.34.7.tgz#0df84ce2bea48ee686fb55060d76ab47aff45c4c"
+  integrity sha512-rB+ejFyjtmSo+g/a4eovDD1lHWHVqizN8P0Hm0RElkINpS0XOdpaXloqM4FBkF9ZWEzg6bezymbpLmeMldfLTw==
+
+"@rollup/rollup-linux-s390x-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.34.7.tgz#73df374c57d036856e33dbd2715138922e91e452"
+  integrity sha512-nNXNjo4As6dNqRn7OrsnHzwTgtypfRA3u3AKr0B3sOOo+HkedIbn8ZtFnB+4XyKJojIfqDKmbIzO1QydQ8c+Pw==
+
+"@rollup/rollup-linux-x64-gnu@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.34.7.tgz#f27af0b55f0cdd84e182e6cd44a6d03da0458149"
+  integrity sha512-9kPVf9ahnpOMSGlCxXGv980wXD0zRR3wyk8+33/MXQIpQEOpaNe7dEHm5LMfyRZRNt9lMEQuH0jUKj15MkM7QA==
+
+"@rollup/rollup-linux-x64-musl@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.34.7.tgz#c7981ad5cfb8c3cd5d643d33ca54e4d2802b9201"
+  integrity sha512-7wJPXRWTTPtTFDFezA8sle/1sdgxDjuMoRXEKtx97ViRxGGkVQYovem+Q8Pr/2HxiHp74SSRG+o6R0Yq0shPwQ==
+
+"@rollup/rollup-win32-arm64-msvc@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.34.7.tgz#06cedc0ef3cbf1cbd8abcf587090712e40ae6941"
+  integrity sha512-MN7aaBC7mAjsiMEZcsJvwNsQVNZShgES/9SzWp1HC9Yjqb5OpexYnRjF7RmE4itbeesHMYYQiAtUAQaSKs2Rfw==
+
+"@rollup/rollup-win32-ia32-msvc@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.34.7.tgz#90b39b977b14961a769be6ea61238e7fc668dd4d"
+  integrity sha512-aeawEKYswsFu1LhDM9RIgToobquzdtSc4jSVqHV8uApz4FVvhFl/mKh92wc8WpFc6aYCothV/03UjY6y7yLgbg==
+
+"@rollup/rollup-win32-x64-msvc@4.34.7":
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.34.7.tgz#6531d61e7141091eaab0461ee8e0380c10e4ca57"
+  integrity sha512-4ZedScpxxIrVO7otcZ8kCX1mZArtH2Wfj3uFCxRJ9NO80gg1XV0U/b2f/MKaGwj2X3QopHfoWiDQ917FRpwY3w==
 
 "@sinclair/typebox@^0.25.16":
   version "0.25.24"
@@ -3468,21 +3680,11 @@
   dependencies:
     "@types/estree" "*"
 
-"@types/estree@*":
-  version "0.0.42"
-  resolved "https://registry.yarnpkg.com/@types/estree/-/estree-0.0.42.tgz#8d0c1f480339efedb3e46070e22dd63e0430dd11"
-  integrity sha512-K1DPVvnBCPxzD+G51/cxVIoc2X8uUVl1zpJeE6iKcgHMj4+tbat5Xu4TjV7v2QSDbIeAfLi2hIk+u2+s0MlpUQ==
-
-"@types/estree@1.0.6", "@types/estree@^1.0.6":
+"@types/estree@*", "@types/estree@1.0.6", "@types/estree@^1.0.0", "@types/estree@^1.0.6":
   version "1.0.6"
   resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.6.tgz#628effeeae2064a1b4e79f78e81d87b7e5fc7b50"
   integrity sha512-AYnb1nQyY49te+VRAVgmzfcgjYS91mY5P0TKUDCLEM+gNnA+3T6rWITXRLYCpahpqSQbN5cE+gHpnPyXjHWxcw==
 
-"@types/estree@^1.0.0":
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.0.tgz#5fb2e536c1ae9bf35366eed879e827fa59ca41c2"
-  integrity sha512-WulqXMDUTYAXCjZnk6JtIHPigp55cVtDgDrO2gHRwhyJto21+1zbVCtOYB2L1F9w4qCQ0rOGWBnBe0FNTiEJIQ==
-
 "@types/express-serve-static-core@*", "@types/express-serve-static-core@^4.17.33":
   version "4.17.35"
   resolved "https://registry.yarnpkg.com/@types/express-serve-static-core/-/express-serve-static-core-4.17.35.tgz#c95dd4424f0d32e525d23812aa8ab8e4d3906c4f"
@@ -11370,6 +11572,11 @@ jsesc@^2.5.1:
   resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-2.5.2.tgz#80564d2e483dacf6e8ef209650a67df3f0c283a4"
   integrity sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==
 
+jsesc@^3.0.2:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-3.1.0.tgz#74d335a234f67ed19907fdadfac7ccf9d409825d"
+  integrity sha512-/sM3dO2FOzXjKQhJuo0Q173wf2KOo8t4I8vHy6lF9poUp7bKT0/NHE8fPX23PwfhnykfqnC2xRxOnVw5XuGIaA==
+
 jsesc@~0.5.0:
   version "0.5.0"
   resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-0.5.0.tgz#e7dee66e35d6fc16f710fe91d5cf69f70f08911d"
@@ -11976,6 +12183,13 @@ magic-string@^0.27.0:
   dependencies:
     "@jridgewell/sourcemap-codec" "^1.4.13"
 
+magic-string@^0.30.10:
+  version "0.30.17"
+  resolved "https://registry.yarnpkg.com/magic-string/-/magic-string-0.30.17.tgz#450a449673d2460e5bbcfba9a61916a1714c7453"
+  integrity sha512-sNPKHvyjVf7gyjwS4xGTaW/mCnF8wnjtifKBEhxfZ7E/S8tQ0rssrwGNn6q8JH/ohItJfSQp9mBtQYuTlH5QnA==
+  dependencies:
+    "@jridgewell/sourcemap-codec" "^1.5.0"
+
 make-dir@^1.0.0, make-dir@^1.2.0:
   version "1.3.0"
   resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-1.3.0.tgz#79c1033b80515bd6d24ec9933e860ca75ee27f0c"
@@ -14343,9 +14557,9 @@ readdirp@^2.2.1:
     readable-stream "^2.0.2"
 
 readdirp@^4.0.1:
-  version "4.1.1"
-  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-4.1.1.tgz#bd115327129672dc47f87408f05df9bd9ca3ef55"
-  integrity sha512-h80JrZu/MHUZCyHu5ciuoI0+WxsCxzxJTILn6Fs8rxSnFPh+UVHYfeIxK1nVGugMqkfC4vJcBOYbkfkwYK0+gw==
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-4.1.2.tgz#eb85801435fbf2a7ee58f19e0921b068fc69948d"
+  integrity sha512-GDhwkLfywWL2s6vEjyhri+eXmfH6j1L7JE27WhqLeYzoh/A3DBaYGEj2H/HFZCn/kMfim73FXxEJTw06WtxQwg==
 
 readdirp@~3.6.0:
   version "3.6.0"
@@ -14744,6 +14958,15 @@ roarr@^2.15.3:
     semver-compare "^1.0.0"
     sprintf-js "^1.1.2"
 
+rollup-plugin-dts@^6.1.1:
+  version "6.1.1"
+  resolved "https://registry.yarnpkg.com/rollup-plugin-dts/-/rollup-plugin-dts-6.1.1.tgz#46b33f4d1d7f4e66f1171ced9b282ac11a15a254"
+  integrity sha512-aSHRcJ6KG2IHIioYlvAOcEq6U99sVtqDDKVhnwt70rW6tsz3tv5OSjEiWcgzfsHdLyGXZ/3b/7b/+Za3Y6r1XA==
+  dependencies:
+    magic-string "^0.30.10"
+  optionalDependencies:
+    "@babel/code-frame" "^7.24.2"
+
 rollup-plugin-prettier@^4.1.1:
   version "4.1.1"
   resolved "https://registry.yarnpkg.com/rollup-plugin-prettier/-/rollup-plugin-prettier-4.1.1.tgz#eb74bd47c3cc3ba68bdf34b5323d0d7a47be8cec"
@@ -14781,31 +15004,31 @@ rollup@^3.29.5:
     fsevents "~2.3.2"
 
 rollup@^4.24.0:
-  version "4.32.1"
-  resolved "https://registry.yarnpkg.com/rollup/-/rollup-4.32.1.tgz#95309604d92c3d21cbf06c3ee46a098209ce13a4"
-  integrity sha512-z+aeEsOeEa3mEbS1Tjl6sAZ8NE3+AalQz1RJGj81M+fizusbdDMoEJwdJNHfaB40Scr4qNu+welOfes7maKonA==
+  version "4.34.7"
+  resolved "https://registry.yarnpkg.com/rollup/-/rollup-4.34.7.tgz#e00d8550688a616a3481c6446bb688d4c753ba8f"
+  integrity sha512-8qhyN0oZ4x0H6wmBgfKxJtxM7qS98YJ0k0kNh5ECVtuchIJ7z9IVVvzpmtQyT10PXKMtBxYr1wQ5Apg8RS8kXQ==
   dependencies:
     "@types/estree" "1.0.6"
   optionalDependencies:
-    "@rollup/rollup-android-arm-eabi" "4.32.1"
-    "@rollup/rollup-android-arm64" "4.32.1"
-    "@rollup/rollup-darwin-arm64" "4.32.1"
-    "@rollup/rollup-darwin-x64" "4.32.1"
-    "@rollup/rollup-freebsd-arm64" "4.32.1"
-    "@rollup/rollup-freebsd-x64" "4.32.1"
-    "@rollup/rollup-linux-arm-gnueabihf" "4.32.1"
-    "@rollup/rollup-linux-arm-musleabihf" "4.32.1"
-    "@rollup/rollup-linux-arm64-gnu" "4.32.1"
-    "@rollup/rollup-linux-arm64-musl" "4.32.1"
-    "@rollup/rollup-linux-loongarch64-gnu" "4.32.1"
-    "@rollup/rollup-linux-powerpc64le-gnu" "4.32.1"
-    "@rollup/rollup-linux-riscv64-gnu" "4.32.1"
-    "@rollup/rollup-linux-s390x-gnu" "4.32.1"
-    "@rollup/rollup-linux-x64-gnu" "4.32.1"
-    "@rollup/rollup-linux-x64-musl" "4.32.1"
-    "@rollup/rollup-win32-arm64-msvc" "4.32.1"
-    "@rollup/rollup-win32-ia32-msvc" "4.32.1"
-    "@rollup/rollup-win32-x64-msvc" "4.32.1"
+    "@rollup/rollup-android-arm-eabi" "4.34.7"
+    "@rollup/rollup-android-arm64" "4.34.7"
+    "@rollup/rollup-darwin-arm64" "4.34.7"
+    "@rollup/rollup-darwin-x64" "4.34.7"
+    "@rollup/rollup-freebsd-arm64" "4.34.7"
+    "@rollup/rollup-freebsd-x64" "4.34.7"
+    "@rollup/rollup-linux-arm-gnueabihf" "4.34.7"
+    "@rollup/rollup-linux-arm-musleabihf" "4.34.7"
+    "@rollup/rollup-linux-arm64-gnu" "4.34.7"
+    "@rollup/rollup-linux-arm64-musl" "4.34.7"
+    "@rollup/rollup-linux-loongarch64-gnu" "4.34.7"
+    "@rollup/rollup-linux-powerpc64le-gnu" "4.34.7"
+    "@rollup/rollup-linux-riscv64-gnu" "4.34.7"
+    "@rollup/rollup-linux-s390x-gnu" "4.34.7"
+    "@rollup/rollup-linux-x64-gnu" "4.34.7"
+    "@rollup/rollup-linux-x64-musl" "4.34.7"
+    "@rollup/rollup-win32-arm64-msvc" "4.34.7"
+    "@rollup/rollup-win32-ia32-msvc" "4.34.7"
+    "@rollup/rollup-win32-x64-msvc" "4.34.7"
     fsevents "~2.3.2"
 
 rrweb-cssom@^0.6.0:
@@ -16530,11 +16753,6 @@ typescript@3.9.3:
   resolved "https://registry.yarnpkg.com/typescript/-/typescript-3.9.3.tgz#d3ac8883a97c26139e42df5e93eeece33d610b8a"
   integrity sha512-D/wqnB2xzNFIcoBG9FG8cXRDjiqSTbG2wd8DMZeQyJlP1vfTkIxH4GKveWaEBYySKIg+USu+E+EDIR47SqnaMQ==
 
-typescript@^3.7.5:
-  version "3.7.5"
-  resolved "https://registry.yarnpkg.com/typescript/-/typescript-3.7.5.tgz#0692e21f65fd4108b9330238aac11dd2e177a1ae"
-  integrity sha512-/P5lkRXkWHNAbcJIiHPfRoKqyd7bsyCma1hZNUGfn20qm64T6ZBlrzprymeu918H+mB/0rIg2gGK/BXkhhYgBw==
-
 typescript@^5.4.3:
   version "5.7.3"
   resolved "https://registry.yarnpkg.com/typescript/-/typescript-5.7.3.tgz#919b44a7dbb8583a9b856d162be24a54bf80073e"

From 037b25cfdcd18deea0e1c6c2e8d2548dbf32f7f3 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 12:23:44 -0600
Subject: [PATCH 55/72] test(eslint): create eslint test fixtures (#32396)

---
 fixtures/{eslint => eslint-v6}/.eslintrc.json |   7 +-
 fixtures/eslint-v6/README.md                  |  12 +
 fixtures/eslint-v6/build.mjs                  |   5 +
 fixtures/eslint-v6/index.js                   | 143 +++
 fixtures/eslint-v6/package.json               |  12 +
 fixtures/eslint-v6/yarn.lock                  | 865 ++++++++++++++++++
 fixtures/eslint-v7/.eslintrc.json             |  14 +
 fixtures/eslint-v7/README.md                  |  12 +
 fixtures/eslint-v7/build.mjs                  |   5 +
 fixtures/eslint-v7/index.js                   | 143 +++
 fixtures/eslint-v7/package.json               |  12 +
 fixtures/eslint-v7/yarn.lock                  | 769 ++++++++++++++++
 fixtures/eslint-v8/.eslintrc.json             |  14 +
 fixtures/eslint-v8/README.md                  |  12 +
 fixtures/eslint-v8/build.mjs                  |   5 +
 fixtures/eslint-v8/index.js                   | 143 +++
 fixtures/eslint-v8/package.json               |  12 +
 fixtures/eslint-v8/yarn.lock                  | 676 ++++++++++++++
 fixtures/eslint-v9/README.md                  |  12 +
 fixtures/eslint-v9/build.mjs                  |   5 +
 fixtures/eslint-v9/eslint.config.mjs          |  21 +
 fixtures/eslint-v9/index.js                   | 143 +++
 fixtures/eslint-v9/package.json               |  12 +
 fixtures/eslint-v9/yarn.lock                  | 579 ++++++++++++
 fixtures/eslint/README.md                     |   7 -
 fixtures/eslint/index.js                      |  26 -
 fixtures/eslint/package.json                  |  12 -
 fixtures/eslint/proxy/index.js                |  35 -
 fixtures/eslint/proxy/package.json            |   4 -
 fixtures/eslint/watch.sh                      |   3 -
 fixtures/eslint/yarn.lock                     | 853 -----------------
 31 files changed, 3629 insertions(+), 944 deletions(-)
 rename fixtures/{eslint => eslint-v6}/.eslintrc.json (52%)
 create mode 100644 fixtures/eslint-v6/README.md
 create mode 100644 fixtures/eslint-v6/build.mjs
 create mode 100644 fixtures/eslint-v6/index.js
 create mode 100644 fixtures/eslint-v6/package.json
 create mode 100644 fixtures/eslint-v6/yarn.lock
 create mode 100644 fixtures/eslint-v7/.eslintrc.json
 create mode 100644 fixtures/eslint-v7/README.md
 create mode 100644 fixtures/eslint-v7/build.mjs
 create mode 100644 fixtures/eslint-v7/index.js
 create mode 100644 fixtures/eslint-v7/package.json
 create mode 100644 fixtures/eslint-v7/yarn.lock
 create mode 100644 fixtures/eslint-v8/.eslintrc.json
 create mode 100644 fixtures/eslint-v8/README.md
 create mode 100644 fixtures/eslint-v8/build.mjs
 create mode 100644 fixtures/eslint-v8/index.js
 create mode 100644 fixtures/eslint-v8/package.json
 create mode 100644 fixtures/eslint-v8/yarn.lock
 create mode 100644 fixtures/eslint-v9/README.md
 create mode 100644 fixtures/eslint-v9/build.mjs
 create mode 100644 fixtures/eslint-v9/eslint.config.mjs
 create mode 100644 fixtures/eslint-v9/index.js
 create mode 100644 fixtures/eslint-v9/package.json
 create mode 100644 fixtures/eslint-v9/yarn.lock
 delete mode 100644 fixtures/eslint/README.md
 delete mode 100644 fixtures/eslint/index.js
 delete mode 100644 fixtures/eslint/package.json
 delete mode 100644 fixtures/eslint/proxy/index.js
 delete mode 100644 fixtures/eslint/proxy/package.json
 delete mode 100755 fixtures/eslint/watch.sh
 delete mode 100644 fixtures/eslint/yarn.lock

