From 2f5436f7a4b815278dc56e252afe4faf946e84b6 Mon Sep 17 00:00:00 2001 From: Francisco Madeira Date: Wed, 20 Sep 2017 12:25:37 +0100 Subject: [PATCH 1/6] add pathNames and queryKey methods. --- index.js | 29 + node_modules/.bin/_mocha | 1 + node_modules/.bin/jade | 1 + node_modules/.bin/mocha | 1 + node_modules/.yarn-integrity | 35 + node_modules/better-assert/.npmignore | 4 + node_modules/better-assert/History.md | 15 + node_modules/better-assert/Makefile | 5 + node_modules/better-assert/Readme.md | 61 + node_modules/better-assert/example.js | 10 + node_modules/better-assert/index.js | 38 + node_modules/better-assert/package.json | 27 + node_modules/callsite/.npmignore | 4 + node_modules/callsite/History.md | 10 + node_modules/callsite/Makefile | 6 + node_modules/callsite/Readme.md | 44 + node_modules/callsite/index.js | 10 + node_modules/callsite/package.json | 11 + node_modules/commander/History.md | 179 + node_modules/commander/Readme.md | 195 + node_modules/commander/index.js | 847 +++ node_modules/commander/package.json | 12 + node_modules/debug/.coveralls.yml | 1 + node_modules/debug/.eslintrc | 14 + node_modules/debug/.npmignore | 9 + node_modules/debug/.travis.yml | 20 + node_modules/debug/CHANGELOG.md | 378 ++ node_modules/debug/LICENSE | 19 + node_modules/debug/Makefile | 58 + node_modules/debug/README.md | 367 ++ node_modules/debug/component.json | 19 + node_modules/debug/karma.conf.js | 70 + node_modules/debug/node.js | 1 + node_modules/debug/package.json | 49 + node_modules/debug/src/browser.js | 195 + node_modules/debug/src/debug.js | 225 + node_modules/debug/src/index.js | 10 + node_modules/debug/src/node.js | 177 + node_modules/diff/README.md | 101 + node_modules/diff/diff.js | 354 + node_modules/diff/package.json | 42 + node_modules/expect.js/.npmignore | 3 + node_modules/expect.js/History.md | 54 + node_modules/expect.js/README.md | 263 + node_modules/expect.js/index.js | 1284 ++++ node_modules/expect.js/package.json | 13 + node_modules/glob/.npmignore | 2 + node_modules/glob/.travis.yml | 3 + node_modules/glob/LICENSE | 27 + node_modules/glob/README.md | 250 + node_modules/glob/examples/g.js | 9 + node_modules/glob/examples/usr-local.js | 9 + node_modules/glob/glob.js | 675 ++ node_modules/glob/package.json | 28 + node_modules/glob/test/00-setup.js | 176 + node_modules/glob/test/bash-comparison.js | 63 + node_modules/glob/test/bash-results.json | 350 + node_modules/glob/test/cwd-test.js | 55 + node_modules/glob/test/globstar-match.js | 19 + node_modules/glob/test/mark.js | 74 + node_modules/glob/test/nocase-nomagic.js | 113 + node_modules/glob/test/pause-resume.js | 73 + node_modules/glob/test/root-nomount.js | 39 + node_modules/glob/test/root.js | 46 + node_modules/glob/test/stat.js | 32 + node_modules/glob/test/zz-cleanup.js | 11 + node_modules/graceful-fs/.npmignore | 1 + node_modules/graceful-fs/LICENSE | 27 + node_modules/graceful-fs/README.md | 26 + node_modules/graceful-fs/graceful-fs.js | 160 + node_modules/graceful-fs/package.json | 37 + node_modules/graceful-fs/polyfills.js | 228 + node_modules/graceful-fs/test/open.js | 39 + node_modules/graceful-fs/test/readdir-sort.js | 21 + node_modules/growl/History.md | 63 + node_modules/growl/Readme.md | 99 + node_modules/growl/lib/growl.js | 234 + node_modules/growl/package.json | 7 + node_modules/growl/test.js | 20 + node_modules/inherits/LICENSE | 16 + node_modules/inherits/README.md | 42 + node_modules/inherits/inherits.js | 7 + node_modules/inherits/inherits_browser.js | 23 + node_modules/inherits/package.json | 29 + node_modules/jade/.npmignore | 15 + node_modules/jade/LICENSE | 22 + node_modules/jade/bin/jade | 147 + node_modules/jade/index.js | 4 + node_modules/jade/jade.js | 3586 ++++++++++ node_modules/jade/jade.md | 510 ++ node_modules/jade/jade.min.js | 2 + node_modules/jade/lib/compiler.js | 642 ++ node_modules/jade/lib/doctypes.js | 18 + node_modules/jade/lib/filters.js | 97 + node_modules/jade/lib/inline-tags.js | 28 + node_modules/jade/lib/jade.js | 237 + node_modules/jade/lib/lexer.js | 771 +++ node_modules/jade/lib/nodes/attrs.js | 77 + node_modules/jade/lib/nodes/block-comment.js | 33 + node_modules/jade/lib/nodes/block.js | 121 + node_modules/jade/lib/nodes/case.js | 43 + node_modules/jade/lib/nodes/code.js | 35 + node_modules/jade/lib/nodes/comment.js | 32 + node_modules/jade/lib/nodes/doctype.js | 29 + node_modules/jade/lib/nodes/each.js | 35 + node_modules/jade/lib/nodes/filter.js | 35 + node_modules/jade/lib/nodes/index.js | 20 + node_modules/jade/lib/nodes/literal.js | 32 + node_modules/jade/lib/nodes/mixin.js | 36 + node_modules/jade/lib/nodes/node.js | 25 + node_modules/jade/lib/nodes/tag.js | 95 + node_modules/jade/lib/nodes/text.js | 36 + node_modules/jade/lib/parser.js | 710 ++ node_modules/jade/lib/runtime.js | 174 + node_modules/jade/lib/self-closing.js | 19 + node_modules/jade/lib/utils.js | 49 + .../jade/node_modules/commander/.npmignore | 4 + .../jade/node_modules/commander/.travis.yml | 4 + .../jade/node_modules/commander/History.md | 107 + .../jade/node_modules/commander/Makefile | 7 + .../jade/node_modules/commander/Readme.md | 262 + .../jade/node_modules/commander/index.js | 2 + .../node_modules/commander/lib/commander.js | 1026 +++ .../jade/node_modules/commander/package.json | 13 + .../jade/node_modules/mkdirp/.gitignore | 2 + .../jade/node_modules/mkdirp/.gitignore.orig | 2 + .../jade/node_modules/mkdirp/.gitignore.rej | 5 + node_modules/jade/node_modules/mkdirp/LICENSE | 21 + .../jade/node_modules/mkdirp/README.markdown | 54 + .../jade/node_modules/mkdirp/examples/pow.js | 6 + .../node_modules/mkdirp/examples/pow.js.orig | 6 + .../node_modules/mkdirp/examples/pow.js.rej | 19 + .../jade/node_modules/mkdirp/index.js | 79 + .../jade/node_modules/mkdirp/package.json | 23 + .../jade/node_modules/mkdirp/test/chmod.js | 38 + .../jade/node_modules/mkdirp/test/clobber.js | 37 + .../jade/node_modules/mkdirp/test/mkdirp.js | 28 + .../jade/node_modules/mkdirp/test/perm.js | 32 + .../node_modules/mkdirp/test/perm_sync.js | 39 + .../jade/node_modules/mkdirp/test/race.js | 41 + .../jade/node_modules/mkdirp/test/rel.js | 32 + .../jade/node_modules/mkdirp/test/sync.js | 27 + .../jade/node_modules/mkdirp/test/umask.js | 28 + .../node_modules/mkdirp/test/umask_sync.js | 27 + node_modules/jade/package.json | 29 + node_modules/jade/runtime.js | 179 + node_modules/jade/runtime.min.js | 1 + node_modules/jade/test.jade | 7 + node_modules/jade/testing/head.jade | 5 + node_modules/jade/testing/index.jade | 22 + node_modules/jade/testing/index.js | 11 + node_modules/jade/testing/layout.jade | 6 + node_modules/jade/testing/user.jade | 7 + node_modules/jade/testing/user.js | 27 + node_modules/lru-cache/.npmignore | 1 + node_modules/lru-cache/.travis.yml | 8 + node_modules/lru-cache/CONTRIBUTORS | 14 + node_modules/lru-cache/LICENSE | 15 + node_modules/lru-cache/README.md | 137 + node_modules/lru-cache/lib/lru-cache.js | 334 + node_modules/lru-cache/package.json | 21 + node_modules/lru-cache/test/basic.js | 396 ++ node_modules/lru-cache/test/foreach.js | 120 + node_modules/lru-cache/test/memory-leak.js | 51 + node_modules/lru-cache/test/serialize.js | 216 + node_modules/minimatch/.npmignore | 1 + node_modules/minimatch/LICENSE | 23 + node_modules/minimatch/README.md | 218 + node_modules/minimatch/minimatch.js | 1055 +++ node_modules/minimatch/package.json | 28 + node_modules/minimatch/test/basic.js | 399 ++ node_modules/minimatch/test/brace-expand.js | 33 + node_modules/minimatch/test/caching.js | 14 + node_modules/minimatch/test/defaults.js | 274 + .../test/extglob-ending-with-state-char.js | 8 + node_modules/mkdirp/.npmignore | 2 + node_modules/mkdirp/.travis.yml | 5 + node_modules/mkdirp/LICENSE | 21 + node_modules/mkdirp/examples/pow.js | 6 + node_modules/mkdirp/index.js | 82 + node_modules/mkdirp/package.json | 22 + node_modules/mkdirp/readme.markdown | 63 + node_modules/mkdirp/test/chmod.js | 38 + node_modules/mkdirp/test/clobber.js | 37 + node_modules/mkdirp/test/mkdirp.js | 28 + node_modules/mkdirp/test/perm.js | 32 + node_modules/mkdirp/test/perm_sync.js | 39 + node_modules/mkdirp/test/race.js | 41 + node_modules/mkdirp/test/rel.js | 32 + node_modules/mkdirp/test/return.js | 25 + node_modules/mkdirp/test/return_sync.js | 24 + node_modules/mkdirp/test/root.js | 18 + node_modules/mkdirp/test/sync.js | 32 + node_modules/mkdirp/test/umask.js | 28 + node_modules/mkdirp/test/umask_sync.js | 32 + node_modules/mocha/Readme.md | 172 + node_modules/mocha/bin/_mocha | 467 ++ node_modules/mocha/bin/mocha | 51 + node_modules/mocha/images/error.png | Bin 0 -> 412 bytes node_modules/mocha/images/ok.png | Bin 0 -> 388 bytes node_modules/mocha/index.js | 4 + node_modules/mocha/lib/browser/debug.js | 5 + node_modules/mocha/lib/browser/diff.js | 354 + node_modules/mocha/lib/browser/events.js | 178 + node_modules/mocha/lib/browser/fs.js | 0 node_modules/mocha/lib/browser/path.js | 0 node_modules/mocha/lib/browser/progress.js | 125 + node_modules/mocha/lib/browser/tty.js | 13 + node_modules/mocha/lib/context.js | 69 + node_modules/mocha/lib/hook.js | 49 + node_modules/mocha/lib/interfaces/bdd.js | 137 + node_modules/mocha/lib/interfaces/exports.js | 60 + node_modules/mocha/lib/interfaces/index.js | 5 + node_modules/mocha/lib/interfaces/qunit.js | 122 + node_modules/mocha/lib/interfaces/tdd.js | 138 + node_modules/mocha/lib/mocha.js | 369 ++ node_modules/mocha/lib/ms.js | 109 + node_modules/mocha/lib/reporters/base.js | 507 ++ node_modules/mocha/lib/reporters/doc.js | 56 + node_modules/mocha/lib/reporters/dot.js | 62 + node_modules/mocha/lib/reporters/html-cov.js | 51 + node_modules/mocha/lib/reporters/html.js | 274 + node_modules/mocha/lib/reporters/index.js | 18 + node_modules/mocha/lib/reporters/json-cov.js | 153 + .../mocha/lib/reporters/json-stream.js | 61 + node_modules/mocha/lib/reporters/json.js | 70 + node_modules/mocha/lib/reporters/landing.js | 97 + node_modules/mocha/lib/reporters/list.js | 64 + node_modules/mocha/lib/reporters/markdown.js | 91 + node_modules/mocha/lib/reporters/min.js | 38 + node_modules/mocha/lib/reporters/nyan.js | 260 + node_modules/mocha/lib/reporters/progress.js | 86 + node_modules/mocha/lib/reporters/spec.js | 83 + node_modules/mocha/lib/reporters/tap.js | 73 + .../lib/reporters/templates/coverage.jade | 50 + .../mocha/lib/reporters/templates/menu.jade | 13 + .../mocha/lib/reporters/templates/script.html | 34 + .../mocha/lib/reporters/templates/style.html | 320 + node_modules/mocha/lib/reporters/xunit.js | 119 + node_modules/mocha/lib/runnable.js | 227 + node_modules/mocha/lib/runner.js | 661 ++ node_modules/mocha/lib/suite.js | 296 + node_modules/mocha/lib/template.html | 18 + node_modules/mocha/lib/test.js | 32 + node_modules/mocha/lib/utils.js | 299 + node_modules/mocha/mocha.css | 270 + node_modules/mocha/mocha.js | 5812 +++++++++++++++++ node_modules/mocha/node_modules/.bin/jade | 1 + node_modules/mocha/package.json | 49 + node_modules/ms/index.js | 152 + node_modules/ms/license.md | 21 + node_modules/ms/package.json | 37 + node_modules/ms/readme.md | 51 + node_modules/sigmund/LICENSE | 15 + node_modules/sigmund/README.md | 53 + node_modules/sigmund/bench.js | 283 + node_modules/sigmund/package.json | 30 + node_modules/sigmund/sigmund.js | 39 + node_modules/sigmund/test/basic.js | 24 + package.json | 7 +- test.js | 3 + yarn.lock | 101 + 262 files changed, 35842 insertions(+), 3 deletions(-) create mode 120000 node_modules/.bin/_mocha create mode 120000 node_modules/.bin/jade create mode 120000 node_modules/.bin/mocha create mode 100644 node_modules/.yarn-integrity create mode 100644 node_modules/better-assert/.npmignore create mode 100644 node_modules/better-assert/History.md create mode 100644 node_modules/better-assert/Makefile create mode 100644 node_modules/better-assert/Readme.md create mode 100644 node_modules/better-assert/example.js create mode 100644 node_modules/better-assert/index.js create mode 100644 node_modules/better-assert/package.json create mode 100644 node_modules/callsite/.npmignore create mode 100644 node_modules/callsite/History.md create mode 100644 node_modules/callsite/Makefile create mode 100644 node_modules/callsite/Readme.md create mode 100644 node_modules/callsite/index.js create mode 100644 node_modules/callsite/package.json create mode 100644 node_modules/commander/History.md create mode 100644 node_modules/commander/Readme.md create mode 100644 node_modules/commander/index.js create mode 100644 node_modules/commander/package.json create mode 100644 node_modules/debug/.coveralls.yml create mode 100644 node_modules/debug/.eslintrc create mode 100644 node_modules/debug/.npmignore create mode 100644 node_modules/debug/.travis.yml create mode 100644 node_modules/debug/CHANGELOG.md create mode 100644 node_modules/debug/LICENSE create mode 100644 node_modules/debug/Makefile create mode 100644 node_modules/debug/README.md create mode 100644 node_modules/debug/component.json create mode 100644 node_modules/debug/karma.conf.js create mode 100644 node_modules/debug/node.js create mode 100644 node_modules/debug/package.json create mode 100644 node_modules/debug/src/browser.js create mode 100644 node_modules/debug/src/debug.js create mode 100644 node_modules/debug/src/index.js create mode 100644 node_modules/debug/src/node.js create mode 100644 node_modules/diff/README.md create mode 100644 node_modules/diff/diff.js create mode 100644 node_modules/diff/package.json create mode 100644 node_modules/expect.js/.npmignore create mode 100644 node_modules/expect.js/History.md create mode 100644 node_modules/expect.js/README.md create mode 100644 node_modules/expect.js/index.js create mode 100644 node_modules/expect.js/package.json create mode 100644 node_modules/glob/.npmignore create mode 100644 node_modules/glob/.travis.yml create mode 100644 node_modules/glob/LICENSE create mode 100644 node_modules/glob/README.md create mode 100644 node_modules/glob/examples/g.js create mode 100644 node_modules/glob/examples/usr-local.js create mode 100644 node_modules/glob/glob.js create mode 100644 node_modules/glob/package.json create mode 100644 node_modules/glob/test/00-setup.js create mode 100644 node_modules/glob/test/bash-comparison.js create mode 100644 node_modules/glob/test/bash-results.json create mode 100644 node_modules/glob/test/cwd-test.js create mode 100644 node_modules/glob/test/globstar-match.js create mode 100644 node_modules/glob/test/mark.js create mode 100644 node_modules/glob/test/nocase-nomagic.js create mode 100644 node_modules/glob/test/pause-resume.js create mode 100644 node_modules/glob/test/root-nomount.js create mode 100644 node_modules/glob/test/root.js create mode 100644 node_modules/glob/test/stat.js create mode 100644 node_modules/glob/test/zz-cleanup.js create mode 100644 node_modules/graceful-fs/.npmignore create mode 100644 node_modules/graceful-fs/LICENSE create mode 100644 node_modules/graceful-fs/README.md create mode 100644 node_modules/graceful-fs/graceful-fs.js create mode 100644 node_modules/graceful-fs/package.json create mode 100644 node_modules/graceful-fs/polyfills.js create mode 100644 node_modules/graceful-fs/test/open.js create mode 100644 node_modules/graceful-fs/test/readdir-sort.js create mode 100644 node_modules/growl/History.md create mode 100644 node_modules/growl/Readme.md create mode 100644 node_modules/growl/lib/growl.js create mode 100644 node_modules/growl/package.json create mode 100644 node_modules/growl/test.js create mode 100644 node_modules/inherits/LICENSE create mode 100644 node_modules/inherits/README.md create mode 100644 node_modules/inherits/inherits.js create mode 100644 node_modules/inherits/inherits_browser.js create mode 100644 node_modules/inherits/package.json create mode 100644 node_modules/jade/.npmignore create mode 100644 node_modules/jade/LICENSE create mode 100755 node_modules/jade/bin/jade create mode 100644 node_modules/jade/index.js create mode 100644 node_modules/jade/jade.js create mode 100644 node_modules/jade/jade.md create mode 100644 node_modules/jade/jade.min.js create mode 100644 node_modules/jade/lib/compiler.js create mode 100644 node_modules/jade/lib/doctypes.js create mode 100644 node_modules/jade/lib/filters.js create mode 100644 node_modules/jade/lib/inline-tags.js create mode 100644 node_modules/jade/lib/jade.js create mode 100644 node_modules/jade/lib/lexer.js create mode 100644 node_modules/jade/lib/nodes/attrs.js create mode 100644 node_modules/jade/lib/nodes/block-comment.js create mode 100644 node_modules/jade/lib/nodes/block.js create mode 100644 node_modules/jade/lib/nodes/case.js create mode 100644 node_modules/jade/lib/nodes/code.js create mode 100644 node_modules/jade/lib/nodes/comment.js create mode 100644 node_modules/jade/lib/nodes/doctype.js create mode 100644 node_modules/jade/lib/nodes/each.js create mode 100644 node_modules/jade/lib/nodes/filter.js create mode 100644 node_modules/jade/lib/nodes/index.js create mode 100644 node_modules/jade/lib/nodes/literal.js create mode 100644 node_modules/jade/lib/nodes/mixin.js create mode 100644 node_modules/jade/lib/nodes/node.js create mode 100644 node_modules/jade/lib/nodes/tag.js create mode 100644 node_modules/jade/lib/nodes/text.js create mode 100644 node_modules/jade/lib/parser.js create mode 100644 node_modules/jade/lib/runtime.js create mode 100644 node_modules/jade/lib/self-closing.js create mode 100644 node_modules/jade/lib/utils.js create mode 100644 node_modules/jade/node_modules/commander/.npmignore create mode 100644 node_modules/jade/node_modules/commander/.travis.yml create mode 100644 node_modules/jade/node_modules/commander/History.md create mode 100644 node_modules/jade/node_modules/commander/Makefile create mode 100644 node_modules/jade/node_modules/commander/Readme.md create mode 100644 node_modules/jade/node_modules/commander/index.js create mode 100644 node_modules/jade/node_modules/commander/lib/commander.js create mode 100644 node_modules/jade/node_modules/commander/package.json create mode 100644 node_modules/jade/node_modules/mkdirp/.gitignore create mode 100644 node_modules/jade/node_modules/mkdirp/.gitignore.orig create mode 100644 node_modules/jade/node_modules/mkdirp/.gitignore.rej create mode 100644 node_modules/jade/node_modules/mkdirp/LICENSE create mode 100644 node_modules/jade/node_modules/mkdirp/README.markdown create mode 100644 node_modules/jade/node_modules/mkdirp/examples/pow.js create mode 100644 node_modules/jade/node_modules/mkdirp/examples/pow.js.orig create mode 100644 node_modules/jade/node_modules/mkdirp/examples/pow.js.rej create mode 100644 node_modules/jade/node_modules/mkdirp/index.js create mode 100644 node_modules/jade/node_modules/mkdirp/package.json create mode 100644 node_modules/jade/node_modules/mkdirp/test/chmod.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/clobber.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/mkdirp.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/perm.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/perm_sync.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/race.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/rel.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/sync.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/umask.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/umask_sync.js create mode 100644 node_modules/jade/package.json create mode 100644 node_modules/jade/runtime.js create mode 100644 node_modules/jade/runtime.min.js create mode 100644 node_modules/jade/test.jade create mode 100644 node_modules/jade/testing/head.jade create mode 100644 node_modules/jade/testing/index.jade create mode 100644 node_modules/jade/testing/index.js create mode 100644 node_modules/jade/testing/layout.jade create mode 100644 node_modules/jade/testing/user.jade create mode 100644 node_modules/jade/testing/user.js create mode 100644 node_modules/lru-cache/.npmignore create mode 100644 node_modules/lru-cache/.travis.yml create mode 100644 node_modules/lru-cache/CONTRIBUTORS create mode 100644 node_modules/lru-cache/LICENSE create mode 100644 node_modules/lru-cache/README.md create mode 100644 node_modules/lru-cache/lib/lru-cache.js create mode 100644 node_modules/lru-cache/package.json create mode 100644 node_modules/lru-cache/test/basic.js create mode 100644 node_modules/lru-cache/test/foreach.js create mode 100644 node_modules/lru-cache/test/memory-leak.js create mode 100644 node_modules/lru-cache/test/serialize.js create mode 100644 node_modules/minimatch/.npmignore create mode 100644 node_modules/minimatch/LICENSE create mode 100644 node_modules/minimatch/README.md create mode 100644 node_modules/minimatch/minimatch.js create mode 100644 node_modules/minimatch/package.json create mode 100644 node_modules/minimatch/test/basic.js create mode 100644 node_modules/minimatch/test/brace-expand.js create mode 100644 node_modules/minimatch/test/caching.js create mode 100644 node_modules/minimatch/test/defaults.js create mode 100644 node_modules/minimatch/test/extglob-ending-with-state-char.js create mode 100644 node_modules/mkdirp/.npmignore create mode 100644 node_modules/mkdirp/.travis.yml create mode 100644 node_modules/mkdirp/LICENSE create mode 100644 node_modules/mkdirp/examples/pow.js create mode 100644 node_modules/mkdirp/index.js create mode 100644 node_modules/mkdirp/package.json create mode 100644 node_modules/mkdirp/readme.markdown create mode 100644 node_modules/mkdirp/test/chmod.js create mode 100644 node_modules/mkdirp/test/clobber.js create mode 100644 node_modules/mkdirp/test/mkdirp.js create mode 100644 node_modules/mkdirp/test/perm.js create mode 100644 node_modules/mkdirp/test/perm_sync.js create mode 100644 node_modules/mkdirp/test/race.js create mode 100644 node_modules/mkdirp/test/rel.js create mode 100644 node_modules/mkdirp/test/return.js create mode 100644 node_modules/mkdirp/test/return_sync.js create mode 100644 node_modules/mkdirp/test/root.js create mode 100644 node_modules/mkdirp/test/sync.js create mode 100644 node_modules/mkdirp/test/umask.js create mode 100644 node_modules/mkdirp/test/umask_sync.js create mode 100644 node_modules/mocha/Readme.md create mode 100755 node_modules/mocha/bin/_mocha create mode 100755 node_modules/mocha/bin/mocha create mode 100644 node_modules/mocha/images/error.png create mode 100644 node_modules/mocha/images/ok.png create mode 100644 node_modules/mocha/index.js create mode 100644 node_modules/mocha/lib/browser/debug.js create mode 100644 node_modules/mocha/lib/browser/diff.js create mode 100644 node_modules/mocha/lib/browser/events.js create mode 100644 node_modules/mocha/lib/browser/fs.js create mode 100644 node_modules/mocha/lib/browser/path.js create mode 100644 node_modules/mocha/lib/browser/progress.js create mode 100644 node_modules/mocha/lib/browser/tty.js create mode 100644 node_modules/mocha/lib/context.js create mode 100644 node_modules/mocha/lib/hook.js create mode 100644 node_modules/mocha/lib/interfaces/bdd.js create mode 100644 node_modules/mocha/lib/interfaces/exports.js create mode 100644 node_modules/mocha/lib/interfaces/index.js create mode 100644 node_modules/mocha/lib/interfaces/qunit.js create mode 100644 node_modules/mocha/lib/interfaces/tdd.js create mode 100644 node_modules/mocha/lib/mocha.js create mode 100644 node_modules/mocha/lib/ms.js create mode 100644 node_modules/mocha/lib/reporters/base.js create mode 100644 node_modules/mocha/lib/reporters/doc.js create mode 100644 node_modules/mocha/lib/reporters/dot.js create mode 100644 node_modules/mocha/lib/reporters/html-cov.js create mode 100644 node_modules/mocha/lib/reporters/html.js create mode 100644 node_modules/mocha/lib/reporters/index.js create mode 100644 node_modules/mocha/lib/reporters/json-cov.js create mode 100644 node_modules/mocha/lib/reporters/json-stream.js create mode 100644 node_modules/mocha/lib/reporters/json.js create mode 100644 node_modules/mocha/lib/reporters/landing.js create mode 100644 node_modules/mocha/lib/reporters/list.js create mode 100644 node_modules/mocha/lib/reporters/markdown.js create mode 100644 node_modules/mocha/lib/reporters/min.js create mode 100644 node_modules/mocha/lib/reporters/nyan.js create mode 100644 node_modules/mocha/lib/reporters/progress.js create mode 100644 node_modules/mocha/lib/reporters/spec.js create mode 100644 node_modules/mocha/lib/reporters/tap.js create mode 100644 node_modules/mocha/lib/reporters/templates/coverage.jade create mode 100644 node_modules/mocha/lib/reporters/templates/menu.jade create mode 100644 node_modules/mocha/lib/reporters/templates/script.html create mode 100644 node_modules/mocha/lib/reporters/templates/style.html create mode 100644 node_modules/mocha/lib/reporters/xunit.js create mode 100644 node_modules/mocha/lib/runnable.js create mode 100644 node_modules/mocha/lib/runner.js create mode 100644 node_modules/mocha/lib/suite.js create mode 100644 node_modules/mocha/lib/template.html create mode 100644 node_modules/mocha/lib/test.js create mode 100644 node_modules/mocha/lib/utils.js create mode 100644 node_modules/mocha/mocha.css create mode 100644 node_modules/mocha/mocha.js create mode 120000 node_modules/mocha/node_modules/.bin/jade create mode 100644 node_modules/mocha/package.json create mode 100644 node_modules/ms/index.js create mode 100644 node_modules/ms/license.md create mode 100644 node_modules/ms/package.json create mode 100644 node_modules/ms/readme.md create mode 100644 node_modules/sigmund/LICENSE create mode 100644 node_modules/sigmund/README.md create mode 100644 node_modules/sigmund/bench.js create mode 100644 node_modules/sigmund/package.json create mode 100644 node_modules/sigmund/sigmund.js create mode 100644 node_modules/sigmund/test/basic.js create mode 100644 yarn.lock diff --git a/index.js b/index.js index 438d6e6..d4704b4 100644 --- a/index.js +++ b/index.js @@ -35,5 +35,34 @@ module.exports = function parseuri(str) { uri.ipv6uri = true; } + uri.pathNames = pathNames(uri, uri['path']); + uri.queryKey = queryKey(uri, uri['query']); + return uri; }; + +function pathNames(obj, path) { + var regx = /\/{2,9}/g, + names = path.replace(regx, "/").split("/"); + + if (path.substr(0, 1) == '/' || path.length === 0) { + names.splice(0, 1); + } + if (path.substr(path.length - 1, 1) == '/') { + names.splice(names.length - 1, 1); + } + + return names; +} + +function queryKey(uri, query) { + var data = {}; + + query.replace(/(?:^|&)([^&=]*)=?([^&]*)/g, function ($0, $1, $2) { + if ($1) { + data[$1] = $2; + } + }); + + return data; +} diff --git a/node_modules/.bin/_mocha b/node_modules/.bin/_mocha new file mode 120000 index 0000000..f2a54ff --- /dev/null +++ b/node_modules/.bin/_mocha @@ -0,0 +1 @@ +../mocha/bin/_mocha \ No newline at end of file diff --git a/node_modules/.bin/jade b/node_modules/.bin/jade new file mode 120000 index 0000000..571fae7 --- /dev/null +++ b/node_modules/.bin/jade @@ -0,0 +1 @@ +../jade/bin/jade \ No newline at end of file diff --git a/node_modules/.bin/mocha b/node_modules/.bin/mocha new file mode 120000 index 0000000..43c668d --- /dev/null +++ b/node_modules/.bin/mocha @@ -0,0 +1 @@ +../mocha/bin/mocha \ No newline at end of file diff --git a/node_modules/.yarn-integrity b/node_modules/.yarn-integrity new file mode 100644 index 0000000..643563d --- /dev/null +++ b/node_modules/.yarn-integrity @@ -0,0 +1,35 @@ +{ + "modulesFolders": [ + "node_modules" + ], + "flags": [], + "linkedModules": [], + "topLevelPatterns": [ + "better-assert@~1.0.0", + "expect.js@^0.3.1", + "mocha@1.17.1" + ], + "lockfileEntries": { + "better-assert@~1.0.0": "https://registry.yarnpkg.com/better-assert/-/better-assert-1.0.2.tgz#40866b9e1b9e0b55b481894311e68faffaebc522", + "callsite@1.0.0": "https://registry.yarnpkg.com/callsite/-/callsite-1.0.0.tgz#280398e5d664bd74038b6f0905153e6e8af1bc20", + "commander@0.6.1": "https://registry.yarnpkg.com/commander/-/commander-0.6.1.tgz#fa68a14f6a945d54dbbe50d8cdb3320e9e3b1a06", + "commander@2.0.0": "https://registry.yarnpkg.com/commander/-/commander-2.0.0.tgz#d1b86f901f8b64bd941bdeadaf924530393be928", + "debug@*": "https://registry.yarnpkg.com/debug/-/debug-3.0.1.tgz#0564c612b521dc92d9f2988f0549e34f9c98db64", + "diff@1.0.7": "https://registry.yarnpkg.com/diff/-/diff-1.0.7.tgz#24bbb001c4a7d5522169e7cabdb2c2814ed91cf4", + "expect.js@^0.3.1": "https://registry.yarnpkg.com/expect.js/-/expect.js-0.3.1.tgz#b0a59a0d2eff5437544ebf0ceaa6015841d09b5b", + "glob@3.2.3": "https://registry.yarnpkg.com/glob/-/glob-3.2.3.tgz#e313eeb249c7affaa5c475286b0e115b59839467", + "graceful-fs@~2.0.0": "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-2.0.3.tgz#7cd2cdb228a4a3f36e95efa6cc142de7d1a136d0", + "growl@1.7.x": "https://registry.yarnpkg.com/growl/-/growl-1.7.0.tgz#de2d66136d002e112ba70f3f10c31cf7c350b2da", + "inherits@2": "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de", + "jade@0.26.3": "https://registry.yarnpkg.com/jade/-/jade-0.26.3.tgz#8f10d7977d8d79f2f6ff862a81b0513ccb25686c", + "lru-cache@2": "https://registry.yarnpkg.com/lru-cache/-/lru-cache-2.7.3.tgz#6d4524e8b955f95d4f5b58851ce21dd72fb4e952", + "minimatch@~0.2.11": "https://registry.yarnpkg.com/minimatch/-/minimatch-0.2.14.tgz#c74e780574f63c6f9a090e90efbe6ef53a6a756a", + "mkdirp@0.3.0": "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.0.tgz#1bbf5ab1ba827af23575143490426455f481fe1e", + "mkdirp@0.3.5": "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.5.tgz#de3e5f8961c88c787ee1368df849ac4413eca8d7", + "mocha@1.17.1": "https://registry.yarnpkg.com/mocha/-/mocha-1.17.1.tgz#7f7671d68526d074b7bae660c9099f87e0ea1ccb", + "ms@2.0.0": "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8", + "sigmund@~1.0.0": "https://registry.yarnpkg.com/sigmund/-/sigmund-1.0.1.tgz#3ff21f198cad2175f9f3b781853fd94d0d19b590" + }, + "files": [], + "artifacts": {} +} \ No newline at end of file diff --git a/node_modules/better-assert/.npmignore b/node_modules/better-assert/.npmignore new file mode 100644 index 0000000..f1250e5 --- /dev/null +++ b/node_modules/better-assert/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/node_modules/better-assert/History.md b/node_modules/better-assert/History.md new file mode 100644 index 0000000..cbb579b --- /dev/null +++ b/node_modules/better-assert/History.md @@ -0,0 +1,15 @@ + +1.0.0 / 2013-02-03 +================== + + * Stop using the removed magic __stack global getter + +0.1.0 / 2012-10-04 +================== + + * add throwing of AssertionError for test frameworks etc + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/better-assert/Makefile b/node_modules/better-assert/Makefile new file mode 100644 index 0000000..36a3ed7 --- /dev/null +++ b/node_modules/better-assert/Makefile @@ -0,0 +1,5 @@ + +test: + @echo "populate me" + +.PHONY: test \ No newline at end of file diff --git a/node_modules/better-assert/Readme.md b/node_modules/better-assert/Readme.md new file mode 100644 index 0000000..d8d3a63 --- /dev/null +++ b/node_modules/better-assert/Readme.md @@ -0,0 +1,61 @@ + +# better-assert + + Better c-style assertions using [callsite](https://github.com/visionmedia/callsite) for + self-documenting failure messages. + +## Installation + + $ npm install better-assert + +## Example + + By default assertions are enabled, however the __NO_ASSERT__ environment variable + will deactivate them when truthy. + +```js +var assert = require('better-assert'); + +test(); + +function test() { + var user = { name: 'tobi' }; + assert('tobi' == user.name); + assert('number' == typeof user.age); +} + +AssertionError: 'number' == typeof user.age + at test (/Users/tj/projects/better-assert/example.js:9:3) + at Object. (/Users/tj/projects/better-assert/example.js:4:1) + at Module._compile (module.js:449:26) + at Object.Module._extensions..js (module.js:467:10) + at Module.load (module.js:356:32) + at Function.Module._load (module.js:312:12) + at Module.runMain (module.js:492:10) + at process.startup.processNextTick.process._tickCallback (node.js:244:9) +``` + +## License + +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/better-assert/example.js b/node_modules/better-assert/example.js new file mode 100644 index 0000000..688c29e --- /dev/null +++ b/node_modules/better-assert/example.js @@ -0,0 +1,10 @@ + +var assert = require('./'); + +test(); + +function test() { + var user = { name: 'tobi' }; + assert('tobi' == user.name); + assert('number' == typeof user.age); +} \ No newline at end of file diff --git a/node_modules/better-assert/index.js b/node_modules/better-assert/index.js new file mode 100644 index 0000000..fd1c9b7 --- /dev/null +++ b/node_modules/better-assert/index.js @@ -0,0 +1,38 @@ +/** + * Module dependencies. + */ + +var AssertionError = require('assert').AssertionError + , callsite = require('callsite') + , fs = require('fs') + +/** + * Expose `assert`. + */ + +module.exports = process.env.NO_ASSERT + ? function(){} + : assert; + +/** + * Assert the given `expr`. + */ + +function assert(expr) { + if (expr) return; + + var stack = callsite(); + var call = stack[1]; + var file = call.getFileName(); + var lineno = call.getLineNumber(); + var src = fs.readFileSync(file, 'utf8'); + var line = src.split('\n')[lineno-1]; + var src = line.match(/assert\((.*)\)/)[1]; + + var err = new AssertionError({ + message: src, + stackStartFunction: stack[0].getFunction() + }); + + throw err; +} diff --git a/node_modules/better-assert/package.json b/node_modules/better-assert/package.json new file mode 100644 index 0000000..ae04635 --- /dev/null +++ b/node_modules/better-assert/package.json @@ -0,0 +1,27 @@ +{ + "name": "better-assert", + "version": "1.0.2", + "description": "Better assertions for node, reporting the expr, filename, lineno etc", + "keywords": [ + "assert", + "stack", + "trace", + "debug" + ], + "author": "TJ Holowaychuk ", + "contributors": [ + "TonyHe ", + "ForbesLindesay" + ], + "dependencies": { + "callsite": "1.0.0" + }, + "repository": { + "type": "git", + "url": "https://github.com/visionmedia/better-assert.git" + }, + "main": "index", + "engines": { + "node": "*" + } +} diff --git a/node_modules/callsite/.npmignore b/node_modules/callsite/.npmignore new file mode 100644 index 0000000..f1250e5 --- /dev/null +++ b/node_modules/callsite/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/node_modules/callsite/History.md b/node_modules/callsite/History.md new file mode 100644 index 0000000..4994198 --- /dev/null +++ b/node_modules/callsite/History.md @@ -0,0 +1,10 @@ + +1.0.0 / 2013-01-24 +================== + + * remove lame magical getters + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/callsite/Makefile b/node_modules/callsite/Makefile new file mode 100644 index 0000000..634e372 --- /dev/null +++ b/node_modules/callsite/Makefile @@ -0,0 +1,6 @@ + +test: + @./node_modules/.bin/mocha \ + --require should + +.PHONY: test \ No newline at end of file diff --git a/node_modules/callsite/Readme.md b/node_modules/callsite/Readme.md new file mode 100644 index 0000000..0dbd16a --- /dev/null +++ b/node_modules/callsite/Readme.md @@ -0,0 +1,44 @@ +# callstack + + Access to v8's "raw" `CallSite`s. + +## Installation + + $ npm install callsite + +## Example + +```js +var stack = require('callsite'); + +foo(); + +function foo() { + bar(); +} + +function bar() { + baz(); +} + +function baz() { + console.log(); + stack().forEach(function(site){ + console.log(' \033[36m%s\033[90m in %s:%d\033[0m' + , site.getFunctionName() || 'anonymous' + , site.getFileName() + , site.getLineNumber()); + }); + console.log(); +} +``` + +## Why? + + Because you can do weird, stupid, clever, wacky things such as: + + - [better-assert](https://github.com/visionmedia/better-assert) + +## License + + MIT diff --git a/node_modules/callsite/index.js b/node_modules/callsite/index.js new file mode 100644 index 0000000..d3ee6f8 --- /dev/null +++ b/node_modules/callsite/index.js @@ -0,0 +1,10 @@ + +module.exports = function(){ + var orig = Error.prepareStackTrace; + Error.prepareStackTrace = function(_, stack){ return stack; }; + var err = new Error; + Error.captureStackTrace(err, arguments.callee); + var stack = err.stack; + Error.prepareStackTrace = orig; + return stack; +}; diff --git a/node_modules/callsite/package.json b/node_modules/callsite/package.json new file mode 100644 index 0000000..348434e --- /dev/null +++ b/node_modules/callsite/package.json @@ -0,0 +1,11 @@ +{ + "name": "callsite" + , "version": "1.0.0" + , "description": "access to v8's CallSites" + , "keywords": ["stack", "trace", "line"] + , "author": "TJ Holowaychuk " + , "dependencies": {} + , "devDependencies": { "mocha": "*", "should": "*" } + , "main": "index" + , "engines": { "node": "*" } +} diff --git a/node_modules/commander/History.md b/node_modules/commander/History.md new file mode 100644 index 0000000..2e66582 --- /dev/null +++ b/node_modules/commander/History.md @@ -0,0 +1,179 @@ + +2.0.0 / 2013-07-18 +================== + + * remove input methods (.prompt, .confirm, etc) + +1.3.2 / 2013-07-18 +================== + + * add support for sub-commands to co-exist with the original command + +1.3.1 / 2013-07-18 +================== + + * add quick .runningCommand hack so you can opt-out of other logic when running a sub command + +1.3.0 / 2013-07-09 +================== + + * add EACCES error handling + * fix sub-command --help + +1.2.0 / 2013-06-13 +================== + + * allow "-" hyphen as an option argument + * support for RegExp coercion + +1.1.1 / 2012-11-20 +================== + + * add more sub-command padding + * fix .usage() when args are present. Closes #106 + +1.1.0 / 2012-11-16 +================== + + * add git-style executable subcommand support. Closes #94 + +1.0.5 / 2012-10-09 +================== + + * fix `--name` clobbering. Closes #92 + * fix examples/help. Closes #89 + +1.0.4 / 2012-09-03 +================== + + * add `outputHelp()` method. + +1.0.3 / 2012-08-30 +================== + + * remove invalid .version() defaulting + +1.0.2 / 2012-08-24 +================== + + * add `--foo=bar` support [arv] + * fix password on node 0.8.8. Make backward compatible with 0.6 [focusaurus] + +1.0.1 / 2012-08-03 +================== + + * fix issue #56 + * fix tty.setRawMode(mode) was moved to tty.ReadStream#setRawMode() (i.e. process.stdin.setRawMode()) + +1.0.0 / 2012-07-05 +================== + + * add support for optional option descriptions + * add defaulting of `.version()` to package.json's version + +0.6.1 / 2012-06-01 +================== + + * Added: append (yes or no) on confirmation + * Added: allow node.js v0.7.x + +0.6.0 / 2012-04-10 +================== + + * Added `.prompt(obj, callback)` support. Closes #49 + * Added default support to .choose(). Closes #41 + * Fixed the choice example + +0.5.1 / 2011-12-20 +================== + + * Fixed `password()` for recent nodes. Closes #36 + +0.5.0 / 2011-12-04 +================== + + * Added sub-command option support [itay] + +0.4.3 / 2011-12-04 +================== + + * Fixed custom help ordering. Closes #32 + +0.4.2 / 2011-11-24 +================== + + * Added travis support + * Fixed: line-buffered input automatically trimmed. Closes #31 + +0.4.1 / 2011-11-18 +================== + + * Removed listening for "close" on --help + +0.4.0 / 2011-11-15 +================== + + * Added support for `--`. Closes #24 + +0.3.3 / 2011-11-14 +================== + + * Fixed: wait for close event when writing help info [Jerry Hamlet] + +0.3.2 / 2011-11-01 +================== + + * Fixed long flag definitions with values [felixge] + +0.3.1 / 2011-10-31 +================== + + * Changed `--version` short flag to `-V` from `-v` + * Changed `.version()` so it's configurable [felixge] + +0.3.0 / 2011-10-31 +================== + + * Added support for long flags only. Closes #18 + +0.2.1 / 2011-10-24 +================== + + * "node": ">= 0.4.x < 0.7.0". Closes #20 + +0.2.0 / 2011-09-26 +================== + + * Allow for defaults that are not just boolean. Default peassignment only occurs for --no-*, optional, and required arguments. [Jim Isaacs] + +0.1.0 / 2011-08-24 +================== + + * Added support for custom `--help` output + +0.0.5 / 2011-08-18 +================== + + * Changed: when the user enters nothing prompt for password again + * Fixed issue with passwords beginning with numbers [NuckChorris] + +0.0.4 / 2011-08-15 +================== + + * Fixed `Commander#args` + +0.0.3 / 2011-08-15 +================== + + * Added default option value support + +0.0.2 / 2011-08-15 +================== + + * Added mask support to `Command#password(str[, mask], fn)` + * Added `Command#password(str, fn)` + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/commander/Readme.md b/node_modules/commander/Readme.md new file mode 100644 index 0000000..d164401 --- /dev/null +++ b/node_modules/commander/Readme.md @@ -0,0 +1,195 @@ +# Commander.js + + The complete solution for [node.js](http://nodejs.org) command-line interfaces, inspired by Ruby's [commander](https://github.com/visionmedia/commander). + + [![Build Status](https://secure.travis-ci.org/visionmedia/commander.js.png)](http://travis-ci.org/visionmedia/commander.js) + +## Installation + + $ npm install commander + +## Option parsing + + Options with commander are defined with the `.option()` method, also serving as documentation for the options. The example below parses args and options from `process.argv`, leaving remaining args as the `program.args` array which were not consumed by options. + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('commander'); + +program + .version('0.0.1') + .option('-p, --peppers', 'Add peppers') + .option('-P, --pineapple', 'Add pineapple') + .option('-b, --bbq', 'Add bbq sauce') + .option('-c, --cheese [type]', 'Add the specified type of cheese [marble]', 'marble') + .parse(process.argv); + +console.log('you ordered a pizza with:'); +if (program.peppers) console.log(' - peppers'); +if (program.pineapple) console.log(' - pineapple'); +if (program.bbq) console.log(' - bbq'); +console.log(' - %s cheese', program.cheese); +``` + + Short flags may be passed as a single arg, for example `-abc` is equivalent to `-a -b -c`. Multi-word options such as "--template-engine" are camel-cased, becoming `program.templateEngine` etc. + +## Automated --help + + The help information is auto-generated based on the information commander already knows about your program, so the following `--help` info is for free: + +``` + $ ./examples/pizza --help + + Usage: pizza [options] + + Options: + + -V, --version output the version number + -p, --peppers Add peppers + -P, --pineapple Add pineapple + -b, --bbq Add bbq sauce + -c, --cheese Add the specified type of cheese [marble] + -h, --help output usage information + +``` + +## Coercion + +```js +function range(val) { + return val.split('..').map(Number); +} + +function list(val) { + return val.split(','); +} + +program + .version('0.0.1') + .usage('[options] ') + .option('-i, --integer ', 'An integer argument', parseInt) + .option('-f, --float ', 'A float argument', parseFloat) + .option('-r, --range ..', 'A range', range) + .option('-l, --list ', 'A list', list) + .option('-o, --optional [value]', 'An optional value') + .parse(process.argv); + +console.log(' int: %j', program.integer); +console.log(' float: %j', program.float); +console.log(' optional: %j', program.optional); +program.range = program.range || []; +console.log(' range: %j..%j', program.range[0], program.range[1]); +console.log(' list: %j', program.list); +console.log(' args: %j', program.args); +``` + +## Custom help + + You can display arbitrary `-h, --help` information + by listening for "--help". Commander will automatically + exit once you are done so that the remainder of your program + does not execute causing undesired behaviours, for example + in the following executable "stuff" will not output when + `--help` is used. + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('../'); + +function list(val) { + return val.split(',').map(Number); +} + +program + .version('0.0.1') + .option('-f, --foo', 'enable some foo') + .option('-b, --bar', 'enable some bar') + .option('-B, --baz', 'enable some baz'); + +// must be before .parse() since +// node's emit() is immediate + +program.on('--help', function(){ + console.log(' Examples:'); + console.log(''); + console.log(' $ custom-help --help'); + console.log(' $ custom-help -h'); + console.log(''); +}); + +program.parse(process.argv); + +console.log('stuff'); +``` + +yielding the following help output: + +``` + +Usage: custom-help [options] + +Options: + + -h, --help output usage information + -V, --version output the version number + -f, --foo enable some foo + -b, --bar enable some bar + -B, --baz enable some baz + +Examples: + + $ custom-help --help + $ custom-help -h + +``` + +## .outputHelp() + + Output help information without exiting. + +## .help() + + Output help information and exit immediately. + +## Links + + - [API documentation](http://visionmedia.github.com/commander.js/) + - [ascii tables](https://github.com/LearnBoost/cli-table) + - [progress bars](https://github.com/visionmedia/node-progress) + - [more progress bars](https://github.com/substack/node-multimeter) + - [examples](https://github.com/visionmedia/commander.js/tree/master/examples) + +## License + +(The MIT License) + +Copyright (c) 2011 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/commander/index.js b/node_modules/commander/index.js new file mode 100644 index 0000000..d5778a7 --- /dev/null +++ b/node_modules/commander/index.js @@ -0,0 +1,847 @@ + +/** + * Module dependencies. + */ + +var EventEmitter = require('events').EventEmitter; +var spawn = require('child_process').spawn; +var fs = require('fs'); +var exists = fs.existsSync; +var path = require('path'); +var dirname = path.dirname; +var basename = path.basename; + +/** + * Expose the root command. + */ + +exports = module.exports = new Command; + +/** + * Expose `Command`. + */ + +exports.Command = Command; + +/** + * Expose `Option`. + */ + +exports.Option = Option; + +/** + * Initialize a new `Option` with the given `flags` and `description`. + * + * @param {String} flags + * @param {String} description + * @api public + */ + +function Option(flags, description) { + this.flags = flags; + this.required = ~flags.indexOf('<'); + this.optional = ~flags.indexOf('['); + this.bool = !~flags.indexOf('-no-'); + flags = flags.split(/[ ,|]+/); + if (flags.length > 1 && !/^[[<]/.test(flags[1])) this.short = flags.shift(); + this.long = flags.shift(); + this.description = description || ''; +} + +/** + * Return option name. + * + * @return {String} + * @api private + */ + +Option.prototype.name = function(){ + return this.long + .replace('--', '') + .replace('no-', ''); +}; + +/** + * Check if `arg` matches the short or long flag. + * + * @param {String} arg + * @return {Boolean} + * @api private + */ + +Option.prototype.is = function(arg){ + return arg == this.short + || arg == this.long; +}; + +/** + * Initialize a new `Command`. + * + * @param {String} name + * @api public + */ + +function Command(name) { + this.commands = []; + this.options = []; + this._execs = []; + this._args = []; + this._name = name; +} + +/** + * Inherit from `EventEmitter.prototype`. + */ + +Command.prototype.__proto__ = EventEmitter.prototype; + +/** + * Add command `name`. + * + * The `.action()` callback is invoked when the + * command `name` is specified via __ARGV__, + * and the remaining arguments are applied to the + * function for access. + * + * When the `name` is "*" an un-matched command + * will be passed as the first arg, followed by + * the rest of __ARGV__ remaining. + * + * Examples: + * + * program + * .version('0.0.1') + * .option('-C, --chdir ', 'change the working directory') + * .option('-c, --config ', 'set config path. defaults to ./deploy.conf') + * .option('-T, --no-tests', 'ignore test hook') + * + * program + * .command('setup') + * .description('run remote setup commands') + * .action(function(){ + * console.log('setup'); + * }); + * + * program + * .command('exec ') + * .description('run the given remote command') + * .action(function(cmd){ + * console.log('exec "%s"', cmd); + * }); + * + * program + * .command('*') + * .description('deploy the given env') + * .action(function(env){ + * console.log('deploying "%s"', env); + * }); + * + * program.parse(process.argv); + * + * @param {String} name + * @param {String} [desc] + * @return {Command} the new command + * @api public + */ + +Command.prototype.command = function(name, desc){ + var args = name.split(/ +/); + var cmd = new Command(args.shift()); + if (desc) cmd.description(desc); + if (desc) this.executables = true; + if (desc) this._execs[cmd._name] = true; + this.commands.push(cmd); + cmd.parseExpectedArgs(args); + cmd.parent = this; + if (desc) return this; + return cmd; +}; + +/** + * Add an implicit `help [cmd]` subcommand + * which invokes `--help` for the given command. + * + * @api private + */ + +Command.prototype.addImplicitHelpCommand = function() { + this.command('help [cmd]', 'display help for [cmd]'); +}; + +/** + * Parse expected `args`. + * + * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`. + * + * @param {Array} args + * @return {Command} for chaining + * @api public + */ + +Command.prototype.parseExpectedArgs = function(args){ + if (!args.length) return; + var self = this; + args.forEach(function(arg){ + switch (arg[0]) { + case '<': + self._args.push({ required: true, name: arg.slice(1, -1) }); + break; + case '[': + self._args.push({ required: false, name: arg.slice(1, -1) }); + break; + } + }); + return this; +}; + +/** + * Register callback `fn` for the command. + * + * Examples: + * + * program + * .command('help') + * .description('display verbose help') + * .action(function(){ + * // output help here + * }); + * + * @param {Function} fn + * @return {Command} for chaining + * @api public + */ + +Command.prototype.action = function(fn){ + var self = this; + this.parent.on(this._name, function(args, unknown){ + // Parse any so-far unknown options + unknown = unknown || []; + var parsed = self.parseOptions(unknown); + + // Output help if necessary + outputHelpIfNecessary(self, parsed.unknown); + + // If there are still any unknown options, then we simply + // die, unless someone asked for help, in which case we give it + // to them, and then we die. + if (parsed.unknown.length > 0) { + self.unknownOption(parsed.unknown[0]); + } + + // Leftover arguments need to be pushed back. Fixes issue #56 + if (parsed.args.length) args = parsed.args.concat(args); + + self._args.forEach(function(arg, i){ + if (arg.required && null == args[i]) { + self.missingArgument(arg.name); + } + }); + + // Always append ourselves to the end of the arguments, + // to make sure we match the number of arguments the user + // expects + if (self._args.length) { + args[self._args.length] = self; + } else { + args.push(self); + } + + fn.apply(this, args); + }); + return this; +}; + +/** + * Define option with `flags`, `description` and optional + * coercion `fn`. + * + * The `flags` string should contain both the short and long flags, + * separated by comma, a pipe or space. The following are all valid + * all will output this way when `--help` is used. + * + * "-p, --pepper" + * "-p|--pepper" + * "-p --pepper" + * + * Examples: + * + * // simple boolean defaulting to false + * program.option('-p, --pepper', 'add pepper'); + * + * --pepper + * program.pepper + * // => Boolean + * + * // simple boolean defaulting to false + * program.option('-C, --no-cheese', 'remove cheese'); + * + * program.cheese + * // => true + * + * --no-cheese + * program.cheese + * // => true + * + * // required argument + * program.option('-C, --chdir ', 'change the working directory'); + * + * --chdir /tmp + * program.chdir + * // => "/tmp" + * + * // optional argument + * program.option('-c, --cheese [type]', 'add cheese [marble]'); + * + * @param {String} flags + * @param {String} description + * @param {Function|Mixed} fn or default + * @param {Mixed} defaultValue + * @return {Command} for chaining + * @api public + */ + +Command.prototype.option = function(flags, description, fn, defaultValue){ + var self = this + , option = new Option(flags, description) + , oname = option.name() + , name = camelcase(oname); + + // default as 3rd arg + if ('function' != typeof fn) defaultValue = fn, fn = null; + + // preassign default value only for --no-*, [optional], or + if (false == option.bool || option.optional || option.required) { + // when --no-* we make sure default is true + if (false == option.bool) defaultValue = true; + // preassign only if we have a default + if (undefined !== defaultValue) self[name] = defaultValue; + } + + // register the option + this.options.push(option); + + // when it's passed assign the value + // and conditionally invoke the callback + this.on(oname, function(val){ + // coercion + if (null != val && fn) val = fn(val); + + // unassigned or bool + if ('boolean' == typeof self[name] || 'undefined' == typeof self[name]) { + // if no value, bool true, and we have a default, then use it! + if (null == val) { + self[name] = option.bool + ? defaultValue || true + : false; + } else { + self[name] = val; + } + } else if (null !== val) { + // reassign + self[name] = val; + } + }); + + return this; +}; + +/** + * Parse `argv`, settings options and invoking commands when defined. + * + * @param {Array} argv + * @return {Command} for chaining + * @api public + */ + +Command.prototype.parse = function(argv){ + // implicit help + if (this.executables) this.addImplicitHelpCommand(); + + // store raw args + this.rawArgs = argv; + + // guess name + this._name = this._name || basename(argv[1]); + + // process argv + var parsed = this.parseOptions(this.normalize(argv.slice(2))); + var args = this.args = parsed.args; + + var result = this.parseArgs(this.args, parsed.unknown); + + // executable sub-commands + var name = result.args[0]; + if (this._execs[name]) return this.executeSubCommand(argv, args, parsed.unknown); + + return result; +}; + +/** + * Execute a sub-command executable. + * + * @param {Array} argv + * @param {Array} args + * @param {Array} unknown + * @api private + */ + +Command.prototype.executeSubCommand = function(argv, args, unknown) { + args = args.concat(unknown); + + if (!args.length) this.help(); + if ('help' == args[0] && 1 == args.length) this.help(); + + // --help + if ('help' == args[0]) { + args[0] = args[1]; + args[1] = '--help'; + } + + // executable + var dir = dirname(argv[1]); + var bin = basename(argv[1]) + '-' + args[0]; + + // check for ./ first + var local = path.join(dir, bin); + + // run it + args = args.slice(1); + var proc = spawn(local, args, { stdio: 'inherit', customFds: [0, 1, 2] }); + proc.on('error', function(err){ + if (err.code == "ENOENT") { + console.error('\n %s(1) does not exist, try --help\n', bin); + } else if (err.code == "EACCES") { + console.error('\n %s(1) not executable. try chmod or run with root\n', bin); + } + }); + + this.runningCommand = proc; +}; + +/** + * Normalize `args`, splitting joined short flags. For example + * the arg "-abc" is equivalent to "-a -b -c". + * This also normalizes equal sign and splits "--abc=def" into "--abc def". + * + * @param {Array} args + * @return {Array} + * @api private + */ + +Command.prototype.normalize = function(args){ + var ret = [] + , arg + , index; + + for (var i = 0, len = args.length; i < len; ++i) { + arg = args[i]; + if (arg.length > 1 && '-' == arg[0] && '-' != arg[1]) { + arg.slice(1).split('').forEach(function(c){ + ret.push('-' + c); + }); + } else if (/^--/.test(arg) && ~(index = arg.indexOf('='))) { + ret.push(arg.slice(0, index), arg.slice(index + 1)); + } else { + ret.push(arg); + } + } + + return ret; +}; + +/** + * Parse command `args`. + * + * When listener(s) are available those + * callbacks are invoked, otherwise the "*" + * event is emitted and those actions are invoked. + * + * @param {Array} args + * @return {Command} for chaining + * @api private + */ + +Command.prototype.parseArgs = function(args, unknown){ + var cmds = this.commands + , len = cmds.length + , name; + + if (args.length) { + name = args[0]; + if (this.listeners(name).length) { + this.emit(args.shift(), args, unknown); + } else { + this.emit('*', args); + } + } else { + outputHelpIfNecessary(this, unknown); + + // If there were no args and we have unknown options, + // then they are extraneous and we need to error. + if (unknown.length > 0) { + this.unknownOption(unknown[0]); + } + } + + return this; +}; + +/** + * Return an option matching `arg` if any. + * + * @param {String} arg + * @return {Option} + * @api private + */ + +Command.prototype.optionFor = function(arg){ + for (var i = 0, len = this.options.length; i < len; ++i) { + if (this.options[i].is(arg)) { + return this.options[i]; + } + } +}; + +/** + * Parse options from `argv` returning `argv` + * void of these options. + * + * @param {Array} argv + * @return {Array} + * @api public + */ + +Command.prototype.parseOptions = function(argv){ + var args = [] + , len = argv.length + , literal + , option + , arg; + + var unknownOptions = []; + + // parse options + for (var i = 0; i < len; ++i) { + arg = argv[i]; + + // literal args after -- + if ('--' == arg) { + literal = true; + continue; + } + + if (literal) { + args.push(arg); + continue; + } + + // find matching Option + option = this.optionFor(arg); + + // option is defined + if (option) { + // requires arg + if (option.required) { + arg = argv[++i]; + if (null == arg) return this.optionMissingArgument(option); + if ('-' == arg[0] && '-' != arg) return this.optionMissingArgument(option, arg); + this.emit(option.name(), arg); + // optional arg + } else if (option.optional) { + arg = argv[i+1]; + if (null == arg || ('-' == arg[0] && '-' != arg)) { + arg = null; + } else { + ++i; + } + this.emit(option.name(), arg); + // bool + } else { + this.emit(option.name()); + } + continue; + } + + // looks like an option + if (arg.length > 1 && '-' == arg[0]) { + unknownOptions.push(arg); + + // If the next argument looks like it might be + // an argument for this option, we pass it on. + // If it isn't, then it'll simply be ignored + if (argv[i+1] && '-' != argv[i+1][0]) { + unknownOptions.push(argv[++i]); + } + continue; + } + + // arg + args.push(arg); + } + + return { args: args, unknown: unknownOptions }; +}; + +/** + * Argument `name` is missing. + * + * @param {String} name + * @api private + */ + +Command.prototype.missingArgument = function(name){ + console.error(); + console.error(" error: missing required argument `%s'", name); + console.error(); + process.exit(1); +}; + +/** + * `Option` is missing an argument, but received `flag` or nothing. + * + * @param {String} option + * @param {String} flag + * @api private + */ + +Command.prototype.optionMissingArgument = function(option, flag){ + console.error(); + if (flag) { + console.error(" error: option `%s' argument missing, got `%s'", option.flags, flag); + } else { + console.error(" error: option `%s' argument missing", option.flags); + } + console.error(); + process.exit(1); +}; + +/** + * Unknown option `flag`. + * + * @param {String} flag + * @api private + */ + +Command.prototype.unknownOption = function(flag){ + console.error(); + console.error(" error: unknown option `%s'", flag); + console.error(); + process.exit(1); +}; + + +/** + * Set the program version to `str`. + * + * This method auto-registers the "-V, --version" flag + * which will print the version number when passed. + * + * @param {String} str + * @param {String} flags + * @return {Command} for chaining + * @api public + */ + +Command.prototype.version = function(str, flags){ + if (0 == arguments.length) return this._version; + this._version = str; + flags = flags || '-V, --version'; + this.option(flags, 'output the version number'); + this.on('version', function(){ + console.log(str); + process.exit(0); + }); + return this; +}; + +/** + * Set the description `str`. + * + * @param {String} str + * @return {String|Command} + * @api public + */ + +Command.prototype.description = function(str){ + if (0 == arguments.length) return this._description; + this._description = str; + return this; +}; + +/** + * Set / get the command usage `str`. + * + * @param {String} str + * @return {String|Command} + * @api public + */ + +Command.prototype.usage = function(str){ + var args = this._args.map(function(arg){ + return arg.required + ? '<' + arg.name + '>' + : '[' + arg.name + ']'; + }); + + var usage = '[options' + + (this.commands.length ? '] [command' : '') + + ']' + + (this._args.length ? ' ' + args : ''); + + if (0 == arguments.length) return this._usage || usage; + this._usage = str; + + return this; +}; + +/** + * Return the largest option length. + * + * @return {Number} + * @api private + */ + +Command.prototype.largestOptionLength = function(){ + return this.options.reduce(function(max, option){ + return Math.max(max, option.flags.length); + }, 0); +}; + +/** + * Return help for options. + * + * @return {String} + * @api private + */ + +Command.prototype.optionHelp = function(){ + var width = this.largestOptionLength(); + + // Prepend the help information + return [pad('-h, --help', width) + ' ' + 'output usage information'] + .concat(this.options.map(function(option){ + return pad(option.flags, width) + + ' ' + option.description; + })) + .join('\n'); +}; + +/** + * Return command help documentation. + * + * @return {String} + * @api private + */ + +Command.prototype.commandHelp = function(){ + if (!this.commands.length) return ''; + return [ + '' + , ' Commands:' + , '' + , this.commands.map(function(cmd){ + var args = cmd._args.map(function(arg){ + return arg.required + ? '<' + arg.name + '>' + : '[' + arg.name + ']'; + }).join(' '); + + return pad(cmd._name + + (cmd.options.length + ? ' [options]' + : '') + ' ' + args, 22) + + (cmd.description() + ? ' ' + cmd.description() + : ''); + }).join('\n').replace(/^/gm, ' ') + , '' + ].join('\n'); +}; + +/** + * Return program help documentation. + * + * @return {String} + * @api private + */ + +Command.prototype.helpInformation = function(){ + return [ + '' + , ' Usage: ' + this._name + ' ' + this.usage() + , '' + this.commandHelp() + , ' Options:' + , '' + , '' + this.optionHelp().replace(/^/gm, ' ') + , '' + , '' + ].join('\n'); +}; + +/** + * Output help information for this command + * + * @api public + */ + +Command.prototype.outputHelp = function(){ + process.stdout.write(this.helpInformation()); + this.emit('--help'); +}; + +/** + * Output help information and exit. + * + * @api public + */ + +Command.prototype.help = function(){ + this.outputHelp(); + process.exit(); +}; + +/** + * Camel-case the given `flag` + * + * @param {String} flag + * @return {String} + * @api private + */ + +function camelcase(flag) { + return flag.split('-').reduce(function(str, word){ + return str + word[0].toUpperCase() + word.slice(1); + }); +} + +/** + * Pad `str` to `width`. + * + * @param {String} str + * @param {Number} width + * @return {String} + * @api private + */ + +function pad(str, width) { + var len = Math.max(0, width - str.length); + return str + Array(len + 1).join(' '); +} + +/** + * Output help information if necessary + * + * @param {Command} command to output help for + * @param {Array} array of options to search for -h or --help + * @api private + */ + +function outputHelpIfNecessary(cmd, options) { + options = options || []; + for (var i = 0; i < options.length; i++) { + if (options[i] == '--help' || options[i] == '-h') { + cmd.outputHelp(); + process.exit(0); + } + } +} diff --git a/node_modules/commander/package.json b/node_modules/commander/package.json new file mode 100644 index 0000000..1fe85bd --- /dev/null +++ b/node_modules/commander/package.json @@ -0,0 +1,12 @@ +{ + "name": "commander" + , "version": "2.0.0" + , "description": "the complete solution for node.js command-line programs" + , "keywords": ["command", "option", "parser", "prompt", "stdin"] + , "author": "TJ Holowaychuk " + , "repository": { "type": "git", "url": "https://github.com/visionmedia/commander.js.git" } + , "devDependencies": { "should": ">= 0.0.1" } + , "scripts": { "test": "make test" } + , "main": "index" + , "engines": { "node": ">= 0.6.x" } +} diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml new file mode 100644 index 0000000..20a7068 --- /dev/null +++ b/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc new file mode 100644 index 0000000..146371e --- /dev/null +++ b/node_modules/debug/.eslintrc @@ -0,0 +1,14 @@ +{ + "env": { + "browser": true, + "node": true + }, + "globals": { + "chrome": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore new file mode 100644 index 0000000..5f60eec --- /dev/null +++ b/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml new file mode 100644 index 0000000..a764300 --- /dev/null +++ b/node_modules/debug/.travis.yml @@ -0,0 +1,20 @@ +sudo: false + +language: node_js + +node_js: + - "4" + - "6" + - "8" + +install: + - make install + +script: + - make lint + - make test + +matrix: + include: + - node_js: '8' + env: BROWSER=1 diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000..a1c0eaf --- /dev/null +++ b/node_modules/debug/CHANGELOG.md @@ -0,0 +1,378 @@ + +3.0.1 / 2017-08-24 +================== + + * Fix: Disable colors in Edge and Internet Explorer (#489) + +3.0.0 / 2017-08-08 +================== + + * Breaking: Remove DEBUG_FD (#406) + * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418) + * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408) + * Addition: document `enabled` flag (#465) + * Addition: add 256 colors mode (#481) + * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440) + * Update: component: update "ms" to v2.0.0 + * Update: separate the Node and Browser tests in Travis-CI + * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots + * Update: separate Node.js and web browser examples for organization + * Update: update "browserify" to v14.4.0 + * Fix: fix Readme typo (#473) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE new file mode 100644 index 0000000..658c933 --- /dev/null +++ b/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile new file mode 100644 index 0000000..3ddd136 --- /dev/null +++ b/node_modules/debug/Makefile @@ -0,0 +1,58 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +install: node_modules + +browser: dist/debug.js + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +dist/debug.js: src/*.js node_modules + @mkdir -p dist + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + +lint: + @eslint *.js src/*.js + +test-node: + @istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + @cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +test-browser: + @$(MAKE) browser + @karma start --single-run + +test-all: + @concurrently \ + "make test-node" \ + "make test-browser" + +test: + @if [ "x$(BROWSER)" = "x" ]; then \ + $(MAKE) test-node; \ + else \ + $(MAKE) test-browser; \ + fi + +clean: + rimraf dist coverage + +.PHONY: browser install clean lint test test-all test-node test-browser diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md new file mode 100644 index 0000000..1f3b08e --- /dev/null +++ b/node_modules/debug/README.md @@ -0,0 +1,367 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows note + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Note that PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Then, run the program to be debugged as usual. + + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/component.json b/node_modules/debug/component.json new file mode 100644 index 0000000..a2e9ad3 --- /dev/null +++ b/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "3.0.1", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "2.0.0" + } +} diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js new file mode 100644 index 0000000..103a82d --- /dev/null +++ b/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js new file mode 100644 index 0000000..7fc36fe --- /dev/null +++ b/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json new file mode 100644 index 0000000..1514200 --- /dev/null +++ b/node_modules/debug/package.json @@ -0,0 +1,49 @@ +{ + "name": "debug", + "version": "3.0.1", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "description": "small debugging utility", + "keywords": [ + "debug", + "log", + "debugger" + ], + "author": "TJ Holowaychuk ", + "contributors": [ + "Nathan Rajlich (http://n8.io)", + "Andrew Rhyne " + ], + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + }, + "devDependencies": { + "browserify": "14.4.0", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "main": "./src/index.js", + "browser": "./src/browser.js", + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + } +} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js new file mode 100644 index 0000000..f5149ff --- /dev/null +++ b/node_modules/debug/src/browser.js @@ -0,0 +1,195 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', + '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', + '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', + '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', + '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', + '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', + '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', + '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', + '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', + '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', + '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js new file mode 100644 index 0000000..77e6384 --- /dev/null +++ b/node_modules/debug/src/debug.js @@ -0,0 +1,225 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * Active `debug` instances. + */ +exports.instances = []; + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + var prevTime; + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + exports.instances.push(debug); + + return debug; +} + +function destroy () { + var index = exports.instances.indexOf(this); + if (index !== -1) { + exports.instances.splice(index, 1); + return true; + } else { + return false; + } +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var i; + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < exports.instances.length; i++) { + var instance = exports.instances[i]; + instance.enabled = exports.enabled(instance.namespace); + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js new file mode 100644 index 0000000..e12cf4d --- /dev/null +++ b/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js new file mode 100644 index 0000000..b85ec7e --- /dev/null +++ b/node_modules/debug/src/node.js @@ -0,0 +1,177 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [ 6, 2, 3, 4, 5, 1 ]; + +try { + var supportsColor = require('supports-color'); + if (supportsColor && supportsColor.level >= 2) { + exports.colors = [ + 20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, + 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, + 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, + 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, + 205, 206, 207, 208, 209, 214, 215, 220, 221 + ]; + } +} catch (err) { + // swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(process.stderr.fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .replace(/\s*\n\s*/g, ' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var colorCode = '\u001b[3' + (c < 8 ? c : '8;5;' + c); + var prefix = ' ' + colorCode + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toISOString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log() { + return process.stderr.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/diff/README.md b/node_modules/diff/README.md new file mode 100644 index 0000000..95bd8da --- /dev/null +++ b/node_modules/diff/README.md @@ -0,0 +1,101 @@ +# jsdiff + +[![Build Status](https://secure.travis-ci.org/kpdecker/jsdiff.png)](http://travis-ci.org/kpdecker/jsdiff) + +A javascript text differencing implementation. + +Based on the algorithm proposed in +["An O(ND) Difference Algorithm and its Variations" (Myers, 1986)](http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927). + +## Installation + + npm install diff + +or + + git clone git://github.com/kpdecker/jsdiff.git + +## API + +* JsDiff.diffChars(oldStr, newStr) + Diffs two blocks of text, comparing character by character. + + Returns a list of change objects (See below). + +* JsDiff.diffWords(oldStr, newStr) + Diffs two blocks of text, comparing word by word. + + Returns a list of change objects (See below). + +* JsDiff.diffLines(oldStr, newStr) + Diffs two blocks of text, comparing line by line. + + Returns a list of change objects (See below). + +* JsDiff.diffCss(oldStr, newStr) + Diffs two blocks of text, comparing CSS tokens. + + Returns a list of change objects (See below). + +* JsDiff.createPatch(fileName, oldStr, newStr, oldHeader, newHeader) + Creates a unified diff patch. + + Parameters: + * fileName : String to be output in the filename sections of the patch + * oldStr : Original string value + * newStr : New string value + * oldHeader : Additional information to include in the old file header + * newHeader : Additional information to include in thew new file header + +* JsDiff.applyPatch(oldStr, diffStr) + Applies a unified diff patch. + + Return a string containing new version of provided data. + +* convertChangesToXML(changes) + Converts a list of changes to a serialized XML format + +### Change Objects +Many of the methods above return change objects. These objects are consist of the following fields: + +* value: Text content +* added: True if the value was inserted into the new string +* removed: True of the value was removed from the old string + +Note that some cases may omit a particular flag field. Comparison on the flag fields should always be done in a truthy or falsy manner. + +## [Example](http://kpdecker.github.com/jsdiff) + +## License + +Software License Agreement (BSD License) + +Copyright (c) 2009-2011, Kevin Decker kpdecker@gmail.com + +All rights reserved. + +Redistribution and use of this software in source and binary forms, with or without modification, +are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above + copyright notice, this list of conditions and the + following disclaimer. + +* Redistributions in binary form must reproduce the above + copyright notice, this list of conditions and the + following disclaimer in the documentation and/or other + materials provided with the distribution. + +* Neither the name of Kevin Decker nor the names of its + contributors may be used to endorse or promote products + derived from this software without specific prior + written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR +IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR +CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER +IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT +OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/diff/diff.js b/node_modules/diff/diff.js new file mode 100644 index 0000000..a34c22a --- /dev/null +++ b/node_modules/diff/diff.js @@ -0,0 +1,354 @@ +/* See LICENSE file for terms of use */ + +/* + * Text diff implementation. + * + * This library supports the following APIS: + * JsDiff.diffChars: Character by character diff + * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace + * JsDiff.diffLines: Line based diff + * + * JsDiff.diffCss: Diff targeted at CSS content + * + * These methods are based on the implementation proposed in + * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986). + * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927 + */ +var JsDiff = (function() { + /*jshint maxparams: 5*/ + function clonePath(path) { + return { newPos: path.newPos, components: path.components.slice(0) }; + } + function removeEmpty(array) { + var ret = []; + for (var i = 0; i < array.length; i++) { + if (array[i]) { + ret.push(array[i]); + } + } + return ret; + } + function escapeHTML(s) { + var n = s; + n = n.replace(/&/g, '&'); + n = n.replace(//g, '>'); + n = n.replace(/"/g, '"'); + + return n; + } + + var Diff = function(ignoreWhitespace) { + this.ignoreWhitespace = ignoreWhitespace; + }; + Diff.prototype = { + diff: function(oldString, newString) { + // Handle the identity case (this is due to unrolling editLength == 0 + if (newString === oldString) { + return [{ value: newString }]; + } + if (!newString) { + return [{ value: oldString, removed: true }]; + } + if (!oldString) { + return [{ value: newString, added: true }]; + } + + newString = this.tokenize(newString); + oldString = this.tokenize(oldString); + + var newLen = newString.length, oldLen = oldString.length; + var maxEditLength = newLen + oldLen; + var bestPath = [{ newPos: -1, components: [] }]; + + // Seed editLength = 0 + var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0); + if (bestPath[0].newPos+1 >= newLen && oldPos+1 >= oldLen) { + return bestPath[0].components; + } + + for (var editLength = 1; editLength <= maxEditLength; editLength++) { + for (var diagonalPath = -1*editLength; diagonalPath <= editLength; diagonalPath+=2) { + var basePath; + var addPath = bestPath[diagonalPath-1], + removePath = bestPath[diagonalPath+1]; + oldPos = (removePath ? removePath.newPos : 0) - diagonalPath; + if (addPath) { + // No one else is going to attempt to use this value, clear it + bestPath[diagonalPath-1] = undefined; + } + + var canAdd = addPath && addPath.newPos+1 < newLen; + var canRemove = removePath && 0 <= oldPos && oldPos < oldLen; + if (!canAdd && !canRemove) { + bestPath[diagonalPath] = undefined; + continue; + } + + // Select the diagonal that we want to branch from. We select the prior + // path whose position in the new string is the farthest from the origin + // and does not pass the bounds of the diff graph + if (!canAdd || (canRemove && addPath.newPos < removePath.newPos)) { + basePath = clonePath(removePath); + this.pushComponent(basePath.components, oldString[oldPos], undefined, true); + } else { + basePath = clonePath(addPath); + basePath.newPos++; + this.pushComponent(basePath.components, newString[basePath.newPos], true, undefined); + } + + var oldPos = this.extractCommon(basePath, newString, oldString, diagonalPath); + + if (basePath.newPos+1 >= newLen && oldPos+1 >= oldLen) { + return basePath.components; + } else { + bestPath[diagonalPath] = basePath; + } + } + } + }, + + pushComponent: function(components, value, added, removed) { + var last = components[components.length-1]; + if (last && last.added === added && last.removed === removed) { + // We need to clone here as the component clone operation is just + // as shallow array clone + components[components.length-1] = + {value: this.join(last.value, value), added: added, removed: removed }; + } else { + components.push({value: value, added: added, removed: removed }); + } + }, + extractCommon: function(basePath, newString, oldString, diagonalPath) { + var newLen = newString.length, + oldLen = oldString.length, + newPos = basePath.newPos, + oldPos = newPos - diagonalPath; + while (newPos+1 < newLen && oldPos+1 < oldLen && this.equals(newString[newPos+1], oldString[oldPos+1])) { + newPos++; + oldPos++; + + this.pushComponent(basePath.components, newString[newPos], undefined, undefined); + } + basePath.newPos = newPos; + return oldPos; + }, + + equals: function(left, right) { + var reWhitespace = /\S/; + if (this.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right)) { + return true; + } else { + return left === right; + } + }, + join: function(left, right) { + return left + right; + }, + tokenize: function(value) { + return value; + } + }; + + var CharDiff = new Diff(); + + var WordDiff = new Diff(true); + var WordWithSpaceDiff = new Diff(); + WordDiff.tokenize = WordWithSpaceDiff.tokenize = function(value) { + return removeEmpty(value.split(/(\s+|\b)/)); + }; + + var CssDiff = new Diff(true); + CssDiff.tokenize = function(value) { + return removeEmpty(value.split(/([{}:;,]|\s+)/)); + }; + + var LineDiff = new Diff(); + LineDiff.tokenize = function(value) { + return value.split(/^/m); + }; + + return { + Diff: Diff, + + diffChars: function(oldStr, newStr) { return CharDiff.diff(oldStr, newStr); }, + diffWords: function(oldStr, newStr) { return WordDiff.diff(oldStr, newStr); }, + diffWordsWithSpace: function(oldStr, newStr) { return WordWithSpaceDiff.diff(oldStr, newStr); }, + diffLines: function(oldStr, newStr) { return LineDiff.diff(oldStr, newStr); }, + + diffCss: function(oldStr, newStr) { return CssDiff.diff(oldStr, newStr); }, + + createPatch: function(fileName, oldStr, newStr, oldHeader, newHeader) { + var ret = []; + + ret.push('Index: ' + fileName); + ret.push('==================================================================='); + ret.push('--- ' + fileName + (typeof oldHeader === 'undefined' ? '' : '\t' + oldHeader)); + ret.push('+++ ' + fileName + (typeof newHeader === 'undefined' ? '' : '\t' + newHeader)); + + var diff = LineDiff.diff(oldStr, newStr); + if (!diff[diff.length-1].value) { + diff.pop(); // Remove trailing newline add + } + diff.push({value: '', lines: []}); // Append an empty value to make cleanup easier + + function contextLines(lines) { + return lines.map(function(entry) { return ' ' + entry; }); + } + function eofNL(curRange, i, current) { + var last = diff[diff.length-2], + isLast = i === diff.length-2, + isLastOfType = i === diff.length-3 && (current.added !== last.added || current.removed !== last.removed); + + // Figure out if this is the last line for the given file and missing NL + if (!/\n$/.test(current.value) && (isLast || isLastOfType)) { + curRange.push('\\ No newline at end of file'); + } + } + + var oldRangeStart = 0, newRangeStart = 0, curRange = [], + oldLine = 1, newLine = 1; + for (var i = 0; i < diff.length; i++) { + var current = diff[i], + lines = current.lines || current.value.replace(/\n$/, '').split('\n'); + current.lines = lines; + + if (current.added || current.removed) { + if (!oldRangeStart) { + var prev = diff[i-1]; + oldRangeStart = oldLine; + newRangeStart = newLine; + + if (prev) { + curRange = contextLines(prev.lines.slice(-4)); + oldRangeStart -= curRange.length; + newRangeStart -= curRange.length; + } + } + curRange.push.apply(curRange, lines.map(function(entry) { return (current.added?'+':'-') + entry; })); + eofNL(curRange, i, current); + + if (current.added) { + newLine += lines.length; + } else { + oldLine += lines.length; + } + } else { + if (oldRangeStart) { + // Close out any changes that have been output (or join overlapping) + if (lines.length <= 8 && i < diff.length-2) { + // Overlapping + curRange.push.apply(curRange, contextLines(lines)); + } else { + // end the range and output + var contextSize = Math.min(lines.length, 4); + ret.push( + '@@ -' + oldRangeStart + ',' + (oldLine-oldRangeStart+contextSize) + + ' +' + newRangeStart + ',' + (newLine-newRangeStart+contextSize) + + ' @@'); + ret.push.apply(ret, curRange); + ret.push.apply(ret, contextLines(lines.slice(0, contextSize))); + if (lines.length <= 4) { + eofNL(ret, i, current); + } + + oldRangeStart = 0; newRangeStart = 0; curRange = []; + } + } + oldLine += lines.length; + newLine += lines.length; + } + } + + return ret.join('\n') + '\n'; + }, + + applyPatch: function(oldStr, uniDiff) { + var diffstr = uniDiff.split('\n'); + var diff = []; + var remEOFNL = false, + addEOFNL = false; + + for (var i = (diffstr[0][0]==='I'?4:0); i < diffstr.length; i++) { + if(diffstr[i][0] === '@') { + var meh = diffstr[i].split(/@@ -(\d+),(\d+) \+(\d+),(\d+) @@/); + diff.unshift({ + start:meh[3], + oldlength:meh[2], + oldlines:[], + newlength:meh[4], + newlines:[] + }); + } else if(diffstr[i][0] === '+') { + diff[0].newlines.push(diffstr[i].substr(1)); + } else if(diffstr[i][0] === '-') { + diff[0].oldlines.push(diffstr[i].substr(1)); + } else if(diffstr[i][0] === ' ') { + diff[0].newlines.push(diffstr[i].substr(1)); + diff[0].oldlines.push(diffstr[i].substr(1)); + } else if(diffstr[i][0] === '\\') { + if (diffstr[i-1][0] === '+') { + remEOFNL = true; + } else if(diffstr[i-1][0] === '-') { + addEOFNL = true; + } + } + } + + var str = oldStr.split('\n'); + for (var i = diff.length - 1; i >= 0; i--) { + var d = diff[i]; + for (var j = 0; j < d.oldlength; j++) { + if(str[d.start-1+j] !== d.oldlines[j]) { + return false; + } + } + Array.prototype.splice.apply(str,[d.start-1,+d.oldlength].concat(d.newlines)); + } + + if (remEOFNL) { + while (!str[str.length-1]) { + str.pop(); + } + } else if (addEOFNL) { + str.push(''); + } + return str.join('\n'); + }, + + convertChangesToXML: function(changes){ + var ret = []; + for ( var i = 0; i < changes.length; i++) { + var change = changes[i]; + if (change.added) { + ret.push(''); + } else if (change.removed) { + ret.push(''); + } + + ret.push(escapeHTML(change.value)); + + if (change.added) { + ret.push(''); + } else if (change.removed) { + ret.push(''); + } + } + return ret.join(''); + }, + + // See: http://code.google.com/p/google-diff-match-patch/wiki/API + convertChangesToDMP: function(changes){ + var ret = [], change; + for ( var i = 0; i < changes.length; i++) { + change = changes[i]; + ret.push([(change.added ? 1 : change.removed ? -1 : 0), change.value]); + } + return ret; + } + }; +})(); + +if (typeof module !== 'undefined') { + module.exports = JsDiff; +} diff --git a/node_modules/diff/package.json b/node_modules/diff/package.json new file mode 100644 index 0000000..4c5d6fc --- /dev/null +++ b/node_modules/diff/package.json @@ -0,0 +1,42 @@ +{ + "name": "diff", + "version": "1.0.7", + "description": "A javascript text diff implementation.", + "keywords": [ + "diff", + "javascript" + ], + "maintainers": [ + "Kevin Decker (http://incaseofstairs.com)" + ], + "bugs": { + "email": "kpdecker@gmail.com", + "url": "http://github.com/kpdecker/jsdiff/issues" + }, + "licenses": [ + { + "type": "BSD", + "url": "http://github.com/kpdecker/jsdiff/blob/master/LICENSE" + } + ], + "repository": { + "type": "git", + "url": "git://github.com/kpdecker/jsdiff.git" + }, + "engines": { + "node": ">=0.3.1" + }, + "main": "./diff", + "scripts": { + "test": "node_modules/.bin/mocha test/*.js" + }, + "dependencies": {}, + "devDependencies": { + "mocha": "~1.6", + "should": "~1.2" + }, + "optionalDependencies": {}, + "files": [ + "diff.js" + ] +} diff --git a/node_modules/expect.js/.npmignore b/node_modules/expect.js/.npmignore new file mode 100644 index 0000000..26ef5d8 --- /dev/null +++ b/node_modules/expect.js/.npmignore @@ -0,0 +1,3 @@ +support +test +Makefile diff --git a/node_modules/expect.js/History.md b/node_modules/expect.js/History.md new file mode 100644 index 0000000..e03f91f --- /dev/null +++ b/node_modules/expect.js/History.md @@ -0,0 +1,54 @@ + +0.3.0 / 2014-02-20 +================== + + * renmaed to `index.js` + * added repository to package.json + * remove unused variable and merge + * simpify isDate() and remove unnecessary semicolon. + * Add .withArgs() syntax for building scenario + * eql(): fix wrong order of actual vs. expected. + * Added formatting for Error objects + * Add support for 'regexp' type and eql comparison of regular expressions. + * Better to follow the same coding style + * Use 'showDiff' flag + * Add 'actual' & 'expected' property to the thrown error + * Pass .fail() unit test + * Ignore 'script*' global leak in chrome + * Exposed object stringification function + * Use isRegExp in Assertion::throwException. Fix #25 + * Cleaned up local variables + +0.2.0 / 2012-10-19 +================== + + * fix isRegExp bug in some edge cases + * add closure to all assertion messages deferring costly inspects + until there is actually a failure + * fix `make test` for recent mochas + * add inspect() case for DOM elements + * relax failure msg null check + * add explicit failure through `expect().fail()` + * clarified all `empty` functionality in README example + * added docs for throwException fn/regexp signatures + +0.1.2 / 2012-02-04 +================== + + * Added regexp matching support for exceptions. + * Added support for throwException callback. + * Added `throwError` synonym to `throwException`. + * Added object support for `.empty`. + * Fixed `.a('object')` with nulls, and english error in error message. + * Fix bug `indexOf` (IE). [hokaccha] + * Fixed object property checking with `undefined` as value. [vovik] + +0.1.1 / 2011-12-18 +================== + + * Fixed typo + +0.1.0 / 2011-12-18 +================== + + * Initial import diff --git a/node_modules/expect.js/README.md b/node_modules/expect.js/README.md new file mode 100644 index 0000000..2683ed3 --- /dev/null +++ b/node_modules/expect.js/README.md @@ -0,0 +1,263 @@ +# Expect + +Minimalistic BDD assertion toolkit based on +[should.js](http://github.com/visionmedia/should.js) + +```js +expect(window.r).to.be(undefined); +expect({ a: 'b' }).to.eql({ a: 'b' }) +expect(5).to.be.a('number'); +expect([]).to.be.an('array'); +expect(window).not.to.be.an(Image); +``` + +## Features + +- Cross-browser: works on IE6+, Firefox, Safari, Chrome, Opera. +- Compatible with all test frameworks. +- Node.JS ready (`require('expect.js')`). +- Standalone. Single global with no prototype extensions or shims. + +## How to use + +### Node + +Install it with NPM or add it to your `package.json`: + +``` +$ npm install expect.js +``` + +Then: + +```js +var expect = require('expect.js'); +``` + +### Browser + +Expose the `expect.js` found at the top level of this repository. + +```html + +``` + +## API + +**ok**: asserts that the value is _truthy_ or not + +```js +expect(1).to.be.ok(); +expect(true).to.be.ok(); +expect({}).to.be.ok(); +expect(0).to.not.be.ok(); +``` + +**be** / **equal**: asserts `===` equality + +```js +expect(1).to.be(1) +expect(NaN).not.to.equal(NaN); +expect(1).not.to.be(true) +expect('1').to.not.be(1); +``` + +**eql**: asserts loose equality that works with objects + +```js +expect({ a: 'b' }).to.eql({ a: 'b' }); +expect(1).to.eql('1'); +``` + +**a**/**an**: asserts `typeof` with support for `array` type and `instanceof` + +```js +// typeof with optional `array` +expect(5).to.be.a('number'); +expect([]).to.be.an('array'); // works +expect([]).to.be.an('object'); // works too, since it uses `typeof` + +// constructors +expect(5).to.be.a(Number); +expect([]).to.be.an(Array); +expect(tobi).to.be.a(Ferret); +expect(person).to.be.a(Mammal); +``` + +**match**: asserts `String` regular expression match + +```js +expect(program.version).to.match(/[0-9]+\.[0-9]+\.[0-9]+/); +``` + +**contain**: asserts indexOf for an array or string + +```js +expect([1, 2]).to.contain(1); +expect('hello world').to.contain('world'); +``` + +**length**: asserts array `.length` + +```js +expect([]).to.have.length(0); +expect([1,2,3]).to.have.length(3); +``` + +**empty**: asserts that an array is empty or not + +```js +expect([]).to.be.empty(); +expect({}).to.be.empty(); +expect({ length: 0, duck: 'typing' }).to.be.empty(); +expect({ my: 'object' }).to.not.be.empty(); +expect([1,2,3]).to.not.be.empty(); +``` + +**property**: asserts presence of an own property (and value optionally) + +```js +expect(window).to.have.property('expect') +expect(window).to.have.property('expect', expect) +expect({a: 'b'}).to.have.property('a'); +``` + +**key**/**keys**: asserts the presence of a key. Supports the `only` modifier + +```js +expect({ a: 'b' }).to.have.key('a'); +expect({ a: 'b', c: 'd' }).to.only.have.keys('a', 'c'); +expect({ a: 'b', c: 'd' }).to.only.have.keys(['a', 'c']); +expect({ a: 'b', c: 'd' }).to.not.only.have.key('a'); +``` + +**throwException**/**throwError**: asserts that the `Function` throws or not when called + +```js +expect(fn).to.throwError(); // synonym of throwException +expect(fn).to.throwException(function (e) { // get the exception object + expect(e).to.be.a(SyntaxError); +}); +expect(fn).to.throwException(/matches the exception message/); +expect(fn2).to.not.throwException(); +``` + +**withArgs**: creates anonymous function to call fn with arguments + +```js +expect(fn).withArgs(invalid, arg).to.throwException(); +expect(fn).withArgs(valid, arg).to.not.throwException(); +``` + +**within**: asserts a number within a range + +```js +expect(1).to.be.within(0, Infinity); +``` + +**greaterThan**/**above**: asserts `>` + +```js +expect(3).to.be.above(0); +expect(5).to.be.greaterThan(3); +``` + +**lessThan**/**below**: asserts `<` + +```js +expect(0).to.be.below(3); +expect(1).to.be.lessThan(3); +``` + +**fail**: explicitly forces failure. + +```js +expect().fail() +expect().fail("Custom failure message") +``` + +## Using with a test framework + +For example, if you create a test suite with +[mocha](http://github.com/visionmedia/mocha). + +Let's say we wanted to test the following program: + +**math.js** + +```js +function add (a, b) { return a + b; }; +``` + +Our test file would look like this: + +```js +describe('test suite', function () { + it('should expose a function', function () { + expect(add).to.be.a('function'); + }); + + it('should do math', function () { + expect(add(1, 3)).to.equal(4); + }); +}); +``` + +If a certain expectation fails, an exception will be raised which gets captured +and shown/processed by the test runner. + +## Differences with should.js + +- No need for static `should` methods like `should.strictEqual`. For example, + `expect(obj).to.be(undefined)` works well. +- Some API simplifications / changes. +- API changes related to browser compatibility. + +## Running tests + +Clone the repository and install the developer dependencies: + +``` +git clone git://github.com/LearnBoost/expect.js.git expect +cd expect && npm install +``` + +### Node + +`make test` + +### Browser + +`make test-browser` + +and point your browser(s) to `http://localhost:3000/test/` + +## Credits + +(The MIT License) + +Copyright (c) 2011 Guillermo Rauch <guillermo@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +### 3rd-party + +Heavily borrows from [should.js](http://github.com/visionmedia/should.js) by TJ +Holowaychuck - MIT. diff --git a/node_modules/expect.js/index.js b/node_modules/expect.js/index.js new file mode 100644 index 0000000..b1e921d --- /dev/null +++ b/node_modules/expect.js/index.js @@ -0,0 +1,1284 @@ +(function (global, module) { + + var exports = module.exports; + + /** + * Exports. + */ + + module.exports = expect; + expect.Assertion = Assertion; + + /** + * Exports version. + */ + + expect.version = '0.3.1'; + + /** + * Possible assertion flags. + */ + + var flags = { + not: ['to', 'be', 'have', 'include', 'only'] + , to: ['be', 'have', 'include', 'only', 'not'] + , only: ['have'] + , have: ['own'] + , be: ['an'] + }; + + function expect (obj) { + return new Assertion(obj); + } + + /** + * Constructor + * + * @api private + */ + + function Assertion (obj, flag, parent) { + this.obj = obj; + this.flags = {}; + + if (undefined != parent) { + this.flags[flag] = true; + + for (var i in parent.flags) { + if (parent.flags.hasOwnProperty(i)) { + this.flags[i] = true; + } + } + } + + var $flags = flag ? flags[flag] : keys(flags) + , self = this; + + if ($flags) { + for (var i = 0, l = $flags.length; i < l; i++) { + // avoid recursion + if (this.flags[$flags[i]]) continue; + + var name = $flags[i] + , assertion = new Assertion(this.obj, name, this) + + if ('function' == typeof Assertion.prototype[name]) { + // clone the function, make sure we dont touch the prot reference + var old = this[name]; + this[name] = function () { + return old.apply(self, arguments); + }; + + for (var fn in Assertion.prototype) { + if (Assertion.prototype.hasOwnProperty(fn) && fn != name) { + this[name][fn] = bind(assertion[fn], assertion); + } + } + } else { + this[name] = assertion; + } + } + } + } + + /** + * Performs an assertion + * + * @api private + */ + + Assertion.prototype.assert = function (truth, msg, error, expected) { + var msg = this.flags.not ? error : msg + , ok = this.flags.not ? !truth : truth + , err; + + if (!ok) { + err = new Error(msg.call(this)); + if (arguments.length > 3) { + err.actual = this.obj; + err.expected = expected; + err.showDiff = true; + } + throw err; + } + + this.and = new Assertion(this.obj); + }; + + /** + * Check if the value is truthy + * + * @api public + */ + + Assertion.prototype.ok = function () { + this.assert( + !!this.obj + , function(){ return 'expected ' + i(this.obj) + ' to be truthy' } + , function(){ return 'expected ' + i(this.obj) + ' to be falsy' }); + }; + + /** + * Creates an anonymous function which calls fn with arguments. + * + * @api public + */ + + Assertion.prototype.withArgs = function() { + expect(this.obj).to.be.a('function'); + var fn = this.obj; + var args = Array.prototype.slice.call(arguments); + return expect(function() { fn.apply(null, args); }); + }; + + /** + * Assert that the function throws. + * + * @param {Function|RegExp} callback, or regexp to match error string against + * @api public + */ + + Assertion.prototype.throwError = + Assertion.prototype.throwException = function (fn) { + expect(this.obj).to.be.a('function'); + + var thrown = false + , not = this.flags.not; + + try { + this.obj(); + } catch (e) { + if (isRegExp(fn)) { + var subject = 'string' == typeof e ? e : e.message; + if (not) { + expect(subject).to.not.match(fn); + } else { + expect(subject).to.match(fn); + } + } else if ('function' == typeof fn) { + fn(e); + } + thrown = true; + } + + if (isRegExp(fn) && not) { + // in the presence of a matcher, ensure the `not` only applies to + // the matching. + this.flags.not = false; + } + + var name = this.obj.name || 'fn'; + this.assert( + thrown + , function(){ return 'expected ' + name + ' to throw an exception' } + , function(){ return 'expected ' + name + ' not to throw an exception' }); + }; + + /** + * Checks if the array is empty. + * + * @api public + */ + + Assertion.prototype.empty = function () { + var expectation; + + if ('object' == typeof this.obj && null !== this.obj && !isArray(this.obj)) { + if ('number' == typeof this.obj.length) { + expectation = !this.obj.length; + } else { + expectation = !keys(this.obj).length; + } + } else { + if ('string' != typeof this.obj) { + expect(this.obj).to.be.an('object'); + } + + expect(this.obj).to.have.property('length'); + expectation = !this.obj.length; + } + + this.assert( + expectation + , function(){ return 'expected ' + i(this.obj) + ' to be empty' } + , function(){ return 'expected ' + i(this.obj) + ' to not be empty' }); + return this; + }; + + /** + * Checks if the obj exactly equals another. + * + * @api public + */ + + Assertion.prototype.be = + Assertion.prototype.equal = function (obj) { + this.assert( + obj === this.obj + , function(){ return 'expected ' + i(this.obj) + ' to equal ' + i(obj) } + , function(){ return 'expected ' + i(this.obj) + ' to not equal ' + i(obj) }); + return this; + }; + + /** + * Checks if the obj sortof equals another. + * + * @api public + */ + + Assertion.prototype.eql = function (obj) { + this.assert( + expect.eql(this.obj, obj) + , function(){ return 'expected ' + i(this.obj) + ' to sort of equal ' + i(obj) } + , function(){ return 'expected ' + i(this.obj) + ' to sort of not equal ' + i(obj) } + , obj); + return this; + }; + + /** + * Assert within start to finish (inclusive). + * + * @param {Number} start + * @param {Number} finish + * @api public + */ + + Assertion.prototype.within = function (start, finish) { + var range = start + '..' + finish; + this.assert( + this.obj >= start && this.obj <= finish + , function(){ return 'expected ' + i(this.obj) + ' to be within ' + range } + , function(){ return 'expected ' + i(this.obj) + ' to not be within ' + range }); + return this; + }; + + /** + * Assert typeof / instance of + * + * @api public + */ + + Assertion.prototype.a = + Assertion.prototype.an = function (type) { + if ('string' == typeof type) { + // proper english in error msg + var n = /^[aeiou]/.test(type) ? 'n' : ''; + + // typeof with support for 'array' + this.assert( + 'array' == type ? isArray(this.obj) : + 'regexp' == type ? isRegExp(this.obj) : + 'object' == type + ? 'object' == typeof this.obj && null !== this.obj + : type == typeof this.obj + , function(){ return 'expected ' + i(this.obj) + ' to be a' + n + ' ' + type } + , function(){ return 'expected ' + i(this.obj) + ' not to be a' + n + ' ' + type }); + } else { + // instanceof + var name = type.name || 'supplied constructor'; + this.assert( + this.obj instanceof type + , function(){ return 'expected ' + i(this.obj) + ' to be an instance of ' + name } + , function(){ return 'expected ' + i(this.obj) + ' not to be an instance of ' + name }); + } + + return this; + }; + + /** + * Assert numeric value above _n_. + * + * @param {Number} n + * @api public + */ + + Assertion.prototype.greaterThan = + Assertion.prototype.above = function (n) { + this.assert( + this.obj > n + , function(){ return 'expected ' + i(this.obj) + ' to be above ' + n } + , function(){ return 'expected ' + i(this.obj) + ' to be below ' + n }); + return this; + }; + + /** + * Assert numeric value below _n_. + * + * @param {Number} n + * @api public + */ + + Assertion.prototype.lessThan = + Assertion.prototype.below = function (n) { + this.assert( + this.obj < n + , function(){ return 'expected ' + i(this.obj) + ' to be below ' + n } + , function(){ return 'expected ' + i(this.obj) + ' to be above ' + n }); + return this; + }; + + /** + * Assert string value matches _regexp_. + * + * @param {RegExp} regexp + * @api public + */ + + Assertion.prototype.match = function (regexp) { + this.assert( + regexp.exec(this.obj) + , function(){ return 'expected ' + i(this.obj) + ' to match ' + regexp } + , function(){ return 'expected ' + i(this.obj) + ' not to match ' + regexp }); + return this; + }; + + /** + * Assert property "length" exists and has value of _n_. + * + * @param {Number} n + * @api public + */ + + Assertion.prototype.length = function (n) { + expect(this.obj).to.have.property('length'); + var len = this.obj.length; + this.assert( + n == len + , function(){ return 'expected ' + i(this.obj) + ' to have a length of ' + n + ' but got ' + len } + , function(){ return 'expected ' + i(this.obj) + ' to not have a length of ' + len }); + return this; + }; + + /** + * Assert property _name_ exists, with optional _val_. + * + * @param {String} name + * @param {Mixed} val + * @api public + */ + + Assertion.prototype.property = function (name, val) { + if (this.flags.own) { + this.assert( + Object.prototype.hasOwnProperty.call(this.obj, name) + , function(){ return 'expected ' + i(this.obj) + ' to have own property ' + i(name) } + , function(){ return 'expected ' + i(this.obj) + ' to not have own property ' + i(name) }); + return this; + } + + if (this.flags.not && undefined !== val) { + if (undefined === this.obj[name]) { + throw new Error(i(this.obj) + ' has no property ' + i(name)); + } + } else { + var hasProp; + try { + hasProp = name in this.obj + } catch (e) { + hasProp = undefined !== this.obj[name] + } + + this.assert( + hasProp + , function(){ return 'expected ' + i(this.obj) + ' to have a property ' + i(name) } + , function(){ return 'expected ' + i(this.obj) + ' to not have a property ' + i(name) }); + } + + if (undefined !== val) { + this.assert( + val === this.obj[name] + , function(){ return 'expected ' + i(this.obj) + ' to have a property ' + i(name) + + ' of ' + i(val) + ', but got ' + i(this.obj[name]) } + , function(){ return 'expected ' + i(this.obj) + ' to not have a property ' + i(name) + + ' of ' + i(val) }); + } + + this.obj = this.obj[name]; + return this; + }; + + /** + * Assert that the array contains _obj_ or string contains _obj_. + * + * @param {Mixed} obj|string + * @api public + */ + + Assertion.prototype.string = + Assertion.prototype.contain = function (obj) { + if ('string' == typeof this.obj) { + this.assert( + ~this.obj.indexOf(obj) + , function(){ return 'expected ' + i(this.obj) + ' to contain ' + i(obj) } + , function(){ return 'expected ' + i(this.obj) + ' to not contain ' + i(obj) }); + } else { + this.assert( + ~indexOf(this.obj, obj) + , function(){ return 'expected ' + i(this.obj) + ' to contain ' + i(obj) } + , function(){ return 'expected ' + i(this.obj) + ' to not contain ' + i(obj) }); + } + return this; + }; + + /** + * Assert exact keys or inclusion of keys by using + * the `.own` modifier. + * + * @param {Array|String ...} keys + * @api public + */ + + Assertion.prototype.key = + Assertion.prototype.keys = function ($keys) { + var str + , ok = true; + + $keys = isArray($keys) + ? $keys + : Array.prototype.slice.call(arguments); + + if (!$keys.length) throw new Error('keys required'); + + var actual = keys(this.obj) + , len = $keys.length; + + // Inclusion + ok = every($keys, function (key) { + return ~indexOf(actual, key); + }); + + // Strict + if (!this.flags.not && this.flags.only) { + ok = ok && $keys.length == actual.length; + } + + // Key string + if (len > 1) { + $keys = map($keys, function (key) { + return i(key); + }); + var last = $keys.pop(); + str = $keys.join(', ') + ', and ' + last; + } else { + str = i($keys[0]); + } + + // Form + str = (len > 1 ? 'keys ' : 'key ') + str; + + // Have / include + str = (!this.flags.only ? 'include ' : 'only have ') + str; + + // Assertion + this.assert( + ok + , function(){ return 'expected ' + i(this.obj) + ' to ' + str } + , function(){ return 'expected ' + i(this.obj) + ' to not ' + str }); + + return this; + }; + + /** + * Assert a failure. + * + * @param {String ...} custom message + * @api public + */ + Assertion.prototype.fail = function (msg) { + var error = function() { return msg || "explicit failure"; } + this.assert(false, error, error); + return this; + }; + + /** + * Function bind implementation. + */ + + function bind (fn, scope) { + return function () { + return fn.apply(scope, arguments); + } + } + + /** + * Array every compatibility + * + * @see bit.ly/5Fq1N2 + * @api public + */ + + function every (arr, fn, thisObj) { + var scope = thisObj || global; + for (var i = 0, j = arr.length; i < j; ++i) { + if (!fn.call(scope, arr[i], i, arr)) { + return false; + } + } + return true; + } + + /** + * Array indexOf compatibility. + * + * @see bit.ly/a5Dxa2 + * @api public + */ + + function indexOf (arr, o, i) { + if (Array.prototype.indexOf) { + return Array.prototype.indexOf.call(arr, o, i); + } + + if (arr.length === undefined) { + return -1; + } + + for (var j = arr.length, i = i < 0 ? i + j < 0 ? 0 : i + j : i || 0 + ; i < j && arr[i] !== o; i++); + + return j <= i ? -1 : i; + } + + // https://gist.github.com/1044128/ + var getOuterHTML = function(element) { + if ('outerHTML' in element) return element.outerHTML; + var ns = "http://www.w3.org/1999/xhtml"; + var container = document.createElementNS(ns, '_'); + var xmlSerializer = new XMLSerializer(); + var html; + if (document.xmlVersion) { + return xmlSerializer.serializeToString(element); + } else { + container.appendChild(element.cloneNode(false)); + html = container.innerHTML.replace('><', '>' + element.innerHTML + '<'); + container.innerHTML = ''; + return html; + } + }; + + // Returns true if object is a DOM element. + var isDOMElement = function (object) { + if (typeof HTMLElement === 'object') { + return object instanceof HTMLElement; + } else { + return object && + typeof object === 'object' && + object.nodeType === 1 && + typeof object.nodeName === 'string'; + } + }; + + /** + * Inspects an object. + * + * @see taken from node.js `util` module (copyright Joyent, MIT license) + * @api private + */ + + function i (obj, showHidden, depth) { + var seen = []; + + function stylize (str) { + return str; + } + + function format (value, recurseTimes) { + // Provide a hook for user-specified inspect functions. + // Check that value is an object with an inspect function on it + if (value && typeof value.inspect === 'function' && + // Filter out the util module, it's inspect function is special + value !== exports && + // Also filter out any prototype objects using the circular check. + !(value.constructor && value.constructor.prototype === value)) { + return value.inspect(recurseTimes); + } + + // Primitive types cannot have properties + switch (typeof value) { + case 'undefined': + return stylize('undefined', 'undefined'); + + case 'string': + var simple = '\'' + json.stringify(value).replace(/^"|"$/g, '') + .replace(/'/g, "\\'") + .replace(/\\"/g, '"') + '\''; + return stylize(simple, 'string'); + + case 'number': + return stylize('' + value, 'number'); + + case 'boolean': + return stylize('' + value, 'boolean'); + } + // For some reason typeof null is "object", so special case here. + if (value === null) { + return stylize('null', 'null'); + } + + if (isDOMElement(value)) { + return getOuterHTML(value); + } + + // Look up the keys of the object. + var visible_keys = keys(value); + var $keys = showHidden ? Object.getOwnPropertyNames(value) : visible_keys; + + // Functions without properties can be shortcutted. + if (typeof value === 'function' && $keys.length === 0) { + if (isRegExp(value)) { + return stylize('' + value, 'regexp'); + } else { + var name = value.name ? ': ' + value.name : ''; + return stylize('[Function' + name + ']', 'special'); + } + } + + // Dates without properties can be shortcutted + if (isDate(value) && $keys.length === 0) { + return stylize(value.toUTCString(), 'date'); + } + + // Error objects can be shortcutted + if (value instanceof Error) { + return stylize("["+value.toString()+"]", 'Error'); + } + + var base, type, braces; + // Determine the object type + if (isArray(value)) { + type = 'Array'; + braces = ['[', ']']; + } else { + type = 'Object'; + braces = ['{', '}']; + } + + // Make functions say that they are functions + if (typeof value === 'function') { + var n = value.name ? ': ' + value.name : ''; + base = (isRegExp(value)) ? ' ' + value : ' [Function' + n + ']'; + } else { + base = ''; + } + + // Make dates with properties first say the date + if (isDate(value)) { + base = ' ' + value.toUTCString(); + } + + if ($keys.length === 0) { + return braces[0] + base + braces[1]; + } + + if (recurseTimes < 0) { + if (isRegExp(value)) { + return stylize('' + value, 'regexp'); + } else { + return stylize('[Object]', 'special'); + } + } + + seen.push(value); + + var output = map($keys, function (key) { + var name, str; + if (value.__lookupGetter__) { + if (value.__lookupGetter__(key)) { + if (value.__lookupSetter__(key)) { + str = stylize('[Getter/Setter]', 'special'); + } else { + str = stylize('[Getter]', 'special'); + } + } else { + if (value.__lookupSetter__(key)) { + str = stylize('[Setter]', 'special'); + } + } + } + if (indexOf(visible_keys, key) < 0) { + name = '[' + key + ']'; + } + if (!str) { + if (indexOf(seen, value[key]) < 0) { + if (recurseTimes === null) { + str = format(value[key]); + } else { + str = format(value[key], recurseTimes - 1); + } + if (str.indexOf('\n') > -1) { + if (isArray(value)) { + str = map(str.split('\n'), function (line) { + return ' ' + line; + }).join('\n').substr(2); + } else { + str = '\n' + map(str.split('\n'), function (line) { + return ' ' + line; + }).join('\n'); + } + } + } else { + str = stylize('[Circular]', 'special'); + } + } + if (typeof name === 'undefined') { + if (type === 'Array' && key.match(/^\d+$/)) { + return str; + } + name = json.stringify('' + key); + if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) { + name = name.substr(1, name.length - 2); + name = stylize(name, 'name'); + } else { + name = name.replace(/'/g, "\\'") + .replace(/\\"/g, '"') + .replace(/(^"|"$)/g, "'"); + name = stylize(name, 'string'); + } + } + + return name + ': ' + str; + }); + + seen.pop(); + + var numLinesEst = 0; + var length = reduce(output, function (prev, cur) { + numLinesEst++; + if (indexOf(cur, '\n') >= 0) numLinesEst++; + return prev + cur.length + 1; + }, 0); + + if (length > 50) { + output = braces[0] + + (base === '' ? '' : base + '\n ') + + ' ' + + output.join(',\n ') + + ' ' + + braces[1]; + + } else { + output = braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1]; + } + + return output; + } + return format(obj, (typeof depth === 'undefined' ? 2 : depth)); + } + + expect.stringify = i; + + function isArray (ar) { + return Object.prototype.toString.call(ar) === '[object Array]'; + } + + function isRegExp(re) { + var s; + try { + s = '' + re; + } catch (e) { + return false; + } + + return re instanceof RegExp || // easy case + // duck-type for context-switching evalcx case + typeof(re) === 'function' && + re.constructor.name === 'RegExp' && + re.compile && + re.test && + re.exec && + s.match(/^\/.*\/[gim]{0,3}$/); + } + + function isDate(d) { + return d instanceof Date; + } + + function keys (obj) { + if (Object.keys) { + return Object.keys(obj); + } + + var keys = []; + + for (var i in obj) { + if (Object.prototype.hasOwnProperty.call(obj, i)) { + keys.push(i); + } + } + + return keys; + } + + function map (arr, mapper, that) { + if (Array.prototype.map) { + return Array.prototype.map.call(arr, mapper, that); + } + + var other= new Array(arr.length); + + for (var i= 0, n = arr.length; i= 2) { + var rv = arguments[1]; + } else { + do { + if (i in this) { + rv = this[i++]; + break; + } + + // if array contains no values, no initial value to return + if (++i >= len) + throw new TypeError(); + } while (true); + } + + for (; i < len; i++) { + if (i in this) + rv = fun.call(null, rv, this[i], i, this); + } + + return rv; + } + + /** + * Asserts deep equality + * + * @see taken from node.js `assert` module (copyright Joyent, MIT license) + * @api private + */ + + expect.eql = function eql(actual, expected) { + // 7.1. All identical values are equivalent, as determined by ===. + if (actual === expected) { + return true; + } else if ('undefined' != typeof Buffer + && Buffer.isBuffer(actual) && Buffer.isBuffer(expected)) { + if (actual.length != expected.length) return false; + + for (var i = 0; i < actual.length; i++) { + if (actual[i] !== expected[i]) return false; + } + + return true; + + // 7.2. If the expected value is a Date object, the actual value is + // equivalent if it is also a Date object that refers to the same time. + } else if (actual instanceof Date && expected instanceof Date) { + return actual.getTime() === expected.getTime(); + + // 7.3. Other pairs that do not both pass typeof value == "object", + // equivalence is determined by ==. + } else if (typeof actual != 'object' && typeof expected != 'object') { + return actual == expected; + // If both are regular expression use the special `regExpEquiv` method + // to determine equivalence. + } else if (isRegExp(actual) && isRegExp(expected)) { + return regExpEquiv(actual, expected); + // 7.4. For all other Object pairs, including Array objects, equivalence is + // determined by having the same number of owned properties (as verified + // with Object.prototype.hasOwnProperty.call), the same set of keys + // (although not necessarily the same order), equivalent values for every + // corresponding key, and an identical "prototype" property. Note: this + // accounts for both named and indexed properties on Arrays. + } else { + return objEquiv(actual, expected); + } + }; + + function isUndefinedOrNull (value) { + return value === null || value === undefined; + } + + function isArguments (object) { + return Object.prototype.toString.call(object) == '[object Arguments]'; + } + + function regExpEquiv (a, b) { + return a.source === b.source && a.global === b.global && + a.ignoreCase === b.ignoreCase && a.multiline === b.multiline; + } + + function objEquiv (a, b) { + if (isUndefinedOrNull(a) || isUndefinedOrNull(b)) + return false; + // an identical "prototype" property. + if (a.prototype !== b.prototype) return false; + //~~~I've managed to break Object.keys through screwy arguments passing. + // Converting to array solves the problem. + if (isArguments(a)) { + if (!isArguments(b)) { + return false; + } + a = pSlice.call(a); + b = pSlice.call(b); + return expect.eql(a, b); + } + try{ + var ka = keys(a), + kb = keys(b), + key, i; + } catch (e) {//happens when one is a string literal and the other isn't + return false; + } + // having the same number of owned properties (keys incorporates hasOwnProperty) + if (ka.length != kb.length) + return false; + //the same set of keys (although not necessarily the same order), + ka.sort(); + kb.sort(); + //~~~cheap key test + for (i = ka.length - 1; i >= 0; i--) { + if (ka[i] != kb[i]) + return false; + } + //equivalent values for every corresponding key, and + //~~~possibly expensive deep test + for (i = ka.length - 1; i >= 0; i--) { + key = ka[i]; + if (!expect.eql(a[key], b[key])) + return false; + } + return true; + } + + var json = (function () { + "use strict"; + + if ('object' == typeof JSON && JSON.parse && JSON.stringify) { + return { + parse: nativeJSON.parse + , stringify: nativeJSON.stringify + } + } + + var JSON = {}; + + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + function date(d, key) { + return isFinite(d.valueOf()) ? + d.getUTCFullYear() + '-' + + f(d.getUTCMonth() + 1) + '-' + + f(d.getUTCDate()) + 'T' + + f(d.getUTCHours()) + ':' + + f(d.getUTCMinutes()) + ':' + + f(d.getUTCSeconds()) + 'Z' : null; + } + + var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + gap, + indent, + meta = { // table of character substitutions + '\b': '\\b', + '\t': '\\t', + '\n': '\\n', + '\f': '\\f', + '\r': '\\r', + '"' : '\\"', + '\\': '\\\\' + }, + rep; + + + function quote(string) { + + // If the string contains no control characters, no quote characters, and no + // backslash characters, then we can safely slap some quotes around it. + // Otherwise we must also replace the offending characters with safe escape + // sequences. + + escapable.lastIndex = 0; + return escapable.test(string) ? '"' + string.replace(escapable, function (a) { + var c = meta[a]; + return typeof c === 'string' ? c : + '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }) + '"' : '"' + string + '"'; + } + + + function str(key, holder) { + + // Produce a string from holder[key]. + + var i, // The loop counter. + k, // The member key. + v, // The member value. + length, + mind = gap, + partial, + value = holder[key]; + + // If the value has a toJSON method, call it to obtain a replacement value. + + if (value instanceof Date) { + value = date(key); + } + + // If we were called with a replacer function, then call the replacer to + // obtain a replacement value. + + if (typeof rep === 'function') { + value = rep.call(holder, key, value); + } + + // What happens next depends on the value's type. + + switch (typeof value) { + case 'string': + return quote(value); + + case 'number': + + // JSON numbers must be finite. Encode non-finite numbers as null. + + return isFinite(value) ? String(value) : 'null'; + + case 'boolean': + case 'null': + + // If the value is a boolean or null, convert it to a string. Note: + // typeof null does not produce 'null'. The case is included here in + // the remote chance that this gets fixed someday. + + return String(value); + + // If the type is 'object', we might be dealing with an object or an array or + // null. + + case 'object': + + // Due to a specification blunder in ECMAScript, typeof null is 'object', + // so watch out for that case. + + if (!value) { + return 'null'; + } + + // Make an array to hold the partial results of stringifying this object value. + + gap += indent; + partial = []; + + // Is the value an array? + + if (Object.prototype.toString.apply(value) === '[object Array]') { + + // The value is an array. Stringify every element. Use null as a placeholder + // for non-JSON values. + + length = value.length; + for (i = 0; i < length; i += 1) { + partial[i] = str(i, value) || 'null'; + } + + // Join all of the elements together, separated with commas, and wrap them in + // brackets. + + v = partial.length === 0 ? '[]' : gap ? + '[\n' + gap + partial.join(',\n' + gap) + '\n' + mind + ']' : + '[' + partial.join(',') + ']'; + gap = mind; + return v; + } + + // If the replacer is an array, use it to select the members to be stringified. + + if (rep && typeof rep === 'object') { + length = rep.length; + for (i = 0; i < length; i += 1) { + if (typeof rep[i] === 'string') { + k = rep[i]; + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } else { + + // Otherwise, iterate through all of the keys in the object. + + for (k in value) { + if (Object.prototype.hasOwnProperty.call(value, k)) { + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } + + // Join all of the member texts together, separated with commas, + // and wrap them in braces. + + v = partial.length === 0 ? '{}' : gap ? + '{\n' + gap + partial.join(',\n' + gap) + '\n' + mind + '}' : + '{' + partial.join(',') + '}'; + gap = mind; + return v; + } + } + + // If the JSON object does not yet have a stringify method, give it one. + + JSON.stringify = function (value, replacer, space) { + + // The stringify method takes a value and an optional replacer, and an optional + // space parameter, and returns a JSON text. The replacer can be a function + // that can replace values, or an array of strings that will select the keys. + // A default replacer method can be provided. Use of the space parameter can + // produce text that is more easily readable. + + var i; + gap = ''; + indent = ''; + + // If the space parameter is a number, make an indent string containing that + // many spaces. + + if (typeof space === 'number') { + for (i = 0; i < space; i += 1) { + indent += ' '; + } + + // If the space parameter is a string, it will be used as the indent string. + + } else if (typeof space === 'string') { + indent = space; + } + + // If there is a replacer, it must be a function or an array. + // Otherwise, throw an error. + + rep = replacer; + if (replacer && typeof replacer !== 'function' && + (typeof replacer !== 'object' || + typeof replacer.length !== 'number')) { + throw new Error('JSON.stringify'); + } + + // Make a fake root object containing our value under the key of ''. + // Return the result of stringifying the value. + + return str('', {'': value}); + }; + + // If the JSON object does not yet have a parse method, give it one. + + JSON.parse = function (text, reviver) { + // The parse method takes a text and an optional reviver function, and returns + // a JavaScript value if the text is a valid JSON text. + + var j; + + function walk(holder, key) { + + // The walk method is used to recursively walk the resulting structure so + // that modifications can be made. + + var k, v, value = holder[key]; + if (value && typeof value === 'object') { + for (k in value) { + if (Object.prototype.hasOwnProperty.call(value, k)) { + v = walk(value, k); + if (v !== undefined) { + value[k] = v; + } else { + delete value[k]; + } + } + } + } + return reviver.call(holder, key, value); + } + + + // Parsing happens in four stages. In the first stage, we replace certain + // Unicode characters with escape sequences. JavaScript handles many characters + // incorrectly, either silently deleting them, or treating them as line endings. + + text = String(text); + cx.lastIndex = 0; + if (cx.test(text)) { + text = text.replace(cx, function (a) { + return '\\u' + + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }); + } + + // In the second stage, we run the text against regular expressions that look + // for non-JSON patterns. We are especially concerned with '()' and 'new' + // because they can cause invocation, and '=' because it can cause mutation. + // But just to be safe, we want to reject all unexpected forms. + + // We split the second stage into 4 regexp operations in order to work around + // crippling inefficiencies in IE's and Safari's regexp engines. First we + // replace the JSON backslash pairs with '@' (a non-JSON character). Second, we + // replace all simple value tokens with ']' characters. Third, we delete all + // open brackets that follow a colon or comma or that begin the text. Finally, + // we look to see that the remaining characters are only whitespace or ']' or + // ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval. + + if (/^[\],:{}\s]*$/ + .test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@') + .replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']') + .replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) { + + // In the third stage we use the eval function to compile the text into a + // JavaScript structure. The '{' operator is subject to a syntactic ambiguity + // in JavaScript: it can begin a block or an object literal. We wrap the text + // in parens to eliminate the ambiguity. + + j = eval('(' + text + ')'); + + // In the optional fourth stage, we recursively walk the new structure, passing + // each name/value pair to a reviver function for possible transformation. + + return typeof reviver === 'function' ? + walk({'': j}, '') : j; + } + + // If the text is not JSON parseable, then a SyntaxError is thrown. + + throw new SyntaxError('JSON.parse'); + }; + + return JSON; + })(); + + if ('undefined' != typeof window) { + window.expect = module.exports; + } + +})( + this + , 'undefined' != typeof module ? module : {exports: {}} +); diff --git a/node_modules/expect.js/package.json b/node_modules/expect.js/package.json new file mode 100644 index 0000000..3ad39f7 --- /dev/null +++ b/node_modules/expect.js/package.json @@ -0,0 +1,13 @@ +{ + "name": "expect.js" + , "version": "0.3.1" + , "description": "BDD style assertions for node and the browser." + , "repository": { + "type": "git", + "url": "git://github.com/LearnBoost/expect.js.git" + } + , "devDependencies": { + "mocha": "*" + , "serve": "*" + } +} diff --git a/node_modules/glob/.npmignore b/node_modules/glob/.npmignore new file mode 100644 index 0000000..2af4b71 --- /dev/null +++ b/node_modules/glob/.npmignore @@ -0,0 +1,2 @@ +.*.swp +test/a/ diff --git a/node_modules/glob/.travis.yml b/node_modules/glob/.travis.yml new file mode 100644 index 0000000..baa0031 --- /dev/null +++ b/node_modules/glob/.travis.yml @@ -0,0 +1,3 @@ +language: node_js +node_js: + - 0.8 diff --git a/node_modules/glob/LICENSE b/node_modules/glob/LICENSE new file mode 100644 index 0000000..0c44ae7 --- /dev/null +++ b/node_modules/glob/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) Isaac Z. Schlueter ("Author") +All rights reserved. + +The BSD License + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: + +1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + +2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS +BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR +BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, +WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE +OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN +IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/glob/README.md b/node_modules/glob/README.md new file mode 100644 index 0000000..cc69164 --- /dev/null +++ b/node_modules/glob/README.md @@ -0,0 +1,250 @@ +# Glob + +Match files using the patterns the shell uses, like stars and stuff. + +This is a glob implementation in JavaScript. It uses the `minimatch` +library to do its matching. + +## Attention: node-glob users! + +The API has changed dramatically between 2.x and 3.x. This library is +now 100% JavaScript, and the integer flags have been replaced with an +options object. + +Also, there's an event emitter class, proper tests, and all the other +things you've come to expect from node modules. + +And best of all, no compilation! + +## Usage + +```javascript +var glob = require("glob") + +// options is optional +glob("**/*.js", options, function (er, files) { + // files is an array of filenames. + // If the `nonull` option is set, and nothing + // was found, then files is ["**/*.js"] + // er is an error object or null. +}) +``` + +## Features + +Please see the [minimatch +documentation](https://github.com/isaacs/minimatch) for more details. + +Supports these glob features: + +* Brace Expansion +* Extended glob matching +* "Globstar" `**` matching + +See: + +* `man sh` +* `man bash` +* `man 3 fnmatch` +* `man 5 gitignore` +* [minimatch documentation](https://github.com/isaacs/minimatch) + +## glob(pattern, [options], cb) + +* `pattern` {String} Pattern to be matched +* `options` {Object} +* `cb` {Function} + * `err` {Error | null} + * `matches` {Array} filenames found matching the pattern + +Perform an asynchronous glob search. + +## glob.sync(pattern, [options]) + +* `pattern` {String} Pattern to be matched +* `options` {Object} +* return: {Array} filenames found matching the pattern + +Perform a synchronous glob search. + +## Class: glob.Glob + +Create a Glob object by instanting the `glob.Glob` class. + +```javascript +var Glob = require("glob").Glob +var mg = new Glob(pattern, options, cb) +``` + +It's an EventEmitter, and starts walking the filesystem to find matches +immediately. + +### new glob.Glob(pattern, [options], [cb]) + +* `pattern` {String} pattern to search for +* `options` {Object} +* `cb` {Function} Called when an error occurs, or matches are found + * `err` {Error | null} + * `matches` {Array} filenames found matching the pattern + +Note that if the `sync` flag is set in the options, then matches will +be immediately available on the `g.found` member. + +### Properties + +* `minimatch` The minimatch object that the glob uses. +* `options` The options object passed in. +* `error` The error encountered. When an error is encountered, the + glob object is in an undefined state, and should be discarded. +* `aborted` Boolean which is set to true when calling `abort()`. There + is no way at this time to continue a glob search after aborting, but + you can re-use the statCache to avoid having to duplicate syscalls. +* `statCache` Collection of all the stat results the glob search + performed. +* `cache` Convenience object. Each field has the following possible + values: + * `false` - Path does not exist + * `true` - Path exists + * `1` - Path exists, and is not a directory + * `2` - Path exists, and is a directory + * `[file, entries, ...]` - Path exists, is a directory, and the + array value is the results of `fs.readdir` + +### Events + +* `end` When the matching is finished, this is emitted with all the + matches found. If the `nonull` option is set, and no match was found, + then the `matches` list contains the original pattern. The matches + are sorted, unless the `nosort` flag is set. +* `match` Every time a match is found, this is emitted with the matched. +* `error` Emitted when an unexpected error is encountered, or whenever + any fs error occurs if `options.strict` is set. +* `abort` When `abort()` is called, this event is raised. + +### Methods + +* `abort` Stop the search. + +### Options + +All the options that can be passed to Minimatch can also be passed to +Glob to change pattern matching behavior. Also, some have been added, +or have glob-specific ramifications. + +All options are false by default, unless otherwise noted. + +All options are added to the glob object, as well. + +* `cwd` The current working directory in which to search. Defaults + to `process.cwd()`. +* `root` The place where patterns starting with `/` will be mounted + onto. Defaults to `path.resolve(options.cwd, "/")` (`/` on Unix + systems, and `C:\` or some such on Windows.) +* `dot` Include `.dot` files in normal matches and `globstar` matches. + Note that an explicit dot in a portion of the pattern will always + match dot files. +* `nomount` By default, a pattern starting with a forward-slash will be + "mounted" onto the root setting, so that a valid filesystem path is + returned. Set this flag to disable that behavior. +* `mark` Add a `/` character to directory matches. Note that this + requires additional stat calls. +* `nosort` Don't sort the results. +* `stat` Set to true to stat *all* results. This reduces performance + somewhat, and is completely unnecessary, unless `readdir` is presumed + to be an untrustworthy indicator of file existence. It will cause + ELOOP to be triggered one level sooner in the case of cyclical + symbolic links. +* `silent` When an unusual error is encountered + when attempting to read a directory, a warning will be printed to + stderr. Set the `silent` option to true to suppress these warnings. +* `strict` When an unusual error is encountered + when attempting to read a directory, the process will just continue on + in search of other matches. Set the `strict` option to raise an error + in these cases. +* `cache` See `cache` property above. Pass in a previously generated + cache object to save some fs calls. +* `statCache` A cache of results of filesystem information, to prevent + unnecessary stat calls. While it should not normally be necessary to + set this, you may pass the statCache from one glob() call to the + options object of another, if you know that the filesystem will not + change between calls. (See "Race Conditions" below.) +* `sync` Perform a synchronous glob search. +* `nounique` In some cases, brace-expanded patterns can result in the + same file showing up multiple times in the result set. By default, + this implementation prevents duplicates in the result set. + Set this flag to disable that behavior. +* `nonull` Set to never return an empty set, instead returning a set + containing the pattern itself. This is the default in glob(3). +* `nocase` Perform a case-insensitive match. Note that case-insensitive + filesystems will sometimes result in glob returning results that are + case-insensitively matched anyway, since readdir and stat will not + raise an error. +* `debug` Set to enable debug logging in minimatch and glob. +* `globDebug` Set to enable debug logging in glob, but not minimatch. + +## Comparisons to other fnmatch/glob implementations + +While strict compliance with the existing standards is a worthwhile +goal, some discrepancies exist between node-glob and other +implementations, and are intentional. + +If the pattern starts with a `!` character, then it is negated. Set the +`nonegate` flag to suppress this behavior, and treat leading `!` +characters normally. This is perhaps relevant if you wish to start the +pattern with a negative extglob pattern like `!(a|B)`. Multiple `!` +characters at the start of a pattern will negate the pattern multiple +times. + +If a pattern starts with `#`, then it is treated as a comment, and +will not match anything. Use `\#` to match a literal `#` at the +start of a line, or set the `nocomment` flag to suppress this behavior. + +The double-star character `**` is supported by default, unless the +`noglobstar` flag is set. This is supported in the manner of bsdglob +and bash 4.1, where `**` only has special significance if it is the only +thing in a path part. That is, `a/**/b` will match `a/x/y/b`, but +`a/**b` will not. + +If an escaped pattern has no matches, and the `nonull` flag is set, +then glob returns the pattern as-provided, rather than +interpreting the character escapes. For example, +`glob.match([], "\\*a\\?")` will return `"\\*a\\?"` rather than +`"*a?"`. This is akin to setting the `nullglob` option in bash, except +that it does not resolve escaped pattern characters. + +If brace expansion is not disabled, then it is performed before any +other interpretation of the glob pattern. Thus, a pattern like +`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded +**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are +checked for validity. Since those two are valid, matching proceeds. + +## Windows + +**Please only use forward-slashes in glob expressions.** + +Though windows uses either `/` or `\` as its path separator, only `/` +characters are used by this glob implementation. You must use +forward-slashes **only** in glob expressions. Back-slashes will always +be interpreted as escape characters, not path separators. + +Results from absolute patterns such as `/foo/*` are mounted onto the +root setting using `path.join`. On windows, this will by default result +in `/foo/*` matching `C:\foo\bar.txt`. + +## Race Conditions + +Glob searching, by its very nature, is susceptible to race conditions, +since it relies on directory walking and such. + +As a result, it is possible that a file that exists when glob looks for +it may have been deleted or modified by the time it returns the result. + +As part of its internal implementation, this program caches all stat +and readdir calls that it makes, in order to cut down on system +overhead. However, this also makes it even more susceptible to races, +especially if the cache or statCache objects are reused between glob +calls. + +Users are thus advised not to use a glob result as a guarantee of +filesystem state in the face of rapid changes. For the vast majority +of operations, this is never a problem. diff --git a/node_modules/glob/examples/g.js b/node_modules/glob/examples/g.js new file mode 100644 index 0000000..be122df --- /dev/null +++ b/node_modules/glob/examples/g.js @@ -0,0 +1,9 @@ +var Glob = require("../").Glob + +var pattern = "test/a/**/[cg]/../[cg]" +console.log(pattern) + +var mg = new Glob(pattern, {mark: true, sync:true}, function (er, matches) { + console.log("matches", matches) +}) +console.log("after") diff --git a/node_modules/glob/examples/usr-local.js b/node_modules/glob/examples/usr-local.js new file mode 100644 index 0000000..327a425 --- /dev/null +++ b/node_modules/glob/examples/usr-local.js @@ -0,0 +1,9 @@ +var Glob = require("../").Glob + +var pattern = "{./*/*,/*,/usr/local/*}" +console.log(pattern) + +var mg = new Glob(pattern, {mark: true}, function (er, matches) { + console.log("matches", matches) +}) +console.log("after") diff --git a/node_modules/glob/glob.js b/node_modules/glob/glob.js new file mode 100644 index 0000000..f0118a4 --- /dev/null +++ b/node_modules/glob/glob.js @@ -0,0 +1,675 @@ +// Approach: +// +// 1. Get the minimatch set +// 2. For each pattern in the set, PROCESS(pattern) +// 3. Store matches per-set, then uniq them +// +// PROCESS(pattern) +// Get the first [n] items from pattern that are all strings +// Join these together. This is PREFIX. +// If there is no more remaining, then stat(PREFIX) and +// add to matches if it succeeds. END. +// readdir(PREFIX) as ENTRIES +// If fails, END +// If pattern[n] is GLOBSTAR +// // handle the case where the globstar match is empty +// // by pruning it out, and testing the resulting pattern +// PROCESS(pattern[0..n] + pattern[n+1 .. $]) +// // handle other cases. +// for ENTRY in ENTRIES (not dotfiles) +// // attach globstar + tail onto the entry +// PROCESS(pattern[0..n] + ENTRY + pattern[n .. $]) +// +// else // not globstar +// for ENTRY in ENTRIES (not dotfiles, unless pattern[n] is dot) +// Test ENTRY against pattern[n] +// If fails, continue +// If passes, PROCESS(pattern[0..n] + item + pattern[n+1 .. $]) +// +// Caveat: +// Cache all stats and readdirs results to minimize syscall. Since all +// we ever care about is existence and directory-ness, we can just keep +// `true` for files, and [children,...] for directories, or `false` for +// things that don't exist. + + + +module.exports = glob + +var fs = require("graceful-fs") +, minimatch = require("minimatch") +, Minimatch = minimatch.Minimatch +, inherits = require("inherits") +, EE = require("events").EventEmitter +, path = require("path") +, isDir = {} +, assert = require("assert").ok + +function glob (pattern, options, cb) { + if (typeof options === "function") cb = options, options = {} + if (!options) options = {} + + if (typeof options === "number") { + deprecated() + return + } + + var g = new Glob(pattern, options, cb) + return g.sync ? g.found : g +} + +glob.fnmatch = deprecated + +function deprecated () { + throw new Error("glob's interface has changed. Please see the docs.") +} + +glob.sync = globSync +function globSync (pattern, options) { + if (typeof options === "number") { + deprecated() + return + } + + options = options || {} + options.sync = true + return glob(pattern, options) +} + + +glob.Glob = Glob +inherits(Glob, EE) +function Glob (pattern, options, cb) { + if (!