diff --git a/fixtures/eslint/.eslintrc.json b/fixtures/eslint-v6/.eslintrc.json
similarity index 52%
rename from fixtures/eslint/.eslintrc.json
rename to fixtures/eslint-v6/.eslintrc.json
index e03178a42a72a..33b2cfaacabcd 100644
--- a/fixtures/eslint/.eslintrc.json
+++ b/fixtures/eslint-v6/.eslintrc.json
@@ -1,15 +1,14 @@
 {
   "root": true,
+  "extends": ["plugin:react-hooks/recommended-legacy"],
   "parserOptions": {
-    "ecmaVersion": 8,
+    "ecmaVersion": 2020,
     "sourceType": "module",
     "ecmaFeatures": {
       "jsx": true
     }
   },
-  "plugins": ["react-hooks"],
   "rules": {
-    "react-hooks/rules-of-hooks": 2,
-    "react-hooks/exhaustive-deps": 2
+    "react-hooks/exhaustive-deps": "error"
   }
 }
diff --git a/fixtures/eslint-v6/README.md b/fixtures/eslint-v6/README.md
new file mode 100644
index 0000000000000..7f0ebe8b038ba
--- /dev/null
+++ b/fixtures/eslint-v6/README.md
@@ -0,0 +1,12 @@
+# ESLint v6 Fixture
+
+This fixture allows us to test e2e functionality for `eslint-plugin-react-hooks` with eslint version 6.
+
+Run the following to test.
+
+```sh
+cd fixtures/eslint-v6
+yarn
+yarn build
+yarn lint
+```
diff --git a/fixtures/eslint-v6/build.mjs b/fixtures/eslint-v6/build.mjs
new file mode 100644
index 0000000000000..02a1bbd25e00e
--- /dev/null
+++ b/fixtures/eslint-v6/build.mjs
@@ -0,0 +1,5 @@
+#!/usr/bin/env node
+
+import {exec} from 'node:child_process';
+
+exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
diff --git a/fixtures/eslint-v6/index.js b/fixtures/eslint-v6/index.js
new file mode 100644
index 0000000000000..6d4a7235dd257
--- /dev/null
+++ b/fixtures/eslint-v6/index.js
@@ -0,0 +1,143 @@
+/**
+ * Exhaustive Deps
+ */
+// Valid because dependencies are declared correctly
+function Comment({comment, commentSource}) {
+  const currentUserID = comment.viewer.id;
+  const environment = RelayEnvironment.forUser(currentUserID);
+  const commentID = nullthrows(comment.id);
+  useEffect(() => {
+    const subscription = SubscriptionCounter.subscribeOnce(
+      `StoreSubscription_${commentID}`,
+      () =>
+        StoreSubscription.subscribe(
+          environment,
+          {
+            comment_id: commentID,
+          },
+          currentUserID,
+          commentSource
+        )
+    );
+    return () => subscription.dispose();
+  }, [commentID, commentSource, currentUserID, environment]);
+}
+
+// Valid because no dependencies
+function UseEffectWithNoDependencies() {
+  const local = {};
+  useEffect(() => {
+    console.log(local);
+  });
+}
+function UseEffectWithEmptyDependencies() {
+  useEffect(() => {
+    const local = {};
+    console.log(local);
+  }, []);
+}
+
+// OK because `props` wasn't defined.
+function ComponentWithNoPropsDefined() {
+  useEffect(() => {
+    console.log(props.foo);
+  }, []);
+}
+
+// Valid because props are declared as a dependency
+function ComponentWithPropsDeclaredAsDep({foo}) {
+  useEffect(() => {
+    console.log(foo.length);
+    console.log(foo.slice(0));
+  }, [foo]);
+}
+
+// Valid because individual props are declared as dependencies
+function ComponentWithIndividualPropsDeclaredAsDeps(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    console.log(props.bar);
+  }, [props.bar, props.foo]);
+}
+
+// Invalid because neither props or props.foo are declared as dependencies
+function ComponentWithoutDeclaringPropAsDep(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.notReactiveHook(() => {
+    console.log(props.foo);
+  }, []); // This one isn't a violation
+}
+
+/**
+ * Rules of Hooks
+ */
+// Valid because functions can call functions.
+function normalFunctionWithConditionalFunction() {
+  if (cond) {
+    doSomething();
+  }
+}
+
+// Valid because hooks can call hooks.
+function useHook() {
+  useState();
+}
+const whatever = function useHook() {
+  useState();
+};
+const useHook1 = () => {
+  useState();
+};
+let useHook2 = () => useState();
+useHook2 = () => {
+  useState();
+};
+
+// Invalid because hooks can't be called in conditionals.
+function ComponentWithConditionalHook() {
+  if (cond) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useConditionalHook();
+  }
+}
+
+// Invalid because hooks can't be called in loops.
+function useHookInLoops() {
+  while (a) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook1();
+    if (b) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook2();
+  }
+  while (c) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook3();
+    if (d) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook4();
+  }
+}
diff --git a/fixtures/eslint-v6/package.json b/fixtures/eslint-v6/package.json
new file mode 100644
index 0000000000000..50c92054b436f
--- /dev/null
+++ b/fixtures/eslint-v6/package.json
@@ -0,0 +1,12 @@
+{
+  "private": true,
+  "name": "eslint-v6",
+  "dependencies": {
+    "eslint": "^6",
+    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+  },
+  "scripts": {
+    "build": "node build.mjs && yarn",
+    "lint": "eslint index.js --report-unused-disable-directives"
+  }
+}
diff --git a/fixtures/eslint-v6/yarn.lock b/fixtures/eslint-v6/yarn.lock
new file mode 100644
index 0000000000000..3d6dbca037b38
--- /dev/null
+++ b/fixtures/eslint-v6/yarn.lock
@@ -0,0 +1,865 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@babel/code-frame@^7.0.0":
+  version "7.26.2"
+  resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.26.2.tgz#4b5fab97d33338eff916235055f0ebc21e573a85"
+  integrity sha512-RJlIHRueQgwWitWgF8OdFYGZX328Ax5BCemNGlqHfplnRT9ESi8JkFlvaVYbS+UubVY6dpv87Fs2u5M29iNFVQ==
+  dependencies:
+    "@babel/helper-validator-identifier" "^7.25.9"
+    js-tokens "^4.0.0"
+    picocolors "^1.0.0"
+
+"@babel/helper-validator-identifier@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.25.9.tgz#24b64e2c3ec7cd3b3c547729b8d16871f22cbdc7"
+  integrity sha512-Ed61U6XJc3CVRfkERJWDz4dJwKe7iLmmJsbOGu9wSloNSFttHV0I8g6UAgb7qnK5ly5bGLPd4oXZlxCdANBOWQ==
+
+acorn-jsx@^5.2.0:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.3.2.tgz#7ed5bb55908b3b2f1bc55c6af1653bada7f07937"
+  integrity sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==
+
+acorn@^7.1.1:
+  version "7.4.1"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-7.4.1.tgz#feaed255973d2e77555b83dbc08851a6c63520fa"
+  integrity sha512-nQyp0o1/mNdbTO1PO6kHkwSrmgZ0MT/jCCpNiwbUjGoRN4dlBhqJtoQuCnEOKzgTVwg0ZWiCoQy6SxMebQVh8A==
+
+ajv@^6.10.0, ajv@^6.10.2:
+  version "6.12.6"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4"
+  integrity sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==
+  dependencies:
+    fast-deep-equal "^3.1.1"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.4.1"
+    uri-js "^4.2.2"
+
+ansi-escapes@^4.2.1:
+  version "4.3.2"
+  resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-4.3.2.tgz#6b2291d1db7d98b6521d5f1efa42d0f3a9feb65e"
+  integrity sha512-gKXj5ALrKWQLsYG9jlTRmR/xKluxHV+Z9QEwNIgCfM1/uwPMCuzVVnh5mwTd+OuBZcwSIMbqssNWRm1lE51QaQ==
+  dependencies:
+    type-fest "^0.21.3"
+
+ansi-regex@^4.1.0:
+  version "4.1.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-4.1.1.tgz#164daac87ab2d6f6db3a29875e2d1766582dabed"
+  integrity sha512-ILlv4k/3f6vfQ4OoP2AGvirOktlQ98ZEL1k9FaQjxa3L1abBgbuTDAdPOpvbGncC0BTVQrl+OM8xZGK6tWXt7g==
+
+ansi-regex@^5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-5.0.1.tgz#082cb2c89c9fe8659a311a53bd6a4dc5301db304"
+  integrity sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==
+
+ansi-styles@^3.2.0, ansi-styles@^3.2.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
+  integrity sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==
+  dependencies:
+    color-convert "^1.9.0"
+
+ansi-styles@^4.1.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937"
+  integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==
+  dependencies:
+    color-convert "^2.0.1"
+
+argparse@^1.0.7:
+  version "1.0.10"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
+  integrity sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==
+  dependencies:
+    sprintf-js "~1.0.2"
+
+astral-regex@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/astral-regex/-/astral-regex-1.0.0.tgz#6c8c3fb827dd43ee3918f27b82782ab7658a6fd9"
+  integrity sha512-+Ryf6g3BKoRc7jfp7ad8tM4TtMiaWvbF/1/sQcZPkkS7ag3D5nMBCe2UfOTONtAkaG0tO0ij3C5Lwmf1EiyjHg==
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
+
+brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+callsites@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73"
+  integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==
+
+chalk@^2.1.0:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424"
+  integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==
+  dependencies:
+    ansi-styles "^3.2.1"
+    escape-string-regexp "^1.0.5"
+    supports-color "^5.3.0"
+
+chalk@^4.1.0:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01"
+  integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==
+  dependencies:
+    ansi-styles "^4.1.0"
+    supports-color "^7.1.0"
+
+chardet@^0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/chardet/-/chardet-0.7.0.tgz#90094849f0937f2eedc2425d0d28a9e5f0cbad9e"
+  integrity sha512-mT8iDcrh03qDGRRmoA2hmBJnxpllMR+0/0qlzjqZES6NdiWDcZkCNAk4rPFZ9Q85r27unkiNNg8ZOiwZXBHwcA==
+
+cli-cursor@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-3.1.0.tgz#264305a7ae490d1d03bf0c9ba7c925d1753af307"
+  integrity sha512-I/zHAwsKf9FqGoXM4WWRACob9+SNukZTd94DWF57E4toouRulbCxcUh6RKUEOQlYTHJnzkPMySvPNaaSLNfLZw==
+  dependencies:
+    restore-cursor "^3.1.0"
+
+cli-width@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-3.0.0.tgz#a2f48437a2caa9a22436e794bf071ec9e61cedf6"
+  integrity sha512-FxqpkPPwu1HjuN93Omfm4h8uIanXofW0RxVEW3k5RKx+mJJYSthzNhp32Kzxxy3YAEZ/Dc/EWN1vZRY0+kOhbw==
+
+color-convert@^1.9.0:
+  version "1.9.3"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.3.tgz#bb71850690e1f136567de629d2d5471deda4c1e8"
+  integrity sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==
+  dependencies:
+    color-name "1.1.3"
+
+color-convert@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3"
+  integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==
+  dependencies:
+    color-name "~1.1.4"
+
+color-name@1.1.3:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
+  integrity sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=
+
+color-name@~1.1.4:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2"
+  integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
+
+cross-spawn@^6.0.5:
+  version "6.0.6"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-6.0.6.tgz#30d0efa0712ddb7eb5a76e1e8721bffafa6b5d57"
+  integrity sha512-VqCUuhcd1iB+dsv8gxPttb5iZh/D0iubSP21g36KXdEuf6I5JiioesUVjpCdHV9MZRUfVFlvwtIUyPfxo5trtw==
+  dependencies:
+    nice-try "^1.0.4"
+    path-key "^2.0.1"
+    semver "^5.5.0"
+    shebang-command "^1.2.0"
+    which "^1.2.9"
+
+debug@^4.0.1:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
+deep-is@~0.1.3:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34"
+  integrity sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=
+
+doctrine@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-3.0.0.tgz#addebead72a6574db783639dc87a121773973961"
+  integrity sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==
+  dependencies:
+    esutils "^2.0.2"
+
+emoji-regex@^7.0.1:
+  version "7.0.3"
+  resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-7.0.3.tgz#933a04052860c85e83c122479c4748a8e4c72156"
+  integrity sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==
+
+emoji-regex@^8.0.0:
+  version "8.0.0"
+  resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-8.0.0.tgz#e818fd69ce5ccfcb404594f842963bf53164cc37"
+  integrity sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==
+
+escape-string-regexp@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
+  integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
+
+"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+  version "0.0.0"
+  uid ""
+
+eslint-scope@^5.0.0:
+  version "5.1.1"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-5.1.1.tgz#e786e59a66cb92b3f6c1fb0d508aab174848f48c"
+  integrity sha512-2NxwbF/hZ0KpepYN0cNbo+FN6XoK7GaHlQhgx/hIZl6Va0bF45RQOOwhLIy8lQDbuCiadSLCBnH2CFYquit5bw==
+  dependencies:
+    esrecurse "^4.3.0"
+    estraverse "^4.1.1"
+
+eslint-utils@^1.4.3:
+  version "1.4.3"
+  resolved "https://registry.yarnpkg.com/eslint-utils/-/eslint-utils-1.4.3.tgz#74fec7c54d0776b6f67e0251040b5806564e981f"
+  integrity sha512-fbBN5W2xdY45KulGXmLHZ3c3FHfVYmKg0IrAKGOkT/464PQsx2UeIzfz1RmEci+KLm1bBaAzZAh8+/E+XAeZ8Q==
+  dependencies:
+    eslint-visitor-keys "^1.1.0"
+
+eslint-visitor-keys@^1.1.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.3.0.tgz#30ebd1ef7c2fdff01c3a4f151044af25fab0523e"
+  integrity sha512-6J72N8UNa462wa/KFODt/PJ3IU60SDpC3QXC1Hjc1BXXpfL2C9R5+AU7jhe0F6GREqVMh4Juu+NY7xn+6dipUQ==
+
+eslint@^6:
+  version "6.8.0"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-6.8.0.tgz#62262d6729739f9275723824302fb227c8c93ffb"
+  integrity sha512-K+Iayyo2LtyYhDSYwz5D5QdWw0hCacNzyq1Y821Xna2xSJj7cijoLLYmLxTQgcgZ9mC61nryMy9S7GRbYpI5Ig==
+  dependencies:
+    "@babel/code-frame" "^7.0.0"
+    ajv "^6.10.0"
+    chalk "^2.1.0"
+    cross-spawn "^6.0.5"
+    debug "^4.0.1"
+    doctrine "^3.0.0"
+    eslint-scope "^5.0.0"
+    eslint-utils "^1.4.3"
+    eslint-visitor-keys "^1.1.0"
+    espree "^6.1.2"
+    esquery "^1.0.1"
+    esutils "^2.0.2"
+    file-entry-cache "^5.0.1"
+    functional-red-black-tree "^1.0.1"
+    glob-parent "^5.0.0"
+    globals "^12.1.0"
+    ignore "^4.0.6"
+    import-fresh "^3.0.0"
+    imurmurhash "^0.1.4"
+    inquirer "^7.0.0"
+    is-glob "^4.0.0"
+    js-yaml "^3.13.1"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    levn "^0.3.0"
+    lodash "^4.17.14"
+    minimatch "^3.0.4"
+    mkdirp "^0.5.1"
+    natural-compare "^1.4.0"
+    optionator "^0.8.3"
+    progress "^2.0.0"
+    regexpp "^2.0.1"
+    semver "^6.1.2"
+    strip-ansi "^5.2.0"
+    strip-json-comments "^3.0.1"
+    table "^5.2.3"
+    text-table "^0.2.0"
+    v8-compile-cache "^2.0.3"
+
+espree@^6.1.2:
+  version "6.2.1"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-6.2.1.tgz#77fc72e1fd744a2052c20f38a5b575832e82734a"
+  integrity sha512-ysCxRQY3WaXJz9tdbWOwuWr5Y/XrPTGX9Kiz3yoUXwW0VZ4w30HTkQLaGx/+ttFjF8i+ACbArnB4ce68a9m5hw==
+  dependencies:
+    acorn "^7.1.1"
+    acorn-jsx "^5.2.0"
+    eslint-visitor-keys "^1.1.0"
+
+esprima@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71"
+  integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==
+
+esquery@^1.0.1:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.6.0.tgz#91419234f804d852a82dceec3e16cdc22cf9dae7"
+  integrity sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==
+  dependencies:
+    estraverse "^5.1.0"
+
+esrecurse@^4.3.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921"
+  integrity sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==
+  dependencies:
+    estraverse "^5.2.0"
+
+estraverse@^4.1.1:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13"
+  integrity sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=
+
+estraverse@^5.1.0, estraverse@^5.2.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-5.3.0.tgz#2eea5290702f26ab8fe5370370ff86c965d21123"
+  integrity sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
+
+external-editor@^3.0.3:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-3.1.0.tgz#cb03f740befae03ea4d283caed2741a83f335495"
+  integrity sha512-hMQ4CX1p1izmuLYyZqLMO/qGNw10wSv9QDCPfzXfyFrOaCSSoRfqE1Kf1s5an66J5JZC62NewG+mK49jOCtQew==
+  dependencies:
+    chardet "^0.7.0"
+    iconv-lite "^0.4.24"
+    tmp "^0.0.33"
+
+fast-deep-equal@^3.1.1:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz#3a7d56b559d6cbc3eb512325244e619a65c6c525"
+  integrity sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
+
+fast-levenshtein@~2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
+  integrity sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==
+
+figures@^3.0.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/figures/-/figures-3.2.0.tgz#625c18bd293c604dc4a8ddb2febf0c88341746af"
+  integrity sha512-yaduQFRKLXYOGgEn6AZau90j3ggSOyiqXU0F9JZfeXYhNa+Jk4X+s45A2zg5jns87GAFa34BBm2kXw4XpNcbdg==
+  dependencies:
+    escape-string-regexp "^1.0.5"
+
+file-entry-cache@^5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-5.0.1.tgz#ca0f6efa6dd3d561333fb14515065c2fafdf439c"
+  integrity sha512-bCg29ictuBaKUwwArK4ouCaqDgLZcysCFLmM/Yn/FDoqndh/9vNuQfXRDvTuXKLxfD/JtZQGKFT8MGcJBK644g==
+  dependencies:
+    flat-cache "^2.0.1"
+
+flat-cache@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-2.0.1.tgz#5d296d6f04bda44a4630a301413bdbc2ec085ec0"
+  integrity sha512-LoQe6yDuUMDzQAEH8sgmh4Md6oZnc/7PjtwjNFSzveXqSHt6ka9fPBuso7IGf9Rz4uqnSnWiFH2B/zj24a5ReA==
+  dependencies:
+    flatted "^2.0.0"
+    rimraf "2.6.3"
+    write "1.0.3"
+
+flatted@^2.0.0:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-2.0.2.tgz#4575b21e2bcee7434aa9be662f4b7b5f9c2b5138"
+  integrity sha512-r5wGx7YeOwNWNlCA0wQ86zKyDLMQr+/RB8xy74M4hTphfmjlijTSSXGuH8rnvKZnfT9i+75zmd8jcKdMR4O6jA==
+
+fs.realpath@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
+  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
+
+functional-red-black-tree@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/functional-red-black-tree/-/functional-red-black-tree-1.0.1.tgz#1b0ab3bd553b2a0d6399d29c0e3ea0b252078327"
+  integrity sha512-dsKNQNdj6xA3T+QlADDA7mOSlX0qiMINjn0cgr+eGHGsbSHzTabcIogz2+p/iqP1Xs6EP/sS2SbqH+brGTbq0g==
+
+glob-parent@^5.0.0:
+  version "5.1.2"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.2.tgz#869832c58034fe68a4093c17dc15e8340d8401c4"
+  integrity sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==
+  dependencies:
+    is-glob "^4.0.1"
+
+glob@^7.1.3:
+  version "7.1.3"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.3.tgz#3960832d3f1574108342dafd3a67b332c0969df1"
+  integrity sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+globals@^12.1.0:
+  version "12.4.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-12.4.0.tgz#a18813576a41b00a24a97e7f815918c2e19925f8"
+  integrity sha512-BWICuzzDvDoH54NHKCseDanAhE3CeDorgDL5MT6LMXXj2WCnd9UC2szdk4AWLfjdgNBCXLUanXYcpBBKOSWGwg==
+  dependencies:
+    type-fest "^0.8.1"
+
+has-flag@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
+  integrity sha1-tdRU3CGZriJWmfNGfloH87lVuv0=
+
+has-flag@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b"
+  integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==
+
+iconv-lite@^0.4.24:
+  version "0.4.24"
+  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.24.tgz#2022b4b25fbddc21d2f524974a474aafe733908b"
+  integrity sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==
+  dependencies:
+    safer-buffer ">= 2.1.2 < 3"
+
+ignore@^4.0.6:
+  version "4.0.6"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-4.0.6.tgz#750e3db5862087b4737ebac8207ffd1ef27b25fc"
+  integrity sha512-cyFDKrqc/YdcWFniJhzI42+AzS+gNwmUzOSFcRCQYwySuBBBy/KjuxWLZ/FHEH6Moq1NizMOBWyTcv8O4OZIMg==
+
+import-fresh@^3.0.0:
+  version "3.3.1"
+  resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.1.tgz#9cecb56503c0ada1f2741dbbd6546e4b13b57ccf"
+  integrity sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==
+  dependencies:
+    parent-module "^1.0.0"
+    resolve-from "^4.0.0"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
+
+inflight@^1.0.4:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
+  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
+  dependencies:
+    once "^1.3.0"
+    wrappy "1"
+
+inherits@2:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
+  integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=
+
+inquirer@^7.0.0:
+  version "7.3.3"
+  resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-7.3.3.tgz#04d176b2af04afc157a83fd7c100e98ee0aad003"
+  integrity sha512-JG3eIAj5V9CwcGvuOmoo6LB9kbAYT8HXffUl6memuszlwDC/qvFAJw49XJ5NROSFNPxp3iQg1GqkFhaY/CR0IA==
+  dependencies:
+    ansi-escapes "^4.2.1"
+    chalk "^4.1.0"
+    cli-cursor "^3.1.0"
+    cli-width "^3.0.0"
+    external-editor "^3.0.3"
+    figures "^3.0.0"
+    lodash "^4.17.19"
+    mute-stream "0.0.8"
+    run-async "^2.4.0"
+    rxjs "^6.6.0"
+    string-width "^4.1.0"
+    strip-ansi "^6.0.0"
+    through "^2.3.6"
+
+is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==
+
+is-fullwidth-code-point@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f"
+  integrity sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=
+
+is-fullwidth-code-point@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz#f116f8064fe90b3f7844a38997c0b75051269f1d"
+  integrity sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==
+
+is-glob@^4.0.0, is-glob@^4.0.1:
+  version "4.0.3"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084"
+  integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==
+  dependencies:
+    is-extglob "^2.1.1"
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+  integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==
+
+js-tokens@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-4.0.0.tgz#19203fb59991df98e3a287050d4647cdeaf32499"
+  integrity sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==
+
+js-yaml@^3.13.1:
+  version "3.14.1"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.14.1.tgz#dae812fdb3825fa306609a8717383c50c36a0537"
+  integrity sha512-okMH7OXXJ7YrN9Ok3/SXrnu4iX9yOk+25nqX4imS2npuvTYDmo/QEZoqwZkYaIDk3jVvBOTOIEgEhaLOynBS9g==
+  dependencies:
+    argparse "^1.0.7"
+    esprima "^4.0.0"
+
+json-schema-traverse@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
+  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
+
+json-stable-stringify-without-jsonify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651"
+  integrity sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==
+
+levn@^0.3.0, levn@~0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.3.0.tgz#3b09924edf9f083c0490fdd4c0bc4421e04764ee"
+  integrity sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=
+  dependencies:
+    prelude-ls "~1.1.2"
+    type-check "~0.3.2"
+
+lodash@^4.17.14, lodash@^4.17.19:
+  version "4.17.21"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.21.tgz#679591c564c3bffaae8454cf0b3df370c3d6911c"
+  integrity sha512-v2kDEe57lecTulaDIuNTPy3Ry4gLGJ6Z1O3vE1krgXZNrsQ+LFTGHVxVjcXPs17LhbZVGedAJv8XZ1tvj5FvSg==
+
+mimic-fn@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-2.1.0.tgz#7ed2c2ccccaf84d3ffcb7a69b57711fc2083401b"
+  integrity sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==
+
+minimatch@^3.0.4:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
+  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+minimist@0.0.8:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d"
+  integrity sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=
+
+mkdirp@^0.5.1:
+  version "0.5.1"
+  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903"
+  integrity sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=
+  dependencies:
+    minimist "0.0.8"
+
+ms@^2.1.3:
+  version "2.1.3"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
+  integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
+
+mute-stream@0.0.8:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.8.tgz#1630c42b2251ff81e2a283de96a5497ea92e5e0d"
+  integrity sha512-nnbWWOkoWyUsTjKrhgD0dcz22mdkSnpYqbEjIm2nhwhuxlSkpywJmBo8h0ZqJdkp73mb90SssHkN4rsRaBAfAA==
+
+natural-compare@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
+  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
+
+nice-try@^1.0.4:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/nice-try/-/nice-try-1.0.5.tgz#a3378a7696ce7d223e88fc9b764bd7ef1089e366"
+  integrity sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ==
+
+once@^1.3.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
+  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
+  dependencies:
+    wrappy "1"
+
+onetime@^5.1.0:
+  version "5.1.2"
+  resolved "https://registry.yarnpkg.com/onetime/-/onetime-5.1.2.tgz#d0e96ebb56b07476df1dd9c4806e5237985ca45e"
+  integrity sha512-kbpaSSGJTWdAY5KPVeMOKXSrPtr8C8C7wodJbcsd51jRnmD+GZu8Y0VoU6Dm5Z4vWr0Ig/1NKuWRKf7j5aaYSg==
+  dependencies:
+    mimic-fn "^2.1.0"
+
+optionator@^0.8.3:
+  version "0.8.3"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.8.3.tgz#84fa1d036fe9d3c7e21d99884b601167ec8fb495"
+  integrity sha512-+IW9pACdk3XWmmTXG8m3upGUJst5XRGzxMRjXzAuJ1XnIFNvfhjjIuYkDvysnPQ7qzqVzLt78BCruntqRhWQbA==
+  dependencies:
+    deep-is "~0.1.3"
+    fast-levenshtein "~2.0.6"
+    levn "~0.3.0"
+    prelude-ls "~1.1.2"
+    type-check "~0.3.2"
+    word-wrap "~1.2.3"
+
+os-tmpdir@~1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
+  integrity sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=
+
+parent-module@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
+  integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==
+  dependencies:
+    callsites "^3.0.0"
+
+path-is-absolute@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
+  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
+
+path-key@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40"
+  integrity sha512-fEHGKCSmUSDPv4uoj8AlD+joPlq3peND+HRYyxFz4KPw4z926S/b8rIuFs2FYJg3BwsxJf6A9/3eIdLaYC+9Dw==
+
+picocolors@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.1.1.tgz#3d321af3eab939b083c8f929a1d12cda81c26b6b"
+  integrity sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==
+
+prelude-ls@~1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54"
+  integrity sha1-IZMqVJ9eUv/ZqCf1cOBL5iqX2lQ=
+
+progress@^2.0.0:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.3.tgz#7e8cf8d8f5b8f239c1bc68beb4eb78567d572ef8"
+  integrity sha512-7PiHtLll5LdnKIMw100I+8xJXR5gW2QwWYkT6iJva0bXitZKa/XMrSbdmg3r2Xnaidz9Qumd0VPaMrZlF9V9sA==
+
+punycode@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
+  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
+
+regexpp@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/regexpp/-/regexpp-2.0.1.tgz#8d19d31cf632482b589049f8281f93dbcba4d07f"
+  integrity sha512-lv0M6+TkDVniA3aD1Eg0DVpfU/booSu7Eev3TDO/mZKHBfVjgCGTV4t4buppESEYDtkArYFOxTJWv6S5C+iaNw==
+
+resolve-from@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6"
+  integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==
+
+restore-cursor@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-3.1.0.tgz#39f67c54b3a7a58cea5236d95cf0034239631f7e"
+  integrity sha512-l+sSefzHpj5qimhFSE5a8nufZYAM3sBSVMAPtYkmC+4EH2anSGaEMXSD0izRQbu9nfyQ9y5JrVmp7E8oZrUjvA==
+  dependencies:
+    onetime "^5.1.0"
+    signal-exit "^3.0.2"
+
+rimraf@2.6.3:
+  version "2.6.3"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.3.tgz#b2d104fe0d8fb27cf9e0a1cda8262dd3833c6cab"
+  integrity sha512-mwqeW5XsA2qAejG46gYdENaxXjx9onRNCfn7L0duuP4hCuTIi/QO7PDK07KJfp1d+izWPrzEJDcSqBa0OZQriA==
+  dependencies:
+    glob "^7.1.3"
+
+run-async@^2.4.0:
+  version "2.4.1"
+  resolved "https://registry.yarnpkg.com/run-async/-/run-async-2.4.1.tgz#8440eccf99ea3e70bd409d49aab88e10c189a455"
+  integrity sha512-tvVnVv01b8c1RrA6Ep7JkStj85Guv/YrMcwqYQnwjsAS2cTmmPGBBjAjpCW7RrSodNSoE2/qg9O4bceNvUuDgQ==
+
+rxjs@^6.6.0:
+  version "6.6.7"
+  resolved "https://registry.yarnpkg.com/rxjs/-/rxjs-6.6.7.tgz#90ac018acabf491bf65044235d5863c4dab804c9"
+  integrity sha512-hTdwr+7yYNIT5n4AMYp85KA6yw2Va0FLa3Rguvbpa4W3I5xynaBZo41cM3XM+4Q6fRMj3sBYIR1VAmZMXYJvRQ==
+  dependencies:
+    tslib "^1.9.0"
+
+"safer-buffer@>= 2.1.2 < 3":
+  version "2.1.2"
+  resolved "https://registry.yarnpkg.com/safer-buffer/-/safer-buffer-2.1.2.tgz#44fa161b0187b9549dd84bb91802f9bd8385cd6a"
+  integrity sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==
+
+semver@^5.5.0:
+  version "5.7.2"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-5.7.2.tgz#48d55db737c3287cd4835e17fa13feace1c41ef8"
+  integrity sha512-cBznnQ9KjJqU67B52RMC65CMarK2600WFnbkcaiwWq3xy/5haFJlshgnpjovMVJ+Hff49d8GEn0b87C5pDQ10g==
+
+semver@^6.1.2:
+  version "6.3.1"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-6.3.1.tgz#556d2ef8689146e46dcea4bfdd095f3434dffcb4"
+  integrity sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==
+
+shebang-command@^1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-1.2.0.tgz#44aac65b695b03398968c39f363fee5deafdf1ea"
+  integrity sha512-EV3L1+UQWGor21OmnvojK36mhg+TyIKDh3iFBKBohr5xeXIhNBcx8oWdgkTEEQ+BEFFYdLRuqMfd5L84N1V5Vg==
+  dependencies:
+    shebang-regex "^1.0.0"
+
+shebang-regex@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-1.0.0.tgz#da42f49740c0b42db2ca9728571cb190c98efea3"
+  integrity sha512-wpoSFAxys6b2a2wHZ1XpDSgD7N9iVjg29Ph9uV/uaP9Ex/KXlkTZTeddxDPSYQpgvzKLGJke2UU0AzoGCjNIvQ==
+
+signal-exit@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d"
+  integrity sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=
+
+slice-ansi@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-2.1.0.tgz#cacd7693461a637a5788d92a7dd4fba068e81636"
+  integrity sha512-Qu+VC3EwYLldKa1fCxuuvULvSJOKEgk9pi8dZeCVK7TqBfUNTH4sFkk4joj8afVSfAYgJoSOetjx9QWOJ5mYoQ==
+  dependencies:
+    ansi-styles "^3.2.0"
+    astral-regex "^1.0.0"
+    is-fullwidth-code-point "^2.0.0"
+
+sprintf-js@~1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
+  integrity sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=
+
+string-width@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-3.1.0.tgz#22767be21b62af1081574306f69ac51b62203961"
+  integrity sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==
+  dependencies:
+    emoji-regex "^7.0.1"
+    is-fullwidth-code-point "^2.0.0"
+    strip-ansi "^5.1.0"
+
+string-width@^4.1.0:
+  version "4.2.3"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-4.2.3.tgz#269c7117d27b05ad2e536830a8ec895ef9c6d010"
+  integrity sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==
+  dependencies:
+    emoji-regex "^8.0.0"
+    is-fullwidth-code-point "^3.0.0"
+    strip-ansi "^6.0.1"
+
+strip-ansi@^5.1.0, strip-ansi@^5.2.0:
+  version "5.2.0"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-5.2.0.tgz#8c9a536feb6afc962bdfa5b104a5091c1ad9c0ae"
+  integrity sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==
+  dependencies:
+    ansi-regex "^4.1.0"
+
+strip-ansi@^6.0.0, strip-ansi@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-6.0.1.tgz#9e26c63d30f53443e9489495b2105d37b67a85d9"
+  integrity sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==
+  dependencies:
+    ansi-regex "^5.0.1"
+
+strip-json-comments@^3.0.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.1.1.tgz#31f1281b3832630434831c310c01cccda8cbe006"
+  integrity sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==
+
+supports-color@^5.3.0:
+  version "5.5.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.5.0.tgz#e2e69a44ac8772f78a1ec0b35b689df6530efc8f"
+  integrity sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==
+  dependencies:
+    has-flag "^3.0.0"
+
+supports-color@^7.1.0:
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da"
+  integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==
+  dependencies:
+    has-flag "^4.0.0"
+
+table@^5.2.3:
+  version "5.4.6"
+  resolved "https://registry.yarnpkg.com/table/-/table-5.4.6.tgz#1292d19500ce3f86053b05f0e8e7e4a3bb21079e"
+  integrity sha512-wmEc8m4fjnob4gt5riFRtTu/6+4rSe12TpAELNSqHMfF3IqnA+CH37USM6/YR3qRZv7e56kAEAtd6nKZaxe0Ug==
+  dependencies:
+    ajv "^6.10.2"
+    lodash "^4.17.14"
+    slice-ansi "^2.1.0"
+    string-width "^3.0.0"
+
+text-table@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+  integrity sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==
+
+through@^2.3.6:
+  version "2.3.8"
+  resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
+  integrity sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=
+
+tmp@^0.0.33:
+  version "0.0.33"
+  resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9"
+  integrity sha512-jRCJlojKnZ3addtTOjdIqoRuPEKBvNXcGYqzO6zWZX8KfKEpnGY5jfggJQ3EjKuu8D4bJRr0y+cYJFmYbImXGw==
+  dependencies:
+    os-tmpdir "~1.0.2"
+
+tslib@^1.9.0:
+  version "1.14.1"
+  resolved "https://registry.yarnpkg.com/tslib/-/tslib-1.14.1.tgz#cf2d38bdc34a134bcaf1091c41f6619e2f672d00"
+  integrity sha512-Xni35NKzjgMrwevysHTCArtLDpPvye8zV/0E4EyYn43P7/7qvQwPh9BGkHewbMulVntbigmcT7rdX3BNo9wRJg==
+
+type-check@~0.3.2:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72"
+  integrity sha1-WITKtRLPHTVeP7eE8wgEsrUg23I=
+  dependencies:
+    prelude-ls "~1.1.2"
+
+type-fest@^0.21.3:
+  version "0.21.3"
+  resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.21.3.tgz#d260a24b0198436e133fa26a524a6d65fa3b2e37"
+  integrity sha512-t0rzBq87m3fVcduHDUFhKmyyX+9eo6WQjZvf51Ea/M0Q7+T374Jp1aUiyUl0GKxp8M/OETVHSDvmkyPgvX+X2w==
+
+type-fest@^0.8.1:
+  version "0.8.1"
+  resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.8.1.tgz#09e249ebde851d3b1e48d27c105444667f17b83d"
+  integrity sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==
+
+uri-js@^4.2.2:
+  version "4.2.2"
+  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
+  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
+  dependencies:
+    punycode "^2.1.0"
+
+v8-compile-cache@^2.0.3:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/v8-compile-cache/-/v8-compile-cache-2.4.0.tgz#cdada8bec61e15865f05d097c5f4fd30e94dc128"
+  integrity sha512-ocyWc3bAHBB/guyqJQVI5o4BZkPhznPYUG2ea80Gond/BgNWpap8TOmLSeeQG7bnh2KMISxskdADG59j7zruhw==
+
+which@^1.2.9:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/which/-/which-1.3.1.tgz#a45043d54f5805316da8d62f9f50918d3da70b0a"
+  integrity sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==
+  dependencies:
+    isexe "^2.0.0"
+
+word-wrap@~1.2.3:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.5.tgz#d2c45c6dd4fbce621a66f136cbe328afd0410b34"
+  integrity sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==
+
+wrappy@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
+  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
+
+write@1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/write/-/write-1.0.3.tgz#0800e14523b923a387e415123c865616aae0f5c3"
+  integrity sha512-/lg70HAjtkUgWPVZhZcm+T4hkL8Zbtp1nFNOn3lRrxnlv50SRBv7cR7RqR+GMsd3hUXy9hWBo4CHTbFTcOYwig==
+  dependencies:
+    mkdirp "^0.5.1"
diff --git a/fixtures/eslint-v7/.eslintrc.json b/fixtures/eslint-v7/.eslintrc.json
new file mode 100644
index 0000000000000..33b2cfaacabcd
--- /dev/null
+++ b/fixtures/eslint-v7/.eslintrc.json
@@ -0,0 +1,14 @@
+{
+  "root": true,
+  "extends": ["plugin:react-hooks/recommended-legacy"],
+  "parserOptions": {
+    "ecmaVersion": 2020,
+    "sourceType": "module",
+    "ecmaFeatures": {
+      "jsx": true
+    }
+  },
+  "rules": {
+    "react-hooks/exhaustive-deps": "error"
+  }
+}
diff --git a/fixtures/eslint-v7/README.md b/fixtures/eslint-v7/README.md
new file mode 100644
index 0000000000000..ea4628b0e035a
--- /dev/null
+++ b/fixtures/eslint-v7/README.md
@@ -0,0 +1,12 @@
+# ESLint v7 Fixture
+
+This fixture allows us to test e2e functionality for `eslint-plugin-react-hooks` with eslint version 7.
+
+Run the following to test.
+
+```sh
+cd fixtures/eslint-v7
+yarn
+yarn build
+yarn lint
+```
diff --git a/fixtures/eslint-v7/build.mjs b/fixtures/eslint-v7/build.mjs
new file mode 100644
index 0000000000000..02a1bbd25e00e
--- /dev/null
+++ b/fixtures/eslint-v7/build.mjs
@@ -0,0 +1,5 @@
+#!/usr/bin/env node
+
+import {exec} from 'node:child_process';
+
+exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
diff --git a/fixtures/eslint-v7/index.js b/fixtures/eslint-v7/index.js
new file mode 100644
index 0000000000000..6d4a7235dd257
--- /dev/null
+++ b/fixtures/eslint-v7/index.js
@@ -0,0 +1,143 @@
+/**
+ * Exhaustive Deps
+ */
+// Valid because dependencies are declared correctly
+function Comment({comment, commentSource}) {
+  const currentUserID = comment.viewer.id;
+  const environment = RelayEnvironment.forUser(currentUserID);
+  const commentID = nullthrows(comment.id);
+  useEffect(() => {
+    const subscription = SubscriptionCounter.subscribeOnce(
+      `StoreSubscription_${commentID}`,
+      () =>
+        StoreSubscription.subscribe(
+          environment,
+          {
+            comment_id: commentID,
+          },
+          currentUserID,
+          commentSource
+        )
+    );
+    return () => subscription.dispose();
+  }, [commentID, commentSource, currentUserID, environment]);
+}
+
+// Valid because no dependencies
+function UseEffectWithNoDependencies() {
+  const local = {};
+  useEffect(() => {
+    console.log(local);
+  });
+}
+function UseEffectWithEmptyDependencies() {
+  useEffect(() => {
+    const local = {};
+    console.log(local);
+  }, []);
+}
+
+// OK because `props` wasn't defined.
+function ComponentWithNoPropsDefined() {
+  useEffect(() => {
+    console.log(props.foo);
+  }, []);
+}
+
+// Valid because props are declared as a dependency
+function ComponentWithPropsDeclaredAsDep({foo}) {
+  useEffect(() => {
+    console.log(foo.length);
+    console.log(foo.slice(0));
+  }, [foo]);
+}
+
+// Valid because individual props are declared as dependencies
+function ComponentWithIndividualPropsDeclaredAsDeps(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    console.log(props.bar);
+  }, [props.bar, props.foo]);
+}
+
+// Invalid because neither props or props.foo are declared as dependencies
+function ComponentWithoutDeclaringPropAsDep(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.notReactiveHook(() => {
+    console.log(props.foo);
+  }, []); // This one isn't a violation
+}
+
+/**
+ * Rules of Hooks
+ */
+// Valid because functions can call functions.
+function normalFunctionWithConditionalFunction() {
+  if (cond) {
+    doSomething();
+  }
+}
+
+// Valid because hooks can call hooks.
+function useHook() {
+  useState();
+}
+const whatever = function useHook() {
+  useState();
+};
+const useHook1 = () => {
+  useState();
+};
+let useHook2 = () => useState();
+useHook2 = () => {
+  useState();
+};
+
+// Invalid because hooks can't be called in conditionals.
+function ComponentWithConditionalHook() {
+  if (cond) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useConditionalHook();
+  }
+}
+
+// Invalid because hooks can't be called in loops.
+function useHookInLoops() {
+  while (a) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook1();
+    if (b) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook2();
+  }
+  while (c) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook3();
+    if (d) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook4();
+  }
+}
diff --git a/fixtures/eslint-v7/package.json b/fixtures/eslint-v7/package.json
new file mode 100644
index 0000000000000..90c369c603e6d
--- /dev/null
+++ b/fixtures/eslint-v7/package.json
@@ -0,0 +1,12 @@
+{
+  "private": true,
+  "name": "eslint-v7",
+  "dependencies": {
+    "eslint": "^7",
+    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+  },
+  "scripts": {
+    "build": "node build.mjs && yarn",
+    "lint": "eslint index.js --report-unused-disable-directives"
+  }
+}
diff --git a/fixtures/eslint-v7/yarn.lock b/fixtures/eslint-v7/yarn.lock
new file mode 100644
index 0000000000000..62f97bbc20d69
--- /dev/null
+++ b/fixtures/eslint-v7/yarn.lock
@@ -0,0 +1,769 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@babel/code-frame@7.12.11":
+  version "7.12.11"
+  resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.12.11.tgz#f4ad435aa263db935b8f10f2c552d23fb716a63f"
+  integrity sha512-Zt1yodBx1UcyiePMSkWnU4hPqhwq7hGi2nFL1LeA3EUl+q2LQx16MISgJ0+z7dnmgvP9QtIleuETGOiOH1RcIw==
+  dependencies:
+    "@babel/highlight" "^7.10.4"
+
+"@babel/helper-validator-identifier@^7.25.9":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.25.9.tgz#24b64e2c3ec7cd3b3c547729b8d16871f22cbdc7"
+  integrity sha512-Ed61U6XJc3CVRfkERJWDz4dJwKe7iLmmJsbOGu9wSloNSFttHV0I8g6UAgb7qnK5ly5bGLPd4oXZlxCdANBOWQ==
+
+"@babel/highlight@^7.10.4":
+  version "7.25.9"
+  resolved "https://registry.yarnpkg.com/@babel/highlight/-/highlight-7.25.9.tgz#8141ce68fc73757946f983b343f1231f4691acc6"
+  integrity sha512-llL88JShoCsth8fF8R4SJnIn+WLvR6ccFxu1H3FlMhDontdcmZWf2HgIZ7AIqV3Xcck1idlohrN4EUBQz6klbw==
+  dependencies:
+    "@babel/helper-validator-identifier" "^7.25.9"
+    chalk "^2.4.2"
+    js-tokens "^4.0.0"
+    picocolors "^1.0.0"
+
+"@eslint/eslintrc@^0.4.3":
+  version "0.4.3"
+  resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-0.4.3.tgz#9e42981ef035beb3dd49add17acb96e8ff6f394c"
+  integrity sha512-J6KFFz5QCYUJq3pf0mjEcCJVERbzv71PUIDczuh9JkwGEzced6CO5ADLHB1rbf/+oPBtoPfMYNOpGDzCANlbXw==
+  dependencies:
+    ajv "^6.12.4"
+    debug "^4.1.1"
+    espree "^7.3.0"
+    globals "^13.9.0"
+    ignore "^4.0.6"
+    import-fresh "^3.2.1"
+    js-yaml "^3.13.1"
+    minimatch "^3.0.4"
+    strip-json-comments "^3.1.1"
+
+"@humanwhocodes/config-array@^0.5.0":
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/config-array/-/config-array-0.5.0.tgz#1407967d4c6eecd7388f83acf1eaf4d0c6e58ef9"
+  integrity sha512-FagtKFz74XrTl7y6HCzQpwDfXP0yhxe9lHLD1UZxjvZIcbyRz8zTFF/yYNfSfzU414eDwZ1SrO0Qvtyf+wFMQg==
+  dependencies:
+    "@humanwhocodes/object-schema" "^1.2.0"
+    debug "^4.1.1"
+    minimatch "^3.0.4"
+
+"@humanwhocodes/object-schema@^1.2.0":
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/object-schema/-/object-schema-1.2.1.tgz#b520529ec21d8e5945a1851dfd1c32e94e39ff45"
+  integrity sha512-ZnQMnLV4e7hDlUvw8H+U8ASL02SS2Gn6+9Ac3wGGLIe7+je2AeAOxPY+izIPJDfFDb7eDjev0Us8MO1iFRN8hA==
+
+acorn-jsx@^5.3.1:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.3.2.tgz#7ed5bb55908b3b2f1bc55c6af1653bada7f07937"
+  integrity sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==
+
+acorn@^7.4.0:
+  version "7.4.1"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-7.4.1.tgz#feaed255973d2e77555b83dbc08851a6c63520fa"
+  integrity sha512-nQyp0o1/mNdbTO1PO6kHkwSrmgZ0MT/jCCpNiwbUjGoRN4dlBhqJtoQuCnEOKzgTVwg0ZWiCoQy6SxMebQVh8A==
+
+ajv@^6.10.0, ajv@^6.12.4:
+  version "6.12.6"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4"
+  integrity sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==
+  dependencies:
+    fast-deep-equal "^3.1.1"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.4.1"
+    uri-js "^4.2.2"
+
+ajv@^8.0.1:
+  version "8.17.1"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-8.17.1.tgz#37d9a5c776af6bc92d7f4f9510eba4c0a60d11a6"
+  integrity sha512-B/gBuNg5SiMTrPkC+A2+cW0RszwxYmn6VYxB/inlBStS5nx6xHIt/ehKRhIMhqusl7a8LjQoZnjCs5vhwxOQ1g==
+  dependencies:
+    fast-deep-equal "^3.1.3"
+    fast-uri "^3.0.1"
+    json-schema-traverse "^1.0.0"
+    require-from-string "^2.0.2"
+
+ansi-colors@^4.1.1:
+  version "4.1.3"
+  resolved "https://registry.yarnpkg.com/ansi-colors/-/ansi-colors-4.1.3.tgz#37611340eb2243e70cc604cad35d63270d48781b"
+  integrity sha512-/6w/C21Pm1A7aZitlI5Ni/2J6FFQN8i1Cvz3kHABAAbw93v/NlvKdVOqz7CCWz/3iv/JplRSEEZ83XION15ovw==
+
+ansi-regex@^5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-5.0.1.tgz#082cb2c89c9fe8659a311a53bd6a4dc5301db304"
+  integrity sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==
+
+ansi-styles@^3.2.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
+  integrity sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==
+  dependencies:
+    color-convert "^1.9.0"
+
+ansi-styles@^4.0.0, ansi-styles@^4.1.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937"
+  integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==
+  dependencies:
+    color-convert "^2.0.1"
+
+argparse@^1.0.7:
+  version "1.0.10"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
+  integrity sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==
+  dependencies:
+    sprintf-js "~1.0.2"
+
+astral-regex@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/astral-regex/-/astral-regex-2.0.0.tgz#483143c567aeed4785759c0865786dc77d7d2e31"
+  integrity sha512-Z7tMw1ytTXt5jqMcOP+OQteU1VuNK9Y02uuJtKQ1Sv69jXQKKg5cibLwGJow8yzZP+eAc18EmLGPal0bp36rvQ==
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
+
+brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+callsites@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73"
+  integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==
+
+chalk@^2.4.2:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424"
+  integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==
+  dependencies:
+    ansi-styles "^3.2.1"
+    escape-string-regexp "^1.0.5"
+    supports-color "^5.3.0"
+
+chalk@^4.0.0:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01"
+  integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==
+  dependencies:
+    ansi-styles "^4.1.0"
+    supports-color "^7.1.0"
+
+color-convert@^1.9.0:
+  version "1.9.3"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.3.tgz#bb71850690e1f136567de629d2d5471deda4c1e8"
+  integrity sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==
+  dependencies:
+    color-name "1.1.3"
+
+color-convert@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3"
+  integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==
+  dependencies:
+    color-name "~1.1.4"
+
+color-name@1.1.3:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
+  integrity sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=
+
+color-name@~1.1.4:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2"
+  integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
+
+cross-spawn@^7.0.2:
+  version "7.0.6"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-7.0.6.tgz#8a58fe78f00dcd70c370451759dfbfaf03e8ee9f"
+  integrity sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==
+  dependencies:
+    path-key "^3.1.0"
+    shebang-command "^2.0.0"
+    which "^2.0.1"
+
+debug@^4.0.1, debug@^4.1.1:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
+deep-is@^0.1.3:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.4.tgz#a6f2dce612fadd2ef1f519b73551f17e85199831"
+  integrity sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==
+
+doctrine@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-3.0.0.tgz#addebead72a6574db783639dc87a121773973961"
+  integrity sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==
+  dependencies:
+    esutils "^2.0.2"
+
+emoji-regex@^8.0.0:
+  version "8.0.0"
+  resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-8.0.0.tgz#e818fd69ce5ccfcb404594f842963bf53164cc37"
+  integrity sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==
+
+enquirer@^2.3.5:
+  version "2.4.1"
+  resolved "https://registry.yarnpkg.com/enquirer/-/enquirer-2.4.1.tgz#93334b3fbd74fc7097b224ab4a8fb7e40bf4ae56"
+  integrity sha512-rRqJg/6gd538VHvR3PSrdRBb/1Vy2YfzHqzvbhGIQpDRKIa4FgV/54b5Q1xYSxOOwKvjXweS26E0Q+nAMwp2pQ==
+  dependencies:
+    ansi-colors "^4.1.1"
+    strip-ansi "^6.0.1"
+
+escape-string-regexp@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
+  integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
+
+escape-string-regexp@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
+  integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
+
+"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+  version "0.0.0"
+  uid ""
+
+eslint-scope@^5.1.1:
+  version "5.1.1"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-5.1.1.tgz#e786e59a66cb92b3f6c1fb0d508aab174848f48c"
+  integrity sha512-2NxwbF/hZ0KpepYN0cNbo+FN6XoK7GaHlQhgx/hIZl6Va0bF45RQOOwhLIy8lQDbuCiadSLCBnH2CFYquit5bw==
+  dependencies:
+    esrecurse "^4.3.0"
+    estraverse "^4.1.1"
+
+eslint-utils@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/eslint-utils/-/eslint-utils-2.1.0.tgz#d2de5e03424e707dc10c74068ddedae708741b27"
+  integrity sha512-w94dQYoauyvlDc43XnGB8lU3Zt713vNChgt4EWwhXAP2XkBvndfxF0AgIqKOOasjPIPzj9JqgwkwbCYD0/V3Zg==
+  dependencies:
+    eslint-visitor-keys "^1.1.0"
+
+eslint-visitor-keys@^1.1.0, eslint-visitor-keys@^1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.3.0.tgz#30ebd1ef7c2fdff01c3a4f151044af25fab0523e"
+  integrity sha512-6J72N8UNa462wa/KFODt/PJ3IU60SDpC3QXC1Hjc1BXXpfL2C9R5+AU7jhe0F6GREqVMh4Juu+NY7xn+6dipUQ==
+
+eslint-visitor-keys@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-2.1.0.tgz#f65328259305927392c938ed44eb0a5c9b2bd303"
+  integrity sha512-0rSmRBzXgDzIsD6mGdJgevzgezI534Cer5L/vyMX0kHzT/jiB43jRhd9YUlMGYLQy2zprNmoT8qasCGtY+QaKw==
+
+eslint@^7:
+  version "7.32.0"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-7.32.0.tgz#c6d328a14be3fb08c8d1d21e12c02fdb7a2a812d"
+  integrity sha512-VHZ8gX+EDfz+97jGcgyGCyRia/dPOd6Xh9yPv8Bl1+SoaIwD+a/vlrOmGRUyOYu7MwUhc7CxqeaDZU13S4+EpA==
+  dependencies:
+    "@babel/code-frame" "7.12.11"
+    "@eslint/eslintrc" "^0.4.3"
+    "@humanwhocodes/config-array" "^0.5.0"
+    ajv "^6.10.0"
+    chalk "^4.0.0"
+    cross-spawn "^7.0.2"
+    debug "^4.0.1"
+    doctrine "^3.0.0"
+    enquirer "^2.3.5"
+    escape-string-regexp "^4.0.0"
+    eslint-scope "^5.1.1"
+    eslint-utils "^2.1.0"
+    eslint-visitor-keys "^2.0.0"
+    espree "^7.3.1"
+    esquery "^1.4.0"
+    esutils "^2.0.2"
+    fast-deep-equal "^3.1.3"
+    file-entry-cache "^6.0.1"
+    functional-red-black-tree "^1.0.1"
+    glob-parent "^5.1.2"
+    globals "^13.6.0"
+    ignore "^4.0.6"
+    import-fresh "^3.0.0"
+    imurmurhash "^0.1.4"
+    is-glob "^4.0.0"
+    js-yaml "^3.13.1"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    levn "^0.4.1"
+    lodash.merge "^4.6.2"
+    minimatch "^3.0.4"
+    natural-compare "^1.4.0"
+    optionator "^0.9.1"
+    progress "^2.0.0"
+    regexpp "^3.1.0"
+    semver "^7.2.1"
+    strip-ansi "^6.0.0"
+    strip-json-comments "^3.1.0"
+    table "^6.0.9"
+    text-table "^0.2.0"
+    v8-compile-cache "^2.0.3"
+
+espree@^7.3.0, espree@^7.3.1:
+  version "7.3.1"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-7.3.1.tgz#f2df330b752c6f55019f8bd89b7660039c1bbbb6"
+  integrity sha512-v3JCNCE64umkFpmkFGqzVKsOT0tN1Zr+ueqLZfpV1Ob8e+CEgPWa+OxCoGH3tnhimMKIaBm4m/vaRpJ/krRz2g==
+  dependencies:
+    acorn "^7.4.0"
+    acorn-jsx "^5.3.1"
+    eslint-visitor-keys "^1.3.0"
+
+esprima@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71"
+  integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==
+
+esquery@^1.4.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.6.0.tgz#91419234f804d852a82dceec3e16cdc22cf9dae7"
+  integrity sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==
+  dependencies:
+    estraverse "^5.1.0"
+
+esrecurse@^4.3.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921"
+  integrity sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==
+  dependencies:
+    estraverse "^5.2.0"
+
+estraverse@^4.1.1:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13"
+  integrity sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=
+
+estraverse@^5.1.0, estraverse@^5.2.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-5.3.0.tgz#2eea5290702f26ab8fe5370370ff86c965d21123"
+  integrity sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
+
+fast-deep-equal@^3.1.1, fast-deep-equal@^3.1.3:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz#3a7d56b559d6cbc3eb512325244e619a65c6c525"
+  integrity sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
+
+fast-levenshtein@^2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
+  integrity sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==
+
+fast-uri@^3.0.1:
+  version "3.0.6"
+  resolved "https://registry.yarnpkg.com/fast-uri/-/fast-uri-3.0.6.tgz#88f130b77cfaea2378d56bf970dea21257a68748"
+  integrity sha512-Atfo14OibSv5wAp4VWNsFYE1AchQRTv9cBGWET4pZWHzYshFSS9NQI6I57rdKn9croWVMbYFbLhJ+yJvmZIIHw==
+
+file-entry-cache@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-6.0.1.tgz#211b2dd9659cb0394b073e7323ac3c933d522027"
+  integrity sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==
+  dependencies:
+    flat-cache "^3.0.4"
+
+flat-cache@^3.0.4:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-3.2.0.tgz#2c0c2d5040c99b1632771a9d105725c0115363ee"
+  integrity sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==
+  dependencies:
+    flatted "^3.2.9"
+    keyv "^4.5.3"
+    rimraf "^3.0.2"
+
+flatted@^3.2.9:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.3.2.tgz#adba1448a9841bec72b42c532ea23dbbedef1a27"
+  integrity sha512-AiwGJM8YcNOaobumgtng+6NHuOqC3A7MixFeDafM3X9cIUM+xUXoS5Vfgf+OihAYe20fxqNM9yPBXJzRtZ/4eA==
+
+fs.realpath@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
+  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
+
+functional-red-black-tree@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/functional-red-black-tree/-/functional-red-black-tree-1.0.1.tgz#1b0ab3bd553b2a0d6399d29c0e3ea0b252078327"
+  integrity sha512-dsKNQNdj6xA3T+QlADDA7mOSlX0qiMINjn0cgr+eGHGsbSHzTabcIogz2+p/iqP1Xs6EP/sS2SbqH+brGTbq0g==
+
+glob-parent@^5.1.2:
+  version "5.1.2"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.2.tgz#869832c58034fe68a4093c17dc15e8340d8401c4"
+  integrity sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==
+  dependencies:
+    is-glob "^4.0.1"
+
+glob@^7.1.3:
+  version "7.1.3"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.3.tgz#3960832d3f1574108342dafd3a67b332c0969df1"
+  integrity sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+globals@^13.6.0, globals@^13.9.0:
+  version "13.24.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-13.24.0.tgz#8432a19d78ce0c1e833949c36adb345400bb1171"
+  integrity sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==
+  dependencies:
+    type-fest "^0.20.2"
+
+has-flag@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
+  integrity sha1-tdRU3CGZriJWmfNGfloH87lVuv0=
+
+has-flag@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b"
+  integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==
+
+ignore@^4.0.6:
+  version "4.0.6"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-4.0.6.tgz#750e3db5862087b4737ebac8207ffd1ef27b25fc"
+  integrity sha512-cyFDKrqc/YdcWFniJhzI42+AzS+gNwmUzOSFcRCQYwySuBBBy/KjuxWLZ/FHEH6Moq1NizMOBWyTcv8O4OZIMg==
+
+import-fresh@^3.0.0, import-fresh@^3.2.1:
+  version "3.3.1"
+  resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.1.tgz#9cecb56503c0ada1f2741dbbd6546e4b13b57ccf"
+  integrity sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==
+  dependencies:
+    parent-module "^1.0.0"
+    resolve-from "^4.0.0"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
+
+inflight@^1.0.4:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
+  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
+  dependencies:
+    once "^1.3.0"
+    wrappy "1"
+
+inherits@2:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
+  integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=
+
+is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==
+
+is-fullwidth-code-point@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz#f116f8064fe90b3f7844a38997c0b75051269f1d"
+  integrity sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==
+
+is-glob@^4.0.0, is-glob@^4.0.1:
+  version "4.0.3"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084"
+  integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==
+  dependencies:
+    is-extglob "^2.1.1"
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+  integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==
+
+js-tokens@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-4.0.0.tgz#19203fb59991df98e3a287050d4647cdeaf32499"
+  integrity sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==
+
+js-yaml@^3.13.1:
+  version "3.14.1"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.14.1.tgz#dae812fdb3825fa306609a8717383c50c36a0537"
+  integrity sha512-okMH7OXXJ7YrN9Ok3/SXrnu4iX9yOk+25nqX4imS2npuvTYDmo/QEZoqwZkYaIDk3jVvBOTOIEgEhaLOynBS9g==
+  dependencies:
+    argparse "^1.0.7"
+    esprima "^4.0.0"
+
+json-buffer@3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/json-buffer/-/json-buffer-3.0.1.tgz#9338802a30d3b6605fbe0613e094008ca8c05a13"
+  integrity sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==
+
+json-schema-traverse@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
+  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
+
+json-schema-traverse@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-1.0.0.tgz#ae7bcb3656ab77a73ba5c49bf654f38e6b6860e2"
+  integrity sha512-NM8/P9n3XjXhIZn1lLhkFaACTOURQXjWhV4BA/RnOv8xvgqtqpAX9IO4mRQxSx1Rlo4tqzeqb0sOlruaOy3dug==
+
+json-stable-stringify-without-jsonify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651"
+  integrity sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==
+
+keyv@^4.5.3:
+  version "4.5.4"
+  resolved "https://registry.yarnpkg.com/keyv/-/keyv-4.5.4.tgz#a879a99e29452f942439f2a405e3af8b31d4de93"
+  integrity sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==
+  dependencies:
+    json-buffer "3.0.1"
+
+levn@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.4.1.tgz#ae4562c007473b932a6200d403268dd2fffc6ade"
+  integrity sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==
+  dependencies:
+    prelude-ls "^1.2.1"
+    type-check "~0.4.0"
+
+lodash.merge@^4.6.2:
+  version "4.6.2"
+  resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.2.tgz#558aa53b43b661e1925a0afdfa36a9a1085fe57a"
+  integrity sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==
+
+lodash.truncate@^4.4.2:
+  version "4.4.2"
+  resolved "https://registry.yarnpkg.com/lodash.truncate/-/lodash.truncate-4.4.2.tgz#5a350da0b1113b837ecfffd5812cbe58d6eae193"
+  integrity sha512-jttmRe7bRse52OsWIMDLaXxWqRAmtIUccAQ3garviCqJjafXOfNMO0yMfNpdD6zbGaTU0P5Nz7e7gAT6cKmJRw==
+
+minimatch@^3.0.4:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
+  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+ms@^2.1.3:
+  version "2.1.3"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
+  integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
+
+natural-compare@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
+  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
+
+once@^1.3.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
+  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
+  dependencies:
+    wrappy "1"
+
+optionator@^0.9.1:
+  version "0.9.4"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.9.4.tgz#7ea1c1a5d91d764fb282139c88fe11e182a3a734"
+  integrity sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==
+  dependencies:
+    deep-is "^0.1.3"
+    fast-levenshtein "^2.0.6"
+    levn "^0.4.1"
+    prelude-ls "^1.2.1"
+    type-check "^0.4.0"
+    word-wrap "^1.2.5"
+
+parent-module@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
+  integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==
+  dependencies:
+    callsites "^3.0.0"
+
+path-is-absolute@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
+  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
+
+path-key@^3.1.0:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-3.1.1.tgz#581f6ade658cbba65a0d3380de7753295054f375"
+  integrity sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==
+
+picocolors@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.1.1.tgz#3d321af3eab939b083c8f929a1d12cda81c26b6b"
+  integrity sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==
+
+prelude-ls@^1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.2.1.tgz#debc6489d7a6e6b0e7611888cec880337d316396"
+  integrity sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==
+
+progress@^2.0.0:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.3.tgz#7e8cf8d8f5b8f239c1bc68beb4eb78567d572ef8"
+  integrity sha512-7PiHtLll5LdnKIMw100I+8xJXR5gW2QwWYkT6iJva0bXitZKa/XMrSbdmg3r2Xnaidz9Qumd0VPaMrZlF9V9sA==
+
+punycode@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
+  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
+
+regexpp@^3.1.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/regexpp/-/regexpp-3.2.0.tgz#0425a2768d8f23bad70ca4b90461fa2f1213e1b2"
+  integrity sha512-pq2bWo9mVD43nbts2wGv17XLiNLya+GklZ8kaDLV2Z08gDCsGpnKn9BFMepvWuHCbyVvY7J5o5+BVvoQbmlJLg==
+
+require-from-string@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/require-from-string/-/require-from-string-2.0.2.tgz#89a7fdd938261267318eafe14f9c32e598c36909"
+  integrity sha512-Xf0nWe6RseziFMu+Ap9biiUbmplq6S9/p+7w7YXP/JBHhrUDDUhwa+vANyubuqfZWTveU//DYVGsDG7RKL/vEw==
+
+resolve-from@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6"
+  integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==
+
+rimraf@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-3.0.2.tgz#f1a5402ba6220ad52cc1282bac1ae3aa49fd061a"
+  integrity sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==
+  dependencies:
+    glob "^7.1.3"
+
+semver@^7.2.1:
+  version "7.7.1"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-7.7.1.tgz#abd5098d82b18c6c81f6074ff2647fd3e7220c9f"
+  integrity sha512-hlq8tAfn0m/61p4BVRcPzIGr6LKiMwo4VM6dGi6pt4qcRkmNzTcWq6eCEjEh+qXjkMDvPlOFFSGwQjoEa6gyMA==
+
+shebang-command@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-2.0.0.tgz#ccd0af4f8835fbdc265b82461aaf0c36663f34ea"
+  integrity sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==
+  dependencies:
+    shebang-regex "^3.0.0"
+
+shebang-regex@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-3.0.0.tgz#ae16f1644d873ecad843b0307b143362d4c42172"
+  integrity sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==
+
+slice-ansi@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-4.0.0.tgz#500e8dd0fd55b05815086255b3195adf2a45fe6b"
+  integrity sha512-qMCMfhY040cVHT43K9BFygqYbUPFZKHOg7K73mtTWJRb8pyP3fzf4Ixd5SzdEJQ6MRUg/WBnOLxghZtKKurENQ==
+  dependencies:
+    ansi-styles "^4.0.0"
+    astral-regex "^2.0.0"
+    is-fullwidth-code-point "^3.0.0"
+
+sprintf-js@~1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
+  integrity sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=
+
+string-width@^4.2.3:
+  version "4.2.3"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-4.2.3.tgz#269c7117d27b05ad2e536830a8ec895ef9c6d010"
+  integrity sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==
+  dependencies:
+    emoji-regex "^8.0.0"
+    is-fullwidth-code-point "^3.0.0"
+    strip-ansi "^6.0.1"
+
+strip-ansi@^6.0.0, strip-ansi@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-6.0.1.tgz#9e26c63d30f53443e9489495b2105d37b67a85d9"
+  integrity sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==
+  dependencies:
+    ansi-regex "^5.0.1"
+
+strip-json-comments@^3.1.0, strip-json-comments@^3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.1.1.tgz#31f1281b3832630434831c310c01cccda8cbe006"
+  integrity sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==
+
+supports-color@^5.3.0:
+  version "5.5.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.5.0.tgz#e2e69a44ac8772f78a1ec0b35b689df6530efc8f"
+  integrity sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==
+  dependencies:
+    has-flag "^3.0.0"
+
+supports-color@^7.1.0:
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da"
+  integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==
+  dependencies:
+    has-flag "^4.0.0"
+
+table@^6.0.9:
+  version "6.9.0"
+  resolved "https://registry.yarnpkg.com/table/-/table-6.9.0.tgz#50040afa6264141c7566b3b81d4d82c47a8668f5"
+  integrity sha512-9kY+CygyYM6j02t5YFHbNz2FN5QmYGv9zAjVp4lCDjlCw7amdckXlEt/bjMhUIfj4ThGRE4gCUH5+yGnNuPo5A==
+  dependencies:
+    ajv "^8.0.1"
+    lodash.truncate "^4.4.2"
+    slice-ansi "^4.0.0"
+    string-width "^4.2.3"
+    strip-ansi "^6.0.1"
+
+text-table@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+  integrity sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==
+
+type-check@^0.4.0, type-check@~0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.4.0.tgz#07b8203bfa7056c0657050e3ccd2c37730bab8f1"
+  integrity sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==
+  dependencies:
+    prelude-ls "^1.2.1"
+
+type-fest@^0.20.2:
+  version "0.20.2"
+  resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.20.2.tgz#1bf207f4b28f91583666cb5fbd327887301cd5f4"
+  integrity sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==
+
+uri-js@^4.2.2:
+  version "4.2.2"
+  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
+  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
+  dependencies:
+    punycode "^2.1.0"
+
+v8-compile-cache@^2.0.3:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/v8-compile-cache/-/v8-compile-cache-2.4.0.tgz#cdada8bec61e15865f05d097c5f4fd30e94dc128"
+  integrity sha512-ocyWc3bAHBB/guyqJQVI5o4BZkPhznPYUG2ea80Gond/BgNWpap8TOmLSeeQG7bnh2KMISxskdADG59j7zruhw==
+
+which@^2.0.1:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/which/-/which-2.0.2.tgz#7c6a8dd0a636a0327e10b59c9286eee93f3f51b1"
+  integrity sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==
+  dependencies:
+    isexe "^2.0.0"
+
+word-wrap@^1.2.5:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.5.tgz#d2c45c6dd4fbce621a66f136cbe328afd0410b34"
+  integrity sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==
+
+wrappy@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
+  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
diff --git a/fixtures/eslint-v8/.eslintrc.json b/fixtures/eslint-v8/.eslintrc.json
new file mode 100644
index 0000000000000..33b2cfaacabcd
--- /dev/null
+++ b/fixtures/eslint-v8/.eslintrc.json
@@ -0,0 +1,14 @@
+{
+  "root": true,
+  "extends": ["plugin:react-hooks/recommended-legacy"],
+  "parserOptions": {
+    "ecmaVersion": 2020,
+    "sourceType": "module",
+    "ecmaFeatures": {
+      "jsx": true
+    }
+  },
+  "rules": {
+    "react-hooks/exhaustive-deps": "error"
+  }
+}
diff --git a/fixtures/eslint-v8/README.md b/fixtures/eslint-v8/README.md
new file mode 100644
index 0000000000000..da220cef5cbdc
--- /dev/null
+++ b/fixtures/eslint-v8/README.md
@@ -0,0 +1,12 @@
+# ESLint v8 Fixture
+
+This fixture allows us to test e2e functionality for `eslint-plugin-react-hooks` with eslint version 8.
+
+Run the following to test.
+
+```sh
+cd fixtures/eslint-v8
+yarn
+yarn build
+yarn lint
+```
diff --git a/fixtures/eslint-v8/build.mjs b/fixtures/eslint-v8/build.mjs
new file mode 100644
index 0000000000000..02a1bbd25e00e
--- /dev/null
+++ b/fixtures/eslint-v8/build.mjs
@@ -0,0 +1,5 @@
+#!/usr/bin/env node
+
+import {exec} from 'node:child_process';
+
+exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
diff --git a/fixtures/eslint-v8/index.js b/fixtures/eslint-v8/index.js
new file mode 100644
index 0000000000000..6d4a7235dd257
--- /dev/null
+++ b/fixtures/eslint-v8/index.js
@@ -0,0 +1,143 @@
+/**
+ * Exhaustive Deps
+ */
+// Valid because dependencies are declared correctly
+function Comment({comment, commentSource}) {
+  const currentUserID = comment.viewer.id;
+  const environment = RelayEnvironment.forUser(currentUserID);
+  const commentID = nullthrows(comment.id);
+  useEffect(() => {
+    const subscription = SubscriptionCounter.subscribeOnce(
+      `StoreSubscription_${commentID}`,
+      () =>
+        StoreSubscription.subscribe(
+          environment,
+          {
+            comment_id: commentID,
+          },
+          currentUserID,
+          commentSource
+        )
+    );
+    return () => subscription.dispose();
+  }, [commentID, commentSource, currentUserID, environment]);
+}
+
+// Valid because no dependencies
+function UseEffectWithNoDependencies() {
+  const local = {};
+  useEffect(() => {
+    console.log(local);
+  });
+}
+function UseEffectWithEmptyDependencies() {
+  useEffect(() => {
+    const local = {};
+    console.log(local);
+  }, []);
+}
+
+// OK because `props` wasn't defined.
+function ComponentWithNoPropsDefined() {
+  useEffect(() => {
+    console.log(props.foo);
+  }, []);
+}
+
+// Valid because props are declared as a dependency
+function ComponentWithPropsDeclaredAsDep({foo}) {
+  useEffect(() => {
+    console.log(foo.length);
+    console.log(foo.slice(0));
+  }, [foo]);
+}
+
+// Valid because individual props are declared as dependencies
+function ComponentWithIndividualPropsDeclaredAsDeps(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    console.log(props.bar);
+  }, [props.bar, props.foo]);
+}
+
+// Invalid because neither props or props.foo are declared as dependencies
+function ComponentWithoutDeclaringPropAsDep(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.notReactiveHook(() => {
+    console.log(props.foo);
+  }, []); // This one isn't a violation
+}
+
+/**
+ * Rules of Hooks
+ */
+// Valid because functions can call functions.
+function normalFunctionWithConditionalFunction() {
+  if (cond) {
+    doSomething();
+  }
+}
+
+// Valid because hooks can call hooks.
+function useHook() {
+  useState();
+}
+const whatever = function useHook() {
+  useState();
+};
+const useHook1 = () => {
+  useState();
+};
+let useHook2 = () => useState();
+useHook2 = () => {
+  useState();
+};
+
+// Invalid because hooks can't be called in conditionals.
+function ComponentWithConditionalHook() {
+  if (cond) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useConditionalHook();
+  }
+}
+
+// Invalid because hooks can't be called in loops.
+function useHookInLoops() {
+  while (a) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook1();
+    if (b) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook2();
+  }
+  while (c) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook3();
+    if (d) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook4();
+  }
+}
diff --git a/fixtures/eslint-v8/package.json b/fixtures/eslint-v8/package.json
new file mode 100644
index 0000000000000..620520ecdbfd4
--- /dev/null
+++ b/fixtures/eslint-v8/package.json
@@ -0,0 +1,12 @@
+{
+  "private": true,
+  "name": "eslint-v8",
+  "dependencies": {
+    "eslint": "^8",
+    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+  },
+  "scripts": {
+    "build": "node build.mjs && yarn",
+    "lint": "eslint index.js --report-unused-disable-directives"
+  }
+}
diff --git a/fixtures/eslint-v8/yarn.lock b/fixtures/eslint-v8/yarn.lock
new file mode 100644
index 0000000000000..88d04029954a4
--- /dev/null
+++ b/fixtures/eslint-v8/yarn.lock
@@ -0,0 +1,676 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@eslint-community/eslint-utils@^4.2.0":
+  version "4.4.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/eslint-utils/-/eslint-utils-4.4.1.tgz#d1145bf2c20132d6400495d6df4bf59362fd9d56"
+  integrity sha512-s3O3waFUrMV8P/XaF/+ZTp1X9XBZW1a4B97ZnjQF2KYWaFD2A8KyFBsrsfSjEmjn3RGWAIuvlneuZm3CUK3jbA==
+  dependencies:
+    eslint-visitor-keys "^3.4.3"
+
+"@eslint-community/regexpp@^4.6.1":
+  version "4.12.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.12.1.tgz#cfc6cffe39df390a3841cde2abccf92eaa7ae0e0"
+  integrity sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==
+
+"@eslint/eslintrc@^2.1.4":
+  version "2.1.4"
+  resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-2.1.4.tgz#388a269f0f25c1b6adc317b5a2c55714894c70ad"
+  integrity sha512-269Z39MS6wVJtsoUl10L60WdkhJVdPG24Q4eZTH3nnF6lpvSShEK3wQjDX9JRWAUPvPh7COouPpU9IrqaZFvtQ==
+  dependencies:
+    ajv "^6.12.4"
+    debug "^4.3.2"
+    espree "^9.6.0"
+    globals "^13.19.0"
+    ignore "^5.2.0"
+    import-fresh "^3.2.1"
+    js-yaml "^4.1.0"
+    minimatch "^3.1.2"
+    strip-json-comments "^3.1.1"
+
+"@eslint/js@8.57.1":
+  version "8.57.1"
+  resolved "https://registry.yarnpkg.com/@eslint/js/-/js-8.57.1.tgz#de633db3ec2ef6a3c89e2f19038063e8a122e2c2"
+  integrity sha512-d9zaMRSTIKDLhctzH12MtXvJKSSUhaHcjV+2Z+GK+EEY7XKpP5yR4x+N3TAcHTcu963nIr+TMcCb4DBCYX1z6Q==
+
+"@humanwhocodes/config-array@^0.13.0":
+  version "0.13.0"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/config-array/-/config-array-0.13.0.tgz#fb907624df3256d04b9aa2df50d7aa97ec648748"
+  integrity sha512-DZLEEqFWQFiyK6h5YIeynKx7JlvCYWL0cImfSRXZ9l4Sg2efkFGTuFf6vzXjK1cq6IYkU+Eg/JizXw+TD2vRNw==
+  dependencies:
+    "@humanwhocodes/object-schema" "^2.0.3"
+    debug "^4.3.1"
+    minimatch "^3.0.5"
+
+"@humanwhocodes/module-importer@^1.0.1":
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz#af5b2691a22b44be847b0ca81641c5fb6ad0172c"
+  integrity sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==
+
+"@humanwhocodes/object-schema@^2.0.3":
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/object-schema/-/object-schema-2.0.3.tgz#4a2868d75d6d6963e423bcf90b7fd1be343409d3"
+  integrity sha512-93zYdMES/c1D69yZiKDBj0V24vqNzB/koF26KPaagAfd3P/4gUlh3Dys5ogAK+Exi9QyzlD8x/08Zt7wIKcDcA==
+
+"@nodelib/fs.scandir@2.1.5":
+  version "2.1.5"
+  resolved "https://registry.yarnpkg.com/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz#7619c2eb21b25483f6d167548b4cfd5a7488c3d5"
+  integrity sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==
+  dependencies:
+    "@nodelib/fs.stat" "2.0.5"
+    run-parallel "^1.1.9"
+
+"@nodelib/fs.stat@2.0.5":
+  version "2.0.5"
+  resolved "https://registry.yarnpkg.com/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz#5bd262af94e9d25bd1e71b05deed44876a222e8b"
+  integrity sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==
+
+"@nodelib/fs.walk@^1.2.8":
+  version "1.2.8"
+  resolved "https://registry.yarnpkg.com/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz#e95737e8bb6746ddedf69c556953494f196fe69a"
+  integrity sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==
+  dependencies:
+    "@nodelib/fs.scandir" "2.1.5"
+    fastq "^1.6.0"
+
+"@ungap/structured-clone@^1.2.0":
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/@ungap/structured-clone/-/structured-clone-1.3.0.tgz#d06bbb384ebcf6c505fde1c3d0ed4ddffe0aaff8"
+  integrity sha512-WmoN8qaIAo7WTYWbAZuG8PYEhn5fkz7dZrqTBZ7dtt//lL2Gwms1IcnQ5yHqjDfX8Ft5j4YzDM23f87zBfDe9g==
+
+acorn-jsx@^5.3.2:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.3.2.tgz#7ed5bb55908b3b2f1bc55c6af1653bada7f07937"
+  integrity sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==
+
+acorn@^8.9.0:
+  version "8.14.0"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-8.14.0.tgz#063e2c70cac5fb4f6467f0b11152e04c682795b0"
+  integrity sha512-cl669nCJTZBsL97OF4kUQm5g5hC2uihk0NxY3WENAC0TYdILVkAyHymAntgxGkl7K+t0cXIrH5siy5S4XkFycA==
+
+ajv@^6.12.4:
+  version "6.12.6"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4"
+  integrity sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==
+  dependencies:
+    fast-deep-equal "^3.1.1"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.4.1"
+    uri-js "^4.2.2"
+
+ansi-regex@^5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-5.0.1.tgz#082cb2c89c9fe8659a311a53bd6a4dc5301db304"
+  integrity sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==
+
+ansi-styles@^4.1.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937"
+  integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==
+  dependencies:
+    color-convert "^2.0.1"
+
+argparse@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-2.0.1.tgz#246f50f3ca78a3240f6c997e8a9bd1eac49e4b38"
+  integrity sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
+
+brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+callsites@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73"
+  integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==
+
+chalk@^4.0.0:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01"
+  integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==
+  dependencies:
+    ansi-styles "^4.1.0"
+    supports-color "^7.1.0"
+
+color-convert@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3"
+  integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==
+  dependencies:
+    color-name "~1.1.4"
+
+color-name@~1.1.4:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2"
+  integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
+
+cross-spawn@^7.0.2:
+  version "7.0.6"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-7.0.6.tgz#8a58fe78f00dcd70c370451759dfbfaf03e8ee9f"
+  integrity sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==
+  dependencies:
+    path-key "^3.1.0"
+    shebang-command "^2.0.0"
+    which "^2.0.1"
+
+debug@^4.3.1, debug@^4.3.2:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
+deep-is@^0.1.3:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.4.tgz#a6f2dce612fadd2ef1f519b73551f17e85199831"
+  integrity sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==
+
+doctrine@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-3.0.0.tgz#addebead72a6574db783639dc87a121773973961"
+  integrity sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==
+  dependencies:
+    esutils "^2.0.2"
+
+escape-string-regexp@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
+  integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
+
+"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+  version "0.0.0"
+  uid ""
+
+eslint-scope@^7.2.2:
+  version "7.2.2"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-7.2.2.tgz#deb4f92563390f32006894af62a22dba1c46423f"
+  integrity sha512-dOt21O7lTMhDM+X9mB4GX+DZrZtCUJPL/wlcTqxyrx5IvO0IYtILdtrQGQp+8n5S0gwSVmOf9NQrjMOgfQZlIg==
+  dependencies:
+    esrecurse "^4.3.0"
+    estraverse "^5.2.0"
+
+eslint-visitor-keys@^3.4.1, eslint-visitor-keys@^3.4.3:
+  version "3.4.3"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz#0cd72fe8550e3c2eae156a96a4dddcd1c8ac5800"
+  integrity sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==
+
+eslint@^8:
+  version "8.57.1"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-8.57.1.tgz#7df109654aba7e3bbe5c8eae533c5e461d3c6ca9"
+  integrity sha512-ypowyDxpVSYpkXr9WPv2PAZCtNip1Mv5KTW0SCurXv/9iOpcrH9PaqUElksqEB6pChqHGDRCFTyrZlGhnLNGiA==
+  dependencies:
+    "@eslint-community/eslint-utils" "^4.2.0"
+    "@eslint-community/regexpp" "^4.6.1"
+    "@eslint/eslintrc" "^2.1.4"
+    "@eslint/js" "8.57.1"
+    "@humanwhocodes/config-array" "^0.13.0"
+    "@humanwhocodes/module-importer" "^1.0.1"
+    "@nodelib/fs.walk" "^1.2.8"
+    "@ungap/structured-clone" "^1.2.0"
+    ajv "^6.12.4"
+    chalk "^4.0.0"
+    cross-spawn "^7.0.2"
+    debug "^4.3.2"
+    doctrine "^3.0.0"
+    escape-string-regexp "^4.0.0"
+    eslint-scope "^7.2.2"
+    eslint-visitor-keys "^3.4.3"
+    espree "^9.6.1"
+    esquery "^1.4.2"
+    esutils "^2.0.2"
+    fast-deep-equal "^3.1.3"
+    file-entry-cache "^6.0.1"
+    find-up "^5.0.0"
+    glob-parent "^6.0.2"
+    globals "^13.19.0"
+    graphemer "^1.4.0"
+    ignore "^5.2.0"
+    imurmurhash "^0.1.4"
+    is-glob "^4.0.0"
+    is-path-inside "^3.0.3"
+    js-yaml "^4.1.0"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    levn "^0.4.1"
+    lodash.merge "^4.6.2"
+    minimatch "^3.1.2"
+    natural-compare "^1.4.0"
+    optionator "^0.9.3"
+    strip-ansi "^6.0.1"
+    text-table "^0.2.0"
+
+espree@^9.6.0, espree@^9.6.1:
+  version "9.6.1"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-9.6.1.tgz#a2a17b8e434690a5432f2f8018ce71d331a48c6f"
+  integrity sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==
+  dependencies:
+    acorn "^8.9.0"
+    acorn-jsx "^5.3.2"
+    eslint-visitor-keys "^3.4.1"
+
+esquery@^1.4.2:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.6.0.tgz#91419234f804d852a82dceec3e16cdc22cf9dae7"
+  integrity sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==
+  dependencies:
+    estraverse "^5.1.0"
+
+esrecurse@^4.3.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921"
+  integrity sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==
+  dependencies:
+    estraverse "^5.2.0"
+
+estraverse@^5.1.0, estraverse@^5.2.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-5.3.0.tgz#2eea5290702f26ab8fe5370370ff86c965d21123"
+  integrity sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
+
+fast-deep-equal@^3.1.1, fast-deep-equal@^3.1.3:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz#3a7d56b559d6cbc3eb512325244e619a65c6c525"
+  integrity sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
+
+fast-levenshtein@^2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
+  integrity sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==
+
+fastq@^1.6.0:
+  version "1.19.0"
+  resolved "https://registry.yarnpkg.com/fastq/-/fastq-1.19.0.tgz#a82c6b7c2bb4e44766d865f07997785fecfdcb89"
+  integrity sha512-7SFSRCNjBQIZH/xZR3iy5iQYR8aGBE0h3VG6/cwlbrpdciNYBMotQav8c1XI3HjHH+NikUpP53nPdlZSdWmFzA==
+  dependencies:
+    reusify "^1.0.4"
+
+file-entry-cache@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-6.0.1.tgz#211b2dd9659cb0394b073e7323ac3c933d522027"
+  integrity sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==
+  dependencies:
+    flat-cache "^3.0.4"
+
+find-up@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/find-up/-/find-up-5.0.0.tgz#4c92819ecb7083561e4f4a240a86be5198f536fc"
+  integrity sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==
+  dependencies:
+    locate-path "^6.0.0"
+    path-exists "^4.0.0"
+
+flat-cache@^3.0.4:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-3.2.0.tgz#2c0c2d5040c99b1632771a9d105725c0115363ee"
+  integrity sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==
+  dependencies:
+    flatted "^3.2.9"
+    keyv "^4.5.3"
+    rimraf "^3.0.2"
+
+flatted@^3.2.9:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.3.2.tgz#adba1448a9841bec72b42c532ea23dbbedef1a27"
+  integrity sha512-AiwGJM8YcNOaobumgtng+6NHuOqC3A7MixFeDafM3X9cIUM+xUXoS5Vfgf+OihAYe20fxqNM9yPBXJzRtZ/4eA==
+
+fs.realpath@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
+  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
+
+glob-parent@^6.0.2:
+  version "6.0.2"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-6.0.2.tgz#6d237d99083950c79290f24c7642a3de9a28f9e3"
+  integrity sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==
+  dependencies:
+    is-glob "^4.0.3"
+
+glob@^7.1.3:
+  version "7.1.3"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.3.tgz#3960832d3f1574108342dafd3a67b332c0969df1"
+  integrity sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+globals@^13.19.0:
+  version "13.24.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-13.24.0.tgz#8432a19d78ce0c1e833949c36adb345400bb1171"
+  integrity sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==
+  dependencies:
+    type-fest "^0.20.2"
+
+graphemer@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/graphemer/-/graphemer-1.4.0.tgz#fb2f1d55e0e3a1849aeffc90c4fa0dd53a0e66c6"
+  integrity sha512-EtKwoO6kxCL9WO5xipiHTZlSzBm7WLT627TqC/uVRd0HKmq8NXyebnNYxDoBi7wt8eTWrUrKXCOVaFq9x1kgag==
+
+has-flag@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b"
+  integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==
+
+ignore@^5.2.0:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.3.2.tgz#3cd40e729f3643fd87cb04e50bf0eb722bc596f5"
+  integrity sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==
+
+import-fresh@^3.2.1:
+  version "3.3.1"
+  resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.1.tgz#9cecb56503c0ada1f2741dbbd6546e4b13b57ccf"
+  integrity sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==
+  dependencies:
+    parent-module "^1.0.0"
+    resolve-from "^4.0.0"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
+
+inflight@^1.0.4:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
+  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
+  dependencies:
+    once "^1.3.0"
+    wrappy "1"
+
+inherits@2:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
+  integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=
+
+is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==
+
+is-glob@^4.0.0, is-glob@^4.0.3:
+  version "4.0.3"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084"
+  integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==
+  dependencies:
+    is-extglob "^2.1.1"
+
+is-path-inside@^3.0.3:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-3.0.3.tgz#d231362e53a07ff2b0e0ea7fed049161ffd16283"
+  integrity sha512-Fd4gABb+ycGAmKou8eMftCupSir5lRxqf4aD/vd0cD2qc4HL07OjCeuHMr8Ro4CoMaeCKDB0/ECBOVWjTwUvPQ==
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+  integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==
+
+js-yaml@^4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-4.1.0.tgz#c1fb65f8f5017901cdd2c951864ba18458a10602"
+  integrity sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==
+  dependencies:
+    argparse "^2.0.1"
+
+json-buffer@3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/json-buffer/-/json-buffer-3.0.1.tgz#9338802a30d3b6605fbe0613e094008ca8c05a13"
+  integrity sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==
+
+json-schema-traverse@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
+  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
+
+json-stable-stringify-without-jsonify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651"
+  integrity sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==
+
+keyv@^4.5.3:
+  version "4.5.4"
+  resolved "https://registry.yarnpkg.com/keyv/-/keyv-4.5.4.tgz#a879a99e29452f942439f2a405e3af8b31d4de93"
+  integrity sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==
+  dependencies:
+    json-buffer "3.0.1"
+
+levn@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.4.1.tgz#ae4562c007473b932a6200d403268dd2fffc6ade"
+  integrity sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==
+  dependencies:
+    prelude-ls "^1.2.1"
+    type-check "~0.4.0"
+
+locate-path@^6.0.0:
+  version "6.0.0"
+  resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-6.0.0.tgz#55321eb309febbc59c4801d931a72452a681d286"
+  integrity sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==
+  dependencies:
+    p-locate "^5.0.0"
+
+lodash.merge@^4.6.2:
+  version "4.6.2"
+  resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.2.tgz#558aa53b43b661e1925a0afdfa36a9a1085fe57a"
+  integrity sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==
+
+minimatch@^3.0.4:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
+  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+minimatch@^3.0.5, minimatch@^3.1.2:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.1.2.tgz#19cd194bfd3e428f049a70817c038d89ab4be35b"
+  integrity sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+ms@^2.1.3:
+  version "2.1.3"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
+  integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
+
+natural-compare@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
+  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
+
+once@^1.3.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
+  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
+  dependencies:
+    wrappy "1"
+
+optionator@^0.9.3:
+  version "0.9.4"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.9.4.tgz#7ea1c1a5d91d764fb282139c88fe11e182a3a734"
+  integrity sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==
+  dependencies:
+    deep-is "^0.1.3"
+    fast-levenshtein "^2.0.6"
+    levn "^0.4.1"
+    prelude-ls "^1.2.1"
+    type-check "^0.4.0"
+    word-wrap "^1.2.5"
+
+p-limit@^3.0.2:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-3.1.0.tgz#e1daccbe78d0d1388ca18c64fea38e3e57e3706b"
+  integrity sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==
+  dependencies:
+    yocto-queue "^0.1.0"
+
+p-locate@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-5.0.0.tgz#83c8315c6785005e3bd021839411c9e110e6d834"
+  integrity sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==
+  dependencies:
+    p-limit "^3.0.2"
+
+parent-module@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
+  integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==
+  dependencies:
+    callsites "^3.0.0"
+
+path-exists@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-4.0.0.tgz#513bdbe2d3b95d7762e8c1137efa195c6c61b5b3"
+  integrity sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==
+
+path-is-absolute@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
+  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
+
+path-key@^3.1.0:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-3.1.1.tgz#581f6ade658cbba65a0d3380de7753295054f375"
+  integrity sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==
+
+prelude-ls@^1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.2.1.tgz#debc6489d7a6e6b0e7611888cec880337d316396"
+  integrity sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==
+
+punycode@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
+  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
+
+queue-microtask@^1.2.2:
+  version "1.2.3"
+  resolved "https://registry.yarnpkg.com/queue-microtask/-/queue-microtask-1.2.3.tgz#4929228bbc724dfac43e0efb058caf7b6cfb6243"
+  integrity sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==
+
+resolve-from@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6"
+  integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==
+
+reusify@^1.0.4:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/reusify/-/reusify-1.0.4.tgz#90da382b1e126efc02146e90845a88db12925d76"
+  integrity sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==
+
+rimraf@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-3.0.2.tgz#f1a5402ba6220ad52cc1282bac1ae3aa49fd061a"
+  integrity sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==
+  dependencies:
+    glob "^7.1.3"
+
+run-parallel@^1.1.9:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/run-parallel/-/run-parallel-1.2.0.tgz#66d1368da7bdf921eb9d95bd1a9229e7f21a43ee"
+  integrity sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==
+  dependencies:
+    queue-microtask "^1.2.2"
+
+shebang-command@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-2.0.0.tgz#ccd0af4f8835fbdc265b82461aaf0c36663f34ea"
+  integrity sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==
+  dependencies:
+    shebang-regex "^3.0.0"
+
+shebang-regex@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-3.0.0.tgz#ae16f1644d873ecad843b0307b143362d4c42172"
+  integrity sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==
+
+strip-ansi@^6.0.1:
+  version "6.0.1"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-6.0.1.tgz#9e26c63d30f53443e9489495b2105d37b67a85d9"
+  integrity sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==
+  dependencies:
+    ansi-regex "^5.0.1"
+
+strip-json-comments@^3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.1.1.tgz#31f1281b3832630434831c310c01cccda8cbe006"
+  integrity sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==
+
+supports-color@^7.1.0:
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da"
+  integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==
+  dependencies:
+    has-flag "^4.0.0"
+
+text-table@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+  integrity sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==
+
+type-check@^0.4.0, type-check@~0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.4.0.tgz#07b8203bfa7056c0657050e3ccd2c37730bab8f1"
+  integrity sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==
+  dependencies:
+    prelude-ls "^1.2.1"
+
+type-fest@^0.20.2:
+  version "0.20.2"
+  resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.20.2.tgz#1bf207f4b28f91583666cb5fbd327887301cd5f4"
+  integrity sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==
+
+uri-js@^4.2.2:
+  version "4.2.2"
+  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
+  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
+  dependencies:
+    punycode "^2.1.0"
+
+which@^2.0.1:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/which/-/which-2.0.2.tgz#7c6a8dd0a636a0327e10b59c9286eee93f3f51b1"
+  integrity sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==
+  dependencies:
+    isexe "^2.0.0"
+
+word-wrap@^1.2.5:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.5.tgz#d2c45c6dd4fbce621a66f136cbe328afd0410b34"
+  integrity sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==
+
+wrappy@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
+  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
+
+yocto-queue@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/yocto-queue/-/yocto-queue-0.1.0.tgz#0294eb3dee05028d31ee1a5fa2c556a6aaf10a1b"
+  integrity sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==
diff --git a/fixtures/eslint-v9/README.md b/fixtures/eslint-v9/README.md
new file mode 100644
index 0000000000000..3ea521cfa8909
--- /dev/null
+++ b/fixtures/eslint-v9/README.md
@@ -0,0 +1,12 @@
+# ESLint v9 Fixture
+
+This fixture allows us to test e2e functionality for `eslint-plugin-react-hooks` with eslint version 9.
+
+Run the following to test.
+
+```sh
+cd fixtures/eslint-v9
+yarn
+yarn build
+yarn lint
+```
diff --git a/fixtures/eslint-v9/build.mjs b/fixtures/eslint-v9/build.mjs
new file mode 100644
index 0000000000000..02a1bbd25e00e
--- /dev/null
+++ b/fixtures/eslint-v9/build.mjs
@@ -0,0 +1,5 @@
+#!/usr/bin/env node
+
+import {exec} from 'node:child_process';
+
+exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
diff --git a/fixtures/eslint-v9/eslint.config.mjs b/fixtures/eslint-v9/eslint.config.mjs
new file mode 100644
index 0000000000000..ffc8375265c2b
--- /dev/null
+++ b/fixtures/eslint-v9/eslint.config.mjs
@@ -0,0 +1,21 @@
+import * as reactHooks from 'eslint-plugin-react-hooks';
+
+export default [
+  {
+    languageOptions: {
+      ecmaVersion: 'latest',
+      sourceType: 'module',
+      parserOptions: {
+        ecmaFeatures: {
+          jsx: true,
+        },
+      },
+    },
+  },
+  reactHooks.configs['recommended-latest'],
+  {
+    rules: {
+      'react-hooks/exhaustive-deps': 'error',
+    },
+  },
+];
diff --git a/fixtures/eslint-v9/index.js b/fixtures/eslint-v9/index.js
new file mode 100644
index 0000000000000..6d4a7235dd257
--- /dev/null
+++ b/fixtures/eslint-v9/index.js
@@ -0,0 +1,143 @@
+/**
+ * Exhaustive Deps
+ */
+// Valid because dependencies are declared correctly
+function Comment({comment, commentSource}) {
+  const currentUserID = comment.viewer.id;
+  const environment = RelayEnvironment.forUser(currentUserID);
+  const commentID = nullthrows(comment.id);
+  useEffect(() => {
+    const subscription = SubscriptionCounter.subscribeOnce(
+      `StoreSubscription_${commentID}`,
+      () =>
+        StoreSubscription.subscribe(
+          environment,
+          {
+            comment_id: commentID,
+          },
+          currentUserID,
+          commentSource
+        )
+    );
+    return () => subscription.dispose();
+  }, [commentID, commentSource, currentUserID, environment]);
+}
+
+// Valid because no dependencies
+function UseEffectWithNoDependencies() {
+  const local = {};
+  useEffect(() => {
+    console.log(local);
+  });
+}
+function UseEffectWithEmptyDependencies() {
+  useEffect(() => {
+    const local = {};
+    console.log(local);
+  }, []);
+}
+
+// OK because `props` wasn't defined.
+function ComponentWithNoPropsDefined() {
+  useEffect(() => {
+    console.log(props.foo);
+  }, []);
+}
+
+// Valid because props are declared as a dependency
+function ComponentWithPropsDeclaredAsDep({foo}) {
+  useEffect(() => {
+    console.log(foo.length);
+    console.log(foo.slice(0));
+  }, [foo]);
+}
+
+// Valid because individual props are declared as dependencies
+function ComponentWithIndividualPropsDeclaredAsDeps(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    console.log(props.bar);
+  }, [props.bar, props.foo]);
+}
+
+// Invalid because neither props or props.foo are declared as dependencies
+function ComponentWithoutDeclaringPropAsDep(props) {
+  useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useEffect(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useCallback(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.useMemo(() => {
+    console.log(props.foo);
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+  React.notReactiveHook(() => {
+    console.log(props.foo);
+  }, []); // This one isn't a violation
+}
+
+/**
+ * Rules of Hooks
+ */
+// Valid because functions can call functions.
+function normalFunctionWithConditionalFunction() {
+  if (cond) {
+    doSomething();
+  }
+}
+
+// Valid because hooks can call hooks.
+function useHook() {
+  useState();
+}
+const whatever = function useHook() {
+  useState();
+};
+const useHook1 = () => {
+  useState();
+};
+let useHook2 = () => useState();
+useHook2 = () => {
+  useState();
+};
+
+// Invalid because hooks can't be called in conditionals.
+function ComponentWithConditionalHook() {
+  if (cond) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useConditionalHook();
+  }
+}
+
+// Invalid because hooks can't be called in loops.
+function useHookInLoops() {
+  while (a) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook1();
+    if (b) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook2();
+  }
+  while (c) {
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook3();
+    if (d) return;
+    // eslint-disable-next-line react-hooks/rules-of-hooks
+    useHook4();
+  }
+}
diff --git a/fixtures/eslint-v9/package.json b/fixtures/eslint-v9/package.json
new file mode 100644
index 0000000000000..e8ae91a0613e1
--- /dev/null
+++ b/fixtures/eslint-v9/package.json
@@ -0,0 +1,12 @@
+{
+  "private": true,
+  "name": "eslint-v9",
+  "dependencies": {
+    "eslint": "^9",
+    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+  },
+  "scripts": {
+    "build": "node build.mjs && yarn",
+    "lint": "eslint index.js --report-unused-disable-directives"
+  }
+}
diff --git a/fixtures/eslint-v9/yarn.lock b/fixtures/eslint-v9/yarn.lock
new file mode 100644
index 0000000000000..5a1a246827f6f
--- /dev/null
+++ b/fixtures/eslint-v9/yarn.lock
@@ -0,0 +1,579 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@eslint-community/eslint-utils@^4.2.0":
+  version "4.4.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/eslint-utils/-/eslint-utils-4.4.1.tgz#d1145bf2c20132d6400495d6df4bf59362fd9d56"
+  integrity sha512-s3O3waFUrMV8P/XaF/+ZTp1X9XBZW1a4B97ZnjQF2KYWaFD2A8KyFBsrsfSjEmjn3RGWAIuvlneuZm3CUK3jbA==
+  dependencies:
+    eslint-visitor-keys "^3.4.3"
+
+"@eslint-community/regexpp@^4.12.1":
+  version "4.12.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.12.1.tgz#cfc6cffe39df390a3841cde2abccf92eaa7ae0e0"
+  integrity sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==
+
+"@eslint/config-array@^0.19.0":
+  version "0.19.2"
+  resolved "https://registry.yarnpkg.com/@eslint/config-array/-/config-array-0.19.2.tgz#3060b809e111abfc97adb0bb1172778b90cb46aa"
+  integrity sha512-GNKqxfHG2ySmJOBSHg7LxeUx4xpuCoFjacmlCoYWEbaPXLwvfIjixRI12xCQZeULksQb23uiA8F40w5TojpV7w==
+  dependencies:
+    "@eslint/object-schema" "^2.1.6"
+    debug "^4.3.1"
+    minimatch "^3.1.2"
+
+"@eslint/core@^0.10.0":
+  version "0.10.0"
+  resolved "https://registry.yarnpkg.com/@eslint/core/-/core-0.10.0.tgz#23727063c21b335f752dbb3a16450f6f9cbc9091"
+  integrity sha512-gFHJ+xBOo4G3WRlR1e/3G8A6/KZAH6zcE/hkLRCZTi/B9avAG365QhFA8uOGzTMqgTghpn7/fSnscW++dpMSAw==
+  dependencies:
+    "@types/json-schema" "^7.0.15"
+
+"@eslint/core@^0.11.0":
+  version "0.11.0"
+  resolved "https://registry.yarnpkg.com/@eslint/core/-/core-0.11.0.tgz#7a9226e850922e42cbd2ba71361eacbe74352a12"
+  integrity sha512-DWUB2pksgNEb6Bz2fggIy1wh6fGgZP4Xyy/Mt0QZPiloKKXerbqq9D3SBQTlCRYOrcRPu4vuz+CGjwdfqxnoWA==
+  dependencies:
+    "@types/json-schema" "^7.0.15"
+
+"@eslint/eslintrc@^3.2.0":
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-3.2.0.tgz#57470ac4e2e283a6bf76044d63281196e370542c"
+  integrity sha512-grOjVNN8P3hjJn/eIETF1wwd12DdnwFDoyceUJLYYdkpbwq3nLi+4fqrTAONx7XDALqlL220wC/RHSC/QTI/0w==
+  dependencies:
+    ajv "^6.12.4"
+    debug "^4.3.2"
+    espree "^10.0.1"
+    globals "^14.0.0"
+    ignore "^5.2.0"
+    import-fresh "^3.2.1"
+    js-yaml "^4.1.0"
+    minimatch "^3.1.2"
+    strip-json-comments "^3.1.1"
+
+"@eslint/js@9.20.0":
+  version "9.20.0"
+  resolved "https://registry.yarnpkg.com/@eslint/js/-/js-9.20.0.tgz#7421bcbe74889fcd65d1be59f00130c289856eb4"
+  integrity sha512-iZA07H9io9Wn836aVTytRaNqh00Sad+EamwOVJT12GTLw1VGMFV/4JaME+JjLtr9fiGaoWgYnS54wrfWsSs4oQ==
+
+"@eslint/object-schema@^2.1.6":
+  version "2.1.6"
+  resolved "https://registry.yarnpkg.com/@eslint/object-schema/-/object-schema-2.1.6.tgz#58369ab5b5b3ca117880c0f6c0b0f32f6950f24f"
+  integrity sha512-RBMg5FRL0I0gs51M/guSAj5/e14VQ4tpZnQNWwuDT66P14I43ItmPfIZRhO9fUVIPOAQXU47atlywZ/czoqFPA==
+
+"@eslint/plugin-kit@^0.2.5":
+  version "0.2.5"
+  resolved "https://registry.yarnpkg.com/@eslint/plugin-kit/-/plugin-kit-0.2.5.tgz#ee07372035539e7847ef834e3f5e7b79f09e3a81"
+  integrity sha512-lB05FkqEdUg2AA0xEbUz0SnkXT1LcCTa438W4IWTUh4hdOnVbQyOJ81OrDXsJk/LSiJHubgGEFoR5EHq1NsH1A==
+  dependencies:
+    "@eslint/core" "^0.10.0"
+    levn "^0.4.1"
+
+"@humanfs/core@^0.19.1":
+  version "0.19.1"
+  resolved "https://registry.yarnpkg.com/@humanfs/core/-/core-0.19.1.tgz#17c55ca7d426733fe3c561906b8173c336b40a77"
+  integrity sha512-5DyQ4+1JEUzejeK1JGICcideyfUbGixgS9jNgex5nqkW+cY7WZhxBigmieN5Qnw9ZosSNVC9KQKyb+GUaGyKUA==
+
+"@humanfs/node@^0.16.6":
+  version "0.16.6"
+  resolved "https://registry.yarnpkg.com/@humanfs/node/-/node-0.16.6.tgz#ee2a10eaabd1131987bf0488fd9b820174cd765e"
+  integrity sha512-YuI2ZHQL78Q5HbhDiBA1X4LmYdXCKCMQIfw0pw7piHJwyREFebJUvrQN4cMssyES6x+vfUbx1CIpaQUKYdQZOw==
+  dependencies:
+    "@humanfs/core" "^0.19.1"
+    "@humanwhocodes/retry" "^0.3.0"
+
+"@humanwhocodes/module-importer@^1.0.1":
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz#af5b2691a22b44be847b0ca81641c5fb6ad0172c"
+  integrity sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==
+
+"@humanwhocodes/retry@^0.3.0":
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/retry/-/retry-0.3.1.tgz#c72a5c76a9fbaf3488e231b13dc52c0da7bab42a"
+  integrity sha512-JBxkERygn7Bv/GbN5Rv8Ul6LVknS+5Bp6RgDC/O8gEBU/yeH5Ui5C/OlWrTb6qct7LjjfT6Re2NxB0ln0yYybA==
+
+"@humanwhocodes/retry@^0.4.1":
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/@humanwhocodes/retry/-/retry-0.4.1.tgz#9a96ce501bc62df46c4031fbd970e3cc6b10f07b"
+  integrity sha512-c7hNEllBlenFTHBky65mhq8WD2kbN9Q6gk0bTk8lSBvc554jpXSkST1iePudpt7+A/AQvuHs9EMqjHDXMY1lrA==
+
+"@types/estree@^1.0.6":
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.6.tgz#628effeeae2064a1b4e79f78e81d87b7e5fc7b50"
+  integrity sha512-AYnb1nQyY49te+VRAVgmzfcgjYS91mY5P0TKUDCLEM+gNnA+3T6rWITXRLYCpahpqSQbN5cE+gHpnPyXjHWxcw==
+
+"@types/json-schema@^7.0.15":
+  version "7.0.15"
+  resolved "https://registry.yarnpkg.com/@types/json-schema/-/json-schema-7.0.15.tgz#596a1747233694d50f6ad8a7869fcb6f56cf5841"
+  integrity sha512-5+fP8P8MFNC+AyZCDxrB2pkZFPGzqQWUzpSeuuVLvm8VMcorNYavBqoFcxK8bQz4Qsbn4oUEEem4wDLfcysGHA==
+
+acorn-jsx@^5.3.2:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.3.2.tgz#7ed5bb55908b3b2f1bc55c6af1653bada7f07937"
+  integrity sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==
+
+acorn@^8.14.0:
+  version "8.14.0"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-8.14.0.tgz#063e2c70cac5fb4f6467f0b11152e04c682795b0"
+  integrity sha512-cl669nCJTZBsL97OF4kUQm5g5hC2uihk0NxY3WENAC0TYdILVkAyHymAntgxGkl7K+t0cXIrH5siy5S4XkFycA==
+
+ajv@^6.12.4:
+  version "6.12.6"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4"
+  integrity sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==
+  dependencies:
+    fast-deep-equal "^3.1.1"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.4.1"
+    uri-js "^4.2.2"
+
+ansi-styles@^4.1.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937"
+  integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==
+  dependencies:
+    color-convert "^2.0.1"
+
+argparse@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-2.0.1.tgz#246f50f3ca78a3240f6c997e8a9bd1eac49e4b38"
+  integrity sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
+
+brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+callsites@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73"
+  integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==
+
+chalk@^4.0.0:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01"
+  integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==
+  dependencies:
+    ansi-styles "^4.1.0"
+    supports-color "^7.1.0"
+
+color-convert@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3"
+  integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==
+  dependencies:
+    color-name "~1.1.4"
+
+color-name@~1.1.4:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2"
+  integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
+
+cross-spawn@^7.0.6:
+  version "7.0.6"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-7.0.6.tgz#8a58fe78f00dcd70c370451759dfbfaf03e8ee9f"
+  integrity sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==
+  dependencies:
+    path-key "^3.1.0"
+    shebang-command "^2.0.0"
+    which "^2.0.1"
+
+debug@^4.3.1, debug@^4.3.2:
+  version "4.4.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
+  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
+  dependencies:
+    ms "^2.1.3"
+
+deep-is@^0.1.3:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.4.tgz#a6f2dce612fadd2ef1f519b73551f17e85199831"
+  integrity sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==
+
+escape-string-regexp@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
+  integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
+
+"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+  version "0.0.0"
+  uid ""
+
+eslint-scope@^8.2.0:
+  version "8.2.0"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-8.2.0.tgz#377aa6f1cb5dc7592cfd0b7f892fd0cf352ce442"
+  integrity sha512-PHlWUfG6lvPc3yvP5A4PNyBL1W8fkDUccmI21JUu/+GKZBoH/W5u6usENXUrWFRsyoW5ACUjFGgAFQp5gUlb/A==
+  dependencies:
+    esrecurse "^4.3.0"
+    estraverse "^5.2.0"
+
+eslint-visitor-keys@^3.4.3:
+  version "3.4.3"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz#0cd72fe8550e3c2eae156a96a4dddcd1c8ac5800"
+  integrity sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==
+
+eslint-visitor-keys@^4.2.0:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-4.2.0.tgz#687bacb2af884fcdda8a6e7d65c606f46a14cd45"
+  integrity sha512-UyLnSehNt62FFhSwjZlHmeokpRK59rcz29j+F1/aDgbkbRTk7wIc9XzdoasMUbRNKDM0qQt/+BJ4BrpFeABemw==
+
+eslint@^9:
+  version "9.20.1"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-9.20.1.tgz#923924c078f5226832449bac86662dd7e53c91d6"
+  integrity sha512-m1mM33o6dBUjxl2qb6wv6nGNwCAsns1eKtaQ4l/NPHeTvhiUPbtdfMyktxN4B3fgHIgsYh1VT3V9txblpQHq+g==
+  dependencies:
+    "@eslint-community/eslint-utils" "^4.2.0"
+    "@eslint-community/regexpp" "^4.12.1"
+    "@eslint/config-array" "^0.19.0"
+    "@eslint/core" "^0.11.0"
+    "@eslint/eslintrc" "^3.2.0"
+    "@eslint/js" "9.20.0"
+    "@eslint/plugin-kit" "^0.2.5"
+    "@humanfs/node" "^0.16.6"
+    "@humanwhocodes/module-importer" "^1.0.1"
+    "@humanwhocodes/retry" "^0.4.1"
+    "@types/estree" "^1.0.6"
+    "@types/json-schema" "^7.0.15"
+    ajv "^6.12.4"
+    chalk "^4.0.0"
+    cross-spawn "^7.0.6"
+    debug "^4.3.2"
+    escape-string-regexp "^4.0.0"
+    eslint-scope "^8.2.0"
+    eslint-visitor-keys "^4.2.0"
+    espree "^10.3.0"
+    esquery "^1.5.0"
+    esutils "^2.0.2"
+    fast-deep-equal "^3.1.3"
+    file-entry-cache "^8.0.0"
+    find-up "^5.0.0"
+    glob-parent "^6.0.2"
+    ignore "^5.2.0"
+    imurmurhash "^0.1.4"
+    is-glob "^4.0.0"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    lodash.merge "^4.6.2"
+    minimatch "^3.1.2"
+    natural-compare "^1.4.0"
+    optionator "^0.9.3"
+
+espree@^10.0.1, espree@^10.3.0:
+  version "10.3.0"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-10.3.0.tgz#29267cf5b0cb98735b65e64ba07e0ed49d1eed8a"
+  integrity sha512-0QYC8b24HWY8zjRnDTL6RiHfDbAWn63qb4LMj1Z4b076A4une81+z03Kg7l7mn/48PUTqoLptSXez8oknU8Clg==
+  dependencies:
+    acorn "^8.14.0"
+    acorn-jsx "^5.3.2"
+    eslint-visitor-keys "^4.2.0"
+
+esquery@^1.5.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.6.0.tgz#91419234f804d852a82dceec3e16cdc22cf9dae7"
+  integrity sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==
+  dependencies:
+    estraverse "^5.1.0"
+
+esrecurse@^4.3.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921"
+  integrity sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==
+  dependencies:
+    estraverse "^5.2.0"
+
+estraverse@^5.1.0, estraverse@^5.2.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-5.3.0.tgz#2eea5290702f26ab8fe5370370ff86c965d21123"
+  integrity sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
+
+fast-deep-equal@^3.1.1, fast-deep-equal@^3.1.3:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz#3a7d56b559d6cbc3eb512325244e619a65c6c525"
+  integrity sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
+
+fast-levenshtein@^2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
+  integrity sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==
+
+file-entry-cache@^8.0.0:
+  version "8.0.0"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-8.0.0.tgz#7787bddcf1131bffb92636c69457bbc0edd6d81f"
+  integrity sha512-XXTUwCvisa5oacNGRP9SfNtYBNAMi+RPwBFmblZEF7N7swHYQS6/Zfk7SRwx4D5j3CH211YNRco1DEMNVfZCnQ==
+  dependencies:
+    flat-cache "^4.0.0"
+
+find-up@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/find-up/-/find-up-5.0.0.tgz#4c92819ecb7083561e4f4a240a86be5198f536fc"
+  integrity sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==
+  dependencies:
+    locate-path "^6.0.0"
+    path-exists "^4.0.0"
+
+flat-cache@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-4.0.1.tgz#0ece39fcb14ee012f4b0410bd33dd9c1f011127c"
+  integrity sha512-f7ccFPK3SXFHpx15UIGyRJ/FJQctuKZ0zVuN3frBo4HnK3cay9VEW0R6yPYFHC0AgqhukPzKjq22t5DmAyqGyw==
+  dependencies:
+    flatted "^3.2.9"
+    keyv "^4.5.4"
+
+flatted@^3.2.9:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.3.2.tgz#adba1448a9841bec72b42c532ea23dbbedef1a27"
+  integrity sha512-AiwGJM8YcNOaobumgtng+6NHuOqC3A7MixFeDafM3X9cIUM+xUXoS5Vfgf+OihAYe20fxqNM9yPBXJzRtZ/4eA==
+
+glob-parent@^6.0.2:
+  version "6.0.2"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-6.0.2.tgz#6d237d99083950c79290f24c7642a3de9a28f9e3"
+  integrity sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==
+  dependencies:
+    is-glob "^4.0.3"
+
+globals@^14.0.0:
+  version "14.0.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-14.0.0.tgz#898d7413c29babcf6bafe56fcadded858ada724e"
+  integrity sha512-oahGvuMGQlPw/ivIYBjVSrWAfWLBeku5tpPE2fOPLi+WHffIWbuh2tCjhyQhTBPMf5E9jDEH4FOmTYgYwbKwtQ==
+
+has-flag@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b"
+  integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==
+
+ignore@^5.2.0:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.3.2.tgz#3cd40e729f3643fd87cb04e50bf0eb722bc596f5"
+  integrity sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==
+
+import-fresh@^3.2.1:
+  version "3.3.1"
+  resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.1.tgz#9cecb56503c0ada1f2741dbbd6546e4b13b57ccf"
+  integrity sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==
+  dependencies:
+    parent-module "^1.0.0"
+    resolve-from "^4.0.0"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
+
+is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==
+
+is-glob@^4.0.0, is-glob@^4.0.3:
+  version "4.0.3"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084"
+  integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==
+  dependencies:
+    is-extglob "^2.1.1"
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+  integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==
+
+js-yaml@^4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-4.1.0.tgz#c1fb65f8f5017901cdd2c951864ba18458a10602"
+  integrity sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==
+  dependencies:
+    argparse "^2.0.1"
+
+json-buffer@3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/json-buffer/-/json-buffer-3.0.1.tgz#9338802a30d3b6605fbe0613e094008ca8c05a13"
+  integrity sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==
+
+json-schema-traverse@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
+  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
+
+json-stable-stringify-without-jsonify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651"
+  integrity sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==
+
+keyv@^4.5.4:
+  version "4.5.4"
+  resolved "https://registry.yarnpkg.com/keyv/-/keyv-4.5.4.tgz#a879a99e29452f942439f2a405e3af8b31d4de93"
+  integrity sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==
+  dependencies:
+    json-buffer "3.0.1"
+
+levn@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.4.1.tgz#ae4562c007473b932a6200d403268dd2fffc6ade"
+  integrity sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==
+  dependencies:
+    prelude-ls "^1.2.1"
+    type-check "~0.4.0"
+
+locate-path@^6.0.0:
+  version "6.0.0"
+  resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-6.0.0.tgz#55321eb309febbc59c4801d931a72452a681d286"
+  integrity sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==
+  dependencies:
+    p-locate "^5.0.0"
+
+lodash.merge@^4.6.2:
+  version "4.6.2"
+  resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.2.tgz#558aa53b43b661e1925a0afdfa36a9a1085fe57a"
+  integrity sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==
+
+minimatch@^3.1.2:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.1.2.tgz#19cd194bfd3e428f049a70817c038d89ab4be35b"
+  integrity sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+ms@^2.1.3:
+  version "2.1.3"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
+  integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
+
+natural-compare@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
+  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
+
+optionator@^0.9.3:
+  version "0.9.4"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.9.4.tgz#7ea1c1a5d91d764fb282139c88fe11e182a3a734"
+  integrity sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==
+  dependencies:
+    deep-is "^0.1.3"
+    fast-levenshtein "^2.0.6"
+    levn "^0.4.1"
+    prelude-ls "^1.2.1"
+    type-check "^0.4.0"
+    word-wrap "^1.2.5"
+
+p-limit@^3.0.2:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-3.1.0.tgz#e1daccbe78d0d1388ca18c64fea38e3e57e3706b"
+  integrity sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==
+  dependencies:
+    yocto-queue "^0.1.0"
+
+p-locate@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-5.0.0.tgz#83c8315c6785005e3bd021839411c9e110e6d834"
+  integrity sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==
+  dependencies:
+    p-limit "^3.0.2"
+
+parent-module@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2"
+  integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==
+  dependencies:
+    callsites "^3.0.0"
+
+path-exists@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-4.0.0.tgz#513bdbe2d3b95d7762e8c1137efa195c6c61b5b3"
+  integrity sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==
+
+path-key@^3.1.0:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-3.1.1.tgz#581f6ade658cbba65a0d3380de7753295054f375"
+  integrity sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==
+
+prelude-ls@^1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.2.1.tgz#debc6489d7a6e6b0e7611888cec880337d316396"
+  integrity sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==
+
+punycode@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
+  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
+
+resolve-from@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6"
+  integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==
+
+shebang-command@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-2.0.0.tgz#ccd0af4f8835fbdc265b82461aaf0c36663f34ea"
+  integrity sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==
+  dependencies:
+    shebang-regex "^3.0.0"
+
+shebang-regex@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-3.0.0.tgz#ae16f1644d873ecad843b0307b143362d4c42172"
+  integrity sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==
+
+strip-json-comments@^3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.1.1.tgz#31f1281b3832630434831c310c01cccda8cbe006"
+  integrity sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==
+
+supports-color@^7.1.0:
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da"
+  integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==
+  dependencies:
+    has-flag "^4.0.0"
+
+type-check@^0.4.0, type-check@~0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.4.0.tgz#07b8203bfa7056c0657050e3ccd2c37730bab8f1"
+  integrity sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==
+  dependencies:
+    prelude-ls "^1.2.1"
+
+uri-js@^4.2.2:
+  version "4.2.2"
+  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
+  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
+  dependencies:
+    punycode "^2.1.0"
+
+which@^2.0.1:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/which/-/which-2.0.2.tgz#7c6a8dd0a636a0327e10b59c9286eee93f3f51b1"
+  integrity sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==
+  dependencies:
+    isexe "^2.0.0"
+
+word-wrap@^1.2.5:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.5.tgz#d2c45c6dd4fbce621a66f136cbe328afd0410b34"
+  integrity sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==
+
+yocto-queue@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/yocto-queue/-/yocto-queue-0.1.0.tgz#0294eb3dee05028d31ee1a5fa2c556a6aaf10a1b"
+  integrity sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==
diff --git a/fixtures/eslint/README.md b/fixtures/eslint/README.md
deleted file mode 100644
index 28ab22551372d..0000000000000
--- a/fixtures/eslint/README.md
+++ /dev/null
@@ -1,7 +0,0 @@
-# ESLint Playground Fixture
-
-This is an internal playground for quick iteration on our lint rules inside an IDE like VSCode.
-
-See instructions in `./index.js` in this directory.
-
-![Demo](https://duaw26jehqd4r.cloudfront.net/items/2Z390a31003O0l0o0e3O/Screen%20Recording%202019-01-16%20at%2010.29%20PM.gif?v=d6856125)
\ No newline at end of file
diff --git a/fixtures/eslint/index.js b/fixtures/eslint/index.js
deleted file mode 100644
index d53415310560d..0000000000000
--- a/fixtures/eslint/index.js
+++ /dev/null
@@ -1,26 +0,0 @@
-// This is a testing playground for our lint rules.
-
-// 1. Run yarn && yarn start
-// 2. "File > Add Folder to Workspace" this specific folder in VSCode with ESLint extension
-// 3. Changes to the rule source should get picked up without restarting ESLint server
-
-function Comment({comment, commentSource}) {
-  const currentUserID = comment.viewer.id;
-  const environment = RelayEnvironment.forUser(currentUserID);
-  const commentID = nullthrows(comment.id);
-  useEffect(() => {
-    const subscription = SubscriptionCounter.subscribeOnce(
-      `StoreSubscription_${commentID}`,
-      () =>
-        StoreSubscription.subscribe(
-          environment,
-          {
-            comment_id: commentID,
-          },
-          currentUserID,
-          commentSource
-        )
-    );
-    return () => subscription.dispose();
-  }, [commentID, commentSource, currentUserID, environment]);
-}
diff --git a/fixtures/eslint/package.json b/fixtures/eslint/package.json
deleted file mode 100644
index 04f8d6b98be99..0000000000000
--- a/fixtures/eslint/package.json
+++ /dev/null
@@ -1,12 +0,0 @@
-{
-  "private": true,
-  "name": "eslint-playground",
-  "dependencies": {
-    "eslint": "4.1.0",
-    "eslint-plugin-react-hooks": "link:./proxy"
-  },
-  "scripts": {
-    "start": "./watch.sh",
-    "lint": "eslint index.js"
-  }
-}
diff --git a/fixtures/eslint/proxy/index.js b/fixtures/eslint/proxy/index.js
deleted file mode 100644
index f54e672d21126..0000000000000
--- a/fixtures/eslint/proxy/index.js
+++ /dev/null
@@ -1,35 +0,0 @@
-'use strict';
-
-// This file is a proxy for our rule definition that will
-// load the latest built version on every check. This makes
-// it convenient to test inside IDEs (which would otherwise
-// load a version of our rule once and never restart the server).
-// See instructions in ../index.js playground.
-
-let build;
-reload();
-
-function reload() {
-  for (let id in require.cache) {
-    if (/eslint-plugin-react-hooks/.test(id)) {
-      delete require.cache[id];
-    }
-  }
-  // Point to the built version.
-  build = require('../../../build/oss-experimental/eslint-plugin-react-hooks');
-}
-
-let rules = {};
-for (let key in build.rules) {
-  if (build.rules.hasOwnProperty(key)) {
-    rules[key] = Object.assign({}, build.rules, {
-      create() {
-        // Reload changes to the built rule
-        reload();
-        return build.rules[key].create.apply(this, arguments);
-      },
-    });
-  }
-}
-
-module.exports = {rules};
diff --git a/fixtures/eslint/proxy/package.json b/fixtures/eslint/proxy/package.json
deleted file mode 100644
index 1461c2d43f5f1..0000000000000
--- a/fixtures/eslint/proxy/package.json
+++ /dev/null
@@ -1,4 +0,0 @@
-{
-  "private": true,
-  "version": "0.0.0"
-}
\ No newline at end of file
diff --git a/fixtures/eslint/watch.sh b/fixtures/eslint/watch.sh
deleted file mode 100755
index 0ca6359c03516..0000000000000
--- a/fixtures/eslint/watch.sh
+++ /dev/null
@@ -1,3 +0,0 @@
-#!/bin/bash
-(cd ../.. && yarn build eslint --type=NODE_DEV)
-(cd ../.. && watchman-make --make 'yarn build eslint --type=NODE_DEV' -p 'packages/eslint-plugin-*/**/*' -t ignored)
diff --git a/fixtures/eslint/yarn.lock b/fixtures/eslint/yarn.lock
deleted file mode 100644
index 7a557036da3aa..0000000000000
--- a/fixtures/eslint/yarn.lock
+++ /dev/null
@@ -1,853 +0,0 @@
-# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
-# yarn lockfile v1
-
-
-acorn-jsx@^3.0.0:
-  version "3.0.1"
-  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-3.0.1.tgz#afdf9488fb1ecefc8348f6fb22f464e32a58b36b"
-  integrity sha1-r9+UiPsezvyDSPb7IvRk4ypYs2s=
-  dependencies:
-    acorn "^3.0.4"
-
-acorn@^3.0.4:
-  version "3.3.0"
-  resolved "https://registry.yarnpkg.com/acorn/-/acorn-3.3.0.tgz#45e37fb39e8da3f25baee3ff5369e2bb5f22017a"
-  integrity sha1-ReN/s56No/JbruP/U2niu18iAXo=
-
-acorn@^5.5.0:
-  version "5.7.3"
-  resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.7.3.tgz#67aa231bf8812974b85235a96771eb6bd07ea279"
-  integrity sha512-T/zvzYRfbVojPWahDsE5evJdHb3oJoQfFbsrKM7w5Zcs++Tr257tia3BmMP8XYVjp1S9RZXQMh7gao96BlqZOw==
-
-ajv-keywords@^3.0.0:
-  version "3.2.0"
-  resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-3.2.0.tgz#e86b819c602cf8821ad637413698f1dec021847a"
-  integrity sha1-6GuBnGAs+IIa1jdBNpjx3sAhhHo=
-
-ajv@^6.0.1:
-  version "6.7.0"
-  resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.7.0.tgz#e3ce7bb372d6577bb1839f1dfdfcbf5ad2948d96"
-  integrity sha512-RZXPviBTtfmtka9n9sy1N5M5b82CbxWIR6HIis4s3WQTXDJamc/0gpCWNGz6EWdWp4DOfjzJfhz/AS9zVPjjWg==
-  dependencies:
-    fast-deep-equal "^2.0.1"
-    fast-json-stable-stringify "^2.0.0"
-    json-schema-traverse "^0.4.1"
-    uri-js "^4.2.2"
-
-ansi-escapes@^3.0.0:
-  version "3.1.0"
-  resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-3.1.0.tgz#f73207bb81207d75fd6c83f125af26eea378ca30"
-  integrity sha512-UgAb8H9D41AQnu/PbWlCofQVcnV4Gs2bBJi9eZPxfU/hgglFh3SMDMENRIqdr7H6XFnXdoknctFByVsCOotTVw==
-
-ansi-regex@^2.0.0:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df"
-  integrity sha1-w7M6te42DYbg5ijwRorn7yfWVN8=
-
-ansi-regex@^3.0.0:
-  version "3.0.0"
-  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-3.0.0.tgz#ed0317c322064f79466c02966bddb605ab37d998"
-  integrity sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=
-
-ansi-styles@^2.2.1:
-  version "2.2.1"
-  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe"
-  integrity sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=
-
-ansi-styles@^3.2.1:
-  version "3.2.1"
-  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
-  integrity sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==
-  dependencies:
-    color-convert "^1.9.0"
-
-argparse@^1.0.7:
-  version "1.0.10"
-  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
-  integrity sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==
-  dependencies:
-    sprintf-js "~1.0.2"
-
-babel-code-frame@^6.22.0:
-  version "6.26.0"
-  resolved "https://registry.yarnpkg.com/babel-code-frame/-/babel-code-frame-6.26.0.tgz#63fd43f7dc1e3bb7ce35947db8fe369a3f58c74b"
-  integrity sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=
-  dependencies:
-    chalk "^1.1.3"
-    esutils "^2.0.2"
-    js-tokens "^3.0.2"
-
-balanced-match@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
-  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
-
-brace-expansion@^1.1.7:
-  version "1.1.11"
-  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
-  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
-  dependencies:
-    balanced-match "^1.0.0"
-    concat-map "0.0.1"
-
-buffer-from@^1.0.0:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/buffer-from/-/buffer-from-1.1.1.tgz#32713bc028f75c02fdb710d7c7bcec1f2c6070ef"
-  integrity sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==
-
-caller-path@^0.1.0:
-  version "0.1.0"
-  resolved "https://registry.yarnpkg.com/caller-path/-/caller-path-0.1.0.tgz#94085ef63581ecd3daa92444a8fe94e82577751f"
-  integrity sha1-lAhe9jWB7NPaqSREqP6U6CV3dR8=
-  dependencies:
-    callsites "^0.2.0"
-
-callsites@^0.2.0:
-  version "0.2.0"
-  resolved "https://registry.yarnpkg.com/callsites/-/callsites-0.2.0.tgz#afab96262910a7f33c19a5775825c69f34e350ca"
-  integrity sha1-r6uWJikQp/M8GaV3WCXGnzTjUMo=
-
-chalk@^1.1.3:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/chalk/-/chalk-1.1.3.tgz#a8115c55e4a702fe4d150abd3872822a7e09fc98"
-  integrity sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=
-  dependencies:
-    ansi-styles "^2.2.1"
-    escape-string-regexp "^1.0.2"
-    has-ansi "^2.0.0"
-    strip-ansi "^3.0.0"
-    supports-color "^2.0.0"
-
-chalk@^2.0.0, chalk@^2.1.0:
-  version "2.4.2"
-  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424"
-  integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==
-  dependencies:
-    ansi-styles "^3.2.1"
-    escape-string-regexp "^1.0.5"
-    supports-color "^5.3.0"
-
-chardet@^0.4.0:
-  version "0.4.2"
-  resolved "https://registry.yarnpkg.com/chardet/-/chardet-0.4.2.tgz#b5473b33dc97c424e5d98dc87d55d4d8a29c8bf2"
-  integrity sha1-tUc7M9yXxCTl2Y3IfVXU2KKci/I=
-
-circular-json@^0.3.1:
-  version "0.3.3"
-  resolved "https://registry.yarnpkg.com/circular-json/-/circular-json-0.3.3.tgz#815c99ea84f6809529d2f45791bdf82711352d66"
-  integrity sha512-UZK3NBx2Mca+b5LsG7bY183pHWt5Y1xts4P3Pz7ENTwGVnJOUWbRb3ocjvX7hx9tq/yTAdclXm9sZ38gNuem4A==
-
-cli-cursor@^2.1.0:
-  version "2.1.0"
-  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-2.1.0.tgz#b35dac376479facc3e94747d41d0d0f5238ffcb5"
-  integrity sha1-s12sN2R5+sw+lHR9QdDQ9SOP/LU=
-  dependencies:
-    restore-cursor "^2.0.0"
-
-cli-width@^2.0.0:
-  version "2.2.0"
-  resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-2.2.0.tgz#ff19ede8a9a5e579324147b0c11f0fbcbabed639"
-  integrity sha1-/xnt6Kml5XkyQUewwR8PvLq+1jk=
-
-color-convert@^1.9.0:
-  version "1.9.3"
-  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.3.tgz#bb71850690e1f136567de629d2d5471deda4c1e8"
-  integrity sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==
-  dependencies:
-    color-name "1.1.3"
-
-color-name@1.1.3:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
-  integrity sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=
-
-concat-map@0.0.1:
-  version "0.0.1"
-  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
-  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
-
-concat-stream@^1.6.0:
-  version "1.6.2"
-  resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.2.tgz#904bdf194cd3122fc675c77fc4ac3d4ff0fd1a34"
-  integrity sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==
-  dependencies:
-    buffer-from "^1.0.0"
-    inherits "^2.0.3"
-    readable-stream "^2.2.2"
-    typedarray "^0.0.6"
-
-core-util-is@~1.0.0:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7"
-  integrity sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=
-
-debug@^2.6.8:
-  version "2.6.9"
-  resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f"
-  integrity sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==
-  dependencies:
-    ms "2.0.0"
-
-deep-is@~0.1.3:
-  version "0.1.3"
-  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34"
-  integrity sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=
-
-doctrine@^2.0.0:
-  version "2.1.0"
-  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-2.1.0.tgz#5cd01fc101621b42c4cd7f5d1a66243716d3f39d"
-  integrity sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw==
-  dependencies:
-    esutils "^2.0.2"
-
-escape-string-regexp@^1.0.2, escape-string-regexp@^1.0.5:
-  version "1.0.5"
-  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
-  integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
-
-"eslint-plugin-react-hooks@link:./proxy":
-  version "0.0.0"
-  uid ""
-
-eslint-scope@^3.7.1:
-  version "3.7.3"
-  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-3.7.3.tgz#bb507200d3d17f60247636160b4826284b108535"
-  integrity sha512-W+B0SvF4gamyCTmUc+uITPY0989iXVfKvhwtmJocTaYoc/3khEHmEmvfY/Gn9HA9VV75jrQECsHizkNw1b68FA==
-  dependencies:
-    esrecurse "^4.1.0"
-    estraverse "^4.1.1"
-
-eslint@4.1.0:
-  version "4.1.0"
-  resolved "https://registry.yarnpkg.com/eslint/-/eslint-4.1.0.tgz#bbb55a28220ee08b69da9554d45a6b2ebfd7d913"
-  integrity sha1-u7VaKCIO4Itp2pVU1FprLr/X2RM=
-  dependencies:
-    babel-code-frame "^6.22.0"
-    chalk "^1.1.3"
-    concat-stream "^1.6.0"
-    debug "^2.6.8"
-    doctrine "^2.0.0"
-    eslint-scope "^3.7.1"
-    espree "^3.4.3"
-    esquery "^1.0.0"
-    estraverse "^4.2.0"
-    esutils "^2.0.2"
-    file-entry-cache "^2.0.0"
-    glob "^7.1.2"
-    globals "^9.17.0"
-    ignore "^3.3.3"
-    imurmurhash "^0.1.4"
-    inquirer "^3.0.6"
-    is-my-json-valid "^2.16.0"
-    is-resolvable "^1.0.0"
-    js-yaml "^3.8.4"
-    json-stable-stringify "^1.0.1"
-    levn "^0.3.0"
-    lodash "^4.17.4"
-    minimatch "^3.0.2"
-    mkdirp "^0.5.1"
-    natural-compare "^1.4.0"
-    optionator "^0.8.2"
-    path-is-inside "^1.0.2"
-    pluralize "^4.0.0"
-    progress "^2.0.0"
-    require-uncached "^1.0.3"
-    strip-json-comments "~2.0.1"
-    table "^4.0.1"
-    text-table "~0.2.0"
-
-espree@^3.4.3:
-  version "3.5.4"
-  resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.4.tgz#b0f447187c8a8bed944b815a660bddf5deb5d1a7"
-  integrity sha512-yAcIQxtmMiB/jL32dzEp2enBeidsB7xWPLNiw3IIkpVds1P+h7qF9YwJq1yUNzp2OKXgAprs4F61ih66UsoD1A==
-  dependencies:
-    acorn "^5.5.0"
-    acorn-jsx "^3.0.0"
-
-esprima@^4.0.0:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71"
-  integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==
-
-esquery@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.0.1.tgz#406c51658b1f5991a5f9b62b1dc25b00e3e5c708"
-  integrity sha512-SmiyZ5zIWH9VM+SRUReLS5Q8a7GxtRdxEBVZpm98rJM7Sb+A9DVCndXfkeFUd3byderg+EbDkfnevfCwynWaNA==
-  dependencies:
-    estraverse "^4.0.0"
-
-esrecurse@^4.1.0:
-  version "4.2.1"
-  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.2.1.tgz#007a3b9fdbc2b3bb87e4879ea19c92fdbd3942cf"
-  integrity sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==
-  dependencies:
-    estraverse "^4.1.0"
-
-estraverse@^4.0.0, estraverse@^4.1.0, estraverse@^4.1.1, estraverse@^4.2.0:
-  version "4.2.0"
-  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13"
-  integrity sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=
-
-esutils@^2.0.2:
-  version "2.0.2"
-  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
-  integrity sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=
-
-external-editor@^2.0.4:
-  version "2.2.0"
-  resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-2.2.0.tgz#045511cfd8d133f3846673d1047c154e214ad3d5"
-  integrity sha512-bSn6gvGxKt+b7+6TKEv1ZycHleA7aHhRHyAqJyp5pbUFuYYNIzpZnQDk7AsYckyWdEnTeAnay0aCy2aV6iTk9A==
-  dependencies:
-    chardet "^0.4.0"
-    iconv-lite "^0.4.17"
-    tmp "^0.0.33"
-
-fast-deep-equal@^2.0.1:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-2.0.1.tgz#7b05218ddf9667bf7f370bf7fdb2cb15fdd0aa49"
-  integrity sha1-ewUhjd+WZ79/Nwv3/bLLFf3Qqkk=
-
-fast-json-stable-stringify@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
-  integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
-
-fast-levenshtein@~2.0.4:
-  version "2.0.6"
-  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
-  integrity sha1-PYpcZog6FqMMqGQ+hR8Zuqd5eRc=
-
-figures@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/figures/-/figures-2.0.0.tgz#3ab1a2d2a62c8bfb431a0c94cb797a2fce27c962"
-  integrity sha1-OrGi0qYsi/tDGgyUy3l6L84nyWI=
-  dependencies:
-    escape-string-regexp "^1.0.5"
-
-file-entry-cache@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-2.0.0.tgz#c392990c3e684783d838b8c84a45d8a048458361"
-  integrity sha1-w5KZDD5oR4PYOLjISkXYoEhFg2E=
-  dependencies:
-    flat-cache "^1.2.1"
-    object-assign "^4.0.1"
-
-flat-cache@^1.2.1:
-  version "1.3.4"
-  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.3.4.tgz#2c2ef77525cc2929007dfffa1dd314aa9c9dee6f"
-  integrity sha512-VwyB3Lkgacfik2vhqR4uv2rvebqmDvFu4jlN/C1RzWoJEo8I7z4Q404oiqYCkq41mni8EzQnm95emU9seckwtg==
-  dependencies:
-    circular-json "^0.3.1"
-    graceful-fs "^4.1.2"
-    rimraf "~2.6.2"
-    write "^0.2.1"
-
-fs.realpath@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
-  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
-
-generate-function@^2.0.0:
-  version "2.3.1"
-  resolved "https://registry.yarnpkg.com/generate-function/-/generate-function-2.3.1.tgz#f069617690c10c868e73b8465746764f97c3479f"
-  integrity sha512-eeB5GfMNeevm/GRYq20ShmsaGcmI81kIX2K9XQx5miC8KdHaC6Jm0qQ8ZNeGOi7wYB8OsdxKs+Y2oVuTFuVwKQ==
-  dependencies:
-    is-property "^1.0.2"
-
-generate-object-property@^1.1.0:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/generate-object-property/-/generate-object-property-1.2.0.tgz#9c0e1c40308ce804f4783618b937fa88f99d50d0"
-  integrity sha1-nA4cQDCM6AT0eDYYuTf6iPmdUNA=
-  dependencies:
-    is-property "^1.0.0"
-
-glob@^7.1.2, glob@^7.1.3:
-  version "7.1.3"
-  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.3.tgz#3960832d3f1574108342dafd3a67b332c0969df1"
-  integrity sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==
-  dependencies:
-    fs.realpath "^1.0.0"
-    inflight "^1.0.4"
-    inherits "2"
-    minimatch "^3.0.4"
-    once "^1.3.0"
-    path-is-absolute "^1.0.0"
-
-globals@^9.17.0:
-  version "9.18.0"
-  resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a"
-  integrity sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ==
-
-graceful-fs@^4.1.2:
-  version "4.1.15"
-  resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.1.15.tgz#ffb703e1066e8a0eeaa4c8b80ba9253eeefbfb00"
-  integrity sha512-6uHUhOPEBgQ24HM+r6b/QwWfZq+yiFcipKFrOFiBEnWdy5sdzYoi+pJeQaPI5qOLRFqWmAXUPQNsielzdLoecA==
-
-has-ansi@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/has-ansi/-/has-ansi-2.0.0.tgz#34f5049ce1ecdf2b0649af3ef24e45ed35416d91"
-  integrity sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=
-  dependencies:
-    ansi-regex "^2.0.0"
-
-has-flag@^3.0.0:
-  version "3.0.0"
-  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
-  integrity sha1-tdRU3CGZriJWmfNGfloH87lVuv0=
-
-iconv-lite@^0.4.17:
-  version "0.4.24"
-  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.24.tgz#2022b4b25fbddc21d2f524974a474aafe733908b"
-  integrity sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==
-  dependencies:
-    safer-buffer ">= 2.1.2 < 3"
-
-ignore@^3.3.3:
-  version "3.3.10"
-  resolved "https://registry.yarnpkg.com/ignore/-/ignore-3.3.10.tgz#0a97fb876986e8081c631160f8f9f389157f0043"
-  integrity sha512-Pgs951kaMm5GXP7MOvxERINe3gsaVjUWFm+UZPSq9xYriQAksyhg0csnS0KXSNRD5NmNdapXEpjxG49+AKh/ug==
-
-imurmurhash@^0.1.4:
-  version "0.1.4"
-  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
-  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
-
-inflight@^1.0.4:
-  version "1.0.6"
-  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
-  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
-  dependencies:
-    once "^1.3.0"
-    wrappy "1"
-
-inherits@2, inherits@^2.0.3, inherits@~2.0.3:
-  version "2.0.3"
-  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
-  integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=
-
-inquirer@^3.0.6:
-  version "3.3.0"
-  resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-3.3.0.tgz#9dd2f2ad765dcab1ff0443b491442a20ba227dc9"
-  integrity sha512-h+xtnyk4EwKvFWHrUYsWErEVR+igKtLdchu+o0Z1RL7VU/jVMFbYir2bp6bAj8efFNxWqHX0dIss6fJQ+/+qeQ==
-  dependencies:
-    ansi-escapes "^3.0.0"
-    chalk "^2.0.0"
-    cli-cursor "^2.1.0"
-    cli-width "^2.0.0"
-    external-editor "^2.0.4"
-    figures "^2.0.0"
-    lodash "^4.3.0"
-    mute-stream "0.0.7"
-    run-async "^2.2.0"
-    rx-lite "^4.0.8"
-    rx-lite-aggregates "^4.0.8"
-    string-width "^2.1.0"
-    strip-ansi "^4.0.0"
-    through "^2.3.6"
-
-is-fullwidth-code-point@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f"
-  integrity sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=
-
-is-my-ip-valid@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/is-my-ip-valid/-/is-my-ip-valid-1.0.0.tgz#7b351b8e8edd4d3995d4d066680e664d94696824"
-  integrity sha512-gmh/eWXROncUzRnIa1Ubrt5b8ep/MGSnfAUI3aRp+sqTCs1tv1Isl8d8F6JmkN3dXKc3ehZMrtiPN9eL03NuaQ==
-
-is-my-json-valid@^2.16.0:
-  version "2.19.0"
-  resolved "https://registry.yarnpkg.com/is-my-json-valid/-/is-my-json-valid-2.19.0.tgz#8fd6e40363cd06b963fa877d444bfb5eddc62175"
-  integrity sha512-mG0f/unGX1HZ5ep4uhRaPOS8EkAY8/j6mDRMJrutq4CqhoJWYp7qAlonIPy3TV7p3ju4TK9fo/PbnoksWmsp5Q==
-  dependencies:
-    generate-function "^2.0.0"
-    generate-object-property "^1.1.0"
-    is-my-ip-valid "^1.0.0"
-    jsonpointer "^4.0.0"
-    xtend "^4.0.0"
-
-is-promise@^2.1.0:
-  version "2.1.0"
-  resolved "https://registry.yarnpkg.com/is-promise/-/is-promise-2.1.0.tgz#79a2a9ece7f096e80f36d2b2f3bc16c1ff4bf3fa"
-  integrity sha1-eaKp7OfwlugPNtKy87wWwf9L8/o=
-
-is-property@^1.0.0, is-property@^1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/is-property/-/is-property-1.0.2.tgz#57fe1c4e48474edd65b09911f26b1cd4095dda84"
-  integrity sha1-V/4cTkhHTt1lsJkR8msc1Ald2oQ=
-
-is-resolvable@^1.0.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.1.0.tgz#fb18f87ce1feb925169c9a407c19318a3206ed88"
-  integrity sha512-qgDYXFSR5WvEfuS5dMj6oTMEbrrSaM0CrFk2Yiq/gXnBvD9pMa2jGXxyhGLfvhZpuMZe18CJpFxAt3CRs42NMg==
-
-isarray@~1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11"
-  integrity sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=
-
-js-tokens@^3.0.2:
-  version "3.0.2"
-  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-3.0.2.tgz#9866df395102130e38f7f996bceb65443209c25b"
-  integrity sha1-mGbfOVECEw449/mWvOtlRDIJwls=
-
-js-yaml@^3.8.4:
-  version "3.12.1"
-  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.12.1.tgz#295c8632a18a23e054cf5c9d3cecafe678167600"
-  integrity sha512-um46hB9wNOKlwkHgiuyEVAybXBjwFUV0Z/RaHJblRd9DXltue9FTYvzCr9ErQrK9Adz5MU4gHWVaNUfdmrC8qA==
-  dependencies:
-    argparse "^1.0.7"
-    esprima "^4.0.0"
-
-json-schema-traverse@^0.4.1:
-  version "0.4.1"
-  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660"
-  integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==
-
-json-stable-stringify@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af"
-  integrity sha1-mnWdOcXy/1A/1TAGRu1EX4jE+a8=
-  dependencies:
-    jsonify "~0.0.0"
-
-jsonify@~0.0.0:
-  version "0.0.0"
-  resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73"
-  integrity sha1-LHS27kHZPKUbe1qu6PUDYx0lKnM=
-
-jsonpointer@^4.0.0:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/jsonpointer/-/jsonpointer-4.0.1.tgz#4fd92cb34e0e9db3c89c8622ecf51f9b978c6cb9"
-  integrity sha1-T9kss04OnbPInIYi7PUfm5eMbLk=
-
-levn@^0.3.0, levn@~0.3.0:
-  version "0.3.0"
-  resolved "https://registry.yarnpkg.com/levn/-/levn-0.3.0.tgz#3b09924edf9f083c0490fdd4c0bc4421e04764ee"
-  integrity sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=
-  dependencies:
-    prelude-ls "~1.1.2"
-    type-check "~0.3.2"
-
-lodash@^4.17.4, lodash@^4.3.0:
-  version "4.17.11"
-  resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.11.tgz#b39ea6229ef607ecd89e2c8df12536891cac9b8d"
-  integrity sha512-cQKh8igo5QUhZ7lg38DYWAxMvjSAKG0A8wGSVimP07SIUEK2UO+arSRKbRZWtelMtN5V0Hkwh5ryOto/SshYIg==
-
-mimic-fn@^1.0.0:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.2.0.tgz#820c86a39334640e99516928bd03fca88057d022"
-  integrity sha512-jf84uxzwiuiIVKiOLpfYk7N46TSy8ubTonmneY9vrpHNAnp0QBt2BxWV9dO3/j+BoVAb+a5G6YDPW3M5HOdMWQ==
-
-minimatch@^3.0.2, minimatch@^3.0.4:
-  version "3.0.4"
-  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
-  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
-  dependencies:
-    brace-expansion "^1.1.7"
-
-minimist@0.0.8:
-  version "0.0.8"
-  resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d"
-  integrity sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=
-
-mkdirp@^0.5.1:
-  version "0.5.1"
-  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903"
-  integrity sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=
-  dependencies:
-    minimist "0.0.8"
-
-ms@2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8"
-  integrity sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=
-
-mute-stream@0.0.7:
-  version "0.0.7"
-  resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.7.tgz#3075ce93bc21b8fab43e1bc4da7e8115ed1e7bab"
-  integrity sha1-MHXOk7whuPq0PhvE2n6BFe0ee6s=
-
-natural-compare@^1.4.0:
-  version "1.4.0"
-  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
-  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
-
-object-assign@^4.0.1:
-  version "4.1.1"
-  resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863"
-  integrity sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=
-
-once@^1.3.0:
-  version "1.4.0"
-  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
-  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
-  dependencies:
-    wrappy "1"
-
-onetime@^2.0.0:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/onetime/-/onetime-2.0.1.tgz#067428230fd67443b2794b22bba528b6867962d4"
-  integrity sha1-BnQoIw/WdEOyeUsiu6UotoZ5YtQ=
-  dependencies:
-    mimic-fn "^1.0.0"
-
-optionator@^0.8.2:
-  version "0.8.2"
-  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.8.2.tgz#364c5e409d3f4d6301d6c0b4c05bba50180aeb64"
-  integrity sha1-NkxeQJ0/TWMB1sC0wFu6UBgK62Q=
-  dependencies:
-    deep-is "~0.1.3"
-    fast-levenshtein "~2.0.4"
-    levn "~0.3.0"
-    prelude-ls "~1.1.2"
-    type-check "~0.3.2"
-    wordwrap "~1.0.0"
-
-os-tmpdir@~1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
-  integrity sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=
-
-path-is-absolute@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
-  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
-
-path-is-inside@^1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53"
-  integrity sha1-NlQX3t5EQw0cEa9hAn+s8HS9/FM=
-
-pluralize@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/pluralize/-/pluralize-4.0.0.tgz#59b708c1c0190a2f692f1c7618c446b052fd1762"
-  integrity sha1-WbcIwcAZCi9pLxx2GMRGsFL9F2I=
-
-prelude-ls@~1.1.2:
-  version "1.1.2"
-  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54"
-  integrity sha1-IZMqVJ9eUv/ZqCf1cOBL5iqX2lQ=
-
-process-nextick-args@~2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.0.tgz#a37d732f4271b4ab1ad070d35508e8290788ffaa"
-  integrity sha512-MtEC1TqN0EU5nephaJ4rAtThHtC86dNN9qCuEhtshvpVBkAW5ZO7BASN9REnF9eoXGcRub+pFuKEpOHE+HbEMw==
-
-progress@^2.0.0:
-  version "2.0.3"
-  resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.3.tgz#7e8cf8d8f5b8f239c1bc68beb4eb78567d572ef8"
-  integrity sha512-7PiHtLll5LdnKIMw100I+8xJXR5gW2QwWYkT6iJva0bXitZKa/XMrSbdmg3r2Xnaidz9Qumd0VPaMrZlF9V9sA==
-
-punycode@^2.1.0:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec"
-  integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==
-
-readable-stream@^2.2.2:
-  version "2.3.6"
-  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.6.tgz#b11c27d88b8ff1fbe070643cf94b0c79ae1b0aaf"
-  integrity sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==
-  dependencies:
-    core-util-is "~1.0.0"
-    inherits "~2.0.3"
-    isarray "~1.0.0"
-    process-nextick-args "~2.0.0"
-    safe-buffer "~5.1.1"
-    string_decoder "~1.1.1"
-    util-deprecate "~1.0.1"
-
-require-uncached@^1.0.3:
-  version "1.0.3"
-  resolved "https://registry.yarnpkg.com/require-uncached/-/require-uncached-1.0.3.tgz#4e0d56d6c9662fd31e43011c4b95aa49955421d3"
-  integrity sha1-Tg1W1slmL9MeQwEcS5WqSZVUIdM=
-  dependencies:
-    caller-path "^0.1.0"
-    resolve-from "^1.0.0"
-
-resolve-from@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-1.0.1.tgz#26cbfe935d1aeeeabb29bc3fe5aeb01e93d44226"
-  integrity sha1-Jsv+k10a7uq7Kbw/5a6wHpPUQiY=
-
-restore-cursor@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-2.0.0.tgz#9f7ee287f82fd326d4fd162923d62129eee0dfaf"
-  integrity sha1-n37ih/gv0ybU/RYpI9YhKe7g368=
-  dependencies:
-    onetime "^2.0.0"
-    signal-exit "^3.0.2"
-
-rimraf@~2.6.2:
-  version "2.6.3"
-  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.3.tgz#b2d104fe0d8fb27cf9e0a1cda8262dd3833c6cab"
-  integrity sha512-mwqeW5XsA2qAejG46gYdENaxXjx9onRNCfn7L0duuP4hCuTIi/QO7PDK07KJfp1d+izWPrzEJDcSqBa0OZQriA==
-  dependencies:
-    glob "^7.1.3"
-
-run-async@^2.2.0:
-  version "2.3.0"
-  resolved "https://registry.yarnpkg.com/run-async/-/run-async-2.3.0.tgz#0371ab4ae0bdd720d4166d7dfda64ff7a445a6c0"
-  integrity sha1-A3GrSuC91yDUFm19/aZP96RFpsA=
-  dependencies:
-    is-promise "^2.1.0"
-
-rx-lite-aggregates@^4.0.8:
-  version "4.0.8"
-  resolved "https://registry.yarnpkg.com/rx-lite-aggregates/-/rx-lite-aggregates-4.0.8.tgz#753b87a89a11c95467c4ac1626c4efc4e05c67be"
-  integrity sha1-dTuHqJoRyVRnxKwWJsTvxOBcZ74=
-  dependencies:
-    rx-lite "*"
-
-rx-lite@*, rx-lite@^4.0.8:
-  version "4.0.8"
-  resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-4.0.8.tgz#0b1e11af8bc44836f04a6407e92da42467b79444"
-  integrity sha1-Cx4Rr4vESDbwSmQH6S2kJGe3lEQ=
-
-safe-buffer@~5.1.0, safe-buffer@~5.1.1:
-  version "5.1.2"
-  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d"
-  integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==
-
-"safer-buffer@>= 2.1.2 < 3":
-  version "2.1.2"
-  resolved "https://registry.yarnpkg.com/safer-buffer/-/safer-buffer-2.1.2.tgz#44fa161b0187b9549dd84bb91802f9bd8385cd6a"
-  integrity sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==
-
-signal-exit@^3.0.2:
-  version "3.0.2"
-  resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d"
-  integrity sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=
-
-slice-ansi@1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-1.0.0.tgz#044f1a49d8842ff307aad6b505ed178bd950134d"
-  integrity sha512-POqxBK6Lb3q6s047D/XsDVNPnF9Dl8JSaqe9h9lURl0OdNqy/ujDrOiIHtsqXMGbWWTIomRzAMaTyawAU//Reg==
-  dependencies:
-    is-fullwidth-code-point "^2.0.0"
-
-sprintf-js@~1.0.2:
-  version "1.0.3"
-  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
-  integrity sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=
-
-string-width@^2.1.0, string-width@^2.1.1:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e"
-  integrity sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==
-  dependencies:
-    is-fullwidth-code-point "^2.0.0"
-    strip-ansi "^4.0.0"
-
-string_decoder@~1.1.1:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.1.1.tgz#9cf1611ba62685d7030ae9e4ba34149c3af03fc8"
-  integrity sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==
-  dependencies:
-    safe-buffer "~5.1.0"
-
-strip-ansi@^3.0.0:
-  version "3.0.1"
-  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf"
-  integrity sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=
-  dependencies:
-    ansi-regex "^2.0.0"
-
-strip-ansi@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-4.0.0.tgz#a8479022eb1ac368a871389b635262c505ee368f"
-  integrity sha1-qEeQIusaw2iocTibY1JixQXuNo8=
-  dependencies:
-    ansi-regex "^3.0.0"
-
-strip-json-comments@~2.0.1:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a"
-  integrity sha1-PFMZQukIwml8DsNEhYwobHygpgo=
-
-supports-color@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7"
-  integrity sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=
-
-supports-color@^5.3.0:
-  version "5.5.0"
-  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.5.0.tgz#e2e69a44ac8772f78a1ec0b35b689df6530efc8f"
-  integrity sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==
-  dependencies:
-    has-flag "^3.0.0"
-
-table@^4.0.1:
-  version "4.0.3"
-  resolved "https://registry.yarnpkg.com/table/-/table-4.0.3.tgz#00b5e2b602f1794b9acaf9ca908a76386a7813bc"
-  integrity sha512-S7rnFITmBH1EnyKcvxBh1LjYeQMmnZtCXSEbHcH6S0NoKit24ZuFO/T1vDcLdYsLQkM188PVVhQmzKIuThNkKg==
-  dependencies:
-    ajv "^6.0.1"
-    ajv-keywords "^3.0.0"
-    chalk "^2.1.0"
-    lodash "^4.17.4"
-    slice-ansi "1.0.0"
-    string-width "^2.1.1"
-
-text-table@~0.2.0:
-  version "0.2.0"
-  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
-  integrity sha1-f17oI66AUgfACvLfSoTsP8+lcLQ=
-
-through@^2.3.6:
-  version "2.3.8"
-  resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
-  integrity sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=
-
-tmp@^0.0.33:
-  version "0.0.33"
-  resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9"
-  integrity sha512-jRCJlojKnZ3addtTOjdIqoRuPEKBvNXcGYqzO6zWZX8KfKEpnGY5jfggJQ3EjKuu8D4bJRr0y+cYJFmYbImXGw==
-  dependencies:
-    os-tmpdir "~1.0.2"
-
-type-check@~0.3.2:
-  version "0.3.2"
-  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72"
-  integrity sha1-WITKtRLPHTVeP7eE8wgEsrUg23I=
-  dependencies:
-    prelude-ls "~1.1.2"
-
-typedarray@^0.0.6:
-  version "0.0.6"
-  resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777"
-  integrity sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=
-
-uri-js@^4.2.2:
-  version "4.2.2"
-  resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.2.2.tgz#94c540e1ff772956e2299507c010aea6c8838eb0"
-  integrity sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==
-  dependencies:
-    punycode "^2.1.0"
-
-util-deprecate@~1.0.1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf"
-  integrity sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=
-
-wordwrap@~1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb"
-  integrity sha1-J1hIEIkUVqQXHI0CJkQa3pDLyus=
-
-wrappy@1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
-  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
-
-write@^0.2.1:
-  version "0.2.1"
-  resolved "https://registry.yarnpkg.com/write/-/write-0.2.1.tgz#5fc03828e264cea3fe91455476f7a3c566cb0757"
-  integrity sha1-X8A4KOJkzqP+kUVUdvejxWbLB1c=
-  dependencies:
-    mkdirp "^0.5.1"
-
-xtend@^4.0.0:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.1.tgz#a5c6d532be656e23db820efb943a1f04998d63af"
-  integrity sha1-pcbVMr5lbiPbgg77lDofBJmNY68=