(this instanceof Glob)) { + return new Glob(pattern, options, cb) + } + + if (typeof cb === "function") { + this.on("error", cb) + this.on("end", function (matches) { + cb(null, matches) + }) + } + + options = options || {} + + this.EOF = {} + this._emitQueue = [] + + this.maxDepth = options.maxDepth || 1000 + this.maxLength = options.maxLength || Infinity + this.cache = options.cache || {} + this.statCache = options.statCache || {} + + this.changedCwd = false + var cwd = process.cwd() + if (!options.hasOwnProperty("cwd")) this.cwd = cwd + else { + this.cwd = options.cwd + this.changedCwd = path.resolve(options.cwd) !== cwd + } + + this.root = options.root || path.resolve(this.cwd, "/") + this.root = path.resolve(this.root) + if (process.platform === "win32") + this.root = this.root.replace(/\\/g, "/") + + this.nomount = !!options.nomount + + if (!pattern) { + throw new Error("must provide pattern") + } + + // base-matching: just use globstar for that. + if (options.matchBase && -1 === pattern.indexOf("/")) { + if (options.noglobstar) { + throw new Error("base matching requires globstar") + } + pattern = "**/" + pattern + } + + this.strict = options.strict !== false + this.dot = !!options.dot + this.mark = !!options.mark + this.sync = !!options.sync + this.nounique = !!options.nounique + this.nonull = !!options.nonull + this.nosort = !!options.nosort + this.nocase = !!options.nocase + this.stat = !!options.stat + + this.debug = !!options.debug || !!options.globDebug + if (this.debug) + this.log = console.error + + this.silent = !!options.silent + + var mm = this.minimatch = new Minimatch(pattern, options) + this.options = mm.options + pattern = this.pattern = mm.pattern + + this.error = null + this.aborted = false + + // list of all the patterns that ** has resolved do, so + // we can avoid visiting multiple times. + this._globstars = {} + + EE.call(this) + + // process each pattern in the minimatch set + var n = this.minimatch.set.length + + // The matches are stored as {: true,...} so that + // duplicates are automagically pruned. + // Later, we do an Object.keys() on these. + // Keep them as a list so we can fill in when nonull is set. + this.matches = new Array(n) + + this.minimatch.set.forEach(iterator.bind(this)) + function iterator (pattern, i, set) { + this._process(pattern, 0, i, function (er) { + if (er) this.emit("error", er) + if (-- n <= 0) this._finish() + }) + } +} + +Glob.prototype.log = function () {} + +Glob.prototype._finish = function () { + assert(this instanceof Glob) + + var nou = this.nounique + , all = nou ? [] : {} + + for (var i = 0, l = this.matches.length; i < l; i ++) { + var matches = this.matches[i] + this.log("matches[%d] =", i, matches) + // do like the shell, and spit out the literal glob + if (!matches) { + if (this.nonull) { + var literal = this.minimatch.globSet[i] + if (nou) all.push(literal) + else all[literal] = true + } + } else { + // had matches + var m = Object.keys(matches) + if (nou) all.push.apply(all, m) + else m.forEach(function (m) { + all[m] = true + }) + } + } + + if (!nou) all = Object.keys(all) + + if (!this.nosort) { + all = all.sort(this.nocase ? alphasorti : alphasort) + } + + if (this.mark) { + // at *some* point we statted all of these + all = all.map(function (m) { + var sc = this.cache[m] + if (!sc) + return m + var isDir = (Array.isArray(sc) || sc === 2) + if (isDir && m.slice(-1) !== "/") { + return m + "/" + } + if (!isDir && m.slice(-1) === "/") { + return m.replace(/\/+$/, "") + } + return m + }, this) + } + + this.log("emitting end", all) + + this.EOF = this.found = all + this.emitMatch(this.EOF) +} + +function alphasorti (a, b) { + a = a.toLowerCase() + b = b.toLowerCase() + return alphasort(a, b) +} + +function alphasort (a, b) { + return a > b ? 1 : a < b ? -1 : 0 +} + +Glob.prototype.abort = function () { + this.aborted = true + this.emit("abort") +} + +Glob.prototype.pause = function () { + if (this.paused) return + if (this.sync) + this.emit("error", new Error("Can't pause/resume sync glob")) + this.paused = true + this.emit("pause") +} + +Glob.prototype.resume = function () { + if (!this.paused) return + if (this.sync) + this.emit("error", new Error("Can't pause/resume sync glob")) + this.paused = false + this.emit("resume") + this._processEmitQueue() + //process.nextTick(this.emit.bind(this, "resume")) +} + +Glob.prototype.emitMatch = function (m) { + if (!this.stat || this.statCache[m] || m === this.EOF) { + this._emitQueue.push(m) + this._processEmitQueue() + } else { + this._stat(m, function(exists, isDir) { + if (exists) { + this._emitQueue.push(m) + this._processEmitQueue() + } + }) + } +} + +Glob.prototype._processEmitQueue = function (m) { + while (!this._processingEmitQueue && + !this.paused) { + this._processingEmitQueue = true + var m = this._emitQueue.shift() + if (!m) { + this._processingEmitQueue = false + break + } + + this.log('emit!', m === this.EOF ? "end" : "match") + + this.emit(m === this.EOF ? "end" : "match", m) + this._processingEmitQueue = false + } +} + +Glob.prototype._process = function (pattern, depth, index, cb_) { + assert(this instanceof Glob) + + var cb = function cb (er, res) { + assert(this instanceof Glob) + if (this.paused) { + if (!this._processQueue) { + this._processQueue = [] + this.once("resume", function () { + var q = this._processQueue + this._processQueue = null + q.forEach(function (cb) { cb() }) + }) + } + this._processQueue.push(cb_.bind(this, er, res)) + } else { + cb_.call(this, er, res) + } + }.bind(this) + + if (this.aborted) return cb() + + if (depth > this.maxDepth) return cb() + + // Get the first [n] parts of pattern that are all strings. + var n = 0 + while (typeof pattern[n] === "string") { + n ++ + } + // now n is the index of the first one that is *not* a string. + + // see if there's anything else + var prefix + switch (n) { + // if not, then this is rather simple + case pattern.length: + prefix = pattern.join("/") + this._stat(prefix, function (exists, isDir) { + // either it's there, or it isn't. + // nothing more to do, either way. + if (exists) { + if (prefix && isAbsolute(prefix) && !this.nomount) { + if (prefix.charAt(0) === "/") { + prefix = path.join(this.root, prefix) + } else { + prefix = path.resolve(this.root, prefix) + } + } + + if (process.platform === "win32") + prefix = prefix.replace(/\\/g, "/") + + this.matches[index] = this.matches[index] || {} + this.matches[index][prefix] = true + this.emitMatch(prefix) + } + return cb() + }) + return + + case 0: + // pattern *starts* with some non-trivial item. + // going to readdir(cwd), but not include the prefix in matches. + prefix = null + break + + default: + // pattern has some string bits in the front. + // whatever it starts with, whether that's "absolute" like /foo/bar, + // or "relative" like "../baz" + prefix = pattern.slice(0, n) + prefix = prefix.join("/") + break + } + + // get the list of entries. + var read + if (prefix === null) read = "." + else if (isAbsolute(prefix) || isAbsolute(pattern.join("/"))) { + if (!prefix || !isAbsolute(prefix)) { + prefix = path.join("/", prefix) + } + read = prefix = path.resolve(prefix) + + // if (process.platform === "win32") + // read = prefix = prefix.replace(/^[a-zA-Z]:|\\/g, "/") + + this.log('absolute: ', prefix, this.root, pattern, read) + } else { + read = prefix + } + + this.log('readdir(%j)', read, this.cwd, this.root) + + return this._readdir(read, function (er, entries) { + if (er) { + // not a directory! + // this means that, whatever else comes after this, it can never match + return cb() + } + + // globstar is special + if (pattern[n] === minimatch.GLOBSTAR) { + // test without the globstar, and with every child both below + // and replacing the globstar. + var s = [ pattern.slice(0, n).concat(pattern.slice(n + 1)) ] + entries.forEach(function (e) { + if (e.charAt(0) === "." && !this.dot) return + // instead of the globstar + s.push(pattern.slice(0, n).concat(e).concat(pattern.slice(n + 1))) + // below the globstar + s.push(pattern.slice(0, n).concat(e).concat(pattern.slice(n))) + }, this) + + s = s.filter(function (pattern) { + var key = gsKey(pattern) + var seen = !this._globstars[key] + this._globstars[key] = true + return seen + }, this) + + if (!s.length) + return cb() + + // now asyncForEach over this + var l = s.length + , errState = null + s.forEach(function (gsPattern) { + this._process(gsPattern, depth + 1, index, function (er) { + if (errState) return + if (er) return cb(errState = er) + if (--l <= 0) return cb() + }) + }, this) + + return + } + + // not a globstar + // It will only match dot entries if it starts with a dot, or if + // dot is set. Stuff like @(.foo|.bar) isn't allowed. + var pn = pattern[n] + var rawGlob = pattern[n]._glob + , dotOk = this.dot || rawGlob.charAt(0) === "." + + entries = entries.filter(function (e) { + return (e.charAt(0) !== "." || dotOk) && + e.match(pattern[n]) + }) + + // If n === pattern.length - 1, then there's no need for the extra stat + // *unless* the user has specified "mark" or "stat" explicitly. + // We know that they exist, since the readdir returned them. + if (n === pattern.length - 1 && + !this.mark && + !this.stat) { + entries.forEach(function (e) { + if (prefix) { + if (prefix !== "/") e = prefix + "/" + e + else e = prefix + e + } + if (e.charAt(0) === "/" && !this.nomount) { + e = path.join(this.root, e) + } + + if (process.platform === "win32") + e = e.replace(/\\/g, "/") + + this.matches[index] = this.matches[index] || {} + this.matches[index][e] = true + this.emitMatch(e) + }, this) + return cb.call(this) + } + + + // now test all the remaining entries as stand-ins for that part + // of the pattern. + var l = entries.length + , errState = null + if (l === 0) return cb() // no matches possible + entries.forEach(function (e) { + var p = pattern.slice(0, n).concat(e).concat(pattern.slice(n + 1)) + this._process(p, depth + 1, index, function (er) { + if (errState) return + if (er) return cb(errState = er) + if (--l === 0) return cb.call(this) + }) + }, this) + }) + +} + +function gsKey (pattern) { + return '**' + pattern.map(function (p) { + return (p === minimatch.GLOBSTAR) ? '**' : (''+p) + }).join('/') +} + +Glob.prototype._stat = function (f, cb) { + assert(this instanceof Glob) + var abs = f + if (f.charAt(0) === "/") { + abs = path.join(this.root, f) + } else if (this.changedCwd) { + abs = path.resolve(this.cwd, f) + } + + if (f.length > this.maxLength) { + var er = new Error("Path name too long") + er.code = "ENAMETOOLONG" + er.path = f + return this._afterStat(f, abs, cb, er) + } + + this.log('stat', [this.cwd, f, '=', abs]) + + if (!this.stat && this.cache.hasOwnProperty(f)) { + var exists = this.cache[f] + , isDir = exists && (Array.isArray(exists) || exists === 2) + if (this.sync) return cb.call(this, !!exists, isDir) + return process.nextTick(cb.bind(this, !!exists, isDir)) + } + + var stat = this.statCache[abs] + if (this.sync || stat) { + var er + try { + stat = fs.statSync(abs) + } catch (e) { + er = e + } + this._afterStat(f, abs, cb, er, stat) + } else { + fs.stat(abs, this._afterStat.bind(this, f, abs, cb)) + } +} + +Glob.prototype._afterStat = function (f, abs, cb, er, stat) { + var exists + assert(this instanceof Glob) + + if (abs.slice(-1) === "/" && stat && !stat.isDirectory()) { + this.log("should be ENOTDIR, fake it") + + er = new Error("ENOTDIR, not a directory '" + abs + "'") + er.path = abs + er.code = "ENOTDIR" + stat = null + } + + var emit = !this.statCache[abs] + this.statCache[abs] = stat + + if (er || !stat) { + exists = false + } else { + exists = stat.isDirectory() ? 2 : 1 + if (emit) + this.emit('stat', f, stat) + } + this.cache[f] = this.cache[f] || exists + cb.call(this, !!exists, exists === 2) +} + +Glob.prototype._readdir = function (f, cb) { + assert(this instanceof Glob) + var abs = f + if (f.charAt(0) === "/") { + abs = path.join(this.root, f) + } else if (isAbsolute(f)) { + abs = f + } else if (this.changedCwd) { + abs = path.resolve(this.cwd, f) + } + + if (f.length > this.maxLength) { + var er = new Error("Path name too long") + er.code = "ENAMETOOLONG" + er.path = f + return this._afterReaddir(f, abs, cb, er) + } + + this.log('readdir', [this.cwd, f, abs]) + if (this.cache.hasOwnProperty(f)) { + var c = this.cache[f] + if (Array.isArray(c)) { + if (this.sync) return cb.call(this, null, c) + return process.nextTick(cb.bind(this, null, c)) + } + + if (!c || c === 1) { + // either ENOENT or ENOTDIR + var code = c ? "ENOTDIR" : "ENOENT" + , er = new Error((c ? "Not a directory" : "Not found") + ": " + f) + er.path = f + er.code = code + this.log(f, er) + if (this.sync) return cb.call(this, er) + return process.nextTick(cb.bind(this, er)) + } + + // at this point, c === 2, meaning it's a dir, but we haven't + // had to read it yet, or c === true, meaning it's *something* + // but we don't have any idea what. Need to read it, either way. + } + + if (this.sync) { + var er, entries + try { + entries = fs.readdirSync(abs) + } catch (e) { + er = e + } + return this._afterReaddir(f, abs, cb, er, entries) + } + + fs.readdir(abs, this._afterReaddir.bind(this, f, abs, cb)) +} + +Glob.prototype._afterReaddir = function (f, abs, cb, er, entries) { + assert(this instanceof Glob) + if (entries && !er) { + this.cache[f] = entries + // if we haven't asked to stat everything for suresies, then just + // assume that everything in there exists, so we can avoid + // having to stat it a second time. This also gets us one step + // further into ELOOP territory. + if (!this.mark && !this.stat) { + entries.forEach(function (e) { + if (f === "/") e = f + e + else e = f + "/" + e + this.cache[e] = true + }, this) + } + + return cb.call(this, er, entries) + } + + // now handle errors, and cache the information + if (er) switch (er.code) { + case "ENOTDIR": // totally normal. means it *does* exist. + this.cache[f] = 1 + return cb.call(this, er) + case "ENOENT": // not terribly unusual + case "ELOOP": + case "ENAMETOOLONG": + case "UNKNOWN": + this.cache[f] = false + return cb.call(this, er) + default: // some unusual error. Treat as failure. + this.cache[f] = false + if (this.strict) this.emit("error", er) + if (!this.silent) console.error("glob error", er) + return cb.call(this, er) + } +} + +var isAbsolute = process.platform === "win32" ? absWin : absUnix + +function absWin (p) { + if (absUnix(p)) return true + // pull off the device/UNC bit from a windows path. + // from node's lib/path.js + var splitDeviceRe = + /^([a-zA-Z]:|[\\\/]{2}[^\\\/]+[\\\/]+[^\\\/]+)?([\\\/])?([\s\S]*?)$/ + , result = splitDeviceRe.exec(p) + , device = result[1] || '' + , isUnc = device && device.charAt(1) !== ':' + , isAbsolute = !!result[2] || isUnc // UNC paths are always absolute + + return isAbsolute +} + +function absUnix (p) { + return p.charAt(0) === "/" || p === "" +} diff --git a/node_modules/glob/package.json b/node_modules/glob/package.json new file mode 100644 index 0000000..91ab140 --- /dev/null +++ b/node_modules/glob/package.json @@ -0,0 +1,28 @@ +{ + "author": "Isaac Z. Schlueter (http://blog.izs.me/)", + "name": "glob", + "description": "a little globber", + "version": "3.2.3", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/node-glob.git" + }, + "main": "glob.js", + "engines": { + "node": "*" + }, + "dependencies": { + "minimatch": "~0.2.11", + "graceful-fs": "~2.0.0", + "inherits": "2" + }, + "devDependencies": { + "tap": "~0.4.0", + "mkdirp": "0", + "rimraf": "1" + }, + "scripts": { + "test": "tap test/*.js" + }, + "license": "BSD" +} diff --git a/node_modules/glob/test/00-setup.js b/node_modules/glob/test/00-setup.js new file mode 100644 index 0000000..245afaf --- /dev/null +++ b/node_modules/glob/test/00-setup.js @@ -0,0 +1,176 @@ +// just a little pre-run script to set up the fixtures. +// zz-finish cleans it up + +var mkdirp = require("mkdirp") +var path = require("path") +var i = 0 +var tap = require("tap") +var fs = require("fs") +var rimraf = require("rimraf") + +var files = +[ "a/.abcdef/x/y/z/a" +, "a/abcdef/g/h" +, "a/abcfed/g/h" +, "a/b/c/d" +, "a/bc/e/f" +, "a/c/d/c/b" +, "a/cb/e/f" +] + +var symlinkTo = path.resolve(__dirname, "a/symlink/a/b/c") +var symlinkFrom = "../.." + +files = files.map(function (f) { + return path.resolve(__dirname, f) +}) + +tap.test("remove fixtures", function (t) { + rimraf(path.resolve(__dirname, "a"), function (er) { + t.ifError(er, "remove fixtures") + t.end() + }) +}) + +files.forEach(function (f) { + tap.test(f, function (t) { + var d = path.dirname(f) + mkdirp(d, 0755, function (er) { + if (er) { + t.fail(er) + return t.bailout() + } + fs.writeFile(f, "i like tests", function (er) { + t.ifError(er, "make file") + t.end() + }) + }) + }) +}) + +if (process.platform !== "win32") { + tap.test("symlinky", function (t) { + var d = path.dirname(symlinkTo) + console.error("mkdirp", d) + mkdirp(d, 0755, function (er) { + t.ifError(er) + fs.symlink(symlinkFrom, symlinkTo, "dir", function (er) { + t.ifError(er, "make symlink") + t.end() + }) + }) + }) +} + +;["foo","bar","baz","asdf","quux","qwer","rewq"].forEach(function (w) { + w = "/tmp/glob-test/" + w + tap.test("create " + w, function (t) { + mkdirp(w, function (er) { + if (er) + throw er + t.pass(w) + t.end() + }) + }) +}) + + +// generate the bash pattern test-fixtures if possible +if (process.platform === "win32" || !process.env.TEST_REGEN) { + console.error("Windows, or TEST_REGEN unset. Using cached fixtures.") + return +} + +var spawn = require("child_process").spawn; +var globs = + // put more patterns here. + // anything that would be directly in / should be in /tmp/glob-test + ["test/a/*/+(c|g)/./d" + ,"test/a/**/[cg]/../[cg]" + ,"test/a/{b,c,d,e,f}/**/g" + ,"test/a/b/**" + ,"test/**/g" + ,"test/a/abc{fed,def}/g/h" + ,"test/a/abc{fed/g,def}/**/" + ,"test/a/abc{fed/g,def}/**///**/" + ,"test/**/a/**/" + ,"test/+(a|b|c)/a{/,bc*}/**" + ,"test/*/*/*/f" + ,"test/**/f" + ,"test/a/symlink/a/b/c/a/b/c/a/b/c//a/b/c////a/b/c/**/b/c/**" + ,"{./*/*,/tmp/glob-test/*}" + ,"{/tmp/glob-test/*,*}" // evil owl face! how you taunt me! + ,"test/a/!(symlink)/**" + ] +var bashOutput = {} +var fs = require("fs") + +globs.forEach(function (pattern) { + tap.test("generate fixture " + pattern, function (t) { + var cmd = "shopt -s globstar && " + + "shopt -s extglob && " + + "shopt -s nullglob && " + + // "shopt >&2; " + + "eval \'for i in " + pattern + "; do echo $i; done\'" + var cp = spawn("bash", ["-c", cmd], { cwd: path.dirname(__dirname) }) + var out = [] + cp.stdout.on("data", function (c) { + out.push(c) + }) + cp.stderr.pipe(process.stderr) + cp.on("close", function (code) { + out = flatten(out) + if (!out) + out = [] + else + out = cleanResults(out.split(/\r*\n/)) + + bashOutput[pattern] = out + t.notOk(code, "bash test should finish nicely") + t.end() + }) + }) +}) + +tap.test("save fixtures", function (t) { + var fname = path.resolve(__dirname, "bash-results.json") + var data = JSON.stringify(bashOutput, null, 2) + "\n" + fs.writeFile(fname, data, function (er) { + t.ifError(er) + t.end() + }) +}) + +function cleanResults (m) { + // normalize discrepancies in ordering, duplication, + // and ending slashes. + return m.map(function (m) { + return m.replace(/\/+/g, "/").replace(/\/$/, "") + }).sort(alphasort).reduce(function (set, f) { + if (f !== set[set.length - 1]) set.push(f) + return set + }, []).sort(alphasort).map(function (f) { + // de-windows + return (process.platform !== 'win32') ? f + : f.replace(/^[a-zA-Z]:\\\\/, '/').replace(/\\/g, '/') + }) +} + +function flatten (chunks) { + var s = 0 + chunks.forEach(function (c) { s += c.length }) + var out = new Buffer(s) + s = 0 + chunks.forEach(function (c) { + c.copy(out, s) + s += c.length + }) + + return out.toString().trim() +} + +function alphasort (a, b) { + a = a.toLowerCase() + b = b.toLowerCase() + return a > b ? 1 : a < b ? -1 : 0 +} diff --git a/node_modules/glob/test/bash-comparison.js b/node_modules/glob/test/bash-comparison.js new file mode 100644 index 0000000..239ed1a --- /dev/null +++ b/node_modules/glob/test/bash-comparison.js @@ -0,0 +1,63 @@ +// basic test +// show that it does the same thing by default as the shell. +var tap = require("tap") +, child_process = require("child_process") +, bashResults = require("./bash-results.json") +, globs = Object.keys(bashResults) +, glob = require("../") +, path = require("path") + +// run from the root of the project +// this is usually where you're at anyway, but be sure. +process.chdir(path.resolve(__dirname, "..")) + +function alphasort (a, b) { + a = a.toLowerCase() + b = b.toLowerCase() + return a > b ? 1 : a < b ? -1 : 0 +} + +globs.forEach(function (pattern) { + var expect = bashResults[pattern] + // anything regarding the symlink thing will fail on windows, so just skip it + if (process.platform === "win32" && + expect.some(function (m) { + return /\/symlink\//.test(m) + })) + return + + tap.test(pattern, function (t) { + glob(pattern, function (er, matches) { + if (er) + throw er + + // sort and unmark, just to match the shell results + matches = cleanResults(matches) + + t.deepEqual(matches, expect, pattern) + t.end() + }) + }) + + tap.test(pattern + " sync", function (t) { + var matches = cleanResults(glob.sync(pattern)) + + t.deepEqual(matches, expect, "should match shell") + t.end() + }) +}) + +function cleanResults (m) { + // normalize discrepancies in ordering, duplication, + // and ending slashes. + return m.map(function (m) { + return m.replace(/\/+/g, "/").replace(/\/$/, "") + }).sort(alphasort).reduce(function (set, f) { + if (f !== set[set.length - 1]) set.push(f) + return set + }, []).sort(alphasort).map(function (f) { + // de-windows + return (process.platform !== 'win32') ? f + : f.replace(/^[a-zA-Z]:[\/\\]+/, '/').replace(/[\\\/]+/g, '/') + }) +} diff --git a/node_modules/glob/test/bash-results.json b/node_modules/glob/test/bash-results.json new file mode 100644 index 0000000..a9bc347 --- /dev/null +++ b/node_modules/glob/test/bash-results.json @@ -0,0 +1,350 @@ +{ + "test/a/*/+(c|g)/./d": [ + "test/a/b/c/./d" + ], + "test/a/**/[cg]/../[cg]": [ + "test/a/abcdef/g/../g", + "test/a/abcfed/g/../g", + "test/a/b/c/../c", + "test/a/c/../c", + "test/a/c/d/c/../c", + "test/a/symlink/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c" + ], + "test/a/{b,c,d,e,f}/**/g": [], + "test/a/b/**": [ + "test/a/b", + "test/a/b/c", + "test/a/b/c/d" + ], + "test/**/g": [ + "test/a/abcdef/g", + "test/a/abcfed/g" + ], + "test/a/abc{fed,def}/g/h": [ + "test/a/abcdef/g/h", + "test/a/abcfed/g/h" + ], + "test/a/abc{fed/g,def}/**/": [ + "test/a/abcdef", + "test/a/abcdef/g", + "test/a/abcfed/g" + ], + "test/a/abc{fed/g,def}/**///**/": [ + "test/a/abcdef", + "test/a/abcdef/g", + "test/a/abcfed/g" + ], + "test/**/a/**/": [ + "test/a", + "test/a/abcdef", + "test/a/abcdef/g", + "test/a/abcfed", + "test/a/abcfed/g", + "test/a/b", + "test/a/b/c", + "test/a/bc", + "test/a/bc/e", + "test/a/c", + "test/a/c/d", + "test/a/c/d/c", + "test/a/cb", + "test/a/cb/e", + "test/a/symlink", + "test/a/symlink/a", + "test/a/symlink/a/b", + "test/a/symlink/a/b/c", + "test/a/symlink/a/b/c/a", + "test/a/symlink/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b" + ], + "test/+(a|b|c)/a{/,bc*}/**": [ + "test/a/abcdef", + "test/a/abcdef/g", + "test/a/abcdef/g/h", + "test/a/abcfed", + "test/a/abcfed/g", + "test/a/abcfed/g/h" + ], + "test/*/*/*/f": [ + "test/a/bc/e/f", + "test/a/cb/e/f" + ], + "test/**/f": [ + "test/a/bc/e/f", + "test/a/cb/e/f" + ], + "test/a/symlink/a/b/c/a/b/c/a/b/c//a/b/c////a/b/c/**/b/c/**": [ + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", + "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c" + ], + "{./*/*,/tmp/glob-test/*}": [ + "./examples/g.js", + "./examples/usr-local.js", + "./node_modules/graceful-fs", + "./node_modules/inherits", + "./node_modules/minimatch", + "./node_modules/mkdirp", + "./node_modules/rimraf", + "./node_modules/tap", + "./test/00-setup.js", + "./test/a", + "./test/bash-comparison.js", + "./test/bash-results.json", + "./test/cwd-test.js", + "./test/globstar-match.js", + "./test/mark.js", + "./test/nocase-nomagic.js", + "./test/pause-resume.js", + "./test/root-nomount.js", + "./test/root.js", + "./test/stat.js", + "./test/zz-cleanup.js", + "/tmp/glob-test/asdf", + "/tmp/glob-test/bar", + "/tmp/glob-test/baz", + "/tmp/glob-test/foo", + "/tmp/glob-test/quux", + "/tmp/glob-test/qwer", + "/tmp/glob-test/rewq" + ], + "{/tmp/glob-test/*,*}": [ + "/tmp/glob-test/asdf", + "/tmp/glob-test/bar", + "/tmp/glob-test/baz", + "/tmp/glob-test/foo", + "/tmp/glob-test/quux", + "/tmp/glob-test/qwer", + "/tmp/glob-test/rewq", + "examples", + "glob.js", + "LICENSE", + "node_modules", + "package.json", + "README.md", + "test" + ], + "test/a/!(symlink)/**": [ + "test/a/abcdef", + "test/a/abcdef/g", + "test/a/abcdef/g/h", + "test/a/abcfed", + "test/a/abcfed/g", + "test/a/abcfed/g/h", + "test/a/b", + "test/a/b/c", + "test/a/b/c/d", + "test/a/bc", + "test/a/bc/e", + "test/a/bc/e/f", + "test/a/c", + "test/a/c/d", + "test/a/c/d/c", + "test/a/c/d/c/b", + "test/a/cb", + "test/a/cb/e", + "test/a/cb/e/f" + ] +} diff --git a/node_modules/glob/test/cwd-test.js b/node_modules/glob/test/cwd-test.js new file mode 100644 index 0000000..352c27e --- /dev/null +++ b/node_modules/glob/test/cwd-test.js @@ -0,0 +1,55 @@ +var tap = require("tap") + +var origCwd = process.cwd() +process.chdir(__dirname) + +tap.test("changing cwd and searching for **/d", function (t) { + var glob = require('../') + var path = require('path') + t.test('.', function (t) { + glob('**/d', function (er, matches) { + t.ifError(er) + t.like(matches, [ 'a/b/c/d', 'a/c/d' ]) + t.end() + }) + }) + + t.test('a', function (t) { + glob('**/d', {cwd:path.resolve('a')}, function (er, matches) { + t.ifError(er) + t.like(matches, [ 'b/c/d', 'c/d' ]) + t.end() + }) + }) + + t.test('a/b', function (t) { + glob('**/d', {cwd:path.resolve('a/b')}, function (er, matches) { + t.ifError(er) + t.like(matches, [ 'c/d' ]) + t.end() + }) + }) + + t.test('a/b/', function (t) { + glob('**/d', {cwd:path.resolve('a/b/')}, function (er, matches) { + t.ifError(er) + t.like(matches, [ 'c/d' ]) + t.end() + }) + }) + + t.test('.', function (t) { + glob('**/d', {cwd: process.cwd()}, function (er, matches) { + t.ifError(er) + t.like(matches, [ 'a/b/c/d', 'a/c/d' ]) + t.end() + }) + }) + + t.test('cd -', function (t) { + process.chdir(origCwd) + t.end() + }) + + t.end() +}) diff --git a/node_modules/glob/test/globstar-match.js b/node_modules/glob/test/globstar-match.js new file mode 100644 index 0000000..9b234fa --- /dev/null +++ b/node_modules/glob/test/globstar-match.js @@ -0,0 +1,19 @@ +var Glob = require("../glob.js").Glob +var test = require('tap').test + +test('globstar should not have dupe matches', function(t) { + var pattern = 'a/**/[gh]' + var g = new Glob(pattern, { cwd: __dirname }) + var matches = [] + g.on('match', function(m) { + console.error('match %j', m) + matches.push(m) + }) + g.on('end', function(set) { + console.error('set', set) + matches = matches.sort() + set = set.sort() + t.same(matches, set, 'should have same set of matches') + t.end() + }) +}) diff --git a/node_modules/glob/test/mark.js b/node_modules/glob/test/mark.js new file mode 100644 index 0000000..ed68a33 --- /dev/null +++ b/node_modules/glob/test/mark.js @@ -0,0 +1,74 @@ +var test = require("tap").test +var glob = require('../') +process.chdir(__dirname) + +test("mark, no / on pattern", function (t) { + glob("a/*", {mark: true}, function (er, results) { + if (er) + throw er + var expect = [ 'a/abcdef/', + 'a/abcfed/', + 'a/b/', + 'a/bc/', + 'a/c/', + 'a/cb/' ] + + if (process.platform !== "win32") + expect.push('a/symlink/') + + t.same(results, expect) + t.end() + }) +}) + +test("mark=false, no / on pattern", function (t) { + glob("a/*", function (er, results) { + if (er) + throw er + var expect = [ 'a/abcdef', + 'a/abcfed', + 'a/b', + 'a/bc', + 'a/c', + 'a/cb' ] + + if (process.platform !== "win32") + expect.push('a/symlink') + t.same(results, expect) + t.end() + }) +}) + +test("mark=true, / on pattern", function (t) { + glob("a/*/", {mark: true}, function (er, results) { + if (er) + throw er + var expect = [ 'a/abcdef/', + 'a/abcfed/', + 'a/b/', + 'a/bc/', + 'a/c/', + 'a/cb/' ] + if (process.platform !== "win32") + expect.push('a/symlink/') + t.same(results, expect) + t.end() + }) +}) + +test("mark=false, / on pattern", function (t) { + glob("a/*/", function (er, results) { + if (er) + throw er + var expect = [ 'a/abcdef/', + 'a/abcfed/', + 'a/b/', + 'a/bc/', + 'a/c/', + 'a/cb/' ] + if (process.platform !== "win32") + expect.push('a/symlink/') + t.same(results, expect) + t.end() + }) +}) diff --git a/node_modules/glob/test/nocase-nomagic.js b/node_modules/glob/test/nocase-nomagic.js new file mode 100644 index 0000000..d862970 --- /dev/null +++ b/node_modules/glob/test/nocase-nomagic.js @@ -0,0 +1,113 @@ +var fs = require('graceful-fs'); +var test = require('tap').test; +var glob = require('../'); + +test('mock fs', function(t) { + var stat = fs.stat + var statSync = fs.statSync + var readdir = fs.readdir + var readdirSync = fs.readdirSync + + function fakeStat(path) { + var ret + switch (path.toLowerCase()) { + case '/tmp': case '/tmp/': + ret = { isDirectory: function() { return true } } + break + case '/tmp/a': + ret = { isDirectory: function() { return false } } + break + } + return ret + } + + fs.stat = function(path, cb) { + var f = fakeStat(path); + if (f) { + process.nextTick(function() { + cb(null, f) + }) + } else { + stat.call(fs, path, cb) + } + } + + fs.statSync = function(path) { + return fakeStat(path) || statSync.call(fs, path) + } + + function fakeReaddir(path) { + var ret + switch (path.toLowerCase()) { + case '/tmp': case '/tmp/': + ret = [ 'a', 'A' ] + break + case '/': + ret = ['tmp', 'tMp', 'tMP', 'TMP'] + } + return ret + } + + fs.readdir = function(path, cb) { + var f = fakeReaddir(path) + if (f) + process.nextTick(function() { + cb(null, f) + }) + else + readdir.call(fs, path, cb) + } + + fs.readdirSync = function(path) { + return fakeReaddir(path) || readdirSync.call(fs, path) + } + + t.pass('mocked') + t.end() +}) + +test('nocase, nomagic', function(t) { + var n = 2 + var want = [ '/TMP/A', + '/TMP/a', + '/tMP/A', + '/tMP/a', + '/tMp/A', + '/tMp/a', + '/tmp/A', + '/tmp/a' ] + glob('/tmp/a', { nocase: true }, function(er, res) { + if (er) + throw er + t.same(res.sort(), want) + if (--n === 0) t.end() + }) + glob('/tmp/A', { nocase: true }, function(er, res) { + if (er) + throw er + t.same(res.sort(), want) + if (--n === 0) t.end() + }) +}) + +test('nocase, with some magic', function(t) { + t.plan(2) + var want = [ '/TMP/A', + '/TMP/a', + '/tMP/A', + '/tMP/a', + '/tMp/A', + '/tMp/a', + '/tmp/A', + '/tmp/a' ] + glob('/tmp/*', { nocase: true }, function(er, res) { + if (er) + throw er + t.same(res.sort(), want) + }) + glob('/tmp/*', { nocase: true }, function(er, res) { + if (er) + throw er + t.same(res.sort(), want) + }) +}) diff --git a/node_modules/glob/test/pause-resume.js b/node_modules/glob/test/pause-resume.js new file mode 100644 index 0000000..e1ffbab --- /dev/null +++ b/node_modules/glob/test/pause-resume.js @@ -0,0 +1,73 @@ +// show that no match events happen while paused. +var tap = require("tap") +, child_process = require("child_process") +// just some gnarly pattern with lots of matches +, pattern = "test/a/!(symlink)/**" +, bashResults = require("./bash-results.json") +, patterns = Object.keys(bashResults) +, glob = require("../") +, Glob = glob.Glob +, path = require("path") + +// run from the root of the project +// this is usually where you're at anyway, but be sure. +process.chdir(path.resolve(__dirname, "..")) + +function alphasort (a, b) { + a = a.toLowerCase() + b = b.toLowerCase() + return a > b ? 1 : a < b ? -1 : 0 +} + +function cleanResults (m) { + // normalize discrepancies in ordering, duplication, + // and ending slashes. + return m.map(function (m) { + return m.replace(/\/+/g, "/").replace(/\/$/, "") + }).sort(alphasort).reduce(function (set, f) { + if (f !== set[set.length - 1]) set.push(f) + return set + }, []).sort(alphasort).map(function (f) { + // de-windows + return (process.platform !== 'win32') ? f + : f.replace(/^[a-zA-Z]:\\\\/, '/').replace(/\\/g, '/') + }) +} + +var globResults = [] +tap.test("use a Glob object, and pause/resume it", function (t) { + var g = new Glob(pattern) + , paused = false + , res = [] + , expect = bashResults[pattern] + + g.on("pause", function () { + console.error("pause") + }) + + g.on("resume", function () { + console.error("resume") + }) + + g.on("match", function (m) { + t.notOk(g.paused, "must not be paused") + globResults.push(m) + g.pause() + t.ok(g.paused, "must be paused") + setTimeout(g.resume.bind(g), 10) + }) + + g.on("end", function (matches) { + t.pass("reached glob end") + globResults = cleanResults(globResults) + matches = cleanResults(matches) + t.deepEqual(matches, globResults, + "end event matches should be the same as match events") + + t.deepEqual(matches, expect, + "glob matches should be the same as bash results") + + t.end() + }) +}) + diff --git a/node_modules/glob/test/root-nomount.js b/node_modules/glob/test/root-nomount.js new file mode 100644 index 0000000..3ac5979 --- /dev/null +++ b/node_modules/glob/test/root-nomount.js @@ -0,0 +1,39 @@ +var tap = require("tap") + +var origCwd = process.cwd() +process.chdir(__dirname) + +tap.test("changing root and searching for /b*/**", function (t) { + var glob = require('../') + var path = require('path') + t.test('.', function (t) { + glob('/b*/**', { globDebug: true, root: '.', nomount: true }, function (er, matches) { + t.ifError(er) + t.like(matches, []) + t.end() + }) + }) + + t.test('a', function (t) { + glob('/b*/**', { globDebug: true, root: path.resolve('a'), nomount: true }, function (er, matches) { + t.ifError(er) + t.like(matches, [ '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' ]) + t.end() + }) + }) + + t.test('root=a, cwd=a/b', function (t) { + glob('/b*/**', { globDebug: true, root: 'a', cwd: path.resolve('a/b'), nomount: true }, function (er, matches) { + t.ifError(er) + t.like(matches, [ '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' ]) + t.end() + }) + }) + + t.test('cd -', function (t) { + process.chdir(origCwd) + t.end() + }) + + t.end() +}) diff --git a/node_modules/glob/test/root.js b/node_modules/glob/test/root.js new file mode 100644 index 0000000..95c23f9 --- /dev/null +++ b/node_modules/glob/test/root.js @@ -0,0 +1,46 @@ +var t = require("tap") + +var origCwd = process.cwd() +process.chdir(__dirname) + +var glob = require('../') +var path = require('path') + +t.test('.', function (t) { + glob('/b*/**', { globDebug: true, root: '.' }, function (er, matches) { + t.ifError(er) + t.like(matches, []) + t.end() + }) +}) + + +t.test('a', function (t) { + console.error("root=" + path.resolve('a')) + glob('/b*/**', { globDebug: true, root: path.resolve('a') }, function (er, matches) { + t.ifError(er) + var wanted = [ + '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' + ].map(function (m) { + return path.join(path.resolve('a'), m).replace(/\\/g, '/') + }) + + t.like(matches, wanted) + t.end() + }) +}) + +t.test('root=a, cwd=a/b', function (t) { + glob('/b*/**', { globDebug: true, root: 'a', cwd: path.resolve('a/b') }, function (er, matches) { + t.ifError(er) + t.like(matches, [ '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' ].map(function (m) { + return path.join(path.resolve('a'), m).replace(/\\/g, '/') + })) + t.end() + }) +}) + +t.test('cd -', function (t) { + process.chdir(origCwd) + t.end() +}) diff --git a/node_modules/glob/test/stat.js b/node_modules/glob/test/stat.js new file mode 100644 index 0000000..6291711 --- /dev/null +++ b/node_modules/glob/test/stat.js @@ -0,0 +1,32 @@ +var glob = require('../') +var test = require('tap').test +var path = require('path') + +test('stat all the things', function(t) { + var g = new glob.Glob('a/*abc*/**', { stat: true, cwd: __dirname }) + var matches = [] + g.on('match', function(m) { + matches.push(m) + }) + var stats = [] + g.on('stat', function(m) { + stats.push(m) + }) + g.on('end', function(eof) { + stats = stats.sort() + matches = matches.sort() + eof = eof.sort() + t.same(stats, matches) + t.same(eof, matches) + var cache = Object.keys(this.statCache) + t.same(cache.map(function (f) { + return path.relative(__dirname, f) + }).sort(), matches) + + cache.forEach(function(c) { + t.equal(typeof this.statCache[c], 'object') + }, this) + + t.end() + }) +}) diff --git a/node_modules/glob/test/zz-cleanup.js b/node_modules/glob/test/zz-cleanup.js new file mode 100644 index 0000000..e085f0f --- /dev/null +++ b/node_modules/glob/test/zz-cleanup.js @@ -0,0 +1,11 @@ +// remove the fixtures +var tap = require("tap") +, rimraf = require("rimraf") +, path = require("path") + +tap.test("cleanup fixtures", function (t) { + rimraf(path.resolve(__dirname, "a"), function (er) { + t.ifError(er, "removed") + t.end() + }) +}) diff --git a/node_modules/graceful-fs/.npmignore b/node_modules/graceful-fs/.npmignore new file mode 100644 index 0000000..c2658d7 --- /dev/null +++ b/node_modules/graceful-fs/.npmignore @@ -0,0 +1 @@ +node_modules/ diff --git a/node_modules/graceful-fs/LICENSE b/node_modules/graceful-fs/LICENSE new file mode 100644 index 0000000..0c44ae7 --- /dev/null +++ b/node_modules/graceful-fs/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) Isaac Z. Schlueter ("Author") +All rights reserved. + +The BSD License + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: + +1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + +2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS +BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR +BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, +WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE +OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN +IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/graceful-fs/README.md b/node_modules/graceful-fs/README.md new file mode 100644 index 0000000..eb1a109 --- /dev/null +++ b/node_modules/graceful-fs/README.md @@ -0,0 +1,26 @@ +# graceful-fs + +graceful-fs functions as a drop-in replacement for the fs module, +making various improvements. + +The improvements are meant to normalize behavior across different +platforms and environments, and to make filesystem access more +resilient to errors. + +## Improvements over fs module + +graceful-fs: + +* Queues up `open` and `readdir` calls, and retries them once + something closes if there is an EMFILE error from too many file + descriptors. +* fixes `lchmod` for Node versions prior to 0.6.2. +* implements `fs.lutimes` if possible. Otherwise it becomes a noop. +* ignores `EINVAL` and `EPERM` errors in `chown`, `fchown` or + `lchown` if the user isn't root. +* makes `lchmod` and `lchown` become noops, if not available. +* retries reading a file if `read` results in EAGAIN error. + +On Windows, it retries renaming a file for up to one second if `EACCESS` +or `EPERM` error occurs, likely because antivirus software has locked +the directory. diff --git a/node_modules/graceful-fs/graceful-fs.js b/node_modules/graceful-fs/graceful-fs.js new file mode 100644 index 0000000..c84db91 --- /dev/null +++ b/node_modules/graceful-fs/graceful-fs.js @@ -0,0 +1,160 @@ +// Monkey-patching the fs module. +// It's ugly, but there is simply no other way to do this. +var fs = module.exports = require('fs') + +var assert = require('assert') + +// fix up some busted stuff, mostly on windows and old nodes +require('./polyfills.js') + +// The EMFILE enqueuing stuff + +var util = require('util') + +function noop () {} + +var debug = noop +if (util.debuglog) + debug = util.debuglog('gfs') +else if (/\bgfs\b/i.test(process.env.NODE_DEBUG || '')) + debug = function() { + var m = util.format.apply(util, arguments) + m = 'GFS: ' + m.split(/\n/).join('\nGFS: ') + console.error(m) + } + +if (/\bgfs\b/i.test(process.env.NODE_DEBUG || '')) { + process.on('exit', function() { + debug('fds', fds) + debug(queue) + assert.equal(queue.length, 0) + }) +} + + +var originalOpen = fs.open +fs.open = open + +function open(path, flags, mode, cb) { + if (typeof mode === "function") cb = mode, mode = null + if (typeof cb !== "function") cb = noop + new OpenReq(path, flags, mode, cb) +} + +function OpenReq(path, flags, mode, cb) { + this.path = path + this.flags = flags + this.mode = mode + this.cb = cb + Req.call(this) +} + +util.inherits(OpenReq, Req) + +OpenReq.prototype.process = function() { + originalOpen.call(fs, this.path, this.flags, this.mode, this.done) +} + +var fds = {} +OpenReq.prototype.done = function(er, fd) { + debug('open done', er, fd) + if (fd) + fds['fd' + fd] = this.path + Req.prototype.done.call(this, er, fd) +} + + +var originalReaddir = fs.readdir +fs.readdir = readdir + +function readdir(path, cb) { + if (typeof cb !== "function") cb = noop + new ReaddirReq(path, cb) +} + +function ReaddirReq(path, cb) { + this.path = path + this.cb = cb + Req.call(this) +} + +util.inherits(ReaddirReq, Req) + +ReaddirReq.prototype.process = function() { + originalReaddir.call(fs, this.path, this.done) +} + +ReaddirReq.prototype.done = function(er, files) { + if (files && files.sort) + files = files.sort() + Req.prototype.done.call(this, er, files) + onclose() +} + + +var originalClose = fs.close +fs.close = close + +function close (fd, cb) { + debug('close', fd) + if (typeof cb !== "function") cb = noop + delete fds['fd' + fd] + originalClose.call(fs, fd, function(er) { + onclose() + cb(er) + }) +} + + +var originalCloseSync = fs.closeSync +fs.closeSync = closeSync + +function closeSync (fd) { + try { + return originalCloseSync(fd) + } finally { + onclose() + } +} + + +// Req class +function Req () { + // start processing + this.done = this.done.bind(this) + this.failures = 0 + this.process() +} + +Req.prototype.done = function (er, result) { + var tryAgain = false + if (er) { + var code = er.code + var tryAgain = code === "EMFILE" + if (process.platform === "win32") + tryAgain = tryAgain || code === "OK" + } + + if (tryAgain) { + this.failures ++ + enqueue(this) + } else { + var cb = this.cb + cb(er, result) + } +} + +var queue = [] + +function enqueue(req) { + queue.push(req) + debug('enqueue %d %s', queue.length, req.constructor.name, req) +} + +function onclose() { + var req = queue.shift() + if (req) { + debug('process', req.constructor.name, req) + req.process() + } +} diff --git a/node_modules/graceful-fs/package.json b/node_modules/graceful-fs/package.json new file mode 100644 index 0000000..2f02893 --- /dev/null +++ b/node_modules/graceful-fs/package.json @@ -0,0 +1,37 @@ +{ + "author": "Isaac Z. Schlueter (http://blog.izs.me)", + "name": "graceful-fs", + "description": "A drop-in replacement for fs, making various improvements.", + "version": "2.0.3", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/node-graceful-fs.git" + }, + "main": "graceful-fs.js", + "engines": { + "node": ">=0.4.0" + }, + "directories": { + "test": "test" + }, + "scripts": { + "test": "tap test/*.js" + }, + "keywords": [ + "fs", + "module", + "reading", + "retry", + "retries", + "queue", + "error", + "errors", + "handling", + "EMFILE", + "EAGAIN", + "EINVAL", + "EPERM", + "EACCESS" + ], + "license": "BSD" +} diff --git a/node_modules/graceful-fs/polyfills.js b/node_modules/graceful-fs/polyfills.js new file mode 100644 index 0000000..afc83b3 --- /dev/null +++ b/node_modules/graceful-fs/polyfills.js @@ -0,0 +1,228 @@ +var fs = require('fs') +var constants = require('constants') + +var origCwd = process.cwd +var cwd = null +process.cwd = function() { + if (!cwd) + cwd = origCwd.call(process) + return cwd +} +var chdir = process.chdir +process.chdir = function(d) { + cwd = null + chdir.call(process, d) +} + +// (re-)implement some things that are known busted or missing. + +// lchmod, broken prior to 0.6.2 +// back-port the fix here. +if (constants.hasOwnProperty('O_SYMLINK') && + process.version.match(/^v0\.6\.[0-2]|^v0\.5\./)) { + fs.lchmod = function (path, mode, callback) { + callback = callback || noop + fs.open( path + , constants.O_WRONLY | constants.O_SYMLINK + , mode + , function (err, fd) { + if (err) { + callback(err) + return + } + // prefer to return the chmod error, if one occurs, + // but still try to close, and report closing errors if they occur. + fs.fchmod(fd, mode, function (err) { + fs.close(fd, function(err2) { + callback(err || err2) + }) + }) + }) + } + + fs.lchmodSync = function (path, mode) { + var fd = fs.openSync(path, constants.O_WRONLY | constants.O_SYMLINK, mode) + + // prefer to return the chmod error, if one occurs, + // but still try to close, and report closing errors if they occur. + var err, err2 + try { + var ret = fs.fchmodSync(fd, mode) + } catch (er) { + err = er + } + try { + fs.closeSync(fd) + } catch (er) { + err2 = er + } + if (err || err2) throw (err || err2) + return ret + } +} + + +// lutimes implementation, or no-op +if (!fs.lutimes) { + if (constants.hasOwnProperty("O_SYMLINK")) { + fs.lutimes = function (path, at, mt, cb) { + fs.open(path, constants.O_SYMLINK, function (er, fd) { + cb = cb || noop + if (er) return cb(er) + fs.futimes(fd, at, mt, function (er) { + fs.close(fd, function (er2) { + return cb(er || er2) + }) + }) + }) + } + + fs.lutimesSync = function (path, at, mt) { + var fd = fs.openSync(path, constants.O_SYMLINK) + , err + , err2 + , ret + + try { + var ret = fs.futimesSync(fd, at, mt) + } catch (er) { + err = er + } + try { + fs.closeSync(fd) + } catch (er) { + err2 = er + } + if (err || err2) throw (err || err2) + return ret + } + + } else if (fs.utimensat && constants.hasOwnProperty("AT_SYMLINK_NOFOLLOW")) { + // maybe utimensat will be bound soonish? + fs.lutimes = function (path, at, mt, cb) { + fs.utimensat(path, at, mt, constants.AT_SYMLINK_NOFOLLOW, cb) + } + + fs.lutimesSync = function (path, at, mt) { + return fs.utimensatSync(path, at, mt, constants.AT_SYMLINK_NOFOLLOW) + } + + } else { + fs.lutimes = function (_a, _b, _c, cb) { process.nextTick(cb) } + fs.lutimesSync = function () {} + } +} + + +// https://github.com/isaacs/node-graceful-fs/issues/4 +// Chown should not fail on einval or eperm if non-root. + +fs.chown = chownFix(fs.chown) +fs.fchown = chownFix(fs.fchown) +fs.lchown = chownFix(fs.lchown) + +fs.chownSync = chownFixSync(fs.chownSync) +fs.fchownSync = chownFixSync(fs.fchownSync) +fs.lchownSync = chownFixSync(fs.lchownSync) + +function chownFix (orig) { + if (!orig) return orig + return function (target, uid, gid, cb) { + return orig.call(fs, target, uid, gid, function (er, res) { + if (chownErOk(er)) er = null + cb(er, res) + }) + } +} + +function chownFixSync (orig) { + if (!orig) return orig + return function (target, uid, gid) { + try { + return orig.call(fs, target, uid, gid) + } catch (er) { + if (!chownErOk(er)) throw er + } + } +} + +function chownErOk (er) { + // if there's no getuid, or if getuid() is something other than 0, + // and the error is EINVAL or EPERM, then just ignore it. + // This specific case is a silent failure in cp, install, tar, + // and most other unix tools that manage permissions. + // When running as root, or if other types of errors are encountered, + // then it's strict. + if (!er || (!process.getuid || process.getuid() !== 0) + && (er.code === "EINVAL" || er.code === "EPERM")) return true +} + + +// if lchmod/lchown do not exist, then make them no-ops +if (!fs.lchmod) { + fs.lchmod = function (path, mode, cb) { + process.nextTick(cb) + } + fs.lchmodSync = function () {} +} +if (!fs.lchown) { + fs.lchown = function (path, uid, gid, cb) { + process.nextTick(cb) + } + fs.lchownSync = function () {} +} + + + +// on Windows, A/V software can lock the directory, causing this +// to fail with an EACCES or EPERM if the directory contains newly +// created files. Try again on failure, for up to 1 second. +if (process.platform === "win32") { + var rename_ = fs.rename + fs.rename = function rename (from, to, cb) { + var start = Date.now() + rename_(from, to, function CB (er) { + if (er + && (er.code === "EACCES" || er.code === "EPERM") + && Date.now() - start < 1000) { + return rename_(from, to, CB) + } + cb(er) + }) + } +} + + +// if read() returns EAGAIN, then just try it again. +var read = fs.read +fs.read = function (fd, buffer, offset, length, position, callback_) { + var callback + if (callback_ && typeof callback_ === 'function') { + var eagCounter = 0 + callback = function (er, _, __) { + if (er && er.code === 'EAGAIN' && eagCounter < 10) { + eagCounter ++ + return read.call(fs, fd, buffer, offset, length, position, callback) + } + callback_.apply(this, arguments) + } + } + return read.call(fs, fd, buffer, offset, length, position, callback) +} + +var readSync = fs.readSync +fs.readSync = function (fd, buffer, offset, length, position) { + var eagCounter = 0 + while (true) { + try { + return readSync.call(fs, fd, buffer, offset, length, position) + } catch (er) { + if (er.code === 'EAGAIN' && eagCounter < 10) { + eagCounter ++ + continue + } + throw er + } + } +} + diff --git a/node_modules/graceful-fs/test/open.js b/node_modules/graceful-fs/test/open.js new file mode 100644 index 0000000..104f36b --- /dev/null +++ b/node_modules/graceful-fs/test/open.js @@ -0,0 +1,39 @@ +var test = require('tap').test +var fs = require('../graceful-fs.js') + +test('graceful fs is monkeypatched fs', function (t) { + t.equal(fs, require('fs')) + t.end() +}) + +test('open an existing file works', function (t) { + var fd = fs.openSync(__filename, 'r') + fs.closeSync(fd) + fs.open(__filename, 'r', function (er, fd) { + if (er) throw er + fs.close(fd, function (er) { + if (er) throw er + t.pass('works') + t.end() + }) + }) +}) + +test('open a non-existing file throws', function (t) { + var er + try { + var fd = fs.openSync('this file does not exist', 'r') + } catch (x) { + er = x + } + t.ok(er, 'should throw') + t.notOk(fd, 'should not get an fd') + t.equal(er.code, 'ENOENT') + + fs.open('neither does this file', 'r', function (er, fd) { + t.ok(er, 'should throw') + t.notOk(fd, 'should not get an fd') + t.equal(er.code, 'ENOENT') + t.end() + }) +}) diff --git a/node_modules/graceful-fs/test/readdir-sort.js b/node_modules/graceful-fs/test/readdir-sort.js new file mode 100644 index 0000000..aeaedf1 --- /dev/null +++ b/node_modules/graceful-fs/test/readdir-sort.js @@ -0,0 +1,21 @@ +var test = require("tap").test +var fs = require("fs") + +var readdir = fs.readdir +fs.readdir = function(path, cb) { + process.nextTick(function() { + cb(null, ["b", "z", "a"]) + }) +} + +var g = require("../") + +test("readdir reorder", function (t) { + g.readdir("whatevers", function (er, files) { + if (er) + throw er + console.error(files) + t.same(files, [ "a", "b", "z" ]) + t.end() + }) +}) diff --git a/node_modules/growl/History.md b/node_modules/growl/History.md new file mode 100644 index 0000000..a4b7b49 --- /dev/null +++ b/node_modules/growl/History.md @@ -0,0 +1,63 @@ + +1.7.0 / 2012-12-30 +================== + + * support transient notifications in Gnome + +1.6.1 / 2012-09-25 +================== + + * restore compatibility with node < 0.8 [fgnass] + +1.6.0 / 2012-09-06 +================== + + * add notification center support [drudge] + +1.5.1 / 2012-04-08 +================== + + * Merge pull request #16 from KyleAMathews/patch-1 + * Fixes #15 + +1.5.0 / 2012-02-08 +================== + + * Added windows support [perfusorius] + +1.4.1 / 2011-12-28 +================== + + * Fixed: dont exit(). Closes #9 + +1.4.0 / 2011-12-17 +================== + + * Changed API: `growl.notify()` -> `growl()` + +1.3.0 / 2011-12-17 +================== + + * Added support for Ubuntu/Debian/Linux users [niftylettuce] + * Fixed: send notifications even if title not specified [alessioalex] + +1.2.0 / 2011-10-06 +================== + + * Add support for priority. + +1.1.0 / 2011-03-15 +================== + + * Added optional callbacks + * Added parsing of version + +1.0.1 / 2010-03-26 +================== + + * Fixed; sys.exec -> child_process.exec to support latest node + +1.0.0 / 2010-03-19 +================== + + * Initial release diff --git a/node_modules/growl/Readme.md b/node_modules/growl/Readme.md new file mode 100644 index 0000000..48d717c --- /dev/null +++ b/node_modules/growl/Readme.md @@ -0,0 +1,99 @@ +# Growl for nodejs + +Growl support for Nodejs. This is essentially a port of my [Ruby Growl Library](http://github.com/visionmedia/growl). Ubuntu/Linux support added thanks to [@niftylettuce](http://github.com/niftylettuce). + +## Installation + +### Install + +### Mac OS X (Darwin): + + Install [growlnotify(1)](http://growl.info/extras.php#growlnotify). On OS X 10.8, Notification Center is supported using [terminal-notifier](https://github.com/alloy/terminal-notifier). To install: + + $ sudo gem install terminal-notifier + + Install [npm](http://npmjs.org/) and run: + + $ npm install growl + +### Ubuntu (Linux): + + Install `notify-send` through the [libnotify-bin](http://packages.ubuntu.com/libnotify-bin) package: + + $ sudo apt-get install libnotify-bin + + Install [npm](http://npmjs.org/) and run: + + $ npm install growl + +### Windows: + + Download and install [Growl for Windows](http://www.growlforwindows.com/gfw/default.aspx) + + Download [growlnotify](http://www.growlforwindows.com/gfw/help/growlnotify.aspx) - **IMPORTANT :** Unpack growlnotify to a folder that is present in your path! + + Install [npm](http://npmjs.org/) and run: + + $ npm install growl + +## Examples + +Callback functions are optional + + var growl = require('growl') + growl('You have mail!') + growl('5 new messages', { sticky: true }) + growl('5 new emails', { title: 'Email Client', image: 'Safari', sticky: true }) + growl('Message with title', { title: 'Title'}) + growl('Set priority', { priority: 2 }) + growl('Show Safari icon', { image: 'Safari' }) + growl('Show icon', { image: 'path/to/icon.icns' }) + growl('Show image', { image: 'path/to/my.image.png' }) + growl('Show png filesystem icon', { image: 'png' }) + growl('Show pdf filesystem icon', { image: 'article.pdf' }) + growl('Show pdf filesystem icon', { image: 'article.pdf' }, function(err){ + // ... notified + }) + +## Options + + - title + - notification title + - name + - application name + - priority + - priority for the notification (default is 0) + - sticky + - weither or not the notification should remainin until closed + - image + - Auto-detects the context: + - path to an icon sets --iconpath + - path to an image sets --image + - capitalized word sets --appIcon + - filename uses extname as --icon + - otherwise treated as --icon + +## License + +(The MIT License) + +Copyright (c) 2009 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/growl/lib/growl.js b/node_modules/growl/lib/growl.js new file mode 100644 index 0000000..04f4f9b --- /dev/null +++ b/node_modules/growl/lib/growl.js @@ -0,0 +1,234 @@ +// Growl - Copyright TJ Holowaychuk (MIT Licensed) + +/** + * Module dependencies. + */ + +var exec = require('child_process').exec + , fs = require('fs') + , path = require('path') + , exists = fs.existsSync || path.existsSync + , os = require('os') + , quote = JSON.stringify + , cmd; + +function which(name) { + var paths = process.env.PATH.split(':'); + var loc; + + for (var i = 0, len = paths.length; i < len; ++i) { + loc = path.join(paths[i], name); + if (exists(loc)) return loc; + } +} + +switch(os.type()) { + case 'Darwin': + if (which('terminal-notifier')) { + cmd = { + type: "Darwin-NotificationCenter" + , pkg: "terminal-notifier" + , msg: '-message' + , title: '-title' + , subtitle: '-subtitle' + , priority: { + cmd: '-execute' + , range: [] + } + }; + } else { + cmd = { + type: "Darwin-Growl" + , pkg: "growlnotify" + , msg: '-m' + , sticky: '--sticky' + , priority: { + cmd: '--priority' + , range: [ + -2 + , -1 + , 0 + , 1 + , 2 + , "Very Low" + , "Moderate" + , "Normal" + , "High" + , "Emergency" + ] + } + }; + } + break; + case 'Linux': + cmd = { + type: "Linux" + , pkg: "notify-send" + , msg: '' + , sticky: '-t 0' + , icon: '-i' + , priority: { + cmd: '-u' + , range: [ + "low" + , "normal" + , "critical" + ] + } + }; + break; + case 'Windows_NT': + cmd = { + type: "Windows" + , pkg: "growlnotify" + , msg: '' + , sticky: '/s:true' + , title: '/t:' + , icon: '/i:' + , priority: { + cmd: '/p:' + , range: [ + -2 + , -1 + , 0 + , 1 + , 2 + ] + } + }; + break; +} + +/** + * Expose `growl`. + */ + +exports = module.exports = growl; + +/** + * Node-growl version. + */ + +exports.version = '1.4.1' + +/** + * Send growl notification _msg_ with _options_. + * + * Options: + * + * - title Notification title + * - sticky Make the notification stick (defaults to false) + * - priority Specify an int or named key (default is 0) + * - name Application name (defaults to growlnotify) + * - image + * - path to an icon sets --iconpath + * - path to an image sets --image + * - capitalized word sets --appIcon + * - filename uses extname as --icon + * - otherwise treated as --icon + * + * Examples: + * + * growl('New email') + * growl('5 new emails', { title: 'Thunderbird' }) + * growl('Email sent', function(){ + * // ... notification sent + * }) + * + * @param {string} msg + * @param {object} options + * @param {function} fn + * @api public + */ + +function growl(msg, options, fn) { + var image + , args + , options = options || {} + , fn = fn || function(){}; + + // noop + if (!cmd) return fn(new Error('growl not supported on this platform')); + args = [cmd.pkg]; + + // image + if (image = options.image) { + switch(cmd.type) { + case 'Darwin-Growl': + var flag, ext = path.extname(image).substr(1) + flag = flag || ext == 'icns' && 'iconpath' + flag = flag || /^[A-Z]/.test(image) && 'appIcon' + flag = flag || /^png|gif|jpe?g$/.test(ext) && 'image' + flag = flag || ext && (image = ext) && 'icon' + flag = flag || 'icon' + args.push('--' + flag, image) + break; + case 'Linux': + args.push(cmd.icon + " " + image); + // libnotify defaults to sticky, set a hint for transient notifications + if (!options.sticky) args.push('--hint=int:transient:1'); + break; + case 'Windows': + args.push(cmd.icon + quote(image)); + break; + } + } + + // sticky + if (options.sticky) args.push(cmd.sticky); + + // priority + if (options.priority) { + var priority = options.priority + ''; + var checkindexOf = cmd.priority.range.indexOf(priority); + if (~cmd.priority.range.indexOf(priority)) { + args.push(cmd.priority, options.priority); + } + } + + // name + if (options.name && cmd.type === "Darwin-Growl") { + args.push('--name', options.name); + } + + switch(cmd.type) { + case 'Darwin-Growl': + args.push(cmd.msg); + args.push(quote(msg)); + if (options.title) args.push(quote(options.title)); + break; + case 'Darwin-NotificationCenter': + args.push(cmd.msg); + args.push(quote(msg)); + if (options.title) { + args.push(cmd.title); + args.push(quote(options.title)); + } + if (options.subtitle) { + args.push(cmd.subtitle); + args.push(quote(options.title)); + } + break; + case 'Darwin-Growl': + args.push(cmd.msg); + args.push(quote(msg)); + if (options.title) args.push(quote(options.title)); + break; + case 'Linux': + if (options.title) { + args.push(quote(options.title)); + args.push(cmd.msg); + args.push(quote(msg)); + } else { + args.push(quote(msg)); + } + break; + case 'Windows': + args.push(quote(msg)); + if (options.title) args.push(cmd.title + quote(options.title)); + break; + } + + // execute + exec(args.join(' '), fn); +}; diff --git a/node_modules/growl/package.json b/node_modules/growl/package.json new file mode 100644 index 0000000..9fe713a --- /dev/null +++ b/node_modules/growl/package.json @@ -0,0 +1,7 @@ +{ + "name": "growl", + "version": "1.7.0", + "description": "Growl unobtrusive notifications", + "author": "TJ Holowaychuk ", + "main": "./lib/growl.js" +} diff --git a/node_modules/growl/test.js b/node_modules/growl/test.js new file mode 100644 index 0000000..cf22d90 --- /dev/null +++ b/node_modules/growl/test.js @@ -0,0 +1,20 @@ + +var growl = require('./lib/growl') + +growl('You have mail!') +growl('5 new messages', { sticky: true }) +growl('5 new emails', { title: 'Email Client', image: 'Safari', sticky: true }) +growl('Message with title', { title: 'Title'}) +growl('Set priority', { priority: 2 }) +growl('Show Safari icon', { image: 'Safari' }) +growl('Show icon', { image: 'path/to/icon.icns' }) +growl('Show image', { image: 'path/to/my.image.png' }) +growl('Show png filesystem icon', { image: 'png' }) +growl('Show pdf filesystem icon', { image: 'article.pdf' }) +growl('Show pdf filesystem icon', { image: 'article.pdf' }, function(){ + console.log('callback'); +}) +growl('Show pdf filesystem icon', { title: 'Use show()', image: 'article.pdf' }) +growl('here \' are \n some \\ characters that " need escaping', {}, function(error, stdout, stderr) { + if (error !== null) throw new Error('escaping failed:\n' + stdout + stderr); +}) diff --git a/node_modules/inherits/LICENSE b/node_modules/inherits/LICENSE new file mode 100644 index 0000000..dea3013 --- /dev/null +++ b/node_modules/inherits/LICENSE @@ -0,0 +1,16 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM +LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR +OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR +PERFORMANCE OF THIS SOFTWARE. + diff --git a/node_modules/inherits/README.md b/node_modules/inherits/README.md new file mode 100644 index 0000000..b1c5665 --- /dev/null +++ b/node_modules/inherits/README.md @@ -0,0 +1,42 @@ +Browser-friendly inheritance fully compatible with standard node.js +[inherits](http://nodejs.org/api/util.html#util_util_inherits_constructor_superconstructor). + +This package exports standard `inherits` from node.js `util` module in +node environment, but also provides alternative browser-friendly +implementation through [browser +field](https://gist.github.com/shtylman/4339901). Alternative +implementation is a literal copy of standard one located in standalone +module to avoid requiring of `util`. It also has a shim for old +browsers with no `Object.create` support. + +While keeping you sure you are using standard `inherits` +implementation in node.js environment, it allows bundlers such as +[browserify](https://github.com/substack/node-browserify) to not +include full `util` package to your client code if all you need is +just `inherits` function. It worth, because browser shim for `util` +package is large and `inherits` is often the single function you need +from it. + +It's recommended to use this package instead of +`require('util').inherits` for any code that has chances to be used +not only in node.js but in browser too. + +## usage + +```js +var inherits = require('inherits'); +// then use exactly as the standard one +``` + +## note on version ~1.0 + +Version ~1.0 had completely different motivation and is not compatible +neither with 2.0 nor with standard node.js `inherits`. + +If you are using version ~1.0 and planning to switch to ~2.0, be +careful: + +* new version uses `super_` instead of `super` for referencing + superclass +* new version overwrites current prototype while old one preserves any + existing fields on it diff --git a/node_modules/inherits/inherits.js b/node_modules/inherits/inherits.js new file mode 100644 index 0000000..3b94763 --- /dev/null +++ b/node_modules/inherits/inherits.js @@ -0,0 +1,7 @@ +try { + var util = require('util'); + if (typeof util.inherits !