From 5adf40208f4a2f56bda5c059d18ce578c5091dab Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 13:10:54 -0600
Subject: [PATCH 56/72] feat(eslint-plugin-react-hooks): convert to typescript
 and package type declarations (#32240)

<!--
  Thanks for submitting a pull request!
We appreciate you spending the time to work on these changes. Please
provide enough information so that others can review your pull request.
The three fields below are mandatory.

Before submitting a pull request, please make sure the following is
done:

1. Fork [the repository](https://github.com/facebook/react) and create
your branch from `main`.
  2. Run `yarn` in the repository root.
3. If you've fixed a bug or added code that should be tested, add tests!
4. Ensure the test suite passes (`yarn test`). Tip: `yarn test --watch
TestName` is helpful in development.
5. Run `yarn test --prod` to test in the production environment. It
supports the same options as `yarn test`.
6. If you need a debugger, run `yarn test --debug --watch TestName`,
open `chrome://inspect`, and press "Inspect".
7. Format your code with
[prettier](https://github.com/prettier/prettier) (`yarn prettier`).
8. Make sure your code lints (`yarn lint`). Tip: `yarn linc` to only
check changed files.
  9. Run the [Flow](https://flowtype.org/) type checks (`yarn flow`).
  10. If you haven't already, complete the CLA.

Learn more about contributing:
https://reactjs.org/docs/how-to-contribute.html
-->

## Summary

This change converts the eslint hooks plugin to typescript, which also
allows us to include type declarations in the package, for those using
[typescript eslint
configs](https://eslint.org/blog/2025/01/eslint-v9.18.0-released/#stable-typescript-configuration-file-support).

### Constituent changes that should land before this one

- [x] ~https://github.com/facebook/react/pull/32276~
- [x] https://github.com/facebook/react/pull/32279
- [x] https://github.com/facebook/react/pull/32283
- [x] https://github.com/facebook/react/pull/32393
- [x] https://github.com/facebook/react/pull/32396

Closes #30119

---------

Co-authored-by: Lauren Tan <poteto@users.noreply.github.com>
---
 .../eslint-plugin-react-hooks/babel.config.js |   8 +
 packages/eslint-plugin-react-hooks/index.js   |   9 +-
 .../eslint-plugin-react-hooks/jest.config.js  |   8 +
 .../eslint-plugin-react-hooks/npm/index.d.ts  |   1 +
 .../eslint-plugin-react-hooks/package.json    |  11 +-
 .../{ExhaustiveDeps.js => ExhaustiveDeps.ts}  | 631 +++++++++++-------
 .../src/{RulesOfHooks.js => RulesOfHooks.ts}  | 145 ++--
 .../eslint-plugin-react-hooks/src/index.js    |  61 --
 .../eslint-plugin-react-hooks/src/index.ts    |  64 ++
 .../src/types/estree.d.ts                     |   2 +
 .../eslint-plugin-react-hooks/tsconfig.json   |   1 -
 .../eslint-plugin-react-hooks/tsup.config.ts  |   9 -
 scripts/rollup/bundles.js                     |  14 +-
 yarn.lock                                     | 467 +------------
 14 files changed, 574 insertions(+), 857 deletions(-)
 create mode 100644 packages/eslint-plugin-react-hooks/babel.config.js
 create mode 100644 packages/eslint-plugin-react-hooks/jest.config.js
 create mode 100644 packages/eslint-plugin-react-hooks/npm/index.d.ts
 rename packages/eslint-plugin-react-hooks/src/{ExhaustiveDeps.js => ExhaustiveDeps.ts} (78%)
 rename packages/eslint-plugin-react-hooks/src/{RulesOfHooks.js => RulesOfHooks.ts} (85%)
 delete mode 100644 packages/eslint-plugin-react-hooks/src/index.js
 create mode 100644 packages/eslint-plugin-react-hooks/src/index.ts
 delete mode 100644 packages/eslint-plugin-react-hooks/tsup.config.ts

diff --git a/packages/eslint-plugin-react-hooks/babel.config.js b/packages/eslint-plugin-react-hooks/babel.config.js
new file mode 100644
index 0000000000000..3b947a7163bcb
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/babel.config.js
@@ -0,0 +1,8 @@
+/**
+ * This file is purely being used for local jest runs, and doesn't participate in the build process.
+ */
+'use strict';
+
+module.exports = {
+  extends: '../../babel.config-ts.js',
+};
diff --git a/packages/eslint-plugin-react-hooks/index.js b/packages/eslint-plugin-react-hooks/index.js
index 754dc9f9c7f23..ce26a10c31518 100644
--- a/packages/eslint-plugin-react-hooks/index.js
+++ b/packages/eslint-plugin-react-hooks/index.js
@@ -1,8 +1 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-export * from './src/index';
+module.exports = require('./src/index.ts');
diff --git a/packages/eslint-plugin-react-hooks/jest.config.js b/packages/eslint-plugin-react-hooks/jest.config.js
new file mode 100644
index 0000000000000..a7b91c3ef1cbe
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/jest.config.js
@@ -0,0 +1,8 @@
+'use strict';
+
+process.env.NODE_ENV = 'development';
+
+module.exports = {
+  setupFiles: [require.resolve('../../scripts/jest/setupEnvironment.js')],
+  moduleFileExtensions: ['ts', 'js', 'json'],
+};
diff --git a/packages/eslint-plugin-react-hooks/npm/index.d.ts b/packages/eslint-plugin-react-hooks/npm/index.d.ts
new file mode 100644
index 0000000000000..62ca164ec2173
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/npm/index.d.ts
@@ -0,0 +1 @@
+export * from './cjs/eslint-plugin-react-hooks';
diff --git a/packages/eslint-plugin-react-hooks/package.json b/packages/eslint-plugin-react-hooks/package.json
index b45609362faac..d3717b9dee61c 100644
--- a/packages/eslint-plugin-react-hooks/package.json
+++ b/packages/eslint-plugin-react-hooks/package.json
@@ -10,8 +10,9 @@
   "files": [
     "LICENSE",
     "README.md",
+    "cjs",
     "index.js",
-    "cjs"
+    "index.d.ts"
   ],
   "keywords": [
     "eslint",
@@ -19,10 +20,16 @@
     "eslintplugin",
     "react"
   ],
+  "scripts": {
+    "test": "jest",
+    "typecheck": "tsc --noEmit"
+  },
   "license": "MIT",
   "bugs": {
     "url": "https://github.com/facebook/react/issues"
   },
+  "main": "./index.js",
+  "types": "./index.d.ts",
   "engines": {
     "node": ">=10"
   },
@@ -32,6 +39,7 @@
   },
   "devDependencies": {
     "@babel/eslint-parser": "^7.11.4",
+    "@babel/preset-typescript": "^7.26.0",
     "@tsconfig/strictest": "^2.0.5",
     "@typescript-eslint/parser-v2": "npm:@typescript-eslint/parser@^2.26.0",
     "@typescript-eslint/parser-v3": "npm:@typescript-eslint/parser@^3.10.0",
@@ -45,7 +53,6 @@
     "eslint-v7": "npm:eslint@^7.7.0",
     "eslint-v9": "npm:eslint@^9.0.0",
     "jest": "^29.5.0",
-    "tsup": "^8.3.5",
     "typescript": "^5.4.3"
   }
 }
diff --git a/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.js b/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
similarity index 78%
rename from packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.js
rename to packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
index b2818327ff9e4..9f3d4d4db9004 100644
--- a/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.js
+++ b/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
@@ -4,12 +4,41 @@
  * This source code is licensed under the MIT license found in the
  * LICENSE file in the root directory of this source tree.
  */
-
 /* eslint-disable no-for-of-loops/no-for-of-loops */
+import type {Rule, Scope} from 'eslint';
+import type {
+  ArrayExpression,
+  ArrowFunctionExpression,
+  CallExpression,
+  Expression,
+  FunctionDeclaration,
+  FunctionExpression,
+  Identifier,
+  Node,
+  Pattern,
+  PrivateIdentifier,
+  Super,
+  VariableDeclarator,
+} from 'estree';
+
+type DeclaredDependency = {
+  key: string;
+  node: Node;
+};
 
-'use strict';
+type Dependency = {
+  isStable: boolean;
+  references: Scope.Reference[];
+};
+
+type DependencyTreeNode = {
+  isUsed: boolean; // True if used in code
+  isSatisfiedRecursively: boolean; // True if specified in deps
+  isSubtreeUsed: boolean; // True if something deeper is used by code
+  children: Map<string, DependencyTreeNode>; // Nodes for properties
+};
 
-export default {
+const rule = {
   meta: {
     type: 'suggestion',
     docs: {
@@ -36,7 +65,7 @@ export default {
       },
     ],
   },
-  create(context) {
+  create(context: Rule.RuleContext) {
     // Parse the `additionalHooks` regex.
     const additionalHooks =
       context.options &&
@@ -45,7 +74,7 @@ export default {
         ? new RegExp(context.options[0].additionalHooks)
         : undefined;
 
-    const enableDangerousAutofixThisMayCauseInfiniteLoops =
+    const enableDangerousAutofixThisMayCauseInfiniteLoops: boolean =
       (context.options &&
         context.options[0] &&
         context.options[0].enableDangerousAutofixThisMayCauseInfiniteLoops) ||
@@ -56,11 +85,15 @@ export default {
       enableDangerousAutofixThisMayCauseInfiniteLoops,
     };
 
-    function reportProblem(problem) {
+    function reportProblem(problem: Rule.ReportDescriptor) {
       if (enableDangerousAutofixThisMayCauseInfiniteLoops) {
         // Used to enable legacy behavior. Dangerous.
         // Keep this as an option until major IDEs upgrade (including VSCode FB ESLint extension).
-        if (Array.isArray(problem.suggest) && problem.suggest.length > 0) {
+        if (
+          Array.isArray(problem.suggest) &&
+          problem.suggest.length > 0 &&
+          problem.suggest[0]
+        ) {
           problem.fix = problem.suggest[0].fix;
         }
       }
@@ -68,15 +101,15 @@ export default {
     }
 
     /**
-     * SourceCode#getText that also works down to ESLint 3.0.0
+     * SourceCode that also works down to ESLint 3.0.0
      */
-    const getSource =
-      typeof context.getSource === 'function'
-        ? node => {
-            return context.getSource(node);
+    const getSourceCode =
+      typeof context.getSourceCode === 'function'
+        ? () => {
+            return context.getSourceCode();
           }
-        : node => {
-            return context.sourceCode.getText(node);
+        : () => {
+            return context.sourceCode;
           };
     /**
      * SourceCode#getScope that also works down to ESLint 3.0.0
@@ -86,24 +119,34 @@ export default {
         ? () => {
             return context.getScope();
           }
-        : node => {
+        : (node: Node) => {
             return context.sourceCode.getScope(node);
           };
 
-    const scopeManager = context.getSourceCode().scopeManager;
+    const scopeManager = getSourceCode().scopeManager;
 
     // Should be shared between visitors.
-    const setStateCallSites = new WeakMap();
-    const stateVariables = new WeakSet();
-    const stableKnownValueCache = new WeakMap();
-    const functionWithoutCapturedValueCache = new WeakMap();
-    const useEffectEventVariables = new WeakSet();
-    function memoizeWithWeakMap(fn, map) {
-      return function (arg) {
+    const setStateCallSites = new WeakMap<
+      Expression | Super,
+      Pattern | null | undefined
+    >();
+    const stateVariables = new WeakSet<Identifier>();
+    const stableKnownValueCache = new WeakMap<Scope.Variable, boolean>();
+    const functionWithoutCapturedValueCache = new WeakMap<
+      Scope.Variable,
+      boolean
+    >();
+    const useEffectEventVariables = new WeakSet<Expression>();
+
+    function memoizeWithWeakMap(
+      fn: (resolved: Scope.Variable) => boolean,
+      map: WeakMap<Scope.Variable, boolean>,
+    ) {
+      return function (arg: Scope.Variable): boolean {
         if (map.has(arg)) {
           // to verify cache hits:
           // console.log(arg.name)
-          return map.get(arg);
+          return map.get(arg)!;
         }
         const result = fn(arg);
         map.set(arg, result);
@@ -114,12 +157,12 @@ export default {
      * Visitor for both function expressions and arrow function expressions.
      */
     function visitFunctionWithDependencies(
-      node,
-      declaredDependenciesNode,
-      reactiveHook,
-      reactiveHookName,
-      isEffect,
-    ) {
+      node: ArrowFunctionExpression | FunctionDeclaration | FunctionExpression,
+      declaredDependenciesNode: Node | undefined,
+      reactiveHook: Node,
+      reactiveHookName: string,
+      isEffect: boolean,
+    ): void {
       if (isEffect && node.async) {
         reportProblem({
           node: node,
@@ -140,6 +183,9 @@ export default {
 
       // Get the current scope.
       const scope = scopeManager.acquire(node);
+      if (!scope) {
+        return;
+      }
 
       // Find all our "pure scopes". On every re-render of a component these
       // pure scopes may have changes to the variables declared within. So all
@@ -150,7 +196,7 @@ export default {
       // scope. We can't enforce this in a lint so we trust that all variables
       // declared outside of pure scope are indeed frozen.
       const pureScopes = new Set();
-      let componentScope = null;
+      let componentScope: Scope.Scope | null = null;
       {
         let currentScope = scope.upper;
         while (currentScope) {
@@ -186,7 +232,7 @@ export default {
       // const onStuff = useEffectEvent(() => {})
       //       ^^^ true for this reference
       // False for everything else.
-      function isStableKnownHookValue(resolved) {
+      function isStableKnownHookValue(resolved: Scope.Variable): boolean {
         if (!isArray(resolved.defs)) {
           return false;
         }
@@ -195,10 +241,11 @@ export default {
           return false;
         }
         // Look for `let stuff = ...`
-        if (def.node.type !== 'VariableDeclarator') {
+        const defNode: VariableDeclarator = def.node;
+        if (defNode.type !== 'VariableDeclarator') {
           return false;
         }
-        let init = def.node.init;
+        let init = defNode.init;
         if (init == null) {
           return false;
         }
@@ -207,8 +254,8 @@ export default {
         }
         // Detect primitive constants
         // const foo = 42
-        let declaration = def.node.parent;
-        if (declaration == null) {
+        let declaration = defNode.parent;
+        if (declaration == null && componentScope) {
           // This might happen if variable is declared after the callback.
           // In that case ESLint won't set up .parent refs.
           // So we'll set them up manually.
@@ -219,6 +266,8 @@ export default {
           }
         }
         if (
+          declaration &&
+          'kind' in declaration &&
           declaration.kind === 'const' &&
           init.type === 'Literal' &&
           (typeof init.value === 'string' ||
@@ -233,10 +282,11 @@ export default {
         if (init.type !== 'CallExpression') {
           return false;
         }
-        let callee = init.callee;
+        let callee: Expression | PrivateIdentifier | Super = init.callee;
         // Step into `= React.something` initializer.
         if (
           callee.type === 'MemberExpression' &&
+          'name' in callee.object &&
           callee.object.name === 'React' &&
           callee.property != null &&
           !callee.computed
@@ -246,7 +296,8 @@ export default {
         if (callee.type !== 'Identifier') {
           return false;
         }
-        const id = def.node.id;
+        const definitionNode: VariableDeclarator = def.node;
+        const id = definitionNode.id;
         const {name} = callee;
         if (name === 'useRef' && id.type === 'Identifier') {
           // useRef() return value is stable.
@@ -256,6 +307,7 @@ export default {
           id.type === 'Identifier'
         ) {
           for (const ref of resolved.references) {
+            // @ts-expect-error These types are not compatible (Reference and Identifier)
             if (ref !== id) {
               useEffectEventVariables.add(ref.identifier);
             }
@@ -278,17 +330,14 @@ export default {
               if (name === 'useState') {
                 const references = resolved.references;
                 let writeCount = 0;
-                for (let i = 0; i < references.length; i++) {
-                  if (references[i].isWrite()) {
+                for (const reference of references) {
+                  if (reference.isWrite()) {
                     writeCount++;
                   }
                   if (writeCount > 1) {
                     return false;
                   }
-                  setStateCallSites.set(
-                    references[i].identifier,
-                    id.elements[0],
-                  );
+                  setStateCallSites.set(reference.identifier, id.elements[0]);
                 }
               }
               // Setter is stable.
@@ -296,8 +345,8 @@ export default {
             } else if (id.elements[0] === resolved.identifiers[0]) {
               if (name === 'useState') {
                 const references = resolved.references;
-                for (let i = 0; i < references.length; i++) {
-                  stateVariables.add(references[i].identifier);
+                for (const reference of references) {
+                  stateVariables.add(reference.identifier);
                 }
               }
               // State variable itself is dynamic.
@@ -323,7 +372,9 @@ export default {
       }
 
       // Some are just functions that don't reference anything dynamic.
-      function isFunctionWithoutCapturedValues(resolved) {
+      function isFunctionWithoutCapturedValues(
+        resolved: Scope.Variable,
+      ): boolean {
         if (!isArray(resolved.defs)) {
           return false;
         }
@@ -336,12 +387,10 @@ export default {
         }
         // Search the direct component subscopes for
         // top-level function definitions matching this reference.
-        const fnNode = def.node;
-        const childScopes = componentScope.childScopes;
+        const fnNode: Node = def.node;
+        const childScopes = componentScope?.childScopes || [];
         let fnScope = null;
-        let i;
-        for (i = 0; i < childScopes.length; i++) {
-          const childScope = childScopes[i];
+        for (const childScope of childScopes) {
           const childScopeBlock = childScope.block;
           if (
             // function handleChange() {}
@@ -362,8 +411,7 @@ export default {
         }
         // Does this function capture any values
         // that are in pure scopes (aka render)?
-        for (i = 0; i < fnScope.through.length; i++) {
-          const ref = fnScope.through[i];
+        for (const ref of fnScope.through) {
           if (ref.resolved == null) {
             continue;
           }
@@ -392,15 +440,21 @@ export default {
       );
 
       // These are usually mistaken. Collect them.
-      const currentRefsInEffectCleanup = new Map();
+      const currentRefsInEffectCleanup = new Map<
+        string,
+        {
+          reference: Scope.Reference;
+          dependencyNode: Identifier;
+        }
+      >();
 
       // Is this reference inside a cleanup function for this effect node?
       // We can check by traversing scopes upwards from the reference, and checking
       // if the last "return () => " we encounter is located directly inside the effect.
-      function isInsideEffectCleanup(reference) {
-        let curScope = reference.from;
+      function isInsideEffectCleanup(reference: Scope.Reference): boolean {
+        let curScope: Scope.Scope | null = reference.from;
         let isInReturnedFunction = false;
-        while (curScope.block !== node) {
+        while (curScope && curScope.block !== node) {
           if (curScope.type === 'function') {
             isInReturnedFunction =
               curScope.block.parent != null &&
@@ -413,11 +467,11 @@ export default {
 
       // Get dependencies from all our resolved references in pure scopes.
       // Key is dependency string, value is whether it's stable.
-      const dependencies = new Map();
-      const optionalChains = new Map();
+      const dependencies = new Map<string, Dependency>();
+      const optionalChains = new Map<string, boolean>();
       gatherDependenciesRecursively(scope);
 
-      function gatherDependenciesRecursively(currentScope) {
+      function gatherDependenciesRecursively(currentScope: Scope.Scope): void {
         for (const reference of currentScope.references) {
           // If this reference is not resolved or it is not declared in a pure
           // scope then we don't care about this reference.
@@ -434,6 +488,9 @@ export default {
             node,
             reference.identifier,
           );
+          if (referenceNode == null) {
+            continue;
+          }
           const dependencyNode = getDependency(referenceNode);
           const dependency = analyzePropertyChain(
             dependencyNode,
@@ -446,8 +503,8 @@ export default {
             isEffect &&
             // ... and this look like accessing .current...
             dependencyNode.type === 'Identifier' &&
-            (dependencyNode.parent.type === 'MemberExpression' ||
-              dependencyNode.parent.type === 'OptionalMemberExpression') &&
+            (dependencyNode.parent?.type === 'MemberExpression' ||
+              dependencyNode.parent?.type === 'OptionalMemberExpression') &&
             !dependencyNode.parent.computed &&
             dependencyNode.parent.property.type === 'Identifier' &&
             dependencyNode.parent.property.name === 'current' &&
@@ -461,8 +518,8 @@ export default {
           }
 
           if (
-            dependencyNode.parent.type === 'TSTypeQuery' ||
-            dependencyNode.parent.type === 'TSTypeReference'
+            dependencyNode.parent?.type === 'TSTypeQuery' ||
+            dependencyNode.parent?.type === 'TSTypeReference'
           ) {
             continue;
           }
@@ -472,10 +529,11 @@ export default {
             continue;
           }
           // Ignore references to the function itself as it's not defined yet.
-          if (def.node != null && def.node.init === node.parent) {
+          if (def.node && def.node.init === node.parent) {
             continue;
           }
           // Ignore Flow type parameters
+          // @ts-expect-error We don't have flow types
           if (def.type === 'TypeParameter') {
             continue;
           }
@@ -492,7 +550,7 @@ export default {
               references: [reference],
             });
           } else {
-            dependencies.get(dependency).references.push(reference);
+            dependencies.get(dependency)?.references.push(reference);
           }
         }
 
@@ -504,12 +562,12 @@ export default {
       // Warn about accessing .current in cleanup effects.
       currentRefsInEffectCleanup.forEach(
         ({reference, dependencyNode}, dependency) => {
-          const references = reference.resolved.references;
+          const references = reference.resolved?.references || [];
           // Is React managing this ref or us?
           // Let's see if we can find a .current assignment.
           let foundCurrentAssignment = false;
-          for (let i = 0; i < references.length; i++) {
-            const {identifier} = references[i];
+          for (const reference of references) {
+            const {identifier} = reference;
             const {parent} = identifier;
             if (
               parent != null &&
@@ -520,7 +578,7 @@ export default {
               parent.property.type === 'Identifier' &&
               parent.property.name === 'current' &&
               // ref.current = <something>
-              parent.parent.type === 'AssignmentExpression' &&
+              parent.parent?.type === 'AssignmentExpression' &&
               parent.parent.left === parent
             ) {
               foundCurrentAssignment = true;
@@ -532,6 +590,7 @@ export default {
             return;
           }
           reportProblem({
+            // @ts-expect-error We can do better here (dependencyNode.parent has not been type narrowed)
             node: dependencyNode.parent.property,
             message:
               `The ref value '${dependency}.current' will likely have ` +
@@ -545,8 +604,8 @@ export default {
 
       // Warn about assigning to variables in the outer scope.
       // Those are usually bugs.
-      const staleAssignments = new Set();
-      function reportStaleAssignment(writeExpr, key) {
+      const staleAssignments = new Set<string>();
+      function reportStaleAssignment(writeExpr: Node, key: string): void {
         if (staleAssignments.has(key)) {
           return;
         }
@@ -555,16 +614,16 @@ export default {
           node: writeExpr,
           message:
             `Assignments to the '${key}' variable from inside React Hook ` +
-            `${getSource(reactiveHook)} will be lost after each ` +
+            `${getSourceCode().getText(reactiveHook)} will be lost after each ` +
             `render. To preserve the value over time, store it in a useRef ` +
             `Hook and keep the mutable value in the '.current' property. ` +
             `Otherwise, you can move this variable directly inside ` +
-            `${getSource(reactiveHook)}.`,
+            `${getSourceCode().getText(reactiveHook)}.`,
         });
       }
 
       // Remember which deps are stable and report bad usage first.
-      const stableDependencies = new Set();
+      const stableDependencies = new Set<string>();
       dependencies.forEach(({isStable, references}, key) => {
         if (isStable) {
           stableDependencies.add(key);
@@ -584,8 +643,8 @@ export default {
       if (!declaredDependenciesNode) {
         // Check if there are any top-level setState() calls.
         // Those tend to lead to infinite loops.
-        let setStateInsideEffectWithoutDeps = null;
-        dependencies.forEach(({isStable, references}, key) => {
+        let setStateInsideEffectWithoutDeps: string | null = null;
+        dependencies.forEach(({references}, key) => {
           if (setStateInsideEffectWithoutDeps) {
             return;
           }
@@ -600,11 +659,11 @@ export default {
               return;
             }
 
-            let fnScope = reference.from;
-            while (fnScope.type !== 'function') {
+            let fnScope: Scope.Scope | null = reference.from;
+            while (fnScope && fnScope.type !== 'function') {
               fnScope = fnScope.upper;
             }
-            const isDirectlyInsideEffect = fnScope.block === node;
+            const isDirectlyInsideEffect = fnScope?.block === node;
             if (isDirectlyInsideEffect) {
               // TODO: we could potentially ignore early returns.
               setStateInsideEffectWithoutDeps = key;
@@ -616,7 +675,7 @@ export default {
             dependencies,
             declaredDependencies: [],
             stableDependencies,
-            externalDependencies: new Set(),
+            externalDependencies: new Set<string>(),
             isEffect: true,
           });
           reportProblem({
@@ -645,8 +704,8 @@ export default {
         return;
       }
 
-      const declaredDependencies = [];
-      const externalDependencies = new Set();
+      const declaredDependencies: DeclaredDependency[] = [];
+      const externalDependencies = new Set<string>();
       const isArrayExpression =
         declaredDependenciesNode.type === 'ArrayExpression';
       const isTSAsArrayExpression =
@@ -660,7 +719,7 @@ export default {
         reportProblem({
           node: declaredDependenciesNode,
           message:
-            `React Hook ${getSource(reactiveHook)} was passed a ` +
+            `React Hook ${getSourceCode().getText(reactiveHook)} was passed a ` +
             'dependency list that is not an array literal. This means we ' +
             "can't statically verify whether you've passed the correct " +
             'dependencies.',
@@ -670,108 +729,117 @@ export default {
           ? declaredDependenciesNode.expression
           : declaredDependenciesNode;
 
-        arrayExpression.elements.forEach(declaredDependencyNode => {
-          // Skip elided elements.
-          if (declaredDependencyNode === null) {
-            return;
-          }
-          // If we see a spread element then add a special warning.
-          if (declaredDependencyNode.type === 'SpreadElement') {
-            reportProblem({
-              node: declaredDependencyNode,
-              message:
-                `React Hook ${getSource(reactiveHook)} has a spread ` +
-                "element in its dependency array. This means we can't " +
-                "statically verify whether you've passed the " +
-                'correct dependencies.',
-            });
-            return;
-          }
-          if (useEffectEventVariables.has(declaredDependencyNode)) {
-            reportProblem({
-              node: declaredDependencyNode,
-              message:
-                'Functions returned from `useEffectEvent` must not be included in the dependency array. ' +
-                `Remove \`${getSource(
-                  declaredDependencyNode,
-                )}\` from the list.`,
-              suggest: [
-                {
-                  desc: `Remove the dependency \`${getSource(
+        (arrayExpression as ArrayExpression).elements.forEach(
+          declaredDependencyNode => {
+            // Skip elided elements.
+            if (declaredDependencyNode === null) {
+              return;
+            }
+            // If we see a spread element then add a special warning.
+            if (declaredDependencyNode.type === 'SpreadElement') {
+              reportProblem({
+                node: declaredDependencyNode,
+                message:
+                  `React Hook ${getSourceCode().getText(reactiveHook)} has a spread ` +
+                  "element in its dependency array. This means we can't " +
+                  "statically verify whether you've passed the " +
+                  'correct dependencies.',
+              });
+              return;
+            }
+            if (useEffectEventVariables.has(declaredDependencyNode)) {
+              reportProblem({
+                node: declaredDependencyNode,
+                message:
+                  'Functions returned from `useEffectEvent` must not be included in the dependency array. ' +
+                  `Remove \`${getSourceCode().getText(
                     declaredDependencyNode,
-                  )}\``,
-                  fix(fixer) {
-                    return fixer.removeRange(declaredDependencyNode.range);
+                  )}\` from the list.`,
+                suggest: [
+                  {
+                    desc: `Remove the dependency \`${getSourceCode().getText(
+                      declaredDependencyNode,
+                    )}\``,
+                    fix(fixer) {
+                      return fixer.removeRange(declaredDependencyNode.range!);
+                    },
                   },
-                },
-              ],
-            });
-          }
-          // Try to normalize the declared dependency. If we can't then an error
-          // will be thrown. We will catch that error and report an error.
-          let declaredDependency;
-          try {
-            declaredDependency = analyzePropertyChain(
-              declaredDependencyNode,
-              null,
-            );
-          } catch (error) {
-            if (/Unsupported node type/.test(error.message)) {
-              if (declaredDependencyNode.type === 'Literal') {
-                if (dependencies.has(declaredDependencyNode.value)) {
-                  reportProblem({
-                    node: declaredDependencyNode,
-                    message:
-                      `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
-                      `because it never changes. ` +
-                      `Did you mean to include ${declaredDependencyNode.value} in the array instead?`,
-                  });
+                ],
+              });
+            }
+            // Try to normalize the declared dependency. If we can't then an error
+            // will be thrown. We will catch that error and report an error.
+            let declaredDependency;
+            try {
+              declaredDependency = analyzePropertyChain(
+                declaredDependencyNode,
+                null,
+              );
+            } catch (error: unknown) {
+              if (
+                error instanceof Error &&
+                /Unsupported node type/.test(error.message)
+              ) {
+                if (declaredDependencyNode.type === 'Literal') {
+                  if (
+                    declaredDependencyNode.value &&
+                    dependencies.has(declaredDependencyNode.value as string)
+                  ) {
+                    reportProblem({
+                      node: declaredDependencyNode,
+                      message:
+                        `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
+                        `because it never changes. ` +
+                        `Did you mean to include ${declaredDependencyNode.value} in the array instead?`,
+                    });
+                  } else {
+                    reportProblem({
+                      node: declaredDependencyNode,
+                      message:
+                        `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
+                        'because it never changes. You can safely remove it.',
+                    });
+                  }
                 } else {
                   reportProblem({
                     node: declaredDependencyNode,
                     message:
-                      `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
-                      'because it never changes. You can safely remove it.',
+                      `React Hook ${getSourceCode().getText(reactiveHook)} has a ` +
+                      `complex expression in the dependency array. ` +
+                      'Extract it to a separate variable so it can be statically checked.',
                   });
                 }
+
+                return;
               } else {
-                reportProblem({
-                  node: declaredDependencyNode,
-                  message:
-                    `React Hook ${getSource(reactiveHook)} has a ` +
-                    `complex expression in the dependency array. ` +
-                    'Extract it to a separate variable so it can be statically checked.',
-                });
+                throw error;
               }
-
-              return;
-            } else {
-              throw error;
             }
-          }
 
-          let maybeID = declaredDependencyNode;
-          while (
-            maybeID.type === 'MemberExpression' ||
-            maybeID.type === 'OptionalMemberExpression' ||
-            maybeID.type === 'ChainExpression'
-          ) {
-            maybeID = maybeID.object || maybeID.expression.object;
-          }
-          const isDeclaredInComponent = !componentScope.through.some(
-            ref => ref.identifier === maybeID,
-          );
+            let maybeID = declaredDependencyNode;
+            while (
+              maybeID.type === 'MemberExpression' ||
+              maybeID.type === 'OptionalMemberExpression' ||
+              maybeID.type === 'ChainExpression'
+            ) {
+              // @ts-expect-error This can be done better
+              maybeID = maybeID.object || maybeID.expression.object;
+            }
+            const isDeclaredInComponent = !componentScope.through.some(
+              ref => ref.identifier === maybeID,
+            );
 
-          // Add the dependency to our declared dependency map.
-          declaredDependencies.push({
-            key: declaredDependency,
-            node: declaredDependencyNode,
-          });
+            // Add the dependency to our declared dependency map.
+            declaredDependencies.push({
+              key: declaredDependency,
+              node: declaredDependencyNode,
+            });
 
-          if (!isDeclaredInComponent) {
-            externalDependencies.add(declaredDependency);
-          }
-        });
+            if (!isDeclaredInComponent) {
+              externalDependencies.add(declaredDependency);
+            }
+          },
+        );
       }
 
       const {
@@ -824,10 +892,10 @@ export default {
 
             const message =
               `The '${construction.name.name}' ${depType} ${causation} the dependencies of ` +
-              `${reactiveHookName} Hook (at line ${declaredDependenciesNode.loc.start.line}) ` +
+              `${reactiveHookName} Hook (at line ${declaredDependenciesNode.loc?.start.line}) ` +
               `change on every render. ${advice}`;
 
-            let suggest;
+            let suggest: Rule.ReportDescriptor['suggest'];
             // Only handle the simple case of variable assignments.
             // Wrapping function declarations can mess up hoisting.
             if (
@@ -848,12 +916,12 @@ export default {
                         : ['useCallback(', ')'];
                     return [
                       // TODO: also add an import?
-                      fixer.insertTextBefore(construction.node.init, before),
+                      fixer.insertTextBefore(construction.node.init!, before),
                       // TODO: ideally we'd gather deps here but it would require
                       // restructuring the rule code. This will cause a new lint
                       // error to appear immediately for useCallback. Note we're
                       // not adding [] because would that changes semantics.
-                      fixer.insertTextAfter(construction.node.init, after),
+                      fixer.insertTextAfter(construction.node.init!, after),
                     ];
                   },
                 },
@@ -889,7 +957,7 @@ export default {
       }
 
       // Alphabetize the suggestions, but only if deps were already alphabetized.
-      function areDeclaredDepsAlphabetized() {
+      function areDeclaredDepsAlphabetized(): boolean {
         if (declaredDependencies.length === 0) {
           return true;
         }
@@ -905,7 +973,7 @@ export default {
       // This function is the last step before printing a dependency, so now is a good time to
       // check whether any members in our path are always used as optional-only. In that case,
       // we will use ?. instead of . to concatenate those parts of the path.
-      function formatDependency(path) {
+      function formatDependency(path: string): string {
         const members = path.split('.');
         let finalPath = '';
         for (let i = 0; i < members.length; i++) {
@@ -919,7 +987,12 @@ export default {
         return finalPath;
       }
 
-      function getWarningMessage(deps, singlePrefix, label, fixVerb) {
+      function getWarningMessage(
+        deps: Set<string>,
+        singlePrefix: string,
+        label: string,
+        fixVerb: string,
+      ): string | null {
         if (deps.size === 0) {
           return null;
         }
@@ -942,7 +1015,7 @@ export default {
 
       let extraWarning = '';
       if (unnecessaryDependencies.size > 0) {
-        let badRef = null;
+        let badRef: string | null = null;
         Array.from(unnecessaryDependencies.keys()).forEach(key => {
           if (badRef !== null) {
             return;
@@ -956,7 +1029,7 @@ export default {
             ` Mutable values like '${badRef}' aren't valid dependencies ` +
             "because mutating them doesn't re-render the component.";
         } else if (externalDependencies.size > 0) {
-          const dep = Array.from(externalDependencies)[0];
+          const dep = Array.from(externalDependencies)[0]!;
           // Don't show this warning for things that likely just got moved *inside* the callback
           // because in that case they're clearly not referring to globals.
           if (!scope.set.has(dep)) {
@@ -980,8 +1053,7 @@ export default {
           return;
         }
         let isPropsOnlyUsedInMembers = true;
-        for (let i = 0; i < refs.length; i++) {
-          const ref = refs[i];
+        for (const ref of refs) {
           const id = fastFindReferenceWithParent(
             componentScope.block,
             ref.identifier,
@@ -1008,14 +1080,14 @@ export default {
             ` However, 'props' will change when *any* prop changes, so the ` +
             `preferred fix is to destructure the 'props' object outside of ` +
             `the ${reactiveHookName} call and refer to those specific props ` +
-            `inside ${getSource(reactiveHook)}.`;
+            `inside ${getSourceCode().getText(reactiveHook)}.`;
         }
       }
 
       if (!extraWarning && missingDependencies.size > 0) {
         // See if the user is trying to avoid specifying a callable prop.
         // This usually means they're unaware of useCallback.
-        let missingCallbackDep = null;
+        let missingCallbackDep: string | null = null;
         missingDependencies.forEach(missingDep => {
           if (missingCallbackDep) {
             return;
@@ -1023,19 +1095,22 @@ export default {
           // Is this a variable from top scope?
           const topScopeRef = componentScope.set.get(missingDep);
           const usedDep = dependencies.get(missingDep);
-          if (usedDep.references[0].resolved !== topScopeRef) {
+          if (
+            !usedDep?.references ||
+            usedDep?.references[0]?.resolved !== topScopeRef
+          ) {
             return;
           }
           // Is this a destructured prop?
-          const def = topScopeRef.defs[0];
+          const def = topScopeRef?.defs[0];
           if (def == null || def.name == null || def.type !== 'Parameter') {
             return;
           }
           // Was it called in at least one case? Then it's a function.
           let isFunctionCall = false;
-          let id;
-          for (let i = 0; i < usedDep.references.length; i++) {
-            id = usedDep.references[i].identifier;
+          let id: Identifier | undefined;
+          for (const reference of usedDep.references) {
+            id = reference.identifier;
             if (
               id != null &&
               id.parent != null &&
@@ -1064,17 +1139,21 @@ export default {
       }
 
       if (!extraWarning && missingDependencies.size > 0) {
-        let setStateRecommendation = null;
-        missingDependencies.forEach(missingDep => {
+        let setStateRecommendation: {
+          missingDep: string;
+          setter: string;
+          form: 'reducer' | 'updater' | 'inlineReducer';
+        } | null = null;
+        for (const missingDep of missingDependencies) {
           if (setStateRecommendation !== null) {
-            return;
+            break;
           }
-          const usedDep = dependencies.get(missingDep);
+          const usedDep = dependencies.get(missingDep)!;
           const references = usedDep.references;
           let id;
           let maybeCall;
-          for (let i = 0; i < references.length; i++) {
-            id = references[i].identifier;
+          for (const reference of references) {
+            id = reference.identifier;
             maybeCall = id.parent;
             // Try to see if we have setState(someExpr(missingDep)).
             while (maybeCall != null && maybeCall !== componentScope.block) {
@@ -1083,22 +1162,27 @@ export default {
                   maybeCall.callee,
                 );
                 if (correspondingStateVariable != null) {
-                  if (correspondingStateVariable.name === missingDep) {
+                  if (
+                    'name' in correspondingStateVariable &&
+                    correspondingStateVariable.name === missingDep
+                  ) {
                     // setCount(count + 1)
                     setStateRecommendation = {
                       missingDep,
-                      setter: maybeCall.callee.name,
+                      setter:
+                        'name' in maybeCall.callee ? maybeCall.callee.name : '',
                       form: 'updater',
                     };
                   } else if (stateVariables.has(id)) {
                     // setCount(count + increment)
                     setStateRecommendation = {
                       missingDep,
-                      setter: maybeCall.callee.name,
+                      setter:
+                        'name' in maybeCall.callee ? maybeCall.callee.name : '',
                       form: 'reducer',
                     };
                   } else {
-                    const resolved = references[i].resolved;
+                    const resolved = reference.resolved;
                     if (resolved != null) {
                       // If it's a parameter *and* a missing dep,
                       // it must be a prop or something inside a prop.
@@ -1107,7 +1191,10 @@ export default {
                       if (def != null && def.type === 'Parameter') {
                         setStateRecommendation = {
                           missingDep,
-                          setter: maybeCall.callee.name,
+                          setter:
+                            'name' in maybeCall.callee
+                              ? maybeCall.callee.name
+                              : '',
                           form: 'inlineReducer',
                         };
                       }
@@ -1122,7 +1209,7 @@ export default {
               break;
             }
           }
-        });
+        }
         if (setStateRecommendation !== null) {
           switch (setStateRecommendation.form) {
             case 'reducer':
@@ -1158,7 +1245,7 @@ export default {
       reportProblem({
         node: declaredDependenciesNode,
         message:
-          `React Hook ${getSource(reactiveHook)} has ` +
+          `React Hook ${getSourceCode().getText(reactiveHook)} has ` +
           // To avoid a long message, show the next actionable item.
           (getWarningMessage(missingDependencies, 'a', 'missing', 'include') ||
             getWarningMessage(
@@ -1191,7 +1278,7 @@ export default {
       });
     }
 
-    function visitCallExpression(node) {
+    function visitCallExpression(node: CallExpression): void {
       const callbackIndex = getReactiveHookCallbackIndex(node.callee, options);
       if (callbackIndex === -1) {
         // Not a React Hook call that needs deps.
@@ -1199,7 +1286,9 @@ export default {
       }
       let callback = node.arguments[callbackIndex];
       const reactiveHook = node.callee;
-      const reactiveHookName = getNodeWithoutReactNamespace(reactiveHook).name;
+      const nodeWithoutNamespace = getNodeWithoutReactNamespace(reactiveHook);
+      const reactiveHookName =
+        'name' in nodeWithoutNamespace ? nodeWithoutNamespace.name : '';
       const maybeNode = node.arguments[callbackIndex + 1];
       const declaredDependenciesNode =
         maybeNode &&
@@ -1268,6 +1357,7 @@ export default {
           // The function passed as a callback is not written inline.
           // But perhaps it's in the dependencies array?
           if (
+            'elements' in declaredDependenciesNode &&
             declaredDependenciesNode.elements &&
             declaredDependenciesNode.elements.some(
               el => el && el.type === 'Identifier' && el.name === callback.name,
@@ -1368,7 +1458,7 @@ export default {
       CallExpression: visitCallExpression,
     };
   },
-};
+} satisfies Rule.RuleModule;
 