== 'function') throw ''; + module.exports = util.inherits; +} catch (e) { + module.exports = require('./inherits_browser.js'); +} diff --git a/node_modules/inherits/inherits_browser.js b/node_modules/inherits/inherits_browser.js new file mode 100644 index 0000000..c1e78a7 --- /dev/null +++ b/node_modules/inherits/inherits_browser.js @@ -0,0 +1,23 @@ +if (typeof Object.create === 'function') { + // implementation from standard node.js 'util' module + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + ctor.prototype = Object.create(superCtor.prototype, { + constructor: { + value: ctor, + enumerable: false, + writable: true, + configurable: true + } + }); + }; +} else { + // old school shim for old browsers + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + var TempCtor = function () {} + TempCtor.prototype = superCtor.prototype + ctor.prototype = new TempCtor() + ctor.prototype.constructor = ctor + } +} diff --git a/node_modules/inherits/package.json b/node_modules/inherits/package.json new file mode 100644 index 0000000..7cf62b9 --- /dev/null +++ b/node_modules/inherits/package.json @@ -0,0 +1,29 @@ +{ + "name": "inherits", + "description": "Browser-friendly inheritance fully compatible with standard node.js inherits()", + "version": "2.0.3", + "keywords": [ + "inheritance", + "class", + "klass", + "oop", + "object-oriented", + "inherits", + "browser", + "browserify" + ], + "main": "./inherits.js", + "browser": "./inherits_browser.js", + "repository": "git://github.com/isaacs/inherits", + "license": "ISC", + "scripts": { + "test": "node test" + }, + "devDependencies": { + "tap": "^7.1.0" + }, + "files": [ + "inherits.js", + "inherits_browser.js" + ] +} diff --git a/node_modules/jade/.npmignore b/node_modules/jade/.npmignore new file mode 100644 index 0000000..b9af3d4 --- /dev/null +++ b/node_modules/jade/.npmignore @@ -0,0 +1,15 @@ +test +support +benchmarks +examples +lib-cov +coverage.html +.gitmodules +.travis.yml +History.md +Readme.md +Makefile +test/ +support/ +benchmarks/ +examples/ diff --git a/node_modules/jade/LICENSE b/node_modules/jade/LICENSE new file mode 100644 index 0000000..8ad0e0d --- /dev/null +++ b/node_modules/jade/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2009-2010 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/jade/bin/jade b/node_modules/jade/bin/jade new file mode 100755 index 0000000..7e6002f --- /dev/null +++ b/node_modules/jade/bin/jade @@ -0,0 +1,147 @@ +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var fs = require('fs') + , program = require('commander') + , path = require('path') + , basename = path.basename + , dirname = path.dirname + , resolve = path.resolve + , join = path.join + , mkdirp = require('mkdirp') + , jade = require('../'); + +// jade options + +var options = {}; + +// options + +program + .version(jade.version) + .usage('[options] [dir|file ...]') + .option('-o, --obj ', 'javascript options object') + .option('-O, --out ', 'output the compiled html to ') + .option('-p, --path ', 'filename used to resolve includes') + .option('-P, --pretty', 'compile pretty html output') + .option('-c, --client', 'compile for client-side runtime.js') + .option('-D, --no-debug', 'compile without debugging (smaller functions)') + +program.on('--help', function(){ + console.log(' Examples:'); + console.log(''); + console.log(' # translate jade the templates dir'); + console.log(' $ jade templates'); + console.log(''); + console.log(' # create {foo,bar}.html'); + console.log(' $ jade {foo,bar}.jade'); + console.log(''); + console.log(' # jade over stdio'); + console.log(' $ jade < my.jade > my.html'); + console.log(''); + console.log(' # jade over stdio'); + console.log(' $ echo "h1 Jade!" | jade'); + console.log(''); + console.log(' # foo, bar dirs rendering to /tmp'); + console.log(' $ jade foo bar --out /tmp '); + console.log(''); +}); + +program.parse(process.argv); + +// options given, parse them + +if (program.obj) options = eval('(' + program.obj + ')'); + +// --filename + +if (program.path) options.filename = program.path; + +// --no-debug + +options.compileDebug = program.debug; + +// --client + +options.client = program.client; + +// --pretty + +options.pretty = program.pretty; + +// left-over args are file paths + +var files = program.args; + +// compile files + +if (files.length) { + console.log(); + files.forEach(renderFile); + process.on('exit', console.log); +// stdio +} else { + stdin(); +} + +/** + * Compile from stdin. + */ + +function stdin() { + var buf = ''; + process.stdin.setEncoding('utf8'); + process.stdin.on('data', function(chunk){ buf += chunk; }); + process.stdin.on('end', function(){ + var fn = jade.compile(buf, options); + var output = options.client + ? fn.toString() + : fn(options); + process.stdout.write(output); + }).resume(); +} + +/** + * Process the given path, compiling the jade files found. + * Always walk the subdirectories. + */ + +function renderFile(path) { + var re = /\.jade$/; + fs.lstat(path, function(err, stat) { + if (err) throw err; + // Found jade file + if (stat.isFile() && re.test(path)) { + fs.readFile(path, 'utf8', function(err, str){ + if (err) throw err; + options.filename = path; + var fn = jade.compile(str, options); + var extname = options.client ? '.js' : '.html'; + path = path.replace(re, extname); + if (program.out) path = join(program.out, basename(path)); + var dir = resolve(dirname(path)); + mkdirp(dir, 0755, function(err){ + if (err) throw err; + var output = options.client + ? fn.toString() + : fn(options); + fs.writeFile(path, output, function(err){ + if (err) throw err; + console.log(' \033[90mrendered \033[36m%s\033[0m', path); + }); + }); + }); + // Found directory + } else if (stat.isDirectory()) { + fs.readdir(path, function(err, files) { + if (err) throw err; + files.map(function(filename) { + return path + '/' + filename; + }).forEach(renderFile); + }); + } + }); +} diff --git a/node_modules/jade/index.js b/node_modules/jade/index.js new file mode 100644 index 0000000..8ad059f --- /dev/null +++ b/node_modules/jade/index.js @@ -0,0 +1,4 @@ + +module.exports = process.env.JADE_COV + ? require('./lib-cov/jade') + : require('./lib/jade'); \ No newline at end of file diff --git a/node_modules/jade/jade.js b/node_modules/jade/jade.js new file mode 100644 index 0000000..1983a20 --- /dev/null +++ b/node_modules/jade/jade.js @@ -0,0 +1,3586 @@ +(function() { + +// CommonJS require() + +function require(p){ + var path = require.resolve(p) + , mod = require.modules[path]; + if (!mod) throw new Error('failed to require "' + p + '"'); + if (!mod.exports) { + mod.exports = {}; + mod.call(mod.exports, mod, mod.exports, require.relative(path)); + } + return mod.exports; + } + +require.modules = {}; + +require.resolve = function (path){ + var orig = path + , reg = path + '.js' + , index = path + '/index.js'; + return require.modules[reg] && reg + || require.modules[index] && index + || orig; + }; + +require.register = function (path, fn){ + require.modules[path] = fn; + }; + +require.relative = function (parent) { + return function(p){ + if ('.' != p.charAt(0)) return require(p); + + var path = parent.split('/') + , segs = p.split('/'); + path.pop(); + + for (var i = 0; i < segs.length; i++) { + var seg = segs[i]; + if ('..' == seg) path.pop(); + else if ('.' != seg) path.push(seg); + } + + return require(path.join('/')); + }; + }; + + +require.register("compiler.js", function(module, exports, require){ + +/*! + * Jade - Compiler + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var nodes = require('./nodes') + , filters = require('./filters') + , doctypes = require('./doctypes') + , selfClosing = require('./self-closing') + , runtime = require('./runtime') + , utils = require('./utils'); + + + if (!Object.keys) { + Object.keys = function(obj){ + var arr = []; + for (var key in obj) { + if (obj.hasOwnProperty(key)) { + arr.push(key); + } + } + return arr; + } + } + + if (!String.prototype.trimLeft) { + String.prototype.trimLeft = function(){ + return this.replace(/^\s+/, ''); + } + } + + + +/** + * Initialize `Compiler` with the given `node`. + * + * @param {Node} node + * @param {Object} options + * @api public + */ + +var Compiler = module.exports = function Compiler(node, options) { + this.options = options = options || {}; + this.node = node; + this.hasCompiledDoctype = false; + this.hasCompiledTag = false; + this.pp = options.pretty || false; + this.debug = false !== options.compileDebug; + this.indents = 0; + this.parentIndents = 0; + if (options.doctype) this.setDoctype(options.doctype); +}; + +/** + * Compiler prototype. + */ + +Compiler.prototype = { + + /** + * Compile parse tree to JavaScript. + * + * @api public + */ + + compile: function(){ + this.buf = ['var interp;']; + if (this.pp) this.buf.push("var __indent = [];"); + this.lastBufferedIdx = -1; + this.visit(this.node); + return this.buf.join('\n'); + }, + + /** + * Sets the default doctype `name`. Sets terse mode to `true` when + * html 5 is used, causing self-closing tags to end with ">" vs "/>", + * and boolean attributes are not mirrored. + * + * @param {string} name + * @api public + */ + + setDoctype: function(name){ + var doctype = doctypes[(name || 'default').toLowerCase()]; + doctype = doctype || ''; + this.doctype = doctype; + this.terse = '5' == name || 'html' == name; + this.xml = 0 == this.doctype.indexOf(' 1 && !escape && block.nodes[0].isText && block.nodes[1].isText) + this.prettyIndent(1, true); + + for (var i = 0; i < len; ++i) { + // Pretty print text + if (pp && i > 0 && !escape && block.nodes[i].isText && block.nodes[i-1].isText) + this.prettyIndent(1, false); + + this.visit(block.nodes[i]); + // Multiple text nodes are separated by newlines + if (block.nodes[i+1] && block.nodes[i].isText && block.nodes[i+1].isText) + this.buffer('\\n'); + } + }, + + /** + * Visit `doctype`. Sets terse mode to `true` when html 5 + * is used, causing self-closing tags to end with ">" vs "/>", + * and boolean attributes are not mirrored. + * + * @param {Doctype} doctype + * @api public + */ + + visitDoctype: function(doctype){ + if (doctype && (doctype.val || !this.doctype)) { + this.setDoctype(doctype.val || 'default'); + } + + if (this.doctype) this.buffer(this.doctype); + this.hasCompiledDoctype = true; + }, + + /** + * Visit `mixin`, generating a function that + * may be called within the template. + * + * @param {Mixin} mixin + * @api public + */ + + visitMixin: function(mixin){ + var name = mixin.name.replace(/-/g, '_') + '_mixin' + , args = mixin.args || '' + , block = mixin.block + , attrs = mixin.attrs + , pp = this.pp; + + if (mixin.call) { + if (pp) this.buf.push("__indent.push('" + Array(this.indents + 1).join(' ') + "');") + if (block || attrs.length) { + + this.buf.push(name + '.call({'); + + if (block) { + this.buf.push('block: function(){'); + + // Render block with no indents, dynamically added when rendered + this.parentIndents++; + var _indents = this.indents; + this.indents = 0; + this.visit(mixin.block); + this.indents = _indents; + this.parentIndents--; + + if (attrs.length) { + this.buf.push('},'); + } else { + this.buf.push('}'); + } + } + + if (attrs.length) { + var val = this.attrs(attrs); + if (val.inherits) { + this.buf.push('attributes: merge({' + val.buf + + '}, attributes), escaped: merge(' + val.escaped + ', escaped, true)'); + } else { + this.buf.push('attributes: {' + val.buf + '}, escaped: ' + val.escaped); + } + } + + if (args) { + this.buf.push('}, ' + args + ');'); + } else { + this.buf.push('});'); + } + + } else { + this.buf.push(name + '(' + args + ');'); + } + if (pp) this.buf.push("__indent.pop();") + } else { + this.buf.push('var ' + name + ' = function(' + args + '){'); + this.buf.push('var block = this.block, attributes = this.attributes || {}, escaped = this.escaped || {};'); + this.parentIndents++; + this.visit(block); + this.parentIndents--; + this.buf.push('};'); + } + }, + + /** + * Visit `tag` buffering tag markup, generating + * attributes, visiting the `tag`'s code and block. + * + * @param {Tag} tag + * @api public + */ + + visitTag: function(tag){ + this.indents++; + var name = tag.name + , pp = this.pp; + + if (tag.buffer) name = "' + (" + name + ") + '"; + + if (!this.hasCompiledTag) { + if (!this.hasCompiledDoctype && 'html' == name) { + this.visitDoctype(); + } + this.hasCompiledTag = true; + } + + // pretty print + if (pp && !tag.isInline()) + this.prettyIndent(0, true); + + if ((~selfClosing.indexOf(name) || tag.selfClosing) && !this.xml) { + this.buffer('<' + name); + this.visitAttributes(tag.attrs); + this.terse + ? this.buffer('>') + : this.buffer('/>'); + } else { + // Optimize attributes buffering + if (tag.attrs.length) { + this.buffer('<' + name); + if (tag.attrs.length) this.visitAttributes(tag.attrs); + this.buffer('>'); + } else { + this.buffer('<' + name + '>'); + } + if (tag.code) this.visitCode(tag.code); + this.escape = 'pre' == tag.name; + this.visit(tag.block); + + // pretty print + if (pp && !tag.isInline() && 'pre' != tag.name && !tag.canInline()) + this.prettyIndent(0, true); + + this.buffer(''); + } + this.indents--; + }, + + /** + * Visit `filter`, throwing when the filter does not exist. + * + * @param {Filter} filter + * @api public + */ + + visitFilter: function(filter){ + var fn = filters[filter.name]; + + // unknown filter + if (!fn) { + if (filter.isASTFilter) { + throw new Error('unknown ast filter "' + filter.name + ':"'); + } else { + throw new Error('unknown filter ":' + filter.name + '"'); + } + } + + if (filter.isASTFilter) { + this.buf.push(fn(filter.block, this, filter.attrs)); + } else { + var text = filter.block.nodes.map(function(node){ return node.val }).join('\n'); + filter.attrs = filter.attrs || {}; + filter.attrs.filename = this.options.filename; + this.buffer(utils.text(fn(text, filter.attrs))); + } + }, + + /** + * Visit `text` node. + * + * @param {Text} text + * @api public + */ + + visitText: function(text){ + text = utils.text(text.val.replace(/\\/g, '\\\\')); + if (this.escape) text = escape(text); + this.buffer(text); + }, + + /** + * Visit a `comment`, only buffering when the buffer flag is set. + * + * @param {Comment} comment + * @api public + */ + + visitComment: function(comment){ + if (!comment.buffer) return; + if (this.pp) this.prettyIndent(1, true); + this.buffer(''); + }, + + /** + * Visit a `BlockComment`. + * + * @param {Comment} comment + * @api public + */ + + visitBlockComment: function(comment){ + if (!comment.buffer) return; + if (0 == comment.val.trim().indexOf('if')) { + this.buffer(''); + } else { + this.buffer(''); + } + }, + + /** + * Visit `code`, respecting buffer / escape flags. + * If the code is followed by a block, wrap it in + * a self-calling function. + * + * @param {Code} code + * @api public + */ + + visitCode: function(code){ + // Wrap code blocks with {}. + // we only wrap unbuffered code blocks ATM + // since they are usually flow control + + // Buffer code + if (code.buffer) { + var val = code.val.trimLeft(); + this.buf.push('var __val__ = ' + val); + val = 'null == __val__ ? "" : __val__'; + if (code.escape) val = 'escape(' + val + ')'; + this.buf.push("buf.push(" + val + ");"); + } else { + this.buf.push(code.val); + } + + // Block support + if (code.block) { + if (!code.buffer) this.buf.push('{'); + this.visit(code.block); + if (!code.buffer) this.buf.push('}'); + } + }, + + /** + * Visit `each` block. + * + * @param {Each} each + * @api public + */ + + visitEach: function(each){ + this.buf.push('' + + '// iterate ' + each.obj + '\n' + + ';(function(){\n' + + ' if (\'number\' == typeof ' + each.obj + '.length) {\n' + + ' for (var ' + each.key + ' = 0, $$l = ' + each.obj + '.length; ' + each.key + ' < $$l; ' + each.key + '++) {\n' + + ' var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n'); + + this.visit(each.block); + + this.buf.push('' + + ' }\n' + + ' } else {\n' + + ' for (var ' + each.key + ' in ' + each.obj + ') {\n' + + ' if (' + each.obj + '.hasOwnProperty(' + each.key + ')){' + + ' var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n'); + + this.visit(each.block); + + this.buf.push(' }\n'); + + this.buf.push(' }\n }\n}).call(this);\n'); + }, + + /** + * Visit `attrs`. + * + * @param {Array} attrs + * @api public + */ + + visitAttributes: function(attrs){ + var val = this.attrs(attrs); + if (val.inherits) { + this.buf.push("buf.push(attrs(merge({ " + val.buf + + " }, attributes), merge(" + val.escaped + ", escaped, true)));"); + } else if (val.constant) { + eval('var buf={' + val.buf + '};'); + this.buffer(runtime.attrs(buf, JSON.parse(val.escaped)), true); + } else { + this.buf.push("buf.push(attrs({ " + val.buf + " }, " + val.escaped + "));"); + } + }, + + /** + * Compile attributes. + */ + + attrs: function(attrs){ + var buf = [] + , classes = [] + , escaped = {} + , constant = attrs.every(function(attr){ return isConstant(attr.val) }) + , inherits = false; + + if (this.terse) buf.push('terse: true'); + + attrs.forEach(function(attr){ + if (attr.name == 'attributes') return inherits = true; + escaped[attr.name] = attr.escaped; + if (attr.name == 'class') { + classes.push('(' + attr.val + ')'); + } else { + var pair = "'" + attr.name + "':(" + attr.val + ')'; + buf.push(pair); + } + }); + + if (classes.length) { + classes = classes.join(" + ' ' + "); + buf.push("class: " + classes); + } + + return { + buf: buf.join(', ').replace('class:', '"class":'), + escaped: JSON.stringify(escaped), + inherits: inherits, + constant: constant + }; + } +}; + +/** + * Check if expression can be evaluated to a constant + * + * @param {String} expression + * @return {Boolean} + * @api private + */ + +function isConstant(val){ + // Check strings/literals + if (/^ *("([^"\\]*(\\.[^"\\]*)*)"|'([^'\\]*(\\.[^'\\]*)*)'|true|false|null|undefined) *$/i.test(val)) + return true; + + // Check numbers + if (!isNaN(Number(val))) + return true; + + // Check arrays + var matches; + if (matches = /^ *\[(.*)\] *$/.exec(val)) + return matches[1].split(',').every(isConstant); + + return false; +} + +/** + * Escape the given string of `html`. + * + * @param {String} html + * @return {String} + * @api private + */ + +function escape(html){ + return String(html) + .replace(/&(?!\w+;)/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); +} +}); // module: compiler.js + +require.register("doctypes.js", function(module, exports, require){ + +/*! + * Jade - doctypes + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +module.exports = { + '5': '' + , 'default': '' + , 'xml': '' + , 'transitional': '' + , 'strict': '' + , 'frameset': '' + , '1.1': '' + , 'basic': '' + , 'mobile': '' +}; +}); // module: doctypes.js + +require.register("filters.js", function(module, exports, require){ + +/*! + * Jade - filters + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +module.exports = { + + /** + * Wrap text with CDATA block. + */ + + cdata: function(str){ + return ''; + }, + + /** + * Transform sass to css, wrapped in style tags. + */ + + sass: function(str){ + str = str.replace(/\\n/g, '\n'); + var sass = require('sass').render(str).replace(/\n/g, '\\n'); + return ''; + }, + + /** + * Transform stylus to css, wrapped in style tags. + */ + + stylus: function(str, options){ + var ret; + str = str.replace(/\\n/g, '\n'); + var stylus = require('stylus'); + stylus(str, options).render(function(err, css){ + if (err) throw err; + ret = css.replace(/\n/g, '\\n'); + }); + return ''; + }, + + /** + * Transform less to css, wrapped in style tags. + */ + + less: function(str){ + var ret; + str = str.replace(/\\n/g, '\n'); + require('less').render(str, function(err, css){ + if (err) throw err; + ret = ''; + }); + return ret; + }, + + /** + * Transform markdown to html. + */ + + markdown: function(str){ + var md; + + // support markdown / discount + try { + md = require('markdown'); + } catch (err){ + try { + md = require('discount'); + } catch (err) { + try { + md = require('markdown-js'); + } catch (err) { + try { + md = require('marked'); + } catch (err) { + throw new + Error('Cannot find markdown library, install markdown, discount, or marked.'); + } + } + } + } + + str = str.replace(/\\n/g, '\n'); + return md.parse(str).replace(/\n/g, '\\n').replace(/'/g,'''); + }, + + /** + * Transform coffeescript to javascript. + */ + + coffeescript: function(str){ + str = str.replace(/\\n/g, '\n'); + var js = require('coffee-script').compile(str).replace(/\\/g, '\\\\').replace(/\n/g, '\\n'); + return ''; + } +}; + +}); // module: filters.js + +require.register("inline-tags.js", function(module, exports, require){ + +/*! + * Jade - inline tags + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +module.exports = [ + 'a' + , 'abbr' + , 'acronym' + , 'b' + , 'br' + , 'code' + , 'em' + , 'font' + , 'i' + , 'img' + , 'ins' + , 'kbd' + , 'map' + , 'samp' + , 'small' + , 'span' + , 'strong' + , 'sub' + , 'sup' +]; +}); // module: inline-tags.js + +require.register("jade.js", function(module, exports, require){ +/*! + * Jade + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Parser = require('./parser') + , Lexer = require('./lexer') + , Compiler = require('./compiler') + , runtime = require('./runtime') + +/** + * Library version. + */ + +exports.version = '0.26.1'; + +/** + * Expose self closing tags. + */ + +exports.selfClosing = require('./self-closing'); + +/** + * Default supported doctypes. + */ + +exports.doctypes = require('./doctypes'); + +/** + * Text filters. + */ + +exports.filters = require('./filters'); + +/** + * Utilities. + */ + +exports.utils = require('./utils'); + +/** + * Expose `Compiler`. + */ + +exports.Compiler = Compiler; + +/** + * Expose `Parser`. + */ + +exports.Parser = Parser; + +/** + * Expose `Lexer`. + */ + +exports.Lexer = Lexer; + +/** + * Nodes. + */ + +exports.nodes = require('./nodes'); + +/** + * Jade runtime helpers. + */ + +exports.runtime = runtime; + +/** + * Template function cache. + */ + +exports.cache = {}; + +/** + * Parse the given `str` of jade and return a function body. + * + * @param {String} str + * @param {Object} options + * @return {String} + * @api private + */ + +function parse(str, options){ + try { + // Parse + var parser = new Parser(str, options.filename, options); + + // Compile + var compiler = new (options.compiler || Compiler)(parser.parse(), options) + , js = compiler.compile(); + + // Debug compiler + if (options.debug) { + console.error('\nCompiled Function:\n\n\033[90m%s\033[0m', js.replace(/^/gm, ' ')); + } + + return '' + + 'var buf = [];\n' + + (options.self + ? 'var self = locals || {};\n' + js + : 'with (locals || {}) {\n' + js + '\n}\n') + + 'return buf.join("");'; + } catch (err) { + parser = parser.context(); + runtime.rethrow(err, parser.filename, parser.lexer.lineno); + } +} + +/** + * Compile a `Function` representation of the given jade `str`. + * + * Options: + * + * - `compileDebug` when `false` debugging code is stripped from the compiled template + * - `client` when `true` the helper functions `escape()` etc will reference `jade.escape()` + * for use with the Jade client-side runtime.js + * + * @param {String} str + * @param {Options} options + * @return {Function} + * @api public + */ + +exports.compile = function(str, options){ + var options = options || {} + , client = options.client + , filename = options.filename + ? JSON.stringify(options.filename) + : 'undefined' + , fn; + + if (options.compileDebug !== false) { + fn = [ + 'var __jade = [{ lineno: 1, filename: ' + filename + ' }];' + , 'try {' + , parse(String(str), options) + , '} catch (err) {' + , ' rethrow(err, __jade[0].filename, __jade[0].lineno);' + , '}' + ].join('\n'); + } else { + fn = parse(String(str), options); + } + + if (client) { + fn = 'attrs = attrs || jade.attrs; escape = escape || jade.escape; rethrow = rethrow || jade.rethrow; merge = merge || jade.merge;\n' + fn; + } + + fn = new Function('locals, attrs, escape, rethrow, merge', fn); + + if (client) return fn; + + return function(locals){ + return fn(locals, runtime.attrs, runtime.escape, runtime.rethrow, runtime.merge); + }; +}; + +/** + * Render the given `str` of jade and invoke + * the callback `fn(err, str)`. + * + * Options: + * + * - `cache` enable template caching + * - `filename` filename required for `include` / `extends` and caching + * + * @param {String} str + * @param {Object|Function} options or fn + * @param {Function} fn + * @api public + */ + +exports.render = function(str, options, fn){ + // swap args + if ('function' == typeof options) { + fn = options, options = {}; + } + + // cache requires .filename + if (options.cache && !options.filename) { + return fn(new Error('the "filename" option is required for caching')); + } + + try { + var path = options.filename; + var tmpl = options.cache + ? exports.cache[path] || (exports.cache[path] = exports.compile(str, options)) + : exports.compile(str, options); + fn(null, tmpl(options)); + } catch (err) { + fn(err); + } +}; + +/** + * Render a Jade file at the given `path` and callback `fn(err, str)`. + * + * @param {String} path + * @param {Object|Function} options or callback + * @param {Function} fn + * @api public + */ + +exports.renderFile = function(path, options, fn){ + var key = path + ':string'; + + if ('function' == typeof options) { + fn = options, options = {}; + } + + try { + options.filename = path; + var str = options.cache + ? exports.cache[key] || (exports.cache[key] = fs.readFileSync(path, 'utf8')) + : fs.readFileSync(path, 'utf8'); + exports.render(str, options, fn); + } catch (err) { + fn(err); + } +}; + +/** + * Express support. + */ + +exports.__express = exports.renderFile; + +}); // module: jade.js + +require.register("lexer.js", function(module, exports, require){ + +/*! + * Jade - Lexer + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Initialize `Lexer` with the given `str`. + * + * Options: + * + * - `colons` allow colons for attr delimiters + * + * @param {String} str + * @param {Object} options + * @api private + */ + +var Lexer = module.exports = function Lexer(str, options) { + options = options || {}; + this.input = str.replace(/\r\n|\r/g, '\n'); + this.colons = options.colons; + this.deferredTokens = []; + this.lastIndents = 0; + this.lineno = 1; + this.stash = []; + this.indentStack = []; + this.indentRe = null; + this.pipeless = false; +}; + +/** + * Lexer prototype. + */ + +Lexer.prototype = { + + /** + * Construct a token with the given `type` and `val`. + * + * @param {String} type + * @param {String} val + * @return {Object} + * @api private + */ + + tok: function(type, val){ + return { + type: type + , line: this.lineno + , val: val + } + }, + + /** + * Consume the given `len` of input. + * + * @param {Number} len + * @api private + */ + + consume: function(len){ + this.input = this.input.substr(len); + }, + + /** + * Scan for `type` with the given `regexp`. + * + * @param {String} type + * @param {RegExp} regexp + * @return {Object} + * @api private + */ + + scan: function(regexp, type){ + var captures; + if (captures = regexp.exec(this.input)) { + this.consume(captures[0].length); + return this.tok(type, captures[1]); + } + }, + + /** + * Defer the given `tok`. + * + * @param {Object} tok + * @api private + */ + + defer: function(tok){ + this.deferredTokens.push(tok); + }, + + /** + * Lookahead `n` tokens. + * + * @param {Number} n + * @return {Object} + * @api private + */ + + lookahead: function(n){ + var fetch = n - this.stash.length; + while (fetch-- > 0) this.stash.push(this.next()); + return this.stash[--n]; + }, + + /** + * Return the indexOf `start` / `end` delimiters. + * + * @param {String} start + * @param {String} end + * @return {Number} + * @api private + */ + + indexOfDelimiters: function(start, end){ + var str = this.input + , nstart = 0 + , nend = 0 + , pos = 0; + for (var i = 0, len = str.length; i < len; ++i) { + if (start == str.charAt(i)) { + ++nstart; + } else if (end == str.charAt(i)) { + if (++nend == nstart) { + pos = i; + break; + } + } + } + return pos; + }, + + /** + * Stashed token. + */ + + stashed: function() { + return this.stash.length + && this.stash.shift(); + }, + + /** + * Deferred token. + */ + + deferred: function() { + return this.deferredTokens.length + && this.deferredTokens.shift(); + }, + + /** + * end-of-source. + */ + + eos: function() { + if (this.input.length) return; + if (this.indentStack.length) { + this.indentStack.shift(); + return this.tok('outdent'); + } else { + return this.tok('eos'); + } + }, + + /** + * Blank line. + */ + + blank: function() { + var captures; + if (captures = /^\n *\n/.exec(this.input)) { + this.consume(captures[0].length - 1); + if (this.pipeless) return this.tok('text', ''); + return this.next(); + } + }, + + /** + * Comment. + */ + + comment: function() { + var captures; + if (captures = /^ *\/\/(-)?([^\n]*)/.exec(this.input)) { + this.consume(captures[0].length); + var tok = this.tok('comment', captures[2]); + tok.buffer = '-' != captures[1]; + return tok; + } + }, + + /** + * Interpolated tag. + */ + + interpolation: function() { + var captures; + if (captures = /^#\{(.*?)\}/.exec(this.input)) { + this.consume(captures[0].length); + return this.tok('interpolation', captures[1]); + } + }, + + /** + * Tag. + */ + + tag: function() { + var captures; + if (captures = /^(\w[-:\w]*)(\/?)/.exec(this.input)) { + this.consume(captures[0].length); + var tok, name = captures[1]; + if (':' == name[name.length - 1]) { + name = name.slice(0, -1); + tok = this.tok('tag', name); + this.defer(this.tok(':')); + while (' ' == this.input[0]) this.input = this.input.substr(1); + } else { + tok = this.tok('tag', name); + } + tok.selfClosing = !! captures[2]; + return tok; + } + }, + + /** + * Filter. + */ + + filter: function() { + return this.scan(/^:(\w+)/, 'filter'); + }, + + /** + * Doctype. + */ + + doctype: function() { + return this.scan(/^(?:!!!|doctype) *([^\n]+)?/, 'doctype'); + }, + + /** + * Id. + */ + + id: function() { + return this.scan(/^#([\w-]+)/, 'id'); + }, + + /** + * Class. + */ + + className: function() { + return this.scan(/^\.([\w-]+)/, 'class'); + }, + + /** + * Text. + */ + + text: function() { + return this.scan(/^(?:\| ?| ?)?([^\n]+)/, 'text'); + }, + + /** + * Extends. + */ + + "extends": function() { + return this.scan(/^extends? +([^\n]+)/, 'extends'); + }, + + /** + * Block prepend. + */ + + prepend: function() { + var captures; + if (captures = /^prepend +([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + var mode = 'prepend' + , name = captures[1] + , tok = this.tok('block', name); + tok.mode = mode; + return tok; + } + }, + + /** + * Block append. + */ + + append: function() { + var captures; + if (captures = /^append +([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + var mode = 'append' + , name = captures[1] + , tok = this.tok('block', name); + tok.mode = mode; + return tok; + } + }, + + /** + * Block. + */ + + block: function() { + var captures; + if (captures = /^block\b *(?:(prepend|append) +)?([^\n]*)/.exec(this.input)) { + this.consume(captures[0].length); + var mode = captures[1] || 'replace' + , name = captures[2] + , tok = this.tok('block', name); + + tok.mode = mode; + return tok; + } + }, + + /** + * Yield. + */ + + yield: function() { + return this.scan(/^yield */, 'yield'); + }, + + /** + * Include. + */ + + include: function() { + return this.scan(/^include +([^\n]+)/, 'include'); + }, + + /** + * Case. + */ + + "case": function() { + return this.scan(/^case +([^\n]+)/, 'case'); + }, + + /** + * When. + */ + + when: function() { + return this.scan(/^when +([^:\n]+)/, 'when'); + }, + + /** + * Default. + */ + + "default": function() { + return this.scan(/^default */, 'default'); + }, + + /** + * Assignment. + */ + + assignment: function() { + var captures; + if (captures = /^(\w+) += *([^;\n]+)( *;? *)/.exec(this.input)) { + this.consume(captures[0].length); + var name = captures[1] + , val = captures[2]; + return this.tok('code', 'var ' + name + ' = (' + val + ');'); + } + }, + + /** + * Call mixin. + */ + + call: function(){ + var captures; + if (captures = /^\+([-\w]+)/.exec(this.input)) { + this.consume(captures[0].length); + var tok = this.tok('call', captures[1]); + + // Check for args (not attributes) + if (captures = /^ *\((.*?)\)/.exec(this.input)) { + if (!/^ *[-\w]+ *=/.test(captures[1])) { + this.consume(captures[0].length); + tok.args = captures[1]; + } + } + + return tok; + } + }, + + /** + * Mixin. + */ + + mixin: function(){ + var captures; + if (captures = /^mixin +([-\w]+)(?: *\((.*)\))?/.exec(this.input)) { + this.consume(captures[0].length); + var tok = this.tok('mixin', captures[1]); + tok.args = captures[2]; + return tok; + } + }, + + /** + * Conditional. + */ + + conditional: function() { + var captures; + if (captures = /^(if|unless|else if|else)\b([^\n]*)/.exec(this.input)) { + this.consume(captures[0].length); + var type = captures[1] + , js = captures[2]; + + switch (type) { + case 'if': js = 'if (' + js + ')'; break; + case 'unless': js = 'if (!(' + js + '))'; break; + case 'else if': js = 'else if (' + js + ')'; break; + case 'else': js = 'else'; break; + } + + return this.tok('code', js); + } + }, + + /** + * While. + */ + + "while": function() { + var captures; + if (captures = /^while +([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + return this.tok('code', 'while (' + captures[1] + ')'); + } + }, + + /** + * Each. + */ + + each: function() { + var captures; + if (captures = /^(?:- *)?(?:each|for) +(\w+)(?: *, *(\w+))? * in *([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + var tok = this.tok('each', captures[1]); + tok.key = captures[2] || '$index'; + tok.code = captures[3]; + return tok; + } + }, + + /** + * Code. + */ + + code: function() { + var captures; + if (captures = /^(!?=|-)([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + var flags = captures[1]; + captures[1] = captures[2]; + var tok = this.tok('code', captures[1]); + tok.escape = flags[0] === '='; + tok.buffer = flags[0] === '=' || flags[1] === '='; + return tok; + } + }, + + /** + * Attributes. + */ + + attrs: function() { + if ('(' == this.input.charAt(0)) { + var index = this.indexOfDelimiters('(', ')') + , str = this.input.substr(1, index-1) + , tok = this.tok('attrs') + , len = str.length + , colons = this.colons + , states = ['key'] + , escapedAttr + , key = '' + , val = '' + , quote + , c + , p; + + function state(){ + return states[states.length - 1]; + } + + function interpolate(attr) { + return attr.replace(/#\{([^}]+)\}/g, function(_, expr){ + return quote + " + (" + expr + ") + " + quote; + }); + } + + this.consume(index + 1); + tok.attrs = {}; + tok.escaped = {}; + + function parse(c) { + var real = c; + // TODO: remove when people fix ":" + if (colons && ':' == c) c = '='; + switch (c) { + case ',': + case '\n': + switch (state()) { + case 'expr': + case 'array': + case 'string': + case 'object': + val += c; + break; + default: + states.push('key'); + val = val.trim(); + key = key.trim(); + if ('' == key) return; + key = key.replace(/^['"]|['"]$/g, '').replace('!', ''); + tok.escaped[key] = escapedAttr; + tok.attrs[key] = '' == val + ? true + : interpolate(val); + key = val = ''; + } + break; + case '=': + switch (state()) { + case 'key char': + key += real; + break; + case 'val': + case 'expr': + case 'array': + case 'string': + case 'object': + val += real; + break; + default: + escapedAttr = '!' != p; + states.push('val'); + } + break; + case '(': + if ('val' == state() + || 'expr' == state()) states.push('expr'); + val += c; + break; + case ')': + if ('expr' == state() + || 'val' == state()) states.pop(); + val += c; + break; + case '{': + if ('val' == state()) states.push('object'); + val += c; + break; + case '}': + if ('object' == state()) states.pop(); + val += c; + break; + case '[': + if ('val' == state()) states.push('array'); + val += c; + break; + case ']': + if ('array' == state()) states.pop(); + val += c; + break; + case '"': + case "'": + switch (state()) { + case 'key': + states.push('key char'); + break; + case 'key char': + states.pop(); + break; + case 'string': + if (c == quote) states.pop(); + val += c; + break; + default: + states.push('string'); + val += c; + quote = c; + } + break; + case '': + break; + default: + switch (state()) { + case 'key': + case 'key char': + key += c; + break; + default: + val += c; + } + } + p = c; + } + + for (var i = 0; i < len; ++i) { + parse(str.charAt(i)); + } + + parse(','); + + if ('/' == this.input.charAt(0)) { + this.consume(1); + tok.selfClosing = true; + } + + return tok; + } + }, + + /** + * Indent | Outdent | Newline. + */ + + indent: function() { + var captures, re; + + // established regexp + if (this.indentRe) { + captures = this.indentRe.exec(this.input); + // determine regexp + } else { + // tabs + re = /^\n(\t*) */; + captures = re.exec(this.input); + + // spaces + if (captures && !captures[1].length) { + re = /^\n( *)/; + captures = re.exec(this.input); + } + + // established + if (captures && captures[1].length) this.indentRe = re; + } + + if (captures) { + var tok + , indents = captures[1].length; + + ++this.lineno; + this.consume(indents + 1); + + if (' ' == this.input[0] || '\t' == this.input[0]) { + throw new Error('Invalid indentation, you can use tabs or spaces but not both'); + } + + // blank line + if ('\n' == this.input[0]) return this.tok('newline'); + + // outdent + if (this.indentStack.length && indents < this.indentStack[0]) { + while (this.indentStack.length && this.indentStack[0] > indents) { + this.stash.push(this.tok('outdent')); + this.indentStack.shift(); + } + tok = this.stash.pop(); + // indent + } else if (indents && indents != this.indentStack[0]) { + this.indentStack.unshift(indents); + tok = this.tok('indent', indents); + // newline + } else { + tok = this.tok('newline'); + } + + return tok; + } + }, + + /** + * Pipe-less text consumed only when + * pipeless is true; + */ + + pipelessText: function() { + if (this.pipeless) { + if ('\n' == this.input[0]) return; + var i = this.input.indexOf('\n'); + if (-1 == i) i = this.input.length; + var str = this.input.substr(0, i); + this.consume(str.length); + return this.tok('text', str); + } + }, + + /** + * ':' + */ + + colon: function() { + return this.scan(/^: */, ':'); + }, + + /** + * Return the next token object, or those + * previously stashed by lookahead. + * + * @return {Object} + * @api private + */ + + advance: function(){ + return this.stashed() + || this.next(); + }, + + /** + * Return the next token object. + * + * @return {Object} + * @api private + */ + + next: function() { + return this.deferred() + || this.blank() + || this.eos() + || this.pipelessText() + || this.yield() + || this.doctype() + || this.interpolation() + || this["case"]() + || this.when() + || this["default"]() + || this["extends"]() + || this.append() + || this.prepend() + || this.block() + || this.include() + || this.mixin() + || this.call() + || this.conditional() + || this.each() + || this["while"]() + || this.assignment() + || this.tag() + || this.filter() + || this.code() + || this.id() + || this.className() + || this.attrs() + || this.indent() + || this.comment() + || this.colon() + || this.text(); + } +}; + +}); // module: lexer.js + +require.register("nodes/attrs.js", function(module, exports, require){ + +/*! + * Jade - nodes - Attrs + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'), + Block = require('./block'); + +/** + * Initialize a `Attrs` node. + * + * @api public + */ + +var Attrs = module.exports = function Attrs() { + this.attrs = []; +}; + +/** + * Inherit from `Node`. + */ + +Attrs.prototype = new Node; +Attrs.prototype.constructor = Attrs; + + +/** + * Set attribute `name` to `val`, keep in mind these become + * part of a raw js object literal, so to quote a value you must + * '"quote me"', otherwise or example 'user.name' is literal JavaScript. + * + * @param {String} name + * @param {String} val + * @param {Boolean} escaped + * @return {Tag} for chaining + * @api public + */ + +Attrs.prototype.setAttribute = function(name, val, escaped){ + this.attrs.push({ name: name, val: val, escaped: escaped }); + return this; +}; + +/** + * Remove attribute `name` when present. + * + * @param {String} name + * @api public + */ + +Attrs.prototype.removeAttribute = function(name){ + for (var i = 0, len = this.attrs.length; i < len; ++i) { + if (this.attrs[i] && this.attrs[i].name == name) { + delete this.attrs[i]; + } + } +}; + +/** + * Get attribute value by `name`. + * + * @param {String} name + * @return {String} + * @api public + */ + +Attrs.prototype.getAttribute = function(name){ + for (var i = 0, len = this.attrs.length; i < len; ++i) { + if (this.attrs[i] && this.attrs[i].name == name) { + return this.attrs[i].val; + } + } +}; + +}); // module: nodes/attrs.js + +require.register("nodes/block-comment.js", function(module, exports, require){ + +/*! + * Jade - nodes - BlockComment + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `BlockComment` with the given `block`. + * + * @param {String} val + * @param {Block} block + * @param {Boolean} buffer + * @api public + */ + +var BlockComment = module.exports = function BlockComment(val, block, buffer) { + this.block = block; + this.val = val; + this.buffer = buffer; +}; + +/** + * Inherit from `Node`. + */ + +BlockComment.prototype = new Node; +BlockComment.prototype.constructor = BlockComment; + +}); // module: nodes/block-comment.js + +require.register("nodes/block.js", function(module, exports, require){ + +/*! + * Jade - nodes - Block + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a new `Block` with an optional `node`. + * + * @param {Node} node + * @api public + */ + +var Block = module.exports = function Block(node){ + this.nodes = []; + if (node) this.push(node); +}; + +/** + * Inherit from `Node`. + */ + +Block.prototype = new Node; +Block.prototype.constructor = Block; + + +/** + * Block flag. + */ + +Block.prototype.isBlock = true; + +/** + * Replace the nodes in `other` with the nodes + * in `this` block. + * + * @param {Block} other + * @api private + */ + +Block.prototype.replace = function(other){ + other.nodes = this.nodes; +}; + +/** + * Pust the given `node`. + * + * @param {Node} node + * @return {Number} + * @api public + */ + +Block.prototype.push = function(node){ + return this.nodes.push(node); +}; + +/** + * Check if this block is empty. + * + * @return {Boolean} + * @api public + */ + +Block.prototype.isEmpty = function(){ + return 0 == this.nodes.length; +}; + +/** + * Unshift the given `node`. + * + * @param {Node} node + * @return {Number} + * @api public + */ + +Block.prototype.unshift = function(node){ + return this.nodes.unshift(node); +}; + +/** + * Return the "last" block, or the first `yield` node. + * + * @return {Block} + * @api private + */ + +Block.prototype.includeBlock = function(){ + var ret = this + , node; + + for (var i = 0, len = this.nodes.length; i < len; ++i) { + node = this.nodes[i]; + if (node.yield) return node; + else if (node.textOnly) continue; + else if (node.includeBlock) ret = node.includeBlock(); + else if (node.block && !node.block.isEmpty()) ret = node.block.includeBlock(); + } + + return ret; +}; + +/** + * Return a clone of this block. + * + * @return {Block} + * @api private + */ + +Block.prototype.clone = function(){ + var clone = new Block; + for (var i = 0, len = this.nodes.length; i < len; ++i) { + clone.push(this.nodes[i].clone()); + } + return clone; +}; + + +}); // module: nodes/block.js + +require.register("nodes/case.js", function(module, exports, require){ + +/*! + * Jade - nodes - Case + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a new `Case` with `expr`. + * + * @param {String} expr + * @api public + */ + +var Case = exports = module.exports = function Case(expr, block){ + this.expr = expr; + this.block = block; +}; + +/** + * Inherit from `Node`. + */ + +Case.prototype = new Node; +Case.prototype.constructor = Case; + + +var When = exports.When = function When(expr, block){ + this.expr = expr; + this.block = block; + this.debug = false; +}; + +/** + * Inherit from `Node`. + */ + +When.prototype = new Node; +When.prototype.constructor = When; + + + +}); // module: nodes/case.js + +require.register("nodes/code.js", function(module, exports, require){ + +/*! + * Jade - nodes - Code + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Code` node with the given code `val`. + * Code may also be optionally buffered and escaped. + * + * @param {String} val + * @param {Boolean} buffer + * @param {Boolean} escape + * @api public + */ + +var Code = module.exports = function Code(val, buffer, escape) { + this.val = val; + this.buffer = buffer; + this.escape = escape; + if (val.match(/^ *else/)) this.debug = false; +}; + +/** + * Inherit from `Node`. + */ + +Code.prototype = new Node; +Code.prototype.constructor = Code; + +}); // module: nodes/code.js + +require.register("nodes/comment.js", function(module, exports, require){ + +/*! + * Jade - nodes - Comment + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Comment` with the given `val`, optionally `buffer`, + * otherwise the comment may render in the output. + * + * @param {String} val + * @param {Boolean} buffer + * @api public + */ + +var Comment = module.exports = function Comment(val, buffer) { + this.val = val; + this.buffer = buffer; +}; + +/** + * Inherit from `Node`. + */ + +Comment.prototype = new Node; +Comment.prototype.constructor = Comment; + +}); // module: nodes/comment.js + +require.register("nodes/doctype.js", function(module, exports, require){ + +/*! + * Jade - nodes - Doctype + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Doctype` with the given `val`. + * + * @param {String} val + * @api public + */ + +var Doctype = module.exports = function Doctype(val) { + this.val = val; +}; + +/** + * Inherit from `Node`. + */ + +Doctype.prototype = new Node; +Doctype.prototype.constructor = Doctype; + +}); // module: nodes/doctype.js + +require.register("nodes/each.js", function(module, exports, require){ + +/*! + * Jade - nodes - Each + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize an `Each` node, representing iteration + * + * @param {String} obj + * @param {String} val + * @param {String} key + * @param {Block} block + * @api public + */ + +var Each = module.exports = function Each(obj, val, key, block) { + this.obj = obj; + this.val = val; + this.key = key; + this.block = block; +}; + +/** + * Inherit from `Node`. + */ + +Each.prototype = new Node; +Each.prototype.constructor = Each; + +}); // module: nodes/each.js + +require.register("nodes/filter.js", function(module, exports, require){ + +/*! + * Jade - nodes - Filter + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node') + , Block = require('./block'); + +/** + * Initialize a `Filter` node with the given + * filter `name` and `block`. + * + * @param {String} name + * @param {Block|Node} block + * @api public + */ + +var Filter = module.exports = function Filter(name, block, attrs) { + this.name = name; + this.block = block; + this.attrs = attrs; + this.isASTFilter = !block.nodes.every(function(node){ return node.isText }); +}; + +/** + * Inherit from `Node`. + */ + +Filter.prototype = new Node; +Filter.prototype.constructor = Filter; + +}); // module: nodes/filter.js + +require.register("nodes/index.js", function(module, exports, require){ + +/*! + * Jade - nodes + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +exports.Node = require('./node'); +exports.Tag = require('./tag'); +exports.Code = require('./code'); +exports.Each = require('./each'); +exports.Case = require('./case'); +exports.Text = require('./text'); +exports.Block = require('./block'); +exports.Mixin = require('./mixin'); +exports.Filter = require('./filter'); +exports.Comment = require('./comment'); +exports.Literal = require('./literal'); +exports.BlockComment = require('./block-comment'); +exports.Doctype = require('./doctype'); + +}); // module: nodes/index.js + +require.register("nodes/literal.js", function(module, exports, require){ + +/*! + * Jade - nodes - Literal + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Literal` node with the given `str. + * + * @param {String} str + * @api public + */ + +var Literal = module.exports = function Literal(str) { + this.str = str + .replace(/\\/g, "\\\\") + .replace(/\n|\r\n/g, "\\n") + .replace(/'/g, "\\'"); +}; + +/** + * Inherit from `Node`. + */ + +Literal.prototype = new Node; +Literal.prototype.constructor = Literal; + + +}); // module: nodes/literal.js + +require.register("nodes/mixin.js", function(module, exports, require){ + +/*! + * Jade - nodes - Mixin + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Attrs = require('./attrs'); + +/** + * Initialize a new `Mixin` with `name` and `block`. + * + * @param {String} name + * @param {String} args + * @param {Block} block + * @api public + */ + +var Mixin = module.exports = function Mixin(name, args, block, call){ + this.name = name; + this.args = args; + this.block = block; + this.attrs = []; + this.call = call; +}; + +/** + * Inherit from `Attrs`. + */ + +Mixin.prototype = new Attrs; +Mixin.prototype.constructor = Mixin; + + + +}); // module: nodes/mixin.js + +require.register("nodes/node.js", function(module, exports, require){ + +/*! + * Jade - nodes - Node + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Initialize a `Node`. + * + * @api public + */ + +var Node = module.exports = function Node(){}; + +/** + * Clone this node (return itself) + * + * @return {Node} + * @api private + */ + +Node.prototype.clone = function(){ + return this; +}; + +}); // module: nodes/node.js + +require.register("nodes/tag.js", function(module, exports, require){ + +/*! + * Jade - nodes - Tag + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Attrs = require('./attrs'), + Block = require('./block'), + inlineTags = require('../inline-tags'); + +/** + * Initialize a `Tag` node with the given tag `name` and optional `block`. + * + * @param {String} name + * @param {Block} block + * @api public + */ + +var Tag = module.exports = function Tag(name, block) { + this.name = name; + this.attrs = []; + this.block = block || new Block; +}; + +/** + * Inherit from `Attrs`. + */ + +Tag.prototype = new Attrs; +Tag.prototype.constructor = Tag; + + +/** + * Clone this tag. + * + * @return {Tag} + * @api private + */ + +Tag.prototype.clone = function(){ + var clone = new Tag(this.name, this.block.clone()); + clone.line = this.line; + clone.attrs = this.attrs; + clone.textOnly = this.textOnly; + return clone; +}; + +/** + * Check if this tag is an inline tag. + * + * @return {Boolean} + * @api private + */ + +Tag.prototype.isInline = function(){ + return ~inlineTags.indexOf(this.name); +}; + +/** + * Check if this tag's contents can be inlined. Used for pretty printing. + * + * @return {Boolean} + * @api private + */ + +Tag.prototype.canInline = function(){ + var nodes = this.block.nodes; + + function isInline(node){ + // Recurse if the node is a block + if (node.isBlock) return node.nodes.every(isInline); + return node.isText || (node.isInline && node.isInline()); + } + + // Empty tag + if (!nodes.length) return true; + + // Text-only or inline-only tag + if (1 == nodes.length) return isInline(nodes[0]); + + // Multi-line inline-only tag + if (this.block.nodes.every(isInline)) { + for (var i = 1, len = nodes.length; i < len; ++i) { + if (nodes[i-1].isText && nodes[i].isText) + return false; + } + return true; + } + + // Mixed tag + return false; +}; +}); // module: nodes/tag.js + +require.register("nodes/text.js", function(module, exports, require){ + +/*! + * Jade - nodes - Text + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Text` node with optional `line`. + * + * @param {String} line + * @api public + */ + +var Text = module.exports = function Text(line) { + this.val = ''; + if ('string' == typeof line) this.val = line; +}; + +/** + * Inherit from `Node`. + */ + +Text.prototype = new Node; +Text.prototype.constructor = Text; + + +/** + * Flag as text. + */ + +Text.prototype.isText = true; +}); // module: nodes/text.js + +require.register("parser.js", function(module, exports, require){ + +/*! + * Jade - Parser + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Lexer = require('./lexer') + , nodes = require('./nodes'); + +/** + * Initialize `Parser` with the given input `str` and `filename`. + * + * @param {String} str + * @param {String} filename + * @param {Object} options + * @api public + */ + +var Parser = exports = module.exports = function Parser(str, filename, options){ + this.input = str; + this.lexer = new Lexer(str, options); + this.filename = filename; + this.blocks = {}; + this.mixins = {}; + this.options = options; + this.contexts = [this]; +}; + +/** + * Tags that may not contain tags. + */ + +var textOnly = exports.textOnly = ['script', 'style']; + +/** + * Parser prototype. + */ + +Parser.prototype = { + + /** + * Push `parser` onto the context stack, + * or pop and return a `Parser`. + */ + + context: function(parser){ + if (parser) { + this.contexts.push(parser); + } else { + return this.contexts.pop(); + } + }, + + /** + * Return the next token object. + * + * @return {Object} + * @api private + */ + + advance: function(){ + return this.lexer.advance(); + }, + + /** + * Skip `n` tokens. + * + * @param {Number} n + * @api private + */ + + skip: function(n){ + while (n--) this.advance(); + }, + + /** + * Single token lookahead. + * + * @return {Object} + * @api private + */ + + peek: function() { + return this.lookahead(1); + }, + + /** + * Return lexer lineno. + * + * @return {Number} + * @api private + */ + + line: function() { + return this.lexer.lineno; + }, + + /** + * `n` token lookahead. + * + * @param {Number} n + * @return {Object} + * @api private + */ + + lookahead: function(n){ + return this.lexer.lookahead(n); + }, + + /** + * Parse input returning a string of js for evaluation. + * + * @return {String} + * @api public + */ + + parse: function(){ + var block = new nodes.Block, parser; + block.line = this.line(); + + while ('eos' != this.peek().type) { + if ('newline' == this.peek().type) { + this.advance(); + } else { + block.push(this.parseExpr()); + } + } + + if (parser = this.extending) { + this.context(parser); + var ast = parser.parse(); + this.context(); + // hoist mixins + for (var name in this.mixins) + ast.unshift(this.mixins[name]); + return ast; + } + + return block; + }, + + /** + * Expect the given type, or throw an exception. + * + * @param {String} type + * @api private + */ + + expect: function(type){ + if (this.peek().type === type) { + return this.advance(); + } else { + throw new Error('expected "' + type + '", but got "' + this.peek().type + '"'); + } + }, + + /** + * Accept the given `type`. + * + * @param {String} type + * @api private + */ + + accept: function(type){ + if (this.peek().type === type) { + return this.advance(); + } + }, + + /** + * tag + * | doctype + * | mixin + * | include + * | filter + * | comment + * | text + * | each + * | code + * | yield + * | id + * | class + * | interpolation + */ + + parseExpr: function(){ + switch (this.peek().type) { + case 'tag': + return this.parseTag(); + case 'mixin': + return this.parseMixin(); + case 'block': + return this.parseBlock(); + case 'case': + return this.parseCase(); + case 'when': + return this.parseWhen(); + case 'default': + return this.parseDefault(); + case 'extends': + return this.parseExtends(); + case 'include': + return this.parseInclude(); + case 'doctype': + return this.parseDoctype(); + case 'filter': + return this.parseFilter(); + case 'comment': + return this.parseComment(); + case 'text': + return this.parseText(); + case 'each': + return this.parseEach(); + case 'code': + return this.parseCode(); + case 'call': + return this.parseCall(); + case 'interpolation': + return this.parseInterpolation(); + case 'yield': + this.advance(); + var block = new nodes.Block; + block.yield = true; + return block; + case 'id': + case 'class': + var tok = this.advance(); + this.lexer.defer(this.lexer.tok('tag', 'div')); + this.lexer.defer(tok); + return this.parseExpr(); + default: + throw new Error('unexpected token "' + this.peek().type + '"'); + } + }, + + /** + * Text + */ + + parseText: function(){ + var tok = this.expect('text') + , node = new nodes.Text(tok.val); + node.line = this.line(); + return node; + }, + + /** + * ':' expr + * | block + */ + + parseBlockExpansion: function(){ + if (':' == this.peek().type) { + this.advance(); + return new nodes.Block(this.parseExpr()); + } else { + return this.block(); + } + }, + + /** + * case + */ + + parseCase: function(){ + var val = this.expect('case').val + , node = new nodes.Case(val); + node.line = this.line(); + node.block = this.block(); + return node; + }, + + /** + * when + */ + + parseWhen: function(){ + var val = this.expect('when').val + return new nodes.Case.When(val, this.parseBlockExpansion()); + }, + + /** + * default + */ + + parseDefault: function(){ + this.expect('default'); + return new nodes.Case.When('default', this.parseBlockExpansion()); + }, + + /** + * code + */ + + parseCode: function(){ + var tok = this.expect('code') + , node = new nodes.Code(tok.val, tok.buffer, tok.escape) + , block + , i = 1; + node.line = this.line(); + while (this.lookahead(i) && 'newline' == this.lookahead(i).type) ++i; + block = 'indent' == this.lookahead(i).type; + if (block) { + this.skip(i-1); + node.block = this.block(); + } + return node; + }, + + /** + * comment + */ + + parseComment: function(){ + var tok = this.expect('comment') + , node; + + if ('indent' == this.peek().type) { + node = new nodes.BlockComment(tok.val, this.block(), tok.buffer); + } else { + node = new nodes.Comment(tok.val, tok.buffer); + } + + node.line = this.line(); + return node; + }, + + /** + * doctype + */ + + parseDoctype: function(){ + var tok = this.expect('doctype') + , node = new nodes.Doctype(tok.val); + node.line = this.line(); + return node; + }, + + /** + * filter attrs? text-block + */ + + parseFilter: function(){ + var block + , tok = this.expect('filter') + , attrs = this.accept('attrs'); + + this.lexer.pipeless = true; + block = this.parseTextBlock(); + this.lexer.pipeless = false; + + var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs); + node.line = this.line(); + return node; + }, + + /** + * tag ':' attrs? block + */ + + parseASTFilter: function(){ + var block + , tok = this.expect('tag') + , attrs = this.accept('attrs'); + + this.expect(':'); + block = this.block(); + + var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs); + node.line = this.line(); + return node; + }, + + /** + * each block + */ + + parseEach: function(){ + var tok = this.expect('each') + , node = new nodes.Each(tok.code, tok.val, tok.key); + node.line = this.line(); + node.block = this.block(); + return node; + }, + + /** + * 'extends' name + */ + + parseExtends: function(){ + var path = require('path') + , fs = require('fs') + , dirname = path.dirname + , basename = path.basename + , join = path.join; + + if (!this.filename) + throw new Error('the "filename" option is required to extend templates'); + + var path = this.expect('extends').val.trim() + , dir = dirname(this.filename); + + var path = join(dir, path + '.jade') + , str = fs.readFileSync(path, 'utf8') + , parser = new Parser(str, path, this.options); + + parser.blocks = this.blocks; + parser.contexts = this.contexts; + this.extending = parser; + + // TODO: null node + return new nodes.Literal(''); + }, + + /** + * 'block' name block + */ + + parseBlock: function(){ + var block = this.expect('block') + , mode = block.mode + , name = block.val.trim(); + + block = 'indent' == this.peek().type + ? this.block() + : new nodes.Block(new nodes.Literal('')); + + var prev = this.blocks[name]; + + if (prev) { + switch (prev.mode) { + case 'append': + block.nodes = block.nodes.concat(prev.nodes); + prev = block; + break; + case 'prepend': + block.nodes = prev.nodes.concat(block.nodes); + prev = block; + break; + } + } + + block.mode = mode; + return this.blocks[name] = prev || block; + }, + + /** + * include block? + */ + + parseInclude: function(){ + var path = require('path') + , fs = require('fs') + , dirname = path.dirname + , basename = path.basename + , join = path.join; + + var path = this.expect('include').val.trim() + , dir = dirname(this.filename); + + if (!this.filename) + throw new Error('the "filename" option is required to use includes'); + + // no extension + if (!~basename(path).indexOf('.')) { + path += '.jade'; + } + + // non-jade + if ('.jade' != path.substr(-5)) { + var path = join(dir, path) + , str = fs.readFileSync(path, 'utf8'); + return new nodes.Literal(str); + } + + var path = join(dir, path) + , str = fs.readFileSync(path, 'utf8') + , parser = new Parser(str, path, this.options); + parser.blocks = this.blocks; + parser.mixins = this.mixins; + + this.context(parser); + var ast = parser.parse(); + this.context(); + ast.filename = path; + + if ('indent' == this.peek().type) { + ast.includeBlock().push(this.block()); + } + + return ast; + }, + + /** + * call ident block + */ + + parseCall: function(){ + var tok = this.expect('call') + , name = tok.val + , args = tok.args + , mixin = new nodes.Mixin(name, args, new nodes.Block, true); + + this.tag(mixin); + if (mixin.block.isEmpty()) mixin.block = null; + return mixin; + }, + + /** + * mixin block + */ + + parseMixin: function(){ + var tok = this.expect('mixin') + , name = tok.val + , args = tok.args + , mixin; + + // definition + if ('indent' == this.peek().type) { + mixin = new nodes.Mixin(name, args, this.block(), false); + this.mixins[name] = mixin; + return mixin; + // call + } else { + return new nodes.Mixin(name, args, null, true); + } + }, + + /** + * indent (text | newline)* outdent + */ + + parseTextBlock: function(){ + var block = new nodes.Block; + block.line = this.line(); + var spaces = this.expect('indent').val; + if (null == this._spaces) this._spaces = spaces; + var indent = Array(spaces - this._spaces + 1).join(' '); + while ('outdent' != this.peek().type) { + switch (this.peek().type) { + case 'newline': + this.advance(); + break; + case 'indent': + this.parseTextBlock().nodes.forEach(function(node){ + block.push(node); + }); + break; + default: + var text = new nodes.Text(indent + this.advance().val); + text.line = this.line(); + block.push(text); + } + } + + if (spaces == this._spaces) this._spaces = null; + this.expect('outdent'); + return block; + }, + + /** + * indent expr* outdent + */ + + block: function(){ + var block = new nodes.Block; + block.line = this.line(); + this.expect('indent'); + while ('outdent' != this.peek().type) { + if ('newline' == this.peek().type) { + this.advance(); + } else { + block.push(this.parseExpr()); + } + } + this.expect('outdent'); + return block; + }, + + /** + * interpolation (attrs | class | id)* (text | code | ':')? newline* block? + */ + + parseInterpolation: function(){ + var tok = this.advance(); + var tag = new nodes.Tag(tok.val); + tag.buffer = true; + return this.tag(tag); + }, + + /** + * tag (attrs | class | id)* (text | code | ':')? newline* block? + */ + + parseTag: function(){ + // ast-filter look-ahead + var i = 2; + if ('attrs' == this.lookahead(i).type) ++i; + if (':' == this.lookahead(i).type) { + if ('indent' == this.lookahead(++i).type) { + return this.parseASTFilter(); + } + } + + var tok = this.advance() + , tag = new nodes.Tag(tok.val); + + tag.selfClosing = tok.selfClosing; + + return this.tag(tag); + }, + + /** + * Parse tag. + */ + + tag: function(tag){ + var dot; + + tag.line = this.line(); + + // (attrs | class | id)* + out: + while (true) { + switch (this.peek().type) { + case 'id': + case 'class': + var tok = this.advance(); + tag.setAttribute(tok.type, "'" + tok.val + "'"); + continue; + case 'attrs': + var tok = this.advance() + , obj = tok.attrs + , escaped = tok.escaped + , names = Object.keys(obj); + + if (tok.selfClosing) tag.selfClosing = true; + + for (var i = 0, len = names.length; i < len; ++i) { + var name = names[i] + , val = obj[name]; + tag.setAttribute(name, val, escaped[name]); + } + continue; + default: + break out; + } + } + + // check immediate '.' + if ('.' == this.peek().val) { + dot = tag.textOnly = true; + this.advance(); + } + + // (text | code | ':')? + switch (this.peek().type) { + case 'text': + tag.block.push(this.parseText()); + break; + case 'code': + tag.code = this.parseCode(); + break; + case ':': + this.advance(); + tag.block = new nodes.Block; + tag.block.push(this.parseExpr()); + break; + } + + // newline* + while ('newline' == this.peek().type) this.advance(); + + tag.textOnly = tag.textOnly || ~textOnly.indexOf(tag.name); + + // script special-case + if ('script' == tag.name) { + var type = tag.getAttribute('type'); + if (!dot && type && 'text/javascript' != type.replace(/^['"]|['"]$/g, '')) { + tag.textOnly = false; + } + } + + // block? + if ('indent' == this.peek().type) { + if (tag.textOnly) { + this.lexer.pipeless = true; + tag.block = this.parseTextBlock(); + this.lexer.pipeless = false; + } else { + var block = this.block(); + if (tag.block) { + for (var i = 0, len = block.nodes.length; i < len; ++i) { + tag.block.push(block.nodes[i]); + } + } else { + tag.block = block; + } + } + } + + return tag; + } +}; + +}); // module: parser.js + +require.register("runtime.js", function(module, exports, require){ + +/*! + * Jade - runtime + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Lame Array.isArray() polyfill for now. + */ + +if (!Array.isArray) { + Array.isArray = function(arr){ + return '[object Array]' == Object.prototype.toString.call(arr); + }; +} + +/** + * Lame Object.keys() polyfill for now. + */ + +if (!Object.keys) { + Object.keys = function(obj){ + var arr = []; + for (var key in obj) { + if (obj.hasOwnProperty(key)) { + arr.push(key); + } + } + return arr; + } +} + +/** + * Merge two attribute objects giving precedence + * to values in object `b`. Classes are special-cased + * allowing for arrays and merging/joining appropriately + * resulting in a string. + * + * @param {Object} a + * @param {Object} b + * @return {Object} a + * @api private + */ + +exports.merge = function merge(a, b) { + var ac = a['class']; + var bc = b['class']; + + if (ac || bc) { + ac = ac || []; + bc = bc || []; + if (!Array.isArray(ac)) ac = [ac]; + if (!Array.isArray(bc)) bc = [bc]; + ac = ac.filter(nulls); + bc = bc.filter(nulls); + a['class'] = ac.concat(bc).join(' '); + } + + for (var key in b) { + if (key != 'class') { + a[key] = b[key]; + } + } + + return a; +}; + +/** + * Filter null `val`s. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function nulls(val) { + return val != null; +} + +/** + * Render the given attributes object. + * + * @param {Object} obj + * @param {Object} escaped + * @return {String} + * @api private + */ + +exports.attrs = function attrs(obj, escaped){ + var buf = [] + , terse = obj.terse; + + delete obj.terse; + var keys = Object.keys(obj) + , len = keys.length; + + if (len) { + buf.push(''); + for (var i = 0; i < len; ++i) { + var key = keys[i] + , val = obj[key]; + + if ('boolean' == typeof val || null == val) { + if (val) { + terse + ? buf.push(key) + : buf.push(key + '="' + key + '"'); + } + } else if (0 == key.indexOf('data') && 'string' != typeof val) { + buf.push(key + "='" + JSON.stringify(val) + "'"); + } else if ('class' == key && Array.isArray(val)) { + buf.push(key + '="' + exports.escape(val.join(' ')) + '"'); + } else if (escaped && escaped[key]) { + buf.push(key + '="' + exports.escape(val) + '"'); + } else { + buf.push(key + '="' + val + '"'); + } + } + } + + return buf.join(' '); +}; + +/** + * Escape the given string of `html`. + * + * @param {String} html + * @return {String} + * @api private + */ + +exports.escape = function escape(html){ + return String(html) + .replace(/&(?!(\w+|\#\d+);)/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); +}; + +/** + * Re-throw the given `err` in context to the + * the jade in `filename` at the given `lineno`. + * + * @param {Error} err + * @param {String} filename + * @param {String} lineno + * @api private + */ + +exports.rethrow = function rethrow(err, filename, lineno){ + if (!filename) throw err; + + var context = 3 + , str = require('fs').readFileSync(filename, 'utf8') + , lines = str.split('\n') + , start = Math.max(lineno - context, 0) + , end = Math.min(lines.length, lineno + context); + + // Error context + var context = lines.slice(start, end).map(function(line, i){ + var curr = i + start + 1; + return (curr == lineno ? ' > ' : ' ') + + curr + + '| ' + + line; + }).join('\n'); + + // Alter exception message + err.path = filename; + err.message = (filename || 'Jade') + ':' + lineno + + '\n' + context + '\n\n' + err.message; + throw err; +}; + +}); // module: runtime.js + +require.register("self-closing.js", function(module, exports, require){ + +/*! + * Jade - self closing tags + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +module.exports = [ + 'meta' + , 'img' + , 'link' + , 'input' + , 'source' + , 'area' + , 'base' + , 'col' + , 'br' + , 'hr' +]; +}); // module: self-closing.js + +require.register("utils.js", function(module, exports, require){ + +/*! + * Jade - utils + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Convert interpolation in the given string to JavaScript. + * + * @param {String} str + * @return {String} + * @api private + */ + +var interpolate = exports.interpolate = function(str){ + return str.replace(/(\\)?([#!]){(.*?)}/g, function(str, escape, flag, code){ + return escape + ? str + : "' + " + + ('!' == flag ? '' : 'escape') + + "((interp = " + code.replace(/\\'/g, "'") + + ") == null ? '' : interp) + '"; + }); +}; + +/** + * Escape single quotes in `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +var escape = exports.escape = function(str) { + return str.replace(/'/g, "\\'"); +}; + +/** + * Interpolate, and escape the given `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +exports.text = function(str){ + return interpolate(escape(str)); +}; +}); // module: utils.js + +window.jade = require("jade"); +})(); diff --git a/node_modules/jade/jade.md b/node_modules/jade/jade.md new file mode 100644 index 0000000..051dc03 --- /dev/null +++ b/node_modules/jade/jade.md @@ -0,0 +1,510 @@ + +# Jade + + The jade template engine for node.js + +## Synopsis + + jade [-h|--help] [-v|--version] [-o|--obj STR] + [-O|--out DIR] [-p|--path PATH] [-P|--pretty] + [-c|--client] [-D|--no-debug] + +## Examples + + translate jade the templates dir + + $ jade templates + + create {foo,bar}.html + + $ jade {foo,bar}.jade + + jade over stdio + + $ jade < my.jade > my.html + + jade over s + + $ echo "h1 Jade!" | jade + + foo, bar dirs rendering to /tmp + + $ jade foo bar --out /tmp + + compile client-side templates without debugging + instrumentation, making the output javascript + very light-weight. This requires runtime.js + in your projects. + + $ jade --client --no-debug < my.jade + +## Tags + + Tags are simply nested via whitespace, closing + tags defined for you. These indents are called "blocks". + + ul + li + a Foo + li + a Bar + + You may have several tags in one "block": + + ul + li + a Foo + a Bar + a Baz + +## Self-closing Tags + + Some tags are flagged as self-closing by default, such + as `meta`, `link`, and so on. To explicitly self-close + a tag simply append the `/` character: + + foo/ + foo(bar='baz')/ + + Would yield: + + + + +## Attributes + + Tag attributes look similar to HTML, however + the values are regular JavaScript, here are + some examples: + + a(href='google.com') Google + a(class='button', href='google.com') Google + + As mentioned the attribute values are just JavaScript, + this means ternary operations and other JavaScript expressions + work just fine: + + body(class=user.authenticated ? 'authenticated' : 'anonymous') + a(href=user.website || 'http://google.com') + + Multiple lines work too: + + input(type='checkbox', + name='agreement', + checked) + + Multiple lines without the comma work fine: + + input(type='checkbox' + name='agreement' + checked) + + Funky whitespace? fine: + + input( + type='checkbox' + name='agreement' + checked) + +## Boolean attributes + + Boolean attributes are mirrored by Jade, and accept + bools, aka _true_ or _false_. When no value is specified + _true_ is assumed. For example: + + input(type="checkbox", checked) + // => "" + + For example if the checkbox was for an agreement, perhaps `user.agreed` + was _true_ the following would also output 'checked="checked"': + + input(type="checkbox", checked=user.agreed) + +## Class attributes + + The _class_ attribute accepts an array of classes, + this can be handy when generated from a javascript + function etc: + + classes = ['foo', 'bar', 'baz'] + a(class=classes) + // => "" + +## Class literal + + Classes may be defined using a ".CLASSNAME" syntax: + + .button + // => "
" + + Or chained: + + .large.button + // => "
" + + The previous defaulted to divs, however you + may also specify the tag type: + + h1.title My Title + // => "