 // The meat of the logic.
 function collectRecommendations({
@@ -1377,6 +1467,12 @@ function collectRecommendations({
   stableDependencies,
   externalDependencies,
   isEffect,
+}: {
+  dependencies: Map<string, Dependency>;
+  declaredDependencies: DeclaredDependency[];
+  stableDependencies: Set<string>;
+  externalDependencies: Set<string>;
+  isEffect: boolean;
 }) {
   // Our primary data structure.
   // It is a logical representation of property chains:
@@ -1388,7 +1484,7 @@ function collectRecommendations({
   // and the nodes that were *declared* as deps. Then we will
   // traverse it to learn which deps are missing or unnecessary.
   const depTree = createDepTree();
-  function createDepTree() {
+  function createDepTree(): DependencyTreeNode {
     return {
       isUsed: false, // True if used in code
       isSatisfiedRecursively: false, // True if specified in deps
@@ -1419,7 +1515,10 @@ function collectRecommendations({
   });
 
   // Tree manipulation helpers.
-  function getOrCreateNodeByPath(rootNode, path) {
+  function getOrCreateNodeByPath(
+    rootNode: DependencyTreeNode,
+    path: string,
+  ): DependencyTreeNode {
     const keys = path.split('.');
     let node = rootNode;
     for (const key of keys) {
@@ -1432,7 +1531,11 @@ function collectRecommendations({
     }
     return node;
   }
-  function markAllParentsByPath(rootNode, path, fn) {
+  function markAllParentsByPath(
+    rootNode: DependencyTreeNode,
+    path: string,
+    fn: (node: DependencyTreeNode) => void,
+  ): void {
     const keys = path.split('.');
     let node = rootNode;
     for (const key of keys) {
@@ -1446,15 +1549,20 @@ function collectRecommendations({
   }
 
   // Now we can learn which dependencies are missing or necessary.
-  const missingDependencies = new Set();
-  const satisfyingDependencies = new Set();
+  const missingDependencies = new Set<string>();
+  const satisfyingDependencies = new Set<string>();
   scanTreeRecursively(
     depTree,
     missingDependencies,
     satisfyingDependencies,
     key => key,
   );
-  function scanTreeRecursively(node, missingPaths, satisfyingPaths, keyToPath) {
+  function scanTreeRecursively(
+    node: DependencyTreeNode,
+    missingPaths: Set<string>,
+    satisfyingPaths: Set<string>,
+    keyToPath: (key: string) => string,
+  ): void {
     node.children.forEach((child, key) => {
       const path = keyToPath(key);
       if (child.isSatisfiedRecursively) {
@@ -1484,9 +1592,9 @@ function collectRecommendations({
   }
 
   // Collect suggestions in the order they were originally specified.
-  const suggestedDependencies = [];
-  const unnecessaryDependencies = new Set();
-  const duplicateDependencies = new Set();
+  const suggestedDependencies: string[] = [];
+  const unnecessaryDependencies = new Set<string>();
+  const duplicateDependencies = new Set<string>();
   declaredDependencies.forEach(({key}) => {
     // Does this declared dep satisfy a real need?
     if (satisfyingDependencies.has(key)) {
@@ -1532,7 +1640,7 @@ function collectRecommendations({
 
 // If the node will result in constructing a referentially unique value, return
 // its human readable type name, else return null.
-function getConstructionExpressionType(node) {
+function getConstructionExpressionType(node: Node): string | null {
   switch (node.type) {
     case 'ObjectExpression':
       return 'object';
@@ -1590,6 +1698,11 @@ function scanForConstructions({
   declaredDependenciesNode,
   componentScope,
   scope,
+}: {
+  declaredDependencies: DeclaredDependency[];
+  declaredDependenciesNode: Node;
+  componentScope: Scope.Scope;
+  scope: Scope.Scope;
 }) {
   const constructions = declaredDependencies
     .map(({key}) => {
@@ -1616,7 +1729,7 @@ function scanForConstructions({
         const constantExpressionType = getConstructionExpressionType(
           node.node.init,
         );
-        if (constantExpressionType != null) {
+        if (constantExpressionType) {
           return [ref, constantExpressionType];
         }
       }
@@ -1634,12 +1747,11 @@ function scanForConstructions({
       }
       return null;
     })
-    .filter(Boolean);
+    .filter(Boolean) as [Scope.Variable, string][];
 
-  function isUsedOutsideOfHook(ref) {
+  function isUsedOutsideOfHook(ref: Scope.Variable): boolean {
     let foundWriteExpr = false;
-    for (let i = 0; i < ref.references.length; i++) {
-      const reference = ref.references[i];
+    for (const reference of ref.references) {
       if (reference.writeExpr) {
         if (foundWriteExpr) {
           // Two writes to the same function.
@@ -1650,7 +1762,7 @@ function scanForConstructions({
           continue;
         }
       }
-      let currentScope = reference.from;
+      let currentScope: Scope.Scope | null = reference.from;
       while (currentScope !== scope && currentScope != null) {
         currentScope = currentScope.upper;
       }
@@ -1666,7 +1778,7 @@ function scanForConstructions({
   }
 
   return constructions.map(([ref, depType]) => ({
-    construction: ref.defs[0],
+    construction: ref.defs[0] as Scope.Definition,
     depType,
     isUsedOutsideOfHook: isUsedOutsideOfHook(ref),
   }));
@@ -1679,11 +1791,13 @@ function scanForConstructions({
  * props.foo.(bar) => (props).foo.bar
  * props.foo.bar.(baz) => (props).foo.bar.baz
  */
-function getDependency(node) {
+function getDependency(node: Node): Node {
   if (
+    node.parent &&
     (node.parent.type === 'MemberExpression' ||
       node.parent.type === 'OptionalMemberExpression') &&
     node.parent.object === node &&
+    'name' in node.parent.property &&
     node.parent.property.name !== 'current' &&
     !node.parent.computed &&
     !(
@@ -1713,9 +1827,13 @@ function getDependency(node) {
  * It just means there is an optional member somewhere inside.
  * This particular node might still represent a required member, so check .optional field.
  */
-function markNode(node, optionalChains, result) {
+function markNode(
+  node: Node,
+  optionalChains: Map<string, boolean> | null,
+  result: string,
+): void {
   if (optionalChains) {
-    if (node.optional) {
+    if ('optional' in node && node.optional) {
       // We only want to consider it optional if *all* usages were optional.
       if (!optionalChains.has(result)) {
         // Mark as (maybe) optional. If there's a required usage, this will be overridden.
@@ -1735,7 +1853,10 @@ function markNode(node, optionalChains, result) {
  * foo.bar(.)baz -> 'foo.bar.baz'
  * Otherwise throw.
  */
-function analyzePropertyChain(node, optionalChains) {
+function analyzePropertyChain(
+  node: Node,
+  optionalChains: Map<string, boolean> | null,
+): string {
   if (node.type === 'Identifier' || node.type === 'JSXIdentifier') {
     const result = node.name;
     if (optionalChains) {
@@ -1755,7 +1876,10 @@ function analyzePropertyChain(node, optionalChains) {
     const result = `${object}.${property}`;
     markNode(node, optionalChains, result);
     return result;
-  } else if (node.type === 'ChainExpression' && !node.computed) {
+  } else if (
+    node.type === 'ChainExpression' &&
+    (!('computed' in node) || !node.computed)
+  ) {
     const expression = node.expression;
 
     if (expression.type === 'CallExpression') {
@@ -1772,7 +1896,9 @@ function analyzePropertyChain(node, optionalChains) {
   }
 }
 
-function getNodeWithoutReactNamespace(node, options) {
+function getNodeWithoutReactNamespace(
+  node: Expression | Super,
+): Expression | Identifier | Super {
   if (
     node.type === 'MemberExpression' &&
     node.object.type === 'Identifier' &&
@@ -1790,7 +1916,13 @@ function getNodeWithoutReactNamespace(node, options) {
 // 0 for useEffect/useMemo/useCallback(fn).
 // 1 for useImperativeHandle(ref, fn).
 // For additionally configured Hooks, assume that they're like useEffect (0).
-function getReactiveHookCallbackIndex(calleeNode, options) {
+function getReactiveHookCallbackIndex(
+  calleeNode: Expression | Super,
+  options?: {
+    additionalHooks: RegExp | undefined;
+    enableDangerousAutofixThisMayCauseInfiniteLoops?: boolean;
+  },
+): 0 | -1 | 1 {
   const node = getNodeWithoutReactNamespace(calleeNode);
   if (node.type !== 'Identifier') {
     return -1;
@@ -1812,8 +1944,11 @@ function getReactiveHookCallbackIndex(calleeNode, options) {
         let name;
         try {
           name = analyzePropertyChain(node, null);
-        } catch (error) {
-          if (/Unsupported node type/.test(error.message)) {
+        } catch (error: unknown) {
+          if (
+            error instanceof Error &&
+            /Unsupported node type/.test(error.message)
+          ) {
             return 0;
           } else {
             throw error;
@@ -1836,12 +1971,12 @@ function getReactiveHookCallbackIndex(calleeNode, options) {
  * - optimized by only searching nodes with a range surrounding our target node
  * - agnostic to AST node types, it looks for `{ type: string, ... }`
  */
-function fastFindReferenceWithParent(start, target) {
+function fastFindReferenceWithParent(start: Node, target: Node): Node | null {
   const queue = [start];
-  let item = null;
+  let item: Node;
 
   while (queue.length) {
-    item = queue.shift();
+    item = queue.shift() as Node;
 
     if (isSameIdentifier(item, target)) {
       return item;
@@ -1872,7 +2007,7 @@ function fastFindReferenceWithParent(start, target) {
   return null;
 }
 
-function joinEnglish(arr) {
+function joinEnglish(arr: string[]): string {
   let s = '';
   for (let i = 0; i < arr.length; i++) {
     s += arr[i];
@@ -1887,39 +2022,49 @@ function joinEnglish(arr) {
   return s;
 }
 
-function isNodeLike(val) {
+function isNodeLike(val: unknown): boolean {
   return (
     typeof val === 'object' &&
     val !== null &&
     !Array.isArray(val) &&
+    'type' in val &&
     typeof val.type === 'string'
   );
 }
 
-function isSameIdentifier(a, b) {
+function isSameIdentifier(a: Node, b: Node): boolean {
   return (
     (a.type === 'Identifier' || a.type === 'JSXIdentifier') &&
     a.type === b.type &&
     a.name === b.name &&
+    !!a.range &&
+    !!b.range &&
     a.range[0] === b.range[0] &&
     a.range[1] === b.range[1]
   );
 }
 
-function isAncestorNodeOf(a, b) {
-  return a.range[0] <= b.range[0] && a.range[1] >= b.range[1];
+function isAncestorNodeOf(a: Node, b: Node): boolean {
+  return (
+    !!a.range &&
+    !!b.range &&
+    a.range[0] <= b.range[0] &&
+    a.range[1] >= b.range[1]
+  );
 }
 
-function isUseEffectEventIdentifier(node) {
+function isUseEffectEventIdentifier(node: Node): boolean {
   if (__EXPERIMENTAL__) {
     return node.type === 'Identifier' && node.name === 'useEffectEvent';
   }
   return false;
 }
 
-function getUnknownDependenciesMessage(reactiveHookName) {
+function getUnknownDependenciesMessage(reactiveHookName: string): string {
   return (
     `React Hook ${reactiveHookName} received a function whose dependencies ` +
     `are unknown. Pass an inline function instead.`
   );
 }
+
+export default rule;
diff --git a/packages/eslint-plugin-react-hooks/src/RulesOfHooks.js b/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
similarity index 85%
rename from packages/eslint-plugin-react-hooks/src/RulesOfHooks.js
rename to packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
index fc340519e233e..24870d71614ea 100644
--- a/packages/eslint-plugin-react-hooks/src/RulesOfHooks.js
+++ b/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
@@ -4,18 +4,16 @@
  * This source code is licensed under the MIT license found in the
  * LICENSE file in the root directory of this source tree.
  */
-
-/* global BigInt */
 /* eslint-disable no-for-of-loops/no-for-of-loops */
 
-'use strict';
+import type {Rule, Scope} from 'eslint';
+import type {CallExpression, DoWhileStatement, Node} from 'estree';
 
 /**
  * Catch all identifiers that begin with "use" followed by an uppercase Latin
  * character to exclude identifiers like "user".
  */
-
-function isHookName(s) {
+function isHookName(s: string): boolean {
   return s === 'use' || /^use[A-Z0-9]/.test(s);
 }
 
@@ -23,8 +21,7 @@ function isHookName(s) {
  * We consider hooks to be a hook name identifier or a member expression
  * containing a hook name.
  */
-
-function isHook(node) {
+function isHook(node: Node): boolean {
   if (node.type === 'Identifier') {
     return isHookName(node.name);
   } else if (
@@ -44,16 +41,17 @@ function isHook(node) {
  * Checks if the node is a React component name. React component names must
  * always start with an uppercase letter.
  */
-
-function isComponentName(node) {
+function isComponentName(node: Node): boolean {
   return node.type === 'Identifier' && /^[A-Z]/.test(node.name);
 }
 
-function isReactFunction(node, functionName) {
+function isReactFunction(node: Node, functionName: string): boolean {
   return (
-    node.name === functionName ||
+    ('name' in node && node.name === functionName) ||
     (node.type === 'MemberExpression' &&
+      'name' in node.object &&
       node.object.name === 'React' &&
+      'name' in node.property &&
       node.property.name === functionName)
   );
 }
@@ -62,10 +60,10 @@ function isReactFunction(node, functionName) {
  * Checks if the node is a callback argument of forwardRef. This render function
  * should follow the rules of hooks.
  */
-
-function isForwardRefCallback(node) {
+function isForwardRefCallback(node: Node): boolean {
   return !!(
     node.parent &&
+    'callee' in node.parent &&
     node.parent.callee &&
     isReactFunction(node.parent.callee, 'forwardRef')
   );
@@ -75,16 +73,16 @@ function isForwardRefCallback(node) {
  * Checks if the node is a callback argument of React.memo. This anonymous
  * functional component should follow the rules of hooks.
  */
-
-function isMemoCallback(node) {
+function isMemoCallback(node: Node): boolean {
   return !!(
     node.parent &&
+    'callee' in node.parent &&
     node.parent.callee &&
     isReactFunction(node.parent.callee, 'memo')
   );
 }
 
-function isInsideComponentOrHook(node) {
+function isInsideComponentOrHook(node: Node | undefined): boolean {
   while (node) {
     const functionName = getFunctionName(node);
     if (functionName) {
@@ -100,7 +98,7 @@ function isInsideComponentOrHook(node) {
   return false;
 }
 
-function isInsideDoWhileLoop(node) {
+function isInsideDoWhileLoop(node: Node | undefined): node is DoWhileStatement {
   while (node) {
     if (node.type === 'DoWhileStatement') {
       return true;
@@ -110,18 +108,18 @@ function isInsideDoWhileLoop(node) {
   return false;
 }
 
-function isUseEffectEventIdentifier(node) {
+function isUseEffectEventIdentifier(node: Node): boolean {
   if (__EXPERIMENTAL__) {
     return node.type === 'Identifier' && node.name === 'useEffectEvent';
   }
   return false;
 }
 
-function isUseIdentifier(node) {
+function isUseIdentifier(node: Node): boolean {
   return isReactFunction(node, 'use');
 }
 
-export default {
+const rule = {
   meta: {
     type: 'problem',
     docs: {
@@ -130,25 +128,28 @@ export default {
       url: 'https://reactjs.org/docs/hooks-rules.html',
     },
   },
-  create(context) {
-    let lastEffect = null;
-    const codePathReactHooksMapStack = [];
-    const codePathSegmentStack = [];
+  create(context: Rule.RuleContext) {
+    let lastEffect: CallExpression | null = null;
+    const codePathReactHooksMapStack: Map<Rule.CodePathSegment, Node[]>[] = [];
+    const codePathSegmentStack: Rule.CodePathSegment[] = [];
     const useEffectEventFunctions = new WeakSet();
 
     // For a given scope, iterate through the references and add all useEffectEvent definitions. We can
     // do this in non-Program nodes because we can rely on the assumption that useEffectEvent functions
     // can only be declared within a component or hook at its top level.
-    function recordAllUseEffectEventFunctions(scope) {
+    function recordAllUseEffectEventFunctions(scope: Scope.Scope): void {
       for (const reference of scope.references) {
         const parent = reference.identifier.parent;
         if (
-          parent.type === 'VariableDeclarator' &&
+          parent?.type === 'VariableDeclarator' &&
           parent.init &&
           parent.init.type === 'CallExpression' &&
           parent.init.callee &&
           isUseEffectEventIdentifier(parent.init.callee)
         ) {
+          if (reference.resolved === null) {
+            throw new Error('Unexpected null reference.resolved');
+          }
           for (const ref of reference.resolved.references) {
             if (ref !== reference) {
               useEffectEventFunctions.add(ref.identifier);
@@ -159,26 +160,26 @@ export default {
     }
 
     /**
-     * SourceCode#getText that also works down to ESLint 3.0.0
+     * SourceCode that also works down to ESLint 3.0.0
      */
-    const getSource =
-      typeof context.getSource === 'function'
-        ? node => {
-            return context.getSource(node);
+    const getSourceCode =
+      typeof context.getSourceCode === 'function'
+        ? () => {
+            return context.getSourceCode();
           }
-        : node => {
-            return context.sourceCode.getText(node);
+        : () => {
+            return context.sourceCode;
           };
     /**
      * SourceCode#getScope that also works down to ESLint 3.0.0
      */
     const getScope =
       typeof context.getScope === 'function'
-        ? () => {
+        ? (): Scope.Scope => {
             return context.getScope();
           }
-        : node => {
-            return context.sourceCode.getScope(node);
+        : (node: Node): Scope.Scope => {
+            return getSourceCode().getScope(node);
           };
 
     return {
@@ -187,7 +188,10 @@ export default {
       onCodePathSegmentEnd: () => codePathSegmentStack.pop(),
 
       // Maintain code path stack as we traverse.
-      onCodePathStart: () => codePathReactHooksMapStack.push(new Map()),
+      onCodePathStart: () =>
+        codePathReactHooksMapStack.push(
+          new Map<Rule.CodePathSegment, Node[]>(),
+        ),
 
       // Process our code path.
       //
@@ -195,8 +199,10 @@ export default {
       // segment and reachable from every final segment.
       onCodePathEnd(codePath, codePathNode) {
         const reactHooksMap = codePathReactHooksMapStack.pop();
-        if (reactHooksMap.size === 0) {
+        if (reactHooksMap?.size === 0) {
           return;
+        } else if (typeof reactHooksMap === 'undefined') {
+          throw new Error('Unexpected undefined reactHooksMap');
         }
 
         // All of the segments which are cyclic are recorded in this set.
@@ -223,11 +229,13 @@ export default {
          *
          * Populates `cyclic` with cyclic segments.
          */
-
-        function countPathsFromStart(segment, pathHistory) {
+        function countPathsFromStart(
+          segment: Rule.CodePathSegment,
+          pathHistory?: Set<string>,
+        ): bigint {
           const {cache} = countPathsFromStart;
           let paths = cache.get(segment.id);
-          const pathList = new Set(pathHistory);
+          const pathList = new Set<string>(pathHistory);
 
           // If `pathList` includes the current segment then we've found a cycle!
           // We need to fill `cyclic` with all segments inside cycle
@@ -295,7 +303,10 @@ export default {
          * Populates `cyclic` with cyclic segments.
          */
 
-        function countPathsToEnd(segment, pathHistory) {
+        function countPathsToEnd(
+          segment: Rule.CodePathSegment,
+          pathHistory?: Set<string>,
+        ): bigint {
           const {cache} = countPathsToEnd;
           let paths = cache.get(segment.id);
           const pathList = new Set(pathHistory);
@@ -359,7 +370,9 @@ export default {
          * so we would return that.
          */
 
-        function shortestPathLengthToStart(segment) {
+        function shortestPathLengthToStart(
+          segment: Rule.CodePathSegment,
+        ): number {
           const {cache} = shortestPathLengthToStart;
           let length = cache.get(segment.id);
 
@@ -392,9 +405,9 @@ export default {
           return length;
         }
 
-        countPathsFromStart.cache = new Map();
-        countPathsToEnd.cache = new Map();
-        shortestPathLengthToStart.cache = new Map();
+        countPathsFromStart.cache = new Map<string, bigint>();
+        countPathsToEnd.cache = new Map<string, bigint>();
+        shortestPathLengthToStart.cache = new Map<string, number | null>();
 
         // Count all code paths to the end of our component/hook. Also primes
         // the `countPathsToEnd` cache.
@@ -502,7 +515,7 @@ export default {
               context.report({
                 node: hook,
                 message:
-                  `React Hook "${getSource(hook)}" may be executed ` +
+                  `React Hook "${getSourceCode().getText(hook)}" may be executed ` +
                   'more than once. Possibly because it is called in a loop. ' +
                   'React Hooks must be called in the exact same order in ' +
                   'every component render.',
@@ -516,12 +529,13 @@ export default {
             // called in.
             if (isDirectlyInsideComponentOrHook) {
               // Report an error if the hook is called inside an async function.
+              // @ts-expect-error the above check hasn't properly type-narrowed `codePathNode` (async doesn't exist on Node)
               const isAsyncFunction = codePathNode.async;
               if (isAsyncFunction) {
                 context.report({
                   node: hook,
                   message:
-                    `React Hook "${getSource(hook)}" cannot be ` +
+                    `React Hook "${getSourceCode().getText(hook)}" cannot be ` +
                     'called in an async function.',
                 });
               }
@@ -537,7 +551,7 @@ export default {
                 !isInsideDoWhileLoop(hook) // wrapping do/while loops are checked separately.
               ) {
                 const message =
-                  `React Hook "${getSource(hook)}" is called ` +
+                  `React Hook "${getSourceCode().getText(hook)}" is called ` +
                   'conditionally. React Hooks must be called in the exact ' +
                   'same order in every component render.' +
                   (possiblyHasEarlyReturn
@@ -549,21 +563,22 @@ export default {
             } else if (
               codePathNode.parent &&
               (codePathNode.parent.type === 'MethodDefinition' ||
+                // @ts-expect-error `ClassProperty` was removed from typescript-estree in https://github.com/typescript-eslint/typescript-eslint/pull/3806
                 codePathNode.parent.type === 'ClassProperty' ||
                 codePathNode.parent.type === 'PropertyDefinition') &&
               codePathNode.parent.value === codePathNode
             ) {
               // Custom message for hooks inside a class
               const message =
-                `React Hook "${getSource(hook)}" cannot be called ` +
+                `React Hook "${getSourceCode().getText(hook)}" cannot be called ` +
                 'in a class component. React Hooks must be called in a ' +
                 'React function component or a custom React Hook function.';
               context.report({node: hook, message});
             } else if (codePathFunctionName) {
               // Custom message if we found an invalid function name.
               const message =
-                `React Hook "${getSource(hook)}" is called in ` +
-                `function "${getSource(codePathFunctionName)}" ` +
+                `React Hook "${getSourceCode().getText(hook)}" is called in ` +
+                `function "${getSourceCode().getText(codePathFunctionName)}" ` +
                 'that is neither a React function component nor a custom ' +
                 'React Hook function.' +
                 ' React component names must start with an uppercase letter.' +
@@ -572,7 +587,7 @@ export default {
             } else if (codePathNode.type === 'Program') {
               // These are dangerous if you have inline requires enabled.
               const message =
-                `React Hook "${getSource(hook)}" cannot be called ` +
+                `React Hook "${getSourceCode().getText(hook)}" cannot be called ` +
                 'at the top level. React Hooks must be called in a ' +
                 'React function component or a custom React Hook function.';
               context.report({node: hook, message});
@@ -585,7 +600,7 @@ export default {
               // `use(...)` can be called in callbacks.
               if (isSomewhereInsideComponentOrHook && !isUseIdentifier(hook)) {
                 const message =
-                  `React Hook "${getSource(hook)}" cannot be called ` +
+                  `React Hook "${getSourceCode().getText(hook)}" cannot be called ` +
                   'inside a callback. React Hooks must be called in a ' +
                   'React function component or a custom React Hook function.';
                 context.report({node: hook, message});
@@ -638,7 +653,7 @@ export default {
           context.report({
             node,
             message:
-              `\`${getSource(
+              `\`${getSourceCode().getText(
                 node,
               )}\` is a function created with React Hook "useEffectEvent", and can only be called from ` +
               'the same component. They cannot be assigned to variables or passed down.',
@@ -667,7 +682,7 @@ export default {
       },
     };
   },
-};
+} satisfies Rule.RuleModule;
 
 /**
  * Gets the static name of a function AST node. For function declarations it is
@@ -677,7 +692,7 @@ export default {
  * same AST nodes with some exceptions to better fit our use case.
  */
 
-function getFunctionName(node) {
+function getFunctionName(node: Node) {
   if (
     node.type === 'FunctionDeclaration' ||
     (node.type === 'FunctionExpression' && node.id)
@@ -693,20 +708,20 @@ function getFunctionName(node) {
     node.type === 'ArrowFunctionExpression'
   ) {
     if (
-      node.parent.type === 'VariableDeclarator' &&
+      node.parent?.type === 'VariableDeclarator' &&
       node.parent.init === node
     ) {
       // const useHook = () => {};
       return node.parent.id;
     } else if (
-      node.parent.type === 'AssignmentExpression' &&
+      node.parent?.type === 'AssignmentExpression' &&
       node.parent.right === node &&
       node.parent.operator === '='
     ) {
       // useHook = () => {};
       return node.parent.left;
     } else if (
-      node.parent.type === 'Property' &&
+      node.parent?.type === 'Property' &&
       node.parent.value === node &&
       !node.parent.computed
     ) {
@@ -721,8 +736,9 @@ function getFunctionName(node) {
       // class {useHook = () => {}}
       // class {useHook() {}}
     } else if (
-      node.parent.type === 'AssignmentPattern' &&
+      node.parent?.type === 'AssignmentPattern' &&
       node.parent.right === node &&
+      // @ts-expect-error Property computed does not exist on type `AssignmentPattern`.
       !node.parent.computed
     ) {
       // const {useHook = () => {}} = {};
@@ -742,7 +758,8 @@ function getFunctionName(node) {
 /**
  * Convenience function for peeking the last item in a stack.
  */
-
-function last(array) {
-  return array[array.length - 1];
+function last<T>(array: T[]): T {
+  return array[array.length - 1] as T;
 }
+
+export default rule;
diff --git a/packages/eslint-plugin-react-hooks/src/index.js b/packages/eslint-plugin-react-hooks/src/index.js
deleted file mode 100644
index 0ebfbc91a5a8d..0000000000000
--- a/packages/eslint-plugin-react-hooks/src/index.js
+++ /dev/null
@@ -1,61 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-'use strict';
-
-import RulesOfHooks from './RulesOfHooks';
-import ExhaustiveDeps from './ExhaustiveDeps';
-
-// All rules
-export const rules = {
-  'rules-of-hooks': RulesOfHooks,
-  'exhaustive-deps': ExhaustiveDeps,
-};
-
-// Config rules
-const configRules = {
-  'react-hooks/rules-of-hooks': 'error',
-  'react-hooks/exhaustive-deps': 'warn',
-};
-
-// Legacy config
-const legacyRecommendedConfig = {
-  plugins: ['react-hooks'],
-  rules: configRules,
-};
-
-// Base plugin object
-const reactHooksPlugin = {
-  meta: {name: 'eslint-plugin-react-hooks'},
-  rules,
-};
-
-// Flat config
-const flatRecommendedConfig = {
-  name: 'react-hooks/recommended',
-  plugins: {'react-hooks': reactHooksPlugin},
-  rules: configRules,
-};
-
-export const configs = {
-  /** Legacy recommended config, to be used with rc-based configurations */
-  'recommended-legacy': legacyRecommendedConfig,
-
-  /** Latest recommended config, to be used with flat configurations */
-  'recommended-latest': flatRecommendedConfig,
-
-  /**
-   * 'recommended' is currently aliased to the legacy / rc recommended config) to maintain backwards compatibility.
-   * This is deprecated and in v6, it will switch to alias the flat recommended config.
-   */
-  recommended: legacyRecommendedConfig,
-};
-
-export default {
-  ...reactHooksPlugin,
-  configs,
-};
diff --git a/packages/eslint-plugin-react-hooks/src/index.ts b/packages/eslint-plugin-react-hooks/src/index.ts
new file mode 100644
index 0000000000000..42b55320fcd89
--- /dev/null
+++ b/packages/eslint-plugin-react-hooks/src/index.ts
@@ -0,0 +1,64 @@
+/**
+ * Copyright (c) Meta Platforms, Inc. and affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ */
+import RulesOfHooks from './RulesOfHooks';
+import ExhaustiveDeps from './ExhaustiveDeps';
+import type {ESLint, Linter, Rule} from 'eslint';
+
+// All rules
+const rules = {
+  'rules-of-hooks': RulesOfHooks,
+  'exhaustive-deps': ExhaustiveDeps,
+} satisfies Record<string, Rule.RuleModule>;
+
+// Config rules
+const configRules = {
+  'react-hooks/rules-of-hooks': 'error',
+  'react-hooks/exhaustive-deps': 'warn',
+} satisfies Linter.RulesRecord;
+
+// Legacy config
+const legacyRecommendedConfig = {
+  plugins: ['react-hooks'],
+  rules: configRules,
+} satisfies Linter.LegacyConfig;
+
+// Plugin object
+const plugin = {
+  // TODO: Make this more dynamic to populate version from package.json.
+  // This can be done by injecting at build time, since importing the package.json isn't an option in Meta
+  meta: {name: 'eslint-plugin-react-hooks'},
+  rules,
+  configs: {
+    /** Legacy recommended config, to be used with rc-based configurations */
+    'recommended-legacy': legacyRecommendedConfig,
+
+    /**
+     * 'recommended' is currently aliased to the legacy / rc recommended config) to maintain backwards compatibility.
+     * This is deprecated and in v6, it will switch to alias the flat recommended config.
+     */
+    recommended: legacyRecommendedConfig,
+
+    /** Latest recommended config, to be used with flat configurations */
+    'recommended-latest': {
+      name: 'react-hooks/recommended',
+      plugins: {
+        get 'react-hooks'(): ESLint.Plugin {
+          return plugin;
+        },
+      },
+      rules: configRules,
+    },
+  },
+} satisfies ESLint.Plugin;
+
+const configs = plugin.configs;
+const meta = plugin.meta;
+export {configs, meta, rules};
+
+// TODO: If the plugin is ever updated to be pure ESM and drops support for rc-based configs, then it should be exporting the plugin as default
+// instead of individual named exports.
+// export default plugin;
diff --git a/packages/eslint-plugin-react-hooks/src/types/estree.d.ts b/packages/eslint-plugin-react-hooks/src/types/estree.d.ts
index 10337ef7d6bf0..f266369704885 100644
--- a/packages/eslint-plugin-react-hooks/src/types/estree.d.ts
+++ b/packages/eslint-plugin-react-hooks/src/types/estree.d.ts
@@ -1,3 +1,5 @@
+import {Expression, Identifier, Node} from 'estree-jsx';
+
 /**
  * This file augments the `estree` types to include types that are not built-in to `estree` or `estree-jsx`.
  * This is necessary because the `estree` types are used by ESLint, and ESLint does not natively support
diff --git a/packages/eslint-plugin-react-hooks/tsconfig.json b/packages/eslint-plugin-react-hooks/tsconfig.json
index db8a4893649ea..e67b840d3fd7a 100644
--- a/packages/eslint-plugin-react-hooks/tsconfig.json
+++ b/packages/eslint-plugin-react-hooks/tsconfig.json
@@ -6,7 +6,6 @@
     "moduleResolution": "Bundler",
     "lib": ["ES2020"],
     "rootDir": ".",
-    "noEmit": true,
     "sourceMap": false,
     "types": ["estree-jsx", "node"]
   },
diff --git a/packages/eslint-plugin-react-hooks/tsup.config.ts b/packages/eslint-plugin-react-hooks/tsup.config.ts
deleted file mode 100644
index e275d0495e26c..0000000000000
--- a/packages/eslint-plugin-react-hooks/tsup.config.ts
+++ /dev/null
@@ -1,9 +0,0 @@
-import {defineConfig} from 'tsup';
-
-export default defineConfig({
-  clean: true,
-  dts: true,
-  entry: ['src/index.ts'],
-  format: ['cjs'],
-  outDir: 'build',
-});
diff --git a/scripts/rollup/bundles.js b/scripts/rollup/bundles.js
index c66cff82c5ac2..0a378c4f31bf7 100644
--- a/scripts/rollup/bundles.js
+++ b/scripts/rollup/bundles.js
@@ -1184,17 +1184,19 @@ const bundles = [
 
   /******* ESLint Plugin for Hooks *******/
   {
-    // TODO: it's awkward to create a bundle for this but if we don't, the package
-    // won't get copied. We also can't create just DEV bundle because it contains a
-    // NODE_ENV check inside. We should probably tweak our build process to allow
-    // "raw" packages that don't get bundled.
-    bundleTypes: [NODE_DEV, NODE_PROD],
+    // TODO: we're building this from typescript source now, but there's really
+    // no reason to have both dev and prod for this package.  It's
+    // currently required in order for the package to be copied over correctly.
+    // So, it would be worth improving that flow.
+    name: 'eslint-plugin-react-hooks',
+    bundleTypes: [NODE_DEV, NODE_PROD, CJS_DTS],
     moduleType: ISOMORPHIC,
-    entry: 'eslint-plugin-react-hooks',
+    entry: 'eslint-plugin-react-hooks/src/index.ts',
     global: 'ESLintPluginReactHooks',
     minifyWithProdErrorCodes: false,
     wrapWithModuleBoundaries: false,
     externals: [],
+    tsconfig: './packages/eslint-plugin-react-hooks/tsconfig.json',
   },
 
   /******* React Fresh *******/
diff --git a/yarn.lock b/yarn.lock
index 44d590625111c..ba71ba7abe323 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -2403,131 +2403,6 @@
     opn "5.3.0"
     react "^16.13.1"
 
-"@esbuild/aix-ppc64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/aix-ppc64/-/aix-ppc64-0.24.2.tgz#38848d3e25afe842a7943643cbcd387cc6e13461"
-  integrity sha512-thpVCb/rhxE/BnMLQ7GReQLLN8q9qbHmI55F4489/ByVg2aQaQ6kbcLb6FHkocZzQhxc4gx0sCk0tJkKBFzDhA==
-
-"@esbuild/android-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm64/-/android-arm64-0.24.2.tgz#f592957ae8b5643129fa889c79e69cd8669bb894"
-  integrity sha512-cNLgeqCqV8WxfcTIOeL4OAtSmL8JjcN6m09XIgro1Wi7cF4t/THaWEa7eL5CMoMBdjoHOTh/vwTO/o2TRXIyzg==
-
-"@esbuild/android-arm@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-arm/-/android-arm-0.24.2.tgz#72d8a2063aa630308af486a7e5cbcd1e134335b3"
-  integrity sha512-tmwl4hJkCfNHwFB3nBa8z1Uy3ypZpxqxfTQOcHX+xRByyYgunVbZ9MzUUfb0RxaHIMnbHagwAxuTL+tnNM+1/Q==
-
-"@esbuild/android-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/android-x64/-/android-x64-0.24.2.tgz#9a7713504d5f04792f33be9c197a882b2d88febb"
-  integrity sha512-B6Q0YQDqMx9D7rvIcsXfmJfvUYLoP722bgfBlO5cGvNVb5V/+Y7nhBE3mHV9OpxBf4eAS2S68KZztiPaWq4XYw==
-
-"@esbuild/darwin-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-arm64/-/darwin-arm64-0.24.2.tgz#02ae04ad8ebffd6e2ea096181b3366816b2b5936"
-  integrity sha512-kj3AnYWc+CekmZnS5IPu9D+HWtUI49hbnyqk0FLEJDbzCIQt7hg7ucF1SQAilhtYpIujfaHr6O0UHlzzSPdOeA==
-
-"@esbuild/darwin-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/darwin-x64/-/darwin-x64-0.24.2.tgz#9ec312bc29c60e1b6cecadc82bd504d8adaa19e9"
-  integrity sha512-WeSrmwwHaPkNR5H3yYfowhZcbriGqooyu3zI/3GGpF8AyUdsrrP0X6KumITGA9WOyiJavnGZUwPGvxvwfWPHIA==
-
-"@esbuild/freebsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-arm64/-/freebsd-arm64-0.24.2.tgz#5e82f44cb4906d6aebf24497d6a068cfc152fa00"
-  integrity sha512-UN8HXjtJ0k/Mj6a9+5u6+2eZ2ERD7Edt1Q9IZiB5UZAIdPnVKDoG7mdTVGhHJIeEml60JteamR3qhsr1r8gXvg==
-
-"@esbuild/freebsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/freebsd-x64/-/freebsd-x64-0.24.2.tgz#3fb1ce92f276168b75074b4e51aa0d8141ecce7f"
-  integrity sha512-TvW7wE/89PYW+IevEJXZ5sF6gJRDY/14hyIGFXdIucxCsbRmLUcjseQu1SyTko+2idmCw94TgyaEZi9HUSOe3Q==
-
-"@esbuild/linux-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm64/-/linux-arm64-0.24.2.tgz#856b632d79eb80aec0864381efd29de8fd0b1f43"
-  integrity sha512-7HnAD6074BW43YvvUmE/35Id9/NB7BeX5EoNkK9obndmZBUk8xmJJeU7DwmUeN7tkysslb2eSl6CTrYz6oEMQg==
-
-"@esbuild/linux-arm@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-arm/-/linux-arm-0.24.2.tgz#c846b4694dc5a75d1444f52257ccc5659021b736"
-  integrity sha512-n0WRM/gWIdU29J57hJyUdIsk0WarGd6To0s+Y+LwvlC55wt+GT/OgkwoXCXvIue1i1sSNWblHEig00GBWiJgfA==
-
-"@esbuild/linux-ia32@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ia32/-/linux-ia32-0.24.2.tgz#f8a16615a78826ccbb6566fab9a9606cfd4a37d5"
-  integrity sha512-sfv0tGPQhcZOgTKO3oBE9xpHuUqguHvSo4jl+wjnKwFpapx+vUDcawbwPNuBIAYdRAvIDBfZVvXprIj3HA+Ugw==
-
-"@esbuild/linux-loong64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-loong64/-/linux-loong64-0.24.2.tgz#1c451538c765bf14913512c76ed8a351e18b09fc"
-  integrity sha512-CN9AZr8kEndGooS35ntToZLTQLHEjtVB5n7dl8ZcTZMonJ7CCfStrYhrzF97eAecqVbVJ7APOEe18RPI4KLhwQ==
-
-"@esbuild/linux-mips64el@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-mips64el/-/linux-mips64el-0.24.2.tgz#0846edeefbc3d8d50645c51869cc64401d9239cb"
-  integrity sha512-iMkk7qr/wl3exJATwkISxI7kTcmHKE+BlymIAbHO8xanq/TjHaaVThFF6ipWzPHryoFsesNQJPE/3wFJw4+huw==
-
-"@esbuild/linux-ppc64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-ppc64/-/linux-ppc64-0.24.2.tgz#8e3fc54505671d193337a36dfd4c1a23b8a41412"
-  integrity sha512-shsVrgCZ57Vr2L8mm39kO5PPIb+843FStGt7sGGoqiiWYconSxwTiuswC1VJZLCjNiMLAMh34jg4VSEQb+iEbw==
-
-"@esbuild/linux-riscv64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-riscv64/-/linux-riscv64-0.24.2.tgz#6a1e92096d5e68f7bb10a0d64bb5b6d1daf9a694"
-  integrity sha512-4eSFWnU9Hhd68fW16GD0TINewo1L6dRrB+oLNNbYyMUAeOD2yCK5KXGK1GH4qD/kT+bTEXjsyTCiJGHPZ3eM9Q==
-
-"@esbuild/linux-s390x@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-s390x/-/linux-s390x-0.24.2.tgz#ab18e56e66f7a3c49cb97d337cd0a6fea28a8577"
-  integrity sha512-S0Bh0A53b0YHL2XEXC20bHLuGMOhFDO6GN4b3YjRLK//Ep3ql3erpNcPlEFed93hsQAjAQDNsvcK+hV90FubSw==
-
-"@esbuild/linux-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/linux-x64/-/linux-x64-0.24.2.tgz#8140c9b40da634d380b0b29c837a0b4267aff38f"
-  integrity sha512-8Qi4nQcCTbLnK9WoMjdC9NiTG6/E38RNICU6sUNqK0QFxCYgoARqVqxdFmWkdonVsvGqWhmm7MO0jyTqLqwj0Q==
-
-"@esbuild/netbsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-arm64/-/netbsd-arm64-0.24.2.tgz#65f19161432bafb3981f5f20a7ff45abb2e708e6"
-  integrity sha512-wuLK/VztRRpMt9zyHSazyCVdCXlpHkKm34WUyinD2lzK07FAHTq0KQvZZlXikNWkDGoT6x3TD51jKQ7gMVpopw==
-
-"@esbuild/netbsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/netbsd-x64/-/netbsd-x64-0.24.2.tgz#7a3a97d77abfd11765a72f1c6f9b18f5396bcc40"
-  integrity sha512-VefFaQUc4FMmJuAxmIHgUmfNiLXY438XrL4GDNV1Y1H/RW3qow68xTwjZKfj/+Plp9NANmzbH5R40Meudu8mmw==
-
-"@esbuild/openbsd-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-arm64/-/openbsd-arm64-0.24.2.tgz#58b00238dd8f123bfff68d3acc53a6ee369af89f"
-  integrity sha512-YQbi46SBct6iKnszhSvdluqDmxCJA+Pu280Av9WICNwQmMxV7nLRHZfjQzwbPs3jeWnuAhE9Jy0NrnJ12Oz+0A==
-
-"@esbuild/openbsd-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/openbsd-x64/-/openbsd-x64-0.24.2.tgz#0ac843fda0feb85a93e288842936c21a00a8a205"
-  integrity sha512-+iDS6zpNM6EnJyWv0bMGLWSWeXGN/HTaF/LXHXHwejGsVi+ooqDfMCCTerNFxEkM3wYVcExkeGXNqshc9iMaOA==
-
-"@esbuild/sunos-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/sunos-x64/-/sunos-x64-0.24.2.tgz#8b7aa895e07828d36c422a4404cc2ecf27fb15c6"
-  integrity sha512-hTdsW27jcktEvpwNHJU4ZwWFGkz2zRJUz8pvddmXPtXDzVKTTINmlmga3ZzwcuMpUvLw7JkLy9QLKyGpD2Yxig==
-
-"@esbuild/win32-arm64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-arm64/-/win32-arm64-0.24.2.tgz#c023afb647cabf0c3ed13f0eddfc4f1d61c66a85"
-  integrity sha512-LihEQ2BBKVFLOC9ZItT9iFprsE9tqjDjnbulhHoFxYQtQfai7qfluVODIYxt1PgdoyQkz23+01rzwNwYfutxUQ==
-
-"@esbuild/win32-ia32@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-ia32/-/win32-ia32-0.24.2.tgz#96c356132d2dda990098c8b8b951209c3cd743c2"
-  integrity sha512-q+iGUwfs8tncmFC9pcnD5IvRHAzmbwQ3GPS5/ceCyHdjXubwQWI12MKWSNSMYLJMq23/IUCvJMS76PDqXe1fxA==
-
-"@esbuild/win32-x64@0.24.2":
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/@esbuild/win32-x64/-/win32-x64-0.24.2.tgz#34aa0b52d0fbb1a654b596acfa595f0c7b77a77b"
-  integrity sha512-7VTgWzgMGvup6aSqDPLiW5zHaxYJGTO4OokMjIlrCtf+VpEL+cXKtCvg723iguPYI5oaUNdS+/V7OU2gvXVWEg==
-
 "@eslint-community/eslint-utils@^4.2.0", "@eslint-community/eslint-utils@^4.4.0":
   version "4.4.0"
   resolved "https://registry.yarnpkg.com/@eslint-community/eslint-utils/-/eslint-utils-4.4.0.tgz#a23514e8fb9af1269d5f7788aa556798d61c6b59"
@@ -2924,15 +2799,6 @@
     "@jridgewell/sourcemap-codec" "^1.4.10"
     "@jridgewell/trace-mapping" "^0.3.9"
 
-"@jridgewell/gen-mapping@^0.3.2":
-  version "0.3.8"
-  resolved "https://registry.yarnpkg.com/@jridgewell/gen-mapping/-/gen-mapping-0.3.8.tgz#4f0e06362e01362f823d348f1872b08f666d8142"
-  integrity sha512-imAbBGkb+ebQyxKgzv5Hu2nmROxoDOXHh80evxdoXNOrvAnVx7zimzc1Oo5h9RlfV4vPXaE2iM5pOFbvOCClWA==
-  dependencies:
-    "@jridgewell/set-array" "^1.2.1"
-    "@jridgewell/sourcemap-codec" "^1.4.10"
-    "@jridgewell/trace-mapping" "^0.3.24"
-
 "@jridgewell/gen-mapping@^0.3.5":
   version "0.3.5"
   resolved "https://registry.yarnpkg.com/@jridgewell/gen-mapping/-/gen-mapping-0.3.5.tgz#dcce6aff74bdf6dad1a95802b69b04a2fcb1fb36"
@@ -3396,101 +3262,6 @@
     estree-walker "^2.0.2"
     picomatch "^4.0.2"
 
-"@rollup/rollup-android-arm-eabi@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.34.7.tgz#e554185b1afa5509a7a4040d15ec0c3b4435ded1"
-  integrity sha512-l6CtzHYo8D2TQ3J7qJNpp3Q1Iye56ssIAtqbM2H8axxCEEwvN7o8Ze9PuIapbxFL3OHrJU2JBX6FIIVnP/rYyw==
-
-"@rollup/rollup-android-arm64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.34.7.tgz#b1ee64bb413b2feba39803b0a1bebf2a9f3d70e1"
-  integrity sha512-KvyJpFUueUnSp53zhAa293QBYqwm94TgYTIfXyOTtidhm5V0LbLCJQRGkQClYiX3FXDQGSvPxOTD/6rPStMMDg==
-
-"@rollup/rollup-darwin-arm64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.34.7.tgz#bfdce3e07a345dd1bd628f3b796050f39629d7f0"
-  integrity sha512-jq87CjmgL9YIKvs8ybtIC98s/M3HdbqXhllcy9EdLV0yMg1DpxES2gr65nNy7ObNo/vZ/MrOTxt0bE5LinL6mA==
-
-"@rollup/rollup-darwin-x64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.34.7.tgz#781a94a537c57bdf0a500e47a25ab5985e5e8dff"
-  integrity sha512-rSI/m8OxBjsdnMMg0WEetu/w+LhLAcCDEiL66lmMX4R3oaml3eXz3Dxfvrxs1FbzPbJMaItQiksyMfv1hoIxnA==
-
-"@rollup/rollup-freebsd-arm64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.34.7.tgz#7a028357cbd12c5869c446ad18177c89f3405102"
-  integrity sha512-oIoJRy3ZrdsXpFuWDtzsOOa/E/RbRWXVokpVrNnkS7npz8GEG++E1gYbzhYxhxHbO2om1T26BZjVmdIoyN2WtA==
-
-"@rollup/rollup-freebsd-x64@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.34.7.tgz#f24836a6371cccc4408db74f0fd986dacf098950"
-  integrity sha512-X++QSLm4NZfZ3VXGVwyHdRf58IBbCu9ammgJxuWZYLX0du6kZvdNqPwrjvDfwmi6wFdvfZ/s6K7ia0E5kI7m8Q==
-
-"@rollup/rollup-linux-arm-gnueabihf@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.34.7.tgz#95f27e96f0eb9b9ae9887739a8b6dffc90c1237f"
-  integrity sha512-Z0TzhrsNqukTz3ISzrvyshQpFnFRfLunYiXxlCRvcrb3nvC5rVKI+ZXPFG/Aa4jhQa1gHgH3A0exHaRRN4VmdQ==
-
-"@rollup/rollup-linux-arm-musleabihf@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.34.7.tgz#677b34fba9d070877736c3fe8b02aacb5e142d97"
-  integrity sha512-nkznpyXekFAbvFBKBy4nNppSgneB1wwG1yx/hujN3wRnhnkrYVugMTCBXED4+Ni6thoWfQuHNYbFjgGH0MBXtw==
-
-"@rollup/rollup-linux-arm64-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.34.7.tgz#32d3d19dedde54e91574a098f22ea43a09cf63dd"
-  integrity sha512-KCjlUkcKs6PjOcxolqrXglBDcfCuUCTVlX5BgzgoJHw+1rWH1MCkETLkLe5iLLS9dP5gKC7mp3y6x8c1oGBUtA==
-
-"@rollup/rollup-linux-arm64-musl@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.34.7.tgz#a58dff44a18696df65ed8c0ad68a2945cf900484"
-  integrity sha512-uFLJFz6+utmpbR313TTx+NpPuAXbPz4BhTQzgaP0tozlLnGnQ6rCo6tLwaSa6b7l6gRErjLicXQ1iPiXzYotjw==
-
-"@rollup/rollup-linux-loongarch64-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-loongarch64-gnu/-/rollup-linux-loongarch64-gnu-4.34.7.tgz#a7488ab078233111e8aeb370d1ecf107ec7e1716"
-  integrity sha512-ws8pc68UcJJqCpneDFepnwlsMUFoWvPbWXT/XUrJ7rWUL9vLoIN3GAasgG+nCvq8xrE3pIrd+qLX/jotcLy0Qw==
-
-"@rollup/rollup-linux-powerpc64le-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.34.7.tgz#e9b9c0d6bd248a92b2d6ec01ebf99c62ae1f2e9a"
-  integrity sha512-vrDk9JDa/BFkxcS2PbWpr0C/LiiSLxFbNOBgfbW6P8TBe9PPHx9Wqbvx2xgNi1TOAyQHQJ7RZFqBiEohm79r0w==
-
-"@rollup/rollup-linux-riscv64-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.34.7.tgz#0df84ce2bea48ee686fb55060d76ab47aff45c4c"
-  integrity sha512-rB+ejFyjtmSo+g/a4eovDD1lHWHVqizN8P0Hm0RElkINpS0XOdpaXloqM4FBkF9ZWEzg6bezymbpLmeMldfLTw==
-
-"@rollup/rollup-linux-s390x-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.34.7.tgz#73df374c57d036856e33dbd2715138922e91e452"
-  integrity sha512-nNXNjo4As6dNqRn7OrsnHzwTgtypfRA3u3AKr0B3sOOo+HkedIbn8ZtFnB+4XyKJojIfqDKmbIzO1QydQ8c+Pw==
-
-"@rollup/rollup-linux-x64-gnu@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.34.7.tgz#f27af0b55f0cdd84e182e6cd44a6d03da0458149"
-  integrity sha512-9kPVf9ahnpOMSGlCxXGv980wXD0zRR3wyk8+33/MXQIpQEOpaNe7dEHm5LMfyRZRNt9lMEQuH0jUKj15MkM7QA==
-
-"@rollup/rollup-linux-x64-musl@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.34.7.tgz#c7981ad5cfb8c3cd5d643d33ca54e4d2802b9201"
-  integrity sha512-7wJPXRWTTPtTFDFezA8sle/1sdgxDjuMoRXEKtx97ViRxGGkVQYovem+Q8Pr/2HxiHp74SSRG+o6R0Yq0shPwQ==
-
-"@rollup/rollup-win32-arm64-msvc@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.34.7.tgz#06cedc0ef3cbf1cbd8abcf587090712e40ae6941"
-  integrity sha512-MN7aaBC7mAjsiMEZcsJvwNsQVNZShgES/9SzWp1HC9Yjqb5OpexYnRjF7RmE4itbeesHMYYQiAtUAQaSKs2Rfw==
-
-"@rollup/rollup-win32-ia32-msvc@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.34.7.tgz#90b39b977b14961a769be6ea61238e7fc668dd4d"
-  integrity sha512-aeawEKYswsFu1LhDM9RIgToobquzdtSc4jSVqHV8uApz4FVvhFl/mKh92wc8WpFc6aYCothV/03UjY6y7yLgbg==
-
-"@rollup/rollup-win32-x64-msvc@4.34.7":
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.34.7.tgz#6531d61e7141091eaab0461ee8e0380c10e4ca57"
-  integrity sha512-4ZedScpxxIrVO7otcZ8kCX1mZArtH2Wfj3uFCxRJ9NO80gg1XV0U/b2f/MKaGwj2X3QopHfoWiDQ917FRpwY3w==
-
 "@sinclair/typebox@^0.25.16":
   version "0.25.24"
   resolved "https://registry.yarnpkg.com/@sinclair/typebox/-/typebox-0.25.24.tgz#8c7688559979f7079aacaf31aa881c3aa410b718"
@@ -3680,7 +3451,7 @@
   dependencies:
     "@types/estree" "*"
 
-"@types/estree@*", "@types/estree@1.0.6", "@types/estree@^1.0.0", "@types/estree@^1.0.6":
+"@types/estree@*", "@types/estree@^1.0.0", "@types/estree@^1.0.6":
   version "1.0.6"
   resolved "https://registry.yarnpkg.com/@types/estree/-/estree-1.0.6.tgz#628effeeae2064a1b4e79f78e81d87b7e5fc7b50"
   integrity sha512-AYnb1nQyY49te+VRAVgmzfcgjYS91mY5P0TKUDCLEM+gNnA+3T6rWITXRLYCpahpqSQbN5cE+gHpnPyXjHWxcw==
@@ -5760,13 +5531,6 @@ bundle-name@^3.0.0:
   dependencies:
     run-applescript "^5.0.0"
 
-bundle-require@^5.0.0:
-  version "5.1.0"
-  resolved "https://registry.yarnpkg.com/bundle-require/-/bundle-require-5.1.0.tgz#8db66f41950da3d77af1ef3322f4c3e04009faee"
-  integrity sha512-3WrrOuZiyaaZPWiEt4G3+IffISVC9HYlWueJEBWED4ZH4aIAC2PnkdnuRrR94M+w6yGWn4AglWtJtBI8YqvgoA==
-  dependencies:
-    load-tsconfig "^0.2.3"
-
 bunyan@1.8.15:
   version "1.8.15"
   resolved "https://registry.yarnpkg.com/bunyan/-/bunyan-1.8.15.tgz#8ce34ca908a17d0776576ca1b2f6cbd916e93b46"
@@ -5787,11 +5551,6 @@ bytes@3.1.2:
   resolved "https://registry.yarnpkg.com/bytes/-/bytes-3.1.2.tgz#8b0beeb98605adf1b128fa4386403c009e0221a5"
   integrity sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==
 
-cac@^6.7.14:
-  version "6.7.14"
-  resolved "https://registry.yarnpkg.com/cac/-/cac-6.7.14.tgz#804e1e6f506ee363cb0e3ccbb09cad5dd9870959"
-  integrity sha512-b6Ilus+c3RrdDk+JhLKUAQfzzgLEPy6wcXqS7f/xe1EETvsDP6GORG7SFuOs6cID5YkqchW/LXZbX5bc8j7ZcQ==
-
 cache-base@^1.0.1:
   version "1.0.1"
   resolved "https://registry.yarnpkg.com/cache-base/-/cache-base-1.0.1.tgz#0a7f46416831c8b662ee36fe4e7c59d76f666ab2"
@@ -6093,13 +5852,6 @@ chokidar@^3.5.3:
   optionalDependencies:
     fsevents "~2.3.2"
 
-chokidar@^4.0.1:
-  version "4.0.3"
-  resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-4.0.3.tgz#7be37a4c03c9aee1ecfe862a4a23b2c70c205d30"
-  integrity sha512-Qgzu8kfBvo+cA4962jnP1KkS6Dop5NS6g7R5LFYJr4b8Ub94PPQXUksCw9PvXoeXPRRddRNC5C1JQUR2SMGtnA==
-  dependencies:
-    readdirp "^4.0.1"
-
 chownr@^1.0.1:
   version "1.1.4"
   resolved "https://registry.yarnpkg.com/chownr/-/chownr-1.1.4.tgz#6fc9d7b42d32a583596337666e7d08084da2cc6b"
@@ -6368,7 +6120,7 @@ commander@^2.18.0, commander@^2.20.0, commander@^2.6.0, commander@^2.8.1:
   resolved "https://registry.yarnpkg.com/commander/-/commander-2.20.3.tgz#fd485e84c03eb4881c20722ba48035e8531aeb33"
   integrity sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==
 
-commander@^4.0.0, commander@^4.0.1:
+commander@^4.0.1:
   version "4.1.1"
   resolved "https://registry.yarnpkg.com/commander/-/commander-4.1.1.tgz#9fd602bd936294e9e9ef46a3f4d6964044b18068"
   integrity sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==
@@ -6511,11 +6263,6 @@ connect-history-api-fallback@^2.0.0:
   resolved "https://registry.yarnpkg.com/connect-history-api-fallback/-/connect-history-api-fallback-2.0.0.tgz#647264845251a0daf25b97ce87834cace0f5f1c8"
   integrity sha512-U73+6lQFmfiNPrYbXqr6kZ1i1wiRqXnp2nhMsINseWXO8lDau0LGEffJ8kQi4EjLZympVgRdvqjAgiZ1tgzDDA==
 
-consola@^3.2.3:
-  version "3.4.0"
-  resolved "https://registry.yarnpkg.com/consola/-/consola-3.4.0.tgz#4cfc9348fd85ed16a17940b3032765e31061ab88"
-  integrity sha512-EiPU8G6dQG0GFHNR8ljnZFki/8a+cQwEQ+7wpxdChl02Q8HXlwEZWD5lqAF8vC2sEC3Tehr8hy7vErz88LHyUA==
-
 console-browserify@^1.1.0:
   version "1.2.0"
   resolved "https://registry.yarnpkg.com/console-browserify/-/console-browserify-1.2.0.tgz#67063cef57ceb6cf4993a2ab3a55840ae8c49336"
@@ -7039,13 +6786,6 @@ debug@^4.3.4, debug@~4.3.1:
   dependencies:
     ms "2.1.2"
 
-debug@^4.3.7:
-  version "4.4.0"
-  resolved "https://registry.yarnpkg.com/debug/-/debug-4.4.0.tgz#2b3f2aea2ffeb776477460267377dc8710faba8a"
-  integrity sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==
-  dependencies:
-    ms "^2.1.3"
-
 decamelize@6.0.0:
   version "6.0.0"
   resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-6.0.0.tgz#8cad4d916fde5c41a264a43d0ecc56fe3d31749e"
@@ -7744,37 +7484,6 @@ es6-error@4.1.1, es6-error@^4.1.1:
   resolved "https://registry.yarnpkg.com/es6-error/-/es6-error-4.1.1.tgz#9e3af407459deed47e9a91f9b885a84eb05c561d"
   integrity sha512-Um/+FxMr9CISWh0bi5Zv0iOD+4cFh5qLeks1qhAopKVAJw3drgKbKySikp7wGhDL0HPeaja0P5ULZrxLkniUVg==
 
-esbuild@^0.24.0:
-  version "0.24.2"
-  resolved "https://registry.yarnpkg.com/esbuild/-/esbuild-0.24.2.tgz#b5b55bee7de017bff5fb8a4e3e44f2ebe2c3567d"
-  integrity sha512-+9egpBW8I3CD5XPe0n6BfT5fxLzxrlDzqydF3aviG+9ni1lDC/OvMHcxqEFV0+LANZG5R1bFMWfUrjVsdwxJvA==
-  optionalDependencies:
-    "@esbuild/aix-ppc64" "0.24.2"
-    "@esbuild/android-arm" "0.24.2"
-    "@esbuild/android-arm64" "0.24.2"
-    "@esbuild/android-x64" "0.24.2"
-    "@esbuild/darwin-arm64" "0.24.2"
-    "@esbuild/darwin-x64" "0.24.2"
-    "@esbuild/freebsd-arm64" "0.24.2"
-    "@esbuild/freebsd-x64" "0.24.2"
-    "@esbuild/linux-arm" "0.24.2"
-    "@esbuild/linux-arm64" "0.24.2"
-    "@esbuild/linux-ia32" "0.24.2"
-    "@esbuild/linux-loong64" "0.24.2"
-    "@esbuild/linux-mips64el" "0.24.2"
-    "@esbuild/linux-ppc64" "0.24.2"
-    "@esbuild/linux-riscv64" "0.24.2"
-    "@esbuild/linux-s390x" "0.24.2"
-    "@esbuild/linux-x64" "0.24.2"
-    "@esbuild/netbsd-arm64" "0.24.2"
-    "@esbuild/netbsd-x64" "0.24.2"
-    "@esbuild/openbsd-arm64" "0.24.2"
-    "@esbuild/openbsd-x64" "0.24.2"
-    "@esbuild/sunos-x64" "0.24.2"
-    "@esbuild/win32-arm64" "0.24.2"
-    "@esbuild/win32-ia32" "0.24.2"
-    "@esbuild/win32-x64" "0.24.2"
-
 escalade@^3.0.2:
   version "3.0.2"
   resolved "https://registry.yarnpkg.com/escalade/-/escalade-3.0.2.tgz#6a580d70edb87880f22b4c91d0d56078df6962c4"
@@ -8649,11 +8358,6 @@ fd-slicer@~1.1.0:
   dependencies:
     pend "~1.2.0"
 
-fdir@^6.4.2:
-  version "6.4.3"
-  resolved "https://registry.yarnpkg.com/fdir/-/fdir-6.4.3.tgz#011cdacf837eca9b811c89dbb902df714273db72"
-  integrity sha512-PMXmW2y1hDDfTSRc9gaXIuCCRpuoz3Kaz8cUelp3smouvfT632ozg2vrT6lJsHKKOF59YLbOGfAWGUcKEfRMQw==
-
 fetch-blob@^3.1.2, fetch-blob@^3.1.4:
   version "3.2.0"
   resolved "https://registry.yarnpkg.com/fetch-blob/-/fetch-blob-3.2.0.tgz#f09b8d4bbd45adc6f0c20b7e787e793e309dcce9"
@@ -9292,18 +8996,6 @@ glob@^10.2.5:
     minipass "^5.0.0 || ^6.0.2"
     path-scurry "^1.7.0"
 
-glob@^10.3.10:
-  version "10.4.5"
-  resolved "https://registry.yarnpkg.com/glob/-/glob-10.4.5.tgz#f4d9f0b90ffdbab09c9d77f5f29b4262517b0956"
-  integrity sha512-7Bv8RF0k6xjo7d4A/PxYLbUCfb6c+Vpd2/mB2yRDlew7Jb5hEXiCD9ibfO7wpk8i4sevK6DFny9h7EYbM3/sHg==
-  dependencies:
-    foreground-child "^3.1.0"
-    jackspeak "^3.1.2"
-    minimatch "^9.0.4"
-    minipass "^7.1.2"
-    package-json-from-dist "^1.0.0"
-    path-scurry "^1.11.1"
-
 glob@^6.0.1:
   version "6.0.4"
   resolved "https://registry.yarnpkg.com/glob/-/glob-6.0.4.tgz#0f08860f6a155127b2fadd4f9ce24b1aab6e4d22"
@@ -11489,11 +11181,6 @@ jose@5.4.1:
   resolved "https://registry.yarnpkg.com/jose/-/jose-5.4.1.tgz#b471ee3963920ba5452fd1b1398c8ba72a7b2fcf"
   integrity sha512-U6QajmpV/nhL9SyfAewo000fkiRQ+Yd2H0lBxJJ9apjpOgkOcBQJWOrMo917lxLptdS/n/o/xPzMkXhF46K8hQ==
 
-joycon@^3.1.1:
-  version "3.1.1"
-  resolved "https://registry.yarnpkg.com/joycon/-/joycon-3.1.1.tgz#bce8596d6ae808f8b68168f5fc69280996894f03"
-  integrity sha512-34wB/Y7MW7bzjKRjUKTa46I2Z7eV62Rkhva+KkopW7Qvv/OSWBqvkSY7vusOPrNuZcUG3tApvdVgNB8POj3SPw==
-
 jpeg-js@^0.4.2:
   version "0.4.4"
   resolved "https://registry.yarnpkg.com/jpeg-js/-/jpeg-js-0.4.4.tgz#a9f1c6f1f9f0fa80cdb3484ed9635054d28936aa"
@@ -11880,11 +11567,6 @@ lighthouse-logger@^1.0.0:
     debug "^2.6.8"
     marky "^1.2.0"
 
-lilconfig@^3.1.1:
-  version "3.1.3"
-  resolved "https://registry.yarnpkg.com/lilconfig/-/lilconfig-3.1.3.tgz#a1bcfd6257f9585bf5ae14ceeebb7b559025e4c4"
-  integrity sha512-/vlFKAoH5Cgt3Ie+JLhRbwOsCQePABiU3tJ1egGvyQ+33R/vcwM2Zl2QR/LzjsBeItPt3oSVXapn+m4nQDvpzw==
-
 lines-and-columns@^1.1.6:
   version "1.2.4"
   resolved "https://registry.yarnpkg.com/lines-and-columns/-/lines-and-columns-1.2.4.tgz#eca284f75d2965079309dc0ad9255abb2ebc1632"
@@ -11906,11 +11588,6 @@ load-json-file@^1.0.0:
     pinkie-promise "^2.0.0"
     strip-bom "^2.0.0"
 
-load-tsconfig@^0.2.3:
-  version "0.2.5"
-  resolved "https://registry.yarnpkg.com/load-tsconfig/-/load-tsconfig-0.2.5.tgz#453b8cd8961bfb912dea77eb6c168fe8cca3d3a1"
-  integrity sha512-IXO6OCs9yg8tMKzfPZ1YmheJbZCiEsnBdcB03l0OcfK9prKnJb96siuHCr5Fl37/yo9DnKU+TLpxzTUspw9shg==
-
 loader-runner@^4.2.0:
   version "4.3.0"
   resolved "https://registry.yarnpkg.com/loader-runner/-/loader-runner-4.3.0.tgz#c1b4a163b99f614830353b16755e7149ac2314e1"
@@ -12047,11 +11724,6 @@ lodash.omitby@4.6.0:
   resolved "https://registry.yarnpkg.com/lodash.omitby/-/lodash.omitby-4.6.0.tgz#5c15ff4754ad555016b53c041311e8f079204791"
   integrity sha1-XBX/R1StVVAWtTwEExHo8HkgR5E=
 
-lodash.sortby@^4.7.0:
-  version "4.7.0"
-  resolved "https://registry.yarnpkg.com/lodash.sortby/-/lodash.sortby-4.7.0.tgz#edd14c824e2cc9c1e0b0a1b42bb5210516a42438"
-  integrity sha512-HDWXG8isMntAyRF5vZ7xKuEvOhT4AhlRt/3czTSjvGUxjYCBVRQY48ViDHyfYz9VIoBkW4TMGQNapx+l3RUwdA==
-
 lodash.truncate@^4.4.2:
   version "4.4.2"
   resolved "https://registry.yarnpkg.com/lodash.truncate/-/lodash.truncate-4.4.2.tgz#5a350da0b1113b837ecfffd5812cbe58d6eae193"
@@ -12572,7 +12244,7 @@ ms@2.1.2:
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009"
   integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==
 
-ms@2.1.3, ms@^2.1.1, ms@^2.1.2, ms@^2.1.3:
+ms@2.1.3, ms@^2.1.1, ms@^2.1.2:
   version "2.1.3"
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2"
   integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==
@@ -12604,7 +12276,7 @@ mv@~2:
     ncp "~2.0.0"
     rimraf "~2.4.0"
 
-mz@2.7.0, mz@^2.7.0:
+mz@2.7.0:
   version "2.7.0"
   resolved "https://registry.yarnpkg.com/mz/-/mz-2.7.0.tgz#95008057a56cafadc2bc63dde7f9ff6955948e32"
   integrity sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==
@@ -13646,11 +13318,6 @@ picocolors@^1.0.0:
   resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.0.0.tgz#cb5bdc74ff3f51892236eaf79d68bc44564ab81c"
   integrity sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==
 
-picocolors@^1.1.1:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/picocolors/-/picocolors-1.1.1.tgz#3d321af3eab939b083c8f929a1d12cda81c26b6b"
-  integrity sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==
-
 picomatch@^2.0.4, picomatch@^2.2.3, picomatch@^2.3.1:
   version "2.3.1"
   resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-2.3.1.tgz#3ba3833733646d9d3e4995946c1365a67fb07a42"
@@ -13821,13 +13488,6 @@ posix-character-classes@^0.1.0:
   resolved "https://registry.yarnpkg.com/posix-character-classes/-/posix-character-classes-0.1.1.tgz#01eac0fe3b5af71a2a6c02feabb8c1fef7e00eab"
   integrity sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=
 
-postcss-load-config@^6.0.1:
-  version "6.0.1"
-  resolved "https://registry.yarnpkg.com/postcss-load-config/-/postcss-load-config-6.0.1.tgz#6fd7dcd8ae89badcf1b2d644489cbabf83aa8096"
-  integrity sha512-oPtTM4oerL+UXmx+93ytZVN82RrlY/wPUV8IeDxFrzIjXOLF1pN+EmKPLbubvKHT2HC20xXsCAH2Z+CKV6Oz/g==
-  dependencies:
-    lilconfig "^3.1.1"
-
 postcss-modules-extract-imports@^1.2.0:
   version "1.2.1"
   resolved "https://registry.yarnpkg.com/postcss-modules-extract-imports/-/postcss-modules-extract-imports-1.2.1.tgz#dc87e34148ec7eab5f791f7cd5849833375b741a"
@@ -14556,11 +14216,6 @@ readdirp@^2.2.1:
     micromatch "^3.1.10"
     readable-stream "^2.0.2"
 
-readdirp@^4.0.1:
-  version "4.1.2"
-  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-4.1.2.tgz#eb85801435fbf2a7ee58f19e0921b068fc69948d"
-  integrity sha512-GDhwkLfywWL2s6vEjyhri+eXmfH6j1L7JE27WhqLeYzoh/A3DBaYGEj2H/HFZCn/kMfim73FXxEJTw06WtxQwg==
-
 readdirp@~3.6.0:
   version "3.6.0"
   resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-3.6.0.tgz#74a370bd857116e245b29cc97340cd431a02a6c7"
@@ -15003,34 +14658,6 @@ rollup@^3.29.5:
   optionalDependencies:
     fsevents "~2.3.2"
 
-rollup@^4.24.0:
-  version "4.34.7"
-  resolved "https://registry.yarnpkg.com/rollup/-/rollup-4.34.7.tgz#e00d8550688a616a3481c6446bb688d4c753ba8f"
-  integrity sha512-8qhyN0oZ4x0H6wmBgfKxJtxM7qS98YJ0k0kNh5ECVtuchIJ7z9IVVvzpmtQyT10PXKMtBxYr1wQ5Apg8RS8kXQ==
-  dependencies:
-    "@types/estree" "1.0.6"
-  optionalDependencies:
-    "@rollup/rollup-android-arm-eabi" "4.34.7"
-    "@rollup/rollup-android-arm64" "4.34.7"
-    "@rollup/rollup-darwin-arm64" "4.34.7"
-    "@rollup/rollup-darwin-x64" "4.34.7"
-    "@rollup/rollup-freebsd-arm64" "4.34.7"
-    "@rollup/rollup-freebsd-x64" "4.34.7"
-    "@rollup/rollup-linux-arm-gnueabihf" "4.34.7"
-    "@rollup/rollup-linux-arm-musleabihf" "4.34.7"
-    "@rollup/rollup-linux-arm64-gnu" "4.34.7"
-    "@rollup/rollup-linux-arm64-musl" "4.34.7"
-    "@rollup/rollup-linux-loongarch64-gnu" "4.34.7"
-    "@rollup/rollup-linux-powerpc64le-gnu" "4.34.7"
-    "@rollup/rollup-linux-riscv64-gnu" "4.34.7"
-    "@rollup/rollup-linux-s390x-gnu" "4.34.7"
-    "@rollup/rollup-linux-x64-gnu" "4.34.7"
-    "@rollup/rollup-linux-x64-musl" "4.34.7"
-    "@rollup/rollup-win32-arm64-msvc" "4.34.7"
-    "@rollup/rollup-win32-ia32-msvc" "4.34.7"
-    "@rollup/rollup-win32-x64-msvc" "4.34.7"
-    fsevents "~2.3.2"
-
 rrweb-cssom@^0.6.0:
   version "0.6.0"
   resolved "https://registry.yarnpkg.com/rrweb-cssom/-/rrweb-cssom-0.6.0.tgz#ed298055b97cbddcdeb278f904857629dec5e0e1"
@@ -15671,13 +15298,6 @@ source-map-url@^0.4.0:
   resolved "https://registry.yarnpkg.com/source-map-url/-/source-map-url-0.4.0.tgz#3e935d7ddd73631b97659956d55128e87b5084a3"
   integrity sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=
 