My Title

" + +## Id literal + + Much like the class literal there's an id literal: + + #user-1 + // => "
" + + Again we may specify the tag as well: + + ul#menu + li: a(href='/home') Home + li: a(href='/store') Store + li: a(href='/contact') Contact + + Finally all of these may be used in any combination, + the following are all valid tags: + + a.button#contact(style: 'color: red') Contact + a.button(style: 'color: red')#contact Contact + a(style: 'color: red').button#contact Contact + +## Block expansion + + Jade supports the concept of "block expansion", in which + using a trailing ":" after a tag will inject a block: + + ul + li: a Foo + li: a Bar + li: a Baz + +## Text + + Arbitrary text may follow tags: + + p Welcome to my site + + yields: + +

Welcome to my site

+ +## Pipe text + + Another form of text is "pipe" text. Pipes act + as the text margin for large bodies of text. + + p + | This is a large + | body of text for + | this tag. + | + | Nothing too + | exciting. + + yields: + +

This is a large + body of text for + this tag. + + Nothing too + exciting. +

+ + Using pipes we can also specify regular Jade tags + within the text: + + p + | Click to visit + a(href='http://google.com') Google + | if you want. + +## Text only tags + + As an alternative to pipe text you may add + a trailing "." to indicate that the block + contains nothing but plain-text, no tags: + + p. + This is a large + body of text for + this tag. + + Nothing too + exciting. + + Some tags are text-only by default, for example + _script_, _textarea_, and _style_ tags do not + contain nested HTML so Jade implies the trailing ".": + + script + if (foo) { + bar(); + } + + style + body { + padding: 50px; + font: 14px Helvetica; + } + +## Template script tags + + Sometimes it's useful to define HTML in script + tags using Jade, typically for client-side templates. + + To do this simply give the _script_ tag an arbitrary + _type_ attribute such as _text/x-template_: + + script(type='text/template') + h1 Look! + p Jade still works in here! + +## Interpolation + + Both plain-text and piped-text support interpolation, + which comes in two forms, escapes and non-escaped. The + following will output the _user.name_ in the paragraph + but HTML within it will be escaped to prevent XSS attacks: + + p Welcome #{user.name} + + The following syntax is identical however it will _not_ escape + HTML, and should only be used with strings that you trust: + + p Welcome !{user.name} + +## Inline HTML + + Sometimes constructing small inline snippets of HTML + in Jade can be annoying, luckily we can add plain + HTML as well: + + p Welcome #{user.name} + +## Code + + To buffer output with Jade simply use _=_ at the beginning + of a line or after a tag. This method escapes any HTML + present in the string. + + p= user.description + + To buffer output unescaped use the _!=_ variant, but again + be careful of XSS. + + p!= user.description + + The final way to mess with JavaScript code in Jade is the unbuffered + _-_, which can be used for conditionals, defining variables etc: + + - var user = { description: 'foo bar baz' } + #user + - if (user.description) { + h2 Description + p.description= user.description + - } + + When compiled blocks are wrapped in anonymous functions, so the + following is also valid, without braces: + + - var user = { description: 'foo bar baz' } + #user + - if (user.description) + h2 Description + p.description= user.description + + If you really want you could even use `.forEach()` and others: + + - users.forEach(function(user){ + .user + h2= user.name + p User #{user.name} is #{user.age} years old + - }) + + Taking this further Jade provides some syntax for conditionals, + iteration, switch statements etc. Let's look at those next! + +## Assignment + + Jade's first-class assignment is simple, simply use the _=_ + operator and Jade will _var_ it for you. The following are equivalent: + + - var user = { name: 'tobi' } + user = { name: 'tobi' } + +## Conditionals + + Jade's first-class conditional syntax allows for optional + parenthesis, and you may now omit the leading _-_ otherwise + it's identical, still just regular javascript: + + user = { description: 'foo bar baz' } + #user + if user.description + h2 Description + p.description= user.description + + Jade provides the negated version, _unless_ as well, the following + are equivalent: + + - if (!(user.isAnonymous)) + p You're logged in as #{user.name} + + unless user.isAnonymous + p You're logged in as #{user.name} + +## Iteration + + JavaScript's _for_ loops don't look very declarative, so Jade + also provides its own _for_ loop construct, aliased as _each_: + + for user in users + .user + h2= user.name + p user #{user.name} is #{user.age} year old + + As mentioned _each_ is identical: + + each user in users + .user + h2= user.name + + If necessary the index is available as well: + + for user, i in users + .user(class='user-#{i}') + h2= user.name + + Remember, it's just JavaScript: + + ul#letters + for letter in ['a', 'b', 'c'] + li= letter + +## Mixins + + Mixins provide a way to define jade "functions" which "mix in" + their contents when called. This is useful for abstracting + out large fragments of Jade. + + The simplest possible mixin which accepts no arguments might + look like this: + + mixin hello + p Hello + + You use a mixin by placing `+` before the name: + + +hello + + For something a little more dynamic, mixins can take + arguments, the mixin itself is converted to a javascript + function internally: + + mixin hello(user) + p Hello #{user} + + +hello('Tobi') + + Yields: + +

Hello Tobi

+ + Mixins may optionally take blocks, when a block is passed + its contents becomes the implicit `block` argument. For + example here is a mixin passed a block, and also invoked + without passing a block: + + mixin article(title) + .article + .article-wrapper + h1= title + if block + block + else + p No content provided + + +article('Hello world') + + +article('Hello world') + p This is my + p Amazing article + + yields: + +
+
+

Hello world

+

No content provided

+
+
+ +
+
+

Hello world

+

This is my

+

Amazing article

+
+
+ + Mixins can even take attributes, just like a tag. When + attributes are passed they become the implicit `attributes` + argument. Individual attributes can be accessed just like + normal object properties: + + mixin centered + .centered(class=attributes.class) + block + + +centered.bold Hello world + + +centered.red + p This is my + p Amazing article + + yields: + +
Hello world
+
+