-source-map@0.8.0-beta.0:
-  version "0.8.0-beta.0"
-  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.8.0-beta.0.tgz#d4c1bb42c3f7ee925f005927ba10709e0d1d1f11"
-  integrity sha512-2ymg6oRBpebeZi9UUNsgQ89bhx01TcTkmNTGnNO88imTmbSgy4nfujrgVEFKWpMTEGA11EDkTt7mqObTPdigIA==
-  dependencies:
-    whatwg-url "^7.0.0"
-
 source-map@^0.5.0, source-map@^0.5.1, source-map@^0.5.6:
   version "0.5.7"
   resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc"
@@ -16136,19 +15756,6 @@ style-loader@^1.2.1:
     loader-utils "^2.0.0"
     schema-utils "^2.6.6"
 
-sucrase@^3.35.0:
-  version "3.35.0"
-  resolved "https://registry.yarnpkg.com/sucrase/-/sucrase-3.35.0.tgz#57f17a3d7e19b36d8995f06679d121be914ae263"
-  integrity sha512-8EbVDiu9iN/nESwxeSxDKe0dunta1GOlHufmSSXxMD2z2/tMZpDMpvXQGsc+ajGo8y2uYUmixaSRUc/QPoQ0GA==
-  dependencies:
-    "@jridgewell/gen-mapping" "^0.3.2"
-    commander "^4.0.0"
-    glob "^10.3.10"
-    lines-and-columns "^1.1.6"
-    mz "^2.7.0"
-    pirates "^4.0.1"
-    ts-interface-checker "^0.1.9"
-
 sumchecker@^3.0.1:
   version "3.0.1"
   resolved "https://registry.yarnpkg.com/sumchecker/-/sumchecker-3.0.1.tgz#6377e996795abb0b6d348e9b3e1dfb24345a8e42"
@@ -16437,19 +16044,6 @@ tiny-warning@^1.0.3:
   resolved "https://registry.yarnpkg.com/tiny-warning/-/tiny-warning-1.0.3.tgz#94a30db453df4c643d0fd566060d60a875d84754"
   integrity sha512-lBN9zLN/oAf68o3zNXYrdCt1kP8WsiGW8Oo2ka41b2IM5JL/S1CTyX1rW0mb/zSuJun0ZUrDxx4sqvYS2FWzPA==
 
-tinyexec@^0.3.1:
-  version "0.3.2"
-  resolved "https://registry.yarnpkg.com/tinyexec/-/tinyexec-0.3.2.tgz#941794e657a85e496577995c6eef66f53f42b3d2"
-  integrity sha512-KQQR9yN7R5+OSwaK0XQoj22pwHoTlgYqmUscPYoknOoWCWfj/5/ABTMRi69FrKU5ffPVh5QcFikpWJI/P1ocHA==
-
-tinyglobby@^0.2.9:
-  version "0.2.10"
-  resolved "https://registry.yarnpkg.com/tinyglobby/-/tinyglobby-0.2.10.tgz#e712cf2dc9b95a1f5c5bbd159720e15833977a0f"
-  integrity sha512-Zc+8eJlFMvgatPZTl6A9L/yht8QqdmUNtURHaKZLmKBE12hNPSrqNkUp2cs3M/UKmNVVAMFQYSjYIVHDjW5zew==
-  dependencies:
-    fdir "^6.4.2"
-    picomatch "^4.0.2"
-
 titleize@^3.0.0:
   version "3.0.0"
   resolved "https://registry.yarnpkg.com/titleize/-/titleize-3.0.0.tgz#71c12eb7fdd2558aa8a44b0be83b8a76694acd53"
@@ -16556,13 +16150,6 @@ tough-cookie@^4.1.2:
     universalify "^0.2.0"
     url-parse "^1.5.3"
 
-tr46@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/tr46/-/tr46-1.0.1.tgz#a8b13fd6bfd2489519674ccde55ba3693b706d09"
-  integrity sha512-dTpowEjclQ7Kgx5SdBkqRzVhERQXov8/l9Ft9dVM9fmg0W0KQSVaXX9T4i6twCPNtYiZM53lpSSUAwJbFPOHxA==
-  dependencies:
-    punycode "^2.1.0"
-
 tr46@^4.1.1:
   version "4.1.1"
   resolved "https://registry.yarnpkg.com/tr46/-/tr46-4.1.1.tgz#281a758dcc82aeb4fe38c7dfe4d11a395aac8469"
@@ -16580,11 +16167,6 @@ traverse-chain@~0.1.0:
   resolved "https://registry.yarnpkg.com/traverse-chain/-/traverse-chain-0.1.0.tgz#61dbc2d53b69ff6091a12a168fd7d433107e40f1"
   integrity sha1-YdvC1Ttp/2CRoSoWj9fUMxB+QPE=
 
-tree-kill@^1.2.2:
-  version "1.2.2"
-  resolved "https://registry.yarnpkg.com/tree-kill/-/tree-kill-1.2.2.tgz#4ca09a9092c88b73a7cdc5e8a01b507b0790a0cc"
-  integrity sha512-L0Orpi8qGpRG//Nd+H90vFB+3iHnue1zSSGmNOOCh1GLJ7rUKVwV2HvijphGQS2UmhUZewS9VgvxYIdgr+fG1A==
-
 trim-newlines@^1.0.0:
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/trim-newlines/-/trim-newlines-1.0.0.tgz#5887966bb582a4503a41eb524f7d35011815a613"
@@ -16602,11 +16184,6 @@ ts-api-utils@^1.0.1:
   resolved "https://registry.yarnpkg.com/ts-api-utils/-/ts-api-utils-1.3.0.tgz#4b490e27129f1e8e686b45cc4ab63714dc60eea1"
   integrity sha512-UQMIo7pb8WRomKR1/+MFVLTroIvDVtMX3K6OUir8ynLyzB8Jeriont2bTAtmNPa1ekAgN7YPDyf6V+ygrdU+eQ==
 
-ts-interface-checker@^0.1.9:
-  version "0.1.13"
-  resolved "https://registry.yarnpkg.com/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz#784fd3d679722bc103b1b4b8030bcddb5db2a699"
-  integrity sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==
-
 ts-node@8.9.1:
   version "8.9.1"
   resolved "https://registry.yarnpkg.com/ts-node/-/ts-node-8.9.1.tgz#2f857f46c47e91dcd28a14e052482eb14cfd65a5"
@@ -16633,28 +16210,6 @@ tslib@^2.3.0:
   resolved "https://registry.yarnpkg.com/tslib/-/tslib-2.3.0.tgz#803b8cdab3e12ba581a4ca41c8839bbb0dacb09e"
   integrity sha512-N82ooyxVNm6h1riLCoyS9e3fuJ3AMG2zIZs2Gd1ATcSFjSA23Q0fzjjZeh0jbJvWVDZ0cJT8yaNNaaXHzueNjg==
 
-tsup@^8.3.5:
-  version "8.3.6"
-  resolved "https://registry.yarnpkg.com/tsup/-/tsup-8.3.6.tgz#a10eb2dc27f84b510a0f00341ab75cad03d13a88"
-  integrity sha512-XkVtlDV/58S9Ye0JxUUTcrQk4S+EqlOHKzg6Roa62rdjL1nGWNUstG0xgI4vanHdfIpjP448J8vlN0oK6XOJ5g==
-  dependencies:
-    bundle-require "^5.0.0"
-    cac "^6.7.14"
-    chokidar "^4.0.1"
-    consola "^3.2.3"
-    debug "^4.3.7"
-    esbuild "^0.24.0"
-    joycon "^3.1.1"
-    picocolors "^1.1.1"
-    postcss-load-config "^6.0.1"
-    resolve-from "^5.0.0"
-    rollup "^4.24.0"
-    source-map "0.8.0-beta.0"
-    sucrase "^3.35.0"
-    tinyexec "^0.3.1"
-    tinyglobby "^0.2.9"
-    tree-kill "^1.2.2"
-
 tsutils@^3.17.1:
   version "3.17.1"
   resolved "https://registry.yarnpkg.com/tsutils/-/tsutils-3.17.1.tgz#ed719917f11ca0dee586272b2ac49e015a2dd759"
@@ -17287,11 +16842,6 @@ webidl-conversions@^3.0.0:
   resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-3.0.1.tgz#24534275e2a7bc6be7bc86611cc16ae0a5654871"
   integrity sha512-2JAn3z8AR6rjK8Sm8orRC0h/bcl/DqL7tRPdGZ4I1CjdF+EaMLmYxBHyXuKL849eucPFhvBoxMsflfOb8kxaeQ==
 
-webidl-conversions@^4.0.2:
-  version "4.0.2"
-  resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-4.0.2.tgz#a855980b1f0b6b359ba1d5d9fb39ae941faa63ad"
-  integrity sha512-YQ+BmxuTgd6UXZW3+ICGfyqRyHXVlD5GtQr5+qjiNW7bF0cqrzX500HVXPBOvgXb5YnzDd+h0zqyv61KUD7+Sg==
-
 webidl-conversions@^7.0.0:
   version "7.0.0"
   resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-7.0.0.tgz#256b4e1882be7debbf01d05f0aa2039778ea080a"
@@ -17462,15 +17012,6 @@ whatwg-url@^5.0.0:
     tr46 "~0.0.3"
     webidl-conversions "^3.0.0"
 
-whatwg-url@^7.0.0:
-  version "7.1.0"
-  resolved "https://registry.yarnpkg.com/whatwg-url/-/whatwg-url-7.1.0.tgz#c2c492f1eca612988efd3d2266be1b9fc6170d06"
-  integrity sha512-WUu7Rg1DroM7oQvGWfOiAK21n74Gg+T4elXEQYkOhtyLeWiJFoOGLXPKI/9gzIie9CtwVLm8wtw6YJdKyxSjeg==
-  dependencies:
-    lodash.sortby "^4.7.0"
-    tr46 "^1.0.1"
-    webidl-conversions "^4.0.2"
-
 when@3.7.7:
   version "3.7.7"
   resolved "https://registry.yarnpkg.com/when/-/when-3.7.7.tgz#aba03fc3bb736d6c88b091d013d8a8e590d84718"

From be91130f184f04c6e7bb9ff18222aba2ef2f96f6 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 15:14:43 -0600
Subject: [PATCH 57/72] chore: remove `devEngines` declaration in root package
 (#32398)

This change removes the `devEngines` declaration in the root package. It
didn't match the package.json spec and in npm 10.9.0 (released in
October), a breaking change was introduced that checks the `devEngines`
property. This causes `npm pack` calls to fail, due to the malformed
`devEngines`. Since there's already an `.nvmrc` defined in the repo, and
no strong need to enforce a specific node version for local development,
this removes the declaration altogether.
---
 package.json | 5 +----
 1 file changed, 1 insertion(+), 4 deletions(-)

diff --git a/package.json b/package.json
index 95fffa700a7e7..8e5dae3f944a0 100644
--- a/package.json
+++ b/package.json
@@ -106,9 +106,6 @@
     "web-streams-polyfill": "^3.1.1",
     "yargs": "^15.3.1"
   },
-  "devEngines": {
-    "node": "16.x || 18.x || 20.x || 22.x"
-  },
   "jest": {
     "testRegex": "/scripts/jest/dont-run-jest-directly\\.js$"
   },
@@ -122,7 +119,7 @@
     "lint": "node ./scripts/tasks/eslint.js",
     "lint-build": "node ./scripts/rollup/validate/index.js",
     "extract-errors": "node scripts/error-codes/extract-errors.js",
-    "postinstall": "node node_modules/fbjs-scripts/node/check-dev-engines.js package.json && node ./scripts/flow/createFlowConfigs.js",
+    "postinstall": "node ./scripts/flow/createFlowConfigs.js",
     "test": "node ./scripts/jest/jest-cli.js",
     "test-stable": "node ./scripts/jest/jest-cli.js --release-channel=stable",
     "test-www": "node ./scripts/jest/jest-cli.js --release-channel=www-modern",

From eb1f77dedfc8f7491ecd39b160e4743fa39dfc99 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 16:00:43 -0600
Subject: [PATCH 58/72] ci: add workflow for running the eslint plugin e2e
 tests (#32397)

This change adds a workflow for PR builds, that runs the e2e tests for
`eslint-plugin-react-hooks` created in #32396

![screenshot of ci tests
running](https://github.com/user-attachments/assets/307a878c-92b5-44cf-84f2-3b21979b262a)
---
 .../workflows/runtime_eslint_plugin_e2e.yml   | 56 +++++++++++++++++++
 fixtures/eslint-v6/build.mjs                  |  9 ++-
 fixtures/eslint-v6/package.json               |  2 +-
 fixtures/eslint-v6/yarn.lock                  |  2 +-
 fixtures/eslint-v7/build.mjs                  |  9 ++-
 fixtures/eslint-v7/package.json               |  2 +-
 fixtures/eslint-v7/yarn.lock                  |  2 +-
 fixtures/eslint-v8/build.mjs                  |  9 ++-
 fixtures/eslint-v8/package.json               |  2 +-
 fixtures/eslint-v8/yarn.lock                  |  2 +-
 fixtures/eslint-v9/build.mjs                  |  9 ++-
 fixtures/eslint-v9/package.json               |  2 +-
 fixtures/eslint-v9/yarn.lock                  |  2 +-
 13 files changed, 96 insertions(+), 12 deletions(-)
 create mode 100644 .github/workflows/runtime_eslint_plugin_e2e.yml

diff --git a/.github/workflows/runtime_eslint_plugin_e2e.yml b/.github/workflows/runtime_eslint_plugin_e2e.yml
new file mode 100644
index 0000000000000..a6f0bf28f005e
--- /dev/null
+++ b/.github/workflows/runtime_eslint_plugin_e2e.yml
@@ -0,0 +1,56 @@
+name: (Runtime) ESLint Plugin E2E
+
+on:
+  push:
+    branches: [main]
+  pull_request:
+    paths-ignore:
+      - compiler/**
+
+concurrency:
+  group: ${{ github.workflow }}-${{ github.ref_name }}-${{ github.event.pull_request.number || github.run_id }}
+  cancel-in-progress: true
+
+env:
+  TZ: /usr/share/zoneinfo/America/Los_Angeles
+
+jobs:
+  # ----- TESTS -----
+  test:
+    name: ESLint v${{ matrix.eslint_major }}
+    runs-on: ubuntu-latest
+    strategy:
+      matrix:
+        eslint_major:
+          - "6"
+          - "7"
+          - "8"
+          - "9"
+    continue-on-error: true
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          ref: ${{ github.event.pull_request.head.sha || github.sha }}
+      - uses: actions/setup-node@v4
+        with:
+          node-version-file: '.nvmrc'
+          cache: yarn
+          cache-dependency-path: yarn.lock
+      - name: Restore cached node_modules
+        uses: actions/cache@v4
+        id: node_modules
+        with:
+          path: "**/node_modules"
+          key: runtime-eslint_e2e-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('yarn.lock') }}
+      - name: Ensure clean build directory
+        run: rm -rf build
+      - run: yarn install --frozen-lockfile
+      - name: Build plugin
+        working-directory: fixtures/eslint-v${{ matrix.eslint_major }}
+        run: node build.mjs
+      - name: Install fixture dependencies
+        working-directory: ./fixtures/eslint-v${{ matrix.eslint_major }}
+        run: yarn --frozen-lockfile
+      - name: Run lint test
+        working-directory: ./fixtures/eslint-v${{ matrix.eslint_major }}
+        run: yarn lint
diff --git a/fixtures/eslint-v6/build.mjs b/fixtures/eslint-v6/build.mjs
index 02a1bbd25e00e..ebcea15190dae 100644
--- a/fixtures/eslint-v6/build.mjs
+++ b/fixtures/eslint-v6/build.mjs
@@ -1,5 +1,12 @@
 #!/usr/bin/env node
 
 import {exec} from 'node:child_process';
+import {dirname, resolve} from 'node:path';
+import {fileURLToPath} from 'node:url';
 
-exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = dirname(__filename);
+
+exec('yarn build -r stable eslint-plugin-react-hooks', {
+  cwd: resolve(__dirname, '..', '..'),
+});
diff --git a/fixtures/eslint-v6/package.json b/fixtures/eslint-v6/package.json
index 50c92054b436f..c410edd78fc87 100644
--- a/fixtures/eslint-v6/package.json
+++ b/fixtures/eslint-v6/package.json
@@ -3,7 +3,7 @@
   "name": "eslint-v6",
   "dependencies": {
     "eslint": "^6",
-    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks"
   },
   "scripts": {
     "build": "node build.mjs && yarn",
diff --git a/fixtures/eslint-v6/yarn.lock b/fixtures/eslint-v6/yarn.lock
index 3d6dbca037b38..5af9623e877f3 100644
--- a/fixtures/eslint-v6/yarn.lock
+++ b/fixtures/eslint-v6/yarn.lock
@@ -205,7 +205,7 @@ escape-string-regexp@^1.0.5:
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
   integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
 
-"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+"eslint-plugin-react-hooks@link:../../build/oss-stable/eslint-plugin-react-hooks":
   version "0.0.0"
   uid ""
 
diff --git a/fixtures/eslint-v7/build.mjs b/fixtures/eslint-v7/build.mjs
index 02a1bbd25e00e..ebcea15190dae 100644
--- a/fixtures/eslint-v7/build.mjs
+++ b/fixtures/eslint-v7/build.mjs
@@ -1,5 +1,12 @@
 #!/usr/bin/env node
 
 import {exec} from 'node:child_process';
+import {dirname, resolve} from 'node:path';
+import {fileURLToPath} from 'node:url';
 
-exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = dirname(__filename);
+
+exec('yarn build -r stable eslint-plugin-react-hooks', {
+  cwd: resolve(__dirname, '..', '..'),
+});
diff --git a/fixtures/eslint-v7/package.json b/fixtures/eslint-v7/package.json
index 90c369c603e6d..5e64917514599 100644
--- a/fixtures/eslint-v7/package.json
+++ b/fixtures/eslint-v7/package.json
@@ -3,7 +3,7 @@
   "name": "eslint-v7",
   "dependencies": {
     "eslint": "^7",
-    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks"
   },
   "scripts": {
     "build": "node build.mjs && yarn",
diff --git a/fixtures/eslint-v7/yarn.lock b/fixtures/eslint-v7/yarn.lock
index 62f97bbc20d69..4a191de947f37 100644
--- a/fixtures/eslint-v7/yarn.lock
+++ b/fixtures/eslint-v7/yarn.lock
@@ -234,7 +234,7 @@ escape-string-regexp@^4.0.0:
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
   integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
 
-"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+"eslint-plugin-react-hooks@link:../../build/oss-stable/eslint-plugin-react-hooks":
   version "0.0.0"
   uid ""
 
diff --git a/fixtures/eslint-v8/build.mjs b/fixtures/eslint-v8/build.mjs
index 02a1bbd25e00e..ebcea15190dae 100644
--- a/fixtures/eslint-v8/build.mjs
+++ b/fixtures/eslint-v8/build.mjs
@@ -1,5 +1,12 @@
 #!/usr/bin/env node
 
 import {exec} from 'node:child_process';
+import {dirname, resolve} from 'node:path';
+import {fileURLToPath} from 'node:url';
 
-exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = dirname(__filename);
+
+exec('yarn build -r stable eslint-plugin-react-hooks', {
+  cwd: resolve(__dirname, '..', '..'),
+});
diff --git a/fixtures/eslint-v8/package.json b/fixtures/eslint-v8/package.json
index 620520ecdbfd4..ed3de107c524f 100644
--- a/fixtures/eslint-v8/package.json
+++ b/fixtures/eslint-v8/package.json
@@ -3,7 +3,7 @@
   "name": "eslint-v8",
   "dependencies": {
     "eslint": "^8",
-    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks"
   },
   "scripts": {
     "build": "node build.mjs && yarn",
diff --git a/fixtures/eslint-v8/yarn.lock b/fixtures/eslint-v8/yarn.lock
index 88d04029954a4..d5a947b6347d7 100644
--- a/fixtures/eslint-v8/yarn.lock
+++ b/fixtures/eslint-v8/yarn.lock
@@ -192,7 +192,7 @@ escape-string-regexp@^4.0.0:
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
   integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
 
-"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+"eslint-plugin-react-hooks@link:../../build/oss-stable/eslint-plugin-react-hooks":
   version "0.0.0"
   uid ""
 
diff --git a/fixtures/eslint-v9/build.mjs b/fixtures/eslint-v9/build.mjs
index 02a1bbd25e00e..ebcea15190dae 100644
--- a/fixtures/eslint-v9/build.mjs
+++ b/fixtures/eslint-v9/build.mjs
@@ -1,5 +1,12 @@
 #!/usr/bin/env node
 
 import {exec} from 'node:child_process';
+import {dirname, resolve} from 'node:path';
+import {fileURLToPath} from 'node:url';
 
-exec('cd ../.. && yarn build -r stable eslint-plugin-react-hooks');
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = dirname(__filename);
+
+exec('yarn build -r stable eslint-plugin-react-hooks', {
+  cwd: resolve(__dirname, '..', '..'),
+});
diff --git a/fixtures/eslint-v9/package.json b/fixtures/eslint-v9/package.json
index e8ae91a0613e1..58d0a94c0c58c 100644
--- a/fixtures/eslint-v9/package.json
+++ b/fixtures/eslint-v9/package.json
@@ -3,7 +3,7 @@
   "name": "eslint-v9",
   "dependencies": {
     "eslint": "^9",
-    "eslint-plugin-react-hooks": "link:../../build/node_modules/eslint-plugin-react-hooks"
+    "eslint-plugin-react-hooks": "link:../../build/oss-stable/eslint-plugin-react-hooks"
   },
   "scripts": {
     "build": "node build.mjs && yarn",
diff --git a/fixtures/eslint-v9/yarn.lock b/fixtures/eslint-v9/yarn.lock
index 5a1a246827f6f..1583b73f14e21 100644
--- a/fixtures/eslint-v9/yarn.lock
+++ b/fixtures/eslint-v9/yarn.lock
@@ -209,7 +209,7 @@ escape-string-regexp@^4.0.0:
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34"
   integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==
 
-"eslint-plugin-react-hooks@link:../../build/node_modules/eslint-plugin-react-hooks":
+"eslint-plugin-react-hooks@link:../../build/oss-stable/eslint-plugin-react-hooks":
   version "0.0.0"
   uid ""
 

From 4632e36a4ef16a1af24987c56e42b664f6403e64 Mon Sep 17 00:00:00 2001
From: michael faith <michaelfaith@users.noreply.github.com>
Date: Sun, 16 Feb 2025 19:28:12 -0600
Subject: [PATCH 59/72] refactor(eslint-plugin-react-hooks): change array type
 and improve conditionals (#32400)

- [build(eslint-plugin-react-hooks): add
ts-linting](https://github.com/facebook/react/commit/4c0fbe73d9abc2681445f62b9450737f3df12ee2)
This change adds configuration to the eslint config governing
`eslint-plugin-react-hooks` to use the typescript-eslint plugin and
parser. It adds the typescript-recommended config, and configures the
team's preferred `array-type` convention.

- [refactor(eslint-plugin-react-hooks): improve
conditionals](https://github.com/facebook/react/commit/540d0d95bc5172ef95ccc2ad70b4b202b6eeedd2)
This change addresses several feedback items from
https://github.com/facebook/react/pull/32240

- [ci (eslint-e2e): exclude nested node_modules from
cache](https://github.com/facebook/react/pull/32400/commits/a3279f46a85cfb4ddea5a863a6f7c71344280d36)
This change removes the nested fixture `node_modules` from being cached,
so that the symbolic link can be made after the build happens.
---
 .eslintrc.js                                  | 25 ++++++++--
 .../workflows/runtime_eslint_plugin_e2e.yml   |  2 +-
 package.json                                  |  2 +
 .../src/ExhaustiveDeps.ts                     | 32 ++++++------
 .../src/RulesOfHooks.ts                       | 12 +++--
 yarn.lock                                     | 50 ++++++++++++++++++-
 6 files changed, 97 insertions(+), 26 deletions(-)

diff --git a/.eslintrc.js b/.eslintrc.js
index 7fe08f4cdf36e..360bd5ba76a9c 100644
--- a/.eslintrc.js
+++ b/.eslintrc.js
@@ -446,10 +446,7 @@ module.exports = {
       },
     },
     {
-      files: [
-        'scripts/eslint-rules/*.js',
-        'packages/eslint-plugin-react-hooks/src/*.js',
-      ],
+      files: ['scripts/eslint-rules/*.js'],
       plugins: ['eslint-plugin'],
       rules: {
         'eslint-plugin/prefer-object-rule': ERROR,
@@ -517,6 +514,26 @@ module.exports = {
         __IS_INTERNAL_VERSION__: 'readonly',
       },
     },
+    {
+      files: ['packages/eslint-plugin-react-hooks/src/**/*'],
+      extends: ['plugin:@typescript-eslint/recommended'],
+      parser: '@typescript-eslint/parser',
+      plugins: ['@typescript-eslint', 'eslint-plugin'],
+      rules: {
+        '@typescript-eslint/no-explicit-any': OFF,
+        '@typescript-eslint/no-non-null-assertion': OFF,
+        '@typescript-eslint/array-type': [ERROR, {default: 'generic'}],
+
+        'es/no-optional-chaining': OFF,
+
+        'eslint-plugin/prefer-object-rule': ERROR,
+        'eslint-plugin/require-meta-fixable': [
+          ERROR,
+          {catchNoFixerButFixableProperty: true},
+        ],
+        'eslint-plugin/require-meta-has-suggestions': ERROR,
+      },
+    },
   ],
 
   env: {
diff --git a/.github/workflows/runtime_eslint_plugin_e2e.yml b/.github/workflows/runtime_eslint_plugin_e2e.yml
index a6f0bf28f005e..edc188f38622e 100644
--- a/.github/workflows/runtime_eslint_plugin_e2e.yml
+++ b/.github/workflows/runtime_eslint_plugin_e2e.yml
@@ -40,7 +40,7 @@ jobs:
         uses: actions/cache@v4
         id: node_modules
         with:
-          path: "**/node_modules"
+          path: "node_modules"
           key: runtime-eslint_e2e-node_modules-${{ runner.arch }}-${{ runner.os }}-${{ hashFiles('yarn.lock') }}
       - name: Ensure clean build directory
         run: rm -rf build
diff --git a/package.json b/package.json
index 8e5dae3f944a0..0a2b6c3024c93 100644
--- a/package.json
+++ b/package.json
@@ -42,6 +42,8 @@
     "@rollup/plugin-node-resolve": "^15.0.1",
     "@rollup/plugin-replace": "^5.0.2",
     "@rollup/plugin-typescript": "^12.1.2",
+    "@typescript-eslint/eslint-plugin": "^6.21.0",
+    "@typescript-eslint/parser": "^6.21.0",
     "abortcontroller-polyfill": "^1.7.5",
     "art": "0.10.1",
     "babel-plugin-syntax-trailing-function-commas": "^6.5.0",
diff --git a/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts b/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
index 9f3d4d4db9004..1b0059757278f 100644
--- a/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
+++ b/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.ts
@@ -28,7 +28,7 @@ type DeclaredDependency = {
 
 type Dependency = {
   isStable: boolean;
-  references: Scope.Reference[];
+  references: Array<Scope.Reference>;
 };
 
 type DependencyTreeNode = {
@@ -184,7 +184,9 @@ const rule = {
       // Get the current scope.
       const scope = scopeManager.acquire(node);
       if (!scope) {
-        return;
+        throw new Error(
+          'Unable to acquire scope for the current node. This is a bug in eslint-plugin-react-hooks, please file an issue.',
+        );
       }
 
       // Find all our "pure scopes". On every re-render of a component these
@@ -255,7 +257,7 @@ const rule = {
         // Detect primitive constants
         // const foo = 42
         let declaration = defNode.parent;
-        if (declaration == null && componentScope) {
+        if (declaration == null && componentScope != null) {
           // This might happen if variable is declared after the callback.
           // In that case ESLint won't set up .parent refs.
           // So we'll set them up manually.
@@ -266,7 +268,7 @@ const rule = {
           }
         }
         if (
-          declaration &&
+          declaration != null &&
           'kind' in declaration &&
           declaration.kind === 'const' &&
           init.type === 'Literal' &&
@@ -454,7 +456,7 @@ const rule = {
       function isInsideEffectCleanup(reference: Scope.Reference): boolean {
         let curScope: Scope.Scope | null = reference.from;
         let isInReturnedFunction = false;
-        while (curScope && curScope.block !== node) {
+        while (curScope != null && curScope.block !== node) {
           if (curScope.type === 'function') {
             isInReturnedFunction =
               curScope.block.parent != null &&
@@ -529,7 +531,7 @@ const rule = {
             continue;
           }
           // Ignore references to the function itself as it's not defined yet.
-          if (def.node && def.node.init === node.parent) {
+          if (def.node != null && def.node.init === node.parent) {
             continue;
           }
           // Ignore Flow type parameters
@@ -566,8 +568,8 @@ const rule = {
           // Is React managing this ref or us?
           // Let's see if we can find a .current assignment.
           let foundCurrentAssignment = false;
-          for (const reference of references) {
-            const {identifier} = reference;
+          for (const ref of references) {
+            const {identifier} = ref;
             const {parent} = identifier;
             if (
               parent != null &&
@@ -660,7 +662,7 @@ const rule = {
             }
 
             let fnScope: Scope.Scope | null = reference.from;
-            while (fnScope && fnScope.type !== 'function') {
+            while (fnScope != null && fnScope.type !== 'function') {
               fnScope = fnScope.upper;
             }
             const isDirectlyInsideEffect = fnScope?.block === node;
@@ -704,7 +706,7 @@ const rule = {
         return;
       }
 
-      const declaredDependencies: DeclaredDependency[] = [];
+      const declaredDependencies: Array<DeclaredDependency> = [];
       const externalDependencies = new Set<string>();
       const isArrayExpression =
         declaredDependenciesNode.type === 'ArrayExpression';
@@ -1469,7 +1471,7 @@ function collectRecommendations({
   isEffect,
 }: {
   dependencies: Map<string, Dependency>;
-  declaredDependencies: DeclaredDependency[];
+  declaredDependencies: Array<DeclaredDependency>;
   stableDependencies: Set<string>;
   externalDependencies: Set<string>;
   isEffect: boolean;
@@ -1592,7 +1594,7 @@ function collectRecommendations({
   }
 
   // Collect suggestions in the order they were originally specified.
-  const suggestedDependencies: string[] = [];
+  const suggestedDependencies: Array<string> = [];
   const unnecessaryDependencies = new Set<string>();
   const duplicateDependencies = new Set<string>();
   declaredDependencies.forEach(({key}) => {
@@ -1699,7 +1701,7 @@ function scanForConstructions({
   componentScope,
   scope,
 }: {
-  declaredDependencies: DeclaredDependency[];
+  declaredDependencies: Array<DeclaredDependency>;
   declaredDependenciesNode: Node;
   componentScope: Scope.Scope;
   scope: Scope.Scope;
@@ -1747,7 +1749,7 @@ function scanForConstructions({
       }
       return null;
     })
-    .filter(Boolean) as [Scope.Variable, string][];
+    .filter(Boolean) as Array<[Scope.Variable, string]>;
 
   function isUsedOutsideOfHook(ref: Scope.Variable): boolean {
     let foundWriteExpr = false;
@@ -2007,7 +2009,7 @@ function fastFindReferenceWithParent(start: Node, target: Node): Node | null {
   return null;
 }
 
-function joinEnglish(arr: string[]): string {
+function joinEnglish(arr: Array<string>): string {
   let s = '';
   for (let i = 0; i < arr.length; i++) {
     s += arr[i];
diff --git a/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts b/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
index 24870d71614ea..0ab0c5ff21e4b 100644
--- a/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
+++ b/packages/eslint-plugin-react-hooks/src/RulesOfHooks.ts
@@ -130,8 +130,10 @@ const rule = {
   },
   create(context: Rule.RuleContext) {
     let lastEffect: CallExpression | null = null;
-    const codePathReactHooksMapStack: Map<Rule.CodePathSegment, Node[]>[] = [];
-    const codePathSegmentStack: Rule.CodePathSegment[] = [];
+    const codePathReactHooksMapStack: Array<
+      Map<Rule.CodePathSegment, Array<Node>>
+    > = [];
+    const codePathSegmentStack: Array<Rule.CodePathSegment> = [];
     const useEffectEventFunctions = new WeakSet();
 
     // For a given scope, iterate through the references and add all useEffectEvent definitions. We can
@@ -190,7 +192,7 @@ const rule = {
       // Maintain code path stack as we traverse.
       onCodePathStart: () =>
         codePathReactHooksMapStack.push(
-          new Map<Rule.CodePathSegment, Node[]>(),
+          new Map<Rule.CodePathSegment, Array<Node>>(),
         ),
 
       // Process our code path.
@@ -561,7 +563,7 @@ const rule = {
                 context.report({node: hook, message});
               }
             } else if (
-              codePathNode.parent &&
+              codePathNode.parent != null &&
               (codePathNode.parent.type === 'MethodDefinition' ||
                 // @ts-expect-error `ClassProperty` was removed from typescript-estree in https://github.com/typescript-eslint/typescript-eslint/pull/3806
                 codePathNode.parent.type === 'ClassProperty' ||
@@ -758,7 +760,7 @@ function getFunctionName(node: Node) {
 /**
  * Convenience function for peeking the last item in a stack.
  */
-function last<T>(array: T[]): T {
+function last<T>(array: Array<T>): T {
   return array[array.length - 1] as T;
 }
 
diff --git a/yarn.lock b/yarn.lock
index ba71ba7abe323..7bc936afae4bd 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -2410,6 +2410,11 @@
   dependencies:
     eslint-visitor-keys "^3.3.0"
 
+"@eslint-community/regexpp@^4.5.1":
+  version "4.12.1"
+  resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.12.1.tgz#cfc6cffe39df390a3841cde2abccf92eaa7ae0e0"
+  integrity sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==
+
 "@eslint-community/regexpp@^4.6.1":
   version "4.10.0"
   resolved "https://registry.yarnpkg.com/@eslint-community/regexpp/-/regexpp-4.10.0.tgz#548f6de556857c8bb73bbee70c35dc82a2e74d63"
@@ -3718,6 +3723,23 @@
   dependencies:
     "@types/node" "*"
 
+"@typescript-eslint/eslint-plugin@^6.21.0":
+  version "6.21.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/eslint-plugin/-/eslint-plugin-6.21.0.tgz#30830c1ca81fd5f3c2714e524c4303e0194f9cd3"
+  integrity sha512-oy9+hTPCUFpngkEZUSzbf9MxI65wbKFoQYsgPdILTfbUldp5ovUuphZVe4i30emU9M/kP+T64Di0mxl7dSw3MA==
+  dependencies:
+    "@eslint-community/regexpp" "^4.5.1"
+    "@typescript-eslint/scope-manager" "6.21.0"
+    "@typescript-eslint/type-utils" "6.21.0"
+    "@typescript-eslint/utils" "6.21.0"
+    "@typescript-eslint/visitor-keys" "6.21.0"
+    debug "^4.3.4"
+    graphemer "^1.4.0"
+    ignore "^5.2.4"
+    natural-compare "^1.4.0"
+    semver "^7.5.4"
+    ts-api-utils "^1.0.1"
+
 "@typescript-eslint/experimental-utils@2.34.0":
   version "2.34.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/experimental-utils/-/experimental-utils-2.34.0.tgz#d3524b644cdb40eebceca67f8cf3e4cc9c8f980f"
@@ -3780,6 +3802,17 @@
     "@typescript-eslint/typescript-estree" "5.62.0"
     debug "^4.3.4"
 
+"@typescript-eslint/parser@^6.21.0":
+  version "6.21.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/parser/-/parser-6.21.0.tgz#af8fcf66feee2edc86bc5d1cf45e33b0630bf35b"
+  integrity sha512-tbsV1jPne5CkFQCgPBcDOt30ItF7aJoZL997JSF7MhGQqOeT3svWRYxiqlfA5RUdlHN6Fi+EI9bxqbdyAUZjYQ==
+  dependencies:
+    "@typescript-eslint/scope-manager" "6.21.0"
+    "@typescript-eslint/types" "6.21.0"
+    "@typescript-eslint/typescript-estree" "6.21.0"
+    "@typescript-eslint/visitor-keys" "6.21.0"
+    debug "^4.3.4"
+
 "@typescript-eslint/scope-manager@4.1.0":
   version "4.1.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/scope-manager/-/scope-manager-4.1.0.tgz#9e389745ee9cfe12252ed1e9958808abd6b3a683"
@@ -3804,6 +3837,16 @@
     "@typescript-eslint/types" "6.21.0"
     "@typescript-eslint/visitor-keys" "6.21.0"
 
+"@typescript-eslint/type-utils@6.21.0":
+  version "6.21.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/type-utils/-/type-utils-6.21.0.tgz#6473281cfed4dacabe8004e8521cee0bd9d4c01e"
+  integrity sha512-rZQI7wHfao8qMX3Rd3xqeYSMCL3SoiSQLBATSiVKARdFGCYSRvmViieZjqc58jKgs8Y8i9YvVVhRbHSTA4VBag==
+  dependencies:
+    "@typescript-eslint/typescript-estree" "6.21.0"
+    "@typescript-eslint/utils" "6.21.0"
+    debug "^4.3.4"
+    ts-api-utils "^1.0.1"
+
 "@typescript-eslint/types@3.10.1":
   version "3.10.1"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/types/-/types-3.10.1.tgz#1d7463fa7c32d8a23ab508a803ca2fe26e758727"
@@ -3892,7 +3935,7 @@
     semver "^7.5.4"
     ts-api-utils "^1.0.1"
 
-"@typescript-eslint/utils@^6.0.0":
+"@typescript-eslint/utils@6.21.0", "@typescript-eslint/utils@^6.0.0":
   version "6.21.0"
   resolved "https://registry.yarnpkg.com/@typescript-eslint/utils/-/utils-6.21.0.tgz#4714e7a6b39e773c1c8e97ec587f520840cd8134"
   integrity sha512-NfWVaC8HP9T8cbKQxHcsJBY5YE1O33+jpMwN45qzWWaPDZgLIbo12toGMWnmhvCpd3sIxkpDw3Wv1B3dYrbDQQ==
@@ -9799,6 +9842,11 @@ ignore@^5.2.0:
   resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.3.1.tgz#5073e554cd42c5b33b394375f538b8593e34d4ef"
   integrity sha512-5Fytz/IraMjqpwfd34ke28PTVMjZjJG2MPn5t7OE4eUCUNf8BAa7b5WUS9/Qvr6mwOQS7Mk6vdsMno5he+T8Xw==
 
+ignore@^5.2.4:
+  version "5.3.2"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.3.2.tgz#3cd40e729f3643fd87cb04e50bf0eb722bc596f5"
+  integrity sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==
+
 image-size@1.1.1:
   version "1.1.1"
   resolved "https://registry.yarnpkg.com/image-size/-/image-size-1.1.1.tgz#ddd67d4dc340e52ac29ce5f546a09f4e29e840ac"

From 8a7b487e3b171c91f2fe18e9142af53f4dd83454 Mon Sep 17 00:00:00 2001
From: Ricky <rickhanlonii@gmail.com>
Date: Tue, 18 Feb 2025 10:29:40 -0500
Subject: [PATCH 60/72] [flags] enable owner stacks everywhere (#32376)

this is now canary and on everywhere
---
 .../shared/forks/ReactFeatureFlags.native-fb-dynamic.js     | 2 --
 packages/shared/forks/ReactFeatureFlags.native-fb.js        | 6 ++++--
 packages/shared/forks/ReactFeatureFlags.native-oss.js       | 4 ++--
 .../forks/ReactFeatureFlags.test-renderer.native-fb.js      | 4 ++--
 .../shared/forks/ReactFeatureFlags.test-renderer.www.js     | 4 ++--
 packages/shared/forks/ReactFeatureFlags.www-dynamic.js      | 2 --
 packages/shared/forks/ReactFeatureFlags.www.js              | 6 ++++--
 scripts/jest/setupTests.www.js                              | 1 +
 scripts/jest/setupTests.xplat.js                            | 2 ++
 9 files changed, 17 insertions(+), 14 deletions(-)

diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index ffcec9334d663..d3c5de81bd909 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -25,7 +25,5 @@ export const enableShallowPropDiffing = __VARIANT__;
 export const passChildrenWhenCloningPersistedNodes = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 export const enableUseEffectCRUDOverload = __VARIANT__;
-export const enableOwnerStacks = __VARIANT__;
-export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
 export const enableLazyPublicInstanceInFabric = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index 470e148959327..a0544dc161173 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -27,12 +27,14 @@ export const {
   enableUseEffectCRUDOverload,
   passChildrenWhenCloningPersistedNodes,
   enableSiblingPrerendering,
-  enableOwnerStacks,
-  enableRemoveConsolePatches,
   enableFastAddPropertiesInDiffing,
   enableLazyPublicInstanceInFabric,
 } = dynamicFlags;
 
+// These two can be removed
+export const enableOwnerStacks = true;
+export const enableRemoveConsolePatches = true;
+
 // The rest of the flags are static for better dead code elimination.
 export const disableClientCache = true;
 export const disableCommentsAsDOMContainers = true;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index 361ebde4136ce..fd846cf312212 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -40,7 +40,7 @@ export const enableLegacyFBSupport = false;
 export const enableLegacyHidden = false;
 export const enableNoCloningMemoCache = false;
 export const enableObjectFiber = false;
-export const enableOwnerStacks = false;
+export const enableOwnerStacks = true;
 export const enablePersistedModeClonedFlag = false;
 export const enablePostpone = false;
 export const enableReactTestRendererWarning = false;
@@ -80,7 +80,7 @@ export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
 export const enableProfilerNestedUpdatePhase = __PROFILE__;
 export const enableUpdaterTracking = __PROFILE__;
-export const enableRemoveConsolePatches = false;
+export const enableRemoveConsolePatches = true;
 
 // Flow magic to verify the exports of this file match the original version.
 ((((null: any): ExportsType): FeatureFlagsType): ExportsType);
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index 18172fdfe5724..e4f1210c29f00 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -35,7 +35,7 @@ export const enableLegacyFBSupport = false;
 export const enableLegacyHidden = false;
 export const enableNoCloningMemoCache = false;
 export const enableObjectFiber = false;
-export const enableOwnerStacks = false;
+export const enableOwnerStacks = true;
 export const enablePersistedModeClonedFlag = false;
 export const enablePostpone = false;
 export const enableProfilerCommitHooks = __PROFILE__;
@@ -67,8 +67,8 @@ export const enableHydrationLaneScheduling = true;
 export const enableYieldingBeforePassive = false;
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableRemoveConsolePatches = true;
 export const enableSwipeTransition = false;
-export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index 628a834133f2f..112b30fe04a81 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -70,7 +70,7 @@ export const disableDefaultPropsExceptForClasses = true;
 export const renameElementSymbol = false;
 
 export const enableObjectFiber = false;
-export const enableOwnerStacks = false;
+export const enableOwnerStacks = true;
 export const enableShallowPropDiffing = false;
 export const enableSiblingPrerendering = true;
 
@@ -82,8 +82,8 @@ export const enableYieldingBeforePassive = false;
 
 export const enableThrottledScheduling = false;
 export const enableViewTransition = false;
+export const enableRemoveConsolePatches = true;
 export const enableSwipeTransition = false;
-export const enableRemoveConsolePatches = false;
 export const enableFastAddPropertiesInDiffing = false;
 export const enableLazyPublicInstanceInFabric = false;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
index d0b4404a3e946..e0f431fe7f10c 100644
--- a/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.www-dynamic.js
@@ -26,7 +26,6 @@ export const enableRetryLaneExpiration = __VARIANT__;
 export const enableTransitionTracing = __VARIANT__;
 export const favorSafetyOverHydrationPerf = __VARIANT__;
 export const renameElementSymbol = __VARIANT__;
-export const enableOwnerStacks = __VARIANT__;
 export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
@@ -37,7 +36,6 @@ export const enableInfiniteRenderLoopDetection = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 
 export const enableUseEffectCRUDOverload = __VARIANT__;
-export const enableRemoveConsolePatches = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
 export const enableLazyPublicInstanceInFabric = false;
 export const enableViewTransition = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index 5932c6eddf6f1..ec0337382e957 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -35,8 +35,6 @@ export const {
   retryLaneExpirationMs,
   syncLaneExpirationMs,
   transitionLaneExpirationMs,
-  enableOwnerStacks,
-  enableRemoveConsolePatches,
   enableFastAddPropertiesInDiffing,
   enableViewTransition,
 } = dynamicFeatureFlags;
@@ -44,6 +42,10 @@ export const {
 // On WWW, __EXPERIMENTAL__ is used for a new modern build.
 // It's not used anywhere in production yet.
 
+// Can remove these two
+export const enableOwnerStacks = true;
+export const enableRemoveConsolePatches = true;
+
 export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
 export const enableProfilerNestedUpdatePhase = __PROFILE__;
diff --git a/scripts/jest/setupTests.www.js b/scripts/jest/setupTests.www.js
index b0b653bb78ff9..9ac7ffc6db002 100644
--- a/scripts/jest/setupTests.www.js
+++ b/scripts/jest/setupTests.www.js
@@ -11,6 +11,7 @@ jest.mock('shared/ReactFeatureFlags', () => {
   // Flags that aren't currently used, but we still want to force variants to keep the
   // code live.
   actual.disableInputAttributeSyncing = __VARIANT__;
+  actual.enableOwnerStacks = __VARIANT__;
 
   // These are hardcoded to true for the next release,
   // but still run the tests against both variants until
diff --git a/scripts/jest/setupTests.xplat.js b/scripts/jest/setupTests.xplat.js
index 859a5065988d6..87fbf8bef8ac5 100644
--- a/scripts/jest/setupTests.xplat.js
+++ b/scripts/jest/setupTests.xplat.js
@@ -11,6 +11,8 @@ jest.mock('shared/ReactFeatureFlags', () => {
     'shared/forks/ReactFeatureFlags.native-fb.js'
   );
 
+  actual.enableOwnerStacks = __VARIANT__;
+
   // Lots of tests use these, but we don't want to expose it to RN.
   // Ideally, tests for xplat wouldn't use react-dom, but many of our tests do.
   // Since the xplat tests run with the www entry points, some of these flags

From d99f8bba2e07e3bb953f0821d4da5e341136fe5c Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 09:32:49 -0700
Subject: [PATCH 61/72] [compiler] Delete LoweredFunction.dependencies and
 hoisted instructions (#32096)

LoweredFunction dependencies were exclusively used for dependency
extraction (in `propagateScopeDeps`). Now that we have a
`propagateScopeDepsHIR` that recursively traverses into nested
functions, we can delete `dependencies` and their associated synthetic
`LoadLocal`/`PropertyLoad` instructions.

[Internal snapshot
diff](https://www.internalfb.com/phabricator/paste/view/P1716950202) for
this change shows ~.2% of files changed. I [read through ~60 of the
changed
files](https://www.internalfb.com/phabricator/paste/view/P1733074307)
- most changes are due to better outlining (due to better DCE)
- a few changes in memo inference are due to changed ordering
```
// source
arr.map(() => contextVar.inner);

// previous instructions
$0 = LoadLocal arr
$1 = $0.map
// Below instructions are synthetic
$2 = LoadLocal contextVar
$3 = $2.inner
$4 = Function deps=$3 context=contextVar {
  ...
}
```
- a few changes are effectively bugfixes (see
`aliased-nested-scope-fn-expr`)
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32096).
* #32099
* #32286
* #32104
* #32098
* #32097
* __->__ #32096
---
 .../src/HIR/BuildHIR.ts                       | 154 +-----------
 .../src/HIR/CollectHoistablePropertyLoads.ts  |  37 +--
 .../src/HIR/Environment.ts                    |   2 -
 .../src/HIR/HIR.ts                            |   1 -
 .../HIR/MergeOverlappingReactiveScopesHIR.ts  |  17 +-
 .../src/HIR/PrintHIR.ts                       |   5 +-
 .../src/HIR/PropagateScopeDependenciesHIR.ts  |   5 +-
 .../src/HIR/visitors.ts                       |   7 +-
 .../src/Inference/AnalyseFunctions.ts         | 146 +++---------
 .../Inference/InferMutableContextVariables.ts |  23 +-
 .../src/Inference/InferReferenceEffects.ts    |  48 ++--
 .../src/Optimization/LowerContextAccess.ts    |   1 -
 .../src/Optimization/OutlineFunctions.ts      |   1 -
 .../InferReactiveScopeVariables.ts            |   8 +
 .../src/SSA/EliminateRedundantPhi.ts          |  19 ++
 .../src/SSA/EnterSSA.ts                       |   3 -
 .../src/Transform/TransformFire.ts            |  53 +----
 .../aliased-nested-scope-fn-expr.expect.md    | 120 ++++++++++
 .../compiler/aliased-nested-scope-fn-expr.tsx |  46 ++++
 ...iased-nested-scope-truncated-dep.expect.md | 221 ++++++++++++++++++
 .../aliased-nested-scope-truncated-dep.tsx    |  93 ++++++++
 ...access-in-unused-callback-nested.expect.md |  40 ++--
 .../capturing-func-mutate-2.expect.md         |   1 -
 .../capturing-func-no-mutate.expect.md        |  12 +-
 ...capturing-func-simple-alias-iife.expect.md |   1 -
 ...ction-alias-computed-load-2-iife.expect.md |   1 -
 ...ction-alias-computed-load-3-iife.expect.md |   2 -
 ...ction-alias-computed-load-4-iife.expect.md |   1 -
 ...unction-alias-computed-load-iife.expect.md |   1 -
 ...capturing-reference-changes-type.expect.md |   1 -
 .../codegen-inline-iife-reassign.expect.md    |   3 +-
 ...-into-function-expression-global.expect.md |   7 +-
 ...to-function-expression-primitive.expect.md |   7 +-
 ...gation-into-function-expressions.expect.md |   9 +-
 ...text-variable-as-jsx-element-tag.expect.md |   3 +-
 ...ting-simple-function-declaration.expect.md |  10 +-
 ...call-freezes-captured-identifier.expect.md |  41 ++++
 ....hook-call-freezes-captured-identifier.tsx |  20 ++
 ...call-freezes-captured-memberexpr.expect.md |  41 ++++
 ....hook-call-freezes-captured-memberexpr.jsx |  20 ++
 ...on-with-shadowed-local-same-name.expect.md |   2 +-
 ...setstate-captured-indirectly-jsx.expect.md |  81 +++++++
 ...isting-setstate-captured-indirectly-jsx.js |  17 ++
 .../compiler/hoisting-setstate.expect.md      |  77 ++++++
 .../fixtures/compiler/hoisting-setstate.js    |  28 +++
 ...call-freezes-captured-memberexpr.expect.md |  87 +++++++
 .../hook-call-freezes-captured-memberexpr.tsx |  21 ++
 .../jsx-local-tag-in-lambda.expect.md         |   7 +-
 .../jsx-memberexpr-tag-in-lambda.expect.md    |   7 +-
 ...mutated-non-reactive-to-reactive.expect.md |   1 -
 .../lambda-mutated-ref-non-reactive.expect.md |   1 -
 ...ed-function-shadowed-identifiers.expect.md |   5 +-
 ...o-reordering-depslist-assignment.expect.md |   1 -
 ...e-phis-in-lambda-capture-context.expect.md |  29 +--
 .../use-operator-conditional.expect.md        |   1 -
 55 files changed, 1123 insertions(+), 473 deletions(-)
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.tsx
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.tsx
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.tsx
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.jsx
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.js
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.tsx

diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
index d5c3ea6a492a9..67cdcab0381f2 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
@@ -7,7 +7,6 @@
 
 import {NodePath, Scope} from '@babel/traverse';
 import * as t from '@babel/types';
-import {Expression} from '@babel/types';
 import invariant from 'invariant';
 import {
   CompilerError,
@@ -75,7 +74,7 @@ export function lower(
   parent: NodePath<t.Function> | null = null,
 ): Result<HIRFunction, CompilerError> {
   const builder = new HIRBuilder(env, parent ?? func, bindings, capturedRefs);
-  const context: Array<Place> = [];
+  const context: HIRFunction['context'] = [];
 
   for (const ref of capturedRefs ?? []) {
     context.push({
@@ -3378,7 +3377,7 @@ function lowerFunction(
   >,
 ): LoweredFunction | null {
   const componentScope: Scope = builder.parentFunction.scope;
-  const captured = gatherCapturedDeps(builder, expr, componentScope);
+  const capturedContext = gatherCapturedContext(expr, componentScope);
 
   /*
    * TODO(gsn): In the future, we could only pass in the context identifiers
@@ -3392,7 +3391,7 @@ function lowerFunction(
     expr,
     builder.environment,
     builder.bindings,
-    [...builder.context, ...captured.identifiers],
+    [...builder.context, ...capturedContext],
     builder.parentFunction,
   );
   let loweredFunc: HIRFunction;
@@ -3405,7 +3404,6 @@ function lowerFunction(
   loweredFunc = lowering.unwrap();
   return {
     func: loweredFunc,
-    dependencies: captured.refs,
   };
 }
 
@@ -4079,14 +4077,6 @@ function lowerAssignment(
   }
 }
 
-function isValidDependency(path: NodePath<t.MemberExpression>): boolean {
-  const parent: NodePath<t.Node> = path.parentPath;
-  return (
-    !path.node.computed &&
-    !(parent.isCallExpression() && parent.get('callee') === path)
-  );
-}
-
 function captureScopes({from, to}: {from: Scope; to: Scope}): Set<Scope> {
   let scopes: Set<Scope> = new Set();
   while (from) {
@@ -4101,8 +4091,7 @@ function captureScopes({from, to}: {from: Scope; to: Scope}): Set<Scope> {
   return scopes;
 }
 
-function gatherCapturedDeps(
-  builder: HIRBuilder,
+function gatherCapturedContext(
   fn: NodePath<
     | t.FunctionExpression
     | t.ArrowFunctionExpression
@@ -4110,10 +4099,8 @@ function gatherCapturedDeps(
     | t.ObjectMethod
   >,
   componentScope: Scope,
-): {identifiers: Array<t.Identifier>; refs: Array<Place>} {
-  const capturedIds: Map<t.Identifier, number> = new Map();
-  const capturedRefs: Set<Place> = new Set();
-  const seenPaths: Set<string> = new Set();
+): Array<t.Identifier> {
+  const capturedIds = new Set<t.Identifier>();
 
   /*
    * Capture all the scopes from the parent of this function up to and including
@@ -4124,33 +4111,11 @@ function gatherCapturedDeps(
     to: componentScope,
   });
 
-  function addCapturedId(bindingIdentifier: t.Identifier): number {
-    if (!capturedIds.has(bindingIdentifier)) {
-      const index = capturedIds.size;
-      capturedIds.set(bindingIdentifier, index);
-      return index;
-    } else {
-      return capturedIds.get(bindingIdentifier)!;
-    }
-  }
-
   function handleMaybeDependency(
-    path:
-      | NodePath<t.MemberExpression>
-      | NodePath<t.Identifier>
-      | NodePath<t.JSXOpeningElement>,
+    path: NodePath<t.Identifier> | NodePath<t.JSXOpeningElement>,
   ): void {
     // Base context variable to depend on
     let baseIdentifier: NodePath<t.Identifier> | NodePath<t.JSXIdentifier>;
-    /*
-     * Base expression to depend on, which (for now) may contain non side-effectful
-     * member expressions
-     */
-    let dependency:
-      | NodePath<t.MemberExpression>
-      | NodePath<t.JSXMemberExpression>
-      | NodePath<t.Identifier>
-      | NodePath<t.JSXIdentifier>;
     if (path.isJSXOpeningElement()) {
       const name = path.get('name');
       if (!(name.isJSXMemberExpression() || name.isJSXIdentifier())) {
@@ -4166,115 +4131,20 @@ function gatherCapturedDeps(
         'Invalid logic in gatherCapturedDeps',
       );
       baseIdentifier = current;
-
-      /*
-       * Get the expression to depend on, which may involve PropertyLoads
-       * for member expressions
-       */
-      let currentDep:
-        | NodePath<t.JSXMemberExpression>
-        | NodePath<t.Identifier>
-        | NodePath<t.JSXIdentifier> = baseIdentifier;
-
-      while (true) {
-        const nextDep: null | NodePath<t.Node> = currentDep.parentPath;
-        if (nextDep && nextDep.isJSXMemberExpression()) {
-          currentDep = nextDep;
-        } else {
-          break;
-        }
-      }
-      dependency = currentDep;
-    } else if (path.isMemberExpression()) {
-      // Calculate baseIdentifier
-      let currentId: NodePath<Expression> = path;
-      while (currentId.isMemberExpression()) {
-        currentId = currentId.get('object');
-      }
-      if (!currentId.isIdentifier()) {
-        return;
-      }
-      baseIdentifier = currentId;
-
-      /*
-       * Get the expression to depend on, which may involve PropertyLoads
-       * for member expressions
-       */
-      let currentDep:
-        | NodePath<t.MemberExpression>
-        | NodePath<t.Identifier>
-        | NodePath<t.JSXIdentifier> = baseIdentifier;
-
-      while (true) {
-        const nextDep: null | NodePath<t.Node> = currentDep.parentPath;
-        if (
-          nextDep &&
-          nextDep.isMemberExpression() &&
-          isValidDependency(nextDep)
-        ) {
-          currentDep = nextDep;
-        } else {
-          break;
-        }
-      }
-
-      dependency = currentDep;
     } else {
       baseIdentifier = path;
-      dependency = path;
     }
 
     /*
      * Skip dependency path, as we already tried to recursively add it (+ all subexpressions)
      * as a dependency.
      */
-    dependency.skip();
+    path.skip();
 
     // Add the base identifier binding as a dependency.
     const binding = baseIdentifier.scope.getBinding(baseIdentifier.node.name);
-    if (binding === undefined || !pureScopes.has(binding.scope)) {
-      return;
-    }
-    const idKey = String(addCapturedId(binding.identifier));
-
-    // Add the expression (potentially a memberexpr path) as a dependency.
-    let exprKey = idKey;
-    if (dependency.isMemberExpression()) {
-      let pathTokens = [];
-      let current: NodePath<Expression> = dependency;
-      while (current.isMemberExpression()) {
-        const property = current.get('property') as NodePath<t.Identifier>;
-        pathTokens.push(property.node.name);
-        current = current.get('object');
-      }
-
-      exprKey += '.' + pathTokens.reverse().join('.');
-    } else if (dependency.isJSXMemberExpression()) {
-      let pathTokens = [];
-      let current: NodePath<t.JSXMemberExpression | t.JSXIdentifier> =
-        dependency;
-      while (current.isJSXMemberExpression()) {
-        const property = current.get('property');
-        pathTokens.push(property.node.name);
-        current = current.get('object');
-      }
-    }
-
-    if (!seenPaths.has(exprKey)) {
-      let loweredDep: Place;
-      if (dependency.isJSXIdentifier()) {
-        loweredDep = lowerValueToTemporary(builder, {
-          kind: 'LoadLocal',
-          place: lowerIdentifier(builder, dependency),
-          loc: path.node.loc ?? GeneratedSource,
-        });
-      } else if (dependency.isJSXMemberExpression()) {
-        loweredDep = lowerJsxMemberExpression(builder, dependency);
-      } else {
-        loweredDep = lowerExpressionToTemporary(builder, dependency);
-      }
-      capturedRefs.add(loweredDep);
-      seenPaths.add(exprKey);
+    if (binding !== undefined && pureScopes.has(binding.scope)) {
+      capturedIds.add(binding.identifier);
     }
   }
 
@@ -4305,13 +4175,13 @@ function gatherCapturedDeps(
         return;
       } else if (path.isJSXElement()) {
         handleMaybeDependency(path.get('openingElement'));
-      } else if (path.isMemberExpression() || path.isIdentifier()) {
+      } else if (path.isIdentifier()) {
         handleMaybeDependency(path);
       }
     },
   });
 
-  return {identifiers: [...capturedIds.keys()], refs: [...capturedRefs]};
+  return [...capturedIds.keys()];
 }
 
 function notNull<T>(value: T | null): value is T {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
index d3c919a6d8afe..a422570fffead 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
@@ -131,15 +131,7 @@ function collectHoistablePropertyLoadsImpl(
   fn: HIRFunction,
   context: CollectHoistablePropertyLoadsContext,
 ): ReadonlyMap<BlockId, BlockInfo> {
-  const functionExpressionLoads = collectFunctionExpressionFakeLoads(fn);
-  const actuallyEvaluatedTemporaries = new Map(
-    [...context.temporaries].filter(([id]) => !functionExpressionLoads.has(id)),
-  );
-
-  const nodes = collectNonNullsInBlocks(fn, {
-    ...context,
-    temporaries: actuallyEvaluatedTemporaries,
-  });
+  const nodes = collectNonNullsInBlocks(fn, context);
   propagateNonNull(fn, nodes, context.registry);
 
   if (DEBUG_PRINT) {
@@ -598,30 +590,3 @@ function reduceMaybeOptionalChains(
     }
   } while (changed);
 }
-
-function collectFunctionExpressionFakeLoads(
-  fn: HIRFunction,
-): Set<IdentifierId> {
-  const sources = new Map<IdentifierId, IdentifierId>();
-  const functionExpressionReferences = new Set<IdentifierId>();
-
-  for (const [_, block] of fn.body.blocks) {
-    for (const {lvalue, value} of block.instructions) {
-      if (
-        value.kind === 'FunctionExpression' ||
-        value.kind === 'ObjectMethod'
-      ) {
-        for (const reference of value.loweredFunc.dependencies) {
-          let curr: IdentifierId | undefined = reference.identifier.id;
-          while (curr != null) {
-            functionExpressionReferences.add(curr);
-            curr = sources.get(curr);
-          }
-        }
-      } else if (value.kind === 'PropertyLoad') {
-        sources.set(lvalue.identifier.id, value.object.identifier.id);
-      }
-    }
-  }
-  return functionExpressionReferences;
-}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts
index 113af2025dd2b..8de9218a662e2 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/Environment.ts
@@ -245,8 +245,6 @@ const EnvironmentConfigSchema = z.object({
    */
   enableUseTypeAnnotations: z.boolean().default(false),
 
-  enableFunctionDependencyRewrite: z.boolean().default(true),
-
   /**
    * Enables inference of optional dependency chains. Without this flag
    * a property chain such as `props?.items?.foo` will infer as a dep on
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
index a6a9cbcd48ec5..4df6da6c1704c 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
@@ -722,7 +722,6 @@ export type ObjectProperty = {
 };
 
 export type LoweredFunction = {
-  dependencies: Array<Place>;
   func: HIRFunction;
 };
 
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/MergeOverlappingReactiveScopesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/MergeOverlappingReactiveScopesHIR.ts
index a3740539b295b..5b286e917d0d3 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/MergeOverlappingReactiveScopesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/MergeOverlappingReactiveScopesHIR.ts
@@ -148,6 +148,14 @@ function collectScopeInfo(fn: HIRFunction): ScopeInfo {
     const scope = place.identifier.scope;
     if (scope != null) {
       placeScopes.set(place, scope);
+      /**
+       * Record both mutating and non-mutating scopes to merge scopes with
+       * still-mutating values with inner scopes that alias those values
+       * (see `nonmutating-capture-in-unsplittable-memo-block`)
+       *
+       * Note that this isn't perfect, as it also leads to merging of mutating
+       * scopes with JSX single-instruction scopes (see `mutation-within-jsx`)
+       */
       if (scope.range.start !== scope.range.end) {
         getOrInsertDefault(scopeStarts, scope.range.start, new Set()).add(
           scope,
@@ -254,7 +262,7 @@ function visitPlace(
    * of the stack to the mutated outer scope.
    */
   const placeScope = getPlaceScope(id, place);
-  if (placeScope != null && isMutable({id} as any, place)) {
+  if (placeScope != null && isMutable({id}, place)) {
     const placeScopeIdx = activeScopes.indexOf(placeScope);
     if (placeScopeIdx !== -1 && placeScopeIdx !== activeScopes.length - 1) {
       joined.union([placeScope, ...activeScopes.slice(placeScopeIdx + 1)]);
@@ -275,6 +283,13 @@ function getOverlappingReactiveScopes(
     for (const instr of block.instructions) {
       visitInstructionId(instr.id, context, state);
       for (const place of eachInstructionOperand(instr)) {
+        if (
+          (instr.value.kind === 'FunctionExpression' ||
+            instr.value.kind === 'ObjectMethod') &&
+          place.identifier.type.kind === 'Primitive'
+        ) {
+          continue;
+        }
         visitPlace(instr.id, place, state);
       }
       for (const place of eachInstructionLValue(instr)) {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
index a6f6c606e118d..7a6586730f9c1 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
@@ -538,9 +538,6 @@ export function printInstructionValue(instrValue: ReactiveValue): string {
         .split('\n')
         .map(line => `      ${line}`)
         .join('\n');
-      const deps = instrValue.loweredFunc.dependencies
-        .map(dep => printPlace(dep))
-        .join(',');
       const context = instrValue.loweredFunc.func.context
         .map(dep => printPlace(dep))
         .join(',');
@@ -557,7 +554,7 @@ export function printInstructionValue(instrValue: ReactiveValue): string {
           })
           .join(', ') ?? '';
       const type = printType(instrValue.loweredFunc.func.returnType).trim();
-      value = `${kind} ${name} @deps[${deps}] @context[${context}] @effects[${effects}]${type !== '' ? ` return${type}` : ''}:\n${fn}`;
+      value = `${kind} ${name} @context[${context}] @effects[${effects}]${type !== '' ? ` return${type}` : ''}:\n${fn}`;
       break;
     }
     case 'TaggedTemplateExpression': {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
index 08856e9143139..4cb84870a8a33 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
@@ -738,9 +738,8 @@ function collectDependencies(
       }
       for (const instr of block.instructions) {
         if (
-          fn.env.config.enableFunctionDependencyRewrite &&
-          (instr.value.kind === 'FunctionExpression' ||
-            instr.value.kind === 'ObjectMethod')
+          instr.value.kind === 'FunctionExpression' ||
+          instr.value.kind === 'ObjectMethod'
         ) {
           context.declare(instr.lvalue.identifier, {
             id: instr.id,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/visitors.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/visitors.ts
index c9ee803bfaffd..49ff3c256e016 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/visitors.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/visitors.ts
@@ -193,7 +193,7 @@ export function* eachInstructionValueOperand(
     }
     case 'ObjectMethod':
     case 'FunctionExpression': {
-      yield* instrValue.loweredFunc.dependencies;
+      yield* instrValue.loweredFunc.func.context;
       break;
     }
     case 'TaggedTemplateExpression': {
@@ -517,8 +517,9 @@ export function mapInstructionValueOperands(
     }
     case 'ObjectMethod':
     case 'FunctionExpression': {
-      instrValue.loweredFunc.dependencies =
-        instrValue.loweredFunc.dependencies.map(d => fn(d));
+      instrValue.loweredFunc.func.context =
+        instrValue.loweredFunc.func.context.map(d => fn(d));
+
       break;
     }
     case 'TaggedTemplateExpression': {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
index 75bd8f6811ffb..5381262874369 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
@@ -10,9 +10,8 @@ import {
   Effect,
   HIRFunction,
   Identifier,
-  IdentifierName,
+  IdentifierId,
   LoweredFunction,
-  Place,
   isRefOrRefValue,
   makeInstructionId,
 } from '../HIR';
@@ -23,78 +22,39 @@ import {inferMutableContextVariables} from './InferMutableContextVariables';
 import {inferMutableRanges} from './InferMutableRanges';
 import inferReferenceEffects from './InferReferenceEffects';
 
-type Dependency = {
-  identifier: Identifier;
-  path: Array<string>;
-};
-
 // Helper class to track indirections such as LoadLocal and PropertyLoad.
 export class IdentifierState {
-  properties: Map<Identifier, Dependency> = new Map();
+  properties: Map<IdentifierId, Identifier> = new Map();
 
   resolve(identifier: Identifier): Identifier {
-    const resolved = this.properties.get(identifier);
+    const resolved = this.properties.get(identifier.id);
     if (resolved !== undefined) {
-      return resolved.identifier;
+      return resolved;
     }
     return identifier;
   }
 
-  declareProperty(lvalue: Place, object: Place, property: string): void {
-    const objectDependency = this.properties.get(object.identifier);
-    let nextDependency: Dependency;
-    if (objectDependency === undefined) {
-      nextDependency = {identifier: object.identifier, path: [property]};
-    } else {
-      nextDependency = {
-        identifier: objectDependency.identifier,
-        path: [...objectDependency.path, property],
-      };
-    }
-    this.properties.set(lvalue.identifier, nextDependency);
-  }
-
-  declareTemporary(lvalue: Place, value: Place): void {
-    const resolved: Dependency = this.properties.get(value.identifier) ?? {
-      identifier: value.identifier,
-      path: [],
-    };
-    this.properties.set(lvalue.identifier, resolved);
+  alias(lvalue: Identifier, value: Identifier): void {
+    this.properties.set(lvalue.id, this.properties.get(value.id) ?? value);
   }
 }
 
 export default function analyseFunctions(func: HIRFunction): void {
-  const state = new IdentifierState();
-
   for (const [_, block] of func.body.blocks) {
     for (const instr of block.instructions) {
       switch (instr.value.kind) {
         case 'ObjectMethod':
         case 'FunctionExpression': {
           lower(instr.value.loweredFunc.func);
-          infer(instr.value.loweredFunc, state, func.context);
-          break;
-        }
-        case 'PropertyLoad': {
-          state.declareProperty(
-            instr.lvalue,
-            instr.value.object,
-            instr.value.property,
-          );
-          break;
-        }
-        case 'ComputedLoad': {
-          /*
-           * The path is set to an empty string as the path doesn't really
-           * matter for a computed load.
+          infer(instr.value.loweredFunc);
+
+          /**
+           * Reset mutable range for outer inferReferenceEffects
            */
-          state.declareProperty(instr.lvalue, instr.value.object, '');
-          break;
-        }
-        case 'LoadLocal':
-        case 'LoadContext': {
-          if (instr.lvalue.identifier.name === null) {
-            state.declareTemporary(instr.lvalue, instr.value.place);
+          for (const operand of instr.value.loweredFunc.func.context) {
+            operand.identifier.mutableRange.start = makeInstructionId(0);
+            operand.identifier.mutableRange.end = makeInstructionId(0);
+            operand.identifier.scope = null;
           }
           break;
         }
@@ -110,7 +70,6 @@ function lower(func: HIRFunction): void {
   inferMutableRanges(func);
   rewriteInstructionKindsBasedOnReassignment(func);
   inferReactiveScopeVariables(func);
-  inferMutableContextVariables(func);
   func.env.logger?.debugLogIRs?.({
     kind: 'hir',
     name: 'AnalyseFunction (inner)',
@@ -118,32 +77,16 @@ function lower(func: HIRFunction): void {
   });
 }
 
-function infer(
-  loweredFunc: LoweredFunction,
-  state: IdentifierState,
-  context: Array<Place>,
-): void {
-  const mutations = new Map<string, Effect>();
+function infer(loweredFunc: LoweredFunction): void {
+  const knownMutated = inferMutableContextVariables(loweredFunc.func);
   for (const operand of loweredFunc.func.context) {
-    if (
-      isMutatedOrReassigned(operand.identifier) &&
-      operand.identifier.name !== null
-    ) {
-      mutations.set(operand.identifier.name.value, operand.effect);
-    }
-  }
-
-  for (const dep of loweredFunc.dependencies) {
-    let name: IdentifierName | null = null;
-
-    if (state.properties.has(dep.identifier)) {
-      const receiver = state.properties.get(dep.identifier)!;
-      name = receiver.identifier.name;
-    } else {
-      name = dep.identifier.name;
-    }
-
-    if (isRefOrRefValue(dep.identifier)) {
+    const identifier = operand.identifier;
+    CompilerError.invariant(operand.effect === Effect.Unknown, {
+      reason:
+        '[AnalyseFunctions] Expected Function context effects to not have been set',
+      loc: operand.loc,
+    });
+    if (isRefOrRefValue(identifier)) {
       /*
        * TODO: this is a hack to ensure we treat functions which reference refs
        * as having a capture and therefore being considered mutable. this ensures
@@ -151,43 +94,16 @@ function infer(
        * could be called, and allows us to help ensure it isn't called during
        * render
        */
-      dep.effect = Effect.Capture;
-    } else if (name !== null) {
-      const effect = mutations.get(name.value);
-      if (effect !== undefined) {
-        dep.effect = effect === Effect.Unknown ? Effect.Capture : effect;
-      }
-    }
-  }
-
-  /*
-   * This could potentially add duplicate deps to mutatedDeps in the case of
-   * mutating a context ref in the child function and in this parent function.
-   * It might be useful to dedupe this.
-   *
-   * In practice this never really matters because the Component function has no
-   * context refs, so it will never have duplicate deps.
-   */
-  for (const place of context) {
-    CompilerError.invariant(place.identifier.name !== null, {
-      reason: 'context refs should always have a name',
-      description: null,
-      loc: place.loc,
-      suggestions: null,
-    });
-
-    const effect = mutations.get(place.identifier.name.value);
-    if (effect !== undefined) {
-      place.effect = effect === Effect.Unknown ? Effect.Capture : effect;
-      loweredFunc.dependencies.push(place);
+      operand.effect = Effect.Capture;
+    } else if (knownMutated.has(operand)) {
+      operand.effect = Effect.Mutate;
+    } else if (isMutatedOrReassigned(identifier)) {
+      // Note that this also reflects if identifier is ConditionallyMutated
+      operand.effect = Effect.Capture;
+    } else {
+      operand.effect = Effect.Read;
     }
   }
-
-  for (const operand of loweredFunc.func.context) {
-    operand.identifier.mutableRange.start = makeInstructionId(0);
-    operand.identifier.mutableRange.end = makeInstructionId(0);
-    operand.identifier.scope = null;
-  }
 }
 
 function isMutatedOrReassigned(id: Identifier): boolean {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
index 67babf43db22f..0025472721542 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
@@ -55,32 +55,21 @@ import {IdentifierState} from './AnalyseFunctions';
  * fn();
  * ```
  */
-export function inferMutableContextVariables(fn: HIRFunction): void {
+export function inferMutableContextVariables(fn: HIRFunction): Set<Place> {
   const state = new IdentifierState();
   const knownMutatedIdentifiers = new Set<Identifier>();
   for (const [, block] of fn.body.blocks) {
     for (const instr of block.instructions) {
       switch (instr.value.kind) {
-        case 'PropertyLoad': {
-          state.declareProperty(
-            instr.lvalue,
-            instr.value.object,
-            instr.value.property,
-          );
-          break;
-        }
+        case 'PropertyLoad':
         case 'ComputedLoad': {
-          /*
-           * The path is set to an empty string as the path doesn't really
-           * matter for a computed load.
-           */
-          state.declareProperty(instr.lvalue, instr.value.object, '');
+          state.alias(instr.lvalue.identifier, instr.value.object.identifier);
           break;
         }
         case 'LoadLocal':
         case 'LoadContext': {
           if (instr.lvalue.identifier.name === null) {
-            state.declareTemporary(instr.lvalue, instr.value.place);
+            state.alias(instr.lvalue.identifier, instr.value.place.identifier);
           }
           break;
         }
@@ -95,11 +84,13 @@ export function inferMutableContextVariables(fn: HIRFunction): void {
       visitOperand(state, knownMutatedIdentifiers, operand);
     }
   }
+  const results = new Set<Place>();
   for (const operand of fn.context) {
     if (knownMutatedIdentifiers.has(operand.identifier)) {
-      operand.effect = Effect.Mutate;
+      results.add(operand);
     }
   }
+  return results;
 }
 
 function visitOperand(
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
index 0afe479df08dd..6420e74a2fd20 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
@@ -390,29 +390,31 @@ class InferenceState {
 
   freezeValues(values: Set<InstructionValue>, reason: Set<ValueReason>): void {
     for (const value of values) {
+      if (value.kind === 'DeclareContext') {
+        /**
+         * Avoid freezing hoisted context declarations
+         * function Component() {
+         *   const cb = useBar(() => foo(2)); // produces a hoisted context declaration
+         *   const foo = useFoo();            // reassigns to the context variable
+         *   return <Foo cb={cb} />;
+         * }
+         */
+        continue;
+      }
       this.#values.set(value, {
         kind: ValueKind.Frozen,
         reason,
         context: new Set(),
       });
-      if (value.kind === 'FunctionExpression') {
-        if (
-          this.#env.config.enablePreserveExistingMemoizationGuarantees ||
-          this.#env.config.enableTransitivelyFreezeFunctionExpressions
-        ) {
-          if (value.kind === 'FunctionExpression') {
-            /*
-             * We want to freeze the captured values, not mark the operands
-             * themselves as frozen. There could be mutations that occur
-             * before the freeze we are processing, and it would be invalid
-             * to overwrite those mutations as a freeze.
-             */
-            for (const operand of eachInstructionValueOperand(value)) {
-              const operandValues = this.#variables.get(operand.identifier.id);
-              if (operandValues !== undefined) {
-                this.freezeValues(operandValues, reason);
-              }
-            }
+      if (
+        value.kind === 'FunctionExpression' &&
+        (this.#env.config.enablePreserveExistingMemoizationGuarantees ||
+          this.#env.config.enableTransitivelyFreezeFunctionExpressions)
+      ) {
+        for (const operand of value.loweredFunc.func.context) {
+          const operandValues = this.#variables.get(operand.identifier.id);
+          if (operandValues !== undefined) {
+            this.freezeValues(operandValues, reason);
           }
         }
       }
@@ -1143,17 +1145,17 @@ function inferBlock(
       case 'ObjectMethod':
       case 'FunctionExpression': {
         let hasMutableOperand = false;
-        const mutableOperands: Array<Place> = [];
         for (const operand of eachInstructionOperand(instr)) {
+          CompilerError.invariant(operand.effect !== Effect.Unknown, {
+            reason: 'Expected fn effects to be populated',
+            loc: operand.loc,
+          });
           state.referenceAndRecordEffects(
             freezeActions,
             operand,
-            operand.effect === Effect.Unknown ? Effect.Read : operand.effect,
+            operand.effect,
             ValueReason.Other,
           );
-          if (isMutableEffect(operand.effect, operand.loc)) {
-            mutableOperands.push(operand);
-          }
           hasMutableOperand ||= isMutableEffect(operand.effect, operand.loc);
         }
         /*
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
index e27b8f952148a..5b700b23b4049 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
@@ -270,7 +270,6 @@ function emitSelectorFn(env: Environment, keys: Array<string>): Instruction {
       name: null,
       loweredFunc: {
         func: fn,
-        dependencies: [],
       },
       type: 'ArrowFunctionExpression',
       loc: GeneratedSource,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/OutlineFunctions.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/OutlineFunctions.ts
index 7a1473be40c87..0e6d1fd59201f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/OutlineFunctions.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/OutlineFunctions.ts
@@ -24,7 +24,6 @@ export function outlineFunctions(
       }
       if (
         value.kind === 'FunctionExpression' &&
-        value.loweredFunc.dependencies.length === 0 &&
         value.loweredFunc.func.context.length === 0 &&
         // TODO: handle outlining named functions
         value.loweredFunc.func.id === null &&
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/InferReactiveScopeVariables.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/InferReactiveScopeVariables.ts
index 1108422f070d7..1f104d8592fab 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/InferReactiveScopeVariables.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/InferReactiveScopeVariables.ts
@@ -379,6 +379,14 @@ export function findDisjointMutableValues(
              */
             operand.identifier.mutableRange.start > 0
           ) {
+            if (
+              instr.value.kind === 'FunctionExpression' ||
+              instr.value.kind === 'ObjectMethod'
+            ) {
+              if (operand.identifier.type.kind === 'Primitive') {
+                continue;
+              }
+            }
             operands.push(operand.identifier);
           }
         }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/SSA/EliminateRedundantPhi.ts b/compiler/packages/babel-plugin-react-compiler/src/SSA/EliminateRedundantPhi.ts
index bae038f9bd9df..12c8c0e2e6221 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/SSA/EliminateRedundantPhi.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/SSA/EliminateRedundantPhi.ts
@@ -13,6 +13,8 @@ import {
   eachTerminalOperand,
 } from '../HIR/visitors';
 
+const DEBUG = false;
+
 /*
  * Pass to eliminate redundant phi nodes:
  * - all operands are the same identifier, ie `x2 = phi(x1, x1, x1)`.
@@ -141,6 +143,23 @@ export function eliminateRedundantPhi(
      * have already propagated forwards since we visit in reverse postorder.
      */
   } while (rewrites.size > size && hasBackEdge);
+
+  if (DEBUG) {
+    for (const [, block] of ir.blocks) {
+      for (const phi of block.phis) {
+        CompilerError.invariant(!rewrites.has(phi.place.identifier), {
+          reason: '[EliminateRedundantPhis]: rewrite not complete',
+          loc: phi.place.loc,
+        });
+        for (const [, operand] of phi.operands) {
+          CompilerError.invariant(!rewrites.has(operand.identifier), {
+            reason: '[EliminateRedundantPhis]: rewrite not complete',
+            loc: phi.place.loc,
+          });
+        }
+      }
+    }
+  }
 }
 
 function rewritePlace(
diff --git a/compiler/packages/babel-plugin-react-compiler/src/SSA/EnterSSA.ts b/compiler/packages/babel-plugin-react-compiler/src/SSA/EnterSSA.ts
index caba0d3c36992..820f7388dc41b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/SSA/EnterSSA.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/SSA/EnterSSA.ts
@@ -301,9 +301,6 @@ function enterSSAImpl(
         entry.preds.add(blockId);
         builder.defineFunction(loweredFunc);
         builder.enter(() => {
-          loweredFunc.context = loweredFunc.context.map(p =>
-            builder.getPlace(p),
-          );
           loweredFunc.params = loweredFunc.params.map(param => {
             if (param.kind === 'Identifier') {
               return builder.definePlace(param);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Transform/TransformFire.ts b/compiler/packages/babel-plugin-react-compiler/src/Transform/TransformFire.ts
index a35c4ddb0182c..a480b5d7c78de 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Transform/TransformFire.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Transform/TransformFire.ts
@@ -319,51 +319,6 @@ function visitFunctionExpressionAndPropagateFireDependencies(
     replaceFireFunctions(fnExpr.loweredFunc.func, context),
   );
 
-  /*
-   * Make a mapping from each dependency to the corresponding LoadLocal for it so that
-   * we can replace the loaded place with the generated fire function binding
-   */
-  const loadLocalsToDepLoads = new Map<IdentifierId, LoadLocal>();
-  for (const dep of fnExpr.loweredFunc.dependencies) {
-    const loadLocal = context.getLoadLocalInstr(dep.identifier.id);
-    if (loadLocal != null) {
-      loadLocalsToDepLoads.set(loadLocal.place.identifier.id, loadLocal);
-    }
-  }
-
-  const replacedCallees = new Map<IdentifierId, Place>();
-  for (const [
-    calleeIdentifierId,
-    loadedFireFunctionBindingPlace,
-  ] of calleesCapturedByFnExpression.entries()) {
-    /*
-     * Given the ids of captured fire callees, look at the deps for loads of those identifiers
-     * and replace them with the new fire function binding
-     */
-    const loadLocal = loadLocalsToDepLoads.get(calleeIdentifierId);
-    if (loadLocal == null) {
-      context.pushError({
-        loc: fnExpr.loc,
-        description: null,
-        severity: ErrorSeverity.Invariant,
-        reason:
-          '[InsertFire] No loadLocal found for fire call argument for lambda',
-        suggestions: null,
-      });
-      continue;
-    }
-
-    const oldPlaceId = loadLocal.place.identifier.id;
-    loadLocal.place = {
-      ...loadedFireFunctionBindingPlace.fireFunctionBinding,
-    };
-
-    replacedCallees.set(
-      oldPlaceId,
-      loadedFireFunctionBindingPlace.fireFunctionBinding,
-    );
-  }
-
   // For each replaced callee, update the context of the function expression to track it
   for (
     let contextIdx = 0;
@@ -371,9 +326,13 @@ function visitFunctionExpressionAndPropagateFireDependencies(
     contextIdx++
   ) {
     const contextItem = fnExpr.loweredFunc.func.context[contextIdx];
-    const replacedCallee = replacedCallees.get(contextItem.identifier.id);
+    const replacedCallee = calleesCapturedByFnExpression.get(
+      contextItem.identifier.id,
+    );
     if (replacedCallee != null) {
-      fnExpr.loweredFunc.func.context[contextIdx] = replacedCallee;
+      fnExpr.loweredFunc.func.context[contextIdx] = {
+        ...replacedCallee.fireFunctionBinding,
+      };
     }
   }
 
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.expect.md
new file mode 100644
index 0000000000000..b30ee7e0d6817
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.expect.md
@@ -0,0 +1,120 @@
+
+## Input
+
+```javascript
+// @enableTransitivelyFreezeFunctionExpressions:false
+import {
+  Stringify,
+  mutate,
+  identity,
+  setPropertyByKey,
+  shallowCopy,
+} from 'shared-runtime';
+/**
+ * Function expression version of `aliased-nested-scope-truncated-dep`.
+ *
+ * In this fixture, the output would be invalid if propagateScopeDeps did not
+ * avoid adding MemberExpression dependencies which would other evaluate during
+ * the mutable ranges of their base objects.
+ * This is different from `aliased-nested-scope-truncated-dep` which *does*
+ * produce correct output regardless of MemberExpression dependency truncation.
+ *
+ * Note while other expressions evaluate inline, function expressions *always*
+ * represent deferred evaluation. This means that
+ * (1) it's always safe to reorder function expression creation until its
+ *     earliest potential invocation
+ * (2) it's invalid to eagerly evaluate function expression dependencies during
+ *     their respective mutable ranges.
+ */
+
+function Component({prop}) {
+  let obj = shallowCopy(prop);
+
+  const aliasedObj = identity(obj);
+
+  // When `obj` is mutable (either directly or through aliases), taking a
+  // dependency on `obj.id` is invalid as it may change before getId() is invoked
+  const getId = () => obj.id;
+
+  mutate(aliasedObj);
+  setPropertyByKey(aliasedObj, 'id', prop.id + 1);
+
+  // Calling getId() should return prop.id + 1, not the prev
+  return <Stringify getId={getId} shouldInvokeFns={true} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{prop: {id: 1}}],
+  sequentialRenders: [{prop: {id: 1}}, {prop: {id: 1}}, {prop: {id: 2}}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime"; // @enableTransitivelyFreezeFunctionExpressions:false
+import {
+  Stringify,
+  mutate,
+  identity,
+  setPropertyByKey,
+  shallowCopy,
+} from "shared-runtime";
+/**
+ * Function expression version of `aliased-nested-scope-truncated-dep`.
+ *
+ * In this fixture, the output would be invalid if propagateScopeDeps did not
+ * avoid adding MemberExpression dependencies which would other evaluate during
+ * the mutable ranges of their base objects.
+ * This is different from `aliased-nested-scope-truncated-dep` which *does*
+ * produce correct output regardless of MemberExpression dependency truncation.
+ *
+ * Note while other expressions evaluate inline, function expressions *always*
+ * represent deferred evaluation. This means that
+ * (1) it's always safe to reorder function expression creation until its
+ *     earliest potential invocation
+ * (2) it's invalid to eagerly evaluate function expression dependencies during
+ *     their respective mutable ranges.
+ */
+
+function Component(t0) {
+  const $ = _c(2);
+  const { prop } = t0;
+  let t1;
+  if ($[0] !== prop) {
+    const obj = shallowCopy(prop);
+
+    const aliasedObj = identity(obj);
+
+    const getId = () => obj.id;
+
+    mutate(aliasedObj);
+    setPropertyByKey(aliasedObj, "id", prop.id + 1);
+
+    t1 = <Stringify getId={getId} shouldInvokeFns={true} />;
+    $[0] = prop;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  return t1;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ prop: { id: 1 } }],
+  sequentialRenders: [
+    { prop: { id: 1 } },
+    { prop: { id: 1 } },
+    { prop: { id: 2 } },
+  ],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"getId":{"kind":"Function","result":2},"shouldInvokeFns":true}</div>
+<div>{"getId":{"kind":"Function","result":2},"shouldInvokeFns":true}</div>
+<div>{"getId":{"kind":"Function","result":3},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.tsx
new file mode 100644
index 0000000000000..40022c6f651fd
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-fn-expr.tsx
@@ -0,0 +1,46 @@
+// @enableTransitivelyFreezeFunctionExpressions:false
+import {
+  Stringify,
+  mutate,
+  identity,
+  setPropertyByKey,
+  shallowCopy,
+} from 'shared-runtime';
+/**
+ * Function expression version of `aliased-nested-scope-truncated-dep`.
+ *
+ * In this fixture, the output would be invalid if propagateScopeDeps did not
+ * avoid adding MemberExpression dependencies which would other evaluate during
+ * the mutable ranges of their base objects.
+ * This is different from `aliased-nested-scope-truncated-dep` which *does*
+ * produce correct output regardless of MemberExpression dependency truncation.
+ *
+ * Note while other expressions evaluate inline, function expressions *always*
+ * represent deferred evaluation. This means that
+ * (1) it's always safe to reorder function expression creation until its
+ *     earliest potential invocation
+ * (2) it's invalid to eagerly evaluate function expression dependencies during
+ *     their respective mutable ranges.
+ */
+
+function Component({prop}) {
+  let obj = shallowCopy(prop);
+
+  const aliasedObj = identity(obj);
+
+  // When `obj` is mutable (either directly or through aliases), taking a
+  // dependency on `obj.id` is invalid as it may change before getId() is invoked
+  const getId = () => obj.id;
+
+  mutate(aliasedObj);
+  setPropertyByKey(aliasedObj, 'id', prop.id + 1);
+
+  // Calling getId() should return prop.id + 1, not the prev
+  return <Stringify getId={getId} shouldInvokeFns={true} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{prop: {id: 1}}],
+  sequentialRenders: [{prop: {id: 1}}, {prop: {id: 1}}, {prop: {id: 2}}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.expect.md
new file mode 100644
index 0000000000000..933fafff5f1ba
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.expect.md
@@ -0,0 +1,221 @@
+
+## Input
+
+```javascript
+import {
+  Stringify,
+  mutate,
+  identity,
+  shallowCopy,
+  setPropertyByKey,
+} from 'shared-runtime';
+
+/**
+ * This fixture is similar to `bug-aliased-capture-aliased-mutate` and
+ * `nonmutating-capture-in-unsplittable-memo-block`, but with a focus on
+ * dependency extraction.
+ *
+ * NOTE: this fixture is currently valid, but will break with optimizations:
+ * - Scope and mutable-range based reordering may move the array creation
+ *     *after* the `mutate(aliasedObj)` call. This is invalid if mutate
+ *     reassigns inner properties.
+ * - RecycleInto or other deeper-equality optimizations may produce invalid
+ *     output -- it may compare the array's contents / dependencies too early.
+ * - Runtime validation for immutable values will break if `mutate` does
+ *     interior mutation of the value captured into the array.
+ *
+ * Before scope block creation, HIR looks like this:
+ *  //
+ *  // $1 is unscoped as obj's mutable range will be
+ *  // extended in a later pass
+ *  //
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  //
+ *  // $3 gets assigned a scope as Array is an allocating
+ *  // instruction, but this does *not* get extended or
+ *  // merged into the later mutation site.
+ *  // (explained in `bug-aliased-capture-aliased-mutate`)
+ *  //
+ *  $3@1  = Array[$2]
+ *  ...
+ *  $10@0 = LoadLocal shallowCopy@0[0, 12]
+ *  $11   = LoadGlobal mutate
+ *  $12   = $11($10@0[0, 12])
+ *
+ * When filling in scope dependencies, we find that it's incorrect to depend on
+ * PropertyLoads from obj as it hasn't completed its mutable range. Following
+ * the immutable / mutable-new typing system, we check the identity of obj to
+ * detect whether it was newly created (and thus mutable) in this render pass.
+ *
+ * HIR with scopes looks like this.
+ * bb0:
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  scopeTerminal deps=[obj@0] block=bb1 fallt=bb2
+ * bb1:
+ *  $3@1  = Array[$2]
+ *  goto bb2
+ * bb2:
+ *  ...
+ *
+ * This is surprising as deps now is entirely decoupled from temporaries used
+ * by the block itself. scope @1's instructions now reference a value (1)
+ * produced outside its scope range and (2) not represented in its dependencies
+ *
+ * The right thing to do is to ensure that all Loads from a value get assigned
+ * the value's reactive scope. This also requires track mutating and aliasing
+ * separately from scope range. In this example, that would correctly merge
+ * the scopes of $3 with obj.
+ * Runtime validation and optimizations such as ReactiveGraph-based reordering
+ * require this as well.
+ *
+ * A tempting fix is to instead extend $3's ReactiveScope range up to include
+ * $2 (the PropertyLoad). This fixes dependency deduping but not reordering
+ * and mutability.
+ */
+function Component({prop}) {
+  let obj = shallowCopy(prop);
+  const aliasedObj = identity(obj);
+
+  // [obj.id] currently is assigned its own reactive scope
+  const id = [obj.id];
+
+  // Writing to the alias may reassign to previously captured references.
+  // The compiler currently produces valid output, but this breaks with
+  // reordering, recycleInto, and other potential optimizations.
+  mutate(aliasedObj);
+  setPropertyByKey(aliasedObj, 'id', prop.id + 1);
+
+  return <Stringify id={id} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{prop: {id: 1}}],
+  sequentialRenders: [{prop: {id: 1}}, {prop: {id: 1}}, {prop: {id: 2}}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime";
+import {
+  Stringify,
+  mutate,
+  identity,
+  shallowCopy,
+  setPropertyByKey,
+} from "shared-runtime";
+
+/**
+ * This fixture is similar to `bug-aliased-capture-aliased-mutate` and
+ * `nonmutating-capture-in-unsplittable-memo-block`, but with a focus on
+ * dependency extraction.
+ *
+ * NOTE: this fixture is currently valid, but will break with optimizations:
+ * - Scope and mutable-range based reordering may move the array creation
+ *     *after* the `mutate(aliasedObj)` call. This is invalid if mutate
+ *     reassigns inner properties.
+ * - RecycleInto or other deeper-equality optimizations may produce invalid
+ *     output -- it may compare the array's contents / dependencies too early.
+ * - Runtime validation for immutable values will break if `mutate` does
+ *     interior mutation of the value captured into the array.
+ *
+ * Before scope block creation, HIR looks like this:
+ *  //
+ *  // $1 is unscoped as obj's mutable range will be
+ *  // extended in a later pass
+ *  //
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  //
+ *  // $3 gets assigned a scope as Array is an allocating
+ *  // instruction, but this does *not* get extended or
+ *  // merged into the later mutation site.
+ *  // (explained in `bug-aliased-capture-aliased-mutate`)
+ *  //
+ *  $3@1  = Array[$2]
+ *  ...
+ *  $10@0 = LoadLocal shallowCopy@0[0, 12]
+ *  $11   = LoadGlobal mutate
+ *  $12   = $11($10@0[0, 12])
+ *
+ * When filling in scope dependencies, we find that it's incorrect to depend on
+ * PropertyLoads from obj as it hasn't completed its mutable range. Following
+ * the immutable / mutable-new typing system, we check the identity of obj to
+ * detect whether it was newly created (and thus mutable) in this render pass.
+ *
+ * HIR with scopes looks like this.
+ * bb0:
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  scopeTerminal deps=[obj@0] block=bb1 fallt=bb2
+ * bb1:
+ *  $3@1  = Array[$2]
+ *  goto bb2
+ * bb2:
+ *  ...
+ *
+ * This is surprising as deps now is entirely decoupled from temporaries used
+ * by the block itself. scope @1's instructions now reference a value (1)
+ * produced outside its scope range and (2) not represented in its dependencies
+ *
+ * The right thing to do is to ensure that all Loads from a value get assigned
+ * the value's reactive scope. This also requires track mutating and aliasing
+ * separately from scope range. In this example, that would correctly merge
+ * the scopes of $3 with obj.
+ * Runtime validation and optimizations such as ReactiveGraph-based reordering
+ * require this as well.
+ *
+ * A tempting fix is to instead extend $3's ReactiveScope range up to include
+ * $2 (the PropertyLoad). This fixes dependency deduping but not reordering
+ * and mutability.
+ */
+function Component(t0) {
+  const $ = _c(4);
+  const { prop } = t0;
+  let t1;
+  if ($[0] !== prop) {
+    const obj = shallowCopy(prop);
+    const aliasedObj = identity(obj);
+    let t2;
+    if ($[2] !== obj) {
+      t2 = [obj.id];
+      $[2] = obj;
+      $[3] = t2;
+    } else {
+      t2 = $[3];
+    }
+    const id = t2;
+
+    mutate(aliasedObj);
+    setPropertyByKey(aliasedObj, "id", prop.id + 1);
+
+    t1 = <Stringify id={id} />;
+    $[0] = prop;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  return t1;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ prop: { id: 1 } }],
+  sequentialRenders: [
+    { prop: { id: 1 } },
+    { prop: { id: 1 } },
+    { prop: { id: 2 } },
+  ],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"id":[1]}</div>
+<div>{"id":[1]}</div>
+<div>{"id":[2]}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.tsx
new file mode 100644
index 0000000000000..4d9d7e78fb309
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/aliased-nested-scope-truncated-dep.tsx
@@ -0,0 +1,93 @@
+import {
+  Stringify,
+  mutate,
+  identity,
+  shallowCopy,
+  setPropertyByKey,
+} from 'shared-runtime';
+
+/**
+ * This fixture is similar to `bug-aliased-capture-aliased-mutate` and
+ * `nonmutating-capture-in-unsplittable-memo-block`, but with a focus on
+ * dependency extraction.
+ *
+ * NOTE: this fixture is currently valid, but will break with optimizations:
+ * - Scope and mutable-range based reordering may move the array creation
+ *     *after* the `mutate(aliasedObj)` call. This is invalid if mutate
+ *     reassigns inner properties.
+ * - RecycleInto or other deeper-equality optimizations may produce invalid
+ *     output -- it may compare the array's contents / dependencies too early.
+ * - Runtime validation for immutable values will break if `mutate` does
+ *     interior mutation of the value captured into the array.
+ *
+ * Before scope block creation, HIR looks like this:
+ *  //
+ *  // $1 is unscoped as obj's mutable range will be
+ *  // extended in a later pass
+ *  //
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  //
+ *  // $3 gets assigned a scope as Array is an allocating
+ *  // instruction, but this does *not* get extended or
+ *  // merged into the later mutation site.
+ *  // (explained in `bug-aliased-capture-aliased-mutate`)
+ *  //
+ *  $3@1  = Array[$2]
+ *  ...
+ *  $10@0 = LoadLocal shallowCopy@0[0, 12]
+ *  $11   = LoadGlobal mutate
+ *  $12   = $11($10@0[0, 12])
+ *
+ * When filling in scope dependencies, we find that it's incorrect to depend on
+ * PropertyLoads from obj as it hasn't completed its mutable range. Following
+ * the immutable / mutable-new typing system, we check the identity of obj to
+ * detect whether it was newly created (and thus mutable) in this render pass.
+ *
+ * HIR with scopes looks like this.
+ * bb0:
+ *  $1    = LoadLocal obj@0[0:12]
+ *  $2    = PropertyLoad $1.id
+ *  scopeTerminal deps=[obj@0] block=bb1 fallt=bb2
+ * bb1:
+ *  $3@1  = Array[$2]
+ *  goto bb2
+ * bb2:
+ *  ...
+ *
+ * This is surprising as deps now is entirely decoupled from temporaries used
+ * by the block itself. scope @1's instructions now reference a value (1)
+ * produced outside its scope range and (2) not represented in its dependencies
+ *
+ * The right thing to do is to ensure that all Loads from a value get assigned
+ * the value's reactive scope. This also requires track mutating and aliasing
+ * separately from scope range. In this example, that would correctly merge
+ * the scopes of $3 with obj.
+ * Runtime validation and optimizations such as ReactiveGraph-based reordering
+ * require this as well.
+ *
+ * A tempting fix is to instead extend $3's ReactiveScope range up to include
+ * $2 (the PropertyLoad). This fixes dependency deduping but not reordering
+ * and mutability.
+ */
+function Component({prop}) {
+  let obj = shallowCopy(prop);
+  const aliasedObj = identity(obj);
+
+  // [obj.id] currently is assigned its own reactive scope
+  const id = [obj.id];
+
+  // Writing to the alias may reassign to previously captured references.
+  // The compiler currently produces valid output, but this breaks with
+  // reordering, recycleInto, and other potential optimizations.
+  mutate(aliasedObj);
+  setPropertyByKey(aliasedObj, 'id', prop.id + 1);
+
+  return <Stringify id={id} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{prop: {id: 1}}],
+  sequentialRenders: [{prop: {id: 1}}, {prop: {id: 1}}, {prop: {id: 2}}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-ref-access-in-unused-callback-nested.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-ref-access-in-unused-callback-nested.expect.md
index 37a510b8c290a..3584faf699f86 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-ref-access-in-unused-callback-nested.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-ref-access-in-unused-callback-nested.expect.md
@@ -44,48 +44,44 @@ import { c as _c } from "react/compiler-runtime"; // @validateRefAccessDuringRen
 import { useEffect, useRef, useState } from "react";
 
 function Component() {
-  const $ = _c(6);
+  const $ = _c(5);
   const ref = useRef(null);
   const [state, setState] = useState(false);
   let t0;
-  let t1;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    t0 = () => {};
-
-    t1 = [];
+    t0 = [];
     $[0] = t0;
-    $[1] = t1;
   } else {
     t0 = $[0];
-    t1 = $[1];
   }
-  useEffect(t0, t1);
+  useEffect(_temp, t0);
+  let t1;
   let t2;
-  let t3;
-  if ($[2] === Symbol.for("react.memo_cache_sentinel")) {
-    t2 = () => {
+  if ($[1] === Symbol.for("react.memo_cache_sentinel")) {
+    t1 = () => {
       setState(true);
     };
-    t3 = [];
+    t2 = [];
+    $[1] = t1;
     $[2] = t2;
-    $[3] = t3;
   } else {
+    t1 = $[1];
     t2 = $[2];
-    t3 = $[3];
   }
-  useEffect(t2, t3);
+  useEffect(t1, t2);
 
-  const t4 = String(state);
-  let t5;
-  if ($[4] !== t4) {
-    t5 = <Child key={t4} ref={ref} />;
+  const t3 = String(state);
+  let t4;
+  if ($[3] !== t3) {
+    t4 = <Child key={t3} ref={ref} />;
+    $[3] = t3;
     $[4] = t4;
-    $[5] = t5;
   } else {
-    t5 = $[5];
+    t4 = $[4];
   }
-  return t5;
+  return t4;
 }
+function _temp() {}
 
 function Child(t0) {
   const { ref } = t0;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-mutate-2.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-mutate-2.expect.md
index c071d5d20ed99..6836544c5d337 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-mutate-2.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-mutate-2.expect.md
@@ -27,7 +27,6 @@ export const FIXTURE_ENTRYPOINT = {
 import { c as _c } from "react/compiler-runtime";
 function component(a, b) {
   const $ = _c(2);
-  const y = { b };
   let z;
   if ($[0] !== a) {
     z = { a };
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-no-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-no-mutate.expect.md
index aa32b3260ef50..14bf94e770a6b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-no-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-no-mutate.expect.md
@@ -31,12 +31,20 @@ export const FIXTURE_ENTRYPOINT = {
 ```javascript
 import { c as _c } from "react/compiler-runtime";
 function Component(t0) {
-  const $ = _c(3);
+  const $ = _c(5);
   const { a, b } = t0;
   let z;
   if ($[0] !== a || $[1] !== b) {
     z = { a };
-    const y = { b };
+    let t1;
+    if ($[3] !== b) {
+      t1 = { b };
+      $[3] = b;
+      $[4] = t1;
+    } else {
+      t1 = $[4];
+    }
+    const y = t1;
     const x = function () {
       z.a = 2;
       return Math.max(y.b, 0);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias-iife.expect.md
index 1b91bc1a11275..a071dddba6b4c 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias-iife.expect.md
@@ -34,7 +34,6 @@ function component(a) {
     const x = { a };
     y = {};
 
-    y;
     y = x;
 
     mutate(y);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-2-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-2-iife.expect.md
index f4721a507f31f..2afc5fd25dbac 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-2-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-2-iife.expect.md
@@ -31,7 +31,6 @@ function bar(a) {
     const x = [a];
     y = {};
 
-    y;
     y = x[0][1];
     $[0] = a;
     $[1] = y;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-3-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-3-iife.expect.md
index 5c0be290a6930..3e57b7dc7c255 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-3-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-3-iife.expect.md
@@ -37,8 +37,6 @@ function bar(a, b) {
     let t;
     t = {};
 
-    y;
-    t;
     y = x[0][1];
     t = x[1][0];
     $[0] = a;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-4-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-4-iife.expect.md
index 34b927d91e5f7..22728aaf4323d 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-4-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-4-iife.expect.md
@@ -31,7 +31,6 @@ function bar(a) {
     const x = [a];
     y = {};
 
-    y;
     y = x[0].a[1];
     $[0] = a;
     $[1] = y;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-iife.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-iife.expect.md
index 0978be54acb46..60f829cdc4d66 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-iife.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-alias-computed-load-iife.expect.md
@@ -30,7 +30,6 @@ function bar(a) {
     const x = [a];
     y = {};
 
-    y;
     y = x[0];
     $[0] = a;
     $[1] = y;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
index 1bdc1c09a3483..299aa5a31dff2 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
@@ -25,7 +25,6 @@ function component(a) {
     const x = { a };
     y = 1;
 
-    y;
     y = x;
 
     mutate(y);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/codegen-inline-iife-reassign.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/codegen-inline-iife-reassign.expect.md
index d17c934b3b42c..cf85967682607 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/codegen-inline-iife-reassign.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/codegen-inline-iife-reassign.expect.md
@@ -38,9 +38,8 @@ function useTest() {
 
     const t1 = (w = 42);
     const t2 = w;
-
-    w;
     let t3;
+
     w = 999;
     t3 = 2;
     t0 = makeArray(t1, t2, t3);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-global.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-global.expect.md
index e42ea8ce933b8..04b6c4f17f41a 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-global.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-global.expect.md
@@ -19,10 +19,10 @@ function foo() {
 import { c as _c } from "react/compiler-runtime";
 function foo() {
   const $ = _c(1);
+
+  const getJSX = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    const getJSX = () => <Child x={GLOBAL_IS_X} />;
-
     t0 = getJSX();
     $[0] = t0;
   } else {
@@ -31,6 +31,9 @@ function foo() {
   const result = t0;
   return result;
 }
+function _temp() {
+  return <Child x={GLOBAL_IS_X} />;
+}
 
 ```
       
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-primitive.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-primitive.expect.md
index 6686c0b5301bf..60fe0808d922a 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-primitive.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/const-propagation-into-function-expression-primitive.expect.md
@@ -23,13 +23,14 @@ export const FIXTURE_ENTRYPOINT = {
 
 ```javascript
 function foo() {
-  const f = () => {
-    console.log(42);
-  };
+  const f = _temp;
 
   f();
   return 42;
 }
+function _temp() {
+  console.log(42);
+}
 
 export const FIXTURE_ENTRYPOINT = {
   fn: foo,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
index 8ea2190480003..8822eddcdb69f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
@@ -18,12 +18,10 @@ function Component(props) {
 import { c as _c } from "react/compiler-runtime";
 function Component(props) {
   const $ = _c(1);
+
+  const onEvent = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    const onEvent = () => {
-      console.log(42);
-    };
-
     t0 = <Foo onEvent={onEvent} />;
     $[0] = t0;
   } else {
@@ -31,6 +29,9 @@ function Component(props) {
   }
   return t0;
 }
+function _temp() {
+  console.log(42);
+}
 
 ```
       
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/context-variable-as-jsx-element-tag.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/context-variable-as-jsx-element-tag.expect.md
index 3dc0dba27c364..da3bb94ed5ed4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/context-variable-as-jsx-element-tag.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/context-variable-as-jsx-element-tag.expect.md
@@ -34,9 +34,8 @@ function Component(props) {
   let Component;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
     Component = Stringify;
-
-    Component;
     let t0;
+
     t0 = Component;
     Component = t0;
     $[0] = Component;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hoisting-simple-function-declaration.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hoisting-simple-function-declaration.expect.md
index 2045ee7901e96..1ba0d59e17265 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hoisting-simple-function-declaration.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hoisting-simple-function-declaration.expect.md
@@ -24,13 +24,17 @@ export const FIXTURE_ENTRYPOINT = {
 ## Error
 
 ```
+   4 |   }
    5 |   return baz(); // OK: FuncDecls are HoistableDeclarations that have both declaration and value hoisting
-   6 |   function baz() {
+>  6 |   function baz() {
+     |   ^^^^^^^^^^^^^^^^
 >  7 |     return bar();
-     |            ^^^ Todo: Support functions with unreachable code that may contain hoisted declarations (7:7)
-   8 |   }
+     | ^^^^^^^^^^^^^^^^^
+>  8 |   }
+     | ^^^^ Todo: Support functions with unreachable code that may contain hoisted declarations (6:8)
    9 | }
   10 |
+  11 | export const FIXTURE_ENTRYPOINT = {
 ```
           
       
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.expect.md
new file mode 100644
index 0000000000000..7babe57b000e2
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.expect.md
@@ -0,0 +1,41 @@
+
+## Input
+
+```javascript
+// @enableTransitivelyFreezeFunctionExpressions
+import {setPropertyByKey, Stringify, useIdentity} from 'shared-runtime';
+
+function Foo({count}) {
+  const x = {value: 0};
+  /**
+   * After this custom hook call, it's no longer valid to mutate x.
+   */
+  const cb = useIdentity(() => {
+    setPropertyByKey(x, 'value', count);
+  });
+
+  x.value += count;
+  return <Stringify x={x} cb={cb} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{count: 1}],
+};
+
+```
+
+
+## Error
+
+```
+  11 |   });
+  12 |
+> 13 |   x.value += count;
+     |   ^ InvalidReact: This mutates a variable that React considers immutable (13:13)
+  14 |   return <Stringify x={x} cb={cb} />;
+  15 | }
+  16 |
+```
+          
+      
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.tsx
new file mode 100644
index 0000000000000..b71626a435b78
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-identifier.tsx
@@ -0,0 +1,20 @@
+// @enableTransitivelyFreezeFunctionExpressions
+import {setPropertyByKey, Stringify, useIdentity} from 'shared-runtime';
+
+function Foo({count}) {
+  const x = {value: 0};
+  /**
+   * After this custom hook call, it's no longer valid to mutate x.
+   */
+  const cb = useIdentity(() => {
+    setPropertyByKey(x, 'value', count);
+  });
+
+  x.value += count;
+  return <Stringify x={x} cb={cb} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{count: 1}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.expect.md
new file mode 100644
index 0000000000000..fcc47ddc2b14f
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.expect.md
@@ -0,0 +1,41 @@
+
+## Input
+
+```javascript
+// @enableTransitivelyFreezeFunctionExpressions
+import {mutate, Stringify, useIdentity} from 'shared-runtime';
+
+function Foo({count}) {
+  const x = {value: 0};
+  /**
+   * After this custom hook call, it's no longer valid to mutate x.
+   */
+  const cb = useIdentity(() => {
+    x.value++;
+  });
+
+  x.value += count;
+  return <Stringify x={x} cb={cb} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{count: 1}],
+};
+
+```
+
+
+## Error
+
+```
+  11 |   });
+  12 |
+> 13 |   x.value += count;
+     |   ^ InvalidReact: This mutates a variable that React considers immutable (13:13)
+  14 |   return <Stringify x={x} cb={cb} />;
+  15 | }
+  16 |
+```
+          
+      
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.jsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.jsx
new file mode 100644
index 0000000000000..2a94559c1f026
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.hook-call-freezes-captured-memberexpr.jsx
@@ -0,0 +1,20 @@
+// @enableTransitivelyFreezeFunctionExpressions
+import {mutate, Stringify, useIdentity} from 'shared-runtime';
+
+function Foo({count}) {
+  const x = {value: 0};
+  /**
+   * After this custom hook call, it's no longer valid to mutate x.
+   */
+  const cb = useIdentity(() => {
+    x.value++;
+  });
+
+  x.value += count;
+  return <Stringify x={x} cb={cb} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{count: 1}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.todo-repro-named-function-with-shadowed-local-same-name.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.todo-repro-named-function-with-shadowed-local-same-name.expect.md
index db3a192eaf604..f66b970f00dd4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.todo-repro-named-function-with-shadowed-local-same-name.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/error.todo-repro-named-function-with-shadowed-local-same-name.expect.md
@@ -22,7 +22,7 @@ function Component(props) {
    7 |     return hasErrors;
    8 |   }
 >  9 |   return hasErrors();
-     |          ^^^^^^^^^ Invariant: [hoisting] Expected value for identifier to be initialized. hasErrors_0$16 (9:9)
+     |          ^^^^^^^^^ Invariant: [hoisting] Expected value for identifier to be initialized. hasErrors_0$14 (9:9)
   10 | }
   11 |
 ```
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.expect.md
new file mode 100644
index 0000000000000..55cab1e9f3bd1
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.expect.md
@@ -0,0 +1,81 @@
+
+## Input
+
+```javascript
+// @validatePreserveExistingMemoizationGuarantees
+function useFoo() {
+  const onClick = response => {
+    setState(DISABLED_FORM);
+  };
+
+  const [state, setState] = useState();
+  const handleLogout = useCallback(() => {
+    setState(DISABLED_FORM);
+  }, [setState]);
+  const getComponent = () => {
+    return <ColumnItem onPress={() => handleLogout()} />;
+  };
+
+  // this `getComponent` call should not be inferred as mutating setState
+  return [getComponent(), onClick]; // pass onClick to avoid dce
+}
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime"; // @validatePreserveExistingMemoizationGuarantees
+function useFoo() {
+  const $ = _c(9);
+  const onClick = (response) => {
+    setState(DISABLED_FORM);
+  };
+
+  const [, t0] = useState();
+  const setState = t0;
+  let t1;
+  if ($[0] !== setState) {
+    t1 = () => {
+      setState(DISABLED_FORM);
+    };
+    $[0] = setState;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  setState;
+  const handleLogout = t1;
+  let t2;
+  if ($[2] !== handleLogout) {
+    t2 = () => <ColumnItem onPress={() => handleLogout()} />;
+    $[2] = handleLogout;
+    $[3] = t2;
+  } else {
+    t2 = $[3];
+  }
+  const getComponent = t2;
+  let t3;
+  if ($[4] !== getComponent) {
+    t3 = getComponent();
+    $[4] = getComponent;
+    $[5] = t3;
+  } else {
+    t3 = $[5];
+  }
+  let t4;
+  if ($[6] !== onClick || $[7] !== t3) {
+    t4 = [t3, onClick];
+    $[6] = onClick;
+    $[7] = t3;
+    $[8] = t4;
+  } else {
+    t4 = $[8];
+  }
+  return t4;
+}
+
+```
+      
+### Eval output
+(kind: exception) Fixture not implemented
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.js
new file mode 100644
index 0000000000000..4a44679390a80
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate-captured-indirectly-jsx.js
@@ -0,0 +1,17 @@
+// @validatePreserveExistingMemoizationGuarantees
+function useFoo() {
+  const onClick = response => {
+    setState(DISABLED_FORM);
+  };
+
+  const [state, setState] = useState();
+  const handleLogout = useCallback(() => {
+    setState(DISABLED_FORM);
+  }, [setState]);
+  const getComponent = () => {
+    return <ColumnItem onPress={() => handleLogout()} />;
+  };
+
+  // this `getComponent` call should not be inferred as mutating setState
+  return [getComponent(), onClick]; // pass onClick to avoid dce
+}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.expect.md
new file mode 100644
index 0000000000000..483d9b1a8e2da
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.expect.md
@@ -0,0 +1,77 @@
+
+## Input
+
+```javascript
+import {useEffect, useState} from 'react';
+import {Stringify} from 'shared-runtime';
+
+function Foo() {
+  /**
+   * Previously, this lowered to
+   * $1 = LoadContext capture setState
+   * $2 = FunctionExpression deps=$1 context=setState
+   *  [[ at this point, we freeze the `LoadContext setState` instruction, but it will never be referenced again ]]
+   *
+   * Now, this function expression directly references `setState`, which freezes
+   * the source `DeclareContext HoistedConst setState`. Freezing source identifiers
+   * (instead of the one level removed `LoadContext`) is more semantically correct
+   * for everything *other* than hoisted context declarations.
+   *
+   * $2 = Function context=setState
+   */
+  useEffect(() => setState(2), []);
+
+  const [state, setState] = useState(0);
+  return <Stringify state={state} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime";
+import { useEffect, useState } from "react";
+import { Stringify } from "shared-runtime";
+
+function Foo() {
+  const $ = _c(3);
+  let t0;
+  if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
+    t0 = [];
+    $[0] = t0;
+  } else {
+    t0 = $[0];
+  }
+  useEffect(() => setState(2), t0);
+
+  const [state, t1] = useState(0);
+  const setState = t1;
+  let t2;
+  if ($[1] !== state) {
+    t2 = <Stringify state={state} />;
+    $[1] = state;
+    $[2] = t2;
+  } else {
+    t2 = $[2];
+  }
+  return t2;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"state":2}</div>
+<div>{"state":2}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.js
new file mode 100644
index 0000000000000..7b26c8d086491
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-setstate.js
@@ -0,0 +1,28 @@
+import {useEffect, useState} from 'react';
+import {Stringify} from 'shared-runtime';
+
+function Foo() {
+  /**
+   * Previously, this lowered to
+   * $1 = LoadContext capture setState
+   * $2 = FunctionExpression deps=$1 context=setState
+   *  [[ at this point, we freeze the `LoadContext setState` instruction, but it will never be referenced again ]]
+   *
+   * Now, this function expression directly references `setState`, which freezes
+   * the source `DeclareContext HoistedConst setState`. Freezing source identifiers
+   * (instead of the one level removed `LoadContext`) is more semantically correct
+   * for everything *other* than hoisted context declarations.
+   *
+   * $2 = Function context=setState
+   */
+  useEffect(() => setState(2), []);
+
+  const [state, setState] = useState(0);
+  return <Stringify state={state} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.expect.md
new file mode 100644
index 0000000000000..957919516d09d
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.expect.md
@@ -0,0 +1,87 @@
+
+## Input
+
+```javascript
+import {useIdentity, Stringify, identity} from 'shared-runtime';
+
+function Foo({val1}) {
+  // `x={inner: val1}` should be able to be memoized
+  const x = {inner: val1};
+
+  // Any references to `x` after this hook call should be read-only
+  const cb = useIdentity(() => x.inner);
+
+  // With enableTransitivelyFreezeFunctionExpressions, it's invalid
+  // to write to `x` after it's been frozen.
+  // TODO: runtime validation for DX
+  const copy = identity(x);
+  return <Stringify copy={copy} cb={cb} shouldInvokeFns={true} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{val1: 1}],
+  sequentialRenders: [{val1: 1}, {val1: 1}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime";
+import { useIdentity, Stringify, identity } from "shared-runtime";
+
+function Foo(t0) {
+  const $ = _c(9);
+  const { val1 } = t0;
+  let t1;
+  if ($[0] !== val1) {
+    t1 = { inner: val1 };
+    $[0] = val1;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  const x = t1;
+  let t2;
+  if ($[2] !== x.inner) {
+    t2 = () => x.inner;
+    $[2] = x.inner;
+    $[3] = t2;
+  } else {
+    t2 = $[3];
+  }
+  const cb = useIdentity(t2);
+  let t3;
+  if ($[4] !== x) {
+    t3 = identity(x);
+    $[4] = x;
+    $[5] = t3;
+  } else {
+    t3 = $[5];
+  }
+  const copy = t3;
+  let t4;
+  if ($[6] !== cb || $[7] !== copy) {
+    t4 = <Stringify copy={copy} cb={cb} shouldInvokeFns={true} />;
+    $[6] = cb;
+    $[7] = copy;
+    $[8] = t4;
+  } else {
+    t4 = $[8];
+  }
+  return t4;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{ val1: 1 }],
+  sequentialRenders: [{ val1: 1 }, { val1: 1 }],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"copy":{"inner":1},"cb":{"kind":"Function","result":1},"shouldInvokeFns":true}</div>
+<div>{"copy":{"inner":1},"cb":{"kind":"Function","result":1},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.tsx
new file mode 100644
index 0000000000000..68e8e034379e1
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hook-call-freezes-captured-memberexpr.tsx
@@ -0,0 +1,21 @@
+import {useIdentity, Stringify, identity} from 'shared-runtime';
+
+function Foo({val1}) {
+  // `x={inner: val1}` should be able to be memoized
+  const x = {inner: val1};
+
+  // Any references to `x` after this hook call should be read-only
+  const cb = useIdentity(() => x.inner);
+
+  // With enableTransitivelyFreezeFunctionExpressions, it's invalid
+  // to write to `x` after it's been frozen.
+  // TODO: runtime validation for DX
+  const copy = identity(x);
+  return <Stringify copy={copy} cb={cb} shouldInvokeFns={true} />;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{val1: 1}],
+  sequentialRenders: [{val1: 1}, {val1: 1}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-local-tag-in-lambda.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-local-tag-in-lambda.expect.md
index 74e01a72d52ba..a7d27bc38193f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-local-tag-in-lambda.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-local-tag-in-lambda.expect.md
@@ -25,10 +25,10 @@ import { c as _c } from "react/compiler-runtime";
 import { Stringify } from "shared-runtime";
 function useFoo() {
   const $ = _c(1);
+
+  const callback = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    const callback = () => <Stringify value={4} />;
-
     t0 = callback();
     $[0] = t0;
   } else {
@@ -36,6 +36,9 @@ function useFoo() {
   }
   return t0;
 }
+function _temp() {
+  return <Stringify value={4} />;
+}
 
 export const FIXTURE_ENTRYPOINT = {
   fn: useFoo,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-memberexpr-tag-in-lambda.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-memberexpr-tag-in-lambda.expect.md
index 22fa3b2e2a2e3..e5ead2479dd40 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-memberexpr-tag-in-lambda.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/jsx-memberexpr-tag-in-lambda.expect.md
@@ -25,10 +25,10 @@ import { c as _c } from "react/compiler-runtime";
 import * as SharedRuntime from "shared-runtime";
 function useFoo() {
   const $ = _c(1);
+
+  const callback = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    const callback = () => <SharedRuntime.Text value={4} />;
-
     t0 = callback();
     $[0] = t0;
   } else {
@@ -36,6 +36,9 @@ function useFoo() {
   }
   return t0;
 }
+function _temp() {
+  return <SharedRuntime.Text value={4} />;
+}
 
 export const FIXTURE_ENTRYPOINT = {
   fn: useFoo,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-non-reactive-to-reactive.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-non-reactive-to-reactive.expect.md
index d34db46d6aa28..ed0ddda55b32f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-non-reactive-to-reactive.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-non-reactive-to-reactive.expect.md
@@ -26,7 +26,6 @@ function f(a) {
   const $ = _c(4);
   let x;
   if ($[0] !== a) {
-    x;
     x = { a };
     $[0] = a;
     $[1] = x;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-ref-non-reactive.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-ref-non-reactive.expect.md
index 2aa5d4d06dfb6..8dc4839085ee5 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-ref-non-reactive.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/lambda-mutated-ref-non-reactive.expect.md
@@ -27,7 +27,6 @@ function f(a) {
   const $ = _c(2);
   let x;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    x;
     x = {};
     $[0] = x;
   } else {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/nested-function-shadowed-identifiers.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/nested-function-shadowed-identifiers.expect.md
index 13ba6d17986bb..3c624de9ebe57 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/nested-function-shadowed-identifiers.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/nested-function-shadowed-identifiers.expect.md
@@ -31,7 +31,7 @@ function Component(props) {
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
     t0 = (e) => {
-      setX((currentX) => currentX + null);
+      setX(_temp);
     };
     $[0] = t0;
   } else {
@@ -48,6 +48,9 @@ function Component(props) {
   }
   return t1;
 }
+function _temp(currentX) {
+  return currentX + null;
+}
 
 export const FIXTURE_ENTRYPOINT = {
   fn: Component,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-reordering-depslist-assignment.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-reordering-depslist-assignment.expect.md
index e8a3e2d627c59..3fffec6a7dc20 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-reordering-depslist-assignment.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-reordering-depslist-assignment.expect.md
@@ -35,7 +35,6 @@ function useFoo(arr1, arr2) {
   if ($[0] !== arr1 || $[1] !== arr2) {
     const x = [arr1];
 
-    y;
     (y = x.concat(arr2)), y;
     $[0] = arr1;
     $[1] = arr2;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/rewrite-phis-in-lambda-capture-context.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/rewrite-phis-in-lambda-capture-context.expect.md
index 2e451d8948988..0c66dee6a85b1 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/rewrite-phis-in-lambda-capture-context.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/rewrite-phis-in-lambda-capture-context.expect.md
@@ -22,26 +22,21 @@ function Component() {
 ## Code
 
 ```javascript
-import { c as _c } from "react/compiler-runtime";
 function Component() {
-  const $ = _c(1);
-  let t0;
-  if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    t0 = () => {
-      while (bar()) {
-        if (baz) {
-          bar();
-        }
-      }
-      return () => 4;
-    };
-    $[0] = t0;
-  } else {
-    t0 = $[0];
-  }
-  const get4 = t0;
+  const get4 = _temp2;
   return get4;
 }
+function _temp2() {
+  while (bar()) {
+    if (baz) {
+      bar();
+    }
+  }
+  return _temp;
+}
+function _temp() {
+  return 4;
+}
 
 ```
       
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/use-operator-conditional.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/use-operator-conditional.expect.md
index e335273026791..6ad460347fa50 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/use-operator-conditional.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/use-operator-conditional.expect.md
@@ -85,7 +85,6 @@ function Inner(props) {
     input = use(FooContext);
   }
 
-  input;
   input;
   let t0;
   let t1;

From a92acdb188990b2b64130d74ccd6437dc9db1901 Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 09:37:21 -0700
Subject: [PATCH 62/72] [compiler] Remove redundant
 InferMutableContextVariables (#32097)

This removes special casing for `PropertyStore` mutability inference
within FunctionExpressions.
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32097).
* #32287
* #32104
* #32098
* __->__ #32097
---
 .../src/Inference/AnalyseFunctions.ts         |  27 +----
 .../Inference/InferMutableContextVariables.ts | 105 ------------------
 ...mutate-global-in-effect-fixpoint.expect.md |  66 ++++++-----
 .../allow-mutate-global-in-effect-fixpoint.js |   7 +-
 .../reanimated-shared-value-writes.expect.md  |  23 ++--
 5 files changed, 54 insertions(+), 174 deletions(-)
 delete mode 100644 compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts

diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
index 5381262874369..a439b4cd01232 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/AnalyseFunctions.ts
@@ -10,7 +10,6 @@ import {
   Effect,
   HIRFunction,
   Identifier,
-  IdentifierId,
   LoweredFunction,
   isRefOrRefValue,
   makeInstructionId,
@@ -18,27 +17,9 @@ import {
 import {deadCodeElimination} from '../Optimization';
 import {inferReactiveScopeVariables} from '../ReactiveScopes';
 import {rewriteInstructionKindsBasedOnReassignment} from '../SSA';
-import {inferMutableContextVariables} from './InferMutableContextVariables';
 import {inferMutableRanges} from './InferMutableRanges';
 import inferReferenceEffects from './InferReferenceEffects';
 
-// Helper class to track indirections such as LoadLocal and PropertyLoad.
-export class IdentifierState {
-  properties: Map<IdentifierId, Identifier> = new Map();
-
-  resolve(identifier: Identifier): Identifier {
-    const resolved = this.properties.get(identifier.id);
-    if (resolved !== undefined) {
-      return resolved;
-    }
-    return identifier;
-  }
-
-  alias(lvalue: Identifier, value: Identifier): void {
-    this.properties.set(lvalue.id, this.properties.get(value.id) ?? value);
-  }
-}
-
 export default function analyseFunctions(func: HIRFunction): void {
   for (const [_, block] of func.body.blocks) {
     for (const instr of block.instructions) {
@@ -78,7 +59,6 @@ function lower(func: HIRFunction): void {
 }
 
 function infer(loweredFunc: LoweredFunction): void {
-  const knownMutated = inferMutableContextVariables(loweredFunc.func);
   for (const operand of loweredFunc.func.context) {
     const identifier = operand.identifier;
     CompilerError.invariant(operand.effect === Effect.Unknown, {
@@ -95,10 +75,11 @@ function infer(loweredFunc: LoweredFunction): void {
        * render
        */
       operand.effect = Effect.Capture;
-    } else if (knownMutated.has(operand)) {
-      operand.effect = Effect.Mutate;
     } else if (isMutatedOrReassigned(identifier)) {
-      // Note that this also reflects if identifier is ConditionallyMutated
+      /**
+       * Reflects direct reassignments, PropertyStores, and ConditionallyMutate
+       * (directly or through maybe-aliases)
+       */
       operand.effect = Effect.Capture;
     } else {
       operand.effect = Effect.Read;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
deleted file mode 100644
index 0025472721542..0000000000000
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferMutableContextVariables.ts
+++ /dev/null
@@ -1,105 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-import {Effect, HIRFunction, Identifier, Place} from '../HIR';
-import {
-  eachInstructionValueOperand,
-  eachTerminalOperand,
-} from '../HIR/visitors';
-import {IdentifierState} from './AnalyseFunctions';
-
-/*
- * This pass infers which of the given function's context (free) variables
- * are definitively mutated by the function. This analysis is *partial*,
- * and only annotates provable mutations, and may miss mutations via indirections.
- * The intent of this pass is to drive validations, rejecting known-bad code
- * while avoiding false negatives, and the inference should *not* be used to
- * drive changes in output.
- *
- * Note that a complete analysis is possible but would have too many false negatives.
- * The approach would be to run LeaveSSA and InferReactiveScopeVariables in order to
- * find all possible aliases of a context variable which may be mutated. However, this
- * can lead to false negatives:
- *
- * ```
- * const [x, setX] = useState(null); // x is frozen
- * const fn = () => { // context=[x]
- *    const z = {}; // z is mutable
- *    foo(z, x); // potentially mutate z and x
- *    z.a = true; // definitively mutate z
- * }
- * fn();
- * ```
- *
- * When we analyze function expressions we assume that context variables are mutable,
- * so we assume that `x` is mutable. We infer that `foo(z, x)` could be mutating the
- * two variables to alias each other, such that `z.a = true` could be mutating `x`,
- * and we would infer that `x` is definitively mutated. Then when we run
- * InferReferenceEffects on the outer code we'd reject it, since there is a definitive
- * mutation of a frozen value.
- *
- * Thus the actual implementation looks at only basic aliasing. The above example would
- * pass, since z does not directly alias `x`. However, mutations through trivial aliases
- * are detected:
- *
- * ```
- * const [x, setX] = useState(null); // x is frozen
- * const fn = () => { // context=[x]
- *    const z = x;
- *    z.a = true; // ERROR: mutates x
- * }
- * fn();
- * ```
- */
-export function inferMutableContextVariables(fn: HIRFunction): Set<Place> {
-  const state = new IdentifierState();
-  const knownMutatedIdentifiers = new Set<Identifier>();
-  for (const [, block] of fn.body.blocks) {
-    for (const instr of block.instructions) {
-      switch (instr.value.kind) {
-        case 'PropertyLoad':
-        case 'ComputedLoad': {
-          state.alias(instr.lvalue.identifier, instr.value.object.identifier);
-          break;
-        }
-        case 'LoadLocal':
-        case 'LoadContext': {
-          if (instr.lvalue.identifier.name === null) {
-            state.alias(instr.lvalue.identifier, instr.value.place.identifier);
-          }
-          break;
-        }
-        default: {
-          for (const operand of eachInstructionValueOperand(instr.value)) {
-            visitOperand(state, knownMutatedIdentifiers, operand);
-          }
-        }
-      }
-    }
-    for (const operand of eachTerminalOperand(block.terminal)) {
-      visitOperand(state, knownMutatedIdentifiers, operand);
-    }
-  }
-  const results = new Set<Place>();
-  for (const operand of fn.context) {
-    if (knownMutatedIdentifiers.has(operand.identifier)) {
-      results.add(operand);
-    }
-  }
-  return results;
-}
-
-function visitOperand(
-  state: IdentifierState,
-  knownMutatedIdentifiers: Set<Identifier>,
-  operand: Place,
-): void {
-  const resolved = state.resolve(operand.identifier);
-  if (operand.effect === Effect.Mutate || operand.effect === Effect.Store) {
-    knownMutatedIdentifiers.add(resolved);
-  }
-}
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.expect.md
index 942daec1dd08c..76e4432fe90d9 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.expect.md
@@ -19,9 +19,14 @@ function Component() {
 
   // capture into a separate variable that is not a context variable.
   const y = x;
+  /**
+   * Note that this fixture currently produces a stale effect closure if `y = x
+   * = someGlobal` changes between renders. Under current compiler assumptions,
+   * that would be a rule of react violation.
+   */
   useEffect(() => {
     y.value = 'hello';
-  }, []);
+  });
 
   useEffect(() => {
     setState(someGlobal.value);
@@ -46,57 +51,50 @@ import { useEffect, useState } from "react";
 let someGlobal = { value: null };
 
 function Component() {
-  const $ = _c(7);
+  const $ = _c(5);
   const [state, setState] = useState(someGlobal);
+
+  let x = someGlobal;
+  while (x == null) {
+    x = someGlobal;
+  }
+
+  const y = x;
   let t0;
-  let t1;
-  let t2;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    let x = someGlobal;
-    while (x == null) {
-      x = someGlobal;
-    }
-
-    const y = x;
-    t0 = useEffect;
-    t1 = () => {
+    t0 = () => {
       y.value = "hello";
     };
-    t2 = [];
     $[0] = t0;
+  } else {
+    t0 = $[0];
+  }
+  useEffect(t0);
+  let t1;
+  let t2;
+  if ($[1] === Symbol.for("react.memo_cache_sentinel")) {
+    t1 = () => {
+      setState(someGlobal.value);
+    };
+    t2 = [someGlobal];
     $[1] = t1;
     $[2] = t2;
   } else {
-    t0 = $[0];
     t1 = $[1];
     t2 = $[2];
   }
-  t0(t1, t2);
-  let t3;
+  useEffect(t1, t2);
+
+  const t3 = String(state);
   let t4;
-  if ($[3] === Symbol.for("react.memo_cache_sentinel")) {
-    t3 = () => {
-      setState(someGlobal.value);
-    };
-    t4 = [someGlobal];
+  if ($[3] !== t3) {
+    t4 = <div>{t3}</div>;
     $[3] = t3;
     $[4] = t4;
   } else {
-    t3 = $[3];
     t4 = $[4];
   }
-  useEffect(t3, t4);
-
-  const t5 = String(state);
-  let t6;
-  if ($[5] !== t5) {
-    t6 = <div>{t5}</div>;
-    $[5] = t5;
-    $[6] = t6;
-  } else {
-    t6 = $[6];
-  }
-  return t6;
+  return t4;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.js
index 84bd42aaefd18..6e44adf204101 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/allow-mutate-global-in-effect-fixpoint.js
@@ -15,9 +15,14 @@ function Component() {
 