This is my

+

Amazing article

+
+ + If you use `attributes` directly, *all* passed attributes + get used: + + mixin link + a.menu(attributes) + block + + +link.highlight(href='#top') Top + +link#sec1.plain(href='#section1') Section 1 + +link#sec2.plain(href='#section2') Section 2 + + yields: + + Top + Section 1 + Section 2 + + If you pass arguments, they must directly follow the mixin: + + mixin list(arr) + if block + .title + block + ul(attributes) + each item in arr + li= item + + +list(['foo', 'bar', 'baz'])(id='myList', class='bold') + + yields: + +
    +
  • foo
    • +
  • bar
    • +
  • baz
    • +
diff --git a/node_modules/jade/jade.min.js b/node_modules/jade/jade.min.js new file mode 100644 index 0000000..72e4535 --- /dev/null +++ b/node_modules/jade/jade.min.js @@ -0,0 +1,2 @@ +(function(){function require(p){var path=require.resolve(p),mod=require.modules[path];if(!mod)throw new Error('failed to require "'+p+'"');return mod.exports||(mod.exports={},mod.call(mod.exports,mod,mod.exports,require.relative(path))),mod.exports}require.modules={},require.resolve=function(path){var orig=path,reg=path+".js",index=path+"/index.js";return require.modules[reg]&®||require.modules[index]&&index||orig},require.register=function(path,fn){require.modules[path]=fn},require.relative=function(parent){return function(p){if("."!=p.charAt(0))return require(p);var path=parent.split("/"),segs=p.split("/");path.pop();for(var i=0;i",this.doctype=doctype,this.terse="5"==name||"html"==name,this.xml=0==this.doctype.indexOf("1&&!escape&&block.nodes[0].isText&&block.nodes[1].isText&&this.prettyIndent(1,!0);for(var i=0;i0&&!escape&&block.nodes[i].isText&&block.nodes[i-1].isText&&this.prettyIndent(1,!1),this.visit(block.nodes[i]),block.nodes[i+1]&&block.nodes[i].isText&&block.nodes[i+1].isText&&this.buffer("\\n")},visitDoctype:function(doctype){doctype&&(doctype.val||!this.doctype)&&this.setDoctype(doctype.val||"default"),this.doctype&&this.buffer(this.doctype),this.hasCompiledDoctype=!0},visitMixin:function(mixin){var name=mixin.name.replace(/-/g,"_")+"_mixin",args=mixin.args||"",block=mixin.block,attrs=mixin.attrs,pp=this.pp;if(mixin.call){pp&&this.buf.push("__indent.push('"+Array(this.indents+1).join(" ")+"');");if(block||attrs.length){this.buf.push(name+".call({");if(block){this.buf.push("block: function(){"),this.parentIndents++;var _indents=this.indents;this.indents=0,this.visit(mixin.block),this.indents=_indents,this.parentIndents--,attrs.length?this.buf.push("},"):this.buf.push("}")}if(attrs.length){var val=this.attrs(attrs);val.inherits?this.buf.push("attributes: merge({"+val.buf+"}, attributes), escaped: merge("+val.escaped+", escaped, true)"):this.buf.push("attributes: {"+val.buf+"}, escaped: "+val.escaped)}args?this.buf.push("}, "+args+");"):this.buf.push("});")}else this.buf.push(name+"("+args+");");pp&&this.buf.push("__indent.pop();")}else this.buf.push("var "+name+" = function("+args+"){"),this.buf.push("var block = this.block, attributes = this.attributes || {}, escaped = this.escaped || {};"),this.parentIndents++,this.visit(block),this.parentIndents--,this.buf.push("};")},visitTag:function(tag){this.indents++;var name=tag.name,pp=this.pp;tag.buffer&&(name="' + ("+name+") + '"),this.hasCompiledTag||(!this.hasCompiledDoctype&&"html"==name&&this.visitDoctype(),this.hasCompiledTag=!0),pp&&!tag.isInline()&&this.prettyIndent(0,!0),(~selfClosing.indexOf(name)||tag.selfClosing)&&!this.xml?(this.buffer("<"+name),this.visitAttributes(tag.attrs),this.terse?this.buffer(">"):this.buffer("/>")):(tag.attrs.length?(this.buffer("<"+name),tag.attrs.length&&this.visitAttributes(tag.attrs),this.buffer(">")):this.buffer("<"+name+">"),tag.code&&this.visitCode(tag.code),this.escape="pre"==tag.name,this.visit(tag.block),pp&&!tag.isInline()&&"pre"!=tag.name&&!tag.canInline()&&this.prettyIndent(0,!0),this.buffer("")),this.indents--},visitFilter:function(filter){var fn=filters[filter.name];if(!fn)throw filter.isASTFilter?new Error('unknown ast filter "'+filter.name+':"'):new Error('unknown filter ":'+filter.name+'"');if(filter.isASTFilter)this.buf.push(fn(filter.block,this,filter.attrs));else{var text=filter.block.nodes.map(function(node){return node.val}).join("\n");filter.attrs=filter.attrs||{},filter.attrs.filename=this.options.filename,this.buffer(utils.text(fn(text,filter.attrs)))}},visitText:function(text){text=utils.text(text.val.replace(/\\/g,"\\\\")),this.escape&&(text=escape(text)),this.buffer(text)},visitComment:function(comment){if(!comment.buffer)return;this.pp&&this.prettyIndent(1,!0),this.buffer("")},visitBlockComment:function(comment){if(!comment.buffer)return;0==comment.val.trim().indexOf("if")?(this.buffer("")):(this.buffer(""))},visitCode:function(code){if(code.buffer){var val=code.val.trimLeft();this.buf.push("var __val__ = "+val),val='null == __val__ ? "" : __val__',code.escape&&(val="escape("+val+")"),this.buf.push("buf.push("+val+");")}else this.buf.push(code.val);code.block&&(code.buffer||this.buf.push("{"),this.visit(code.block),code.buffer||this.buf.push("}"))},visitEach:function(each){this.buf.push("// iterate "+each.obj+"\n"+";(function(){\n"+" if ('number' == typeof "+each.obj+".length) {\n"+" for (var "+each.key+" = 0, $$l = "+each.obj+".length; "+each.key+" < $$l; "+each.key+"++) {\n"+" var "+each.val+" = "+each.obj+"["+each.key+"];\n"),this.visit(each.block),this.buf.push(" }\n } else {\n for (var "+each.key+" in "+each.obj+") {\n"+" if ("+each.obj+".hasOwnProperty("+each.key+")){"+" var "+each.val+" = "+each.obj+"["+each.key+"];\n"),this.visit(each.block),this.buf.push(" }\n"),this.buf.push(" }\n }\n}).call(this);\n")},visitAttributes:function(attrs){var val=this.attrs(attrs);val.inherits?this.buf.push("buf.push(attrs(merge({ "+val.buf+" }, attributes), merge("+val.escaped+", escaped, true)));"):val.constant?(eval("var buf={"+val.buf+"};"),this.buffer(runtime.attrs(buf,JSON.parse(val.escaped)),!0)):this.buf.push("buf.push(attrs({ "+val.buf+" }, "+val.escaped+"));")},attrs:function(attrs){var buf=[],classes=[],escaped={},constant=attrs.every(function(attr){return isConstant(attr.val)}),inherits=!1;return this.terse&&buf.push("terse: true"),attrs.forEach(function(attr){if(attr.name=="attributes")return inherits=!0;escaped[attr.name]=attr.escaped;if(attr.name=="class")classes.push("("+attr.val+")");else{var pair="'"+attr.name+"':("+attr.val+")";buf.push(pair)}}),classes.length&&(classes=classes.join(" + ' ' + "),buf.push("class: "+classes)),{buf:buf.join(", ").replace("class:",'"class":'),escaped:JSON.stringify(escaped),inherits:inherits,constant:constant}}};function isConstant(val){if(/^ *("([^"\\]*(\\.[^"\\]*)*)"|'([^'\\]*(\\.[^'\\]*)*)'|true|false|null|undefined) *$/i.test(val))return!0;if(!isNaN(Number(val)))return!0;var matches;return(matches=/^ *\[(.*)\] *$/.exec(val))?matches[1].split(",").every(isConstant):!1}function escape(html){return String(html).replace(/&(?!\w+;)/g,"&").replace(//g,">").replace(/"/g,""")}}),require.register("doctypes.js",function(module,exports,require){module.exports={5:"","default":"",xml:'',transitional:'',strict:'',frameset:'',1.1:'',basic:'',mobile:''}}),require.register("filters.js",function(module,exports,require){module.exports={cdata:function(str){return""},sass:function(str){str=str.replace(/\\n/g,"\n");var sass=require("sass").render(str).replace(/\n/g,"\\n");return'"},stylus:function(str,options){var ret;str=str.replace(/\\n/g,"\n");var stylus=require("stylus");return stylus(str,options).render(function(err,css){if(err)throw err;ret=css.replace(/\n/g,"\\n")}),'"},less:function(str){var ret;return str=str.replace(/\\n/g,"\n"),require("less").render(str,function(err,css){if(err)throw err;ret='"}),ret},markdown:function(str){var md;try{md=require("markdown")}catch(err){try{md=require("discount")}catch(err){try{md=require("markdown-js")}catch(err){try{md=require("marked")}catch(err){throw new Error("Cannot find markdown library, install markdown, discount, or marked.")}}}}return str=str.replace(/\\n/g,"\n"),md.parse(str).replace(/\n/g,"\\n").replace(/'/g,"'")},coffeescript:function(str){str=str.replace(/\\n/g,"\n");var js=require("coffee-script").compile(str).replace(/\\/g,"\\\\").replace(/\n/g,"\\n");return'"}}}),require.register("inline-tags.js",function(module,exports,require){module.exports=["a","abbr","acronym","b","br","code","em","font","i","img","ins","kbd","map","samp","small","span","strong","sub","sup"]}),require.register("jade.js",function(module,exports,require){var Parser=require("./parser"),Lexer=require("./lexer"),Compiler=require("./compiler"),runtime=require("./runtime");exports.version="0.26.1",exports.selfClosing=require("./self-closing"),exports.doctypes=require("./doctypes"),exports.filters=require("./filters"),exports.utils=require("./utils"),exports.Compiler=Compiler,exports.Parser=Parser,exports.Lexer=Lexer,exports.nodes=require("./nodes"),exports.runtime=runtime,exports.cache={};function parse(str,options){try{var parser=new Parser(str,options.filename,options),compiler=new(options.compiler||Compiler)(parser.parse(),options),js=compiler.compile();return options.debug&&console.error("\nCompiled Function:\n\n%s",js.replace(/^/gm," ")),"var buf = [];\n"+(options.self?"var self = locals || {};\n"+js:"with (locals || {}) {\n"+js+"\n}\n")+'return buf.join("");'}catch(err){parser=parser.context(),runtime.rethrow(err,parser.filename,parser.lexer.lineno)}}exports.compile=function(str,options){var options=options||{},client=options.client,filename=options.filename?JSON.stringify(options.filename):"undefined",fn;return options.compileDebug!==!1?fn=["var __jade = [{ lineno: 1, filename: "+filename+" }];","try {",parse(String(str),options),"} catch (err) {"," rethrow(err, __jade[0].filename, __jade[0].lineno);","}"].join("\n"):fn=parse(String(str),options),client&&(fn="attrs = attrs || jade.attrs; escape = escape || jade.escape; rethrow = rethrow || jade.rethrow; merge = merge || jade.merge;\n"+fn),fn=new Function("locals, attrs, escape, rethrow, merge",fn),client?fn:function(locals){return fn(locals,runtime.attrs,runtime.escape,runtime.rethrow,runtime.merge)}},exports.render=function(str,options,fn){"function"==typeof options&&(fn=options,options={});if(options.cache&&!options.filename)return fn(new Error('the "filename" option is required for caching'));try{var path=options.filename,tmpl=options.cache?exports.cache[path]||(exports.cache[path]=exports.compile(str,options)):exports.compile(str,options);fn(null,tmpl(options))}catch(err){fn(err)}},exports.renderFile=function(path,options,fn){var key=path+":string";"function"==typeof options&&(fn=options,options={});try{options.filename=path;var str=options.cache?exports.cache[key]||(exports.cache[key]=fs.readFileSync(path,"utf8")):fs.readFileSync(path,"utf8");exports.render(str,options,fn)}catch(err){fn(err)}},exports.__express=exports.renderFile}),require.register("lexer.js",function(module,exports,require){var Lexer=module.exports=function Lexer(str,options){options=options||{},this.input=str.replace(/\r\n|\r/g,"\n"),this.colons=options.colons,this.deferredTokens=[],this.lastIndents=0,this.lineno=1,this.stash=[],this.indentStack=[],this.indentRe=null,this.pipeless=!1};Lexer.prototype={tok:function(type,val){return{type:type,line:this.lineno,val:val}},consume:function(len){this.input=this.input.substr(len)},scan:function(regexp,type){var captures;if(captures=regexp.exec(this.input))return this.consume(captures[0].length),this.tok(type,captures[1])},defer:function(tok){this.deferredTokens.push(tok)},lookahead:function(n){var fetch=n-this.stash.length;while(fetch-->0)this.stash.push(this.next());return this.stash[--n]},indexOfDelimiters:function(start,end){var str=this.input,nstart=0,nend=0,pos=0;for(var i=0,len=str.length;iindents)this.stash.push(this.tok("outdent")),this.indentStack.shift();tok=this.stash.pop()}else indents&&indents!=this.indentStack[0]?(this.indentStack.unshift(indents),tok=this.tok("indent",indents)):tok=this.tok("newline");return tok}},pipelessText:function(){if(this.pipeless){if("\n"==this.input[0])return;var i=this.input.indexOf("\n");-1==i&&(i=this.input.length);var str=this.input.substr(0,i);return this.consume(str.length),this.tok("text",str)}},colon:function(){return this.scan(/^: */,":")},advance:function(){return this.stashed()||this.next()},next:function(){return this.deferred()||this.blank()||this.eos()||this.pipelessText()||this.yield()||this.doctype()||this.interpolation()||this["case"]()||this.when()||this["default"]()||this["extends"]()||this.append()||this.prepend()||this.block()||this.include()||this.mixin()||this.call()||this.conditional()||this.each()||this["while"]()||this.assignment()||this.tag()||this.filter()||this.code()||this.id()||this.className()||this.attrs()||this.indent()||this.comment()||this.colon()||this.text()}}}),require.register("nodes/attrs.js",function(module,exports,require){var Node=require("./node"),Block=require("./block"),Attrs=module.exports=function Attrs(){this.attrs=[]};Attrs.prototype=new Node,Attrs.prototype.constructor=Attrs,Attrs.prototype.setAttribute=function(name,val,escaped){return this.attrs.push({name:name,val:val,escaped:escaped}),this},Attrs.prototype.removeAttribute=function(name){for(var i=0,len=this.attrs.length;i/g,">").replace(/"/g,""")},exports.rethrow=function rethrow(err,filename,lineno){if(!filename)throw err;var context=3,str=require("fs").readFileSync(filename,"utf8"),lines=str.split("\n"),start=Math.max(lineno-context,0),end=Math.min(lines.length,lineno+context),context=lines.slice(start,end).map(function(line,i){var curr=i+start+1;return(curr==lineno?" > ":" ")+curr+"| "+line}).join("\n");throw err.path=filename,err.message=(filename||"Jade")+":"+lineno+"\n"+context+"\n\n"+err.message,err}}),require.register("self-closing.js",function(module,exports,require){module.exports=["meta","img","link","input","source","area","base","col","br","hr"]}),require.register("utils.js",function(module,exports,require){var interpolate=exports.interpolate=function(str){return str.replace(/(\\)?([#!]){(.*?)}/g,function(str,escape,flag,code){return escape?str:"' + "+("!"==flag?"":"escape")+"((interp = "+code.replace(/\\'/g,"'")+") == null ? '' : interp) + '"})},escape=exports.escape=function(str){return str.replace(/'/g,"\\'")};exports.text=function(str){return interpolate(escape(str))}}),window.jade=require("jade")})(); \ No newline at end of file diff --git a/node_modules/jade/lib/compiler.js b/node_modules/jade/lib/compiler.js new file mode 100644 index 0000000..516ac83 --- /dev/null +++ b/node_modules/jade/lib/compiler.js @@ -0,0 +1,642 @@ + +/*! + * Jade - Compiler + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var nodes = require('./nodes') + , filters = require('./filters') + , doctypes = require('./doctypes') + , selfClosing = require('./self-closing') + , runtime = require('./runtime') + , utils = require('./utils'); + +// if browser +// +// if (!Object.keys) { +// Object.keys = function(obj){ +// var arr = []; +// for (var key in obj) { +// if (obj.hasOwnProperty(key)) { +// arr.push(key); +// } +// } +// return arr; +// } +// } +// +// if (!String.prototype.trimLeft) { +// String.prototype.trimLeft = function(){ +// return this.replace(/^\s+/, ''); +// } +// } +// +// end + + +/** + * Initialize `Compiler` with the given `node`. + * + * @param {Node} node + * @param {Object} options + * @api public + */ + +var Compiler = module.exports = function Compiler(node, options) { + this.options = options = options || {}; + this.node = node; + this.hasCompiledDoctype = false; + this.hasCompiledTag = false; + this.pp = options.pretty || false; + this.debug = false !== options.compileDebug; + this.indents = 0; + this.parentIndents = 0; + if (options.doctype) this.setDoctype(options.doctype); +}; + +/** + * Compiler prototype. + */ + +Compiler.prototype = { + + /** + * Compile parse tree to JavaScript. + * + * @api public + */ + + compile: function(){ + this.buf = ['var interp;']; + if (this.pp) this.buf.push("var __indent = [];"); + this.lastBufferedIdx = -1; + this.visit(this.node); + return this.buf.join('\n'); + }, + + /** + * Sets the default doctype `name`. Sets terse mode to `true` when + * html 5 is used, causing self-closing tags to end with ">" vs "/>", + * and boolean attributes are not mirrored. + * + * @param {string} name + * @api public + */ + + setDoctype: function(name){ + var doctype = doctypes[(name || 'default').toLowerCase()]; + doctype = doctype || ''; + this.doctype = doctype; + this.terse = '5' == name || 'html' == name; + this.xml = 0 == this.doctype.indexOf(' 1 && !escape && block.nodes[0].isText && block.nodes[1].isText) + this.prettyIndent(1, true); + + for (var i = 0; i < len; ++i) { + // Pretty print text + if (pp && i > 0 && !escape && block.nodes[i].isText && block.nodes[i-1].isText) + this.prettyIndent(1, false); + + this.visit(block.nodes[i]); + // Multiple text nodes are separated by newlines + if (block.nodes[i+1] && block.nodes[i].isText && block.nodes[i+1].isText) + this.buffer('\\n'); + } + }, + + /** + * Visit `doctype`. Sets terse mode to `true` when html 5 + * is used, causing self-closing tags to end with ">" vs "/>", + * and boolean attributes are not mirrored. + * + * @param {Doctype} doctype + * @api public + */ + + visitDoctype: function(doctype){ + if (doctype && (doctype.val || !this.doctype)) { + this.setDoctype(doctype.val || 'default'); + } + + if (this.doctype) this.buffer(this.doctype); + this.hasCompiledDoctype = true; + }, + + /** + * Visit `mixin`, generating a function that + * may be called within the template. + * + * @param {Mixin} mixin + * @api public + */ + + visitMixin: function(mixin){ + var name = mixin.name.replace(/-/g, '_') + '_mixin' + , args = mixin.args || '' + , block = mixin.block + , attrs = mixin.attrs + , pp = this.pp; + + if (mixin.call) { + if (pp) this.buf.push("__indent.push('" + Array(this.indents + 1).join(' ') + "');") + if (block || attrs.length) { + + this.buf.push(name + '.call({'); + + if (block) { + this.buf.push('block: function(){'); + + // Render block with no indents, dynamically added when rendered + this.parentIndents++; + var _indents = this.indents; + this.indents = 0; + this.visit(mixin.block); + this.indents = _indents; + this.parentIndents--; + + if (attrs.length) { + this.buf.push('},'); + } else { + this.buf.push('}'); + } + } + + if (attrs.length) { + var val = this.attrs(attrs); + if (val.inherits) { + this.buf.push('attributes: merge({' + val.buf + + '}, attributes), escaped: merge(' + val.escaped + ', escaped, true)'); + } else { + this.buf.push('attributes: {' + val.buf + '}, escaped: ' + val.escaped); + } + } + + if (args) { + this.buf.push('}, ' + args + ');'); + } else { + this.buf.push('});'); + } + + } else { + this.buf.push(name + '(' + args + ');'); + } + if (pp) this.buf.push("__indent.pop();") + } else { + this.buf.push('var ' + name + ' = function(' + args + '){'); + this.buf.push('var block = this.block, attributes = this.attributes || {}, escaped = this.escaped || {};'); + this.parentIndents++; + this.visit(block); + this.parentIndents--; + this.buf.push('};'); + } + }, + + /** + * Visit `tag` buffering tag markup, generating + * attributes, visiting the `tag`'s code and block. + * + * @param {Tag} tag + * @api public + */ + + visitTag: function(tag){ + this.indents++; + var name = tag.name + , pp = this.pp; + + if (tag.buffer) name = "' + (" + name + ") + '"; + + if (!this.hasCompiledTag) { + if (!this.hasCompiledDoctype && 'html' == name) { + this.visitDoctype(); + } + this.hasCompiledTag = true; + } + + // pretty print + if (pp && !tag.isInline()) + this.prettyIndent(0, true); + + if ((~selfClosing.indexOf(name) || tag.selfClosing) && !this.xml) { + this.buffer('<' + name); + this.visitAttributes(tag.attrs); + this.terse + ? this.buffer('>') + : this.buffer('/>'); + } else { + // Optimize attributes buffering + if (tag.attrs.length) { + this.buffer('<' + name); + if (tag.attrs.length) this.visitAttributes(tag.attrs); + this.buffer('>'); + } else { + this.buffer('<' + name + '>'); + } + if (tag.code) this.visitCode(tag.code); + this.escape = 'pre' == tag.name; + this.visit(tag.block); + + // pretty print + if (pp && !tag.isInline() && 'pre' != tag.name && !tag.canInline()) + this.prettyIndent(0, true); + + this.buffer(''); + } + this.indents--; + }, + + /** + * Visit `filter`, throwing when the filter does not exist. + * + * @param {Filter} filter + * @api public + */ + + visitFilter: function(filter){ + var fn = filters[filter.name]; + + // unknown filter + if (!fn) { + if (filter.isASTFilter) { + throw new Error('unknown ast filter "' + filter.name + ':"'); + } else { + throw new Error('unknown filter ":' + filter.name + '"'); + } + } + + if (filter.isASTFilter) { + this.buf.push(fn(filter.block, this, filter.attrs)); + } else { + var text = filter.block.nodes.map(function(node){ return node.val }).join('\n'); + filter.attrs = filter.attrs || {}; + filter.attrs.filename = this.options.filename; + this.buffer(utils.text(fn(text, filter.attrs))); + } + }, + + /** + * Visit `text` node. + * + * @param {Text} text + * @api public + */ + + visitText: function(text){ + text = utils.text(text.val.replace(/\\/g, '\\\\')); + if (this.escape) text = escape(text); + this.buffer(text); + }, + + /** + * Visit a `comment`, only buffering when the buffer flag is set. + * + * @param {Comment} comment + * @api public + */ + + visitComment: function(comment){ + if (!comment.buffer) return; + if (this.pp) this.prettyIndent(1, true); + this.buffer(''); + }, + + /** + * Visit a `BlockComment`. + * + * @param {Comment} comment + * @api public + */ + + visitBlockComment: function(comment){ + if (!comment.buffer) return; + if (0 == comment.val.trim().indexOf('if')) { + this.buffer(''); + } else { + this.buffer(''); + } + }, + + /** + * Visit `code`, respecting buffer / escape flags. + * If the code is followed by a block, wrap it in + * a self-calling function. + * + * @param {Code} code + * @api public + */ + + visitCode: function(code){ + // Wrap code blocks with {}. + // we only wrap unbuffered code blocks ATM + // since they are usually flow control + + // Buffer code + if (code.buffer) { + var val = code.val.trimLeft(); + this.buf.push('var __val__ = ' + val); + val = 'null == __val__ ? "" : __val__'; + if (code.escape) val = 'escape(' + val + ')'; + this.buf.push("buf.push(" + val + ");"); + } else { + this.buf.push(code.val); + } + + // Block support + if (code.block) { + if (!code.buffer) this.buf.push('{'); + this.visit(code.block); + if (!code.buffer) this.buf.push('}'); + } + }, + + /** + * Visit `each` block. + * + * @param {Each} each + * @api public + */ + + visitEach: function(each){ + this.buf.push('' + + '// iterate ' + each.obj + '\n' + + ';(function(){\n' + + ' if (\'number\' == typeof ' + each.obj + '.length) {\n' + + ' for (var ' + each.key + ' = 0, $$l = ' + each.obj + '.length; ' + each.key + ' < $$l; ' + each.key + '++) {\n' + + ' var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n'); + + this.visit(each.block); + + this.buf.push('' + + ' }\n' + + ' } else {\n' + + ' for (var ' + each.key + ' in ' + each.obj + ') {\n' + // if browser + // + ' if (' + each.obj + '.hasOwnProperty(' + each.key + ')){' + // end + + ' var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n'); + + this.visit(each.block); + + // if browser + // this.buf.push(' }\n'); + // end + + this.buf.push(' }\n }\n}).call(this);\n'); + }, + + /** + * Visit `attrs`. + * + * @param {Array} attrs + * @api public + */ + + visitAttributes: function(attrs){ + var val = this.attrs(attrs); + if (val.inherits) { + this.buf.push("buf.push(attrs(merge({ " + val.buf + + " }, attributes), merge(" + val.escaped + ", escaped, true)));"); + } else if (val.constant) { + eval('var buf={' + val.buf + '};'); + this.buffer(runtime.attrs(buf, JSON.parse(val.escaped)), true); + } else { + this.buf.push("buf.push(attrs({ " + val.buf + " }, " + val.escaped + "));"); + } + }, + + /** + * Compile attributes. + */ + + attrs: function(attrs){ + var buf = [] + , classes = [] + , escaped = {} + , constant = attrs.every(function(attr){ return isConstant(attr.val) }) + , inherits = false; + + if (this.terse) buf.push('terse: true'); + + attrs.forEach(function(attr){ + if (attr.name == 'attributes') return inherits = true; + escaped[attr.name] = attr.escaped; + if (attr.name == 'class') { + classes.push('(' + attr.val + ')'); + } else { + var pair = "'" + attr.name + "':(" + attr.val + ')'; + buf.push(pair); + } + }); + + if (classes.length) { + classes = classes.join(" + ' ' + "); + buf.push("class: " + classes); + } + + return { + buf: buf.join(', ').replace('class:', '"class":'), + escaped: JSON.stringify(escaped), + inherits: inherits, + constant: constant + }; + } +}; + +/** + * Check if expression can be evaluated to a constant + * + * @param {String} expression + * @return {Boolean} + * @api private + */ + +function isConstant(val){ + // Check strings/literals + if (/^ *("([^"\\]*(\\.[^"\\]*)*)"|'([^'\\]*(\\.[^'\\]*)*)'|true|false|null|undefined) *$/i.test(val)) + return true; + + // Check numbers + if (!isNaN(Number(val))) + return true; + + // Check arrays + var matches; + if (matches = /^ *\[(.*)\] *$/.exec(val)) + return matches[1].split(',').every(isConstant); + + return false; +} + +/** + * Escape the given string of `html`. + * + * @param {String} html + * @return {String} + * @api private + */ + +function escape(html){ + return String(html) + .replace(/&(?!\w+;)/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); +} \ No newline at end of file diff --git a/node_modules/jade/lib/doctypes.js b/node_modules/jade/lib/doctypes.js new file mode 100644 index 0000000..e87ca1e --- /dev/null +++ b/node_modules/jade/lib/doctypes.js @@ -0,0 +1,18 @@ + +/*! + * Jade - doctypes + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +module.exports = { + '5': '' + , 'default': '' + , 'xml': '' + , 'transitional': '' + , 'strict': '' + , 'frameset': '' + , '1.1': '' + , 'basic': '' + , 'mobile': '' +}; \ No newline at end of file diff --git a/node_modules/jade/lib/filters.js b/node_modules/jade/lib/filters.js new file mode 100644 index 0000000..fdb634c --- /dev/null +++ b/node_modules/jade/lib/filters.js @@ -0,0 +1,97 @@ + +/*! + * Jade - filters + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +module.exports = { + + /** + * Wrap text with CDATA block. + */ + + cdata: function(str){ + return ''; + }, + + /** + * Transform sass to css, wrapped in style tags. + */ + + sass: function(str){ + str = str.replace(/\\n/g, '\n'); + var sass = require('sass').render(str).replace(/\n/g, '\\n'); + return ''; + }, + + /** + * Transform stylus to css, wrapped in style tags. + */ + + stylus: function(str, options){ + var ret; + str = str.replace(/\\n/g, '\n'); + var stylus = require('stylus'); + stylus(str, options).render(function(err, css){ + if (err) throw err; + ret = css.replace(/\n/g, '\\n'); + }); + return ''; + }, + + /** + * Transform less to css, wrapped in style tags. + */ + + less: function(str){ + var ret; + str = str.replace(/\\n/g, '\n'); + require('less').render(str, function(err, css){ + if (err) throw err; + ret = ''; + }); + return ret; + }, + + /** + * Transform markdown to html. + */ + + markdown: function(str){ + var md; + + // support markdown / discount + try { + md = require('markdown'); + } catch (err){ + try { + md = require('discount'); + } catch (err) { + try { + md = require('markdown-js'); + } catch (err) { + try { + md = require('marked'); + } catch (err) { + throw new + Error('Cannot find markdown library, install markdown, discount, or marked.'); + } + } + } + } + + str = str.replace(/\\n/g, '\n'); + return md.parse(str).replace(/\n/g, '\\n').replace(/'/g,'''); + }, + + /** + * Transform coffeescript to javascript. + */ + + coffeescript: function(str){ + str = str.replace(/\\n/g, '\n'); + var js = require('coffee-script').compile(str).replace(/\\/g, '\\\\').replace(/\n/g, '\\n'); + return ''; + } +}; diff --git a/node_modules/jade/lib/inline-tags.js b/node_modules/jade/lib/inline-tags.js new file mode 100644 index 0000000..491de0b --- /dev/null +++ b/node_modules/jade/lib/inline-tags.js @@ -0,0 +1,28 @@ + +/*! + * Jade - inline tags + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +module.exports = [ + 'a' + , 'abbr' + , 'acronym' + , 'b' + , 'br' + , 'code' + , 'em' + , 'font' + , 'i' + , 'img' + , 'ins' + , 'kbd' + , 'map' + , 'samp' + , 'small' + , 'span' + , 'strong' + , 'sub' + , 'sup' +]; \ No newline at end of file diff --git a/node_modules/jade/lib/jade.js b/node_modules/jade/lib/jade.js new file mode 100644 index 0000000..00f0abb --- /dev/null +++ b/node_modules/jade/lib/jade.js @@ -0,0 +1,237 @@ +/*! + * Jade + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Parser = require('./parser') + , Lexer = require('./lexer') + , Compiler = require('./compiler') + , runtime = require('./runtime') +// if node + , fs = require('fs'); +// end + +/** + * Library version. + */ + +exports.version = '0.26.3'; + +/** + * Expose self closing tags. + */ + +exports.selfClosing = require('./self-closing'); + +/** + * Default supported doctypes. + */ + +exports.doctypes = require('./doctypes'); + +/** + * Text filters. + */ + +exports.filters = require('./filters'); + +/** + * Utilities. + */ + +exports.utils = require('./utils'); + +/** + * Expose `Compiler`. + */ + +exports.Compiler = Compiler; + +/** + * Expose `Parser`. + */ + +exports.Parser = Parser; + +/** + * Expose `Lexer`. + */ + +exports.Lexer = Lexer; + +/** + * Nodes. + */ + +exports.nodes = require('./nodes'); + +/** + * Jade runtime helpers. + */ + +exports.runtime = runtime; + +/** + * Template function cache. + */ + +exports.cache = {}; + +/** + * Parse the given `str` of jade and return a function body. + * + * @param {String} str + * @param {Object} options + * @return {String} + * @api private + */ + +function parse(str, options){ + try { + // Parse + var parser = new Parser(str, options.filename, options); + + // Compile + var compiler = new (options.compiler || Compiler)(parser.parse(), options) + , js = compiler.compile(); + + // Debug compiler + if (options.debug) { + console.error('\nCompiled Function:\n\n\033[90m%s\033[0m', js.replace(/^/gm, ' ')); + } + + return '' + + 'var buf = [];\n' + + (options.self + ? 'var self = locals || {};\n' + js + : 'with (locals || {}) {\n' + js + '\n}\n') + + 'return buf.join("");'; + } catch (err) { + parser = parser.context(); + runtime.rethrow(err, parser.filename, parser.lexer.lineno); + } +} + +/** + * Compile a `Function` representation of the given jade `str`. + * + * Options: + * + * - `compileDebug` when `false` debugging code is stripped from the compiled template + * - `client` when `true` the helper functions `escape()` etc will reference `jade.escape()` + * for use with the Jade client-side runtime.js + * + * @param {String} str + * @param {Options} options + * @return {Function} + * @api public + */ + +exports.compile = function(str, options){ + var options = options || {} + , client = options.client + , filename = options.filename + ? JSON.stringify(options.filename) + : 'undefined' + , fn; + + if (options.compileDebug !== false) { + fn = [ + 'var __jade = [{ lineno: 1, filename: ' + filename + ' }];' + , 'try {' + , parse(String(str), options) + , '} catch (err) {' + , ' rethrow(err, __jade[0].filename, __jade[0].lineno);' + , '}' + ].join('\n'); + } else { + fn = parse(String(str), options); + } + + if (client) { + fn = 'attrs = attrs || jade.attrs; escape = escape || jade.escape; rethrow = rethrow || jade.rethrow; merge = merge || jade.merge;\n' + fn; + } + + fn = new Function('locals, attrs, escape, rethrow, merge', fn); + + if (client) return fn; + + return function(locals){ + return fn(locals, runtime.attrs, runtime.escape, runtime.rethrow, runtime.merge); + }; +}; + +/** + * Render the given `str` of jade and invoke + * the callback `fn(err, str)`. + * + * Options: + * + * - `cache` enable template caching + * - `filename` filename required for `include` / `extends` and caching + * + * @param {String} str + * @param {Object|Function} options or fn + * @param {Function} fn + * @api public + */ + +exports.render = function(str, options, fn){ + // swap args + if ('function' == typeof options) { + fn = options, options = {}; + } + + // cache requires .filename + if (options.cache && !options.filename) { + return fn(new Error('the "filename" option is required for caching')); + } + + try { + var path = options.filename; + var tmpl = options.cache + ? exports.cache[path] || (exports.cache[path] = exports.compile(str, options)) + : exports.compile(str, options); + fn(null, tmpl(options)); + } catch (err) { + fn(err); + } +}; + +/** + * Render a Jade file at the given `path` and callback `fn(err, str)`. + * + * @param {String} path + * @param {Object|Function} options or callback + * @param {Function} fn + * @api public + */ + +exports.renderFile = function(path, options, fn){ + var key = path + ':string'; + + if ('function' == typeof options) { + fn = options, options = {}; + } + + try { + options.filename = path; + var str = options.cache + ? exports.cache[key] || (exports.cache[key] = fs.readFileSync(path, 'utf8')) + : fs.readFileSync(path, 'utf8'); + exports.render(str, options, fn); + } catch (err) { + fn(err); + } +}; + +/** + * Express support. + */ + +exports.__express = exports.renderFile; diff --git a/node_modules/jade/lib/lexer.js b/node_modules/jade/lib/lexer.js new file mode 100644 index 0000000..bca314a --- /dev/null +++ b/node_modules/jade/lib/lexer.js @@ -0,0 +1,771 @@ + +/*! + * Jade - Lexer + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Initialize `Lexer` with the given `str`. + * + * Options: + * + * - `colons` allow colons for attr delimiters + * + * @param {String} str + * @param {Object} options + * @api private + */ + +var Lexer = module.exports = function Lexer(str, options) { + options = options || {}; + this.input = str.replace(/\r\n|\r/g, '\n'); + this.colons = options.colons; + this.deferredTokens = []; + this.lastIndents = 0; + this.lineno = 1; + this.stash = []; + this.indentStack = []; + this.indentRe = null; + this.pipeless = false; +}; + +/** + * Lexer prototype. + */ + +Lexer.prototype = { + + /** + * Construct a token with the given `type` and `val`. + * + * @param {String} type + * @param {String} val + * @return {Object} + * @api private + */ + + tok: function(type, val){ + return { + type: type + , line: this.lineno + , val: val + } + }, + + /** + * Consume the given `len` of input. + * + * @param {Number} len + * @api private + */ + + consume: function(len){ + this.input = this.input.substr(len); + }, + + /** + * Scan for `type` with the given `regexp`. + * + * @param {String} type + * @param {RegExp} regexp + * @return {Object} + * @api private + */ + + scan: function(regexp, type){ + var captures; + if (captures = regexp.exec(this.input)) { + this.consume(captures[0].length); + return this.tok(type, captures[1]); + } + }, + + /** + * Defer the given `tok`. + * + * @param {Object} tok + * @api private + */ + + defer: function(tok){ + this.deferredTokens.push(tok); + }, + + /** + * Lookahead `n` tokens. + * + * @param {Number} n + * @return {Object} + * @api private + */ + + lookahead: function(n){ + var fetch = n - this.stash.length; + while (fetch-- > 0) this.stash.push(this.next()); + return this.stash[--n]; + }, + + /** + * Return the indexOf `start` / `end` delimiters. + * + * @param {String} start + * @param {String} end + * @return {Number} + * @api private + */ + + indexOfDelimiters: function(start, end){ + var str = this.input + , nstart = 0 + , nend = 0 + , pos = 0; + for (var i = 0, len = str.length; i < len; ++i) { + if (start == str.charAt(i)) { + ++nstart; + } else if (end == str.charAt(i)) { + if (++nend == nstart) { + pos = i; + break; + } + } + } + return pos; + }, + + /** + * Stashed token. + */ + + stashed: function() { + return this.stash.length + && this.stash.shift(); + }, + + /** + * Deferred token. + */ + + deferred: function() { + return this.deferredTokens.length + && this.deferredTokens.shift(); + }, + + /** + * end-of-source. + */ + + eos: function() { + if (this.input.length) return; + if (this.indentStack.length) { + this.indentStack.shift(); + return this.tok('outdent'); + } else { + return this.tok('eos'); + } + }, + + /** + * Blank line. + */ + + blank: function() { + var captures; + if (captures = /^\n *\n/.exec(this.input)) { + this.consume(captures[0].length - 1); + if (this.pipeless) return this.tok('text', ''); + return this.next(); + } + }, + + /** + * Comment. + */ + + comment: function() { + var captures; + if (captures = /^ *\/\/(-)?([^\n]*)/.exec(this.input)) { + this.consume(captures[0].length); + var tok = this.tok('comment', captures[2]); + tok.buffer = '-' != captures[1]; + return tok; + } + }, + + /** + * Interpolated tag. + */ + + interpolation: function() { + var captures; + if (captures = /^#\{(.*?)\}/.exec(this.input)) { + this.consume(captures[0].length); + return this.tok('interpolation', captures[1]); + } + }, + + /** + * Tag. + */ + + tag: function() { + var captures; + if (captures = /^(\w[-:\w]*)(\/?)/.exec(this.input)) { + this.consume(captures[0].length); + var tok, name = captures[1]; + if (':' == name[name.length - 1]) { + name = name.slice(0, -1); + tok = this.tok('tag', name); + this.defer(this.tok(':')); + while (' ' == this.input[0]) this.input = this.input.substr(1); + } else { + tok = this.tok('tag', name); + } + tok.selfClosing = !! captures[2]; + return tok; + } + }, + + /** + * Filter. + */ + + filter: function() { + return this.scan(/^:(\w+)/, 'filter'); + }, + + /** + * Doctype. + */ + + doctype: function() { + return this.scan(/^(?:!!!|doctype) *([^\n]+)?/, 'doctype'); + }, + + /** + * Id. + */ + + id: function() { + return this.scan(/^#([\w-]+)/, 'id'); + }, + + /** + * Class. + */ + + className: function() { + return this.scan(/^\.([\w-]+)/, 'class'); + }, + + /** + * Text. + */ + + text: function() { + return this.scan(/^(?:\| ?| ?)?([^\n]+)/, 'text'); + }, + + /** + * Extends. + */ + + "extends": function() { + return this.scan(/^extends? +([^\n]+)/, 'extends'); + }, + + /** + * Block prepend. + */ + + prepend: function() { + var captures; + if (captures = /^prepend +([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + var mode = 'prepend' + , name = captures[1] + , tok = this.tok('block', name); + tok.mode = mode; + return tok; + } + }, + + /** + * Block append. + */ + + append: function() { + var captures; + if (captures = /^append +([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + var mode = 'append' + , name = captures[1] + , tok = this.tok('block', name); + tok.mode = mode; + return tok; + } + }, + + /** + * Block. + */ + + block: function() { + var captures; + if (captures = /^block\b *(?:(prepend|append) +)?([^\n]*)/.exec(this.input)) { + this.consume(captures[0].length); + var mode = captures[1] || 'replace' + , name = captures[2] + , tok = this.tok('block', name); + + tok.mode = mode; + return tok; + } + }, + + /** + * Yield. + */ + + yield: function() { + return this.scan(/^yield */, 'yield'); + }, + + /** + * Include. + */ + + include: function() { + return this.scan(/^include +([^\n]+)/, 'include'); + }, + + /** + * Case. + */ + + "case": function() { + return this.scan(/^case +([^\n]+)/, 'case'); + }, + + /** + * When. + */ + + when: function() { + return this.scan(/^when +([^:\n]+)/, 'when'); + }, + + /** + * Default. + */ + + "default": function() { + return this.scan(/^default */, 'default'); + }, + + /** + * Assignment. + */ + + assignment: function() { + var captures; + if (captures = /^(\w+) += *([^;\n]+)( *;? *)/.exec(this.input)) { + this.consume(captures[0].length); + var name = captures[1] + , val = captures[2]; + return this.tok('code', 'var ' + name + ' = (' + val + ');'); + } + }, + + /** + * Call mixin. + */ + + call: function(){ + var captures; + if (captures = /^\+([-\w]+)/.exec(this.input)) { + this.consume(captures[0].length); + var tok = this.tok('call', captures[1]); + + // Check for args (not attributes) + if (captures = /^ *\((.*?)\)/.exec(this.input)) { + if (!/^ *[-\w]+ *=/.test(captures[1])) { + this.consume(captures[0].length); + tok.args = captures[1]; + } + } + + return tok; + } + }, + + /** + * Mixin. + */ + + mixin: function(){ + var captures; + if (captures = /^mixin +([-\w]+)(?: *\((.*)\))?/.exec(this.input)) { + this.consume(captures[0].length); + var tok = this.tok('mixin', captures[1]); + tok.args = captures[2]; + return tok; + } + }, + + /** + * Conditional. + */ + + conditional: function() { + var captures; + if (captures = /^(if|unless|else if|else)\b([^\n]*)/.exec(this.input)) { + this.consume(captures[0].length); + var type = captures[1] + , js = captures[2]; + + switch (type) { + case 'if': js = 'if (' + js + ')'; break; + case 'unless': js = 'if (!(' + js + '))'; break; + case 'else if': js = 'else if (' + js + ')'; break; + case 'else': js = 'else'; break; + } + + return this.tok('code', js); + } + }, + + /** + * While. + */ + + "while": function() { + var captures; + if (captures = /^while +([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + return this.tok('code', 'while (' + captures[1] + ')'); + } + }, + + /** + * Each. + */ + + each: function() { + var captures; + if (captures = /^(?:- *)?(?:each|for) +(\w+)(?: *, *(\w+))? * in *([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + var tok = this.tok('each', captures[1]); + tok.key = captures[2] || '$index'; + tok.code = captures[3]; + return tok; + } + }, + + /** + * Code. + */ + + code: function() { + var captures; + if (captures = /^(!?=|-)([^\n]+)/.exec(this.input)) { + this.consume(captures[0].length); + var flags = captures[1]; + captures[1] = captures[2]; + var tok = this.tok('code', captures[1]); + tok.escape = flags[0] === '='; + tok.buffer = flags[0] === '=' || flags[1] === '='; + return tok; + } + }, + + /** + * Attributes. + */ + + attrs: function() { + if ('(' == this.input.charAt(0)) { + var index = this.indexOfDelimiters('(', ')') + , str = this.input.substr(1, index-1) + , tok = this.tok('attrs') + , len = str.length + , colons = this.colons + , states = ['key'] + , escapedAttr + , key = '' + , val = '' + , quote + , c + , p; + + function state(){ + return states[states.length - 1]; + } + + function interpolate(attr) { + return attr.replace(/#\{([^}]+)\}/g, function(_, expr){ + return quote + " + (" + expr + ") + " + quote; + }); + } + + this.consume(index + 1); + tok.attrs = {}; + tok.escaped = {}; + + function parse(c) { + var real = c; + // TODO: remove when people fix ":" + if (colons && ':' == c) c = '='; + switch (c) { + case ',': + case '\n': + switch (state()) { + case 'expr': + case 'array': + case 'string': + case 'object': + val += c; + break; + default: + states.push('key'); + val = val.trim(); + key = key.trim(); + if ('' == key) return; + key = key.replace(/^['"]|['"]$/g, '').replace('!', ''); + tok.escaped[key] = escapedAttr; + tok.attrs[key] = '' == val + ? true + : interpolate(val); + key = val = ''; + } + break; + case '=': + switch (state()) { + case 'key char': + key += real; + break; + case 'val': + case 'expr': + case 'array': + case 'string': + case 'object': + val += real; + break; + default: + escapedAttr = '!' != p; + states.push('val'); + } + break; + case '(': + if ('val' == state() + || 'expr' == state()) states.push('expr'); + val += c; + break; + case ')': + if ('expr' == state() + || 'val' == state()) states.pop(); + val += c; + break; + case '{': + if ('val' == state()) states.push('object'); + val += c; + break; + case '}': + if ('object' == state()) states.pop(); + val += c; + break; + case '[': + if ('val' == state()) states.push('array'); + val += c; + break; + case ']': + if ('array' == state()) states.pop(); + val += c; + break; + case '"': + case "'": + switch (state()) { + case 'key': + states.push('key char'); + break; + case 'key char': + states.pop(); + break; + case 'string': + if (c == quote) states.pop(); + val += c; + break; + default: + states.push('string'); + val += c; + quote = c; + } + break; + case '': + break; + default: + switch (state()) { + case 'key': + case 'key char': + key += c; + break; + default: + val += c; + } + } + p = c; + } + + for (var i = 0; i < len; ++i) { + parse(str.charAt(i)); + } + + parse(','); + + if ('/' == this.input.charAt(0)) { + this.consume(1); + tok.selfClosing = true; + } + + return tok; + } + }, + + /** + * Indent | Outdent | Newline. + */ + + indent: function() { + var captures, re; + + // established regexp + if (this.indentRe) { + captures = this.indentRe.exec(this.input); + // determine regexp + } else { + // tabs + re = /^\n(\t*) */; + captures = re.exec(this.input); + + // spaces + if (captures && !captures[1].length) { + re = /^\n( *)/; + captures = re.exec(this.input); + } + + // established + if (captures && captures[1].length) this.indentRe = re; + } + + if (captures) { + var tok + , indents = captures[1].length; + + ++this.lineno; + this.consume(indents + 1); + + if (' ' == this.input[0] || '\t' == this.input[0]) { + throw new Error('Invalid indentation, you can use tabs or spaces but not both'); + } + + // blank line + if ('\n' == this.input[0]) return this.tok('newline'); + + // outdent + if (this.indentStack.length && indents < this.indentStack[0]) { + while (this.indentStack.length && this.indentStack[0] > indents) { + this.stash.push(this.tok('outdent')); + this.indentStack.shift(); + } + tok = this.stash.pop(); + // indent + } else if (indents && indents != this.indentStack[0]) { + this.indentStack.unshift(indents); + tok = this.tok('indent', indents); + // newline + } else { + tok = this.tok('newline'); + } + + return tok; + } + }, + + /** + * Pipe-less text consumed only when + * pipeless is true; + */ + + pipelessText: function() { + if (this.pipeless) { + if ('\n' == this.input[0]) return; + var i = this.input.indexOf('\n'); + if (-1 == i) i = this.input.length; + var str = this.input.substr(0, i); + this.consume(str.length); + return this.tok('text', str); + } + }, + + /** + * ':' + */ + + colon: function() { + return this.scan(/^: */, ':'); + }, + + /** + * Return the next token object, or those + * previously stashed by lookahead. + * + * @return {Object} + * @api private + */ + + advance: function(){ + return this.stashed() + || this.next(); + }, + + /** + * Return the next token object. + * + * @return {Object} + * @api private + */ + + next: function() { + return this.deferred() + || this.blank() + || this.eos() + || this.pipelessText() + || this.yield() + || this.doctype() + || this.interpolation() + || this["case"]() + || this.when() + || this["default"]() + || this["extends"]() + || this.append() + || this.prepend() + || this.block() + || this.include() + || this.mixin() + || this.call() + || this.conditional() + || this.each() + || this["while"]() + || this.assignment() + || this.tag() + || this.filter() + || this.code() + || this.id() + || this.className() + || this.attrs() + || this.indent() + || this.comment() + || this.colon() + || this.text(); + } +}; diff --git a/node_modules/jade/lib/nodes/attrs.js b/node_modules/jade/lib/nodes/attrs.js new file mode 100644 index 0000000..5de9b59 --- /dev/null +++ b/node_modules/jade/lib/nodes/attrs.js @@ -0,0 +1,77 @@ + +/*! + * Jade - nodes - Attrs + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'), + Block = require('./block'); + +/** + * Initialize a `Attrs` node. + * + * @api public + */ + +var Attrs = module.exports = function Attrs() { + this.attrs = []; +}; + +/** + * Inherit from `Node`. + */ + +Attrs.prototype.__proto__ = Node.prototype; + +/** + * Set attribute `name` to `val`, keep in mind these become + * part of a raw js object literal, so to quote a value you must + * '"quote me"', otherwise or example 'user.name' is literal JavaScript. + * + * @param {String} name + * @param {String} val + * @param {Boolean} escaped + * @return {Tag} for chaining + * @api public + */ + +Attrs.prototype.setAttribute = function(name, val, escaped){ + this.attrs.push({ name: name, val: val, escaped: escaped }); + return this; +}; + +/** + * Remove attribute `name` when present. + * + * @param {String} name + * @api public + */ + +Attrs.prototype.removeAttribute = function(name){ + for (var i = 0, len = this.attrs.length; i < len; ++i) { + if (this.attrs[i] && this.attrs[i].name == name) { + delete this.attrs[i]; + } + } +}; + +/** + * Get attribute value by `name`. + * + * @param {String} name + * @return {String} + * @api public + */ + +Attrs.prototype.getAttribute = function(name){ + for (var i = 0, len = this.attrs.length; i < len; ++i) { + if (this.attrs[i] && this.attrs[i].name == name) { + return this.attrs[i].val; + } + } +}; diff --git a/node_modules/jade/lib/nodes/block-comment.js b/node_modules/jade/lib/nodes/block-comment.js new file mode 100644 index 0000000..4f41e4a --- /dev/null +++ b/node_modules/jade/lib/nodes/block-comment.js @@ -0,0 +1,33 @@ + +/*! + * Jade - nodes - BlockComment + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `BlockComment` with the given `block`. + * + * @param {String} val + * @param {Block} block + * @param {Boolean} buffer + * @api public + */ + +var BlockComment = module.exports = function BlockComment(val, block, buffer) { + this.block = block; + this.val = val; + this.buffer = buffer; +}; + +/** + * Inherit from `Node`. + */ + +BlockComment.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/block.js b/node_modules/jade/lib/nodes/block.js new file mode 100644 index 0000000..bb00a1d --- /dev/null +++ b/node_modules/jade/lib/nodes/block.js @@ -0,0 +1,121 @@ + +/*! + * Jade - nodes - Block + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a new `Block` with an optional `node`. + * + * @param {Node} node + * @api public + */ + +var Block = module.exports = function Block(node){ + this.nodes = []; + if (node) this.push(node); +}; + +/** + * Inherit from `Node`. + */ + +Block.prototype.__proto__ = Node.prototype; + +/** + * Block flag. + */ + +Block.prototype.isBlock = true; + +/** + * Replace the nodes in `other` with the nodes + * in `this` block. + * + * @param {Block} other + * @api private + */ + +Block.prototype.replace = function(other){ + other.nodes = this.nodes; +}; + +/** + * Pust the given `node`. + * + * @param {Node} node + * @return {Number} + * @api public + */ + +Block.prototype.push = function(node){ + return this.nodes.push(node); +}; + +/** + * Check if this block is empty. + * + * @return {Boolean} + * @api public + */ + +Block.prototype.isEmpty = function(){ + return 0 == this.nodes.length; +}; + +/** + * Unshift the given `node`. + * + * @param {Node} node + * @return {Number} + * @api public + */ + +Block.prototype.unshift = function(node){ + return this.nodes.unshift(node); +}; + +/** + * Return the "last" block, or the first `yield` node. + * + * @return {Block} + * @api private + */ + +Block.prototype.includeBlock = function(){ + var ret = this + , node; + + for (var i = 0, len = this.nodes.length; i < len; ++i) { + node = this.nodes[i]; + if (node.yield) return node; + else if (node.textOnly) continue; + else if (node.includeBlock) ret = node.includeBlock(); + else if (node.block && !node.block.isEmpty()) ret = node.block.includeBlock(); + } + + return ret; +}; + +/** + * Return a clone of this block. + * + * @return {Block} + * @api private + */ + +Block.prototype.clone = function(){ + var clone = new Block; + for (var i = 0, len = this.nodes.length; i < len; ++i) { + clone.push(this.nodes[i].clone()); + } + return clone; +}; + diff --git a/node_modules/jade/lib/nodes/case.js b/node_modules/jade/lib/nodes/case.js new file mode 100644 index 0000000..08ff033 --- /dev/null +++ b/node_modules/jade/lib/nodes/case.js @@ -0,0 +1,43 @@ + +/*! + * Jade - nodes - Case + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a new `Case` with `expr`. + * + * @param {String} expr + * @api public + */ + +var Case = exports = module.exports = function Case(expr, block){ + this.expr = expr; + this.block = block; +}; + +/** + * Inherit from `Node`. + */ + +Case.prototype.__proto__ = Node.prototype; + +var When = exports.When = function When(expr, block){ + this.expr = expr; + this.block = block; + this.debug = false; +}; + +/** + * Inherit from `Node`. + */ + +When.prototype.__proto__ = Node.prototype; + diff --git a/node_modules/jade/lib/nodes/code.js b/node_modules/jade/lib/nodes/code.js new file mode 100644 index 0000000..babc675 --- /dev/null +++ b/node_modules/jade/lib/nodes/code.js @@ -0,0 +1,35 @@ + +/*! + * Jade - nodes - Code + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Code` node with the given code `val`. + * Code may also be optionally buffered and escaped. + * + * @param {String} val + * @param {Boolean} buffer + * @param {Boolean} escape + * @api public + */ + +var Code = module.exports = function Code(val, buffer, escape) { + this.val = val; + this.buffer = buffer; + this.escape = escape; + if (val.match(/^ *else/)) this.debug = false; +}; + +/** + * Inherit from `Node`. + */ + +Code.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/comment.js b/node_modules/jade/lib/nodes/comment.js new file mode 100644 index 0000000..2e1469e --- /dev/null +++ b/node_modules/jade/lib/nodes/comment.js @@ -0,0 +1,32 @@ + +/*! + * Jade - nodes - Comment + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Comment` with the given `val`, optionally `buffer`, + * otherwise the comment may render in the output. + * + * @param {String} val + * @param {Boolean} buffer + * @api public + */ + +var Comment = module.exports = function Comment(val, buffer) { + this.val = val; + this.buffer = buffer; +}; + +/** + * Inherit from `Node`. + */ + +Comment.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/doctype.js b/node_modules/jade/lib/nodes/doctype.js new file mode 100644 index 0000000..b8f33e5 --- /dev/null +++ b/node_modules/jade/lib/nodes/doctype.js @@ -0,0 +1,29 @@ + +/*! + * Jade - nodes - Doctype + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Doctype` with the given `val`. + * + * @param {String} val + * @api public + */ + +var Doctype = module.exports = function Doctype(val) { + this.val = val; +}; + +/** + * Inherit from `Node`. + */ + +Doctype.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/each.js b/node_modules/jade/lib/nodes/each.js new file mode 100644 index 0000000..f54101f --- /dev/null +++ b/node_modules/jade/lib/nodes/each.js @@ -0,0 +1,35 @@ + +/*! + * Jade - nodes - Each + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize an `Each` node, representing iteration + * + * @param {String} obj + * @param {String} val + * @param {String} key + * @param {Block} block + * @api public + */ + +var Each = module.exports = function Each(obj, val, key, block) { + this.obj = obj; + this.val = val; + this.key = key; + this.block = block; +}; + +/** + * Inherit from `Node`. + */ + +Each.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/filter.js b/node_modules/jade/lib/nodes/filter.js new file mode 100644 index 0000000..851a004 --- /dev/null +++ b/node_modules/jade/lib/nodes/filter.js @@ -0,0 +1,35 @@ + +/*! + * Jade - nodes - Filter + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node') + , Block = require('./block'); + +/** + * Initialize a `Filter` node with the given + * filter `name` and `block`. + * + * @param {String} name + * @param {Block|Node} block + * @api public + */ + +var Filter = module.exports = function Filter(name, block, attrs) { + this.name = name; + this.block = block; + this.attrs = attrs; + this.isASTFilter = !block.nodes.every(function(node){ return node.isText }); +}; + +/** + * Inherit from `Node`. + */ + +Filter.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/index.js b/node_modules/jade/lib/nodes/index.js new file mode 100644 index 0000000..386ad2f --- /dev/null +++ b/node_modules/jade/lib/nodes/index.js @@ -0,0 +1,20 @@ + +/*! + * Jade - nodes + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +exports.Node = require('./node'); +exports.Tag = require('./tag'); +exports.Code = require('./code'); +exports.Each = require('./each'); +exports.Case = require('./case'); +exports.Text = require('./text'); +exports.Block = require('./block'); +exports.Mixin = require('./mixin'); +exports.Filter = require('./filter'); +exports.Comment = require('./comment'); +exports.Literal = require('./literal'); +exports.BlockComment = require('./block-comment'); +exports.Doctype = require('./doctype'); diff --git a/node_modules/jade/lib/nodes/literal.js b/node_modules/jade/lib/nodes/literal.js new file mode 100644 index 0000000..fde586b --- /dev/null +++ b/node_modules/jade/lib/nodes/literal.js @@ -0,0 +1,32 @@ + +/*! + * Jade - nodes - Literal + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Literal` node with the given `str. + * + * @param {String} str + * @api public + */ + +var Literal = module.exports = function Literal(str) { + this.str = str + .replace(/\\/g, "\\\\") + .replace(/\n|\r\n/g, "\\n") + .replace(/'/g, "\\'"); +}; + +/** + * Inherit from `Node`. + */ + +Literal.prototype.__proto__ = Node.prototype; diff --git a/node_modules/jade/lib/nodes/mixin.js b/node_modules/jade/lib/nodes/mixin.js new file mode 100644 index 0000000..8407bc7 --- /dev/null +++ b/node_modules/jade/lib/nodes/mixin.js @@ -0,0 +1,36 @@ + +/*! + * Jade - nodes - Mixin + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Attrs = require('./attrs'); + +/** + * Initialize a new `Mixin` with `name` and `block`. + * + * @param {String} name + * @param {String} args + * @param {Block} block + * @api public + */ + +var Mixin = module.exports = function Mixin(name, args, block, call){ + this.name = name; + this.args = args; + this.block = block; + this.attrs = []; + this.call = call; +}; + +/** + * Inherit from `Attrs`. + */ + +Mixin.prototype.__proto__ = Attrs.prototype; + diff --git a/node_modules/jade/lib/nodes/node.js b/node_modules/jade/lib/nodes/node.js new file mode 100644 index 0000000..e98f042 --- /dev/null +++ b/node_modules/jade/lib/nodes/node.js @@ -0,0 +1,25 @@ + +/*! + * Jade - nodes - Node + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Initialize a `Node`. + * + * @api public + */ + +var Node = module.exports = function Node(){}; + +/** + * Clone this node (return itself) + * + * @return {Node} + * @api private + */ + +Node.prototype.clone = function(){ + return this; +}; diff --git a/node_modules/jade/lib/nodes/tag.js b/node_modules/jade/lib/nodes/tag.js new file mode 100644 index 0000000..4b6728a --- /dev/null +++ b/node_modules/jade/lib/nodes/tag.js @@ -0,0 +1,95 @@ + +/*! + * Jade - nodes - Tag + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Attrs = require('./attrs'), + Block = require('./block'), + inlineTags = require('../inline-tags'); + +/** + * Initialize a `Tag` node with the given tag `name` and optional `block`. + * + * @param {String} name + * @param {Block} block + * @api public + */ + +var Tag = module.exports = function Tag(name, block) { + this.name = name; + this.attrs = []; + this.block = block || new Block; +}; + +/** + * Inherit from `Attrs`. + */ + +Tag.prototype.__proto__ = Attrs.prototype; + +/** + * Clone this tag. + * + * @return {Tag} + * @api private + */ + +Tag.prototype.clone = function(){ + var clone = new Tag(this.name, this.block.clone()); + clone.line = this.line; + clone.attrs = this.attrs; + clone.textOnly = this.textOnly; + return clone; +}; + +/** + * Check if this tag is an inline tag. + * + * @return {Boolean} + * @api private + */ + +Tag.prototype.isInline = function(){ + return ~inlineTags.indexOf(this.name); +}; + +/** + * Check if this tag's contents can be inlined. Used for pretty printing. + * + * @return {Boolean} + * @api private + */ + +Tag.prototype.canInline = function(){ + var nodes = this.block.nodes; + + function isInline(node){ + // Recurse if the node is a block + if (node.isBlock) return node.nodes.every(isInline); + return node.isText || (node.isInline && node.isInline()); + } + + // Empty tag + if (!nodes.length) return true; + + // Text-only or inline-only tag + if (1 == nodes.length) return isInline(nodes[0]); + + // Multi-line inline-only tag + if (this.block.nodes.every(isInline)) { + for (var i = 1, len = nodes.length; i < len; ++i) { + if (nodes[i-1].isText && nodes[i].isText) + return false; + } + return true; + } + + // Mixed tag + return false; +}; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/text.js b/node_modules/jade/lib/nodes/text.js new file mode 100644 index 0000000..3b5dd55 --- /dev/null +++ b/node_modules/jade/lib/nodes/text.js @@ -0,0 +1,36 @@ + +/*! + * Jade - nodes - Text + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Node = require('./node'); + +/** + * Initialize a `Text` node with optional `line`. + * + * @param {String} line + * @api public + */ + +var Text = module.exports = function Text(line) { + this.val = ''; + if ('string' == typeof line) this.val = line; +}; + +/** + * Inherit from `Node`. + */ + +Text.prototype.__proto__ = Node.prototype; + +/** + * Flag as text. + */ + +Text.prototype.isText = true; \ No newline at end of file diff --git a/node_modules/jade/lib/parser.js b/node_modules/jade/lib/parser.js new file mode 100644 index 0000000..92f2af0 --- /dev/null +++ b/node_modules/jade/lib/parser.js @@ -0,0 +1,710 @@ + +/*! + * Jade - Parser + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var Lexer = require('./lexer') + , nodes = require('./nodes'); + +/** + * Initialize `Parser` with the given input `str` and `filename`. + * + * @param {String} str + * @param {String} filename + * @param {Object} options + * @api public + */ + +var Parser = exports = module.exports = function Parser(str, filename, options){ + this.input = str; + this.lexer = new Lexer(str, options); + this.filename = filename; + this.blocks = {}; + this.mixins = {}; + this.options = options; + this.contexts = [this]; +}; + +/** + * Tags that may not contain tags. + */ + +var textOnly = exports.textOnly = ['script', 'style']; + +/** + * Parser prototype. + */ + +Parser.prototype = { + + /** + * Push `parser` onto the context stack, + * or pop and return a `Parser`. + */ + + context: function(parser){ + if (parser) { + this.contexts.push(parser); + } else { + return this.contexts.pop(); + } + }, + + /** + * Return the next token object. + * + * @return {Object} + * @api private + */ + + advance: function(){ + return this.lexer.advance(); + }, + + /** + * Skip `n` tokens. + * + * @param {Number} n + * @api private + */ + + skip: function(n){ + while (n--) this.advance(); + }, + + /** + * Single token lookahead. + * + * @return {Object} + * @api private + */ + + peek: function() { + return this.lookahead(1); + }, + + /** + * Return lexer lineno. + * + * @return {Number} + * @api private + */ + + line: function() { + return this.lexer.lineno; + }, + + /** + * `n` token lookahead. + * + * @param {Number} n + * @return {Object} + * @api private + */ + + lookahead: function(n){ + return this.lexer.lookahead(n); + }, + + /** + * Parse input returning a string of js for evaluation. + * + * @return {String} + * @api public + */ + + parse: function(){ + var block = new nodes.Block, parser; + block.line = this.line(); + + while ('eos' != this.peek().type) { + if ('newline' == this.peek().type) { + this.advance(); + } else { + block.push(this.parseExpr()); + } + } + + if (parser = this.extending) { + this.context(parser); + var ast = parser.parse(); + this.context(); + // hoist mixins + for (var name in this.mixins) + ast.unshift(this.mixins[name]); + return ast; + } + + return block; + }, + + /** + * Expect the given type, or throw an exception. + * + * @param {String} type + * @api private + */ + + expect: function(type){ + if (this.peek().type === type) { + return this.advance(); + } else { + throw new Error('expected "' + type + '", but got "' + this.peek().type + '"'); + } + }, + + /** + * Accept the given `type`. + * + * @param {String} type + * @api private + */ + + accept: function(type){ + if (this.peek().type === type) { + return this.advance(); + } + }, + + /** + * tag + * | doctype + * | mixin + * | include + * | filter + * | comment + * | text + * | each + * | code + * | yield + * | id + * | class + * | interpolation + */ + + parseExpr: function(){ + switch (this.peek().type) { + case 'tag': + return this.parseTag(); + case 'mixin': + return this.parseMixin(); + case 'block': + return this.parseBlock(); + case 'case': + return this.parseCase(); + case 'when': + return this.parseWhen(); + case 'default': + return this.parseDefault(); + case 'extends': + return this.parseExtends(); + case 'include': + return this.parseInclude(); + case 'doctype': + return this.parseDoctype(); + case 'filter': + return this.parseFilter(); + case 'comment': + return this.parseComment(); + case 'text': + return this.parseText(); + case 'each': + return this.parseEach(); + case 'code': + return this.parseCode(); + case 'call': + return this.parseCall(); + case 'interpolation': + return this.parseInterpolation(); + case 'yield': + this.advance(); + var block = new nodes.Block; + block.yield = true; + return block; + case 'id': + case 'class': + var tok = this.advance(); + this.lexer.defer(this.lexer.tok('tag', 'div')); + this.lexer.defer(tok); + return this.parseExpr(); + default: + throw new Error('unexpected token "' + this.peek().type + '"'); + } + }, + + /** + * Text + */ + + parseText: function(){ + var tok = this.expect('text') + , node = new nodes.Text(tok.val); + node.line = this.line(); + return node; + }, + + /** + * ':' expr + * | block + */ + + parseBlockExpansion: function(){ + if (':' == this.peek().type) { + this.advance(); + return new nodes.Block(this.parseExpr()); + } else { + return this.block(); + } + }, + + /** + * case + */ + + parseCase: function(){ + var val = this.expect('case').val + , node = new nodes.Case(val); + node.line = this.line(); + node.block = this.block(); + return node; + }, + + /** + * when + */ + + parseWhen: function(){ + var val = this.expect('when').val + return new nodes.Case.When(val, this.parseBlockExpansion()); + }, + + /** + * default + */ + + parseDefault: function(){ + this.expect('default'); + return new nodes.Case.When('default', this.parseBlockExpansion()); + }, + + /** + * code + */ + + parseCode: function(){ + var tok = this.expect('code') + , node = new nodes.Code(tok.val, tok.buffer, tok.escape) + , block + , i = 1; + node.line = this.line(); + while (this.lookahead(i) && 'newline' == this.lookahead(i).type) ++i; + block = 'indent' == this.lookahead(i).type; + if (block) { + this.skip(i-1); + node.block = this.block(); + } + return node; + }, + + /** + * comment + */ + + parseComment: function(){ + var tok = this.expect('comment') + , node; + + if ('indent' == this.peek().type) { + node = new nodes.BlockComment(tok.val, this.block(), tok.buffer); + } else { + node = new nodes.Comment(tok.val, tok.buffer); + } + + node.line = this.line(); + return node; + }, + + /** + * doctype + */ + + parseDoctype: function(){ + var tok = this.expect('doctype') + , node = new nodes.Doctype(tok.val); + node.line = this.line(); + return node; + }, + + /** + * filter attrs? text-block + */ + + parseFilter: function(){ + var block + , tok = this.expect('filter') + , attrs = this.accept('attrs'); + + this.lexer.pipeless = true; + block = this.parseTextBlock(); + this.lexer.pipeless = false; + + var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs); + node.line = this.line(); + return node; + }, + + /** + * tag ':' attrs? block + */ + + parseASTFilter: function(){ + var block + , tok = this.expect('tag') + , attrs = this.accept('attrs'); + + this.expect(':'); + block = this.block(); + + var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs); + node.line = this.line(); + return node; + }, + + /** + * each block + */ + + parseEach: function(){ + var tok = this.expect('each') + , node = new nodes.Each(tok.code, tok.val, tok.key); + node.line = this.line(); + node.block = this.block(); + return node; + }, + + /** + * 'extends' name + */ + + parseExtends: function(){ + var path = require('path') + , fs = require('fs') + , dirname = path.dirname + , basename = path.basename + , join = path.join; + + if (!this.filename) + throw new Error('the "filename" option is required to extend templates'); + + var path = this.expect('extends').val.trim() + , dir = dirname(this.filename); + + var path = join(dir, path + '.jade') + , str = fs.readFileSync(path, 'utf8') + , parser = new Parser(str, path, this.options); + + parser.blocks = this.blocks; + parser.contexts = this.contexts; + this.extending = parser; + + // TODO: null node + return new nodes.Literal(''); + }, + + /** + * 'block' name block + */ + + parseBlock: function(){ + var block = this.expect('block') + , mode = block.mode + , name = block.val.trim(); + + block = 'indent' == this.peek().type + ? this.block() + : new nodes.Block(new nodes.Literal('')); + + var prev = this.blocks[name]; + + if (prev) { + switch (prev.mode) { + case 'append': + block.nodes = block.nodes.concat(prev.nodes); + prev = block; + break; + case 'prepend': + block.nodes = prev.nodes.concat(block.nodes); + prev = block; + break; + } + } + + block.mode = mode; + return this.blocks[name] = prev || block; + }, + + /** + * include block? + */ + + parseInclude: function(){ + var path = require('path') + , fs = require('fs') + , dirname = path.dirname + , basename = path.basename + , join = path.join; + + var path = this.expect('include').val.trim() + , dir = dirname(this.filename); + + if (!this.filename) + throw new Error('the "filename" option is required to use includes'); + + // no extension + if (!