   // capture into a separate variable that is not a context variable.
   const y = x;
+  /**
+   * Note that this fixture currently produces a stale effect closure if `y = x
+   * = someGlobal` changes between renders. Under current compiler assumptions,
+   * that would be a rule of react violation.
+   */
   useEffect(() => {
     y.value = 'hello';
-  }, []);
+  });
 
   useEffect(() => {
     setState(someGlobal.value);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reanimated-shared-value-writes.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reanimated-shared-value-writes.expect.md
index 8f808c94b3043..0a19a85428939 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reanimated-shared-value-writes.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reanimated-shared-value-writes.expect.md
@@ -36,21 +36,22 @@ import { useSharedValue } from "react-native-reanimated";
  * of render
  */
 function SomeComponent() {
-  const $ = _c(3);
+  const $ = _c(2);
   const sharedVal = useSharedValue(0);
-
-  const T0 = Button;
-  const t0 = () => (sharedVal.value = Math.random());
-  let t1;
-  if ($[0] !== T0 || $[1] !== t0) {
-    t1 = <T0 onPress={t0} title="Randomize" />;
-    $[0] = T0;
+  let t0;
+  if ($[0] !== sharedVal) {
+    t0 = (
+      <Button
+        onPress={() => (sharedVal.value = Math.random())}
+        title="Randomize"
+      />
+    );
+    $[0] = sharedVal;
     $[1] = t0;
-    $[2] = t1;
   } else {
-    t1 = $[2];
+    t0 = $[1];
   }
-  return t1;
+  return t0;
 }
 
 ```

From 498514c04d824f88a9b77595c18c1323f4d1006f Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 09:37:34 -0700
Subject: [PATCH 63/72] [compiler] Clean up deadcode: ReactiveFunctionValue
 (#32098)

(title)
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32098).
* #32287
* #32104
* __->__ #32098
* #32097
---
 .../src/HIR/HIR.ts                            | 11 +-------
 .../src/HIR/PrintHIR.ts                       |  5 ----
 .../ReactiveScopes/CodegenReactiveFunction.ts |  1 -
 .../ReactiveScopes/PruneNonEscapingScopes.ts  |  8 ------
 .../src/ReactiveScopes/visitors.ts            | 25 -------------------
 .../ValidatePreservedManualMemoization.ts     |  7 ------
 6 files changed, 1 insertion(+), 56 deletions(-)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
index 4df6da6c1704c..e124caee7a23f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
@@ -108,16 +108,7 @@ export type ReactiveValue =
   | ReactiveLogicalValue
   | ReactiveSequenceValue
   | ReactiveTernaryValue
-  | ReactiveOptionalCallValue
-  | ReactiveFunctionValue;
-
-export type ReactiveFunctionValue = {
-  kind: 'ReactiveFunctionValue';
-  fn: ReactiveFunction;
-  dependencies: Array<Place>;
-  returnType: t.FlowType | t.TSType | null;
-  loc: SourceLocation;
-};
+  | ReactiveOptionalCallValue;
 
 export type ReactiveLogicalValue = {
   kind: 'LogicalExpression';
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
index 7a6586730f9c1..19d3f707b9199 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/PrintHIR.ts
@@ -6,7 +6,6 @@
  */
 
 import generate from '@babel/generator';
-import {printReactiveFunction} from '..';
 import {CompilerError} from '../CompilerError';
 import {printReactiveScopeSummary} from '../ReactiveScopes/PrintReactiveFunction';
 import DisjointSet from '../Utils/DisjointSet';
@@ -701,10 +700,6 @@ export function printInstructionValue(instrValue: ReactiveValue): string {
       value = `FinishMemoize decl=${printPlace(instrValue.decl)}`;
       break;
     }
-    case 'ReactiveFunctionValue': {
-      value = `FunctionValue ${printReactiveFunction(instrValue.fn)}`;
-      break;
-    }
     default: {
       assertExhaustive(
         instrValue,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
index cf40d86abc552..93b70bd7d1da3 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
@@ -2231,7 +2231,6 @@ function codegenInstructionValue(
       );
       break;
     }
-    case 'ReactiveFunctionValue':
     case 'StartMemoize':
     case 'FinishMemoize':
     case 'Debugger':
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneNonEscapingScopes.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneNonEscapingScopes.ts
index 5a9aa6b2a7368..441d529b39616 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneNonEscapingScopes.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneNonEscapingScopes.ts
@@ -772,14 +772,6 @@ function computeMemoizationInputs(
         rvalues: operands,
       };
     }
-    case 'ReactiveFunctionValue': {
-      CompilerError.invariant(false, {
-        reason: `Unexpected ReactiveFunctionValue node`,
-        description: null,
-        loc: value.loc,
-        suggestions: null,
-      });
-    }
     case 'UnsupportedNode': {
       CompilerError.invariant(false, {
         reason: `Unexpected unsupported node`,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/visitors.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/visitors.ts
index 487de2767a516..4ad05aa302ac1 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/visitors.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/visitors.ts
@@ -73,15 +73,6 @@ export class ReactiveFunctionVisitor<TState = void> {
         this.visitValue(value.id, value.value, state);
         break;
       }
-      case 'ReactiveFunctionValue': {
-        this.visitReactiveFunctionValue(
-          id,
-          value.dependencies,
-          value.fn,
-          state,
-        );
-        break;
-      }
       default: {
         for (const place of eachInstructionValueOperand(value)) {
           this.visitPlace(id, place, state);
@@ -434,18 +425,6 @@ export class ReactiveFunctionTransform<
         }
         break;
       }
-      case 'ReactiveFunctionValue': {
-        const nextValue = this.transformReactiveFunctionValue(
-          id,
-          value.dependencies,
-          value.fn,
-          state,
-        );
-        if (nextValue.kind === 'replace') {
-          value.fn = nextValue.value;
-        }
-        break;
-      }
       default: {
         for (const place of eachInstructionValueOperand(value)) {
           this.visitPlace(id, place, state);
@@ -619,10 +598,6 @@ export function* eachReactiveValueOperand(
       yield* eachReactiveValueOperand(instrValue.alternate);
       break;
     }
-    case 'ReactiveFunctionValue': {
-      yield* instrValue.dependencies;
-      break;
-    }
     default: {
       yield* eachInstructionValueOperand(instrValue);
     }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidatePreservedManualMemoization.ts b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidatePreservedManualMemoization.ts
index e7615320c7b95..28be6c166d2e4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidatePreservedManualMemoization.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidatePreservedManualMemoization.ts
@@ -327,13 +327,6 @@ class Visitor extends ReactiveFunctionVisitor<VisitorState> {
       case 'OptionalExpression': {
         return this.recordDepsInValue(value.value, state);
       }
-      case 'ReactiveFunctionValue': {
-        CompilerError.throwTodo({
-          reason:
-            'Handle ReactiveFunctionValue in ValidatePreserveManualMemoization',
-          loc: value.loc,
-        });
-      }
       case 'ConditionalExpression': {
         this.recordDepsInValue(value.test, state);
         this.recordDepsInValue(value.consequent, state);

From 19cc5af41ead904100a55fd2a1cfb40b1380f4be Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 09:38:02 -0700
Subject: [PATCH 64/72] [compiler] Clean up deadcode: DeriveMinimalDeps
 (non-hir fork) (#32104)

(title)
---
[//]: # (BEGIN SAPLING FOOTER)
Stack created with [Sapling](https://sapling-scm.com). Best reviewed
with [ReviewStack](https://reviewstack.dev/facebook/react/pull/32104).
* #32287
* __->__ #32104
* #32098
* #32097
---
 .../src/HIR/DeriveMinimalDependenciesHIR.ts   |   3 +-
 .../DeriveMinimalDependencies.ts              | 639 ------------------
 2 files changed, 1 insertion(+), 641 deletions(-)
 delete mode 100644 compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/DeriveMinimalDependencies.ts

diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
index f5567b3e536d1..07f44a59a26de 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
@@ -13,7 +13,6 @@ import {
   ReactiveScopeDependency,
 } from '../HIR';
 import {printIdentifier} from '../HIR/PrintHIR';
-import {ReactiveScopePropertyDependency} from '../ReactiveScopes/DeriveMinimalDependencies';
 
 /**
  * Simpler fork of DeriveMinimalDependencies, see PropagateScopeDependenciesHIR
@@ -91,7 +90,7 @@ export class ReactiveScopeDependencyTreeHIR {
    * dependency. This effectively truncates @param dep to its maximal
    * safe-to-evaluate subpath
    */
-  addDependency(dep: ReactiveScopePropertyDependency): void {
+  addDependency(dep: ReactiveScopeDependency): void {
     const {identifier, path} = dep;
     let depCursor = ReactiveScopeDependencyTreeHIR.#getOrCreateRoot(
       identifier,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/DeriveMinimalDependencies.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/DeriveMinimalDependencies.ts
deleted file mode 100644
index c7e16cce7ac86..0000000000000
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/DeriveMinimalDependencies.ts
+++ /dev/null
@@ -1,639 +0,0 @@
-/**
- * Copyright (c) Meta Platforms, Inc. and affiliates.
- *
- * This source code is licensed under the MIT license found in the
- * LICENSE file in the root directory of this source tree.
- */
-
-import {CompilerError} from '../CompilerError';
-import {DependencyPath, Identifier, ReactiveScopeDependency} from '../HIR';
-import {printIdentifier} from '../HIR/PrintHIR';
-import {assertExhaustive} from '../Utils/utils';
-
-/*
- * We need to understand optional member expressions only when determining
- * dependencies of a ReactiveScope (i.e. in {@link PropagateScopeDependencies}),
- * hence why this type lives here (not in HIR.ts)
- */
-export type ReactiveScopePropertyDependency = ReactiveScopeDependency;
-
-/*
- * Finalizes a set of ReactiveScopeDependencies to produce a set of minimal unconditional
- * dependencies, preserving granular accesses when possible.
- *
- * Correctness properties:
- *   - All dependencies to a ReactiveBlock must be tracked.
- *     We can always truncate a dependency's path to a subpath, due to Forget assuming
- *     deep immutability. If the value produced by a subpath has not changed, then
- *     dependency must have not changed.
- *     i.e. props.a === $[..] implies props.a.b === $[..]
- *
- *     Note the inverse is not true, but this only means a false positive (we run the
- *     reactive block more than needed).
- *     i.e. props.a !== $[..] does not imply props.a.b !== $[..]
- *
- *   - The dependencies of a finalized ReactiveBlock must be all safe to access
- *     unconditionally (i.e. preserve program semantics with respect to nullthrows).
- *     If a dependency is only accessed within a conditional, we must track the nearest
- *     unconditionally accessed subpath instead.
- * @param initialDeps
- * @returns
- */
-export class ReactiveScopeDependencyTree {
-  #roots: Map<Identifier, DependencyNode> = new Map();
-
-  #getOrCreateRoot(identifier: Identifier): DependencyNode {
-    // roots can always be accessed unconditionally in JS
-    let rootNode = this.#roots.get(identifier);
-
-    if (rootNode === undefined) {
-      rootNode = {
-        properties: new Map(),
-        accessType: PropertyAccessType.UnconditionalAccess,
-      };
-      this.#roots.set(identifier, rootNode);
-    }
-    return rootNode;
-  }
-
-  add(dep: ReactiveScopePropertyDependency, inConditional: boolean): void {
-    const {path} = dep;
-    let currNode = this.#getOrCreateRoot(dep.identifier);
-
-    for (const item of path) {
-      // all properties read 'on the way' to a dependency are marked as 'access'
-      let currChild = getOrMakeProperty(currNode, item.property);
-      const accessType = inConditional
-        ? PropertyAccessType.ConditionalAccess
-        : item.optional
-          ? PropertyAccessType.OptionalAccess
-          : PropertyAccessType.UnconditionalAccess;
-      currChild.accessType = merge(currChild.accessType, accessType);
-      currNode = currChild;
-    }
-
-    /**
-     * The final property node should be marked as an conditional/unconditional
-     * `dependency` as based on control flow.
-     */
-    const depType = inConditional
-      ? PropertyAccessType.ConditionalDependency
-      : isOptional(currNode.accessType)
-        ? PropertyAccessType.OptionalDependency
-        : PropertyAccessType.UnconditionalDependency;
-
-    currNode.accessType = merge(currNode.accessType, depType);
-  }
-
-  deriveMinimalDependencies(): Set<ReactiveScopeDependency> {
-    const results = new Set<ReactiveScopeDependency>();
-    for (const [rootId, rootNode] of this.#roots.entries()) {
-      const deps = deriveMinimalDependenciesInSubtree(rootNode, null);
-      CompilerError.invariant(
-        deps.every(
-          dep =>
-            dep.accessType === PropertyAccessType.UnconditionalDependency ||
-            dep.accessType == PropertyAccessType.OptionalDependency,
-        ),
-        {
-          reason:
-            '[PropagateScopeDependencies] All dependencies must be reduced to unconditional dependencies.',
-          description: null,
-          loc: null,
-          suggestions: null,
-        },
-      );
-
-      for (const dep of deps) {
-        results.add({
-          identifier: rootId,
-          path: dep.relativePath,
-        });
-      }
-    }
-
-    return results;
-  }
-
-  addDepsFromInnerScope(
-    depsFromInnerScope: ReactiveScopeDependencyTree,
-    innerScopeInConditionalWithinParent: boolean,
-    checkValidDepIdFn: (dep: ReactiveScopeDependency) => boolean,
-  ): void {
-    for (const [id, otherRoot] of depsFromInnerScope.#roots) {
-      if (!checkValidDepIdFn({identifier: id, path: []})) {
-        continue;
-      }
-      let currRoot = this.#getOrCreateRoot(id);
-      addSubtree(currRoot, otherRoot, innerScopeInConditionalWithinParent);
-      if (!isUnconditional(currRoot.accessType)) {
-        currRoot.accessType = isDependency(currRoot.accessType)
-          ? PropertyAccessType.UnconditionalDependency
-          : PropertyAccessType.UnconditionalAccess;
-      }
-    }
-  }
-
-  promoteDepsFromExhaustiveConditionals(
-    trees: Array<ReactiveScopeDependencyTree>,
-  ): void {
-    CompilerError.invariant(trees.length > 1, {
-      reason: 'Expected trees to be at least 2 elements long.',
-      description: null,
-      loc: null,
-      suggestions: null,
-    });
-
-    for (const [id, root] of this.#roots) {
-      const nodesForRootId = mapNonNull(trees, tree => {
-        const node = tree.#roots.get(id);
-        if (node != null && isUnconditional(node.accessType)) {
-          return node;
-        } else {
-          return null;
-        }
-      });
-      if (nodesForRootId) {
-        addSubtreeIntersection(
-          root.properties,
-          nodesForRootId.map(root => root.properties),
-        );
-      }
-    }
-  }
-
-  /*
-   * Prints dependency tree to string for debugging.
-   * @param includeAccesses
-   * @returns string representation of DependencyTree
-   */
-  printDeps(includeAccesses: boolean): string {
-    let res = [];
-
-    for (const [rootId, rootNode] of this.#roots.entries()) {
-      const rootResults = printSubtree(rootNode, includeAccesses).map(
-        result => `${printIdentifier(rootId)}.${result}`,
-      );
-      res.push(rootResults);
-    }
-    return res.flat().join('\n');
-  }
-
-  debug(): string {
-    const buf: Array<string> = [`tree() [`];
-    for (const [rootId, rootNode] of this.#roots) {
-      buf.push(`${printIdentifier(rootId)} (${rootNode.accessType}):`);
-      this.#debugImpl(buf, rootNode, 1);
-    }
-    buf.push(']');
-    return buf.length > 2 ? buf.join('\n') : buf.join('');
-  }
-
-  #debugImpl(
-    buf: Array<string>,
-    node: DependencyNode,
-    depth: number = 0,
-  ): void {
-    for (const [property, childNode] of node.properties) {
-      buf.push(`${'  '.repeat(depth)}.${property} (${childNode.accessType}):`);
-      this.#debugImpl(buf, childNode, depth + 1);
-    }
-  }
-}
-
-/*
- * Enum representing the access type of single property on a parent object.
- * We distinguish on two independent axes:
- * Conditional / Unconditional:
- *    - whether this property is accessed unconditionally (within the ReactiveBlock)
- * Access / Dependency:
- *    - Access: this property is read on the path of a dependency. We do not
- *      need to track change variables for accessed properties. Tracking accesses
- *      helps Forget do more granular dependency tracking.
- *    - Dependency: this property is read as a dependency and we must track changes
- *      to it for correctness.
- *
- *    ```javascript
- *    // props.a is a dependency here and must be tracked
- *    deps: {props.a, props.a.b} ---> minimalDeps: {props.a}
- *    // props.a is just an access here and does not need to be tracked
- *    deps: {props.a.b} ---> minimalDeps: {props.a.b}
- *    ```
- */
-enum PropertyAccessType {
-  ConditionalAccess = 'ConditionalAccess',
-  OptionalAccess = 'OptionalAccess',
-  UnconditionalAccess = 'UnconditionalAccess',
-  ConditionalDependency = 'ConditionalDependency',
-  OptionalDependency = 'OptionalDependency',
-  UnconditionalDependency = 'UnconditionalDependency',
-}
-
-const MIN_ACCESS_TYPE = PropertyAccessType.ConditionalAccess;
-function isUnconditional(access: PropertyAccessType): boolean {
-  return (
-    access === PropertyAccessType.UnconditionalAccess ||
-    access === PropertyAccessType.UnconditionalDependency
-  );
-}
-function isDependency(access: PropertyAccessType): boolean {
-  return (
-    access === PropertyAccessType.ConditionalDependency ||
-    access === PropertyAccessType.OptionalDependency ||
-    access === PropertyAccessType.UnconditionalDependency
-  );
-}
-function isOptional(access: PropertyAccessType): boolean {
-  return (
-    access === PropertyAccessType.OptionalAccess ||
-    access === PropertyAccessType.OptionalDependency
-  );
-}
-
-function merge(
-  access1: PropertyAccessType,
-  access2: PropertyAccessType,
-): PropertyAccessType {
-  const resultIsUnconditional =
-    isUnconditional(access1) || isUnconditional(access2);
-  const resultIsDependency = isDependency(access1) || isDependency(access2);
-  const resultIsOptional = isOptional(access1) || isOptional(access2);
-
-  /*
-   * Straightforward merge.
-   * This can be represented as bitwise OR, but is written out for readability
-   *
-   * Observe that `UnconditionalAccess | ConditionalDependency` produces an
-   * unconditionally accessed conditional dependency. We currently use these
-   * as we use unconditional dependencies. (i.e. to codegen change variables)
-   */
-  if (resultIsUnconditional) {
-    if (resultIsDependency) {
-      return PropertyAccessType.UnconditionalDependency;
-    } else {
-      return PropertyAccessType.UnconditionalAccess;
-    }
-  } else if (resultIsOptional) {
-    if (resultIsDependency) {
-      return PropertyAccessType.OptionalDependency;
-    } else {
-      return PropertyAccessType.OptionalAccess;
-    }
-  } else {
-    if (resultIsDependency) {
-      return PropertyAccessType.ConditionalDependency;
-    } else {
-      return PropertyAccessType.ConditionalAccess;
-    }
-  }
-}
-
-type DependencyNode = {
-  properties: Map<string, DependencyNode>;
-  accessType: PropertyAccessType;
-};
-
-type ReduceResultNode = {
-  relativePath: DependencyPath;
-  accessType: PropertyAccessType;
-};
-
-function promoteResult(
-  accessType: PropertyAccessType,
-  path: {property: string; optional: boolean} | null,
-): Array<ReduceResultNode> {
-  const result: ReduceResultNode = {
-    relativePath: [],
-    accessType,
-  };
-  if (path !== null) {
-    result.relativePath.push(path);
-  }
-  return [result];
-}
-
-function prependPath(
-  results: Array<ReduceResultNode>,
-  path: {property: string; optional: boolean} | null,
-): Array<ReduceResultNode> {
-  if (path === null) {
-    return results;
-  }
-  return results.map(result => {
-    return {
-      accessType: result.accessType,
-      relativePath: [path, ...result.relativePath],
-    };
-  });
-}
-
-/*
- * Recursively calculates minimal dependencies in a subtree.
- * @param dep DependencyNode representing a dependency subtree.
- * @returns a minimal list of dependencies in this subtree.
- */
-function deriveMinimalDependenciesInSubtree(
-  dep: DependencyNode,
-  property: string | null,
-): Array<ReduceResultNode> {
-  const results: Array<ReduceResultNode> = [];
-  for (const [childName, childNode] of dep.properties) {
-    const childResult = deriveMinimalDependenciesInSubtree(
-      childNode,
-      childName,
-    );
-    results.push(...childResult);
-  }
-
-  switch (dep.accessType) {
-    case PropertyAccessType.UnconditionalDependency: {
-      return promoteResult(
-        PropertyAccessType.UnconditionalDependency,
-        property !== null ? {property, optional: false} : null,
-      );
-    }
-    case PropertyAccessType.UnconditionalAccess: {
-      if (
-        results.every(
-          ({accessType}) =>
-            accessType === PropertyAccessType.UnconditionalDependency ||
-            accessType === PropertyAccessType.OptionalDependency,
-        )
-      ) {
-        // all children are unconditional dependencies, return them to preserve granularity
-        return prependPath(
-          results,
-          property !== null ? {property, optional: false} : null,
-        );
-      } else {
-        /*
-         * at least one child is accessed conditionally, so this node needs to be promoted to
-         * unconditional dependency
-         */
-        return promoteResult(
-          PropertyAccessType.UnconditionalDependency,
-          property !== null ? {property, optional: false} : null,
-        );
-      }
-    }
-    case PropertyAccessType.OptionalDependency: {
-      return promoteResult(
-        PropertyAccessType.OptionalDependency,
-        property !== null ? {property, optional: true} : null,
-      );
-    }
-    case PropertyAccessType.OptionalAccess: {
-      if (
-        results.every(
-          ({accessType}) =>
-            accessType === PropertyAccessType.UnconditionalDependency ||
-            accessType === PropertyAccessType.OptionalDependency,
-        )
-      ) {
-        // all children are unconditional dependencies, return them to preserve granularity
-        return prependPath(
-          results,
-          property !== null ? {property, optional: true} : null,
-        );
-      } else {
-        /*
-         * at least one child is accessed conditionally, so this node needs to be promoted to
-         * unconditional dependency
-         */
-        return promoteResult(
-          PropertyAccessType.OptionalDependency,
-          property !== null ? {property, optional: true} : null,
-        );
-      }
-    }
-    case PropertyAccessType.ConditionalAccess:
-    case PropertyAccessType.ConditionalDependency: {
-      if (
-        results.every(
-          ({accessType}) =>
-            accessType === PropertyAccessType.ConditionalDependency,
-        )
-      ) {
-        /*
-         * No children are accessed unconditionally, so we cannot promote this node to
-         * unconditional access.
-         * Truncate results of child nodes here, since we shouldn't access them anyways
-         */
-        return promoteResult(
-          PropertyAccessType.ConditionalDependency,
-          property !== null ? {property, optional: true} : null,
-        );
-      } else {
-        /*
-         * at least one child is accessed unconditionally, so this node can be promoted to
-         * unconditional dependency
-         */
-        return promoteResult(
-          PropertyAccessType.UnconditionalDependency,
-          property !== null ? {property, optional: true} : null,
-        );
-      }
-    }
-    default: {
-      assertExhaustive(
-        dep.accessType,
-        '[PropgateScopeDependencies] Unhandled access type!',
-      );
-    }
-  }
-}
-
-/*
- * Demote all unconditional accesses + dependencies in subtree to the
- * conditional equivalent, mutating subtree in place.
- * @param subtree unconditional node representing a subtree of dependencies
- */
-function demoteSubtreeToConditional(subtree: DependencyNode): void {
-  const stack: Array<DependencyNode> = [subtree];
-
-  let node;
-  while ((node = stack.pop()) !== undefined) {
-    const {accessType, properties} = node;
-    if (!isUnconditional(accessType)) {
-      // A conditionally accessed node should not have unconditional children
-      continue;
-    }
-    node.accessType = isDependency(accessType)
-      ? PropertyAccessType.ConditionalDependency
-      : PropertyAccessType.ConditionalAccess;
-
-    for (const childNode of properties.values()) {
-      if (isUnconditional(accessType)) {
-        /*
-         * No conditional node can have an unconditional node as a child, so
-         * we only process childNode if it is unconditional
-         */
-        stack.push(childNode);
-      }
-    }
-  }
-}
-
-/*
- * Calculates currNode = union(currNode, otherNode), mutating currNode in place
- * If demoteOtherNode is specified, we demote the subtree represented by
- * otherNode to conditional access/deps before taking the union.
- *
- * This is a helper function used to join an inner scope to its parent scope.
- * @param currNode (mutable) return by argument
- * @param otherNode (move) {@link addSubtree} takes ownership of the subtree
- * represented by otherNode, which may be mutated or moved to currNode. It is
- * invalid to use otherNode after this call.
- *
- * Note that @param otherNode may contain both conditional and unconditional nodes,
- * due to inner control flow and conditional member expressions
- *
- * @param demoteOtherNode
- */
-function addSubtree(
-  currNode: DependencyNode,
-  otherNode: DependencyNode,
-  demoteOtherNode: boolean,
-): void {
-  let otherType = otherNode.accessType;
-  if (demoteOtherNode) {
-    otherType = isDependency(otherType)
-      ? PropertyAccessType.ConditionalDependency
-      : PropertyAccessType.ConditionalAccess;
-  }
-  currNode.accessType = merge(currNode.accessType, otherType);
-
-  for (const [propertyName, otherChild] of otherNode.properties) {
-    const currChild = currNode.properties.get(propertyName);
-    if (currChild) {
-      // recursively calculate currChild = union(currChild, otherChild)
-      addSubtree(currChild, otherChild, demoteOtherNode);
-    } else {
-      /*
-       * if currChild doesn't exist, we can just move otherChild
-       * currChild = otherChild.
-       */
-      if (demoteOtherNode) {
-        demoteSubtreeToConditional(otherChild);
-      }
-      currNode.properties.set(propertyName, otherChild);
-    }
-  }
-}
-
-/*
- * Adds intersection(otherProperties) to currProperties, mutating
- * currProperties in place. i.e.
- *    currProperties = union(currProperties, intersection(otherProperties))
- *
- * Used to merge unconditional accesses from exhaustive conditional branches
- * into the parent ReactiveDeps Tree.
- * intersection(currProperties) is determined as such:
- *   - a node is present in the intersection iff it is present in all every
- *     branch
- *   - the type of an added node is `UnconditionalDependency` if it is a
- *     dependency in at least one branch (otherwise `UnconditionalAccess`)
- *
- * @param otherProperties (read-only) an array of node properties containing
- *         conditionally and unconditionally accessed nodes. Each element
- *         represents asubtree of reactive dependencies from a single CFG
- *         branch.
- *        otherProperties must represent all reachable branches.
- * @param currProperties (mutable) return by argument properties of a node
- *
- * otherProperties and currProperties must be properties of disjoint nodes
- * that represent the same dependency (identifier + path).
- */
-function addSubtreeIntersection(
-  currProperties: Map<string, DependencyNode>,
-  otherProperties: Array<Map<string, DependencyNode>>,
-): void {
-  CompilerError.invariant(otherProperties.length > 1, {
-    reason:
-      '[DeriveMinimalDependencies] Expected otherProperties to be at least 2 elements long.',
-    description: null,
-    loc: null,
-    suggestions: null,
-  });
-
-  /*
-   * otherProperties here may contain unconditional nodes as the result of
-   * recursively merging exhaustively conditional children with unconditionally
-   * accessed nodes (e.g. in the test condition itself)
-   * See `reduce-reactive-cond-deps-cfg-nested-testifelse` fixture for example
-   */
-
-  for (const [propertyName, currNode] of currProperties) {
-    const otherNodes = mapNonNull(otherProperties, properties => {
-      const node = properties.get(propertyName);
-      if (node != null && isUnconditional(node.accessType)) {
-        return node;
-      } else {
-        return null;
-      }
-    });
-
-    /*
-     * intersection(otherNodes[propertyName]) only exists if each element in
-     * otherProperties accesses propertyName.
-     */
-    if (otherNodes) {
-      addSubtreeIntersection(
-        currNode.properties,
-        otherNodes.map(node => node.properties),
-      );
-
-      const isDep = otherNodes.some(tree => isDependency(tree.accessType));
-      const externalAccessType = isDep
-        ? PropertyAccessType.UnconditionalDependency
-        : PropertyAccessType.UnconditionalAccess;
-      currNode.accessType = merge(externalAccessType, currNode.accessType);
-    }
-  }
-}
-
-function printSubtree(
-  node: DependencyNode,
-  includeAccesses: boolean,
-): Array<string> {
-  const results: Array<string> = [];
-  for (const [propertyName, propertyNode] of node.properties) {
-    if (includeAccesses || isDependency(propertyNode.accessType)) {
-      results.push(`${propertyName} (${propertyNode.accessType})`);
-    }
-    const propertyResults = printSubtree(propertyNode, includeAccesses);
-    results.push(...propertyResults.map(result => `${propertyName}.${result}`));
-  }
-  return results;
-}
-
-function getOrMakeProperty(
-  node: DependencyNode,
-  property: string,
-): DependencyNode {
-  let child = node.properties.get(property);
-  if (child == null) {
-    child = {
-      properties: new Map(),
-      accessType: MIN_ACCESS_TYPE,
-    };
-    node.properties.set(property, child);
-  }
-  return child;
-}
-
-function mapNonNull<T extends NonNullable<V>, V, U>(
-  arr: Array<U>,
-  fn: (arg0: U) => T | undefined | null,
-): Array<T> | null {
-  const result = [];
-  for (let i = 0; i < arr.length; i++) {
-    const element = fn(arr[i]);
-    if (element) {
-      result.push(element);
-    } else {
-      return null;
-    }
-  }
-  return result;
-}

From a9575dcf62e5cb6f8b1d8f738aa75ece216d9054 Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 11:54:20 -0700
Subject: [PATCH 65/72] [compiler] Represent array accesses with PropertyLoad
 (#32287)

Prior to this PR, our HIR represented property access with numeric
literals (e.g. `myVar[0]`) as ComputedLoads. This means that they were
subject to some deopts (most notably, not being easily dedupable /
hoistable as dependencies).

Now, `PropertyLoad`, `PropertyStore`, etc reference numeric and string
literals (although not yet string literals that aren't valid babel
identifiers). The difference between PropertyLoad and ComputedLoad is
fuzzy now (maybe we should rename these).
- PropertyLoad: property keys are string and numeric literals, only when
the string literals are valid babel identifiers
- ComputedLoad: non-valid babel identifier string literals (rare) and
other non-literal expressions

The biggest feature from this PR is that it trivially enables
array-indicing expressions as dependencies. The compiler can also
specify global and imported types for arrays (e.g. return value of
`useState`)


I'm happy to close this if it complicates more than it helps --
alternative options are to entirely rely on instruction reordering-based
approaches like ReactiveGraphIR or make dependency-specific parsing +
hoisting logic more robust.
---
 .../src/HIR/BuildHIR.ts                       | 59 +++++++++-----
 .../src/HIR/CollectHoistablePropertyLoads.ts  |  9 ++-
 .../HIR/CollectOptionalChainDependencies.ts   |  3 +-
 .../src/HIR/DeriveMinimalDependenciesHIR.ts   |  5 +-
 .../src/HIR/HIR.ts                            | 18 ++++-
 .../src/HIR/PropagateScopeDependenciesHIR.ts  |  9 ++-
 .../src/HIR/Types.ts                          |  3 +-
 .../src/Inference/DropManualMemoization.ts    |  5 +-
 .../src/Optimization/ConstantPropagation.ts   | 15 ++--
 .../src/Optimization/InlineJsxTransform.ts    |  3 +-
 .../src/Optimization/LowerContextAccess.ts    |  3 +-
 .../ReactiveScopes/CodegenReactiveFunction.ts | 62 ++++++++-------
 .../ReactiveScopes/PropagateEarlyReturns.ts   |  3 +-
 .../PruneInitializationDependencies.ts        | 18 +++--
 .../src/TypeInference/InferTypes.ts           | 15 ++--
 .../src/Validation/ValidateHooksUsage.ts      |  4 +-
 .../Validation/ValidateNoCapitalizedCalls.ts  |  5 +-
 .../Validation/ValidateNoRefAccesInRender.ts  |  2 +-
 .../mixedreadonly-mutating-map.expect.md      | 19 +++--
 ...error.useMemo-dep-not-recognized.expect.md | 40 ----------
 ...useMemo-dep-array-literal-access.expect.md | 71 +++++++++++++++++
 ...ts => useMemo-dep-array-literal-access.ts} |  0
 ...ivity-via-aliased-mutation-array.expect.md | 24 ++----
 ...vity-via-aliased-mutation-lambda.expect.md | 24 ++----
 ...r-store-capture-namespace-import.expect.md | 78 +++++++++----------
 .../type-provider-store-capture.expect.md     | 78 +++++++++----------
 26 files changed, 322 insertions(+), 253 deletions(-)
 delete mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.expect.md
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/{error.useMemo-dep-not-recognized.ts => useMemo-dep-array-literal-access.ts} (100%)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
index 67cdcab0381f2..c60bbd0e1ba3d 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/BuildHIR.ts
@@ -36,12 +36,14 @@ import {
   ObjectProperty,
   ObjectPropertyKey,
   Place,
+  PropertyLiteral,
   ReturnTerminal,
   SourceLocation,
   SpreadPattern,
   ThrowTerminal,
   Type,
   makeInstructionId,
+  makePropertyLiteral,
   makeType,
   promoteTemporary,
 } from './HIR';
@@ -2017,11 +2019,11 @@ function lowerExpression(
           });
 
           // Save the result back to the property
-          if (typeof property === 'string') {
+          if (typeof property === 'string' || typeof property === 'number') {
             return {
               kind: 'PropertyStore',
               object: {...object},
-              property,
+              property: makePropertyLiteral(property),
               value: {...newValuePlace},
               loc: leftExpr.node.loc ?? GeneratedSource,
             };
@@ -2316,11 +2318,11 @@ function lowerExpression(
         const argument = expr.get('argument');
         if (argument.isMemberExpression()) {
           const {object, property} = lowerMemberExpression(builder, argument);
-          if (typeof property === 'string') {
+          if (typeof property === 'string' || typeof property === 'number') {
             return {
               kind: 'PropertyDelete',
               object,
-              property,
+              property: makePropertyLiteral(property),
               loc: exprLoc,
             };
           } else {
@@ -2427,11 +2429,11 @@ function lowerExpression(
 
         // Save the result back to the property
         let newValuePlace;
-        if (typeof property === 'string') {
+        if (typeof property === 'string' || typeof property === 'number') {
           newValuePlace = lowerValueToTemporary(builder, {
             kind: 'PropertyStore',
             object: {...object},
-            property,
+            property: makePropertyLiteral(property),
             value: {...updatedValue},
             loc: leftExpr.node.loc ?? GeneratedSource,
           });
@@ -3057,7 +3059,7 @@ function lowerArguments(
 
 type LoweredMemberExpression = {
   object: Place;
-  property: Place | string;
+  property: Place | string | number;
   value: InstructionValue;
 };
 function lowerMemberExpression(
@@ -3072,8 +3074,13 @@ function lowerMemberExpression(
   const object =
     loweredObject ?? lowerExpressionToTemporary(builder, objectNode);
 
-  if (!expr.node.computed) {
-    if (!propertyNode.isIdentifier()) {
+  if (!expr.node.computed || expr.node.property.type === 'NumericLiteral') {
+    let property: PropertyLiteral;
+    if (propertyNode.isIdentifier()) {
+      property = makePropertyLiteral(propertyNode.node.name);
+    } else if (propertyNode.isNumericLiteral()) {
+      property = makePropertyLiteral(propertyNode.node.value);
+    } else {
       builder.errors.push({
         reason: `(BuildHIR::lowerMemberExpression) Handle ${propertyNode.type} property`,
         severity: ErrorSeverity.Todo,
@@ -3089,10 +3096,10 @@ function lowerMemberExpression(
     const value: InstructionValue = {
       kind: 'PropertyLoad',
       object: {...object},
-      property: propertyNode.node.name,
+      property,
       loc: exprLoc,
     };
-    return {object, property: propertyNode.node.name, value};
+    return {object, property, value};
   } else {
     if (!propertyNode.isExpression()) {
       builder.errors.push({
@@ -3210,7 +3217,7 @@ function lowerJsxMemberExpression(
   return lowerValueToTemporary(builder, {
     kind: 'PropertyLoad',
     object: objectPlace,
-    property,
+    property: makePropertyLiteral(property),
     loc,
   });
 }
@@ -3626,8 +3633,25 @@ function lowerAssignment(
       const lvalue = lvaluePath as NodePath<t.MemberExpression>;
       const property = lvalue.get('property');
       const object = lowerExpressionToTemporary(builder, lvalue.get('object'));
-      if (!lvalue.node.computed) {
-        if (!property.isIdentifier()) {
+      if (!lvalue.node.computed || lvalue.get('property').isNumericLiteral()) {
+        let temporary;
+        if (property.isIdentifier()) {
+          temporary = lowerValueToTemporary(builder, {
+            kind: 'PropertyStore',
+            object,
+            property: makePropertyLiteral(property.node.name),
+            value,
+            loc,
+          });
+        } else if (property.isNumericLiteral()) {
+          temporary = lowerValueToTemporary(builder, {
+            kind: 'PropertyStore',
+            object,
+            property: makePropertyLiteral(property.node.value),
+            value,
+            loc,
+          });
+        } else {
           builder.errors.push({
             reason: `(BuildHIR::lowerAssignment) Handle ${property.type} properties in MemberExpression`,
             severity: ErrorSeverity.Todo,
@@ -3636,13 +3660,6 @@ function lowerAssignment(
           });
           return {kind: 'UnsupportedNode', node: lvalueNode, loc};
         }
-        const temporary = lowerValueToTemporary(builder, {
-          kind: 'PropertyStore',
-          object,
-          property: property.node.name,
-          value,
-          loc,
-        });
         return {kind: 'LoadLocal', place: temporary, loc: temporary.loc};
       } else {
         if (!property.isExpression()) {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
index a422570fffead..7b352696860e8 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectHoistablePropertyLoads.ts
@@ -18,6 +18,7 @@ import {
   IdentifierId,
   InstructionId,
   InstructionValue,
+  PropertyLiteral,
   ReactiveScopeDependency,
   ScopeId,
 } from './HIR';
@@ -172,8 +173,8 @@ export type BlockInfo = {
  * and make computing sets intersections simpler.
  */
 type RootNode = {
-  properties: Map<string, PropertyPathNode>;
-  optionalProperties: Map<string, PropertyPathNode>;
+  properties: Map<PropertyLiteral, PropertyPathNode>;
+  optionalProperties: Map<PropertyLiteral, PropertyPathNode>;
   parent: null;
   // Recorded to make later computations simpler
   fullPath: ReactiveScopeDependency;
@@ -183,8 +184,8 @@ type RootNode = {
 
 type PropertyPathNode =
   | {
-      properties: Map<string, PropertyPathNode>;
-      optionalProperties: Map<string, PropertyPathNode>;
+      properties: Map<PropertyLiteral, PropertyPathNode>;
+      optionalProperties: Map<PropertyLiteral, PropertyPathNode>;
       parent: PropertyPathNode;
       fullPath: ReactiveScopeDependency;
       hasOptional: boolean;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectOptionalChainDependencies.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectOptionalChainDependencies.ts
index 2b7c9f2134e71..02a28b9f35776 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectOptionalChainDependencies.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/CollectOptionalChainDependencies.ts
@@ -16,6 +16,7 @@ import {
   DependencyPathEntry,
   Instruction,
   Terminal,
+  PropertyLiteral,
 } from './HIR';
 import {printIdentifier} from './PrintHIR';
 
@@ -157,7 +158,7 @@ function matchOptionalTestBlock(
   blocks: ReadonlyMap<BlockId, BasicBlock>,
 ): {
   consequentId: IdentifierId;
-  property: string;
+  property: PropertyLiteral;
   propertyId: IdentifierId;
   storeLocalInstr: Instruction;
   consequentGoto: BlockId;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
index 07f44a59a26de..7f6fb9e88f817 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/DeriveMinimalDependenciesHIR.ts
@@ -10,6 +10,7 @@ import {
   DependencyPathEntry,
   GeneratedSource,
   Identifier,
+  PropertyLiteral,
   ReactiveScopeDependency,
 } from '../HIR';
 import {printIdentifier} from '../HIR/PrintHIR';
@@ -286,7 +287,7 @@ function merge(
 }
 
 type TreeNode<T extends string> = {
-  properties: Map<string, TreeNode<T>>;
+  properties: Map<PropertyLiteral, TreeNode<T>>;
   accessType: T;
 };
 type HoistableNode = TreeNode<'Optional' | 'NonNull'>;
@@ -343,7 +344,7 @@ function printSubtree(
 
 function makeOrMergeProperty(
   node: DependencyNode,
-  property: string,
+  property: PropertyLiteral,
   accessType: PropertyAccessType,
 ): DependencyNode {
   let child = node.properties.get(property);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
index e124caee7a23f..1ca00ef5877c4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/HIR.ts
@@ -937,7 +937,7 @@ export type InstructionValue =
   | {
       kind: 'PropertyStore';
       object: Place;
-      property: string;
+      property: PropertyLiteral;
       value: Place;
       loc: SourceLocation;
     }
@@ -947,7 +947,7 @@ export type InstructionValue =
   | {
       kind: 'PropertyDelete';
       object: Place;
-      property: string;
+      property: PropertyLiteral;
       loc: SourceLocation;
     }
 
@@ -1121,7 +1121,7 @@ export type StoreLocal = {
 export type PropertyLoad = {
   kind: 'PropertyLoad';
   object: Place;
-  property: string;
+  property: PropertyLiteral;
   loc: SourceLocation;
 };
 
@@ -1502,7 +1502,17 @@ export type ReactiveScopeDeclaration = {
   scope: ReactiveScope; // the scope in which the variable was originally declared
 };
 
-export type DependencyPathEntry = {property: string; optional: boolean};
+const opaquePropertyLiteral = Symbol();
+export type PropertyLiteral = (string | number) & {
+  [opaquePropertyLiteral]: 'PropertyLiteral';
+};
+export function makePropertyLiteral(value: string | number): PropertyLiteral {
+  return value as PropertyLiteral;
+}
+export type DependencyPathEntry = {
+  property: PropertyLiteral;
+  optional: boolean;
+};
 export type DependencyPath = Array<DependencyPathEntry>;
 export type ReactiveScopeDependency = {
   identifier: Identifier;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
index 4cb84870a8a33..e12d10b40612b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/PropagateScopeDependenciesHIR.ts
@@ -22,6 +22,7 @@ import {
   TInstruction,
   FunctionExpression,
   ObjectMethod,
+  PropertyLiteral,
 } from './HIR';
 import {
   collectHoistablePropertyLoads,
@@ -321,7 +322,7 @@ function collectTemporariesSidemapImpl(
 
 function getProperty(
   object: Place,
-  propertyName: string,
+  propertyName: PropertyLiteral,
   optional: boolean,
   temporaries: ReadonlyMap<IdentifierId, ReactiveScopeDependency>,
 ): ReactiveScopeDependency {
@@ -519,7 +520,11 @@ class Context {
     );
   }
 
-  visitProperty(object: Place, property: string, optional: boolean): void {
+  visitProperty(
+    object: Place,
+    property: PropertyLiteral,
+    optional: boolean,
+  ): void {
     const nextDependency = getProperty(
       object,
       property,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/HIR/Types.ts b/compiler/packages/babel-plugin-react-compiler/src/HIR/Types.ts
index 55cd1531aee93..a67b580a6728b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/HIR/Types.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/HIR/Types.ts
@@ -6,6 +6,7 @@
  */
 
 import {CompilerError} from '../CompilerError';
+import {PropertyLiteral} from './HIR';
 
 export type BuiltInType = PrimitiveType | FunctionType | ObjectType;
 
@@ -59,7 +60,7 @@ export type PropType = {
   kind: 'Property';
   objectType: Type;
   objectName: string;
-  propertyName: string;
+  propertyName: PropertyLiteral;
 };
 
 export type ObjectMethod = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/DropManualMemoization.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/DropManualMemoization.ts
index 4dcdc21e15ac5..8d123845c3739 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/DropManualMemoization.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/DropManualMemoization.ts
@@ -145,9 +145,10 @@ function collectTemporaries(
     }
     case 'PropertyLoad': {
       if (sidemap.react.has(value.object.identifier.id)) {
-        if (value.property === 'useMemo' || value.property === 'useCallback') {
+        const property = value.property;
+        if (property === 'useMemo' || property === 'useCallback') {
           sidemap.manualMemos.set(instr.lvalue.identifier.id, {
-            kind: value.property,
+            kind: property as 'useMemo' | 'useCallback',
             loadInstr: instr as TInstruction<PropertyLoad>,
           });
         }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/ConstantPropagation.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/ConstantPropagation.ts
index a9f62c1986efa..07cd419230ac4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/ConstantPropagation.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/ConstantPropagation.ts
@@ -19,6 +19,7 @@ import {
   Primitive,
   assertConsistentIdentifiers,
   assertTerminalSuccessorsExist,
+  makePropertyLiteral,
   markInstructionIds,
   markPredecessors,
   mergeConsecutiveBlocks,
@@ -238,13 +239,14 @@ function evaluateInstruction(
       if (
         property !== null &&
         property.kind === 'Primitive' &&
-        typeof property.value === 'string' &&
-        isValidIdentifier(property.value)
+        ((typeof property.value === 'string' &&
+          isValidIdentifier(property.value)) ||
+          typeof property.value === 'number')
       ) {
         const nextValue: InstructionValue = {
           kind: 'PropertyLoad',
           loc: value.loc,
-          property: property.value,
+          property: makePropertyLiteral(property.value),
           object: value.object,
         };
         instr.value = nextValue;
@@ -256,13 +258,14 @@ function evaluateInstruction(
       if (
         property !== null &&
         property.kind === 'Primitive' &&
-        typeof property.value === 'string' &&
-        isValidIdentifier(property.value)
+        ((typeof property.value === 'string' &&
+          isValidIdentifier(property.value)) ||
+          typeof property.value === 'number')
       ) {
         const nextValue: InstructionValue = {
           kind: 'PropertyStore',
           loc: value.loc,
-          property: property.value,
+          property: makePropertyLiteral(property.value),
           object: value.object,
           value: value.value,
         };
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/InlineJsxTransform.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/InlineJsxTransform.ts
index 9ffc64864f397..29c59c7b3644a 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/InlineJsxTransform.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/InlineJsxTransform.ts
@@ -21,6 +21,7 @@ import {
   InstructionKind,
   JsxAttribute,
   makeInstructionId,
+  makePropertyLiteral,
   ObjectProperty,
   Phi,
   Place,
@@ -446,7 +447,7 @@ function createSymbolProperty(
     value: {
       kind: 'PropertyLoad',
       object: {...symbolInstruction.lvalue},
-      property: 'for',
+      property: makePropertyLiteral('for'),
       loc: instr.value.loc,
     },
     loc: instr.loc,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts b/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
index 5b700b23b4049..b636c7b1718cc 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Optimization/LowerContextAccess.ts
@@ -23,6 +23,7 @@ import {
   isUseContextHookType,
   makeBlockId,
   makeInstructionId,
+  makePropertyLiteral,
   makeType,
   markInstructionIds,
   promoteTemporary,
@@ -195,7 +196,7 @@ function emitPropertyLoad(
   const loadProp: PropertyLoad = {
     kind: 'PropertyLoad',
     object,
-    property,
+    property: makePropertyLiteral(property),
     loc: GeneratedSource,
   };
   const element: Place = createTemporaryPlace(env, GeneratedSource);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
index 93b70bd7d1da3..6c89aea45ea45 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/CodegenReactiveFunction.ts
@@ -1453,15 +1453,20 @@ function codegenDependency(
   if (dependency.path.length !== 0) {
     const hasOptional = dependency.path.some(path => path.optional);
     for (const path of dependency.path) {
+      const property =
+        typeof path.property === 'string'
+          ? t.identifier(path.property)
+          : t.numericLiteral(path.property);
+      const isComputed = typeof path.property !== 'string';
       if (hasOptional) {
         object = t.optionalMemberExpression(
           object,
-          t.identifier(path.property),
-          false,
+          property,
+          isComputed,
           path.optional,
         );
       } else {
-        object = t.memberExpression(object, t.identifier(path.property));
+        object = t.memberExpression(object, property, isComputed);
       }
     }
   }
@@ -1962,38 +1967,37 @@ function codegenInstructionValue(
       value = node;
       break;
     }
-    case 'PropertyStore': {
-      value = t.assignmentExpression(
-        '=',
-        t.memberExpression(
-          codegenPlaceToExpression(cx, instrValue.object),
-          t.identifier(instrValue.property),
-        ),
-        codegenPlaceToExpression(cx, instrValue.value),
-      );
-      break;
-    }
-    case 'PropertyLoad': {
-      const object = codegenPlaceToExpression(cx, instrValue.object);
+    case 'PropertyStore':
+    case 'PropertyLoad':
+    case 'PropertyDelete': {
+      let memberExpr;
       /*
        * We currently only lower single chains of optional memberexpr.
        * (See BuildHIR.ts for more detail.)
        */
-      value = t.memberExpression(
-        object,
-        t.identifier(instrValue.property),
-        undefined,
-      );
-      break;
-    }
-    case 'PropertyDelete': {
-      value = t.unaryExpression(
-        'delete',
-        t.memberExpression(
+      if (typeof instrValue.property === 'string') {
+        memberExpr = t.memberExpression(
           codegenPlaceToExpression(cx, instrValue.object),
           t.identifier(instrValue.property),
-        ),
-      );
+        );
+      } else {
+        memberExpr = t.memberExpression(
+          codegenPlaceToExpression(cx, instrValue.object),
+          t.numericLiteral(instrValue.property),
+          true,
+        );
+      }
+      if (instrValue.kind === 'PropertyStore') {
+        value = t.assignmentExpression(
+          '=',
+          memberExpr,
+          codegenPlaceToExpression(cx, instrValue.value),
+        );
+      } else if (instrValue.kind === 'PropertyLoad') {
+        value = memberExpr;
+      } else {
+        value = t.unaryExpression('delete', memberExpr);
+      }
       break;
     }
     case 'ComputedStore': {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PropagateEarlyReturns.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PropagateEarlyReturns.ts
index b8ba19628451b..522aaf5a5df28 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PropagateEarlyReturns.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PropagateEarlyReturns.ts
@@ -17,6 +17,7 @@ import {
   ReactiveStatement,
   ReactiveTerminalStatement,
   makeInstructionId,
+  makePropertyLiteral,
   promoteTemporary,
 } from '../HIR';
 import {createTemporaryPlace} from '../HIR/HIRBuilder';
@@ -189,7 +190,7 @@ class Transform extends ReactiveFunctionTransform<State> {
               value: {
                 kind: 'PropertyLoad',
                 object: {...symbolTemp},
-                property: 'for',
+                property: makePropertyLiteral('for'),
                 loc,
               },
             },
diff --git a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneInitializationDependencies.ts b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneInitializationDependencies.ts
index 2a9d0b9793d9f..9ef9d382c2834 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneInitializationDependencies.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/ReactiveScopes/PruneInitializationDependencies.ts
@@ -12,6 +12,7 @@ import {
   IdentifierId,
   InstructionId,
   Place,
+  PropertyLiteral,
   ReactiveBlock,
   ReactiveFunction,
   ReactiveInstruction,
@@ -64,13 +65,13 @@ type KindMap = Map<IdentifierId, CreateUpdate>;
 class Visitor extends ReactiveFunctionVisitor<CreateUpdate> {
   map: KindMap = new Map();
   aliases: DisjointSet<IdentifierId>;
-  paths: Map<IdentifierId, Map<string, IdentifierId>>;
+  paths: Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>;
   env: Environment;
 
   constructor(
     env: Environment,
     aliases: DisjointSet<IdentifierId>,
-    paths: Map<IdentifierId, Map<string, IdentifierId>>,
+    paths: Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>,
   ) {
     super();
     this.aliases = aliases;
@@ -218,9 +219,9 @@ export default function pruneInitializationDependencies(
 }
 
 function update(
-  map: Map<IdentifierId, Map<string, IdentifierId>>,
+  map: Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>,
   key: IdentifierId,
-  path: string,
+  path: PropertyLiteral,
   value: IdentifierId,
 ): void {
   const inner = map.get(key) ?? new Map();
@@ -230,7 +231,7 @@ function update(
 
 class AliasVisitor extends ReactiveFunctionVisitor {
   scopeIdentifiers: DisjointSet<IdentifierId> = new DisjointSet<IdentifierId>();
-  scopePaths: Map<IdentifierId, Map<string, IdentifierId>> = new Map();
+  scopePaths: Map<IdentifierId, Map<PropertyLiteral, IdentifierId>> = new Map();
 
   override visitInstruction(instr: ReactiveInstruction): void {
     if (
@@ -271,11 +272,14 @@ class AliasVisitor extends ReactiveFunctionVisitor {
 
 function getAliases(
   fn: ReactiveFunction,
-): [DisjointSet<IdentifierId>, Map<IdentifierId, Map<string, IdentifierId>>] {
+): [
+  DisjointSet<IdentifierId>,
+  Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>,
+] {
   const visitor = new AliasVisitor();
   visitReactiveFunction(fn, visitor, null);
   let disjoint = visitor.scopeIdentifiers;
-  let scopePaths = new Map<IdentifierId, Map<string, IdentifierId>>();
+  let scopePaths = new Map<IdentifierId, Map<PropertyLiteral, IdentifierId>>();
   for (const [key, value] of visitor.scopePaths) {
     for (const [path, id] of value) {
       update(
diff --git a/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts b/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
index 44bf539e847bb..3054a83c76138 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/TypeInference/InferTypes.ts
@@ -14,6 +14,7 @@ import {
   Identifier,
   IdentifierId,
   Instruction,
+  makePropertyLiteral,
   makeType,
   PropType,
   Type,
@@ -335,7 +336,7 @@ function* generateInstructionTypes(
               kind: 'Property',
               objectType: value.value.identifier.type,
               objectName: getName(names, value.value.identifier.id),
-              propertyName,
+              propertyName: makePropertyLiteral(propertyName),
             });
           } else {
             break;
@@ -352,7 +353,7 @@ function* generateInstructionTypes(
                 kind: 'Property',
                 objectType: value.value.identifier.type,
                 objectName: getName(names, value.value.identifier.id),
-                propertyName: property.key.name,
+                propertyName: makePropertyLiteral(property.key.name),
               });
             }
           }
@@ -453,10 +454,12 @@ class Unifier {
         return;
       }
       const objectType = this.get(tB.objectType);
-      const propertyType = this.env.getPropertyType(
-        objectType,
-        tB.propertyName,
-      );
+      let propertyType;
+      if (typeof tB.propertyName === 'number') {
+        propertyType = null;
+      } else {
+        propertyType = this.env.getPropertyType(objectType, tB.propertyName);
+      }
       if (propertyType !== null) {
         this.unify(tA, propertyType);
       }
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateHooksUsage.ts b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateHooksUsage.ts
index 53640da5020bd..ed23693f61439 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateHooksUsage.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateHooksUsage.ts
@@ -257,7 +257,9 @@ export function validateHooksUsage(fn: HIRFunction): void {
         }
         case 'PropertyLoad': {
           const objectKind = getKindForPlace(instr.value.object);
-          const isHookProperty = isHookName(instr.value.property);
+          const isHookProperty =
+            typeof instr.value.property === 'string' &&
+            isHookName(instr.value.property);
           let kind: Kind;
           switch (objectKind) {
             case Kind.Error: {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoCapitalizedCalls.ts b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoCapitalizedCalls.ts
index 2988d1cc02430..2f9b0a1c7e2ce 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoCapitalizedCalls.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoCapitalizedCalls.ts
@@ -61,7 +61,10 @@ export function validateNoCapitalizedCalls(fn: HIRFunction): void {
         }
         case 'PropertyLoad': {
           // Start conservative and disallow all capitalized method calls
-          if (/^[A-Z]/.test(value.property)) {
+          if (
+            typeof value.property === 'string' &&
+            /^[A-Z]/.test(value.property)
+          ) {
             capitalizedProperties.set(lvalue.identifier.id, value.property);
           }
           break;
diff --git a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoRefAccesInRender.ts b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoRefAccesInRender.ts
index 4db8c700f387f..779207b22e646 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoRefAccesInRender.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Validation/ValidateNoRefAccesInRender.ts
@@ -285,7 +285,7 @@ function validateNoRefAccessInRenderImpl(
           }
           case 'ComputedLoad':
           case 'PropertyLoad': {
-            if (typeof instr.value.property !== 'string') {
+            if (instr.value.kind === 'ComputedLoad') {
               validateNoDirectRefValueAccess(errors, instr.value.property, env);
             }
             const objType = env.get(instr.value.object.identifier.id);
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/mixedreadonly-mutating-map.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/mixedreadonly-mutating-map.expect.md
index 4867388a864d2..6dd05cbe7c619 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/mixedreadonly-mutating-map.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/mixedreadonly-mutating-map.expect.md
@@ -125,22 +125,21 @@ function Component(t0) {
   } else {
     t1 = $[2];
   }
-  const t2 = jsx[0];
-  let t3;
-  if ($[3] !== t1 || $[4] !== t2) {
-    t3 = (
+  let t2;
+  if ($[3] !== jsx[0] || $[4] !== t1) {
+    t2 = (
       <>
         {t1}
-        {t2}
+        {jsx[0]}
       </>
     );
-    $[3] = t1;
-    $[4] = t2;
-    $[5] = t3;
+    $[3] = jsx[0];
+    $[4] = t1;
+    $[5] = t2;
   } else {
-    t3 = $[5];
+    t2 = $[5];
   }
-  return t3;
+  return t2;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.expect.md
deleted file mode 100644
index bf22790a51c12..0000000000000
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.expect.md
+++ /dev/null
@@ -1,40 +0,0 @@
-
-## Input
-
-```javascript
-// @validatePreserveExistingMemoizationGuarantees
-
-import {useMemo} from 'react';
-import {makeArray} from 'shared-runtime';
-
-// We currently only recognize "hoistable" values (e.g. variable reads
-// and property loads from named variables) in the source depslist.
-// This makes validation logic simpler and follows the same constraints
-// from the eslint react-hooks-deps plugin.
-function Foo(props) {
-  const x = makeArray(props);
-  // react-hooks-deps lint would already fail here
-  return useMemo(() => [x[0]], [x[0]]);
-}
-
-export const FIXTURE_ENTRYPOINT = {
-  fn: Foo,
-  params: [{val: 1}],
-};
-
-```
-
-
-## Error
-
-```
-  11 |   const x = makeArray(props);
-  12 |   // react-hooks-deps lint would already fail here
-> 13 |   return useMemo(() => [x[0]], [x[0]]);
-     |                                 ^^^^ InvalidReact: Expected the dependency list to be an array of simple expressions (e.g. `x`, `x.y.z`, `x?.y?.z`) (13:13)
-  14 | }
-  15 |
-  16 | export const FIXTURE_ENTRYPOINT = {
-```
-          
-      
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.expect.md
new file mode 100644
index 0000000000000..dafe2b63e35ae
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.expect.md
@@ -0,0 +1,71 @@
+
+## Input
+
+```javascript
+// @validatePreserveExistingMemoizationGuarantees
+
+import {useMemo} from 'react';
+import {makeArray} from 'shared-runtime';
+
+// We currently only recognize "hoistable" values (e.g. variable reads
+// and property loads from named variables) in the source depslist.
+// This makes validation logic simpler and follows the same constraints
+// from the eslint react-hooks-deps plugin.
+function Foo(props) {
+  const x = makeArray(props);
+  // react-hooks-deps lint would already fail here
+  return useMemo(() => [x[0]], [x[0]]);
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{val: 1}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime"; // @validatePreserveExistingMemoizationGuarantees
+
+import { useMemo } from "react";
+import { makeArray } from "shared-runtime";
+
+// We currently only recognize "hoistable" values (e.g. variable reads
+// and property loads from named variables) in the source depslist.
+// This makes validation logic simpler and follows the same constraints
+// from the eslint react-hooks-deps plugin.
+function Foo(props) {
+  const $ = _c(4);
+  let t0;
+  if ($[0] !== props) {
+    t0 = makeArray(props);
+    $[0] = props;
+    $[1] = t0;
+  } else {
+    t0 = $[1];
+  }
+  const x = t0;
+  let t1;
+  let t2;
+  if ($[2] !== x[0]) {
+    t2 = [x[0]];
+    $[2] = x[0];
+    $[3] = t2;
+  } else {
+    t2 = $[3];
+  }
+  t1 = t2;
+  return t1;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{ val: 1 }],
+};
+
+```
+      
+### Eval output
+(kind: ok) [{"val":1}]
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.ts b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.ts
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/error.useMemo-dep-not-recognized.ts
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/preserve-memo-validation/useMemo-dep-array-literal-access.ts
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-array.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-array.expect.md
index ee52047fbe982..b9ff24519e50f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-array.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-array.expect.md
@@ -32,28 +32,20 @@ export const FIXTURE_ENTRYPOINT = {
 ```javascript
 import { c as _c } from "react/compiler-runtime";
 function Component(props) {
-  const $ = _c(4);
-  let x;
+  const $ = _c(2);
+  let t0;
   if ($[0] !== props.input) {
-    x = [];
+    const x = [];
     const y = x;
     y.push(props.input);
-    $[0] = props.input;
-    $[1] = x;
-  } else {
-    x = $[1];
-  }
 
-  const t0 = x[0];
-  let t1;
-  if ($[2] !== t0) {
-    t1 = [t0];
-    $[2] = t0;
-    $[3] = t1;
+    t0 = [x[0]];
+    $[0] = props.input;
+    $[1] = t0;
   } else {
-    t1 = $[3];
+    t0 = $[1];
   }
-  return t1;
+  return t0;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-lambda.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-lambda.expect.md
index 3a338af5ab58f..ebf30d9d28560 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-lambda.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reactivity-via-aliased-mutation-lambda.expect.md
@@ -35,32 +35,24 @@ export const FIXTURE_ENTRYPOINT = {
 ```javascript
 import { c as _c } from "react/compiler-runtime";
 function Component(props) {
-  const $ = _c(4);
-  let x;
+  const $ = _c(2);
+  let t0;
   if ($[0] !== props.input) {
-    x = [];
+    const x = [];
     const f = (arg) => {
       const y = x;
       y.push(arg);
     };
 
     f(props.input);
-    $[0] = props.input;
-    $[1] = x;
-  } else {
-    x = $[1];
-  }
 
-  const t0 = x[0];
-  let t1;
-  if ($[2] !== t0) {
-    t1 = [t0];
-    $[2] = t0;
-    $[3] = t1;
+    t0 = [x[0]];
+    $[0] = props.input;
+    $[1] = t0;
   } else {
-    t1 = $[3];
+    t0 = $[1];
   }
-  return t1;
+  return t0;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture-namespace-import.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture-namespace-import.expect.md
index 5016b0c4dfdfd..87b5d7a09e28d 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture-namespace-import.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture-namespace-import.expect.md
@@ -94,69 +94,67 @@ export function Component(t0) {
   } else {
     t6 = $[8];
   }
-  const t7 = items_0[0];
-  let t8;
-  if ($[9] !== t6 || $[10] !== t7) {
-    t8 = <SharedRuntime.ValidateMemoization inputs={t6} output={t7} />;
-    $[9] = t6;
-    $[10] = t7;
-    $[11] = t8;
+  let t7;
+  if ($[9] !== items_0[0] || $[10] !== t6) {
+    t7 = <SharedRuntime.ValidateMemoization inputs={t6} output={items_0[0]} />;
+    $[9] = items_0[0];
+    $[10] = t6;
+    $[11] = t7;
   } else {
-    t8 = $[11];
+    t7 = $[11];
   }
-  let t9;
+  let t8;
   if ($[12] !== b) {
-    t9 = [b];
+    t8 = [b];
     $[12] = b;
-    $[13] = t9;
+    $[13] = t8;
   } else {
-    t9 = $[13];
+    t8 = $[13];
   }
-  const t10 = items_0[1];
-  let t11;
-  if ($[14] !== t10 || $[15] !== t9) {
-    t11 = <SharedRuntime.ValidateMemoization inputs={t9} output={t10} />;
-    $[14] = t10;
-    $[15] = t9;
-    $[16] = t11;
+  let t9;
+  if ($[14] !== items_0[1] || $[15] !== t8) {
+    t9 = <SharedRuntime.ValidateMemoization inputs={t8} output={items_0[1]} />;
+    $[14] = items_0[1];
+    $[15] = t8;
+    $[16] = t9;
   } else {
-    t11 = $[16];
+    t9 = $[16];
   }
-  let t12;
+  let t10;
   if ($[17] !== a || $[18] !== b) {
-    t12 = [a, b];
+    t10 = [a, b];
     $[17] = a;
     $[18] = b;
-    $[19] = t12;
+    $[19] = t10;
   } else {
-    t12 = $[19];
+    t10 = $[19];
   }
-  let t13;
-  if ($[20] !== items_0 || $[21] !== t12) {
-    t13 = <SharedRuntime.ValidateMemoization inputs={t12} output={items_0} />;
+  let t11;
+  if ($[20] !== items_0 || $[21] !== t10) {
+    t11 = <SharedRuntime.ValidateMemoization inputs={t10} output={items_0} />;
     $[20] = items_0;
-    $[21] = t12;
-    $[22] = t13;
+    $[21] = t10;
+    $[22] = t11;
   } else {
-    t13 = $[22];
+    t11 = $[22];
   }
-  let t14;
-  if ($[23] !== t11 || $[24] !== t13 || $[25] !== t8) {
-    t14 = (
+  let t12;
+  if ($[23] !== t11 || $[24] !== t7 || $[25] !== t9) {
+    t12 = (
       <>
-        {t8}
+        {t7}
+        {t9}
         {t11}
-        {t13}
       </>
     );
     $[23] = t11;
-    $[24] = t13;
-    $[25] = t8;
-    $[26] = t14;
+    $[24] = t7;
+    $[25] = t9;
+    $[26] = t12;
   } else {
-    t14 = $[26];
+    t12 = $[26];
   }
-  return t14;
+  return t12;
 }
 
 export const FIXTURE_ENTRYPOINT = {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture.expect.md
index 3f341fc6650d5..c71e4c2530fce 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/type-provider-store-capture.expect.md
@@ -94,69 +94,67 @@ export function Component(t0) {
   } else {
     t6 = $[8];
   }
-  const t7 = items_0[0];
-  let t8;
-  if ($[9] !== t6 || $[10] !== t7) {
-    t8 = <ValidateMemoization inputs={t6} output={t7} />;
-    $[9] = t6;
-    $[10] = t7;
-    $[11] = t8;
+  let t7;
+  if ($[9] !== items_0[0] || $[10] !== t6) {
+    t7 = <ValidateMemoization inputs={t6} output={items_0[0]} />;
+    $[9] = items_0[0];
+    $[10] = t6;
+    $[11] = t7;
   } else {
-    t8 = $[11];
+    t7 = $[11];
   }
-  let t9;
+  let t8;
   if ($[12] !== b) {
-    t9 = [b];
+    t8 = [b];
     $[12] = b;
-    $[13] = t9;
+    $[13] = t8;
   } else {
-    t9 = $[13];
+    t8 = $[13];
   }
-  const t10 = items_0[1];
-  let t11;
-  if ($[14] !== t10 || $[15] !== t9) {
-    t11 = <ValidateMemoization inputs={t9} output={t10} />;
-    $[14] = t10;
-    $[15] = t9;
-    $[16] = t11;
+  let t9;
+  if ($[14] !== items_0[1] || $[15] !== t8) {
+    t9 = <ValidateMemoization inputs={t8} output={items_0[1]} />;
+    $[14] = items_0[1];
+    $[15] = t8;
+    $[16] = t9;
   } else {
-    t11 = $[16];
+    t9 = $[16];
   }
-  let t12;
+  let t10;
   if ($[17] !== a || $[18] !== b) {
-    t12 = [a, b];
+    t10 = [a, b];
     $[17] = a;
     $[18] = b;
-    $[19] = t12;
+    $[19] = t10;
   } else {
-    t12 = $[19];
+    t10 = $[19];
   }
-  let t13;
-  if ($[20] !== items_0 || $[21] !== t12) {
-    t13 = <ValidateMemoization inputs={t12} output={items_0} />;
+  let t11;
+  if ($[20] !== items_0 || $[21] !== t10) {
+    t11 = <ValidateMemoization inputs={t10} output={items_0} />;
     $[20] = items_0;
-    $[21] = t12;
-    $[22] = t13;
+    $[21] = t10;
+    $[22] = t11;
   } else {
-    t13 = $[22];
+    t11 = $[22];
   }
-  let t14;
-  if ($[23] !== t11 || $[24] !== t13 || $[25] !== t8) {
-    t14 = (
+  let t12;
+  if ($[23] !== t11 || $[24] !== t7 || $[25] !== t9) {
+    t12 = (
       <>
-        {t8}
+        {t7}
+        {t9}
         {t11}
-        {t13}
       </>
     );
     $[23] = t11;
-    $[24] = t13;
-    $[25] = t8;
-    $[26] = t14;
+    $[24] = t7;
+    $[25] = t9;
+    $[26] = t12;
   } else {
-    t14 = $[26];
+    t12 = $[26];
   }
-  return t14;
+  return t12;
 }
 
 export const FIXTURE_ENTRYPOINT = {

From 86b191347474fa98f002217ed88926efc8164c1e Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Tue, 18 Feb 2025 12:25:33 -0700
Subject: [PATCH 66/72] [compiler][be] Clean up bug test fixtures; evaluate
 more fixtures (#31812)

Test fixtures testing different compiler features (e.g. non-auto
memoization) should live in separate directories.

Remove bug-prefixed fixtures that have since been fixed

Add test evaluator export to more fixtures
---
 .../fixtures/compiler/call-spread.expect.md   | 22 ++++++-
 .../fixtures/compiler/call-spread.js          |  9 ++-
 ...ring-fun-alias-captured-mutate-2.expect.md | 38 +++++++++++-
 .../capturing-fun-alias-captured-mutate-2.js  | 15 ++++-
 ...-fun-alias-captured-mutate-arr-2.expect.md | 38 +++++++++++-
 ...pturing-fun-alias-captured-mutate-arr-2.js | 15 ++++-
 ...g-func-alias-captured-mutate-arr.expect.md | 36 +++++++++++-
 ...apturing-func-alias-captured-mutate-arr.js | 14 ++++-
 ...uring-func-alias-computed-mutate.expect.md | 25 +++++++-
 .../capturing-func-alias-computed-mutate.js   |  9 ++-
 .../capturing-func-alias-mutate.expect.md     | 25 +++++++-
 .../compiler/capturing-func-alias-mutate.js   |  9 ++-
 ...c-alias-receiver-computed-mutate.expect.md | 27 ++++++++-
 ...ing-func-alias-receiver-computed-mutate.js | 10 +++-
 ...uring-func-alias-receiver-mutate.expect.md | 27 ++++++++-
 .../capturing-func-alias-receiver-mutate.js   | 10 +++-
 .../capturing-func-simple-alias.expect.md     | 27 ++++++++-
 .../compiler/capturing-func-simple-alias.js   | 10 +++-
 ...nction-capture-ref-before-rename.expect.md | 58 ++++++++++++++-----
 ...ring-function-capture-ref-before-rename.js | 15 ++++-
 ...ction-conditional-capture-mutate.expect.md |  7 +--
 ...ing-function-conditional-capture-mutate.js |  3 +-
 .../capturing-function-renamed-ref.expect.md  | 48 ++++++++++++---
 .../capturing-function-renamed-ref.js         | 15 ++++-
 ...apturing-function-runs-inference.expect.md | 56 ++++++++++++------
 .../capturing-function-runs-inference.js      | 10 +++-
 ...pturing-function-shadow-captured.expect.md | 40 +++++++++++--
 .../capturing-function-shadow-captured.js     | 12 +++-
 ...capturing-reference-changes-type.expect.md | 25 +++++++-
 .../capturing-reference-changes-type.js       |  9 ++-
 .../compiler/computed-store-alias.expect.md   | 33 ++++++++++-
 .../fixtures/compiler/computed-store-alias.js | 13 ++++-
 ...gation-into-function-expressions.expect.md | 29 ++++++++--
 ...t-propagation-into-function-expressions.js | 12 +++-
 ...ng-functionexpr-conditional-dep.expect.md} |  4 +-
 ...hoisting-functionexpr-conditional-dep.tsx} |  0
 ...-uncond-optional-chain-and-cond.expect.md} |  5 +-
 ...e-merge-uncond-optional-chain-and-cond.ts} |  0
 ...unction-cond-access-not-hoisted.expect.md} |  6 +-
 ...nfer-function-cond-access-not-hoisted.tsx} |  0
 ...try-catch-maybe-null-dependency.expect.md} |  7 ++-
 ....ts => try-catch-maybe-null-dependency.ts} |  0
 .../packages/snap/src/SproutTodoFilter.ts     | 30 +---------
 43 files changed, 664 insertions(+), 139 deletions(-)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/{bug-invalid-hoisting-functionexpr.expect.md => hoisting-functionexpr-conditional-dep.expect.md} (95%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/{bug-invalid-hoisting-functionexpr.tsx => hoisting-functionexpr-conditional-dep.tsx} (100%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/{bug-merge-uncond-optional-chain-and-cond.expect.md => edge-case-merge-uncond-optional-chain-and-cond.expect.md} (94%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/{bug-merge-uncond-optional-chain-and-cond.ts => edge-case-merge-uncond-optional-chain-and-cond.ts} (100%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/{bug-infer-function-cond-access-not-hoisted.expect.md => infer-function-cond-access-not-hoisted.expect.md} (82%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/{bug-infer-function-cond-access-not-hoisted.tsx => infer-function-cond-access-not-hoisted.tsx} (100%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/{bug-try-catch-maybe-null-dependency.expect.md => try-catch-maybe-null-dependency.expect.md} (95%)
 rename compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/{bug-try-catch-maybe-null-dependency.ts => try-catch-maybe-null-dependency.ts} (100%)

diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.expect.md
index 7a3ddf443f43f..2d7bc3f046e45 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.expect.md
@@ -2,22 +2,31 @@
 ## Input
 
 ```javascript
+import {makeArray} from 'shared-runtime';
+
 function Component(props) {
-  const x = foo(...props.a, null, ...props.b);
+  const x = makeArray(...props.a, null, ...props.b);
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: [1, 2], b: [2, 3, 4]}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
+import { makeArray } from "shared-runtime";
+
 function Component(props) {
   const $ = _c(3);
   let t0;
   if ($[0] !== props.a || $[1] !== props.b) {
-    t0 = foo(...props.a, null, ...props.b);
+    t0 = makeArray(...props.a, null, ...props.b);
     $[0] = props.a;
     $[1] = props.b;
     $[2] = t0;
@@ -28,5 +37,12 @@ function Component(props) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: [1, 2], b: [2, 3, 4] }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) [1,2,null,2,3,4]
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.js
index 5e73773bd1d24..8b7767c3bf890 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/call-spread.js
@@ -1,4 +1,11 @@
+import {makeArray} from 'shared-runtime';
+
 function Component(props) {
-  const x = foo(...props.a, null, ...props.b);
+  const x = makeArray(...props.a, null, ...props.b);
   return x;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: [1, 2], b: [2, 3, 4]}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.expect.md
index f9ce3f2e98cf5..061e64222eef0 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -15,14 +17,28 @@ function component(foo, bar) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(foo, bar) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(3);
+  const { foo, bar } = t0;
   let x;
   if ($[0] !== bar || $[1] !== foo) {
     x = { foo };
@@ -44,5 +60,21 @@ function component(foo, bar) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ foo: 2, bar: 3 }],
+  sequentialRenders: [
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 4 },
+    { foo: 3, bar: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"foo":2}
+{"foo":2}
+{"foo":2}
+{"foo":3}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.js
index a83acfcdb0e46..8579e8c4943f6 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-2.js
@@ -1,4 +1,6 @@
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -10,3 +12,14 @@ function component(foo, bar) {
   mutate(y);
   return x;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.expect.md
index 38590d1559bb5..fb44f2c7b8f24 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -15,14 +17,28 @@ function component(foo, bar) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(foo, bar) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(3);
+  const { foo, bar } = t0;
   let x;
   if ($[0] !== bar || $[1] !== foo) {
     x = { foo };
@@ -44,5 +60,21 @@ function component(foo, bar) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ foo: 2, bar: 3 }],
+  sequentialRenders: [
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 4 },
+    { foo: 3, bar: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"foo":2}
+{"foo":2}
+{"foo":2}
+{"foo":3}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.js
index 2a30bfbce197d..24dddd4910e08 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-fun-alias-captured-mutate-arr-2.js
@@ -1,4 +1,6 @@
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -10,3 +12,14 @@ function component(foo, bar) {
   mutate(y);
   return x;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.expect.md
index 7c94c33e495a8..e9cb3c4fd145b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -15,14 +16,27 @@ function component(foo, bar) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(foo, bar) {
+import { mutate } from "shared-runtime";
+function Component(t0) {
   const $ = _c(3);
+  const { foo, bar } = t0;
   let y;
   if ($[0] !== bar || $[1] !== foo) {
     const x = { foo };
@@ -44,5 +58,21 @@ function component(foo, bar) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ foo: 2, bar: 3 }],
+  sequentialRenders: [
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 3 },
+    { foo: 2, bar: 4 },
+    { foo: 3, bar: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"bar":3,"wat0":"joe"}
+{"bar":3,"wat0":"joe"}
+{"bar":4,"wat0":"joe"}
+{"bar":4,"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.js
index 5b7665498dfd6..f757078e73266 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-captured-mutate-arr.js
@@ -1,4 +1,5 @@
-function component(foo, bar) {
+import {mutate} from 'shared-runtime';
+function Component({foo, bar}) {
   let x = {foo};
   let y = {bar};
   const f0 = function () {
@@ -10,3 +11,14 @@ function component(foo, bar) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{foo: 2, bar: 3}],
+  sequentialRenders: [
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 3},
+    {foo: 2, bar: 4},
+    {foo: 3, bar: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.expect.md
index 1a561453a915e..513718ba8606b 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -13,14 +14,22 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -39,5 +48,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"x":{"a":2},"wat0":"joe"}
+{"x":{"a":2},"wat0":"joe"}
+{"x":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.js
index a66039c9ad283..daa4fffb28df8 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-computed-mutate.js
@@ -1,4 +1,5 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -8,3 +9,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.expect.md
index 386cbec42db64..ae145f4d9e2eb 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -13,14 +14,22 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -39,5 +48,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"x":{"a":2},"wat0":"joe"}
+{"x":{"a":2},"wat0":"joe"}
+{"x":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.js
index f528a8c02bc9a..524dc8af35601 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-mutate.js
@@ -1,4 +1,5 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -8,3 +9,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.expect.md
index 90df65c6ae425..d65e9cca92740 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -14,14 +16,23 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -41,5 +52,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"x":{"a":2},"wat0":"joe"}
+{"x":{"a":2},"wat0":"joe"}
+{"x":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.js
index d0a1f62320605..b4f645846c5be 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-computed-mutate.js
@@ -1,4 +1,6 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -9,3 +11,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.expect.md
index e26f048efba9a..deb78c79e08ed 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -14,14 +16,23 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -41,5 +52,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"x":{"a":2},"wat0":"joe"}
+{"x":{"a":2},"wat0":"joe"}
+{"x":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.js
index e34a03ec87742..a82df6b27fff8 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-alias-receiver-mutate.js
@@ -1,4 +1,6 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -9,3 +11,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.expect.md
index bdee721b5820e..0e2d77023996a 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -13,14 +15,23 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -39,5 +50,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"a":2,"wat0":"joe"}
+{"a":2,"wat0":"joe"}
+{"a":3,"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.js
index 39e87de8c089d..22764fec72e6e 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-func-simple-alias.js
@@ -1,4 +1,6 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+
+function Component({a}) {
   let x = {a};
   let y = {};
   const f0 = function () {
@@ -8,3 +10,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.expect.md
index 4087dc53c98f2..6364e83deb9a2 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+
+function Component({a, b}) {
   let z = {a};
   (function () {
     mutate(z);
@@ -17,14 +19,28 @@ function component(a, b) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 2, b: 4},
+    {a: 3, b: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a, b) {
+import { mutate } from "shared-runtime";
+
+function Component(t0) {
   const $ = _c(7);
+  const { a, b } = t0;
   let z;
   if ($[0] !== a) {
     z = { a };
@@ -37,27 +53,43 @@ function component(a, b) {
   }
 
   let y = z;
-  let t0;
+  let t1;
   if ($[2] !== b) {
-    t0 = { b };
+    t1 = { b };
     $[2] = b;
-    $[3] = t0;
+    $[3] = t1;
   } else {
-    t0 = $[3];
+    t1 = $[3];
   }
-  const z_0 = t0;
-  let t1;
+  const z_0 = t1;
+  let t2;
   if ($[4] !== y || $[5] !== z_0) {
-    t1 = { y, z: z_0 };
+    t2 = { y, z: z_0 };
     $[4] = y;
     $[5] = z_0;
-    $[6] = t1;
+    $[6] = t2;
   } else {
-    t1 = $[6];
+    t2 = $[6];
   }
-  y = t1;
+  y = t2;
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2, b: 3 }],
+  sequentialRenders: [
+    { a: 2, b: 3 },
+    { a: 2, b: 3 },
+    { a: 2, b: 4 },
+    { a: 3, b: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"y":{"a":2,"wat0":"joe"},"z":{"b":3}}
+{"y":{"a":2,"wat0":"joe"},"z":{"b":3}}
+{"y":{"a":2,"wat0":"joe"},"z":{"b":4}}
+{"y":{"a":3,"wat0":"joe"},"z":{"b":4}}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.js
index ad1a1f03c105c..b13e563ea820f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-capture-ref-before-rename.js
@@ -1,4 +1,6 @@
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+
+function Component({a, b}) {
   let z = {a};
   (function () {
     mutate(z);
@@ -12,3 +14,14 @@ function component(a, b) {
   }
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 2, b: 4},
+    {a: 3, b: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.expect.md
index 2f827d699a90c..c42aa4c48c5fd 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.expect.md
@@ -2,8 +2,7 @@
 ## Input
 
 ```javascript
-// @debug
-function component(a, b) {
+function useHook(a, b) {
   let z = {a};
   let y = b;
   let x = function () {
@@ -22,8 +21,8 @@ function component(a, b) {
 ## Code
 