~basename(path).indexOf('.')) { + path += '.jade'; + } + + // non-jade + if ('.jade' != path.substr(-5)) { + var path = join(dir, path) + , str = fs.readFileSync(path, 'utf8'); + return new nodes.Literal(str); + } + + var path = join(dir, path) + , str = fs.readFileSync(path, 'utf8') + , parser = new Parser(str, path, this.options); + parser.blocks = this.blocks; + parser.mixins = this.mixins; + + this.context(parser); + var ast = parser.parse(); + this.context(); + ast.filename = path; + + if ('indent' == this.peek().type) { + ast.includeBlock().push(this.block()); + } + + return ast; + }, + + /** + * call ident block + */ + + parseCall: function(){ + var tok = this.expect('call') + , name = tok.val + , args = tok.args + , mixin = new nodes.Mixin(name, args, new nodes.Block, true); + + this.tag(mixin); + if (mixin.block.isEmpty()) mixin.block = null; + return mixin; + }, + + /** + * mixin block + */ + + parseMixin: function(){ + var tok = this.expect('mixin') + , name = tok.val + , args = tok.args + , mixin; + + // definition + if ('indent' == this.peek().type) { + mixin = new nodes.Mixin(name, args, this.block(), false); + this.mixins[name] = mixin; + return mixin; + // call + } else { + return new nodes.Mixin(name, args, null, true); + } + }, + + /** + * indent (text | newline)* outdent + */ + + parseTextBlock: function(){ + var block = new nodes.Block; + block.line = this.line(); + var spaces = this.expect('indent').val; + if (null == this._spaces) this._spaces = spaces; + var indent = Array(spaces - this._spaces + 1).join(' '); + while ('outdent' != this.peek().type) { + switch (this.peek().type) { + case 'newline': + this.advance(); + break; + case 'indent': + this.parseTextBlock().nodes.forEach(function(node){ + block.push(node); + }); + break; + default: + var text = new nodes.Text(indent + this.advance().val); + text.line = this.line(); + block.push(text); + } + } + + if (spaces == this._spaces) this._spaces = null; + this.expect('outdent'); + return block; + }, + + /** + * indent expr* outdent + */ + + block: function(){ + var block = new nodes.Block; + block.line = this.line(); + this.expect('indent'); + while ('outdent' != this.peek().type) { + if ('newline' == this.peek().type) { + this.advance(); + } else { + block.push(this.parseExpr()); + } + } + this.expect('outdent'); + return block; + }, + + /** + * interpolation (attrs | class | id)* (text | code | ':')? newline* block? + */ + + parseInterpolation: function(){ + var tok = this.advance(); + var tag = new nodes.Tag(tok.val); + tag.buffer = true; + return this.tag(tag); + }, + + /** + * tag (attrs | class | id)* (text | code | ':')? newline* block? + */ + + parseTag: function(){ + // ast-filter look-ahead + var i = 2; + if ('attrs' == this.lookahead(i).type) ++i; + if (':' == this.lookahead(i).type) { + if ('indent' == this.lookahead(++i).type) { + return this.parseASTFilter(); + } + } + + var tok = this.advance() + , tag = new nodes.Tag(tok.val); + + tag.selfClosing = tok.selfClosing; + + return this.tag(tag); + }, + + /** + * Parse tag. + */ + + tag: function(tag){ + var dot; + + tag.line = this.line(); + + // (attrs | class | id)* + out: + while (true) { + switch (this.peek().type) { + case 'id': + case 'class': + var tok = this.advance(); + tag.setAttribute(tok.type, "'" + tok.val + "'"); + continue; + case 'attrs': + var tok = this.advance() + , obj = tok.attrs + , escaped = tok.escaped + , names = Object.keys(obj); + + if (tok.selfClosing) tag.selfClosing = true; + + for (var i = 0, len = names.length; i < len; ++i) { + var name = names[i] + , val = obj[name]; + tag.setAttribute(name, val, escaped[name]); + } + continue; + default: + break out; + } + } + + // check immediate '.' + if ('.' == this.peek().val) { + dot = tag.textOnly = true; + this.advance(); + } + + // (text | code | ':')? + switch (this.peek().type) { + case 'text': + tag.block.push(this.parseText()); + break; + case 'code': + tag.code = this.parseCode(); + break; + case ':': + this.advance(); + tag.block = new nodes.Block; + tag.block.push(this.parseExpr()); + break; + } + + // newline* + while ('newline' == this.peek().type) this.advance(); + + tag.textOnly = tag.textOnly || ~textOnly.indexOf(tag.name); + + // script special-case + if ('script' == tag.name) { + var type = tag.getAttribute('type'); + if (!dot && type && 'text/javascript' != type.replace(/^['"]|['"]$/g, '')) { + tag.textOnly = false; + } + } + + // block? + if ('indent' == this.peek().type) { + if (tag.textOnly) { + this.lexer.pipeless = true; + tag.block = this.parseTextBlock(); + this.lexer.pipeless = false; + } else { + var block = this.block(); + if (tag.block) { + for (var i = 0, len = block.nodes.length; i < len; ++i) { + tag.block.push(block.nodes[i]); + } + } else { + tag.block = block; + } + } + } + + return tag; + } +}; diff --git a/node_modules/jade/lib/runtime.js b/node_modules/jade/lib/runtime.js new file mode 100644 index 0000000..fb711f5 --- /dev/null +++ b/node_modules/jade/lib/runtime.js @@ -0,0 +1,174 @@ + +/*! + * Jade - runtime + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Lame Array.isArray() polyfill for now. + */ + +if (!Array.isArray) { + Array.isArray = function(arr){ + return '[object Array]' == Object.prototype.toString.call(arr); + }; +} + +/** + * Lame Object.keys() polyfill for now. + */ + +if (!Object.keys) { + Object.keys = function(obj){ + var arr = []; + for (var key in obj) { + if (obj.hasOwnProperty(key)) { + arr.push(key); + } + } + return arr; + } +} + +/** + * Merge two attribute objects giving precedence + * to values in object `b`. Classes are special-cased + * allowing for arrays and merging/joining appropriately + * resulting in a string. + * + * @param {Object} a + * @param {Object} b + * @return {Object} a + * @api private + */ + +exports.merge = function merge(a, b) { + var ac = a['class']; + var bc = b['class']; + + if (ac || bc) { + ac = ac || []; + bc = bc || []; + if (!Array.isArray(ac)) ac = [ac]; + if (!Array.isArray(bc)) bc = [bc]; + ac = ac.filter(nulls); + bc = bc.filter(nulls); + a['class'] = ac.concat(bc).join(' '); + } + + for (var key in b) { + if (key != 'class') { + a[key] = b[key]; + } + } + + return a; +}; + +/** + * Filter null `val`s. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function nulls(val) { + return val != null; +} + +/** + * Render the given attributes object. + * + * @param {Object} obj + * @param {Object} escaped + * @return {String} + * @api private + */ + +exports.attrs = function attrs(obj, escaped){ + var buf = [] + , terse = obj.terse; + + delete obj.terse; + var keys = Object.keys(obj) + , len = keys.length; + + if (len) { + buf.push(''); + for (var i = 0; i < len; ++i) { + var key = keys[i] + , val = obj[key]; + + if ('boolean' == typeof val || null == val) { + if (val) { + terse + ? buf.push(key) + : buf.push(key + '="' + key + '"'); + } + } else if (0 == key.indexOf('data') && 'string' != typeof val) { + buf.push(key + "='" + JSON.stringify(val) + "'"); + } else if ('class' == key && Array.isArray(val)) { + buf.push(key + '="' + exports.escape(val.join(' ')) + '"'); + } else if (escaped && escaped[key]) { + buf.push(key + '="' + exports.escape(val) + '"'); + } else { + buf.push(key + '="' + val + '"'); + } + } + } + + return buf.join(' '); +}; + +/** + * Escape the given string of `html`. + * + * @param {String} html + * @return {String} + * @api private + */ + +exports.escape = function escape(html){ + return String(html) + .replace(/&(?!(\w+|\#\d+);)/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); +}; + +/** + * Re-throw the given `err` in context to the + * the jade in `filename` at the given `lineno`. + * + * @param {Error} err + * @param {String} filename + * @param {String} lineno + * @api private + */ + +exports.rethrow = function rethrow(err, filename, lineno){ + if (!filename) throw err; + + var context = 3 + , str = require('fs').readFileSync(filename, 'utf8') + , lines = str.split('\n') + , start = Math.max(lineno - context, 0) + , end = Math.min(lines.length, lineno + context); + + // Error context + var context = lines.slice(start, end).map(function(line, i){ + var curr = i + start + 1; + return (curr == lineno ? ' > ' : ' ') + + curr + + '| ' + + line; + }).join('\n'); + + // Alter exception message + err.path = filename; + err.message = (filename || 'Jade') + ':' + lineno + + '\n' + context + '\n\n' + err.message; + throw err; +}; diff --git a/node_modules/jade/lib/self-closing.js b/node_modules/jade/lib/self-closing.js new file mode 100644 index 0000000..0548771 --- /dev/null +++ b/node_modules/jade/lib/self-closing.js @@ -0,0 +1,19 @@ + +/*! + * Jade - self closing tags + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +module.exports = [ + 'meta' + , 'img' + , 'link' + , 'input' + , 'source' + , 'area' + , 'base' + , 'col' + , 'br' + , 'hr' +]; \ No newline at end of file diff --git a/node_modules/jade/lib/utils.js b/node_modules/jade/lib/utils.js new file mode 100644 index 0000000..ff46d02 --- /dev/null +++ b/node_modules/jade/lib/utils.js @@ -0,0 +1,49 @@ + +/*! + * Jade - utils + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Convert interpolation in the given string to JavaScript. + * + * @param {String} str + * @return {String} + * @api private + */ + +var interpolate = exports.interpolate = function(str){ + return str.replace(/(\\)?([#!]){(.*?)}/g, function(str, escape, flag, code){ + return escape + ? str + : "' + " + + ('!' == flag ? '' : 'escape') + + "((interp = " + code.replace(/\\'/g, "'") + + ") == null ? '' : interp) + '"; + }); +}; + +/** + * Escape single quotes in `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +var escape = exports.escape = function(str) { + return str.replace(/'/g, "\\'"); +}; + +/** + * Interpolate, and escape the given `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +exports.text = function(str){ + return interpolate(escape(str)); +}; \ No newline at end of file diff --git a/node_modules/jade/node_modules/commander/.npmignore b/node_modules/jade/node_modules/commander/.npmignore new file mode 100644 index 0000000..f1250e5 --- /dev/null +++ b/node_modules/jade/node_modules/commander/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/node_modules/jade/node_modules/commander/.travis.yml b/node_modules/jade/node_modules/commander/.travis.yml new file mode 100644 index 0000000..f1d0f13 --- /dev/null +++ b/node_modules/jade/node_modules/commander/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.4 + - 0.6 diff --git a/node_modules/jade/node_modules/commander/History.md b/node_modules/jade/node_modules/commander/History.md new file mode 100644 index 0000000..4961d2e --- /dev/null +++ b/node_modules/jade/node_modules/commander/History.md @@ -0,0 +1,107 @@ + +0.6.1 / 2012-06-01 +================== + + * Added: append (yes or no) on confirmation + * Added: allow node.js v0.7.x + +0.6.0 / 2012-04-10 +================== + + * Added `.prompt(obj, callback)` support. Closes #49 + * Added default support to .choose(). Closes #41 + * Fixed the choice example + +0.5.1 / 2011-12-20 +================== + + * Fixed `password()` for recent nodes. Closes #36 + +0.5.0 / 2011-12-04 +================== + + * Added sub-command option support [itay] + +0.4.3 / 2011-12-04 +================== + + * Fixed custom help ordering. Closes #32 + +0.4.2 / 2011-11-24 +================== + + * Added travis support + * Fixed: line-buffered input automatically trimmed. Closes #31 + +0.4.1 / 2011-11-18 +================== + + * Removed listening for "close" on --help + +0.4.0 / 2011-11-15 +================== + + * Added support for `--`. Closes #24 + +0.3.3 / 2011-11-14 +================== + + * Fixed: wait for close event when writing help info [Jerry Hamlet] + +0.3.2 / 2011-11-01 +================== + + * Fixed long flag definitions with values [felixge] + +0.3.1 / 2011-10-31 +================== + + * Changed `--version` short flag to `-V` from `-v` + * Changed `.version()` so it's configurable [felixge] + +0.3.0 / 2011-10-31 +================== + + * Added support for long flags only. Closes #18 + +0.2.1 / 2011-10-24 +================== + + * "node": ">= 0.4.x < 0.7.0". Closes #20 + +0.2.0 / 2011-09-26 +================== + + * Allow for defaults that are not just boolean. Default peassignment only occurs for --no-*, optional, and required arguments. [Jim Isaacs] + +0.1.0 / 2011-08-24 +================== + + * Added support for custom `--help` output + +0.0.5 / 2011-08-18 +================== + + * Changed: when the user enters nothing prompt for password again + * Fixed issue with passwords beginning with numbers [NuckChorris] + +0.0.4 / 2011-08-15 +================== + + * Fixed `Commander#args` + +0.0.3 / 2011-08-15 +================== + + * Added default option value support + +0.0.2 / 2011-08-15 +================== + + * Added mask support to `Command#password(str[, mask], fn)` + * Added `Command#password(str, fn)` + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/jade/node_modules/commander/Makefile b/node_modules/jade/node_modules/commander/Makefile new file mode 100644 index 0000000..0074625 --- /dev/null +++ b/node_modules/jade/node_modules/commander/Makefile @@ -0,0 +1,7 @@ + +TESTS = $(shell find test/test.*.js) + +test: + @./test/run $(TESTS) + +.PHONY: test \ No newline at end of file diff --git a/node_modules/jade/node_modules/commander/Readme.md b/node_modules/jade/node_modules/commander/Readme.md new file mode 100644 index 0000000..b8328c3 --- /dev/null +++ b/node_modules/jade/node_modules/commander/Readme.md @@ -0,0 +1,262 @@ +# Commander.js + + The complete solution for [node.js](http://nodejs.org) command-line interfaces, inspired by Ruby's [commander](https://github.com/visionmedia/commander). + + [![Build Status](https://secure.travis-ci.org/visionmedia/commander.js.png)](http://travis-ci.org/visionmedia/commander.js) + +## Installation + + $ npm install commander + +## Option parsing + + Options with commander are defined with the `.option()` method, also serving as documentation for the options. The example below parses args and options from `process.argv`, leaving remaining args as the `program.args` array which were not consumed by options. + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('commander'); + +program + .version('0.0.1') + .option('-p, --peppers', 'Add peppers') + .option('-P, --pineapple', 'Add pineapple') + .option('-b, --bbq', 'Add bbq sauce') + .option('-c, --cheese [type]', 'Add the specified type of cheese [marble]', 'marble') + .parse(process.argv); + +console.log('you ordered a pizza with:'); +if (program.peppers) console.log(' - peppers'); +if (program.pineapple) console.log(' - pineappe'); +if (program.bbq) console.log(' - bbq'); +console.log(' - %s cheese', program.cheese); +``` + + Short flags may be passed as a single arg, for example `-abc` is equivalent to `-a -b -c`. Multi-word options such as "--template-engine" are camel-cased, becoming `program.templateEngine` etc. + +## Automated --help + + The help information is auto-generated based on the information commander already knows about your program, so the following `--help` info is for free: + +``` + $ ./examples/pizza --help + + Usage: pizza [options] + + Options: + + -V, --version output the version number + -p, --peppers Add peppers + -P, --pineapple Add pineappe + -b, --bbq Add bbq sauce + -c, --cheese Add the specified type of cheese [marble] + -h, --help output usage information + +``` + +## Coercion + +```js +function range(val) { + return val.split('..').map(Number); +} + +function list(val) { + return val.split(','); +} + +program + .version('0.0.1') + .usage('[options] ') + .option('-i, --integer ', 'An integer argument', parseInt) + .option('-f, --float ', 'A float argument', parseFloat) + .option('-r, --range ..', 'A range', range) + .option('-l, --list ', 'A list', list) + .option('-o, --optional [value]', 'An optional value') + .parse(process.argv); + +console.log(' int: %j', program.integer); +console.log(' float: %j', program.float); +console.log(' optional: %j', program.optional); +program.range = program.range || []; +console.log(' range: %j..%j', program.range[0], program.range[1]); +console.log(' list: %j', program.list); +console.log(' args: %j', program.args); +``` + +## Custom help + + You can display arbitrary `-h, --help` information + by listening for "--help". Commander will automatically + exit once you are done so that the remainder of your program + does not execute causing undesired behaviours, for example + in the following executable "stuff" will not output when + `--help` is used. + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('../'); + +function list(val) { + return val.split(',').map(Number); +} + +program + .version('0.0.1') + .option('-f, --foo', 'enable some foo') + .option('-b, --bar', 'enable some bar') + .option('-B, --baz', 'enable some baz'); + +// must be before .parse() since +// node's emit() is immediate + +program.on('--help', function(){ + console.log(' Examples:'); + console.log(''); + console.log(' $ custom-help --help'); + console.log(' $ custom-help -h'); + console.log(''); +}); + +program.parse(process.argv); + +console.log('stuff'); +``` + +yielding the following help output: + +``` + +Usage: custom-help [options] + +Options: + + -h, --help output usage information + -V, --version output the version number + -f, --foo enable some foo + -b, --bar enable some bar + -B, --baz enable some baz + +Examples: + + $ custom-help --help + $ custom-help -h + +``` + +## .prompt(msg, fn) + + Single-line prompt: + +```js +program.prompt('name: ', function(name){ + console.log('hi %s', name); +}); +``` + + Multi-line prompt: + +```js +program.prompt('description:', function(name){ + console.log('hi %s', name); +}); +``` + + Coercion: + +```js +program.prompt('Age: ', Number, function(age){ + console.log('age: %j', age); +}); +``` + +```js +program.prompt('Birthdate: ', Date, function(date){ + console.log('date: %s', date); +}); +``` + +## .password(msg[, mask], fn) + +Prompt for password without echoing: + +```js +program.password('Password: ', function(pass){ + console.log('got "%s"', pass); + process.stdin.destroy(); +}); +``` + +Prompt for password with mask char "*": + +```js +program.password('Password: ', '*', function(pass){ + console.log('got "%s"', pass); + process.stdin.destroy(); +}); +``` + +## .confirm(msg, fn) + + Confirm with the given `msg`: + +```js +program.confirm('continue? ', function(ok){ + console.log(' got %j', ok); +}); +``` + +## .choose(list, fn) + + Let the user choose from a `list`: + +```js +var list = ['tobi', 'loki', 'jane', 'manny', 'luna']; + +console.log('Choose the coolest pet:'); +program.choose(list, function(i){ + console.log('you chose %d "%s"', i, list[i]); +}); +``` + +## Links + + - [API documentation](http://visionmedia.github.com/commander.js/) + - [ascii tables](https://github.com/LearnBoost/cli-table) + - [progress bars](https://github.com/visionmedia/node-progress) + - [more progress bars](https://github.com/substack/node-multimeter) + - [examples](https://github.com/visionmedia/commander.js/tree/master/examples) + +## License + +(The MIT License) + +Copyright (c) 2011 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/jade/node_modules/commander/index.js b/node_modules/jade/node_modules/commander/index.js new file mode 100644 index 0000000..06ec1e4 --- /dev/null +++ b/node_modules/jade/node_modules/commander/index.js @@ -0,0 +1,2 @@ + +module.exports = require('./lib/commander'); \ No newline at end of file diff --git a/node_modules/jade/node_modules/commander/lib/commander.js b/node_modules/jade/node_modules/commander/lib/commander.js new file mode 100644 index 0000000..5ba87eb --- /dev/null +++ b/node_modules/jade/node_modules/commander/lib/commander.js @@ -0,0 +1,1026 @@ + +/*! + * commander + * Copyright(c) 2011 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var EventEmitter = require('events').EventEmitter + , path = require('path') + , tty = require('tty') + , basename = path.basename; + +/** + * Expose the root command. + */ + +exports = module.exports = new Command; + +/** + * Expose `Command`. + */ + +exports.Command = Command; + +/** + * Expose `Option`. + */ + +exports.Option = Option; + +/** + * Initialize a new `Option` with the given `flags` and `description`. + * + * @param {String} flags + * @param {String} description + * @api public + */ + +function Option(flags, description) { + this.flags = flags; + this.required = ~flags.indexOf('<'); + this.optional = ~flags.indexOf('['); + this.bool = !~flags.indexOf('-no-'); + flags = flags.split(/[ ,|]+/); + if (flags.length > 1 && !/^[[<]/.test(flags[1])) this.short = flags.shift(); + this.long = flags.shift(); + this.description = description; +} + +/** + * Return option name. + * + * @return {String} + * @api private + */ + +Option.prototype.name = function(){ + return this.long + .replace('--', '') + .replace('no-', ''); +}; + +/** + * Check if `arg` matches the short or long flag. + * + * @param {String} arg + * @return {Boolean} + * @api private + */ + +Option.prototype.is = function(arg){ + return arg == this.short + || arg == this.long; +}; + +/** + * Initialize a new `Command`. + * + * @param {String} name + * @api public + */ + +function Command(name) { + this.commands = []; + this.options = []; + this.args = []; + this.name = name; +} + +/** + * Inherit from `EventEmitter.prototype`. + */ + +Command.prototype.__proto__ = EventEmitter.prototype; + +/** + * Add command `name`. + * + * The `.action()` callback is invoked when the + * command `name` is specified via __ARGV__, + * and the remaining arguments are applied to the + * function for access. + * + * When the `name` is "*" an un-matched command + * will be passed as the first arg, followed by + * the rest of __ARGV__ remaining. + * + * Examples: + * + * program + * .version('0.0.1') + * .option('-C, --chdir ', 'change the working directory') + * .option('-c, --config ', 'set config path. defaults to ./deploy.conf') + * .option('-T, --no-tests', 'ignore test hook') + * + * program + * .command('setup') + * .description('run remote setup commands') + * .action(function(){ + * console.log('setup'); + * }); + * + * program + * .command('exec ') + * .description('run the given remote command') + * .action(function(cmd){ + * console.log('exec "%s"', cmd); + * }); + * + * program + * .command('*') + * .description('deploy the given env') + * .action(function(env){ + * console.log('deploying "%s"', env); + * }); + * + * program.parse(process.argv); + * + * @param {String} name + * @return {Command} the new command + * @api public + */ + +Command.prototype.command = function(name){ + var args = name.split(/ +/); + var cmd = new Command(args.shift()); + this.commands.push(cmd); + cmd.parseExpectedArgs(args); + cmd.parent = this; + return cmd; +}; + +/** + * Parse expected `args`. + * + * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`. + * + * @param {Array} args + * @return {Command} for chaining + * @api public + */ + +Command.prototype.parseExpectedArgs = function(args){ + if (!args.length) return; + var self = this; + args.forEach(function(arg){ + switch (arg[0]) { + case '<': + self.args.push({ required: true, name: arg.slice(1, -1) }); + break; + case '[': + self.args.push({ required: false, name: arg.slice(1, -1) }); + break; + } + }); + return this; +}; + +/** + * Register callback `fn` for the command. + * + * Examples: + * + * program + * .command('help') + * .description('display verbose help') + * .action(function(){ + * // output help here + * }); + * + * @param {Function} fn + * @return {Command} for chaining + * @api public + */ + +Command.prototype.action = function(fn){ + var self = this; + this.parent.on(this.name, function(args, unknown){ + // Parse any so-far unknown options + unknown = unknown || []; + var parsed = self.parseOptions(unknown); + + // Output help if necessary + outputHelpIfNecessary(self, parsed.unknown); + + // If there are still any unknown options, then we simply + // die, unless someone asked for help, in which case we give it + // to them, and then we die. + if (parsed.unknown.length > 0) { + self.unknownOption(parsed.unknown[0]); + } + + self.args.forEach(function(arg, i){ + if (arg.required && null == args[i]) { + self.missingArgument(arg.name); + } + }); + + // Always append ourselves to the end of the arguments, + // to make sure we match the number of arguments the user + // expects + if (self.args.length) { + args[self.args.length] = self; + } else { + args.push(self); + } + + fn.apply(this, args); + }); + return this; +}; + +/** + * Define option with `flags`, `description` and optional + * coercion `fn`. + * + * The `flags` string should contain both the short and long flags, + * separated by comma, a pipe or space. The following are all valid + * all will output this way when `--help` is used. + * + * "-p, --pepper" + * "-p|--pepper" + * "-p --pepper" + * + * Examples: + * + * // simple boolean defaulting to false + * program.option('-p, --pepper', 'add pepper'); + * + * --pepper + * program.pepper + * // => Boolean + * + * // simple boolean defaulting to false + * program.option('-C, --no-cheese', 'remove cheese'); + * + * program.cheese + * // => true + * + * --no-cheese + * program.cheese + * // => true + * + * // required argument + * program.option('-C, --chdir ', 'change the working directory'); + * + * --chdir /tmp + * program.chdir + * // => "/tmp" + * + * // optional argument + * program.option('-c, --cheese [type]', 'add cheese [marble]'); + * + * @param {String} flags + * @param {String} description + * @param {Function|Mixed} fn or default + * @param {Mixed} defaultValue + * @return {Command} for chaining + * @api public + */ + +Command.prototype.option = function(flags, description, fn, defaultValue){ + var self = this + , option = new Option(flags, description) + , oname = option.name() + , name = camelcase(oname); + + // default as 3rd arg + if ('function' != typeof fn) defaultValue = fn, fn = null; + + // preassign default value only for --no-*, [optional], or + if (false == option.bool || option.optional || option.required) { + // when --no-* we make sure default is true + if (false == option.bool) defaultValue = true; + // preassign only if we have a default + if (undefined !== defaultValue) self[name] = defaultValue; + } + + // register the option + this.options.push(option); + + // when it's passed assign the value + // and conditionally invoke the callback + this.on(oname, function(val){ + // coercion + if (null != val && fn) val = fn(val); + + // unassigned or bool + if ('boolean' == typeof self[name] || 'undefined' == typeof self[name]) { + // if no value, bool true, and we have a default, then use it! + if (null == val) { + self[name] = option.bool + ? defaultValue || true + : false; + } else { + self[name] = val; + } + } else if (null !== val) { + // reassign + self[name] = val; + } + }); + + return this; +}; + +/** + * Parse `argv`, settings options and invoking commands when defined. + * + * @param {Array} argv + * @return {Command} for chaining + * @api public + */ + +Command.prototype.parse = function(argv){ + // store raw args + this.rawArgs = argv; + + // guess name + if (!this.name) this.name = basename(argv[1]); + + // process argv + var parsed = this.parseOptions(this.normalize(argv.slice(2))); + this.args = parsed.args; + return this.parseArgs(this.args, parsed.unknown); +}; + +/** + * Normalize `args`, splitting joined short flags. For example + * the arg "-abc" is equivalent to "-a -b -c". + * + * @param {Array} args + * @return {Array} + * @api private + */ + +Command.prototype.normalize = function(args){ + var ret = [] + , arg; + + for (var i = 0, len = args.length; i < len; ++i) { + arg = args[i]; + if (arg.length > 1 && '-' == arg[0] && '-' != arg[1]) { + arg.slice(1).split('').forEach(function(c){ + ret.push('-' + c); + }); + } else { + ret.push(arg); + } + } + + return ret; +}; + +/** + * Parse command `args`. + * + * When listener(s) are available those + * callbacks are invoked, otherwise the "*" + * event is emitted and those actions are invoked. + * + * @param {Array} args + * @return {Command} for chaining + * @api private + */ + +Command.prototype.parseArgs = function(args, unknown){ + var cmds = this.commands + , len = cmds.length + , name; + + if (args.length) { + name = args[0]; + if (this.listeners(name).length) { + this.emit(args.shift(), args, unknown); + } else { + this.emit('*', args); + } + } else { + outputHelpIfNecessary(this, unknown); + + // If there were no args and we have unknown options, + // then they are extraneous and we need to error. + if (unknown.length > 0) { + this.unknownOption(unknown[0]); + } + } + + return this; +}; + +/** + * Return an option matching `arg` if any. + * + * @param {String} arg + * @return {Option} + * @api private + */ + +Command.prototype.optionFor = function(arg){ + for (var i = 0, len = this.options.length; i < len; ++i) { + if (this.options[i].is(arg)) { + return this.options[i]; + } + } +}; + +/** + * Parse options from `argv` returning `argv` + * void of these options. + * + * @param {Array} argv + * @return {Array} + * @api public + */ + +Command.prototype.parseOptions = function(argv){ + var args = [] + , len = argv.length + , literal + , option + , arg; + + var unknownOptions = []; + + // parse options + for (var i = 0; i < len; ++i) { + arg = argv[i]; + + // literal args after -- + if ('--' == arg) { + literal = true; + continue; + } + + if (literal) { + args.push(arg); + continue; + } + + // find matching Option + option = this.optionFor(arg); + + // option is defined + if (option) { + // requires arg + if (option.required) { + arg = argv[++i]; + if (null == arg) return this.optionMissingArgument(option); + if ('-' == arg[0]) return this.optionMissingArgument(option, arg); + this.emit(option.name(), arg); + // optional arg + } else if (option.optional) { + arg = argv[i+1]; + if (null == arg || '-' == arg[0]) { + arg = null; + } else { + ++i; + } + this.emit(option.name(), arg); + // bool + } else { + this.emit(option.name()); + } + continue; + } + + // looks like an option + if (arg.length > 1 && '-' == arg[0]) { + unknownOptions.push(arg); + + // If the next argument looks like it might be + // an argument for this option, we pass it on. + // If it isn't, then it'll simply be ignored + if (argv[i+1] && '-' != argv[i+1][0]) { + unknownOptions.push(argv[++i]); + } + continue; + } + + // arg + args.push(arg); + } + + return { args: args, unknown: unknownOptions }; +}; + +/** + * Argument `name` is missing. + * + * @param {String} name + * @api private + */ + +Command.prototype.missingArgument = function(name){ + console.error(); + console.error(" error: missing required argument `%s'", name); + console.error(); + process.exit(1); +}; + +/** + * `Option` is missing an argument, but received `flag` or nothing. + * + * @param {String} option + * @param {String} flag + * @api private + */ + +Command.prototype.optionMissingArgument = function(option, flag){ + console.error(); + if (flag) { + console.error(" error: option `%s' argument missing, got `%s'", option.flags, flag); + } else { + console.error(" error: option `%s' argument missing", option.flags); + } + console.error(); + process.exit(1); +}; + +/** + * Unknown option `flag`. + * + * @param {String} flag + * @api private + */ + +Command.prototype.unknownOption = function(flag){ + console.error(); + console.error(" error: unknown option `%s'", flag); + console.error(); + process.exit(1); +}; + +/** + * Set the program version to `str`. + * + * This method auto-registers the "-V, --version" flag + * which will print the version number when passed. + * + * @param {String} str + * @param {String} flags + * @return {Command} for chaining + * @api public + */ + +Command.prototype.version = function(str, flags){ + if (0 == arguments.length) return this._version; + this._version = str; + flags = flags || '-V, --version'; + this.option(flags, 'output the version number'); + this.on('version', function(){ + console.log(str); + process.exit(0); + }); + return this; +}; + +/** + * Set the description `str`. + * + * @param {String} str + * @return {String|Command} + * @api public + */ + +Command.prototype.description = function(str){ + if (0 == arguments.length) return this._description; + this._description = str; + return this; +}; + +/** + * Set / get the command usage `str`. + * + * @param {String} str + * @return {String|Command} + * @api public + */ + +Command.prototype.usage = function(str){ + var args = this.args.map(function(arg){ + return arg.required + ? '<' + arg.name + '>' + : '[' + arg.name + ']'; + }); + + var usage = '[options' + + (this.commands.length ? '] [command' : '') + + ']' + + (this.args.length ? ' ' + args : ''); + if (0 == arguments.length) return this._usage || usage; + this._usage = str; + + return this; +}; + +/** + * Return the largest option length. + * + * @return {Number} + * @api private + */ + +Command.prototype.largestOptionLength = function(){ + return this.options.reduce(function(max, option){ + return Math.max(max, option.flags.length); + }, 0); +}; + +/** + * Return help for options. + * + * @return {String} + * @api private + */ + +Command.prototype.optionHelp = function(){ + var width = this.largestOptionLength(); + + // Prepend the help information + return [pad('-h, --help', width) + ' ' + 'output usage information'] + .concat(this.options.map(function(option){ + return pad(option.flags, width) + + ' ' + option.description; + })) + .join('\n'); +}; + +/** + * Return command help documentation. + * + * @return {String} + * @api private + */ + +Command.prototype.commandHelp = function(){ + if (!this.commands.length) return ''; + return [ + '' + , ' Commands:' + , '' + , this.commands.map(function(cmd){ + var args = cmd.args.map(function(arg){ + return arg.required + ? '<' + arg.name + '>' + : '[' + arg.name + ']'; + }).join(' '); + + return cmd.name + + (cmd.options.length + ? ' [options]' + : '') + ' ' + args + + (cmd.description() + ? '\n' + cmd.description() + : ''); + }).join('\n\n').replace(/^/gm, ' ') + , '' + ].join('\n'); +}; + +/** + * Return program help documentation. + * + * @return {String} + * @api private + */ + +Command.prototype.helpInformation = function(){ + return [ + '' + , ' Usage: ' + this.name + ' ' + this.usage() + , '' + this.commandHelp() + , ' Options:' + , '' + , '' + this.optionHelp().replace(/^/gm, ' ') + , '' + , '' + ].join('\n'); +}; + +/** + * Prompt for a `Number`. + * + * @param {String} str + * @param {Function} fn + * @api private + */ + +Command.prototype.promptForNumber = function(str, fn){ + var self = this; + this.promptSingleLine(str, function parseNumber(val){ + val = Number(val); + if (isNaN(val)) return self.promptSingleLine(str + '(must be a number) ', parseNumber); + fn(val); + }); +}; + +/** + * Prompt for a `Date`. + * + * @param {String} str + * @param {Function} fn + * @api private + */ + +Command.prototype.promptForDate = function(str, fn){ + var self = this; + this.promptSingleLine(str, function parseDate(val){ + val = new Date(val); + if (isNaN(val.getTime())) return self.promptSingleLine(str + '(must be a date) ', parseDate); + fn(val); + }); +}; + +/** + * Single-line prompt. + * + * @param {String} str + * @param {Function} fn + * @api private + */ + +Command.prototype.promptSingleLine = function(str, fn){ + if ('function' == typeof arguments[2]) { + return this['promptFor' + (fn.name || fn)](str, arguments[2]); + } + + process.stdout.write(str); + process.stdin.setEncoding('utf8'); + process.stdin.once('data', function(val){ + fn(val.trim()); + }).resume(); +}; + +/** + * Multi-line prompt. + * + * @param {String} str + * @param {Function} fn + * @api private + */ + +Command.prototype.promptMultiLine = function(str, fn){ + var buf = []; + console.log(str); + process.stdin.setEncoding('utf8'); + process.stdin.on('data', function(val){ + if ('\n' == val || '\r\n' == val) { + process.stdin.removeAllListeners('data'); + fn(buf.join('\n')); + } else { + buf.push(val.trimRight()); + } + }).resume(); +}; + +/** + * Prompt `str` and callback `fn(val)` + * + * Commander supports single-line and multi-line prompts. + * To issue a single-line prompt simply add white-space + * to the end of `str`, something like "name: ", whereas + * for a multi-line prompt omit this "description:". + * + * + * Examples: + * + * program.prompt('Username: ', function(name){ + * console.log('hi %s', name); + * }); + * + * program.prompt('Description:', function(desc){ + * console.log('description was "%s"', desc.trim()); + * }); + * + * @param {String|Object} str + * @param {Function} fn + * @api public + */ + +Command.prototype.prompt = function(str, fn){ + var self = this; + + if ('string' == typeof str) { + if (/ $/.test(str)) return this.promptSingleLine.apply(this, arguments); + this.promptMultiLine(str, fn); + } else { + var keys = Object.keys(str) + , obj = {}; + + function next() { + var key = keys.shift() + , label = str[key]; + + if (!key) return fn(obj); + self.prompt(label, function(val){ + obj[key] = val; + next(); + }); + } + + next(); + } +}; + +/** + * Prompt for password with `str`, `mask` char and callback `fn(val)`. + * + * The mask string defaults to '', aka no output is + * written while typing, you may want to use "*" etc. + * + * Examples: + * + * program.password('Password: ', function(pass){ + * console.log('got "%s"', pass); + * process.stdin.destroy(); + * }); + * + * program.password('Password: ', '*', function(pass){ + * console.log('got "%s"', pass); + * process.stdin.destroy(); + * }); + * + * @param {String} str + * @param {String} mask + * @param {Function} fn + * @api public + */ + +Command.prototype.password = function(str, mask, fn){ + var self = this + , buf = ''; + + // default mask + if ('function' == typeof mask) { + fn = mask; + mask = ''; + } + + process.stdin.resume(); + tty.setRawMode(true); + process.stdout.write(str); + + // keypress + process.stdin.on('keypress', function(c, key){ + if (key && 'enter' == key.name) { + console.log(); + process.stdin.removeAllListeners('keypress'); + tty.setRawMode(false); + if (!buf.trim().length) return self.password(str, mask, fn); + fn(buf); + return; + } + + if (key && key.ctrl && 'c' == key.name) { + console.log('%s', buf); + process.exit(); + } + + process.stdout.write(mask); + buf += c; + }).resume(); +}; + +/** + * Confirmation prompt with `str` and callback `fn(bool)` + * + * Examples: + * + * program.confirm('continue? ', function(ok){ + * console.log(' got %j', ok); + * process.stdin.destroy(); + * }); + * + * @param {String} str + * @param {Function} fn + * @api public + */ + + +Command.prototype.confirm = function(str, fn, verbose){ + var self = this; + this.prompt(str, function(ok){ + if (!ok.trim()) { + if (!verbose) str += '(yes or no) '; + return self.confirm(str, fn, true); + } + fn(parseBool(ok)); + }); +}; + +/** + * Choice prompt with `list` of items and callback `fn(index, item)` + * + * Examples: + * + * var list = ['tobi', 'loki', 'jane', 'manny', 'luna']; + * + * console.log('Choose the coolest pet:'); + * program.choose(list, function(i){ + * console.log('you chose %d "%s"', i, list[i]); + * process.stdin.destroy(); + * }); + * + * @param {Array} list + * @param {Number|Function} index or fn + * @param {Function} fn + * @api public + */ + +Command.prototype.choose = function(list, index, fn){ + var self = this + , hasDefault = 'number' == typeof index; + + if (!hasDefault) { + fn = index; + index = null; + } + + list.forEach(function(item, i){ + if (hasDefault && i == index) { + console.log('* %d) %s', i + 1, item); + } else { + console.log(' %d) %s', i + 1, item); + } + }); + + function again() { + self.prompt(' : ', function(val){ + val = parseInt(val, 10) - 1; + if (hasDefault && isNaN(val)) val = index; + + if (null == list[val]) { + again(); + } else { + fn(val, list[val]); + } + }); + } + + again(); +}; + +/** + * Camel-case the given `flag` + * + * @param {String} flag + * @return {String} + * @api private + */ + +function camelcase(flag) { + return flag.split('-').reduce(function(str, word){ + return str + word[0].toUpperCase() + word.slice(1); + }); +} + +/** + * Parse a boolean `str`. + * + * @param {String} str + * @return {Boolean} + * @api private + */ + +function parseBool(str) { + return /^y|yes|ok|true$/i.test(str); +} + +/** + * Pad `str` to `width`. + * + * @param {String} str + * @param {Number} width + * @return {String} + * @api private + */ + +function pad(str, width) { + var len = Math.max(0, width - str.length); + return str + Array(len + 1).join(' '); +} + +/** + * Output help information if necessary + * + * @param {Command} command to output help for + * @param {Array} array of options to search for -h or --help + * @api private + */ + +function outputHelpIfNecessary(cmd, options) { + options = options || []; + for (var i = 0; i < options.length; i++) { + if (options[i] == '--help' || options[i] == '-h') { + process.stdout.write(cmd.helpInformation()); + cmd.emit('--help'); + process.exit(0); + } + } +} diff --git a/node_modules/jade/node_modules/commander/package.json b/node_modules/jade/node_modules/commander/package.json new file mode 100644 index 0000000..7161a8b --- /dev/null +++ b/node_modules/jade/node_modules/commander/package.json @@ -0,0 +1,13 @@ +{ + "name": "commander" + , "version": "0.6.1" + , "description": "the complete solution for node.js command-line programs" + , "keywords": ["command", "option", "parser", "prompt", "stdin"] + , "author": "TJ Holowaychuk " + , "repository": { "type": "git", "url": "https://github.com/visionmedia/commander.js.git" } + , "dependencies": {} + , "devDependencies": { "should": ">= 0.0.1" } + , "scripts": { "test": "make test" } + , "main": "index" + , "engines": { "node": ">= 0.4.x" } +} \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/.gitignore b/node_modules/jade/node_modules/mkdirp/.gitignore new file mode 100644 index 0000000..9303c34 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/.gitignore @@ -0,0 +1,2 @@ +node_modules/ +npm-debug.log \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/.gitignore.orig b/node_modules/jade/node_modules/mkdirp/.gitignore.orig new file mode 100644 index 0000000..9303c34 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/.gitignore.orig @@ -0,0 +1,2 @@ +node_modules/ +npm-debug.log \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/.gitignore.rej b/node_modules/jade/node_modules/mkdirp/.gitignore.rej new file mode 100644 index 0000000..69244ff --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/.gitignore.rej @@ -0,0 +1,5 @@ +--- /dev/null ++++ .gitignore +@@ -0,0 +1,2 @@ ++node_modules/ ++npm-debug.log \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/LICENSE b/node_modules/jade/node_modules/mkdirp/LICENSE new file mode 100644 index 0000000..432d1ae --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/LICENSE @@ -0,0 +1,21 @@ +Copyright 2010 James Halliday (mail@substack.net) + +This project is free software released under the MIT/X11 license: + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/jade/node_modules/mkdirp/README.markdown b/node_modules/jade/node_modules/mkdirp/README.markdown new file mode 100644 index 0000000..b4dd75f --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/README.markdown @@ -0,0 +1,54 @@ +mkdirp +====== + +Like `mkdir -p`, but in node.js! + +example +======= + +pow.js +------ + var mkdirp = require('mkdirp'); + + mkdirp('/tmp/foo/bar/baz', function (err) { + if (err) console.error(err) + else console.log('pow!') + }); + +Output + pow! + +And now /tmp/foo/bar/baz exists, huzzah! + +methods +======= + +var mkdirp = require('mkdirp'); + +mkdirp(dir, mode, cb) +--------------------- + +Create a new directory and any necessary subdirectories at `dir` with octal +permission string `mode`. + +If `mode` isn't specified, it defaults to `0777 & (~process.umask())`. + +mkdirp.sync(dir, mode) +---------------------- + +Synchronously create a new directory and any necessary subdirectories at `dir` +with octal permission string `mode`. + +If `mode` isn't specified, it defaults to `0777 & (~process.umask())`. + +install +======= + +With [npm](http://npmjs.org) do: + + npm install mkdirp + +license +======= + +MIT/X11 diff --git a/node_modules/jade/node_modules/mkdirp/examples/pow.js b/node_modules/jade/node_modules/mkdirp/examples/pow.js new file mode 100644 index 0000000..e692421 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/examples/pow.js @@ -0,0 +1,6 @@ +var mkdirp = require('mkdirp'); + +mkdirp('/tmp/foo/bar/baz', function (err) { + if (err) console.error(err) + else console.log('pow!') +}); diff --git a/node_modules/jade/node_modules/mkdirp/examples/pow.js.orig b/node_modules/jade/node_modules/mkdirp/examples/pow.js.orig new file mode 100644 index 0000000..7741462 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/examples/pow.js.orig @@ -0,0 +1,6 @@ +var mkdirp = require('mkdirp'); + +mkdirp('/tmp/foo/bar/baz', 0755, function (err) { + if (err) console.error(err) + else console.log('pow!') +}); diff --git a/node_modules/jade/node_modules/mkdirp/examples/pow.js.rej b/node_modules/jade/node_modules/mkdirp/examples/pow.js.rej new file mode 100644 index 0000000..81e7f43 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/examples/pow.js.rej @@ -0,0 +1,19 @@ +--- examples/pow.js ++++ examples/pow.js +@@ -1,6 +1,15 @@ +-var mkdirp = require('mkdirp').mkdirp; ++var mkdirp = require('../').mkdirp, ++ mkdirpSync = require('../').mkdirpSync; + + mkdirp('/tmp/foo/bar/baz', 0755, function (err) { + if (err) console.error(err) + else console.log('pow!') + }); ++ ++try { ++ mkdirpSync('/tmp/bar/foo/baz', 0755); ++ console.log('double pow!'); ++} ++catch (ex) { ++ console.log(ex); ++} \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/index.js b/node_modules/jade/node_modules/mkdirp/index.js new file mode 100644 index 0000000..25f43ad --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/index.js @@ -0,0 +1,79 @@ +var path = require('path'); +var fs = require('fs'); + +module.exports = mkdirP.mkdirp = mkdirP.mkdirP = mkdirP; + +function mkdirP (p, mode, f) { + if (typeof mode === 'function' || mode === undefined) { + f = mode; + mode = 0777 & (~process.umask()); + } + + var cb = f || function () {}; + if (typeof mode === 'string') mode = parseInt(mode, 8); + p = path.resolve(p); + + fs.mkdir(p, mode, function (er) { + if (!er) return cb(); + switch (er.code) { + case 'ENOENT': + mkdirP(path.dirname(p), mode, function (er) { + if (er) cb(er); + else mkdirP(p, mode, cb); + }); + break; + + case 'EEXIST': + fs.stat(p, function (er2, stat) { + // if the stat fails, then that's super weird. + // let the original EEXIST be the failure reason. + if (er2 || !stat.isDirectory()) cb(er) + else cb(); + }); + break; + + default: + cb(er); + break; + } + }); +} + +mkdirP.sync = function sync (p, mode) { + if (mode === undefined) { + mode = 0777 & (~process.umask()); + } + + if (typeof mode === 'string') mode = parseInt(mode, 8); + p = path.resolve(p); + + try { + fs.mkdirSync(p, mode) + } + catch (err0) { + switch (err0.code) { + case 'ENOENT' : + var err1 = sync(path.dirname(p), mode) + if (err1) throw err1; + else return sync(p, mode); + break; + + case 'EEXIST' : + var stat; + try { + stat = fs.statSync(p); + } + catch (err1) { + throw err0 + } + if (!stat.isDirectory()) throw err0; + else return null; + break; + default : + throw err0 + break; + } + } + + return null; +}; diff --git a/node_modules/jade/node_modules/mkdirp/package.json b/node_modules/jade/node_modules/mkdirp/package.json new file mode 100644 index 0000000..1bf9ac7 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/package.json @@ -0,0 +1,23 @@ +{ + "name" : "mkdirp", + "description" : "Recursively mkdir, like `mkdir -p`", + "version" : "0.3.0", + "author" : "James Halliday (http://substack.net)", + "main" : "./index", + "keywords" : [ + "mkdir", + "directory" + ], + "repository" : { + "type" : "git", + "url" : "http://github.com/substack/node-mkdirp.git" + }, + "scripts" : { + "test" : "tap test/*.js" + }, + "devDependencies" : { + "tap" : "0.0.x" + }, + "license" : "MIT/X11", + "engines": { "node": "*" } +} diff --git a/node_modules/jade/node_modules/mkdirp/test/chmod.js b/node_modules/jade/node_modules/mkdirp/test/chmod.js new file mode 100644 index 0000000..520dcb8 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/chmod.js @@ -0,0 +1,38 @@ +var mkdirp = require('../').mkdirp; +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +var ps = [ '', 'tmp' ]; + +for (var i = 0; i < 25; i++) { + var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + ps.push(dir); +} + +var file = ps.join('/'); + +test('chmod-pre', function (t) { + var mode = 0744 + mkdirp(file, mode, function (er) { + t.ifError(er, 'should not error'); + fs.stat(file, function (er, stat) { + t.ifError(er, 'should exist'); + t.ok(stat && stat.isDirectory(), 'should be directory'); + t.equal(stat && stat.mode & 0777, mode, 'should be 0744'); + t.end(); + }); + }); +}); + +test('chmod', function (t) { + var mode = 0755 + mkdirp(file, mode, function (er) { + t.ifError(er, 'should not error'); + fs.stat(file, function (er, stat) { + t.ifError(er, 'should exist'); + t.ok(stat && stat.isDirectory(), 'should be directory'); + t.end(); + }); + }); +}); diff --git a/node_modules/jade/node_modules/mkdirp/test/clobber.js b/node_modules/jade/node_modules/mkdirp/test/clobber.js new file mode 100644 index 0000000..0eb7099 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/clobber.js @@ -0,0 +1,37 @@ +var mkdirp = require('../').mkdirp; +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +var ps = [ '', 'tmp' ]; + +for (var i = 0; i < 25; i++) { + var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + ps.push(dir); +} + +var file = ps.join('/'); + +// a file in the way +var itw = ps.slice(0, 3).join('/'); + + +test('clobber-pre', function (t) { + console.error("about to write to "+itw) + fs.writeFileSync(itw, 'I AM IN THE WAY, THE TRUTH, AND THE LIGHT.'); + + fs.stat(itw, function (er, stat) { + t.ifError(er) + t.ok(stat && stat.isFile(), 'should be file') + t.end() + }) +}) + +test('clobber', function (t) { + t.plan(2); + mkdirp(file, 0755, function (err) { + t.ok(err); + t.equal(err.code, 'ENOTDIR'); + t.end(); + }); +}); diff --git a/node_modules/jade/node_modules/mkdirp/test/mkdirp.js b/node_modules/jade/node_modules/mkdirp/test/mkdirp.js new file mode 100644 index 0000000..b07cd70 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/mkdirp.js @@ -0,0 +1,28 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('woo', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + mkdirp(file, 0755, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) + }); +}); diff --git a/node_modules/jade/node_modules/mkdirp/test/perm.js b/node_modules/jade/node_modules/mkdirp/test/perm.js new file mode 100644 index 0000000..23a7abb --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/perm.js @@ -0,0 +1,32 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('async perm', function (t) { + t.plan(2); + var file = '/tmp/' + (Math.random() * (1<<30)).toString(16); + + mkdirp(file, 0755, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) + }); +}); + +test('async root perm', function (t) { + mkdirp('/tmp', 0755, function (err) { + if (err) t.fail(err); + t.end(); + }); + t.end(); +}); diff --git a/node_modules/jade/node_modules/mkdirp/test/perm_sync.js b/node_modules/jade/node_modules/mkdirp/test/perm_sync.js new file mode 100644 index 0000000..f685f60 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/perm_sync.js @@ -0,0 +1,39 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('sync perm', function (t) { + t.plan(2); + var file = '/tmp/' + (Math.random() * (1<<30)).toString(16) + '.json'; + + mkdirp.sync(file, 0755); + path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }); +}); + +test('sync root perm', function (t) { + t.plan(1); + + var file = '/tmp'; + mkdirp.sync(file, 0755); + path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }); +}); diff --git a/node_modules/jade/node_modules/mkdirp/test/race.js b/node_modules/jade/node_modules/mkdirp/test/race.js new file mode 100644 index 0000000..96a0447 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/race.js @@ -0,0 +1,41 @@ +var mkdirp = require('../').mkdirp; +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('race', function (t) { + t.plan(4); + var ps = [ '', 'tmp' ]; + + for (var i = 0; i < 25; i++) { + var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + ps.push(dir); + } + var file = ps.join('/'); + + var res = 2; + mk(file, function () { + if (--res === 0) t.end(); + }); + + mk(file, function () { + if (--res === 0) t.end(); + }); + + function mk (file, cb) { + mkdirp(file, 0755, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + if (cb) cb(); + } + }) + }) + }); + } +}); diff --git a/node_modules/jade/node_modules/mkdirp/test/rel.js b/node_modules/jade/node_modules/mkdirp/test/rel.js new file mode 100644 index 0000000..7985824 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/rel.js @@ -0,0 +1,32 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('rel', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var cwd = process.cwd(); + process.chdir('/tmp'); + + var file = [x,y,z].join('/'); + + mkdirp(file, 0755, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + process.chdir(cwd); + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) + }); +}); diff --git a/node_modules/jade/node_modules/mkdirp/test/sync.js b/node_modules/jade/node_modules/mkdirp/test/sync.js new file mode 100644 index 0000000..e0e389d --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/sync.js @@ -0,0 +1,27 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('sync', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + var err = mkdirp.sync(file, 0755); + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) +}); diff --git a/node_modules/jade/node_modules/mkdirp/test/umask.js b/node_modules/jade/node_modules/mkdirp/test/umask.js new file mode 100644 index 0000000..64ccafe --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/umask.js @@ -0,0 +1,28 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('implicit mode from umask', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + mkdirp(file, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0777 & (~process.umask())); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) + }); +}); diff --git a/node_modules/jade/node_modules/mkdirp/test/umask_sync.js b/node_modules/jade/node_modules/mkdirp/test/umask_sync.js new file mode 100644 index 0000000..83cba56 --- /dev/null +++ b/node_modules/jade/node_modules/mkdirp/test/umask_sync.js @@ -0,0 +1,27 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('umask sync modes', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + var err = mkdirp.sync(file); + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, (0777 & (~process.umask()))); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) +}); diff --git a/node_modules/jade/package.json b/node_modules/jade/package.json new file mode 100644 index 0000000..e91d8ac --- /dev/null +++ b/node_modules/jade/package.json @@ -0,0 +1,29 @@ +{ + "name": "jade", + "description": "Jade template engine", + "version": "0.26.3", + "author": "TJ Holowaychuk ", + "repository": "git://github.com/visionmedia/jade", + "main": "./index.js", + "bin": { "jade": "./bin/jade" }, + "man": "./jade.1", + "dependencies": { + "commander": "0.6.1", + "mkdirp": "0.3.0" + }, + "devDependencies": { + "mocha": "*", + "markdown": "*", + "stylus": "*", + "uubench": "*", + "should": "*", + "less": "*", + "uglify-js": "*" + }, + "component": { + "scripts": { + "jade": "runtime.js" + } + }, + "scripts" : { "prepublish" : "npm prune" } +} diff --git a/node_modules/jade/runtime.js b/node_modules/jade/runtime.js new file mode 100644 index 0000000..0f54907 --- /dev/null +++ b/node_modules/jade/runtime.js @@ -0,0 +1,179 @@ + +jade = (function(exports){ +/*! + * Jade - runtime + * Copyright(c) 2010 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Lame Array.isArray() polyfill for now. + */ + +if (!Array.isArray) { + Array.isArray = function(arr){ + return '[object Array]' == Object.prototype.toString.call(arr); + }; +} + +/** + * Lame Object.keys() polyfill for now. + */ + +if (!Object.keys) { + Object.keys = function(obj){ + var arr = []; + for (var key in obj) { + if (obj.hasOwnProperty(key)) { + arr.push(key); + } + } + return arr; + } +} + +/** + * Merge two attribute objects giving precedence + * to values in object `b`. Classes are special-cased + * allowing for arrays and merging/joining appropriately + * resulting in a string. + * + * @param {Object} a + * @param {Object} b + * @return {Object} a + * @api private + */ + +exports.merge = function merge(a, b) { + var ac = a['class']; + var bc = b['class']; + + if (ac || bc) { + ac = ac || []; + bc = bc || []; + if (!Array.isArray(ac)) ac = [ac]; + if (!Array.isArray(bc)) bc = [bc]; + ac = ac.filter(nulls); + bc = bc.filter(nulls); + a['class'] = ac.concat(bc).join(' '); + } + + for (var key in b) { + if (key != 'class') { + a[key] = b[key]; + } + } + + return a; +}; + +/** + * Filter null `val`s. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function nulls(val) { + return val != null; +} + +/** + * Render the given attributes object. + * + * @param {Object} obj + * @param {Object} escaped + * @return {String} + * @api private + */ + +exports.attrs = function attrs(obj, escaped){ + var buf = [] + , terse = obj.terse; + + delete obj.terse; + var keys = Object.keys(obj) + , len = keys.length; + + if (len) { + buf.push(''); + for (var i = 0; i < len; ++i) { + var key = keys[i] + , val = obj[key]; + + if ('boolean' == typeof val || null == val) { + if (val) { + terse + ? buf.push(key) + : buf.push(key + '="' + key + '"'); + } + } else if (0 == key.indexOf('data') && 'string' != typeof val) { + buf.push(key + "='" + JSON.stringify(val) + "'"); + } else if ('class' == key && Array.isArray(val)) { + buf.push(key + '="' + exports.escape(val.join(' ')) + '"'); + } else if (escaped && escaped[key]) { + buf.push(key + '="' + exports.escape(val) + '"'); + } else { + buf.push(key + '="' + val + '"'); + } + } + } + + return buf.join(' '); +}; + +/** + * Escape the given string of `html`. + * + * @param {String} html + * @return {String} + * @api private + */ + +exports.escape = function escape(html){ + return String(html) + .replace(/&(?!(\w+|\#\d+);)/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); +}; + +/** + * Re-throw the given `err` in context to the + * the jade in `filename` at the given `lineno`. + * + * @param {Error} err + * @param {String} filename + * @param {String} lineno + * @api private + */ + +exports.rethrow = function rethrow(err, filename, lineno){ + if (!filename) throw err; + + var context = 3 + , str = require('fs').readFileSync(filename, 'utf8') + , lines = str.split('\n') + , start = Math.max(lineno - context, 0) + , end = Math.min(lines.length, lineno + context); + + // Error context + var context = lines.slice(start, end).map(function(line, i){ + var curr = i + start + 1; + return (curr == lineno ? ' > ' : ' ') + + curr + + '| ' + + line; + }).join('\n'); + + // Alter exception message + err.path = filename; + err.message = (filename || 'Jade') + ':' + lineno + + '\n' + context + '\n\n' + err.message; + throw err; +}; + + return exports; + +})({}); diff --git a/node_modules/jade/runtime.min.js b/node_modules/jade/runtime.min.js new file mode 100644 index 0000000..1714efb --- /dev/null +++ b/node_modules/jade/runtime.min.js @@ -0,0 +1 @@ +jade=function(exports){Array.isArray||(Array.isArray=function(arr){return"[object Array]"==Object.prototype.toString.call(arr)}),Object.keys||(Object.keys=function(obj){var arr=[];for(var key in obj)obj.hasOwnProperty(key)&&arr.push(key);return arr}),exports.merge=function merge(a,b){var ac=a["class"],bc=b["class"];if(ac||bc)ac=ac||[],bc=bc||[],Array.isArray(ac)||(ac=[ac]),Array.isArray(bc)||(bc=[bc]),ac=ac.filter(nulls),bc=bc.filter(nulls),a["class"]=ac.concat(bc).join(" ");for(var key in b)key!="class"&&(a[key]=b[key]);return a};function nulls(val){return val!=null}return exports.attrs=function attrs(obj,escaped){var buf=[],terse=obj.terse;delete obj.terse;var keys=Object.keys(obj),len=keys.length;if(len){buf.push("");for(var i=0;i/g,">").replace(/"/g,""")},exports.rethrow=function rethrow(err,filename,lineno){if(!filename)throw err;var context=3,str=require("fs").readFileSync(filename,"utf8"),lines=str.split("\n"),start=Math.max(lineno-context,0),end=Math.min(lines.length,lineno+context),context=lines.slice(start,end).map(function(line,i){var curr=i+start+1;return(curr==lineno?" > ":" ")+curr+"| "+line}).join("\n");throw err.path=filename,err.message=(filename||"Jade")+":"+lineno+"\n"+context+"\n\n"+err.message,err},exports}({}); \ No newline at end of file diff --git a/node_modules/jade/test.jade b/node_modules/jade/test.jade new file mode 100644 index 0000000..b3a8988 --- /dev/null +++ b/node_modules/jade/test.jade @@ -0,0 +1,7 @@ +p. + This is a large + body of text for + this tag. + + Nothing too + exciting. \ No newline at end of file diff --git a/node_modules/jade/testing/head.jade b/node_modules/jade/testing/head.jade new file mode 100644 index 0000000..8515406 --- /dev/null +++ b/node_modules/jade/testing/head.jade @@ -0,0 +1,5 @@ +head + script(src='/jquery.js') + yield + if false + script(src='/jquery.ui.js') diff --git a/node_modules/jade/testing/index.jade b/node_modules/jade/testing/index.jade new file mode 100644 index 0000000..1032c5f --- /dev/null +++ b/node_modules/jade/testing/index.jade @@ -0,0 +1,22 @@ + +tag = 'p' +foo = 'bar' + +#{tag} value +#{tag}(foo='bar') value +#{foo ? 'a' : 'li'}(something) here + +mixin item(icon) + li + if attributes.href + a(attributes) + img.icon(src=icon) + block + else + span(attributes) + img.icon(src=icon) + block + +ul + +item('contact') Contact + +item(href='/contact') Contact diff --git a/node_modules/jade/testing/index.js b/node_modules/jade/testing/index.js new file mode 100644 index 0000000..226e8c0 --- /dev/null +++ b/node_modules/jade/testing/index.js @@ -0,0 +1,11 @@ + +/** + * Module dependencies. + */ + +var jade = require('../'); + +jade.renderFile('testing/index.jade', { pretty: true, debug: true, compileDebug: false }, function(err, str){ + if (err) throw err; + console.log(str); +}); \ No newline at end of file diff --git a/node_modules/jade/testing/layout.jade b/node_modules/jade/testing/layout.jade new file mode 100644 index 0000000..6923cf1 --- /dev/null +++ b/node_modules/jade/testing/layout.jade @@ -0,0 +1,6 @@ +html + include head + script(src='/caustic.js') + script(src='/app.js') + body + block content \ No newline at end of file diff --git a/node_modules/jade/testing/user.jade b/node_modules/jade/testing/user.jade new file mode 100644 index 0000000..3c636b7 --- /dev/null +++ b/node_modules/jade/testing/user.jade @@ -0,0 +1,7 @@ +h1 Tobi +p Is a ferret + +ul + li: a foo + li: a bar + li: a baz \ No newline at end of file diff --git a/node_modules/jade/testing/user.js b/node_modules/jade/testing/user.js new file mode 100644 index 0000000..2ecc45e --- /dev/null +++ b/node_modules/jade/testing/user.js @@ -0,0 +1,27 @@ +function anonymous(locals, attrs, escape, rethrow) { +var attrs = jade.attrs, escape = jade.escape, rethrow = jade.rethrow; +var __jade = [{ lineno: 1, filename: "testing/user.jade" }]; +try { +var buf = []; +with (locals || {}) { +var interp; +__jade.unshift({ lineno: 1, filename: __jade[0].filename }); +__jade.unshift({ lineno: 1, filename: __jade[0].filename }); +buf.push('