 ```javascript
-import { c as _c } from "react/compiler-runtime"; // @debug
-function component(a, b) {
+import { c as _c } from "react/compiler-runtime";
+function useHook(a, b) {
   const $ = _c(5);
   let t0;
   if ($[0] !== a) {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.js
index 3a1a7d0d297a8..04d6ca29e1fea 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-conditional-capture-mutate.js
@@ -1,5 +1,4 @@
-// @debug
-function component(a, b) {
+function useHook(a, b) {
   let z = {a};
   let y = b;
   let x = function () {
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.expect.md
index edc6fb6d6cba4..034e9781b2356 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.expect.md
@@ -2,7 +2,9 @@
 ## Input
 
 ```javascript
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+
+function useHook({a, b}) {
   let z = {a};
   {
     let z = {b};
@@ -13,23 +15,37 @@ function component(a, b) {
   return z;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 2, b: 4},
+    {a: 3, b: 4},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a, b) {
+import { mutate } from "shared-runtime";
+
+function useHook(t0) {
   const $ = _c(2);
-  let t0;
+  const { a, b } = t0;
+  let t1;
   if ($[0] !== a) {
-    t0 = { a };
+    t1 = { a };
     $[0] = a;
-    $[1] = t0;
+    $[1] = t1;
   } else {
-    t0 = $[1];
+    t1 = $[1];
   }
-  const z = t0;
+  const z = t1;
 
   const z_0 = { b };
 
@@ -37,5 +53,21 @@ function component(a, b) {
   return z;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{ a: 2, b: 3 }],
+  sequentialRenders: [
+    { a: 2, b: 3 },
+    { a: 2, b: 3 },
+    { a: 2, b: 4 },
+    { a: 3, b: 4 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"a":2}
+{"a":2}
+{"a":2}
+{"a":3}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.js
index 1022a8604ab9c..49595f19d7e6f 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-renamed-ref.js
@@ -1,4 +1,6 @@
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+
+function useHook({a, b}) {
   let z = {a};
   {
     let z = {b};
@@ -8,3 +10,14 @@ function component(a, b) {
   }
   return z;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 2, b: 4},
+    {a: 3, b: 4},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.expect.md
index 344b9439078ca..dc0961c61264c 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.expect.md
@@ -2,11 +2,17 @@
 ## Input
 
 ```javascript
-function component(a, b) {
+import {Stringify} from 'shared-runtime';
+function Component({a, b}) {
   let z = {a};
-  let p = () => <Foo>{z}</Foo>;
+  let p = () => <Stringify>{z}</Stringify>;
   return p();
 }
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 1}],
+  sequentialRenders: [{a: 1}, {a: 1}, {a: 2}],
+};
 
 ```
 
@@ -14,36 +20,48 @@ function component(a, b) {
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a, b) {
+import { Stringify } from "shared-runtime";
+function Component(t0) {
   const $ = _c(6);
-  let t0;
+  const { a } = t0;
+  let t1;
   if ($[0] !== a) {
-    t0 = { a };
+    t1 = { a };
     $[0] = a;
-    $[1] = t0;
+    $[1] = t1;
   } else {
-    t0 = $[1];
+    t1 = $[1];
   }
-  const z = t0;
-  let t1;
+  const z = t1;
+  let t2;
   if ($[2] !== z) {
-    t1 = () => <Foo>{z}</Foo>;
+    t2 = () => <Stringify>{z}</Stringify>;
     $[2] = z;
-    $[3] = t1;
+    $[3] = t2;
   } else {
-    t1 = $[3];
+    t2 = $[3];
   }
-  const p = t1;
-  let t2;
+  const p = t2;
+  let t3;
   if ($[4] !== p) {
-    t2 = p();
+    t3 = p();
     $[4] = p;
-    $[5] = t2;
+    $[5] = t3;
   } else {
-    t2 = $[5];
+    t3 = $[5];
   }
-  return t2;
+  return t3;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 1 }],
+  sequentialRenders: [{ a: 1 }, { a: 1 }, { a: 2 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) <div>{"children":{"a":1}}</div>
+<div>{"children":{"a":1}}</div>
+<div>{"children":{"a":2}}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.js
index c4335e757feac..d5a4bb842f96c 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-runs-inference.js
@@ -1,5 +1,11 @@
-function component(a, b) {
+import {Stringify} from 'shared-runtime';
+function Component({a, b}) {
   let z = {a};
-  let p = () => <Foo>{z}</Foo>;
+  let p = () => <Stringify>{z}</Stringify>;
   return p();
 }
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 1}],
+  sequentialRenders: [{a: 1}, {a: 1}, {a: 2}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.expect.md
index 82012899616cd..d409bd32965f9 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.expect.md
@@ -2,28 +2,58 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate, Stringify} from 'shared-runtime';
+function Component({a}) {
   let z = {a};
   let x = function () {
     let z;
     mutate(z);
+    return z;
   };
-  return x;
+  return <Stringify fn={x} shouldInvokeFns={true} />;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 1}],
+  sequentialRenders: [{a: 1}, {a: 1}, {a: 2}],
+};
+
 ```
 
 ## Code
 
 ```javascript
-function component(a) {
+import { c as _c } from "react/compiler-runtime";
+import { mutate, Stringify } from "shared-runtime";
+function Component(t0) {
+  const $ = _c(1);
+
   const x = _temp;
-  return x;
+  let t1;
+  if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
+    t1 = <Stringify fn={x} shouldInvokeFns={true} />;
+    $[0] = t1;
+  } else {
+    t1 = $[0];
+  }
+  return t1;
 }
 function _temp() {
   let z_0;
   mutate(z_0);
+  return z_0;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 1 }],
+  sequentialRenders: [{ a: 1 }, { a: 1 }, { a: 2 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) <div>{"fn":{"kind":"Function"},"shouldInvokeFns":true}</div>
+<div>{"fn":{"kind":"Function"},"shouldInvokeFns":true}</div>
+<div>{"fn":{"kind":"Function"},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.js
index 0361ef08bb13e..a0ce67e4d00b6 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-function-shadow-captured.js
@@ -1,8 +1,16 @@
-function component(a) {
+import {mutate, Stringify} from 'shared-runtime';
+function Component({a}) {
   let z = {a};
   let x = function () {
     let z;
     mutate(z);
+    return z;
   };
-  return x;
+  return <Stringify fn={x} shouldInvokeFns={true} />;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 1}],
+  sequentialRenders: [{a: 1}, {a: 1}, {a: 2}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
index 299aa5a31dff2..f5d4b94ae5410 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = 1;
   (function () {
@@ -12,14 +13,22 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a) {
+import { mutate } from "shared-runtime";
+function Component(t0) {
   const $ = _c(2);
+  const { a } = t0;
   let y;
   if ($[0] !== a) {
     const x = { a };
@@ -36,5 +45,15 @@ function component(a) {
   return y;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{ a: 2 }],
+  sequentialRenders: [{ a: 2 }, { a: 2 }, { a: 3 }],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"a":2,"wat0":"joe"}
+{"a":2,"wat0":"joe"}
+{"a":3,"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.js
index 0a454b19b45e7..2b4b1b47ecc31 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/capturing-reference-changes-type.js
@@ -1,4 +1,5 @@
-function component(a) {
+import {mutate} from 'shared-runtime';
+function Component({a}) {
   let x = {a};
   let y = 1;
   (function () {
@@ -7,3 +8,9 @@ function component(a) {
   mutate(y);
   return y;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{a: 2}],
+  sequentialRenders: [{a: 2}, {a: 2}, {a: 3}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.expect.md
index 6d8782f74b50c..9af46bbfd9889 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.expect.md
@@ -2,7 +2,8 @@
 ## Input
 
 ```javascript
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+function useHook({a, b}) {
   let y = {a};
   let x = {b};
   x['y'] = y;
@@ -10,14 +11,26 @@ function component(a, b) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 3, b: 3},
+  ],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
-function component(a, b) {
+import { mutate } from "shared-runtime";
+function useHook(t0) {
   const $ = _c(3);
+  const { a, b } = t0;
   let x;
   if ($[0] !== a || $[1] !== b) {
     const y = { a };
@@ -33,5 +46,19 @@ function component(a, b) {
   return x;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{ a: 2, b: 3 }],
+  sequentialRenders: [
+    { a: 2, b: 3 },
+    { a: 2, b: 3 },
+    { a: 3, b: 3 },
+  ],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {"b":3,"y":{"a":2},"wat0":"joe"}
+{"b":3,"y":{"a":2},"wat0":"joe"}
+{"b":3,"y":{"a":3},"wat0":"joe"}
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.js
index e28a2c0928c04..85d0c398bcffc 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/computed-store-alias.js
@@ -1,7 +1,18 @@
-function component(a, b) {
+import {mutate} from 'shared-runtime';
+function useHook({a, b}) {
   let y = {a};
   let x = {b};
   x['y'] = y;
   mutate(x);
   return x;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: useHook,
+  params: [{a: 2, b: 3}],
+  sequentialRenders: [
+    {a: 2, b: 3},
+    {a: 2, b: 3},
+    {a: 3, b: 3},
+  ],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
index 8822eddcdb69f..503ee6d716813 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.expect.md
@@ -2,27 +2,37 @@
 ## Input
 
 ```javascript
+import {Stringify, identity} from 'shared-runtime';
+
 function Component(props) {
   const x = 42;
   const onEvent = () => {
-    console.log(x);
+    return identity(x);
   };
-  return <Foo onEvent={onEvent} />;
+  return <Stringify onEvent={onEvent} shouldInvokeFns={true} />;
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
+
 ```
 
 ## Code
 
 ```javascript
 import { c as _c } from "react/compiler-runtime";
+import { Stringify, identity } from "shared-runtime";
+
 function Component(props) {
   const $ = _c(1);
 
   const onEvent = _temp;
   let t0;
   if ($[0] === Symbol.for("react.memo_cache_sentinel")) {
-    t0 = <Foo onEvent={onEvent} />;
+    t0 = <Stringify onEvent={onEvent} shouldInvokeFns={true} />;
     $[0] = t0;
   } else {
     t0 = $[0];
@@ -30,8 +40,17 @@ function Component(props) {
   return t0;
 }
 function _temp() {
-  console.log(42);
+  return identity(42);
 }
 
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
+
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) <div>{"onEvent":{"kind":"Function","result":42},"shouldInvokeFns":true}</div>
+<div>{"onEvent":{"kind":"Function","result":42},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.js
index c98bd9b670056..d1df503ad9736 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.js
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/constant-propagation-into-function-expressions.js
@@ -1,7 +1,15 @@
+import {Stringify, identity} from 'shared-runtime';
+
 function Component(props) {
   const x = 42;
   const onEvent = () => {
-    console.log(x);
+    return identity(x);
   };
-  return <Foo onEvent={onEvent} />;
+  return <Stringify onEvent={onEvent} shouldInvokeFns={true} />;
 }
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Component,
+  params: [{}],
+  sequentialRenders: [{}, {}],
+};
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.expect.md
similarity index 95%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.expect.md
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.expect.md
index d6331db4e7ea3..e99e9e1c80226 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.expect.md
@@ -90,4 +90,6 @@ export const FIXTURE_ENTRYPOINT = {
 };
 
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) <div>{"shouldInvokeFns":true,"callback":{"kind":"Function","result":null}}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.tsx
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-invalid-hoisting-functionexpr.tsx
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/hoisting-functionexpr-conditional-dep.tsx
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.expect.md
similarity index 94%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.expect.md
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.expect.md
index fa265ae1f8d74..d9361bee322e3 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.expect.md
@@ -85,4 +85,7 @@ export const FIXTURE_ENTRYPOINT = {
 };
 
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) {}
+[[ (exception in render) TypeError: Cannot read properties of null (reading 'title_text') ]]
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.ts b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.ts
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond.ts
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/edge-case-merge-uncond-optional-chain-and-cond.ts
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.expect.md
similarity index 82%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.expect.md
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.expect.md
index f68c826507207..263dd4d2e78d0 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.expect.md
@@ -70,4 +70,8 @@ export const FIXTURE_ENTRYPOINT = {
 };
 
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) [[ (exception in render) TypeError: Cannot read properties of null (reading 'b') ]]
+<div>{"fn":{"kind":"Function","result":null},"shouldInvokeFns":true}</div>
+<div>{"fn":{"kind":"Function","result":4},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.tsx b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.tsx
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted.tsx
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/reduce-reactive-deps/infer-function-cond-access-not-hoisted.tsx
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.expect.md
similarity index 95%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.expect.md
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.expect.md
index 839821b349a6f..52b359839f220 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.expect.md
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.expect.md
@@ -70,4 +70,9 @@ export const FIXTURE_ENTRYPOINT = {
 };
 
 ```
-      
\ No newline at end of file
+      
+### Eval output
+(kind: ok) ["null"]
+[null]
+[null]
+["null"]
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.ts b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.ts
similarity index 100%
rename from compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/bug-try-catch-maybe-null-dependency.ts
rename to compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/try-catch-maybe-null-dependency.ts
diff --git a/compiler/packages/snap/src/SproutTodoFilter.ts b/compiler/packages/snap/src/SproutTodoFilter.ts
index f363fd922e51a..0817bbf89c582 100644
--- a/compiler/packages/snap/src/SproutTodoFilter.ts
+++ b/compiler/packages/snap/src/SproutTodoFilter.ts
@@ -229,31 +229,15 @@ const skipFilter = new Set([
   'builtin-jsx-tag-lowered-between-mutations',
   'call-args-assignment',
   'call-args-destructuring-assignment',
-  'call-spread',
   'call-with-independently-memoizable-arg',
   'capture-param-mutate',
-  'capturing-fun-alias-captured-mutate-2',
-  'capturing-fun-alias-captured-mutate-arr-2',
-  'capturing-func-alias-captured-mutate-arr',
-  'capturing-func-alias-computed-mutate',
-  'capturing-func-alias-mutate',
-  'capturing-func-alias-receiver-computed-mutate',
-  'capturing-func-alias-receiver-mutate',
-  'capturing-func-simple-alias',
-  'capturing-function-capture-ref-before-rename',
   'capturing-function-conditional-capture-mutate',
   'capturing-function-member-expr-arguments',
   'capturing-function-member-expr-call',
-  'capturing-function-renamed-ref',
-  'capturing-function-runs-inference',
-  'capturing-function-shadow-captured',
-  'capturing-reference-changes-type',
   'codegen-emit-imports-same-source',
   'codegen-emit-make-read-only',
   'computed-call-spread',
   'computed-load-primitive-as-dependency',
-  'computed-store-alias',
-  'constant-propagation-into-function-expressions',
   'destructuring-mixed-scope-declarations-and-locals',
   'destructuring-property-inference',
   'do-while-conditional-break',
@@ -477,23 +461,15 @@ const skipFilter = new Set([
   'invalid-jsx-lowercase-localvar',
 
   // bugs
-  'fbt/bug-fbt-plural-multiple-function-calls',
-  'fbt/bug-fbt-plural-multiple-mixed-call-tag',
-  `bug-capturing-func-maybealias-captured-mutate`,
   'bug-object-expression-computed-key-modified-during-after-construction-hoisted-sequence-expr',
-  'bug-invalid-hoisting-functionexpr',
+  `bug-capturing-func-maybealias-captured-mutate`,
   'bug-aliased-capture-aliased-mutate',
   'bug-aliased-capture-mutate',
   'bug-functiondecl-hoisting',
-  'bug-try-catch-maybe-null-dependency',
-  'bug-invalid-mixedreadonly-map-shape',
   'bug-type-inference-control-flow',
-  'reduce-reactive-deps/bug-infer-function-cond-access-not-hoisted',
+  'fbt/bug-fbt-plural-multiple-function-calls',
+  'fbt/bug-fbt-plural-multiple-mixed-call-tag',
   'bug-invalid-phi-as-dependency',
-  'reduce-reactive-deps/bug-merge-uncond-optional-chain-and-cond',
-  'original-reactive-scopes-fork/bug-nonmutating-capture-in-unsplittable-memo-block',
-  'original-reactive-scopes-fork/bug-hoisted-declaration-with-scope',
-  'bug-codegen-inline-iife',
 
   // 'react-compiler-runtime' not yet supported
   'flag-enable-emit-hook-guards',

From a84862dbdc8dada08a9d1df1c72144cd767704b6 Mon Sep 17 00:00:00 2001
From: lauren <poteto@users.noreply.github.com>
Date: Tue, 18 Feb 2025 16:56:02 -0500
Subject: [PATCH 67/72] [eslint] Target ES5 (#32420)

Update eslint-plugin-react-hooks to be built targetting ES5 instead. For
various reasons our internal infra relies on these files being built
already downleveled.
---
 packages/eslint-plugin-react-hooks/tsconfig.json | 5 +++--
 1 file changed, 3 insertions(+), 2 deletions(-)

diff --git a/packages/eslint-plugin-react-hooks/tsconfig.json b/packages/eslint-plugin-react-hooks/tsconfig.json
index e67b840d3fd7a..068ca0315a7b5 100644
--- a/packages/eslint-plugin-react-hooks/tsconfig.json
+++ b/packages/eslint-plugin-react-hooks/tsconfig.json
@@ -2,12 +2,13 @@
   "extends": "@tsconfig/strictest/tsconfig.json",
   "compilerOptions": {
     "module": "ES2015",
-    "target": "ES2015",
+    "target": "ES5",
     "moduleResolution": "Bundler",
     "lib": ["ES2020"],
     "rootDir": ".",
     "sourceMap": false,
-    "types": ["estree-jsx", "node"]
+    "types": ["estree-jsx", "node"],
+    "downlevelIteration": true
   },
   "exclude": ["node_modules"],
   "include": ["src/**/*.ts"]

From fcb4e0f137db6efa6e180ad12dcfaabd0c590219 Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Wed, 19 Feb 2025 14:22:53 -0700
Subject: [PATCH 68/72] [compiler] remove invariant to account for backedges
 (#32417)

Fixes https://github.com/facebook/react/issues/32269, see comments for
details.

Added test fixture for repro
---
 .../src/Inference/InferReferenceEffects.ts    | 18 ++---
 .../repro-backedge-reference-effect.expect.md | 71 +++++++++++++++++++
 .../repro-backedge-reference-effect.js        | 23 ++++++
 3 files changed, 101 insertions(+), 11 deletions(-)
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.expect.md
 create mode 100644 compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.js

diff --git a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
index 6420e74a2fd20..e6883250705d4 100644
--- a/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
+++ b/compiler/packages/babel-plugin-react-compiler/src/Inference/InferReferenceEffects.ts
@@ -1598,18 +1598,14 @@ function inferBlock(
         break;
       }
       case 'LoadLocal': {
+        /**
+         * Due to backedges in the CFG, we may revisit LoadLocal lvalues
+         * multiple times. Unlike StoreLocal which may reassign to existing
+         * identifiers, LoadLocal always evaluates to store a new temporary.
+         * This means that we should always model LoadLocal as a Capture effect
+         * on the rvalue.
+         */
         const lvalue = instr.lvalue;
-        CompilerError.invariant(
-          !(
-            state.isDefined(lvalue) &&
-            state.kind(lvalue).kind === ValueKind.Context
-          ),
-          {
-            reason:
-              '[InferReferenceEffects] Unexpected LoadLocal with context kind',
-            loc: lvalue.loc,
-          },
-        );
         state.referenceAndRecordEffects(
           freezeActions,
           instrValue.place,
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.expect.md b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.expect.md
new file mode 100644
index 0000000000000..cc33cfc0846ce
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.expect.md
@@ -0,0 +1,71 @@
+
+## Input
+
+```javascript
+import {Stringify} from 'shared-runtime';
+
+function Foo({userIds}) {
+  return (
+    <Stringify
+      fn={() => {
+        const arr = [];
+
+        for (const selectedUser of userIds) {
+          arr.push(selectedUser);
+        }
+        return arr;
+      }}
+      shouldInvokeFns={true}
+    />
+  );
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{userIds: [1, 2, 3]}],
+  sequentialRenders: [{userIds: [1, 2, 4]}],
+};
+
+```
+
+## Code
+
+```javascript
+import { c as _c } from "react/compiler-runtime";
+import { Stringify } from "shared-runtime";
+
+function Foo(t0) {
+  const $ = _c(2);
+  const { userIds } = t0;
+  let t1;
+  if ($[0] !== userIds) {
+    t1 = (
+      <Stringify
+        fn={() => {
+          const arr = [];
+          for (const selectedUser of userIds) {
+            arr.push(selectedUser);
+          }
+          return arr;
+        }}
+        shouldInvokeFns={true}
+      />
+    );
+    $[0] = userIds;
+    $[1] = t1;
+  } else {
+    t1 = $[1];
+  }
+  return t1;
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{ userIds: [1, 2, 3] }],
+  sequentialRenders: [{ userIds: [1, 2, 4] }],
+};
+
+```
+      
+### Eval output
+(kind: ok) <div>{"fn":{"kind":"Function","result":[1,2,4]},"shouldInvokeFns":true}</div>
\ No newline at end of file
diff --git a/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.js b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.js
new file mode 100644
index 0000000000000..03145445ec5b2
--- /dev/null
+++ b/compiler/packages/babel-plugin-react-compiler/src/__tests__/fixtures/compiler/repro-backedge-reference-effect.js
@@ -0,0 +1,23 @@
+import {Stringify} from 'shared-runtime';
+
+function Foo({userIds}) {
+  return (
+    <Stringify
+      fn={() => {
+        const arr = [];
+
+        for (const selectedUser of userIds) {
+          arr.push(selectedUser);
+        }
+        return arr;
+      }}
+      shouldInvokeFns={true}
+    />
+  );
+}
+
+export const FIXTURE_ENTRYPOINT = {
+  fn: Foo,
+  params: [{userIds: [1, 2, 3]}],
+  sequentialRenders: [{userIds: [1, 2, 4]}],
+};

From 5f31228d7d17f5959a99456d89a52d467ee2f329 Mon Sep 17 00:00:00 2001
From: mofeiZ <34200447+mofeiZ@users.noreply.github.com>
Date: Thu, 20 Feb 2025 12:28:34 -0500
Subject: [PATCH 69/72] [compiler][playground] Upgrade to Next 15.2.0-canary.64
 (#32428)

Upgrade compiler playground to use the newest nextjs release, which
includes react compiler transform pipeline optimizations
https://github.com/vercel/next.js/pull/75676/.

Also made a drive-by fix to avoid the error `Cannot update a component
('Router') while rendering a different component ('StoreProvider'). To
locate the bad setState() call inside 'StoreProvider', follow the stack
trace as described in https://react.dev/link/setstate-in-render`. The
bad setState came from `history.replaceState({}, '', \`#${hash}\`);`.

Prior to this, playground ran side effects in a reducer (i.e. during
render). These have now been moved an effect.
---
 .../playground/components/StoreContext.tsx    |  15 +-
 compiler/apps/playground/next-env.d.ts        |   2 +-
 compiler/apps/playground/package.json         |   2 +-
 compiler/apps/playground/yarn.lock            | 129 +++++++++---------
 4 files changed, 76 insertions(+), 72 deletions(-)

diff --git a/compiler/apps/playground/components/StoreContext.tsx b/compiler/apps/playground/components/StoreContext.tsx
index 8529a3c9f84d2..10ad614b05554 100644
--- a/compiler/apps/playground/components/StoreContext.tsx
+++ b/compiler/apps/playground/components/StoreContext.tsx
@@ -6,11 +6,10 @@
  */
 
 import type {Dispatch, ReactNode} from 'react';
-import {useReducer} from 'react';
+import {useEffect, useReducer} from 'react';
 import createContext from '../lib/createContext';
 import {emptyStore} from '../lib/defaultStore';
-import type {Store} from '../lib/stores';
-import {saveStore} from '../lib/stores';
+import {saveStore, type Store} from '../lib/stores';
 
 const StoreContext = createContext<Store>();
 
@@ -31,6 +30,11 @@ export const useStoreDispatch = StoreDispatchContext.useContext;
  */
 export function StoreProvider({children}: {children: ReactNode}): JSX.Element {
   const [store, dispatch] = useReducer(storeReducer, emptyStore);
+  useEffect(() => {
+    if (store !== emptyStore) {
+      saveStore(store);
+    }
+  }, [store]);
 
   return (
     <StoreContext.Provider value={store}>
@@ -59,19 +63,14 @@ function storeReducer(store: Store, action: ReducerAction): Store {
   switch (action.type) {
     case 'setStore': {
       const newStore = action.payload.store;
-
-      saveStore(newStore);
       return newStore;
     }
     case 'updateFile': {
       const {source} = action.payload;
-
       const newStore = {
         ...store,
         source,
       };
-
-      saveStore(newStore);
       return newStore;
     }
   }
diff --git a/compiler/apps/playground/next-env.d.ts b/compiler/apps/playground/next-env.d.ts
index 40c3d68096c27..1b3be0840f3f6 100644
--- a/compiler/apps/playground/next-env.d.ts
+++ b/compiler/apps/playground/next-env.d.ts
@@ -2,4 +2,4 @@
 /// <reference types="next/image-types/global" />
 
 // NOTE: This file should not be edited
-// see https://nextjs.org/docs/app/building-your-application/configuring/typescript for more information.
+// see https://nextjs.org/docs/app/api-reference/config/typescript for more information.
diff --git a/compiler/apps/playground/package.json b/compiler/apps/playground/package.json
index 9b43f18f0e8c4..b8360ae06f5a7 100644
--- a/compiler/apps/playground/package.json
+++ b/compiler/apps/playground/package.json
@@ -34,7 +34,7 @@
     "invariant": "^2.2.4",
     "lz-string": "^1.5.0",
     "monaco-editor": "^0.52.0",
-    "next": "^15.0.1",
+    "next": "^15.2.0-canary.64",
     "notistack": "^3.0.0-alpha.7",
     "prettier": "^3.3.3",
     "pretty-format": "^29.3.1",
diff --git a/compiler/apps/playground/yarn.lock b/compiler/apps/playground/yarn.lock
index dc5362548a7f7..ea0487b01c901 100644
--- a/compiler/apps/playground/yarn.lock
+++ b/compiler/apps/playground/yarn.lock
@@ -589,10 +589,10 @@
   dependencies:
     "@monaco-editor/loader" "^1.4.0"
 
-"@next/env@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/env/-/env-15.0.1.tgz#660fe9303e255cec112d3f4198d2897a24bc60b3"
-  integrity sha512-lc4HeDUKO9gxxlM5G2knTRifqhsY6yYpwuHspBZdboZe0Gp+rZHBNNSIjmQKDJIdRXiXGyVnSD6gafrbQPvILQ==
+"@next/env@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/env/-/env-15.2.0-canary.66.tgz#c4ca0d502ad099c68927643df9c9b5d75c7b7fbb"
+  integrity sha512-/RxW1GJ7a6MJOQ7LOa2bcli7VTjqB7jPyzXwNJQflcYJH4gz1kP6uzg8+IptLJGFSRB58RBKHJk+q1cD8jongA==
 
 "@next/eslint-plugin-next@15.0.1":
   version "15.0.1"
@@ -601,45 +601,45 @@
   dependencies:
     fast-glob "3.3.1"
 
-"@next/swc-darwin-arm64@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-darwin-arm64/-/swc-darwin-arm64-15.0.1.tgz#b80a25f1569bd0ca03eca9473f7e93e64937e404"
-  integrity sha512-C9k/Xv4sxkQRTA37Z6MzNq3Yb1BJMmSqjmwowoWEpbXTkAdfOwnoKOpAb71ItSzoA26yUTIo6ZhN8rKGu4ExQw==
-
-"@next/swc-darwin-x64@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-darwin-x64/-/swc-darwin-x64-15.0.1.tgz#00dcf79ec7c638a85c3b9ff2e2de2bfb09c1c250"
-  integrity sha512-uHl13HXOuq1G7ovWFxCACDJHTSDVbn/sbLv8V1p+7KIvTrYQ5HNoSmKBdYeEKRRCbEmd+OohOgg9YOp8Ux3MBg==
-
-"@next/swc-linux-arm64-gnu@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-15.0.1.tgz#faab5f7ffcc6d1a15e8dea1cb9953966658b39bf"
-  integrity sha512-LvyhvxHOihFTEIbb35KxOc3q8w8G4xAAAH/AQnsYDEnOvwawjL2eawsB59AX02ki6LJdgDaHoTEnC54Gw+82xw==
-
-"@next/swc-linux-arm64-musl@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-15.0.1.tgz#97abada9a782ab5b3cb42cf0d4799cbc2e733351"
-  integrity sha512-vFmCGUFNyk/A5/BYcQNhAQqPIw01RJaK6dRO+ZEhz0DncoW+hJW1kZ8aH2UvTX27zPq3m85zN5waMSbZEmANcQ==
-
-"@next/swc-linux-x64-gnu@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-15.0.1.tgz#548bd47c49fe6d819302139aff8766eb704322e2"
-  integrity sha512-5by7IYq0NCF8rouz6Qg9T97jYU68kaClHPfGpQG2lCZpSYHtSPQF1kjnqBTd34RIqPKMbCa4DqCufirgr8HM5w==
-
-"@next/swc-linux-x64-musl@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-15.0.1.tgz#84423fbd3a058dd6ae8322e530878f0ec7a1027a"
-  integrity sha512-lmYr6H3JyDNBJLzklGXLfbehU3ay78a+b6UmBGlHls4xhDXBNZfgb0aI67sflrX+cGBnv1LgmWzFlYrAYxS1Qw==
-
-"@next/swc-win32-arm64-msvc@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-15.0.1.tgz#723c2ced12a998fb40dc901b8faea9170e788c2f"
-  integrity sha512-DS8wQtl6diAj0eZTdH0sefykm4iXMbHT4MOvLwqZiIkeezKpkgPFcEdFlz3vKvXa2R/2UEgMh48z1nEpNhjeOQ==
-
-"@next/swc-win32-x64-msvc@15.0.1":
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-15.0.1.tgz#ec7e3befc0bcc47527537b1eda2b3745beb15a09"
-  integrity sha512-4Ho2ggvDdMKlZ/0e9HNdZ9ngeaBwtc+2VS5oCeqrbXqOgutX6I4U2X/42VBw0o+M5evn4/7v3zKgGHo+9v/VjA==
+"@next/swc-darwin-arm64@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-darwin-arm64/-/swc-darwin-arm64-15.2.0-canary.66.tgz#368438cf713c439b5b4c44d54b5c3b31ee5b772d"
+  integrity sha512-sVzNJWTekcLOdqkDMistBGr84AVh9eSu4o5JQNEOdxHry4jiF8lqixpOg0+Twj2RRuv4bx32h5xaRVvCSUpITQ==
+
+"@next/swc-darwin-x64@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-darwin-x64/-/swc-darwin-x64-15.2.0-canary.66.tgz#3ddc3f4f6e86e204727770e5984cabf52f852472"
+  integrity sha512-Avv6Nf/0j0WVqY72Q0mK2glGhvN7LT7iVF31iBYUe/Cbf2cXBjgpXUVmksJjg+2Fi6uTEpaMoZWSVEpJyPkjVQ==
+
+"@next/swc-linux-arm64-gnu@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-15.2.0-canary.66.tgz#cd3683bf569c66444340b1e4d876913584e93aea"
+  integrity sha512-kUPejaStjKpF79fz4525DKQKADtUuE+T6j7IvLQsZuWrSX3a5Mix+i52fdTzMJ+sFGg3v147wopZt6L6JMIxxA==
+
+"@next/swc-linux-arm64-musl@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-15.2.0-canary.66.tgz#453836b11efdb50b91cf8a6cfbce8779f6778dd9"
+  integrity sha512-U8l8jaZ+BAU5wn3bw7PRqq4vGTpObBt+7JbJLpbDqB1GfkZdCDc4nGtqAfLy3pY0O4lEfqal9jrsEVtUBCbfHg==
+
+"@next/swc-linux-x64-gnu@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-15.2.0-canary.66.tgz#f02b295febaacf8d041f9f149c30c41aea16a81f"
+  integrity sha512-c+AV8ZN1znGBHu5BACGym+9FhV8+213XVHFI7i2J7TSsJ6T+Eofhwn0tSn1Vy/XpVmpyoEdkwepL+djbdQAGhw==
+
+"@next/swc-linux-x64-musl@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-15.2.0-canary.66.tgz#f942c000ba3ffc0289520d25fa1067a75e72fa41"
+  integrity sha512-4mTIv86qyXuo8NfjigSQ7rk2cDwM8/f8R/kf3hNh8NF1Aaat2RrEet9a/SbsuNpdhhNnPI5RcRwpIJx2JQSPcQ==
+
+"@next/swc-win32-arm64-msvc@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-15.2.0-canary.66.tgz#0ffdcf5c74b5aa6214307f2ae4aa84f1526e6bf9"
+  integrity sha512-NPnfsDQXk44h8VtncWq2AgLjHDbUMsc8Tpz7pcLe9qb8lZSxZ9jYbV7NwKzgd+qJbjy/58vgCWhL5PhyXDlWwQ==
+
+"@next/swc-win32-x64-msvc@15.2.0-canary.66":
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-15.2.0-canary.66.tgz#458245850cf407d2551155e4662785c109f58bda"
+  integrity sha512-L/ef++GJqW+T3g2x6mrZ2vrBK+6QS9Ieam8EqK9dG7cFKv7Gqm9yrHvDuVse62hnNB11ZdxfDDKrs9vabuQLlw==
 
 "@nodelib/fs.scandir@2.1.5":
   version "2.1.5"
@@ -716,12 +716,12 @@
   resolved "https://registry.yarnpkg.com/@swc/counter/-/counter-0.1.3.tgz#cc7463bd02949611c6329596fccd2b0ec782b0e9"
   integrity sha512-e2BR4lsJkkRlKZ/qCHPw9ZaSxc0MVUd7gtbtaB7aMvHeJVYe8sOB8DBZkP2DtISHGSku9sCK6T6cnY0CtXrOCQ==
 
-"@swc/helpers@0.5.13":
-  version "0.5.13"
-  resolved "https://registry.yarnpkg.com/@swc/helpers/-/helpers-0.5.13.tgz#33e63ff3cd0cade557672bd7888a39ce7d115a8c"
-  integrity sha512-UoKGxQ3r5kYI9dALKJapMmuK+1zWM/H17Z1+iwnNmzcJRnfFuevZs375TA5rW31pu4BS4NoSy1fRsexDXfWn5w==
+"@swc/helpers@0.5.15":
+  version "0.5.15"
+  resolved "https://registry.yarnpkg.com/@swc/helpers/-/helpers-0.5.15.tgz#79efab344c5819ecf83a43f3f9f811fc84b516d7"
+  integrity sha512-JQ5TuMi45Owi4/BIMAJBoSQoOJu12oOk/gADqlcUL9JEdHB8vyjUSsxqeNXnmXHjYKMi2WcYtezGEEhqUI/E2g==
   dependencies:
-    tslib "^2.4.0"
+    tslib "^2.8.0"
 
 "@types/json5@^0.0.29":
   version "0.0.29"
@@ -2682,27 +2682,27 @@ natural-compare@^1.4.0:
   resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
   integrity sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==
 
-next@^15.0.1:
-  version "15.0.1"
-  resolved "https://registry.yarnpkg.com/next/-/next-15.0.1.tgz#a0e8eda35d803cb7f8092b2a2eb9d072e22bf21d"
-  integrity sha512-PSkFkr/w7UnFWm+EP8y/QpHrJXMqpZzAXpergB/EqLPOh4SGPJXv1wj4mslr2hUZBAS9pX7/9YLIdxTv6fwytw==
+next@^15.2.0-canary.64:
+  version "15.2.0-canary.66"
+  resolved "https://registry.yarnpkg.com/next/-/next-15.2.0-canary.66.tgz#cb5ee4453c88f247b6e74fe33fd181eca58e7c86"
+  integrity sha512-S+gsEu8vxxejI7nKqtCLqZlTi9L40xelLRK/Fgtvm/XT8W8ziLp3KMtN4I9Si5nEMU5uv7bllIfd04kVX8+HIw==
   dependencies:
-    "@next/env" "15.0.1"
+    "@next/env" "15.2.0-canary.66"
     "@swc/counter" "0.1.3"
-    "@swc/helpers" "0.5.13"
+    "@swc/helpers" "0.5.15"
     busboy "1.6.0"
     caniuse-lite "^1.0.30001579"
     postcss "8.4.31"
     styled-jsx "5.1.6"
   optionalDependencies:
-    "@next/swc-darwin-arm64" "15.0.1"
-    "@next/swc-darwin-x64" "15.0.1"
-    "@next/swc-linux-arm64-gnu" "15.0.1"
-    "@next/swc-linux-arm64-musl" "15.0.1"
-    "@next/swc-linux-x64-gnu" "15.0.1"
-    "@next/swc-linux-x64-musl" "15.0.1"
-    "@next/swc-win32-arm64-msvc" "15.0.1"
-    "@next/swc-win32-x64-msvc" "15.0.1"
+    "@next/swc-darwin-arm64" "15.2.0-canary.66"
+    "@next/swc-darwin-x64" "15.2.0-canary.66"
+    "@next/swc-linux-arm64-gnu" "15.2.0-canary.66"
+    "@next/swc-linux-arm64-musl" "15.2.0-canary.66"
+    "@next/swc-linux-x64-gnu" "15.2.0-canary.66"
+    "@next/swc-linux-x64-musl" "15.2.0-canary.66"
+    "@next/swc-win32-arm64-msvc" "15.2.0-canary.66"
+    "@next/swc-win32-x64-msvc" "15.2.0-canary.66"
     sharp "^0.33.5"
 
 node-releases@^2.0.18:
@@ -3559,6 +3559,11 @@ tslib@^2.1.0, tslib@^2.4.0:
   resolved "https://registry.yarnpkg.com/tslib/-/tslib-2.7.0.tgz#d9b40c5c40ab59e8738f297df3087bf1a2690c01"
   integrity sha512-gLXCKdN1/j47AiHiOkJN69hJmcbGTHI0ImLmbYLHykhgeN0jVGola9yVjFgzCUklsZQMW55o+dW7IXv3RCXDzA==
 
+tslib@^2.8.0:
+  version "2.8.1"
+  resolved "https://registry.yarnpkg.com/tslib/-/tslib-2.8.1.tgz#612efe4ed235d567e8aba5f2a5fab70280ade83f"
+  integrity sha512-oJFu94HQb+KVduSUQL7wnpmqnfmLsOA/nAh6b6EH0wCEoK0/mPeXU6c3wKDV83MkOuHPRHtSXKKU99IBazS/2w==
+
 type-check@^0.4.0, type-check@~0.4.0:
   version "0.4.0"
   resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.4.0.tgz#07b8203bfa7056c0657050e3ccd2c37730bab8f1"

From 885532c124f32436723cd51627d06de6e8c13fdd Mon Sep 17 00:00:00 2001
From: Jack Pope <jackpope1@gmail.com>
Date: Thu, 20 Feb 2025 12:29:01 -0500
Subject: [PATCH 70/72] Revert "Ship enableFabricCompleteRootInCommitPhase
 (#32318)" (#32434)

This reverts commit 8759c5c8d6aef34df576827215ff7ebaeafc79ea /
https://github.com/facebook/react/pull/32318

We discovered that the experiment setup for this was faulty and we need
to re-run as a back test.
---
 .../src/ReactFiberConfigFabric.js                      | 10 ++++++++--
 packages/shared/ReactFeatureFlags.js                   |  5 +++++
 .../forks/ReactFeatureFlags.native-fb-dynamic.js       |  1 +
 packages/shared/forks/ReactFeatureFlags.native-fb.js   |  1 +
 packages/shared/forks/ReactFeatureFlags.native-oss.js  |  1 +
 .../shared/forks/ReactFeatureFlags.test-renderer.js    |  1 +
 .../forks/ReactFeatureFlags.test-renderer.native-fb.js |  1 +
 .../forks/ReactFeatureFlags.test-renderer.www.js       |  1 +
 packages/shared/forks/ReactFeatureFlags.www.js         |  1 +
 9 files changed, 20 insertions(+), 2 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactFiberConfigFabric.js b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
index d28b3400c66c3..6db223e4b4dc5 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigFabric.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigFabric.js
@@ -58,6 +58,7 @@ import {
 } from './ReactNativeFiberInspector';
 
 import {
+  enableFabricCompleteRootInCommitPhase,
   passChildrenWhenCloningPersistedNodes,
   enableLazyPublicInstanceInFabric,
 } from 'shared/ReactFeatureFlags';
@@ -533,14 +534,19 @@ export function finalizeContainerChildren(
   container: Container,
   newChildren: ChildSet,
 ): void {
-  // Noop - children will be finalized in replaceContainerChildren
+  if (!enableFabricCompleteRootInCommitPhase) {
+    completeRoot(container.containerTag, newChildren);
+  }
 }
 
 export function replaceContainerChildren(
   container: Container,
   newChildren: ChildSet,
 ): void {
-  completeRoot(container.containerTag, newChildren);
+  // Noop - children will be replaced in finalizeContainerChildren
+  if (enableFabricCompleteRootInCommitPhase) {
+    completeRoot(container.containerTag, newChildren);
+  }
 }
 
 export {getClosestInstanceFromNode as getInstanceFromNode};
diff --git a/packages/shared/ReactFeatureFlags.js b/packages/shared/ReactFeatureFlags.js
index ea09d0a3c76e3..f1f1a09373664 100644
--- a/packages/shared/ReactFeatureFlags.js
+++ b/packages/shared/ReactFeatureFlags.js
@@ -94,6 +94,11 @@ export const enableViewTransition = __EXPERIMENTAL__;
 
 export const enableSwipeTransition = __EXPERIMENTAL__;
 
+/**
+ * Switches the Fabric API from doing layout in commit work instead of complete work.
+ */
+export const enableFabricCompleteRootInCommitPhase = false;
+
 /**
  * Switches Fiber creation to a simple object instead of a constructor.
  */
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
index d3c5de81bd909..6825b2b608b9b 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb-dynamic.js
@@ -23,6 +23,7 @@ export const enableHiddenSubtreeInsertionEffectCleanup = __VARIANT__;
 export const enablePersistedModeClonedFlag = __VARIANT__;
 export const enableShallowPropDiffing = __VARIANT__;
 export const passChildrenWhenCloningPersistedNodes = __VARIANT__;
+export const enableFabricCompleteRootInCommitPhase = __VARIANT__;
 export const enableSiblingPrerendering = __VARIANT__;
 export const enableUseEffectCRUDOverload = __VARIANT__;
 export const enableFastAddPropertiesInDiffing = __VARIANT__;
diff --git a/packages/shared/forks/ReactFeatureFlags.native-fb.js b/packages/shared/forks/ReactFeatureFlags.native-fb.js
index a0544dc161173..5c3015563d51c 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-fb.js
@@ -20,6 +20,7 @@ const dynamicFlags: DynamicExportsType = (dynamicFlagsUntyped: any);
 // the exports object every time a flag is read.
 export const {
   alwaysThrottleRetries,
+  enableFabricCompleteRootInCommitPhase,
   enableHiddenSubtreeInsertionEffectCleanup,
   enableObjectFiber,
   enablePersistedModeClonedFlag,
diff --git a/packages/shared/forks/ReactFeatureFlags.native-oss.js b/packages/shared/forks/ReactFeatureFlags.native-oss.js
index fd846cf312212..f767b3427b25f 100644
--- a/packages/shared/forks/ReactFeatureFlags.native-oss.js
+++ b/packages/shared/forks/ReactFeatureFlags.native-oss.js
@@ -30,6 +30,7 @@ export const enableAsyncIterableChildren = false;
 export const enableCPUSuspense = false;
 export const enableCreateEventHandleAPI = false;
 export const enableDO_NOT_USE_disableStrictPassiveEffect = false;
+export const enableFabricCompleteRootInCommitPhase = false;
 export const enableMoveBefore = true;
 export const enableFizzExternalRuntime = true;
 export const enableHalt = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
index 5945416050286..181e504ef7e1b 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.js
@@ -36,6 +36,7 @@ export const enableUseEffectEventHook = false;
 export const favorSafetyOverHydrationPerf = true;
 export const enableLegacyFBSupport = false;
 export const enableMoveBefore = false;
+export const enableFabricCompleteRootInCommitPhase = false;
 export const enableHiddenSubtreeInsertionEffectCleanup = false;
 export const enableHydrationLaneScheduling = true;
 
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
index e4f1210c29f00..dcca098b21539 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.native-fb.js
@@ -61,6 +61,7 @@ export const renameElementSymbol = false;
 export const retryLaneExpirationMs = 5000;
 export const syncLaneExpirationMs = 250;
 export const transitionLaneExpirationMs = 5000;
+export const enableFabricCompleteRootInCommitPhase = false;
 export const enableSiblingPrerendering = true;
 export const enableUseEffectCRUDOverload = true;
 export const enableHydrationLaneScheduling = true;
diff --git a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
index 112b30fe04a81..31ac32b253dd4 100644
--- a/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.test-renderer.www.js
@@ -39,6 +39,7 @@ export const favorSafetyOverHydrationPerf = true;
 export const enableLegacyFBSupport = false;
 export const enableMoveBefore = false;
 export const enableRenderableContext = false;
+export const enableFabricCompleteRootInCommitPhase = false;
 export const enableHiddenSubtreeInsertionEffectCleanup = true;
 
 export const enableRetryLaneExpiration = false;
diff --git a/packages/shared/forks/ReactFeatureFlags.www.js b/packages/shared/forks/ReactFeatureFlags.www.js
index ec0337382e957..f3fdc1e4f489e 100644
--- a/packages/shared/forks/ReactFeatureFlags.www.js
+++ b/packages/shared/forks/ReactFeatureFlags.www.js
@@ -50,6 +50,7 @@ export const enableProfilerTimer = __PROFILE__;
 export const enableProfilerCommitHooks = __PROFILE__;
 export const enableProfilerNestedUpdatePhase = __PROFILE__;
 export const enableUpdaterTracking = __PROFILE__;
+export const enableFabricCompleteRootInCommitPhase = false;
 
 export const enableSuspenseAvoidThisFallback = true;
 

From 70f1d766e8ae7ca3701193abb8c8a9f2fdbdaa9d Mon Sep 17 00:00:00 2001
From: Sam Zhou <sam@developersam.com>
Date: Thu, 20 Feb 2025 12:42:33 -0500
Subject: [PATCH 71/72] [flow] Eliminate usage of global React types in
 ReactNativeTypes.js (#32330)

---
 .../react-native-renderer/src/ReactNativeTypes.js   | 13 ++++++++++---
 packages/react/index.js                             |  1 +
 2 files changed, 11 insertions(+), 3 deletions(-)

diff --git a/packages/react-native-renderer/src/ReactNativeTypes.js b/packages/react-native-renderer/src/ReactNativeTypes.js
index 261e1f0b63104..1aa11cb3be0d7 100644
--- a/packages/react-native-renderer/src/ReactNativeTypes.js
+++ b/packages/react-native-renderer/src/ReactNativeTypes.js
@@ -9,7 +9,13 @@
  * @flow strict
  */
 
-import type {ElementRef, ElementType, MixedElement} from 'react';
+import type {
+  Component as ReactComponent,
+  ElementRef,
+  ElementType,
+  MixedElement,
+  RefSetter,
+} from 'react';
 // $FlowFixMe[nonstrict-import] TODO(@rubennorte)
 import {type PublicRootInstance} from 'react-native/Libraries/ReactPrivate/ReactNativePrivateInterface';
 
@@ -135,7 +141,7 @@ declare const ensureNativeMethodsAreSynced: NativeMethods;
 
 export type HostInstance = NativeMethods;
 export type HostComponent<Config: {...}> = component(
-  ref: React$RefSetter<HostInstance>,
+  ref: RefSetter<HostInstance>,
   ...Config
 );
 
@@ -188,7 +194,8 @@ export type RenderRootOptions = {
     errorInfo: {
       +componentStack?: ?string,
       // $FlowFixMe[unclear-type] unknown props and state.
-      +errorBoundary?: ?React$Component<any, any>,
+      // $FlowFixMe[value-as-type] Component in react repo is any-typed, but it will be well typed externally.
+      +errorBoundary?: ?ReactComponent<any, any>,
     },
   ) => void,
   onRecoverableError?: (
diff --git a/packages/react/index.js b/packages/react/index.js
index af4cd4b0c1b17..92e1cf181ec1b 100644
--- a/packages/react/index.js
+++ b/packages/react/index.js
@@ -17,6 +17,7 @@ export type Key = React$Key;
 export type Node = React$Node;
 export type Context<T> = React$Context<T>;
 export type Portal = React$Portal;
+export type RefSetter<-I> = React$RefSetter<I>;
 export type ElementProps<C> = React$ElementProps<C>;
 export type ElementConfig<C> = React$ElementConfig<C>;
 export type ElementRef<C> = React$ElementRef<C>;

From 88479c6fc31ba2902587694338350ae95733d6b2 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Sebastian=20Markb=C3=A5ge?= <sebastian@calyptus.eu>
Date: Thu, 20 Feb 2025 18:13:09 -0500
Subject: [PATCH 72/72] Rerender useSwipeTransition when direction changes
 (#32379)

We can only render one direction at a time with View Transitions. When
the direction changes we need to do another render in the new direction
(returning previous or next).

To determine direction we store the position we started at and anything
moving to a lower value (left/up) is "previous" direction (`false`) and
anything else is "next" (`true`) direction.

For the very first render we won't know which direction you're going
since you're still on the initial position. It's useful to start the
render to allow the view transition to take control before anything
shifts around so we start from the original position. This is not
guaranteed though if the render suspends.

For now we start the first render by guessing the direction such as if
we know that prev/next are the same as current. With the upcoming auto
start mode we can guess more accurately there before we start. We can
also add explicit APIs to `startGesture` but ideally it wouldn't matter.
Ideally we could just start after the first change in direction from the
starting point.
---
 .eslintrc.js                                  |  1 +
 .../view-transition/src/components/Page.js    |  4 +-
 packages/react-art/src/ReactFiberConfigART.js |  9 +++
 .../src/client/ReactFiberConfigDOM.js         | 54 +++++++++++++++
 .../src/ReactFiberConfigNative.js             |  9 +++
 .../src/createReactNoop.js                    |  9 +++
 .../src/ReactFiberConfigWithNoMutation.js     |  2 +
 .../src/ReactFiberGestureScheduler.js         | 37 +++++++++-
 .../react-reconciler/src/ReactFiberHooks.js   | 67 ++++++++++++-------
 .../src/forks/ReactFiberConfig.custom.js      |  3 +
 .../src/ReactFiberConfigTestHost.js           |  9 +++
 packages/shared/ReactTypes.js                 |  2 +-
 scripts/error-codes/codes.json                |  5 +-
 scripts/flow/environment.js                   | 12 ++++
 scripts/rollup/validate/eslintrc.cjs.js       |  2 +
 scripts/rollup/validate/eslintrc.cjs2015.js   |  1 +
 scripts/rollup/validate/eslintrc.esm.js       |  2 +
 scripts/rollup/validate/eslintrc.fb.js        |  2 +
 scripts/rollup/validate/eslintrc.rn.js        |  2 +
 19 files changed, 200 insertions(+), 32 deletions(-)

diff --git a/.eslintrc.js b/.eslintrc.js
index 360bd5ba76a9c..ae108a37e3da1 100644
--- a/.eslintrc.js
+++ b/.eslintrc.js
@@ -614,6 +614,7 @@ module.exports = {
     KeyframeAnimationOptions: 'readonly',
     GetAnimationsOptions: 'readonly',
     Animatable: 'readonly',
+    ScrollTimeline: 'readonly',
 
     spyOnDev: 'readonly',
     spyOnDevAndProd: 'readonly',
diff --git a/fixtures/view-transition/src/components/Page.js b/fixtures/view-transition/src/components/Page.js
index 1c7a9bfeb32db..589d09a79ad7d 100644
--- a/fixtures/view-transition/src/components/Page.js
+++ b/fixtures/view-transition/src/components/Page.js
@@ -68,10 +68,12 @@ export default function Page({url, navigate}) {
       activeGesture.current = null;
       cancelGesture();
     }
+    // Reset scroll
+    swipeRecognizer.current.scrollLeft = !show ? 0 : 10000;
   }
 
   useLayoutEffect(() => {
-    swipeRecognizer.current.scrollLeft = show ? 0 : 10000;
+    swipeRecognizer.current.scrollLeft = !show ? 0 : 10000;
   }, [show]);
 
   const exclamation = (
diff --git a/packages/react-art/src/ReactFiberConfigART.js b/packages/react-art/src/ReactFiberConfigART.js
index 95acc9e541e99..18cc84b18e3c8 100644
--- a/packages/react-art/src/ReactFiberConfigART.js
+++ b/packages/react-art/src/ReactFiberConfigART.js
@@ -508,6 +508,15 @@ export function createViewTransitionInstance(
   return null;
 }
 
+export type GestureTimeline = null;
+
+export function subscribeToGestureDirection(
+  provider: GestureTimeline,
+  directionCallback: (direction: boolean) => void,
+): () => void {
+  throw new Error('useSwipeTransition is not yet supported in react-art.');
+}
+
 export function clearContainer(container) {
   // TODO Implement this
 }
diff --git a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
index e96810122da6e..626231a1fae6a 100644
--- a/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
+++ b/packages/react-dom-bindings/src/client/ReactFiberConfigDOM.js
@@ -1478,6 +1478,60 @@ export function createViewTransitionInstance(
   };
 }
 
+export type GestureTimeline = AnimationTimeline; // TODO: More provider types.
+
+export function subscribeToGestureDirection(
+  provider: GestureTimeline,
+  directionCallback: (direction: boolean) => void,
+): () => void {
+  const time = provider.currentTime;
+  if (time === null) {
+    throw new Error(
+      'Cannot start a gesture with a disconnected AnimationTimeline.',
+    );
+  }
+  const startTime = typeof time === 'number' ? time : time.value;
+  if (
+    typeof ScrollTimeline === 'function' &&
+    provider instanceof ScrollTimeline
+  ) {
+    // For ScrollTimeline we optimize to only update the current time on scroll events.
+    const element = provider.source;
+    const scrollCallback = () => {
+      const newTime = provider.currentTime;
+      if (newTime !== null) {
+        directionCallback(
+          typeof newTime === 'number'
+            ? newTime > startTime
+            : newTime.value > startTime,
+        );
+      }
+    };
+    element.addEventListener('scroll', scrollCallback, false);
+    return () => {
+      element.removeEventListener('scroll', scrollCallback, false);
+    };
+  } else {
+    // For other AnimationTimelines, such as DocumentTimeline, we just update every rAF.
+    // TODO: Optimize ViewTimeline using an IntersectionObserver if it becomes common.
+    const rafCallback = () => {
+      const newTime = provider.currentTime;
+      if (newTime !== null) {
+        directionCallback(
+          typeof newTime === 'number'
+            ? newTime > startTime
+            : newTime.value > startTime,
+        );
+      }
+      callbackID = requestAnimationFrame(rafCallback);
+    };
+    let callbackID = requestAnimationFrame(rafCallback);
+    return () => {
+      cancelAnimationFrame(callbackID);
+    };
+  }
+}
+
 export function clearContainer(container: Container): void {
   const nodeType = container.nodeType;
   if (nodeType === DOCUMENT_NODE) {
diff --git a/packages/react-native-renderer/src/ReactFiberConfigNative.js b/packages/react-native-renderer/src/ReactFiberConfigNative.js
index b565e89e9c524..7929ed7bd87e3 100644
--- a/packages/react-native-renderer/src/ReactFiberConfigNative.js
+++ b/packages/react-native-renderer/src/ReactFiberConfigNative.js
@@ -605,6 +605,15 @@ export function createViewTransitionInstance(
   return null;
 }
 
+export type GestureTimeline = null;
+
+export function subscribeToGestureDirection(
+  provider: GestureTimeline,
+  directionCallback: (direction: boolean) => void,
+): () => void {
+  throw new Error('useSwipeTransition is not yet supported in React Native.');
+}
+
 export function clearContainer(container: Container): void {
   // TODO Implement this for React Native
   // UIManager does not expose a "remove all" type method.
diff --git a/packages/react-noop-renderer/src/createReactNoop.js b/packages/react-noop-renderer/src/createReactNoop.js
index f412f90f6c87f..985c715bd4130 100644
--- a/packages/react-noop-renderer/src/createReactNoop.js
+++ b/packages/react-noop-renderer/src/createReactNoop.js
@@ -95,6 +95,8 @@ export type FormInstance = Instance;
 
 export type ViewTransitionInstance = null | {name: string, ...};
 
+export type GestureTimeline = null;
+
 const NO_CONTEXT = {};
 const UPPERCASE_CONTEXT = {};
 if (__DEV__) {
@@ -794,6 +796,13 @@ function createReactNoop(reconciler: Function, useMutation: boolean) {
           return null;
         },
 
+        subscribeToGestureDirection(
+          provider: GestureTimeline,
+          directionCallback: (direction: boolean) => void,
+        ): () => void {
+          return () => {};
+        },
+
         resetTextContent(instance: Instance): void {
           instance.text = null;
         },
diff --git a/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js b/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
index 5e54757807cd8..26231df8bfe52 100644
--- a/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
+++ b/packages/react-reconciler/src/ReactFiberConfigWithNoMutation.js
@@ -48,3 +48,5 @@ export const hasInstanceAffectedParent = shim;
 export const startViewTransition = shim;
 export type ViewTransitionInstance = null | {name: string, ...};
 export const createViewTransitionInstance = shim;
+export type GestureTimeline = any;
+export const subscribeToGestureDirection = shim;
diff --git a/packages/react-reconciler/src/ReactFiberGestureScheduler.js b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
index 7664316b67558..acbc6ab765850 100644
--- a/packages/react-reconciler/src/ReactFiberGestureScheduler.js
+++ b/packages/react-reconciler/src/ReactFiberGestureScheduler.js
@@ -8,22 +8,26 @@
  */
 
 import type {FiberRoot} from './ReactInternalTypes';
-import type {GestureProvider} from 'shared/ReactTypes';
+import type {GestureTimeline} from './ReactFiberConfig';
 
 import {GestureLane} from './ReactFiberLane';
 import {ensureRootIsScheduled} from './ReactFiberRootScheduler';
+import {subscribeToGestureDirection} from './ReactFiberConfig';
 
 // This type keeps track of any scheduled or active gestures.
 export type ScheduledGesture = {
-  provider: GestureProvider,
+  provider: GestureTimeline,
   count: number, // The number of times this same provider has been started.
+  direction: boolean, // false = previous, true = next
+  cancel: () => void, // Cancel the subscription to direction change.
   prev: null | ScheduledGesture, // The previous scheduled gesture in the queue for this root.
   next: null | ScheduledGesture, // The next scheduled gesture in the queue for this root.
 };
 
 export function scheduleGesture(
   root: FiberRoot,
-  provider: GestureProvider,
+  provider: GestureTimeline,
+  initialDirection: boolean,
 ): ScheduledGesture {
   let prev = root.gestures;
   while (prev !== null) {
@@ -39,9 +43,32 @@ export function scheduleGesture(
     prev = next;
   }
   // Add new instance to the end of the queue.
+  const cancel = subscribeToGestureDirection(provider, (direction: boolean) => {
+    if (gesture.direction !== direction) {
+      gesture.direction = direction;
+      if (gesture.prev === null && root.gestures !== gesture) {
+        // This gesture is not in the schedule, meaning it was already rendered.
+        // We need to rerender in the new direction. Insert it into the first slot
+        // in case other gestures are queued after the on-going one.
+        const existing = root.gestures;
+        gesture.next = existing;
+        if (existing !== null) {
+          existing.prev = gesture;
+        }
+        root.gestures = gesture;
+        // Schedule the lane on the root. The Fibers will already be marked as
+        // long as the gesture is active on that Hook.
+        root.pendingLanes |= GestureLane;
+        ensureRootIsScheduled(root);
+      }
+      // TODO: If we're currently rendering this gesture, we need to restart it.
+    }
+  });
   const gesture: ScheduledGesture = {
     provider: provider,
     count: 1,
+    direction: initialDirection,
+    cancel: cancel,
     prev: prev,
     next: null,
   };
@@ -60,8 +87,12 @@ export function cancelScheduledGesture(
 ): void {
   gesture.count--;
   if (gesture.count === 0) {
+    const cancelDirectionSubscription = gesture.cancel;
+    cancelDirectionSubscription();
     // Delete the scheduled gesture from the queue.
     deleteScheduledGesture(root, gesture);
+    // TODO: If we're currently rendering this gesture, we need to restart the render
+    // on a different gesture or cancel the render..
   }
 }
 
diff --git a/packages/react-reconciler/src/ReactFiberHooks.js b/packages/react-reconciler/src/ReactFiberHooks.js
index 06e00441c3b8e..16ceb167683b4 100644
--- a/packages/react-reconciler/src/ReactFiberHooks.js
+++ b/packages/react-reconciler/src/ReactFiberHooks.js
@@ -27,7 +27,7 @@ import type {
 import type {Lanes, Lane} from './ReactFiberLane';
 import type {HookFlags} from './ReactHookEffectTags';
 import type {Flags} from './ReactFiberFlags';
-import type {TransitionStatus} from './ReactFiberConfig';
+import type {TransitionStatus, GestureTimeline} from './ReactFiberConfig';
 import type {ScheduledGesture} from './ReactFiberGestureScheduler';
 
 import {
@@ -3981,6 +3981,7 @@ type SwipeTransitionGestureUpdate = {
 type SwipeTransitionUpdateQueue = {
   pending: null | SwipeTransitionGestureUpdate,
   dispatch: StartGesture,
+  initialDirection: boolean,
 };
 
 function startGesture(
@@ -3996,9 +3997,14 @@ function startGesture(
       // Noop.
     };
   }
-  const scheduledGesture = scheduleGesture(root, gestureProvider);
+  const gestureTimeline: GestureTimeline = gestureProvider;
+  const scheduledGesture = scheduleGesture(
+    root,
+    gestureTimeline,
+    queue.initialDirection,
+  );
   // Add this particular instance to the queue.
-  // We add multiple of the same provider even if they get batched so
+  // We add multiple of the same timeline even if they get batched so
   // that if we cancel one but not the other we can keep track of this.
   // Order doesn't matter but we insert in the beginning to avoid two fields.
   const update: SwipeTransitionGestureUpdate = {
@@ -4041,6 +4047,7 @@ function mountSwipeTransition<T>(
   const queue: SwipeTransitionUpdateQueue = {
     pending: null,
     dispatch: (null: any),
+    initialDirection: previous === current,
   };
   const startGestureOnHook: StartGesture = (queue.dispatch = (startGesture.bind(
     null,
@@ -4062,31 +4069,34 @@ function updateSwipeTransition<T>(
   const startGestureOnHook: StartGesture = queue.dispatch;
   const rootRenderLanes = getWorkInProgressRootRenderLanes();
   let value = current;
-  if (isGestureRender(rootRenderLanes)) {
-    // We're inside a gesture render. We'll traverse the queue to see if
-    // this specific Hook is part of this gesture and, if so, which
-    // direction to render.
-    const root: FiberRoot | null = getWorkInProgressRoot();
-    if (root === null) {
-      throw new Error(
-        'Expected a work-in-progress root. This is a bug in React. Please file an issue.',
-      );
-    }
-    // We assume that the currently rendering gesture is the one first in the queue.
-    const rootRenderGesture = root.gestures;
-    let update = queue.pending;
-    while (update !== null) {
-      if (rootRenderGesture === update.gesture) {
-        // We had a match, meaning we're currently rendering a direction of this
-        // hook for this gesture.
-        // TODO: Determine which direction this gesture is currently rendering.
-        value = previous;
-        break;
+  if (queue.pending !== null) {
+    if (isGestureRender(rootRenderLanes)) {
+      // We're inside a gesture render. We'll traverse the queue to see if
+      // this specific Hook is part of this gesture and, if so, which
+      // direction to render.
+      const root: FiberRoot | null = getWorkInProgressRoot();
+      if (root === null) {
+        throw new Error(
+          'Expected a work-in-progress root. This is a bug in React. Please file an issue.',
+        );
       }
-      update = update.next;
+      // We assume that the currently rendering gesture is the one first in the queue.
+      const rootRenderGesture = root.gestures;
+      if (rootRenderGesture !== null) {
+        let update = queue.pending;
+        while (update !== null) {
+          if (rootRenderGesture === update.gesture) {
+            // We had a match, meaning we're currently rendering a direction of this
+            // hook for this gesture.
+            value = rootRenderGesture.direction ? next : previous;
+            break;
+          }
+          update = update.next;
+        }
+      }
+      // This lane cannot be cleared as long as we have active gestures.
+      markWorkInProgressReceivedUpdate();
     }
-  }
-  if (queue.pending !== null) {
     // As long as there are any active gestures we need to leave the lane on
     // in case we need to render it later. Since a gesture render doesn't commit
     // the only time it really fully gets cleared is if something else rerenders
@@ -4096,6 +4106,11 @@ function updateSwipeTransition<T>(
       GestureLane,
     );
   }
+  // By default, we don't know which direction we should start until a movement
+  // has happened. However, if one direction has the same value as current we
+  // know that it's probably not that direction since it won't do anything anyway.
+  // TODO: Add an explicit option to provide this.
+  queue.initialDirection = previous === current;
   return [value, startGestureOnHook];
 }
 
diff --git a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
index ee5f40ad829ad..3a5cccc6d3695 100644
--- a/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
+++ b/packages/react-reconciler/src/forks/ReactFiberConfig.custom.js
@@ -43,6 +43,7 @@ export opaque type FormInstance = mixed;
 export type ViewTransitionInstance = null | {name: string, ...};
 export opaque type InstanceMeasurement = mixed;
 export type EventResponder = any;
+export type GestureTimeline = any;
 
 export const rendererVersion = $$$config.rendererVersion;
 export const rendererPackageName = $$$config.rendererPackageName;
@@ -144,6 +145,8 @@ export const wasInstanceInViewport = $$$config.wasInstanceInViewport;
 export const hasInstanceChanged = $$$config.hasInstanceChanged;
 export const hasInstanceAffectedParent = $$$config.hasInstanceAffectedParent;
 export const startViewTransition = $$$config.startViewTransition;
+export const subscribeToGestureDirection =
+  $$$config.subscribeToGestureDirection;
 export const createViewTransitionInstance =
   $$$config.createViewTransitionInstance;
 export const clearContainer = $$$config.clearContainer;
diff --git a/packages/react-test-renderer/src/ReactFiberConfigTestHost.js b/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
index aa8b34523b3b4..922155f35b8f3 100644
--- a/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
+++ b/packages/react-test-renderer/src/ReactFiberConfigTestHost.js
@@ -391,6 +391,15 @@ export function getInstanceFromNode(mockNode: Object): Object | null {
   return null;
 }
 
+export type GestureTimeline = null;
+
+export function subscribeToGestureDirection(
+  provider: GestureTimeline,
+  directionCallback: (direction: boolean) => void,
+): () => void {
+  return () => {};
+}
+
 export function beforeActiveInstanceBlur(internalInstanceHandle: Object) {
   // noop
 }
diff --git a/packages/shared/ReactTypes.js b/packages/shared/ReactTypes.js
index 0402f9aac1832..fbf4e9b06fce9 100644
--- a/packages/shared/ReactTypes.js
+++ b/packages/shared/ReactTypes.js
@@ -170,7 +170,7 @@ export type ReactFormState<S, ReferenceId> = [
 
 // Intrinsic GestureProvider. This type varies by Environment whether a particular
 // renderer supports it.
-export type GestureProvider = AnimationTimeline; // TODO: More provider types.
+export type GestureProvider = any;
 
 export type StartGesture = (gestureProvider: GestureProvider) => () => void;
 
diff --git a/scripts/error-codes/codes.json b/scripts/error-codes/codes.json
index f001b660bd2aa..a55d7505cebf9 100644
--- a/scripts/error-codes/codes.json
+++ b/scripts/error-codes/codes.json
@@ -533,5 +533,8 @@
   "545": "The %s tag may only be rendered once.",
   "546": "useEffect CRUD overload is not enabled in this build of React.",
   "547": "startGesture cannot be called during server rendering.",
-  "548": "Finished rendering the gesture lane but there were no pending gestures. React should not have started a render in this case. This is a bug in React."
+  "548": "Finished rendering the gesture lane but there were no pending gestures. React should not have started a render in this case. This is a bug in React.",
+  "549": "Cannot start a gesture with a disconnected AnimationTimeline.",
+  "550": "useSwipeTransition is not yet supported in react-art.",
+  "551": "useSwipeTransition is not yet supported in React Native."
 }
diff --git a/scripts/flow/environment.js b/scripts/flow/environment.js
index a083223ba1b5e..96784a8353383 100644
--- a/scripts/flow/environment.js
+++ b/scripts/flow/environment.js
@@ -33,6 +33,18 @@ declare interface ConsoleTask {
   run<T>(f: () => T): T;
 }
 
+type ScrollTimelineOptions = {
+  source: Element,
+  axis?: 'block' | 'inline' | 'x' | 'y',
+  ...
+};
+
+declare class ScrollTimeline extends AnimationTimeline {
+  constructor(options?: ScrollTimelineOptions): void;
+  axis: 'block' | 'inline' | 'x' | 'y';
+  source: Element;
+}
+
 // Flow hides the props of React$Element, this overrides it to unhide
 // them for React internals.
 // prettier-ignore
diff --git a/scripts/rollup/validate/eslintrc.cjs.js b/scripts/rollup/validate/eslintrc.cjs.js
index b974ecee0d903..88d17772d7b21 100644
--- a/scripts/rollup/validate/eslintrc.cjs.js
+++ b/scripts/rollup/validate/eslintrc.cjs.js
@@ -34,6 +34,8 @@ module.exports = {
 
     FinalizationRegistry: 'readonly',
 
+    ScrollTimeline: 'readonly',
+
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',
diff --git a/scripts/rollup/validate/eslintrc.cjs2015.js b/scripts/rollup/validate/eslintrc.cjs2015.js
index 6efc8838f0326..8e87c8dbe0203 100644
--- a/scripts/rollup/validate/eslintrc.cjs2015.js
+++ b/scripts/rollup/validate/eslintrc.cjs2015.js
@@ -32,6 +32,7 @@ module.exports = {
     Reflect: 'readonly',
     globalThis: 'readonly',
     FinalizationRegistry: 'readonly',
+    ScrollTimeline: 'readonly',
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',
diff --git a/scripts/rollup/validate/eslintrc.esm.js b/scripts/rollup/validate/eslintrc.esm.js
index 20b5341a82ad8..8b4bba35796fa 100644
--- a/scripts/rollup/validate/eslintrc.esm.js
+++ b/scripts/rollup/validate/eslintrc.esm.js
@@ -34,6 +34,8 @@ module.exports = {
 
     FinalizationRegistry: 'readonly',
 
+    ScrollTimeline: 'readonly',
+
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',
diff --git a/scripts/rollup/validate/eslintrc.fb.js b/scripts/rollup/validate/eslintrc.fb.js
index 9606d00b353ac..f0602e79e5074 100644
--- a/scripts/rollup/validate/eslintrc.fb.js
+++ b/scripts/rollup/validate/eslintrc.fb.js
@@ -34,6 +34,8 @@ module.exports = {
 
     FinalizationRegistry: 'readonly',
 
+    ScrollTimeline: 'readonly',
+
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',
diff --git a/scripts/rollup/validate/eslintrc.rn.js b/scripts/rollup/validate/eslintrc.rn.js
index 941b1d1872efd..052edabdc0f92 100644
--- a/scripts/rollup/validate/eslintrc.rn.js
+++ b/scripts/rollup/validate/eslintrc.rn.js
@@ -34,6 +34,8 @@ module.exports = {
 
     FinalizationRegistry: 'readonly',
 
+    ScrollTimeline: 'readonly',
+
     // Vendor specific
     MSApp: 'readonly',
     __REACT_DEVTOOLS_GLOBAL_HOOK__: 'readonly',