Tobi'); +__jade.unshift({ lineno: undefined, filename: __jade[0].filename }); +__jade.shift(); +buf.push('

'); +__jade.shift(); +__jade.unshift({ lineno: 2, filename: __jade[0].filename }); +buf.push('

Is a ferret'); +__jade.unshift({ lineno: undefined, filename: __jade[0].filename }); +__jade.shift(); +buf.push('

'); +__jade.shift(); +__jade.shift(); +} +return buf.join(""); +} catch (err) { + rethrow(err, __jade[0].filename, __jade[0].lineno); +} +} \ No newline at end of file diff --git a/node_modules/lru-cache/.npmignore b/node_modules/lru-cache/.npmignore new file mode 100644 index 0000000..07e6e47 --- /dev/null +++ b/node_modules/lru-cache/.npmignore @@ -0,0 +1 @@ +/node_modules diff --git a/node_modules/lru-cache/.travis.yml b/node_modules/lru-cache/.travis.yml new file mode 100644 index 0000000..4af02b3 --- /dev/null +++ b/node_modules/lru-cache/.travis.yml @@ -0,0 +1,8 @@ +language: node_js +node_js: + - '0.8' + - '0.10' + - '0.12' + - 'iojs' +before_install: + - npm install -g npm@latest diff --git a/node_modules/lru-cache/CONTRIBUTORS b/node_modules/lru-cache/CONTRIBUTORS new file mode 100644 index 0000000..4a0bc50 --- /dev/null +++ b/node_modules/lru-cache/CONTRIBUTORS @@ -0,0 +1,14 @@ +# Authors, sorted by whether or not they are me +Isaac Z. Schlueter +Brian Cottingham +Carlos Brito Lage +Jesse Dailey +Kevin O'Hara +Marco Rogers +Mark Cavage +Marko Mikulicic +Nathan Rajlich +Satheesh Natesan +Trent Mick +ashleybrener +n4kz diff --git a/node_modules/lru-cache/LICENSE b/node_modules/lru-cache/LICENSE new file mode 100644 index 0000000..19129e3 --- /dev/null +++ b/node_modules/lru-cache/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/lru-cache/README.md b/node_modules/lru-cache/README.md new file mode 100644 index 0000000..c06814e --- /dev/null +++ b/node_modules/lru-cache/README.md @@ -0,0 +1,137 @@ +# lru cache + +A cache object that deletes the least-recently-used items. + +## Usage: + +```javascript +var LRU = require("lru-cache") + , options = { max: 500 + , length: function (n) { return n * 2 } + , dispose: function (key, n) { n.close() } + , maxAge: 1000 * 60 * 60 } + , cache = LRU(options) + , otherCache = LRU(50) // sets just the max size + +cache.set("key", "value") +cache.get("key") // "value" + +cache.reset() // empty the cache +``` + +If you put more stuff in it, then items will fall out. + +If you try to put an oversized thing in it, then it'll fall out right +away. + +## Keys should always be Strings or Numbers + +Note: this module will print warnings to `console.error` if you use a +key that is not a String or Number. Because items are stored in an +object, which coerces keys to a string, it won't go well for you if +you try to use a key that is not a unique string, it'll cause surprise +collisions. For example: + +```JavaScript +// Bad Example! Dont' do this! +var cache = LRU() +var a = {} +var b = {} +cache.set(a, 'this is a') +cache.set(b, 'this is b') +console.log(cache.get(a)) // prints: 'this is b' +``` + +## Options + +* `max` The maximum size of the cache, checked by applying the length + function to all values in the cache. Not setting this is kind of + silly, since that's the whole purpose of this lib, but it defaults + to `Infinity`. +* `maxAge` Maximum age in ms. Items are not pro-actively pruned out + as they age, but if you try to get an item that is too old, it'll + drop it and return undefined instead of giving it to you. +* `length` Function that is used to calculate the length of stored + items. If you're storing strings or buffers, then you probably want + to do something like `function(n){return n.length}`. The default is + `function(n){return 1}`, which is fine if you want to store `max` + like-sized things. +* `dispose` Function that is called on items when they are dropped + from the cache. This can be handy if you want to close file + descriptors or do other cleanup tasks when items are no longer + accessible. Called with `key, value`. It's called *before* + actually removing the item from the internal cache, so if you want + to immediately put it back in, you'll have to do that in a + `nextTick` or `setTimeout` callback or it won't do anything. +* `stale` By default, if you set a `maxAge`, it'll only actually pull + stale items out of the cache when you `get(key)`. (That is, it's + not pre-emptively doing a `setTimeout` or anything.) If you set + `stale:true`, it'll return the stale value before deleting it. If + you don't set this, then it'll return `undefined` when you try to + get a stale entry, as if it had already been deleted. + +## API + +* `set(key, value, maxAge)` +* `get(key) => value` + + Both of these will update the "recently used"-ness of the key. + They do what you think. `max` is optional and overrides the + cache `max` option if provided. + +* `peek(key)` + + Returns the key value (or `undefined` if not found) without + updating the "recently used"-ness of the key. + + (If you find yourself using this a lot, you *might* be using the + wrong sort of data structure, but there are some use cases where + it's handy.) + +* `del(key)` + + Deletes a key out of the cache. + +* `reset()` + + Clear the cache entirely, throwing away all values. + +* `has(key)` + + Check if a key is in the cache, without updating the recent-ness + or deleting it for being stale. + +* `forEach(function(value,key,cache), [thisp])` + + Just like `Array.prototype.forEach`. Iterates over all the keys + in the cache, in order of recent-ness. (Ie, more recently used + items are iterated over first.) + +* `keys()` + + Return an array of the keys in the cache. + +* `values()` + + Return an array of the values in the cache. + +* `length()` + + Return total length of objects in cache taking into account + `length` options function. + +* `itemCount` + + Return total quantity of objects currently in cache. Note, that + `stale` (see options) items are returned as part of this item + count. + +* `dump()` + + Return an array of the cache entries ready for serialization and usage + with 'destinationCache.load(arr)`. + +* `load(cacheEntriesArray)` + + Loads another cache entries array, obtained with `sourceCache.dump()`, + into the cache. The destination cache is reset before loading new entries diff --git a/node_modules/lru-cache/lib/lru-cache.js b/node_modules/lru-cache/lib/lru-cache.js new file mode 100644 index 0000000..2bbe653 --- /dev/null +++ b/node_modules/lru-cache/lib/lru-cache.js @@ -0,0 +1,334 @@ +;(function () { // closure for web browsers + +if (typeof module === 'object' && module.exports) { + module.exports = LRUCache +} else { + // just set the global for non-node platforms. + this.LRUCache = LRUCache +} + +function hOP (obj, key) { + return Object.prototype.hasOwnProperty.call(obj, key) +} + +function naiveLength () { return 1 } + +var didTypeWarning = false +function typeCheckKey(key) { + if (!didTypeWarning && typeof key !== 'string' && typeof key !== 'number') { + didTypeWarning = true + console.error(new TypeError("LRU: key must be a string or number. Almost certainly a bug! " + typeof key).stack) + } +} + +function LRUCache (options) { + if (!(this instanceof LRUCache)) + return new LRUCache(options) + + if (typeof options === 'number') + options = { max: options } + + if (!options) + options = {} + + this._max = options.max + // Kind of weird to have a default max of Infinity, but oh well. + if (!this._max || !(typeof this._max === "number") || this._max <= 0 ) + this._max = Infinity + + this._lengthCalculator = options.length || naiveLength + if (typeof this._lengthCalculator !== "function") + this._lengthCalculator = naiveLength + + this._allowStale = options.stale || false + this._maxAge = options.maxAge || null + this._dispose = options.dispose + this.reset() +} + +// resize the cache when the max changes. +Object.defineProperty(LRUCache.prototype, "max", + { set : function (mL) { + if (!mL || !(typeof mL === "number") || mL <= 0 ) mL = Infinity + this._max = mL + if (this._length > this._max) trim(this) + } + , get : function () { return this._max } + , enumerable : true + }) + +// resize the cache when the lengthCalculator changes. +Object.defineProperty(LRUCache.prototype, "lengthCalculator", + { set : function (lC) { + if (typeof lC !== "function") { + this._lengthCalculator = naiveLength + this._length = this._itemCount + for (var key in this._cache) { + this._cache[key].length = 1 + } + } else { + this._lengthCalculator = lC + this._length = 0 + for (var key in this._cache) { + this._cache[key].length = this._lengthCalculator(this._cache[key].value) + this._length += this._cache[key].length + } + } + + if (this._length > this._max) trim(this) + } + , get : function () { return this._lengthCalculator } + , enumerable : true + }) + +Object.defineProperty(LRUCache.prototype, "length", + { get : function () { return this._length } + , enumerable : true + }) + + +Object.defineProperty(LRUCache.prototype, "itemCount", + { get : function () { return this._itemCount } + , enumerable : true + }) + +LRUCache.prototype.forEach = function (fn, thisp) { + thisp = thisp || this + var i = 0 + var itemCount = this._itemCount + + for (var k = this._mru - 1; k >= 0 && i < itemCount; k--) if (this._lruList[k]) { + i++ + var hit = this._lruList[k] + if (isStale(this, hit)) { + del(this, hit) + if (!this._allowStale) hit = undefined + } + if (hit) { + fn.call(thisp, hit.value, hit.key, this) + } + } +} + +LRUCache.prototype.keys = function () { + var keys = new Array(this._itemCount) + var i = 0 + for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) { + var hit = this._lruList[k] + keys[i++] = hit.key + } + return keys +} + +LRUCache.prototype.values = function () { + var values = new Array(this._itemCount) + var i = 0 + for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) { + var hit = this._lruList[k] + values[i++] = hit.value + } + return values +} + +LRUCache.prototype.reset = function () { + if (this._dispose && this._cache) { + for (var k in this._cache) { + this._dispose(k, this._cache[k].value) + } + } + + this._cache = Object.create(null) // hash of items by key + this._lruList = Object.create(null) // list of items in order of use recency + this._mru = 0 // most recently used + this._lru = 0 // least recently used + this._length = 0 // number of items in the list + this._itemCount = 0 +} + +LRUCache.prototype.dump = function () { + var arr = [] + var i = 0 + + for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) { + var hit = this._lruList[k] + if (!isStale(this, hit)) { + //Do not store staled hits + ++i + arr.push({ + k: hit.key, + v: hit.value, + e: hit.now + (hit.maxAge || 0) + }); + } + } + //arr has the most read first + return arr +} + +LRUCache.prototype.dumpLru = function () { + return this._lruList +} + +LRUCache.prototype.set = function (key, value, maxAge) { + maxAge = maxAge || this._maxAge + typeCheckKey(key) + + var now = maxAge ? Date.now() : 0 + var len = this._lengthCalculator(value) + + if (hOP(this._cache, key)) { + if (len > this._max) { + del(this, this._cache[key]) + return false + } + // dispose of the old one before overwriting + if (this._dispose) + this._dispose(key, this._cache[key].value) + + this._cache[key].now = now + this._cache[key].maxAge = maxAge + this._cache[key].value = value + this._length += (len - this._cache[key].length) + this._cache[key].length = len + this.get(key) + + if (this._length > this._max) + trim(this) + + return true + } + + var hit = new Entry(key, value, this._mru++, len, now, maxAge) + + // oversized objects fall out of cache automatically. + if (hit.length > this._max) { + if (this._dispose) this._dispose(key, value) + return false + } + + this._length += hit.length + this._lruList[hit.lu] = this._cache[key] = hit + this._itemCount ++ + + if (this._length > this._max) + trim(this) + + return true +} + +LRUCache.prototype.has = function (key) { + typeCheckKey(key) + if (!hOP(this._cache, key)) return false + var hit = this._cache[key] + if (isStale(this, hit)) { + return false + } + return true +} + +LRUCache.prototype.get = function (key) { + typeCheckKey(key) + return get(this, key, true) +} + +LRUCache.prototype.peek = function (key) { + typeCheckKey(key) + return get(this, key, false) +} + +LRUCache.prototype.pop = function () { + var hit = this._lruList[this._lru] + del(this, hit) + return hit || null +} + +LRUCache.prototype.del = function (key) { + typeCheckKey(key) + del(this, this._cache[key]) +} + +LRUCache.prototype.load = function (arr) { + //reset the cache + this.reset(); + + var now = Date.now() + //A previous serialized cache has the most recent items first + for (var l = arr.length - 1; l >= 0; l-- ) { + var hit = arr[l] + typeCheckKey(hit.k) + var expiresAt = hit.e || 0 + if (expiresAt === 0) { + //the item was created without expiration in a non aged cache + this.set(hit.k, hit.v) + } else { + var maxAge = expiresAt - now + //dont add already expired items + if (maxAge > 0) this.set(hit.k, hit.v, maxAge) + } + } +} + +function get (self, key, doUse) { + typeCheckKey(key) + var hit = self._cache[key] + if (hit) { + if (isStale(self, hit)) { + del(self, hit) + if (!self._allowStale) hit = undefined + } else { + if (doUse) use(self, hit) + } + if (hit) hit = hit.value + } + return hit +} + +function isStale(self, hit) { + if (!hit || (!hit.maxAge && !self._maxAge)) return false + var stale = false; + var diff = Date.now() - hit.now + if (hit.maxAge) { + stale = diff > hit.maxAge + } else { + stale = self._maxAge && (diff > self._maxAge) + } + return stale; +} + +function use (self, hit) { + shiftLU(self, hit) + hit.lu = self._mru ++ + self._lruList[hit.lu] = hit +} + +function trim (self) { + while (self._lru < self._mru && self._length > self._max) + del(self, self._lruList[self._lru]) +} + +function shiftLU (self, hit) { + delete self._lruList[ hit.lu ] + while (self._lru < self._mru && !self._lruList[self._lru]) self._lru ++ +} + +function del (self, hit) { + if (hit) { + if (self._dispose) self._dispose(hit.key, hit.value) + self._length -= hit.length + self._itemCount -- + delete self._cache[ hit.key ] + shiftLU(self, hit) + } +} + +// classy, since V8 prefers predictable objects. +function Entry (key, value, lu, length, now, maxAge) { + this.key = key + this.value = value + this.lu = lu + this.length = length + this.now = now + if (maxAge) this.maxAge = maxAge +} + +})() diff --git a/node_modules/lru-cache/package.json b/node_modules/lru-cache/package.json new file mode 100644 index 0000000..189e33d --- /dev/null +++ b/node_modules/lru-cache/package.json @@ -0,0 +1,21 @@ +{ + "name": "lru-cache", + "description": "A cache object that deletes the least-recently-used items.", + "version": "2.7.3", + "author": "Isaac Z. Schlueter ", + "keywords": [ + "mru", + "lru", + "cache" + ], + "scripts": { + "test": "tap test --gc" + }, + "main": "lib/lru-cache.js", + "repository": "git://github.com/isaacs/node-lru-cache.git", + "devDependencies": { + "tap": "^1.2.0", + "weak": "" + }, + "license": "ISC" +} diff --git a/node_modules/lru-cache/test/basic.js b/node_modules/lru-cache/test/basic.js new file mode 100644 index 0000000..b47225f --- /dev/null +++ b/node_modules/lru-cache/test/basic.js @@ -0,0 +1,396 @@ +var test = require("tap").test + , LRU = require("../") + +test("basic", function (t) { + var cache = new LRU({max: 10}) + cache.set("key", "value") + t.equal(cache.get("key"), "value") + t.equal(cache.get("nada"), undefined) + t.equal(cache.length, 1) + t.equal(cache.max, 10) + t.end() +}) + +test("least recently set", function (t) { + var cache = new LRU(2) + cache.set("a", "A") + cache.set("b", "B") + cache.set("c", "C") + t.equal(cache.get("c"), "C") + t.equal(cache.get("b"), "B") + t.equal(cache.get("a"), undefined) + t.end() +}) + +test("lru recently gotten", function (t) { + var cache = new LRU(2) + cache.set("a", "A") + cache.set("b", "B") + cache.get("a") + cache.set("c", "C") + t.equal(cache.get("c"), "C") + t.equal(cache.get("b"), undefined) + t.equal(cache.get("a"), "A") + t.end() +}) + +test("del", function (t) { + var cache = new LRU(2) + cache.set("a", "A") + cache.del("a") + t.equal(cache.get("a"), undefined) + t.end() +}) + +test("max", function (t) { + var cache = new LRU(3) + + // test changing the max, verify that the LRU items get dropped. + cache.max = 100 + for (var i = 0; i < 100; i ++) cache.set(i, i) + t.equal(cache.length, 100) + for (var i = 0; i < 100; i ++) { + t.equal(cache.get(i), i) + } + cache.max = 3 + t.equal(cache.length, 3) + for (var i = 0; i < 97; i ++) { + t.equal(cache.get(i), undefined) + } + for (var i = 98; i < 100; i ++) { + t.equal(cache.get(i), i) + } + + // now remove the max restriction, and try again. + cache.max = "hello" + for (var i = 0; i < 100; i ++) cache.set(i, i) + t.equal(cache.length, 100) + for (var i = 0; i < 100; i ++) { + t.equal(cache.get(i), i) + } + // should trigger an immediate resize + cache.max = 3 + t.equal(cache.length, 3) + for (var i = 0; i < 97; i ++) { + t.equal(cache.get(i), undefined) + } + for (var i = 98; i < 100; i ++) { + t.equal(cache.get(i), i) + } + t.end() +}) + +test("reset", function (t) { + var cache = new LRU(10) + cache.set("a", "A") + cache.set("b", "B") + cache.reset() + t.equal(cache.length, 0) + t.equal(cache.max, 10) + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), undefined) + t.end() +}) + + +test("basic with weighed length", function (t) { + var cache = new LRU({ + max: 100, + length: function (item) { return item.size } + }) + cache.set("key", {val: "value", size: 50}) + t.equal(cache.get("key").val, "value") + t.equal(cache.get("nada"), undefined) + t.equal(cache.lengthCalculator(cache.get("key")), 50) + t.equal(cache.length, 50) + t.equal(cache.max, 100) + t.end() +}) + + +test("weighed length item too large", function (t) { + var cache = new LRU({ + max: 10, + length: function (item) { return item.size } + }) + t.equal(cache.max, 10) + + // should fall out immediately + cache.set("key", {val: "value", size: 50}) + + t.equal(cache.length, 0) + t.equal(cache.get("key"), undefined) + t.end() +}) + +test("least recently set with weighed length", function (t) { + var cache = new LRU({ + max:8, + length: function (item) { return item.length } + }) + cache.set("a", "A") + cache.set("b", "BB") + cache.set("c", "CCC") + cache.set("d", "DDDD") + t.equal(cache.get("d"), "DDDD") + t.equal(cache.get("c"), "CCC") + t.equal(cache.get("b"), undefined) + t.equal(cache.get("a"), undefined) + t.end() +}) + +test("lru recently gotten with weighed length", function (t) { + var cache = new LRU({ + max: 8, + length: function (item) { return item.length } + }) + cache.set("a", "A") + cache.set("b", "BB") + cache.set("c", "CCC") + cache.get("a") + cache.get("b") + cache.set("d", "DDDD") + t.equal(cache.get("c"), undefined) + t.equal(cache.get("d"), "DDDD") + t.equal(cache.get("b"), "BB") + t.equal(cache.get("a"), "A") + t.end() +}) + +test("lru recently updated with weighed length", function (t) { + var cache = new LRU({ + max: 8, + length: function (item) { return item.length } + }) + cache.set("a", "A") + cache.set("b", "BB") + cache.set("c", "CCC") + t.equal(cache.length, 6) //CCC BB A + cache.set("a", "+A") + t.equal(cache.length, 7) //+A CCC BB + cache.set("b", "++BB") + t.equal(cache.length, 6) //++BB +A + t.equal(cache.get("c"), undefined) + + cache.set("c", "oversized") + t.equal(cache.length, 6) //++BB +A + t.equal(cache.get("c"), undefined) + + cache.set("a", "oversized") + t.equal(cache.length, 4) //++BB + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), "++BB") + t.end() +}) + +test("set returns proper booleans", function(t) { + var cache = new LRU({ + max: 5, + length: function (item) { return item.length } + }) + + t.equal(cache.set("a", "A"), true) + + // should return false for max exceeded + t.equal(cache.set("b", "donuts"), false) + + t.equal(cache.set("b", "B"), true) + t.equal(cache.set("c", "CCCC"), true) + t.end() +}) + +test("drop the old items", function(t) { + var cache = new LRU({ + max: 5, + maxAge: 50 + }) + + cache.set("a", "A") + + setTimeout(function () { + cache.set("b", "b") + t.equal(cache.get("a"), "A") + }, 25) + + setTimeout(function () { + cache.set("c", "C") + // timed out + t.notOk(cache.get("a")) + }, 60 + 25) + + setTimeout(function () { + t.notOk(cache.get("b")) + t.equal(cache.get("c"), "C") + }, 90) + + setTimeout(function () { + t.notOk(cache.get("c")) + t.end() + }, 155) +}) + +test("individual item can have it's own maxAge", function(t) { + var cache = new LRU({ + max: 5, + maxAge: 50 + }) + + cache.set("a", "A", 20) + setTimeout(function () { + t.notOk(cache.get("a")) + t.end() + }, 25) +}) + +test("individual item can have it's own maxAge > cache's", function(t) { + var cache = new LRU({ + max: 5, + maxAge: 20 + }) + + cache.set("a", "A", 50) + setTimeout(function () { + t.equal(cache.get("a"), "A") + t.end() + }, 25) +}) + +test("disposal function", function(t) { + var disposed = false + var cache = new LRU({ + max: 1, + dispose: function (k, n) { + disposed = n + } + }) + + cache.set(1, 1) + cache.set(2, 2) + t.equal(disposed, 1) + cache.set(3, 3) + t.equal(disposed, 2) + cache.reset() + t.equal(disposed, 3) + t.end() +}) + +test("disposal function on too big of item", function(t) { + var disposed = false + var cache = new LRU({ + max: 1, + length: function (k) { + return k.length + }, + dispose: function (k, n) { + disposed = n + } + }) + var obj = [ 1, 2 ] + + t.equal(disposed, false) + cache.set("obj", obj) + t.equal(disposed, obj) + t.end() +}) + +test("has()", function(t) { + var cache = new LRU({ + max: 1, + maxAge: 10 + }) + + cache.set('foo', 'bar') + t.equal(cache.has('foo'), true) + cache.set('blu', 'baz') + t.equal(cache.has('foo'), false) + t.equal(cache.has('blu'), true) + setTimeout(function() { + t.equal(cache.has('blu'), false) + t.end() + }, 15) +}) + +test("stale", function(t) { + var cache = new LRU({ + maxAge: 10, + stale: true + }) + + cache.set('foo', 'bar') + t.equal(cache.get('foo'), 'bar') + t.equal(cache.has('foo'), true) + setTimeout(function() { + t.equal(cache.has('foo'), false) + t.equal(cache.get('foo'), 'bar') + t.equal(cache.get('foo'), undefined) + t.end() + }, 15) +}) + +test("lru update via set", function(t) { + var cache = LRU({ max: 2 }); + + cache.set('foo', 1); + cache.set('bar', 2); + cache.del('bar'); + cache.set('baz', 3); + cache.set('qux', 4); + + t.equal(cache.get('foo'), undefined) + t.equal(cache.get('bar'), undefined) + t.equal(cache.get('baz'), 3) + t.equal(cache.get('qux'), 4) + t.end() +}) + +test("least recently set w/ peek", function (t) { + var cache = new LRU(2) + cache.set("a", "A") + cache.set("b", "B") + t.equal(cache.peek("a"), "A") + cache.set("c", "C") + t.equal(cache.get("c"), "C") + t.equal(cache.get("b"), "B") + t.equal(cache.get("a"), undefined) + t.end() +}) + +test("pop the least used item", function (t) { + var cache = new LRU(3) + , last + + cache.set("a", "A") + cache.set("b", "B") + cache.set("c", "C") + + t.equal(cache.length, 3) + t.equal(cache.max, 3) + + // Ensure we pop a, c, b + cache.get("b", "B") + + last = cache.pop() + t.equal(last.key, "a") + t.equal(last.value, "A") + t.equal(cache.length, 2) + t.equal(cache.max, 3) + + last = cache.pop() + t.equal(last.key, "c") + t.equal(last.value, "C") + t.equal(cache.length, 1) + t.equal(cache.max, 3) + + last = cache.pop() + t.equal(last.key, "b") + t.equal(last.value, "B") + t.equal(cache.length, 0) + t.equal(cache.max, 3) + + last = cache.pop() + t.equal(last, null) + t.equal(cache.length, 0) + t.equal(cache.max, 3) + + t.end() +}) diff --git a/node_modules/lru-cache/test/foreach.js b/node_modules/lru-cache/test/foreach.js new file mode 100644 index 0000000..4190417 --- /dev/null +++ b/node_modules/lru-cache/test/foreach.js @@ -0,0 +1,120 @@ +var test = require('tap').test +var LRU = require('../') + +test('forEach', function (t) { + var l = new LRU(5) + for (var i = 0; i < 10; i ++) { + l.set(i.toString(), i.toString(2)) + } + + var i = 9 + l.forEach(function (val, key, cache) { + t.equal(cache, l) + t.equal(key, i.toString()) + t.equal(val, i.toString(2)) + i -= 1 + }) + + // get in order of most recently used + l.get(6) + l.get(8) + + var order = [ 8, 6, 9, 7, 5 ] + var i = 0 + + l.forEach(function (val, key, cache) { + var j = order[i ++] + t.equal(cache, l) + t.equal(key, j.toString()) + t.equal(val, j.toString(2)) + }) + t.equal(i, order.length); + + t.end() +}) + +test('keys() and values()', function (t) { + var l = new LRU(5) + for (var i = 0; i < 10; i ++) { + l.set(i.toString(), i.toString(2)) + } + + t.similar(l.keys(), ['9', '8', '7', '6', '5']) + t.similar(l.values(), ['1001', '1000', '111', '110', '101']) + + // get in order of most recently used + l.get(6) + l.get(8) + + t.similar(l.keys(), ['8', '6', '9', '7', '5']) + t.similar(l.values(), ['1000', '110', '1001', '111', '101']) + + t.end() +}) + +test('all entries are iterated over', function(t) { + var l = new LRU(5) + for (var i = 0; i < 10; i ++) { + l.set(i.toString(), i.toString(2)) + } + + var i = 0 + l.forEach(function (val, key, cache) { + if (i > 0) { + cache.del(key) + } + i += 1 + }) + + t.equal(i, 5) + t.equal(l.keys().length, 1) + + t.end() +}) + +test('all stale entries are removed', function(t) { + var l = new LRU({ max: 5, maxAge: -5, stale: true }) + for (var i = 0; i < 10; i ++) { + l.set(i.toString(), i.toString(2)) + } + + var i = 0 + l.forEach(function () { + i += 1 + }) + + t.equal(i, 5) + t.equal(l.keys().length, 0) + + t.end() +}) + +test('expires', function (t) { + var l = new LRU({ + max: 10, + maxAge: 50 + }) + for (var i = 0; i < 10; i++) { + l.set(i.toString(), i.toString(2), ((i % 2) ? 25 : undefined)) + } + + var i = 0 + var order = [ 8, 6, 4, 2, 0 ] + setTimeout(function () { + l.forEach(function (val, key, cache) { + var j = order[i++] + t.equal(cache, l) + t.equal(key, j.toString()) + t.equal(val, j.toString(2)) + }) + t.equal(i, order.length); + + setTimeout(function () { + var count = 0; + l.forEach(function (val, key, cache) { count++; }) + t.equal(0, count); + t.end() + }, 25) + + }, 26) +}) diff --git a/node_modules/lru-cache/test/memory-leak.js b/node_modules/lru-cache/test/memory-leak.js new file mode 100644 index 0000000..b5912f6 --- /dev/null +++ b/node_modules/lru-cache/test/memory-leak.js @@ -0,0 +1,51 @@ +#!/usr/bin/env node --expose_gc + + +var weak = require('weak'); +var test = require('tap').test +var LRU = require('../') +var l = new LRU({ max: 10 }) +var refs = 0 +function X() { + refs ++ + weak(this, deref) +} + +function deref() { + refs -- +} + +test('no leaks', function (t) { + // fill up the cache + for (var i = 0; i < 100; i++) { + l.set(i, new X); + // throw some gets in there, too. + if (i % 2 === 0) + l.get(i / 2) + } + + gc() + + var start = process.memoryUsage() + + // capture the memory + var startRefs = refs + + // do it again, but more + for (var i = 0; i < 10000; i++) { + l.set(i, new X); + // throw some gets in there, too. + if (i % 2 === 0) + l.get(i / 2) + } + + gc() + + var end = process.memoryUsage() + t.equal(refs, startRefs, 'no leaky refs') + + console.error('start: %j\n' + + 'end: %j', start, end); + t.pass(); + t.end(); +}) diff --git a/node_modules/lru-cache/test/serialize.js b/node_modules/lru-cache/test/serialize.js new file mode 100644 index 0000000..1094194 --- /dev/null +++ b/node_modules/lru-cache/test/serialize.js @@ -0,0 +1,216 @@ +var test = require('tap').test +var LRU = require('../') + +test('dump', function (t) { + var cache = new LRU() + + t.equal(cache.dump().length, 0, "nothing in dump for empty cache") + + cache.set("a", "A") + cache.set("b", "B") + t.deepEqual(cache.dump(), [ + { k: "b", v: "B", e: 0 }, + { k: "a", v: "A", e: 0 } + ]) + + cache.set("a", "A"); + t.deepEqual(cache.dump(), [ + { k: "a", v: "A", e: 0 }, + { k: "b", v: "B", e: 0 } + ]) + + cache.get("b"); + t.deepEqual(cache.dump(), [ + { k: "b", v: "B", e: 0 }, + { k: "a", v: "A", e: 0 } + ]) + + cache.del("a"); + t.deepEqual(cache.dump(), [ + { k: "b", v: "B", e: 0 } + ]) + + t.end() +}) + +test("do not dump stale items", function(t) { + var cache = new LRU({ + max: 5, + maxAge: 50 + }) + + //expires at 50 + cache.set("a", "A") + + setTimeout(function () { + //expires at 75 + cache.set("b", "B") + var s = cache.dump() + t.equal(s.length, 2) + t.equal(s[0].k, "b") + t.equal(s[1].k, "a") + }, 25) + + setTimeout(function () { + //expires at 110 + cache.set("c", "C") + var s = cache.dump() + t.equal(s.length, 2) + t.equal(s[0].k, "c") + t.equal(s[1].k, "b") + }, 60) + + setTimeout(function () { + //expires at 130 + cache.set("d", "D", 40) + var s = cache.dump() + t.equal(s.length, 2) + t.equal(s[0].k, "d") + t.equal(s[1].k, "c") + }, 90) + + setTimeout(function () { + var s = cache.dump() + t.equal(s.length, 1) + t.equal(s[0].k, "d") + }, 120) + + setTimeout(function () { + var s = cache.dump() + t.deepEqual(s, []) + t.end() + }, 155) +}) + +test("load basic cache", function(t) { + var cache = new LRU(), + copy = new LRU() + + cache.set("a", "A") + cache.set("b", "B") + + copy.load(cache.dump()) + t.deepEquals(cache.dump(), copy.dump()) + + t.end() +}) + + +test("load staled cache", function(t) { + var cache = new LRU({maxAge: 50}), + copy = new LRU({maxAge: 50}), + arr + + //expires at 50 + cache.set("a", "A") + setTimeout(function () { + //expires at 80 + cache.set("b", "B") + arr = cache.dump() + t.equal(arr.length, 2) + }, 30) + + setTimeout(function () { + copy.load(arr) + t.equal(copy.get("a"), undefined) + t.equal(copy.get("b"), "B") + }, 60) + + setTimeout(function () { + t.equal(copy.get("b"), undefined) + t.end() + }, 90) +}) + +test("load to other size cache", function(t) { + var cache = new LRU({max: 2}), + copy = new LRU({max: 1}) + + cache.set("a", "A") + cache.set("b", "B") + + copy.load(cache.dump()) + t.equal(copy.get("a"), undefined) + t.equal(copy.get("b"), "B") + + //update the last read from original cache + cache.get("a") + copy.load(cache.dump()) + t.equal(copy.get("a"), "A") + t.equal(copy.get("b"), undefined) + + t.end() +}) + + +test("load to other age cache", function(t) { + var cache = new LRU({maxAge: 50}), + aged = new LRU({maxAge: 100}), + simple = new LRU(), + arr, + expired + + //created at 0 + //a would be valid till 0 + 50 + cache.set("a", "A") + setTimeout(function () { + //created at 20 + //b would be valid till 20 + 50 + cache.set("b", "B") + //b would be valid till 20 + 70 + cache.set("c", "C", 70) + arr = cache.dump() + t.equal(arr.length, 3) + }, 20) + + setTimeout(function () { + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), "B") + t.equal(cache.get("c"), "C") + + aged.load(arr) + t.equal(aged.get("a"), undefined) + t.equal(aged.get("b"), "B") + t.equal(aged.get("c"), "C") + + simple.load(arr) + t.equal(simple.get("a"), undefined) + t.equal(simple.get("b"), "B") + t.equal(simple.get("c"), "C") + }, 60) + + setTimeout(function () { + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), undefined) + t.equal(cache.get("c"), "C") + + aged.load(arr) + t.equal(aged.get("a"), undefined) + t.equal(aged.get("b"), undefined) + t.equal(aged.get("c"), "C") + + simple.load(arr) + t.equal(simple.get("a"), undefined) + t.equal(simple.get("b"), undefined) + t.equal(simple.get("c"), "C") + }, 80) + + setTimeout(function () { + t.equal(cache.get("a"), undefined) + t.equal(cache.get("b"), undefined) + t.equal(cache.get("c"), undefined) + + aged.load(arr) + t.equal(aged.get("a"), undefined) + t.equal(aged.get("b"), undefined) + t.equal(aged.get("c"), undefined) + + simple.load(arr) + t.equal(simple.get("a"), undefined) + t.equal(simple.get("b"), undefined) + t.equal(simple.get("c"), undefined) + t.end() + }, 100) + +}) + diff --git a/node_modules/minimatch/.npmignore b/node_modules/minimatch/.npmignore new file mode 100644 index 0000000..3c3629e --- /dev/null +++ b/node_modules/minimatch/.npmignore @@ -0,0 +1 @@ +node_modules diff --git a/node_modules/minimatch/LICENSE b/node_modules/minimatch/LICENSE new file mode 100644 index 0000000..05a4010 --- /dev/null +++ b/node_modules/minimatch/LICENSE @@ -0,0 +1,23 @@ +Copyright 2009, 2010, 2011 Isaac Z. Schlueter. +All rights reserved. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/minimatch/README.md b/node_modules/minimatch/README.md new file mode 100644 index 0000000..978268e --- /dev/null +++ b/node_modules/minimatch/README.md @@ -0,0 +1,218 @@ +# minimatch + +A minimal matching utility. + +[![Build Status](https://secure.travis-ci.org/isaacs/minimatch.png)](http://travis-ci.org/isaacs/minimatch) + + +This is the matching library used internally by npm. + +Eventually, it will replace the C binding in node-glob. + +It works by converting glob expressions into JavaScript `RegExp` +objects. + +## Usage + +```javascript +var minimatch = require("minimatch") + +minimatch("bar.foo", "*.foo") // true! +minimatch("bar.foo", "*.bar") // false! +minimatch("bar.foo", "*.+(bar|foo)", { debug: true }) // true, and noisy! +``` + +## Features + +Supports these glob features: + +* Brace Expansion +* Extended glob matching +* "Globstar" `**` matching + +See: + +* `man sh` +* `man bash` +* `man 3 fnmatch` +* `man 5 gitignore` + +## Minimatch Class + +Create a minimatch object by instanting the `minimatch.Minimatch` class. + +```javascript +var Minimatch = require("minimatch").Minimatch +var mm = new Minimatch(pattern, options) +``` + +### Properties + +* `pattern` The original pattern the minimatch object represents. +* `options` The options supplied to the constructor. +* `set` A 2-dimensional array of regexp or string expressions. + Each row in the + array corresponds to a brace-expanded pattern. Each item in the row + corresponds to a single path-part. For example, the pattern + `{a,b/c}/d` would expand to a set of patterns like: + + [ [ a, d ] + , [ b, c, d ] ] + + If a portion of the pattern doesn't have any "magic" in it + (that is, it's something like `"foo"` rather than `fo*o?`), then it + will be left as a string rather than converted to a regular + expression. + +* `regexp` Created by the `makeRe` method. A single regular expression + expressing the entire pattern. This is useful in cases where you wish + to use the pattern somewhat like `fnmatch(3)` with `FNM_PATH` enabled. +* `negate` True if the pattern is negated. +* `comment` True if the pattern is a comment. +* `empty` True if the pattern is `""`. + +### Methods + +* `makeRe` Generate the `regexp` member if necessary, and return it. + Will return `false` if the pattern is invalid. +* `match(fname)` Return true if the filename matches the pattern, or + false otherwise. +* `matchOne(fileArray, patternArray, partial)` Take a `/`-split + filename, and match it against a single row in the `regExpSet`. This + method is mainly for internal use, but is exposed so that it can be + used by a glob-walker that needs to avoid excessive filesystem calls. + +All other methods are internal, and will be called as necessary. + +## Functions + +The top-level exported function has a `cache` property, which is an LRU +cache set to store 100 items. So, calling these methods repeatedly +with the same pattern and options will use the same Minimatch object, +saving the cost of parsing it multiple times. + +### minimatch(path, pattern, options) + +Main export. Tests a path against the pattern using the options. + +```javascript +var isJS = minimatch(file, "*.js", { matchBase: true }) +``` + +### minimatch.filter(pattern, options) + +Returns a function that tests its +supplied argument, suitable for use with `Array.filter`. Example: + +```javascript +var javascripts = fileList.filter(minimatch.filter("*.js", {matchBase: true})) +``` + +### minimatch.match(list, pattern, options) + +Match against the list of +files, in the style of fnmatch or glob. If nothing is matched, and +options.nonull is set, then return a list containing the pattern itself. + +```javascript +var javascripts = minimatch.match(fileList, "*.js", {matchBase: true})) +``` + +### minimatch.makeRe(pattern, options) + +Make a regular expression object from the pattern. + +## Options + +All options are `false` by default. + +### debug + +Dump a ton of stuff to stderr. + +### nobrace + +Do not expand `{a,b}` and `{1..3}` brace sets. + +### noglobstar + +Disable `**` matching against multiple folder names. + +### dot + +Allow patterns to match filenames starting with a period, even if +the pattern does not explicitly have a period in that spot. + +Note that by default, `a/**/b` will **not** match `a/.d/b`, unless `dot` +is set. + +### noext + +Disable "extglob" style patterns like `+(a|b)`. + +### nocase + +Perform a case-insensitive match. + +### nonull + +When a match is not found by `minimatch.match`, return a list containing +the pattern itself. When set, an empty list is returned if there are +no matches. + +### matchBase + +If set, then patterns without slashes will be matched +against the basename of the path if it contains slashes. For example, +`a?b` would match the path `/xyz/123/acb`, but not `/xyz/acb/123`. + +### nocomment + +Suppress the behavior of treating `#` at the start of a pattern as a +comment. + +### nonegate + +Suppress the behavior of treating a leading `!` character as negation. + +### flipNegate + +Returns from negate expressions the same as if they were not negated. +(Ie, true on a hit, false on a miss.) + + +## Comparisons to other fnmatch/glob implementations + +While strict compliance with the existing standards is a worthwhile +goal, some discrepancies exist between minimatch and other +implementations, and are intentional. + +If the pattern starts with a `!` character, then it is negated. Set the +`nonegate` flag to suppress this behavior, and treat leading `!` +characters normally. This is perhaps relevant if you wish to start the +pattern with a negative extglob pattern like `!(a|B)`. Multiple `!` +characters at the start of a pattern will negate the pattern multiple +times. + +If a pattern starts with `#`, then it is treated as a comment, and +will not match anything. Use `\#` to match a literal `#` at the +start of a line, or set the `nocomment` flag to suppress this behavior. + +The double-star character `**` is supported by default, unless the +`noglobstar` flag is set. This is supported in the manner of bsdglob +and bash 4.1, where `**` only has special significance if it is the only +thing in a path part. That is, `a/**/b` will match `a/x/y/b`, but +`a/**b` will not. + +If an escaped pattern has no matches, and the `nonull` flag is set, +then minimatch.match returns the pattern as-provided, rather than +interpreting the character escapes. For example, +`minimatch.match([], "\\*a\\?")` will return `"\\*a\\?"` rather than +`"*a?"`. This is akin to setting the `nullglob` option in bash, except +that it does not resolve escaped pattern characters. + +If brace expansion is not disabled, then it is performed before any +other interpretation of the glob pattern. Thus, a pattern like +`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded +**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are +checked for validity. Since those two are valid, matching proceeds. diff --git a/node_modules/minimatch/minimatch.js b/node_modules/minimatch/minimatch.js new file mode 100644 index 0000000..c633f89 --- /dev/null +++ b/node_modules/minimatch/minimatch.js @@ -0,0 +1,1055 @@ +;(function (require, exports, module, platform) { + +if (module) module.exports = minimatch +else exports.minimatch = minimatch + +if (!require) { + require = function (id) { + switch (id) { + case "sigmund": return function sigmund (obj) { + return JSON.stringify(obj) + } + case "path": return { basename: function (f) { + f = f.split(/[\/\\]/) + var e = f.pop() + if (!e) e = f.pop() + return e + }} + case "lru-cache": return function LRUCache () { + // not quite an LRU, but still space-limited. + var cache = {} + var cnt = 0 + this.set = function (k, v) { + cnt ++ + if (cnt >= 100) cache = {} + cache[k] = v + } + this.get = function (k) { return cache[k] } + } + } + } +} + +minimatch.Minimatch = Minimatch + +var LRU = require("lru-cache") + , cache = minimatch.cache = new LRU({max: 100}) + , GLOBSTAR = minimatch.GLOBSTAR = Minimatch.GLOBSTAR = {} + , sigmund = require("sigmund") + +var path = require("path") + // any single thing other than / + // don't need to escape / when using new RegExp() + , qmark = "[^/]" + + // * => any number of characters + , star = qmark + "*?" + + // ** when dots are allowed. Anything goes, except .. and . + // not (^ or / followed by one or two dots followed by $ or /), + // followed by anything, any number of times. + , twoStarDot = "(?:(?!(?:\\\/|^)(?:\\.{1,2})($|\\\/)).)*?" + + // not a ^ or / followed by a dot, + // followed by anything, any number of times. + , twoStarNoDot = "(?:(?!(?:\\\/|^)\\.).)*?" + + // characters that need to be escaped in RegExp. + , reSpecials = charSet("().*{}+?[]^$\\!") + +// "abc" -> { a:true, b:true, c:true } +function charSet (s) { + return s.split("").reduce(function (set, c) { + set[c] = true + return set + }, {}) +} + +// normalizes slashes. +var slashSplit = /\/+/ + +minimatch.filter = filter +function filter (pattern, options) { + options = options || {} + return function (p, i, list) { + return minimatch(p, pattern, options) + } +} + +function ext (a, b) { + a = a || {} + b = b || {} + var t = {} + Object.keys(b).forEach(function (k) { + t[k] = b[k] + }) + Object.keys(a).forEach(function (k) { + t[k] = a[k] + }) + return t +} + +minimatch.defaults = function (def) { + if (!def || !Object.keys(def).length) return minimatch + + var orig = minimatch + + var m = function minimatch (p, pattern, options) { + return orig.minimatch(p, pattern, ext(def, options)) + } + + m.Minimatch = function Minimatch (pattern, options) { + return new orig.Minimatch(pattern, ext(def, options)) + } + + return m +} + +Minimatch.defaults = function (def) { + if (!def || !Object.keys(def).length) return Minimatch + return minimatch.defaults(def).Minimatch +} + + +function minimatch (p, pattern, options) { + if (typeof pattern !== "string") { + throw new TypeError("glob pattern string required") + } + + if (!options) options = {} + + // shortcut: comments match nothing. + if (!options.nocomment && pattern.charAt(0) === "#") { + return false + } + + // "" only matches "" + if (pattern.trim() === "") return p === "" + + return new Minimatch(pattern, options).match(p) +} + +function Minimatch (pattern, options) { + if (!(this instanceof Minimatch)) { + return new Minimatch(pattern, options, cache) + } + + if (typeof pattern !== "string") { + throw new TypeError("glob pattern string required") + } + + if (!options) options = {} + pattern = pattern.trim() + + // windows: need to use /, not \ + // On other platforms, \ is a valid (albeit bad) filename char. + if (platform === "win32") { + pattern = pattern.split("\\").join("/") + } + + // lru storage. + // these things aren't particularly big, but walking down the string + // and turning it into a regexp can get pretty costly. + var cacheKey = pattern + "\n" + sigmund(options) + var cached = minimatch.cache.get(cacheKey) + if (cached) return cached + minimatch.cache.set(cacheKey, this) + + this.options = options + this.set = [] + this.pattern = pattern + this.regexp = null + this.negate = false + this.comment = false + this.empty = false + + // make the set of regexps etc. + this.make() +} + +Minimatch.prototype.debug = function() {} + +Minimatch.prototype.make = make +function make () { + // don't do it more than once. + if (this._made) return + + var pattern = this.pattern + var options = this.options + + // empty patterns and comments match nothing. + if (!options.nocomment && pattern.charAt(0) === "#") { + this.comment = true + return + } + if (!pattern) { + this.empty = true + return + } + + // step 1: figure out negation, etc. + this.parseNegate() + + // step 2: expand braces + var set = this.globSet = this.braceExpand() + + if (options.debug) this.debug = console.error + + this.debug(this.pattern, set) + + // step 3: now we have a set, so turn each one into a series of path-portion + // matching patterns. + // These will be regexps, except in the case of "**", which is + // set to the GLOBSTAR object for globstar behavior, + // and will not contain any / characters + set = this.globParts = set.map(function (s) { + return s.split(slashSplit) + }) + + this.debug(this.pattern, set) + + // glob --> regexps + set = set.map(function (s, si, set) { + return s.map(this.parse, this) + }, this) + + this.debug(this.pattern, set) + + // filter out everything that didn't compile properly. + set = set.filter(function (s) { + return -1 === s.indexOf(false) + }) + + this.debug(this.pattern, set) + + this.set = set +} + +Minimatch.prototype.parseNegate = parseNegate +function parseNegate () { + var pattern = this.pattern + , negate = false + , options = this.options + , negateOffset = 0 + + if (options.nonegate) return + + for ( var i = 0, l = pattern.length + ; i < l && pattern.charAt(i) === "!" + ; i ++) { + negate = !negate + negateOffset ++ + } + + if (negateOffset) this.pattern = pattern.substr(negateOffset) + this.negate = negate +} + +// Brace expansion: +// a{b,c}d -> abd acd +// a{b,}c -> abc ac +// a{0..3}d -> a0d a1d a2d a3d +// a{b,c{d,e}f}g -> abg acdfg acefg +// a{b,c}d{e,f}g -> abdeg acdeg abdeg abdfg +// +// Invalid sets are not expanded. +// a{2..}b -> a{2..}b +// a{b}c -> a{b}c +minimatch.braceExpand = function (pattern, options) { + return new Minimatch(pattern, options).braceExpand() +} + +Minimatch.prototype.braceExpand = braceExpand +function braceExpand (pattern, options) { + options = options || this.options + pattern = typeof pattern === "undefined" + ? this.pattern : pattern + + if (typeof pattern === "undefined") { + throw new Error("undefined pattern") + } + + if (options.nobrace || + !pattern.match(/\{.*\}/)) { + // shortcut. no need to expand. + return [pattern] + } + + var escaping = false + + // examples and comments refer to this crazy pattern: + // a{b,c{d,e},{f,g}h}x{y,z} + // expected: + // abxy + // abxz + // acdxy + // acdxz + // acexy + // acexz + // afhxy + // afhxz + // aghxy + // aghxz + + // everything before the first \{ is just a prefix. + // So, we pluck that off, and work with the rest, + // and then prepend it to everything we find. + if (pattern.charAt(0) !== "{") { + this.debug(pattern) + var prefix = null + for (var i = 0, l = pattern.length; i < l; i ++) { + var c = pattern.charAt(i) + this.debug(i, c) + if (c === "\\") { + escaping = !escaping + } else if (c === "{" && !escaping) { + prefix = pattern.substr(0, i) + break + } + } + + // actually no sets, all { were escaped. + if (prefix === null) { + this.debug("no sets") + return [pattern] + } + + var tail = braceExpand.call(this, pattern.substr(i), options) + return tail.map(function (t) { + return prefix + t + }) + } + + // now we have something like: + // {b,c{d,e},{f,g}h}x{y,z} + // walk through the set, expanding each part, until + // the set ends. then, we'll expand the suffix. + // If the set only has a single member, then'll put the {} back + + // first, handle numeric sets, since they're easier + var numset = pattern.match(/^\{(-?[0-9]+)\.\.(-?[0-9]+)\}/) + if (numset) { + this.debug("numset", numset[1], numset[2]) + var suf = braceExpand.call(this, pattern.substr(numset[0].length), options) + , start = +numset[1] + , end = +numset[2] + , inc = start > end ? -1 : 1 + , set = [] + for (var i = start; i != (end + inc); i += inc) { + // append all the suffixes + for (var ii = 0, ll = suf.length; ii < ll; ii ++) { + set.push(i + suf[ii]) + } + } + return set + } + + // ok, walk through the set + // We hope, somewhat optimistically, that there + // will be a } at the end. + // If the closing brace isn't found, then the pattern is + // interpreted as braceExpand("\\" + pattern) so that + // the leading \{ will be interpreted literally. + var i = 1 // skip the \{ + , depth = 1 + , set = [] + , member = "" + , sawEnd = false + , escaping = false + + function addMember () { + set.push(member) + member = "" + } + + this.debug("Entering for") + FOR: for (i = 1, l = pattern.length; i < l; i ++) { + var c = pattern.charAt(i) + this.debug("", i, c) + + if (escaping) { + escaping = false + member += "\\" + c + } else { + switch (c) { + case "\\": + escaping = true + continue + + case "{": + depth ++ + member += "{" + continue + + case "}": + depth -- + // if this closes the actual set, then we're done + if (depth === 0) { + addMember() + // pluck off the close-brace + i ++ + break FOR + } else { + member += c + continue + } + + case ",": + if (depth === 1) { + addMember() + } else { + member += c + } + continue + + default: + member += c + continue + } // switch + } // else + } // for + + // now we've either finished the set, and the suffix is + // pattern.substr(i), or we have *not* closed the set, + // and need to escape the leading brace + if (depth !== 0) { + this.debug("didn't close", pattern) + return braceExpand.call(this, "\\" + pattern, options) + } + + // x{y,z} -> ["xy", "xz"] + this.debug("set", set) + this.debug("suffix", pattern.substr(i)) + var suf = braceExpand.call(this, pattern.substr(i), options) + // ["b", "c{d,e}","{f,g}h"] -> + // [["b"], ["cd", "ce"], ["fh", "gh"]] + var addBraces = set.length === 1 + this.debug("set pre-expanded", set) + set = set.map(function (p) { + return braceExpand.call(this, p, options) + }, this) + this.debug("set expanded", set) + + + // [["b"], ["cd", "ce"], ["fh", "gh"]] -> + // ["b", "cd", "ce", "fh", "gh"] + set = set.reduce(function (l, r) { + return l.concat(r) + }) + + if (addBraces) { + set = set.map(function (s) { + return "{" + s + "}" + }) + } + + // now attach the suffixes. + var ret = [] + for (var i = 0, l = set.length; i < l; i ++) { + for (var ii = 0, ll = suf.length; ii < ll; ii ++) { + ret.push(set[i] + suf[ii]) + } + } + return ret +} + +// parse a component of the expanded set. +// At this point, no pattern may contain "/" in it +// so we're going to return a 2d array, where each entry is the full +// pattern, split on '/', and then turned into a regular expression. +// A regexp is made at the end which joins each array with an +// escaped /, and another full one which joins each regexp with |. +// +// Following the lead of Bash 4.1, note that "**" only has special meaning +// when it is the *only* thing in a path portion. Otherwise, any series +// of * is equivalent to a single *. Globstar behavior is enabled by +// default, and can be disabled by setting options.noglobstar. +Minimatch.prototype.parse = parse +var SUBPARSE = {} +function parse (pattern, isSub) { + var options = this.options + + // shortcuts + if (!options.noglobstar && pattern === "**") return GLOBSTAR + if (pattern === "") return "" + + var re = "" + , hasMagic = !!options.nocase + , escaping = false + // ? => one single character + , patternListStack = [] + , plType + , stateChar + , inClass = false + , reClassStart = -1 + , classStart = -1 + // . and .. never match anything that doesn't start with ., + // even when options.dot is set. + , patternStart = pattern.charAt(0) === "." ? "" // anything + // not (start or / followed by . or .. followed by / or end) + : options.dot ? "(?!(?:^|\\\/)\\.{1,2}(?:$|\\\/))" + : "(?!\\.)" + , self = this + + function clearStateChar () { + if (stateChar) { + // we had some state-tracking character + // that wasn't consumed by this pass. + switch (stateChar) { + case "*": + re += star + hasMagic = true + break + case "?": + re += qmark + hasMagic = true + break + default: + re += "\\"+stateChar + break + } + self.debug('clearStateChar %j %j', stateChar, re) + stateChar = false + } + } + + for ( var i = 0, len = pattern.length, c + ; (i < len) && (c = pattern.charAt(i)) + ; i ++ ) { + + this.debug("%s\t%s %s %j", pattern, i, re, c) + + // skip over any that are escaped. + if (escaping && reSpecials[c]) { + re += "\\" + c + escaping = false + continue + } + + SWITCH: switch (c) { + case "/": + // completely not allowed, even escaped. + // Should already be path-split by now. + return false + + case "\\": + clearStateChar() + escaping = true + continue + + // the various stateChar values + // for the "extglob" stuff. + case "?": + case "*": + case "+": + case "@": + case "!": + this.debug("%s\t%s %s %j <-- stateChar", pattern, i, re, c) + + // all of those are literals inside a class, except that + // the glob [!a] means [^a] in regexp + if (inClass) { + this.debug(' in class') + if (c === "!" && i === classStart + 1) c = "^" + re += c + continue + } + + // if we already have a stateChar, then it means + // that there was something like ** or +? in there. + // Handle the stateChar, then proceed with this one. + self.debug('call clearStateChar %j', stateChar) + clearStateChar() + stateChar = c + // if extglob is disabled, then +(asdf|foo) isn't a thing. + // just clear the statechar *now*, rather than even diving into + // the patternList stuff. + if (options.noext) clearStateChar() + continue + + case "(": + if (inClass) { + re += "(" + continue + } + + if (!stateChar) { + re += "\\(" + continue + } + + plType = stateChar + patternListStack.push({ type: plType + , start: i - 1 + , reStart: re.length }) + // negation is (?:(?!js)[^/]*) + re += stateChar === "!" ? "(?:(?!" : "(?:" + this.debug('plType %j %j', stateChar, re) + stateChar = false + continue + + case ")": + if (inClass || !patternListStack.length) { + re += "\\)" + continue + } + + clearStateChar() + hasMagic = true + re += ")" + plType = patternListStack.pop().type + // negation is (?:(?!js)[^/]*) + // The others are (?:) + switch (plType) { + case "!": + re += "[^/]*?)" + break + case "?": + case "+": + case "*": re += plType + case "@": break // the default anyway + } + continue + + case "|": + if (inClass || !patternListStack.length || escaping) { + re += "\\|" + escaping = false + continue + } + + clearStateChar() + re += "|" + continue + + // these are mostly the same in regexp and glob + case "[": + // swallow any state-tracking char before the [ + clearStateChar() + + if (inClass) { + re += "\\" + c + continue + } + + inClass = true + classStart = i + reClassStart = re.length + re += c + continue + + case "]": + // a right bracket shall lose its special + // meaning and represent itself in + // a bracket expression if it occurs + // first in the list. -- POSIX.2 2.8.3.2 + if (i === classStart + 1 || !inClass) { + re += "\\" + c + escaping = false + continue + } + + // finish up the class. + hasMagic = true + inClass = false + re += c + continue + + default: + // swallow any state char that wasn't consumed + clearStateChar() + + if (escaping) { + // no need + escaping = false + } else if (reSpecials[c] + && !(c === "^" && inClass)) { + re += "\\" + } + + re += c + + } // switch + } // for + + + // handle the case where we left a class open. + // "[abc" is valid, equivalent to "\[abc" + if (inClass) { + // split where the last [ was, and escape it + // this is a huge pita. We now have to re-walk + // the contents of the would-be class to re-translate + // any characters that were passed through as-is + var cs = pattern.substr(classStart + 1) + , sp = this.parse(cs, SUBPARSE) + re = re.substr(0, reClassStart) + "\\[" + sp[0] + hasMagic = hasMagic || sp[1] + } + + // handle the case where we had a +( thing at the *end* + // of the pattern. + // each pattern list stack adds 3 chars, and we need to go through + // and escape any | chars that were passed through as-is for the regexp. + // Go through and escape them, taking care not to double-escape any + // | chars that were already escaped. + var pl + while (pl = patternListStack.pop()) { + var tail = re.slice(pl.reStart + 3) + // maybe some even number of \, then maybe 1 \, followed by a | + tail = tail.replace(/((?:\\{2})*)(\\?)\|/g, function (_, $1, $2) { + if (!$2) { + // the | isn't already escaped, so escape it. + $2 = "\\" + } + + // need to escape all those slashes *again*, without escaping the + // one that we need for escaping the | character. As it works out, + // escaping an even number of slashes can be done by simply repeating + // it exactly after itself. That's why this trick works. + // + // I am sorry that you have to see this. + return $1 + $1 + $2 + "|" + }) + + this.debug("tail=%j\n %s", tail, tail) + var t = pl.type === "*" ? star + : pl.type === "?" ? qmark + : "\\" + pl.type + + hasMagic = true + re = re.slice(0, pl.reStart) + + t + "\\(" + + tail + } + + // handle trailing things that only matter at the very end. + clearStateChar() + if (escaping) { + // trailing \\ + re += "\\\\" + } + + // only need to apply the nodot start if the re starts with + // something that could conceivably capture a dot + var addPatternStart = false + switch (re.charAt(0)) { + case ".": + case "[": + case "(": addPatternStart = true + } + + // if the re is not "" at this point, then we need to make sure + // it doesn't match against an empty path part. + // Otherwise a/* will match a/, which it should not. + if (re !== "" && hasMagic) re = "(?=.)" + re + + if (addPatternStart) re = patternStart + re + + // parsing just a piece of a larger pattern. + if (isSub === SUBPARSE) { + return [ re, hasMagic ] + } + + // skip the regexp for non-magical patterns + // unescape anything in it, though, so that it'll be + // an exact match against a file etc. + if (!hasMagic) { + return globUnescape(pattern) + } + + var flags = options.nocase ? "i" : "" + , regExp = new RegExp("^" + re + "$", flags) + + regExp._glob = pattern + regExp._src = re + + return regExp +} + +minimatch.makeRe = function (pattern, options) { + return new Minimatch(pattern, options || {}).makeRe() +} + +Minimatch.prototype.makeRe = makeRe +function makeRe () { + if (this.regexp || this.regexp === false) return this.regexp + + // at this point, this.set is a 2d array of partial + // pattern strings, or "**". + // + // It's better to use .match(). This function shouldn't + // be used, really, but it's pretty convenient sometimes, + // when you just want to work with a regex. + var set = this.set + + if (!set.length) return this.regexp = false + var options = this.options + + var twoStar = options.noglobstar ? star + : options.dot ? twoStarDot + : twoStarNoDot + , flags = options.nocase ? "i" : "" + + var re = set.map(function (pattern) { + return pattern.map(function (p) { + return (p === GLOBSTAR) ? twoStar + : (typeof p === "string") ? regExpEscape(p) + : p._src + }).join("\\\/") + }).join("|") + + // must match entire pattern + // ending in a * or ** will make it less strict. + re = "^(?:" + re + ")$" + + // can match anything, as long as it's not this. + if (this.negate) re = "^(?!" + re + ").*$" + + try { + return this.regexp = new RegExp(re, flags) + } catch (ex) { + return this.regexp = false + } +} + +minimatch.match = function (list, pattern, options) { + var mm = new Minimatch(pattern, options) + list = list.filter(function (f) { + return mm.match(f) + }) + if (options.nonull && !list.length) { + list.push(pattern) + } + return list +} + +Minimatch.prototype.match = match +function match (f, partial) { + this.debug("match", f, this.pattern) + // short-circuit in the case of busted things. + // comments, etc. + if (this.comment) return false + if (this.empty) return f === "" + + if (f === "/" && partial) return true + + var options = this.options + + // windows: need to use /, not \ + // On other platforms, \ is a valid (albeit bad) filename char. + if (platform === "win32") { + f = f.split("\\").join("/") + } + + // treat the test path as a set of pathparts. + f = f.split(slashSplit) + this.debug(this.pattern, "split", f) + + // just ONE of the pattern sets in this.set needs to match + // in order for it to be valid. If negating, then just one + // match means that we have failed. + // Either way, return on the first hit. + + var set = this.set + this.debug(this.pattern, "set", set) + + var splitFile = path.basename(f.join("/")).split("/") + + for (var i = 0, l = set.length; i < l; i ++) { + var pattern = set[i], file = f + if (options.matchBase && pattern.length === 1) { + file = splitFile + } + var hit = this.matchOne(file, pattern, partial) + if (hit) { + if (options.flipNegate) return true + return !this.negate + } + } + + // didn't get any hits. this is success if it's a negative + // pattern, failure otherwise. + if (options.flipNegate) return false + return this.negate +} + +// set partial to true to test if, for example, +// "/a/b" matches the start of "/*/b/*/d" +// Partial means, if you run out of file before you run +// out of pattern, then that's fine, as long as all +// the parts match. +Minimatch.prototype.matchOne = function (file, pattern, partial) { + var options = this.options + + this.debug("matchOne", + { "this": this + , file: file + , pattern: pattern }) + + this.debug("matchOne", file.length, pattern.length) + + for ( var fi = 0 + , pi = 0 + , fl = file.length + , pl = pattern.length + ; (fi < fl) && (pi < pl) + ; fi ++, pi ++ ) { + + this.debug("matchOne loop") + var p = pattern[pi] + , f = file[fi] + + this.debug(pattern, p, f) + + // should be impossible. + // some invalid regexp stuff in the set. + if (p === false) return false + + if (p === GLOBSTAR) { + this.debug('GLOBSTAR', [pattern, p, f]) + + // "**" + // a/**/b/**/c would match the following: + // a/b/x/y/z/c + // a/x/y/z/b/c + // a/b/x/b/x/c + // a/b/c + // To do this, take the rest of the pattern after + // the **, and see if it would match the file remainder. + // If so, return success. + // If not, the ** "swallows" a segment, and try again. + // This is recursively awful. + // + // a/**/b/**/c matching a/b/x/y/z/c + // - a matches a + // - doublestar + // - matchOne(b/x/y/z/c, b/**/c) + // - b matches b + // - doublestar + // - matchOne(x/y/z/c, c) -> no + // - matchOne(y/z/c, c) -> no + // - matchOne(z/c, c) -> no + // - matchOne(c, c) yes, hit + var fr = fi + , pr = pi + 1 + if (pr === pl) { + this.debug('** at the end') + // a ** at the end will just swallow the rest. + // We have found a match. + // however, it will not swallow /.x, unless + // options.dot is set. + // . and .. are *never* matched by **, for explosively + // exponential reasons. + for ( ; fi < fl; fi ++) { + if (file[fi] === "." || file[fi] === ".." || + (!options.dot && file[fi].charAt(0) === ".")) return false + } + return true + } + + // ok, let's see if we can swallow whatever we can. + WHILE: while (fr < fl) { + var swallowee = file[fr] + + this.debug('\nglobstar while', + file, fr, pattern, pr, swallowee) + + // XXX remove this slice. Just pass the start index. + if (this.matchOne(file.slice(fr), pattern.slice(pr), partial)) { + this.debug('globstar found match!', fr, fl, swallowee) + // found a match. + return true + } else { + // can't swallow "." or ".." ever. + // can only swallow ".foo" when explicitly asked. + if (swallowee === "." || swallowee === ".." || + (!options.dot && swallowee.charAt(0) === ".")) { + this.debug("dot detected!", file, fr, pattern, pr) + break WHILE + } + + // ** swallows a segment, and continue. + this.debug('globstar swallow a segment, and continue') + fr ++ + } + } + // no match was found. + // However, in partial mode, we can't say this is necessarily over. + // If there's more *pattern* left, then + if (partial) { + // ran out of file + this.debug("\n>>> no match, partial?", file, fr, pattern, pr) + if (fr === fl) return true + } + return false + } + + // something other than ** + // non-magic patterns just have to match exactly + // patterns with magic have been turned into regexps. + var hit + if (typeof p === "string") { + if (options.nocase) { + hit = f.toLowerCase() === p.toLowerCase() + } else { + hit = f === p + } + this.debug("string match", p, f, hit) + } else { + hit = f.match(p) + this.debug("pattern match", p, f, hit) + } + + if (!hit) return false + } + + // Note: ending in / means that we'll get a final "" + // at the end of the pattern. This can only match a + // corresponding "" at the end of the file. + // If the file ends in /, then it can only match a + // a pattern that ends in /, unless the pattern just + // doesn't have any more for it. But, a/b/ should *not* + // match "a/b/*", even though "" matches against the + // [^/]*? pattern, except in partial mode, where it might + // simply not be reached yet. + // However, a/b/ should still satisfy a/* + + // now either we fell off the end of the pattern, or we're done. + if (fi === fl && pi === pl) { + // ran out of pattern and filename at the same time. + // an exact hit! + return true + } else if (fi === fl) { + // ran out of file, but still had pattern left. + // this is ok if we're doing the match as part of + // a glob fs traversal. + return partial + } else if (pi === pl) { + // ran out of pattern, still have file left. + // this is only acceptable if we're on the very last + // empty segment of a file with a trailing slash. + // a/* should match a/b/ + var emptyFileEnd = (fi === fl - 1) && (file[fi] === "") + return emptyFileEnd + } + + // should be unreachable. + throw new Error("wtf?") +} + + +// replace stuff like \* with * +function globUnescape (s) { + return s.replace(/\\(.)/g, "$1") +} + + +function regExpEscape (s) { + return s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&") +} + +})( typeof require === "function" ? require : null, + this, + typeof module === "object" ? module : null, + typeof process === "object" ? process.platform : "win32" + ) diff --git a/node_modules/minimatch/package.json b/node_modules/minimatch/package.json new file mode 100644 index 0000000..814cb0a --- /dev/null +++ b/node_modules/minimatch/package.json @@ -0,0 +1,28 @@ +{ + "author": "Isaac Z. Schlueter (http://blog.izs.me)", + "name": "minimatch", + "description": "a glob matcher in javascript", + "version": "0.2.14", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/minimatch.git" + }, + "main": "minimatch.js", + "scripts": { + "test": "tap test/*.js" + }, + "engines": { + "node": "*" + }, + "dependencies": { + "lru-cache": "2", + "sigmund": "~1.0.0" + }, + "devDependencies": { + "tap": "" + }, + "license": { + "type": "MIT", + "url": "http://github.com/isaacs/minimatch/raw/master/LICENSE" + } +} diff --git a/node_modules/minimatch/test/basic.js b/node_modules/minimatch/test/basic.js new file mode 100644 index 0000000..ae7ac73 --- /dev/null +++ b/node_modules/minimatch/test/basic.js @@ -0,0 +1,399 @@ +// http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test +// +// TODO: Some of these tests do very bad things with backslashes, and will +// most likely fail badly on windows. They should probably be skipped. + +var tap = require("tap") + , globalBefore = Object.keys(global) + , mm = require("../") + , files = [ "a", "b", "c", "d", "abc" + , "abd", "abe", "bb", "bcd" + , "ca", "cb", "dd", "de" + , "bdir/", "bdir/cfile"] + , next = files.concat([ "a-b", "aXb" + , ".x", ".y" ]) + + +var patterns = + [ "http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test" + , ["a*", ["a", "abc", "abd", "abe"]] + , ["X*", ["X*"], {nonull: true}] + + // allow null glob expansion + , ["X*", []] + + // isaacs: Slightly different than bash/sh/ksh + // \\* is not un-escaped to literal "*" in a failed match, + // but it does make it get treated as a literal star + , ["\\*", ["\\*"], {nonull: true}] + , ["\\**", ["\\**"], {nonull: true}] + , ["\\*\\*", ["\\*\\*"], {nonull: true}] + + , ["b*/", ["bdir/"]] + , ["c*", ["c", "ca", "cb"]] + , ["**", files] + + , ["\\.\\./*/", ["\\.\\./*/"], {nonull: true}] + , ["s/\\..*//", ["s/\\..*//"], {nonull: true}] + + , "legendary larry crashes bashes" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"], {nonull: true}] + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"], {nonull: true}] + + , "character classes" + , ["[a-c]b*", ["abc", "abd", "abe", "bb", "cb"]] + , ["[a-y]*[^c]", ["abd", "abe", "bb", "bcd", + "bdir/", "ca", "cb", "dd", "de"]] + , ["a*[^c]", ["abd", "abe"]] + , function () { files.push("a-b", "aXb") } + , ["a[X-]b", ["a-b", "aXb"]] + , function () { files.push(".x", ".y") } + , ["[^a-c]*", ["d", "dd", "de"]] + , function () { files.push("a*b/", "a*b/ooo") } + , ["a\\*b/*", ["a*b/ooo"]] + , ["a\\*?/*", ["a*b/ooo"]] + , ["*\\\\!*", [], {null: true}, ["echo !7"]] + , ["*\\!*", ["echo !7"], null, ["echo !7"]] + , ["*.\\*", ["r.*"], null, ["r.*"]] + , ["a[b]c", ["abc"]] + , ["a[\\b]c", ["abc"]] + , ["a?c", ["abc"]] + , ["a\\*c", [], {null: true}, ["abc"]] + , ["", [""], { null: true }, [""]] + + , "http://www.opensource.apple.com/source/bash/bash-23/" + + "bash/tests/glob-test" + , function () { files.push("man/", "man/man1/", "man/man1/bash.1") } + , ["*/man*/bash.*", ["man/man1/bash.1"]] + , ["man/man1/bash.1", ["man/man1/bash.1"]] + , ["a***c", ["abc"], null, ["abc"]] + , ["a*****?c", ["abc"], null, ["abc"]] + , ["?*****??", ["abc"], null, ["abc"]] + , ["*****??", ["abc"], null, ["abc"]] + , ["?*****?c", ["abc"], null, ["abc"]] + , ["?***?****c", ["abc"], null, ["abc"]] + , ["?***?****?", ["abc"], null, ["abc"]] + , ["?***?****", ["abc"], null, ["abc"]] + , ["*******c", ["abc"], null, ["abc"]] + , ["*******?", ["abc"], null, ["abc"]] + , ["a*cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??k***", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??***k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??***k**", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a****c**?**??*****", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["[-abc]", ["-"], null, ["-"]] + , ["[abc-]", ["-"], null, ["-"]] + , ["\\", ["\\"], null, ["\\"]] + , ["[\\\\]", ["\\"], null, ["\\"]] + , ["[[]", ["["], null, ["["]] + , ["[", ["["], null, ["["]] + , ["[*", ["[abc"], null, ["[abc"]] + , "a right bracket shall lose its special meaning and\n" + + "represent itself in a bracket expression if it occurs\n" + + "first in the list. -- POSIX.2 2.8.3.2" + , ["[]]", ["]"], null, ["]"]] + , ["[]-]", ["]"], null, ["]"]] + , ["[a-\z]", ["p"], null, ["p"]] + , ["??**********?****?", [], { null: true }, ["abc"]] + , ["??**********?****c", [], { null: true }, ["abc"]] + , ["?************c****?****", [], { null: true }, ["abc"]] + , ["*c*?**", [], { null: true }, ["abc"]] + , ["a*****c*?**", [], { null: true }, ["abc"]] + , ["a********???*******", [], { null: true }, ["abc"]] + , ["[]", [], { null: true }, ["a"]] + , ["[abc", [], { null: true }, ["["]] + + , "nocase tests" + , ["XYZ", ["xYz"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + , ["ab*", ["ABC"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + , ["[ia]?[ck]", ["ABC", "IjK"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + + // [ pattern, [matches], MM opts, files, TAP opts] + , "onestar/twostar" + , ["{/*,*}", [], {null: true}, ["/asdf/asdf/asdf"]] + , ["{/?,*}", ["/a", "bb"], {null: true} + , ["/a", "/b/b", "/a/b/c", "bb"]] + + , "dots should not match unless requested" + , ["**", ["a/b"], {}, ["a/b", "a/.d", ".a/.d"]] + + // .. and . can only match patterns starting with ., + // even when options.dot is set. + , function () { + files = ["a/./b", "a/../b", "a/c/b", "a/.d/b"] + } + , ["a/*/b", ["a/c/b", "a/.d/b"], {dot: true}] + , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: true}] + , ["a/*/b", ["a/c/b"], {dot:false}] + , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: false}] + + + // this also tests that changing the options needs + // to change the cache key, even if the pattern is + // the same! + , ["**", ["a/b","a/.d",".a/.d"], { dot: true } + , [ ".a/.d", "a/.d", "a/b"]] + + , "paren sets cannot contain slashes" + , ["*(a/b)", ["*(a/b)"], {nonull: true}, ["a/b"]] + + // brace sets trump all else. + // + // invalid glob pattern. fails on bash4 and bsdglob. + // however, in this implementation, it's easier just + // to do the intuitive thing, and let brace-expansion + // actually come before parsing any extglob patterns, + // like the documentation seems to say. + // + // XXX: if anyone complains about this, either fix it + // or tell them to grow up and stop complaining. + // + // bash/bsdglob says this: + // , ["*(a|{b),c)}", ["*(a|{b),c)}"], {}, ["a", "ab", "ac", "ad"]] + // but we do this instead: + , ["*(a|{b),c)}", ["a", "ab", "ac"], {}, ["a", "ab", "ac", "ad"]] + + // test partial parsing in the presence of comment/negation chars + , ["[!a*", ["[!ab"], {}, ["[!ab", "[ab"]] + , ["[#a*", ["[#ab"], {}, ["[#ab", "[ab"]] + + // like: {a,b|c\\,d\\\|e} except it's unclosed, so it has to be escaped. + , ["+(a|*\\|c\\\\|d\\\\\\|e\\\\\\\\|f\\\\\\\\\\|g" + , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g"] + , {} + , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g", "a", "b\\c"]] + + + // crazy nested {,,} and *(||) tests. + , function () { + files = [ "a", "b", "c", "d" + , "ab", "ac", "ad" + , "bc", "cb" + , "bc,d", "c,db", "c,d" + , "d)", "(b|c", "*(b|c" + , "b|c", "b|cc", "cb|c" + , "x(a|b|c)", "x(a|c)" + , "(a|b|c)", "(a|c)"] + } + , ["*(a|{b,c})", ["a", "b", "c", "ab", "ac"]] + , ["{a,*(b|c,d)}", ["a","(b|c", "*(b|c", "d)"]] + // a + // *(b|c) + // *(b|d) + , ["{a,*(b|{c,d})}", ["a","b", "bc", "cb", "c", "d"]] + , ["*(a|{b|c,c})", ["a", "b", "c", "ab", "ac", "bc", "cb"]] + + + // test various flag settings. + , [ "*(a|{b|c,c})", ["x(a|b|c)", "x(a|c)", "(a|b|c)", "(a|c)"] + , { noext: true } ] + , ["a?b", ["x/y/acb", "acb/"], {matchBase: true} + , ["x/y/acb", "acb/", "acb/d/e", "x/y/acb/d"] ] + , ["#*", ["#a", "#b"], {nocomment: true}, ["#a", "#b", "c#d"]] + + + // begin channelling Boole and deMorgan... + , "negation tests" + , function () { + files = ["d", "e", "!ab", "!abc", "a!b", "\\!a"] + } + + // anything that is NOT a* matches. + , ["!a*", ["\\!a", "d", "e", "!ab", "!abc"]] + + // anything that IS !a* matches. + , ["!a*", ["!ab", "!abc"], {nonegate: true}] + + // anything that IS a* matches + , ["!!a*", ["a!b"]] + + // anything that is NOT !a* matches + , ["!\\!a*", ["a!b", "d", "e", "\\!a"]] + + // negation nestled within a pattern + , function () { + files = [ "foo.js" + , "foo.bar" + // can't match this one without negative lookbehind. + , "foo.js.js" + , "blar.js" + , "foo." + , "boo.js.boo" ] + } + , ["*.!(js)", ["foo.bar", "foo.", "boo.js.boo"] ] + + // https://github.com/isaacs/minimatch/issues/5 + , function () { + files = [ 'a/b/.x/c' + , 'a/b/.x/c/d' + , 'a/b/.x/c/d/e' + , 'a/b/.x' + , 'a/b/.x/' + , 'a/.x/b' + , '.x' + , '.x/' + , '.x/a' + , '.x/a/b' + , 'a/.x/b/.x/c' + , '.x/.x' ] + } + , ["**/.x/**", [ '.x/' + , '.x/a' + , '.x/a/b' + , 'a/.x/b' + , 'a/b/.x/' + , 'a/b/.x/c' + , 'a/b/.x/c/d' + , 'a/b/.x/c/d/e' ] ] + + ] + +var regexps = + [ '/^(?:(?=.)a[^/]*?)$/', + '/^(?:(?=.)X[^/]*?)$/', + '/^(?:(?=.)X[^/]*?)$/', + '/^(?:\\*)$/', + '/^(?:(?=.)\\*[^/]*?)$/', + '/^(?:\\*\\*)$/', + '/^(?:(?=.)b[^/]*?\\/)$/', + '/^(?:(?=.)c[^/]*?)$/', + '/^(?:(?:(?!(?:\\/|^)\\.).)*?)$/', + '/^(?:\\.\\.\\/(?!\\.)(?=.)[^/]*?\\/)$/', + '/^(?:s\\/(?=.)\\.\\.[^/]*?\\/)$/', + '/^(?:\\/\\^root:\\/\\{s\\/(?=.)\\^[^:][^/]*?:[^:][^/]*?:\\([^:]\\)[^/]*?\\.[^/]*?\\$\\/1\\/)$/', + '/^(?:\\/\\^root:\\/\\{s\\/(?=.)\\^[^:][^/]*?:[^:][^/]*?:\\([^:]\\)[^/]*?\\.[^/]*?\\$\\/\u0001\\/)$/', + '/^(?:(?!\\.)(?=.)[a-c]b[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[a-y][^/]*?[^c])$/', + '/^(?:(?=.)a[^/]*?[^c])$/', + '/^(?:(?=.)a[X-]b)$/', + '/^(?:(?!\\.)(?=.)[^a-c][^/]*?)$/', + '/^(?:a\\*b\\/(?!\\.)(?=.)[^/]*?)$/', + '/^(?:(?=.)a\\*[^/]\\/(?!\\.)(?=.)[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\\\\\![^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\![^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\.\\*)$/', + '/^(?:(?=.)a[b]c)$/', + '/^(?:(?=.)a[b]c)$/', + '/^(?:(?=.)a[^/]c)$/', + '/^(?:a\\*c)$/', + 'false', + '/^(?:(?!\\.)(?=.)[^/]*?\\/(?=.)man[^/]*?\\/(?=.)bash\\.[^/]*?)$/', + '/^(?:man\\/man1\\/bash\\.1)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?c)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]c)$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/])$/', + '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/])$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]c)$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?c)$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/])$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c)$/', + '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/])$/', + '/^(?:(?=.)a[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k[^/]*?[^/]*?[^/]*?)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?k)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?k[^/]*?[^/]*?)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[-abc])$/', + '/^(?:(?!\\.)(?=.)[abc-])$/', + '/^(?:\\\\)$/', + '/^(?:(?!\\.)(?=.)[\\\\])$/', + '/^(?:(?!\\.)(?=.)[\\[])$/', + '/^(?:\\[)$/', + '/^(?:(?=.)\\[(?!\\.)(?=.)[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[\\]])$/', + '/^(?:(?!\\.)(?=.)[\\]-])$/', + '/^(?:(?!\\.)(?=.)[a-z])$/', + '/^(?:(?!\\.)(?=.)[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/])$/', + '/^(?:(?!\\.)(?=.)[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?c)$/', + '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?c[^/]*?[^/][^/]*?[^/]*?)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/][^/]*?[^/]*?)$/', + '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?)$/', + '/^(?:\\[\\])$/', + '/^(?:\\[abc)$/', + '/^(?:(?=.)XYZ)$/i', + '/^(?:(?=.)ab[^/]*?)$/i', + '/^(?:(?!\\.)(?=.)[ia][^/][ck])$/i', + '/^(?:\\/(?!\\.)(?=.)[^/]*?|(?!\\.)(?=.)[^/]*?)$/', + '/^(?:\\/(?!\\.)(?=.)[^/]|(?!\\.)(?=.)[^/]*?)$/', + '/^(?:(?:(?!(?:\\/|^)\\.).)*?)$/', + '/^(?:a\\/(?!(?:^|\\/)\\.{1,2}(?:$|\\/))(?=.)[^/]*?\\/b)$/', + '/^(?:a\\/(?=.)\\.[^/]*?\\/b)$/', + '/^(?:a\\/(?!\\.)(?=.)[^/]*?\\/b)$/', + '/^(?:a\\/(?=.)\\.[^/]*?\\/b)$/', + '/^(?:(?:(?!(?:\\/|^)(?:\\.{1,2})($|\\/)).)*?)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\(a\\/b\\))$/', + '/^(?:(?!\\.)(?=.)(?:a|b)*|(?!\\.)(?=.)(?:a|c)*)$/', + '/^(?:(?=.)\\[(?=.)\\!a[^/]*?)$/', + '/^(?:(?=.)\\[(?=.)#a[^/]*?)$/', + '/^(?:(?=.)\\+\\(a\\|[^/]*?\\|c\\\\\\\\\\|d\\\\\\\\\\|e\\\\\\\\\\\\\\\\\\|f\\\\\\\\\\\\\\\\\\|g)$/', + '/^(?:(?!\\.)(?=.)(?:a|b)*|(?!\\.)(?=.)(?:a|c)*)$/', + '/^(?:a|(?!\\.)(?=.)[^/]*?\\(b\\|c|d\\))$/', + '/^(?:a|(?!\\.)(?=.)(?:b|c)*|(?!\\.)(?=.)(?:b|d)*)$/', + '/^(?:(?!\\.)(?=.)(?:a|b|c)*|(?!\\.)(?=.)(?:a|c)*)$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\(a\\|b\\|c\\)|(?!\\.)(?=.)[^/]*?\\(a\\|c\\))$/', + '/^(?:(?=.)a[^/]b)$/', + '/^(?:(?=.)#[^/]*?)$/', + '/^(?!^(?:(?=.)a[^/]*?)$).*$/', + '/^(?:(?=.)\\!a[^/]*?)$/', + '/^(?:(?=.)a[^/]*?)$/', + '/^(?!^(?:(?=.)\\!a[^/]*?)$).*$/', + '/^(?:(?!\\.)(?=.)[^/]*?\\.(?:(?!js)[^/]*?))$/', + '/^(?:(?:(?!(?:\\/|^)\\.).)*?\\/\\.x\\/(?:(?!(?:\\/|^)\\.).)*?)$/' ] +var re = 0; + +tap.test("basic tests", function (t) { + var start = Date.now() + + // [ pattern, [matches], MM opts, files, TAP opts] + patterns.forEach(function (c) { + if (typeof c === "function") return c() + if (typeof c === "string") return t.comment(c) + + var pattern = c[0] + , expect = c[1].sort(alpha) + , options = c[2] || {} + , f = c[3] || files + , tapOpts = c[4] || {} + + // options.debug = true + var m = new mm.Minimatch(pattern, options) + var r = m.makeRe() + var expectRe = regexps[re++] + tapOpts.re = String(r) || JSON.stringify(r) + tapOpts.files = JSON.stringify(f) + tapOpts.pattern = pattern + tapOpts.set = m.set + tapOpts.negated = m.negate + + var actual = mm.match(f, pattern, options) + actual.sort(alpha) + + t.equivalent( actual, expect + , JSON.stringify(pattern) + " " + JSON.stringify(expect) + , tapOpts ) + + t.equal(tapOpts.re, expectRe, tapOpts) + }) + + t.comment("time=" + (Date.now() - start) + "ms") + t.end() +}) + +tap.test("global leak test", function (t) { + var globalAfter = Object.keys(global) + t.equivalent(globalAfter, globalBefore, "no new globals, please") + t.end() +}) + +function alpha (a, b) { + return a > b ? 1 : -1 +} diff --git a/node_modules/minimatch/test/brace-expand.js b/node_modules/minimatch/test/brace-expand.js new file mode 100644 index 0000000..7ee278a --- /dev/null +++ b/node_modules/minimatch/test/brace-expand.js @@ -0,0 +1,33 @@ +var tap = require("tap") + , minimatch = require("../") + +tap.test("brace expansion", function (t) { + // [ pattern, [expanded] ] + ; [ [ "a{b,c{d,e},{f,g}h}x{y,z}" + , [ "abxy" + , "abxz" + , "acdxy" + , "acdxz" + , "acexy" + , "acexz" + , "afhxy" + , "afhxz" + , "aghxy" + , "aghxz" ] ] + , [ "a{1..5}b" + , [ "a1b" + , "a2b" + , "a3b" + , "a4b" + , "a5b" ] ] + , [ "a{b}c", ["a{b}c"] ] + ].forEach(function (tc) { + var p = tc[0] + , expect = tc[1] + t.equivalent(minimatch.braceExpand(p), expect, p) + }) + console.error("ending") + t.end() +}) + + diff --git a/node_modules/minimatch/test/caching.js b/node_modules/minimatch/test/caching.js new file mode 100644 index 0000000..0fec4b0 --- /dev/null +++ b/node_modules/minimatch/test/caching.js @@ -0,0 +1,14 @@ +var Minimatch = require("../minimatch.js").Minimatch +var tap = require("tap") +tap.test("cache test", function (t) { + var mm1 = new Minimatch("a?b") + var mm2 = new Minimatch("a?b") + t.equal(mm1, mm2, "should get the same object") + // the lru should drop it after 100 entries + for (var i = 0; i < 100; i ++) { + new Minimatch("a"+i) + } + mm2 = new Minimatch("a?b") + t.notEqual(mm1, mm2, "cache should have dropped") + t.end() +}) diff --git a/node_modules/minimatch/test/defaults.js b/node_modules/minimatch/test/defaults.js new file mode 100644 index 0000000..25f1f60 --- /dev/null +++ b/node_modules/minimatch/test/defaults.js @@ -0,0 +1,274 @@ +// http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test +// +// TODO: Some of these tests do very bad things with backslashes, and will +// most likely fail badly on windows. They should probably be skipped. + +var tap = require("tap") + , globalBefore = Object.keys(global) + , mm = require("../") + , files = [ "a", "b", "c", "d", "abc" + , "abd", "abe", "bb", "bcd" + , "ca", "cb", "dd", "de" + , "bdir/", "bdir/cfile"] + , next = files.concat([ "a-b", "aXb" + , ".x", ".y" ]) + +tap.test("basic tests", function (t) { + var start = Date.now() + + // [ pattern, [matches], MM opts, files, TAP opts] + ; [ "http://www.bashcookbook.com/bashinfo" + + "/source/bash-1.14.7/tests/glob-test" + , ["a*", ["a", "abc", "abd", "abe"]] + , ["X*", ["X*"], {nonull: true}] + + // allow null glob expansion + , ["X*", []] + + // isaacs: Slightly different than bash/sh/ksh + // \\* is not un-escaped to literal "*" in a failed match, + // but it does make it get treated as a literal star + , ["\\*", ["\\*"], {nonull: true}] + , ["\\**", ["\\**"], {nonull: true}] + , ["\\*\\*", ["\\*\\*"], {nonull: true}] + + , ["b*/", ["bdir/"]] + , ["c*", ["c", "ca", "cb"]] + , ["**", files] + + , ["\\.\\./*/", ["\\.\\./*/"], {nonull: true}] + , ["s/\\..*//", ["s/\\..*//"], {nonull: true}] + + , "legendary larry crashes bashes" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"], {nonull: true}] + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/" + , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"], {nonull: true}] + + , "character classes" + , ["[a-c]b*", ["abc", "abd", "abe", "bb", "cb"]] + , ["[a-y]*[^c]", ["abd", "abe", "bb", "bcd", + "bdir/", "ca", "cb", "dd", "de"]] + , ["a*[^c]", ["abd", "abe"]] + , function () { files.push("a-b", "aXb") } + , ["a[X-]b", ["a-b", "aXb"]] + , function () { files.push(".x", ".y") } + , ["[^a-c]*", ["d", "dd", "de"]] + , function () { files.push("a*b/", "a*b/ooo") } + , ["a\\*b/*", ["a*b/ooo"]] + , ["a\\*?/*", ["a*b/ooo"]] + , ["*\\\\!*", [], {null: true}, ["echo !7"]] + , ["*\\!*", ["echo !7"], null, ["echo !7"]] + , ["*.\\*", ["r.*"], null, ["r.*"]] + , ["a[b]c", ["abc"]] + , ["a[\\b]c", ["abc"]] + , ["a?c", ["abc"]] + , ["a\\*c", [], {null: true}, ["abc"]] + , ["", [""], { null: true }, [""]] + + , "http://www.opensource.apple.com/source/bash/bash-23/" + + "bash/tests/glob-test" + , function () { files.push("man/", "man/man1/", "man/man1/bash.1") } + , ["*/man*/bash.*", ["man/man1/bash.1"]] + , ["man/man1/bash.1", ["man/man1/bash.1"]] + , ["a***c", ["abc"], null, ["abc"]] + , ["a*****?c", ["abc"], null, ["abc"]] + , ["?*****??", ["abc"], null, ["abc"]] + , ["*****??", ["abc"], null, ["abc"]] + , ["?*****?c", ["abc"], null, ["abc"]] + , ["?***?****c", ["abc"], null, ["abc"]] + , ["?***?****?", ["abc"], null, ["abc"]] + , ["?***?****", ["abc"], null, ["abc"]] + , ["*******c", ["abc"], null, ["abc"]] + , ["*******?", ["abc"], null, ["abc"]] + , ["a*cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??k***", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??***k", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a**?**cd**?**??***k**", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["a****c**?**??*****", ["abcdecdhjk"], null, ["abcdecdhjk"]] + , ["[-abc]", ["-"], null, ["-"]] + , ["[abc-]", ["-"], null, ["-"]] + , ["\\", ["\\"], null, ["\\"]] + , ["[\\\\]", ["\\"], null, ["\\"]] + , ["[[]", ["["], null, ["["]] + , ["[", ["["], null, ["["]] + , ["[*", ["[abc"], null, ["[abc"]] + , "a right bracket shall lose its special meaning and\n" + + "represent itself in a bracket expression if it occurs\n" + + "first in the list. -- POSIX.2 2.8.3.2" + , ["[]]", ["]"], null, ["]"]] + , ["[]-]", ["]"], null, ["]"]] + , ["[a-\z]", ["p"], null, ["p"]] + , ["??**********?****?", [], { null: true }, ["abc"]] + , ["??**********?****c", [], { null: true }, ["abc"]] + , ["?************c****?****", [], { null: true }, ["abc"]] + , ["*c*?**", [], { null: true }, ["abc"]] + , ["a*****c*?**", [], { null: true }, ["abc"]] + , ["a********???*******", [], { null: true }, ["abc"]] + , ["[]", [], { null: true }, ["a"]] + , ["[abc", [], { null: true }, ["["]] + + , "nocase tests" + , ["XYZ", ["xYz"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + , ["ab*", ["ABC"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + , ["[ia]?[ck]", ["ABC", "IjK"], { nocase: true, null: true } + , ["xYz", "ABC", "IjK"]] + + // [ pattern, [matches], MM opts, files, TAP opts] + , "onestar/twostar" + , ["{/*,*}", [], {null: true}, ["/asdf/asdf/asdf"]] + , ["{/?,*}", ["/a", "bb"], {null: true} + , ["/a", "/b/b", "/a/b/c", "bb"]] + + , "dots should not match unless requested" + , ["**", ["a/b"], {}, ["a/b", "a/.d", ".a/.d"]] + + // .. and . can only match patterns starting with ., + // even when options.dot is set. + , function () { + files = ["a/./b", "a/../b", "a/c/b", "a/.d/b"] + } + , ["a/*/b", ["a/c/b", "a/.d/b"], {dot: true}] + , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: true}] + , ["a/*/b", ["a/c/b"], {dot:false}] + , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: false}] + + + // this also tests that changing the options needs + // to change the cache key, even if the pattern is + // the same! + , ["**", ["a/b","a/.d",".a/.d"], { dot: true } + , [ ".a/.d", "a/.d", "a/b"]] + + , "paren sets cannot contain slashes" + , ["*(a/b)", ["*(a/b)"], {nonull: true}, ["a/b"]] + + // brace sets trump all else. + // + // invalid glob pattern. fails on bash4 and bsdglob. + // however, in this implementation, it's easier just + // to do the intuitive thing, and let brace-expansion + // actually come before parsing any extglob patterns, + // like the documentation seems to say. + // + // XXX: if anyone complains about this, either fix it + // or tell them to grow up and stop complaining. + // + // bash/bsdglob says this: + // , ["*(a|{b),c)}", ["*(a|{b),c)}"], {}, ["a", "ab", "ac", "ad"]] + // but we do this instead: + , ["*(a|{b),c)}", ["a", "ab", "ac"], {}, ["a", "ab", "ac", "ad"]] + + // test partial parsing in the presence of comment/negation chars + , ["[!a*", ["[!ab"], {}, ["[!ab", "[ab"]] + , ["[#a*", ["[#ab"], {}, ["[#ab", "[ab"]] + + // like: {a,b|c\\,d\\\|e} except it's unclosed, so it has to be escaped. + , ["+(a|*\\|c\\\\|d\\\\\\|e\\\\\\\\|f\\\\\\\\\\|g" + , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g"] + , {} + , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g", "a", "b\\c"]] + + + // crazy nested {,,} and *(||) tests. + , function () { + files = [ "a", "b", "c", "d" + , "ab", "ac", "ad" + , "bc", "cb" + , "bc,d", "c,db", "c,d" + , "d)", "(b|c", "*(b|c" + , "b|c", "b|cc", "cb|c" + , "x(a|b|c)", "x(a|c)" + , "(a|b|c)", "(a|c)"] + } + , ["*(a|{b,c})", ["a", "b", "c", "ab", "ac"]] + , ["{a,*(b|c,d)}", ["a","(b|c", "*(b|c", "d)"]] + // a + // *(b|c) + // *(b|d) + , ["{a,*(b|{c,d})}", ["a","b", "bc", "cb", "c", "d"]] + , ["*(a|{b|c,c})", ["a", "b", "c", "ab", "ac", "bc", "cb"]] + + + // test various flag settings. + , [ "*(a|{b|c,c})", ["x(a|b|c)", "x(a|c)", "(a|b|c)", "(a|c)"] + , { noext: true } ] + , ["a?b", ["x/y/acb", "acb/"], {matchBase: true} + , ["x/y/acb", "acb/", "acb/d/e", "x/y/acb/d"] ] + , ["#*", ["#a", "#b"], {nocomment: true}, ["#a", "#b", "c#d"]] + + + // begin channelling Boole and deMorgan... + , "negation tests" + , function () { + files = ["d", "e", "!ab", "!abc", "a!b", "\\!a"] + } + + // anything that is NOT a* matches. + , ["!a*", ["\\!a", "d", "e", "!ab", "!abc"]] + + // anything that IS !a* matches. + , ["!a*", ["!ab", "!abc"], {nonegate: true}] + + // anything that IS a* matches + , ["!!a*", ["a!b"]] + + // anything that is NOT !a* matches + , ["!\\!a*", ["a!b", "d", "e", "\\!a"]] + + // negation nestled within a pattern + , function () { + files = [ "foo.js" + , "foo.bar" + // can't match this one without negative lookbehind. + , "foo.js.js" + , "blar.js" + , "foo." + , "boo.js.boo" ] + } + , ["*.!(js)", ["foo.bar", "foo.", "boo.js.boo"] ] + + ].forEach(function (c) { + if (typeof c === "function") return c() + if (typeof c === "string") return t.comment(c) + + var pattern = c[0] + , expect = c[1].sort(alpha) + , options = c[2] || {} + , f = c[3] || files + , tapOpts = c[4] || {} + + // options.debug = true + var Class = mm.defaults(options).Minimatch + var m = new Class(pattern, {}) + var r = m.makeRe() + tapOpts.re = String(r) || JSON.stringify(r) + tapOpts.files = JSON.stringify(f) + tapOpts.pattern = pattern + tapOpts.set = m.set + tapOpts.negated = m.negate + + var actual = mm.match(f, pattern, options) + actual.sort(alpha) + + t.equivalent( actual, expect + , JSON.stringify(pattern) + " " + JSON.stringify(expect) + , tapOpts ) + }) + + t.comment("time=" + (Date.now() - start) + "ms") + t.end() +}) + +tap.test("global leak test", function (t) { + var globalAfter = Object.keys(global) + t.equivalent(globalAfter, globalBefore, "no new globals, please") + t.end() +}) + +function alpha (a, b) { + return a > b ? 1 : -1 +} diff --git a/node_modules/minimatch/test/extglob-ending-with-state-char.js b/node_modules/minimatch/test/extglob-ending-with-state-char.js new file mode 100644 index 0000000..6676e26 --- /dev/null +++ b/node_modules/minimatch/test/extglob-ending-with-state-char.js @@ -0,0 +1,8 @@ +var test = require('tap').test +var minimatch = require('../') + +test('extglob ending with statechar', function(t) { + t.notOk(minimatch('ax', 'a?(b*)')) + t.ok(minimatch('ax', '?(a*|b)')) + t.end() +}) diff --git a/node_modules/mkdirp/.npmignore b/node_modules/mkdirp/.npmignore new file mode 100644 index 0000000..9303c34 --- /dev/null +++ b/node_modules/mkdirp/.npmignore @@ -0,0 +1,2 @@ +node_modules/ +npm-debug.log \ No newline at end of file diff --git a/node_modules/mkdirp/.travis.yml b/node_modules/mkdirp/.travis.yml new file mode 100644 index 0000000..84fd7ca --- /dev/null +++ b/node_modules/mkdirp/.travis.yml @@ -0,0 +1,5 @@ +language: node_js +node_js: + - 0.6 + - 0.8 + - 0.9 diff --git a/node_modules/mkdirp/LICENSE b/node_modules/mkdirp/LICENSE new file mode 100644 index 0000000..432d1ae --- /dev/null +++ b/node_modules/mkdirp/LICENSE @@ -0,0 +1,21 @@ +Copyright 2010 James Halliday (mail@substack.net) + +This project is free software released under the MIT/X11 license: + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/mkdirp/examples/pow.js b/node_modules/mkdirp/examples/pow.js new file mode 100644 index 0000000..e692421 --- /dev/null +++ b/node_modules/mkdirp/examples/pow.js @@ -0,0 +1,6 @@ +var mkdirp = require('mkdirp'); + +mkdirp('/tmp/foo/bar/baz', function (err) { + if (err) console.error(err) + else console.log('pow!') +}); diff --git a/node_modules/mkdirp/index.js b/node_modules/mkdirp/index.js new file mode 100644 index 0000000..fda6de8 --- /dev/null +++ b/node_modules/mkdirp/index.js @@ -0,0 +1,82 @@ +var path = require('path'); +var fs = require('fs'); + +module.exports = mkdirP.mkdirp = mkdirP.mkdirP = mkdirP; + +function mkdirP (p, mode, f, made) { + if (typeof mode === 'function' || mode === undefined) { + f = mode; + mode = 0777 & (~process.umask()); + } + if (!made) made = null; + + var cb = f || function () {}; + if (typeof mode === 'string') mode = parseInt(mode, 8); + p = path.resolve(p); + + fs.mkdir(p, mode, function (er) { + if (!er) { + made = made || p; + return cb(null, made); + } + switch (er.code) { + case 'ENOENT': + mkdirP(path.dirname(p), mode, function (er, made) { + if (er) cb(er, made); + else mkdirP(p, mode, cb, made); + }); + break; + + // In the case of any other error, just see if there's a dir + // there already. If so, then hooray! If not, then something + // is borked. + default: + fs.stat(p, function (er2, stat) { + // if the stat fails, then that's super weird. + // let the original error be the failure reason. + if (er2 || !stat.isDirectory()) cb(er, made) + else cb(null, made); + }); + break; + } + }); +} + +mkdirP.sync = function sync (p, mode, made) { + if (mode === undefined) { + mode = 0777 & (~process.umask()); + } + if (!made) made = null; + + if (typeof mode === 'string') mode = parseInt(mode, 8); + p = path.resolve(p); + + try { + fs.mkdirSync(p, mode); + made = made || p; + } + catch (err0) { + switch (err0.code) { + case 'ENOENT' : + made = sync(path.dirname(p), mode, made); + sync(p, mode, made); + break; + + // In the case of any other error, just see if there's a dir + // there already. If so, then hooray! If not, then something + // is borked. + default: + var stat; + try { + stat = fs.statSync(p); + } + catch (err1) { + throw err0; + } + if (!stat.isDirectory()) throw err0; + break; + } + } + + return made; +}; diff --git a/node_modules/mkdirp/package.json b/node_modules/mkdirp/package.json new file mode 100644 index 0000000..8aa64fe --- /dev/null +++ b/node_modules/mkdirp/package.json @@ -0,0 +1,22 @@ +{ + "name" : "mkdirp", + "description" : "Recursively mkdir, like `mkdir -p`", + "version" : "0.3.5", + "author" : "James Halliday (http://substack.net)", + "main" : "./index", + "keywords" : [ + "mkdir", + "directory" + ], + "repository" : { + "type" : "git", + "url" : "http://github.com/substack/node-mkdirp.git" + }, + "scripts" : { + "test" : "tap test/*.js" + }, + "devDependencies" : { + "tap" : "~0.4.0" + }, + "license" : "MIT" +} diff --git a/node_modules/mkdirp/readme.markdown b/node_modules/mkdirp/readme.markdown new file mode 100644 index 0000000..83b0216 --- /dev/null +++ b/node_modules/mkdirp/readme.markdown @@ -0,0 +1,63 @@ +# mkdirp + +Like `mkdir -p`, but in node.js! + +[![build status](https://secure.travis-ci.org/substack/node-mkdirp.png)](http://travis-ci.org/substack/node-mkdirp) + +# example + +## pow.js + +```js +var mkdirp = require('mkdirp'); + +mkdirp('/tmp/foo/bar/baz', function (err) { + if (err) console.error(err) + else console.log('pow!') +}); +``` + +Output + +``` +pow! +``` + +And now /tmp/foo/bar/baz exists, huzzah! + +# methods + +```js +var mkdirp = require('mkdirp'); +``` + +## mkdirp(dir, mode, cb) + +Create a new directory and any necessary subdirectories at `dir` with octal +permission string `mode`. + +If `mode` isn't specified, it defaults to `0777 & (~process.umask())`. + +`cb(err, made)` fires with the error or the first directory `made` +that had to be created, if any. + +## mkdirp.sync(dir, mode) + +Synchronously create a new directory and any necessary subdirectories at `dir` +with octal permission string `mode`. + +If `mode` isn't specified, it defaults to `0777 & (~process.umask())`. + +Returns the first directory that had to be created, if any. + +# install + +With [npm](http://npmjs.org) do: + +``` +npm install mkdirp +``` + +# license + +MIT diff --git a/node_modules/mkdirp/test/chmod.js b/node_modules/mkdirp/test/chmod.js new file mode 100644 index 0000000..520dcb8 --- /dev/null +++ b/node_modules/mkdirp/test/chmod.js @@ -0,0 +1,38 @@ +var mkdirp = require('../').mkdirp; +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +var ps = [ '', 'tmp' ]; + +for (var i = 0; i < 25; i++) { + var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + ps.push(dir); +} + +var file = ps.join('/'); + +test('chmod-pre', function (t) { + var mode = 0744 + mkdirp(file, mode, function (er) { + t.ifError(er, 'should not error'); + fs.stat(file, function (er, stat) { + t.ifError(er, 'should exist'); + t.ok(stat && stat.isDirectory(), 'should be directory'); + t.equal(stat && stat.mode & 0777, mode, 'should be 0744'); + t.end(); + }); + }); +}); + +test('chmod', function (t) { + var mode = 0755 + mkdirp(file, mode, function (er) { + t.ifError(er, 'should not error'); + fs.stat(file, function (er, stat) { + t.ifError(er, 'should exist'); + t.ok(stat && stat.isDirectory(), 'should be directory'); + t.end(); + }); + }); +}); diff --git a/node_modules/mkdirp/test/clobber.js b/node_modules/mkdirp/test/clobber.js new file mode 100644 index 0000000..0eb7099 --- /dev/null +++ b/node_modules/mkdirp/test/clobber.js @@ -0,0 +1,37 @@ +var mkdirp = require('../').mkdirp; +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +var ps = [ '', 'tmp' ]; + +for (var i = 0; i < 25; i++) { + var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + ps.push(dir); +} + +var file = ps.join('/'); + +// a file in the way +var itw = ps.slice(0, 3).join('/'); + + +test('clobber-pre', function (t) { + console.error("about to write to "+itw) + fs.writeFileSync(itw, 'I AM IN THE WAY, THE TRUTH, AND THE LIGHT.'); + + fs.stat(itw, function (er, stat) { + t.ifError(er) + t.ok(stat && stat.isFile(), 'should be file') + t.end() + }) +}) + +test('clobber', function (t) { + t.plan(2); + mkdirp(file, 0755, function (err) { + t.ok(err); + t.equal(err.code, 'ENOTDIR'); + t.end(); + }); +}); diff --git a/node_modules/mkdirp/test/mkdirp.js b/node_modules/mkdirp/test/mkdirp.js new file mode 100644 index 0000000..b07cd70 --- /dev/null +++ b/node_modules/mkdirp/test/mkdirp.js @@ -0,0 +1,28 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('woo', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + mkdirp(file, 0755, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) + }); +}); diff --git a/node_modules/mkdirp/test/perm.js b/node_modules/mkdirp/test/perm.js new file mode 100644 index 0000000..23a7abb --- /dev/null +++ b/node_modules/mkdirp/test/perm.js @@ -0,0 +1,32 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('async perm', function (t) { + t.plan(2); + var file = '/tmp/' + (Math.random() * (1<<30)).toString(16); + + mkdirp(file, 0755, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) + }); +}); + +test('async root perm', function (t) { + mkdirp('/tmp', 0755, function (err) { + if (err) t.fail(err); + t.end(); + }); + t.end(); +}); diff --git a/node_modules/mkdirp/test/perm_sync.js b/node_modules/mkdirp/test/perm_sync.js new file mode 100644 index 0000000..f685f60 --- /dev/null +++ b/node_modules/mkdirp/test/perm_sync.js @@ -0,0 +1,39 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('sync perm', function (t) { + t.plan(2); + var file = '/tmp/' + (Math.random() * (1<<30)).toString(16) + '.json'; + + mkdirp.sync(file, 0755); + path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }); +}); + +test('sync root perm', function (t) { + t.plan(1); + + var file = '/tmp'; + mkdirp.sync(file, 0755); + path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }); +}); diff --git a/node_modules/mkdirp/test/race.js b/node_modules/mkdirp/test/race.js new file mode 100644 index 0000000..96a0447 --- /dev/null +++ b/node_modules/mkdirp/test/race.js @@ -0,0 +1,41 @@ +var mkdirp = require('../').mkdirp; +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('race', function (t) { + t.plan(4); + var ps = [ '', 'tmp' ]; + + for (var i = 0; i < 25; i++) { + var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + ps.push(dir); + } + var file = ps.join('/'); + + var res = 2; + mk(file, function () { + if (--res === 0) t.end(); + }); + + mk(file, function () { + if (--res === 0) t.end(); + }); + + function mk (file, cb) { + mkdirp(file, 0755, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + if (cb) cb(); + } + }) + }) + }); + } +}); diff --git a/node_modules/mkdirp/test/rel.js b/node_modules/mkdirp/test/rel.js new file mode 100644 index 0000000..7985824 --- /dev/null +++ b/node_modules/mkdirp/test/rel.js @@ -0,0 +1,32 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('rel', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var cwd = process.cwd(); + process.chdir('/tmp'); + + var file = [x,y,z].join('/'); + + mkdirp(file, 0755, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + process.chdir(cwd); + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) + }); +}); diff --git a/node_modules/mkdirp/test/return.js b/node_modules/mkdirp/test/return.js new file mode 100644 index 0000000..bce68e5 --- /dev/null +++ b/node_modules/mkdirp/test/return.js @@ -0,0 +1,25 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('return value', function (t) { + t.plan(4); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + // should return the first dir created. + // By this point, it would be profoundly surprising if /tmp didn't + // already exist, since every other test makes things in there. + mkdirp(file, function (err, made) { + t.ifError(err); + t.equal(made, '/tmp/' + x); + mkdirp(file, function (err, made) { + t.ifError(err); + t.equal(made, null); + }); + }); +}); diff --git a/node_modules/mkdirp/test/return_sync.js b/node_modules/mkdirp/test/return_sync.js new file mode 100644 index 0000000..7c222d3 --- /dev/null +++ b/node_modules/mkdirp/test/return_sync.js @@ -0,0 +1,24 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('return value', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + // should return the first dir created. + // By this point, it would be profoundly surprising if /tmp didn't + // already exist, since every other test makes things in there. + // Note that this will throw on failure, which will fail the test. + var made = mkdirp.sync(file); + t.equal(made, '/tmp/' + x); + + // making the same file again should have no effect. + made = mkdirp.sync(file); + t.equal(made, null); +}); diff --git a/node_modules/mkdirp/test/root.js b/node_modules/mkdirp/test/root.js new file mode 100644 index 0000000..97ad7a2 --- /dev/null +++ b/node_modules/mkdirp/test/root.js @@ -0,0 +1,18 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('root', function (t) { + // '/' on unix, 'c:/' on windows. + var file = path.resolve('/'); + + mkdirp(file, 0755, function (err) { + if (err) throw err + fs.stat(file, function (er, stat) { + if (er) throw er + t.ok(stat.isDirectory(), 'target is a directory'); + t.end(); + }) + }); +}); diff --git a/node_modules/mkdirp/test/sync.js b/node_modules/mkdirp/test/sync.js new file mode 100644 index 0000000..7530cad --- /dev/null +++ b/node_modules/mkdirp/test/sync.js @@ -0,0 +1,32 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('sync', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + try { + mkdirp.sync(file, 0755); + } catch (err) { + t.fail(err); + return t.end(); + } + + path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0755); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }); + }); +}); diff --git a/node_modules/mkdirp/test/umask.js b/node_modules/mkdirp/test/umask.js new file mode 100644 index 0000000..64ccafe --- /dev/null +++ b/node_modules/mkdirp/test/umask.js @@ -0,0 +1,28 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('implicit mode from umask', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + mkdirp(file, function (err) { + if (err) t.fail(err); + else path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, 0777 & (~process.umask())); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }) + }) + }); +}); diff --git a/node_modules/mkdirp/test/umask_sync.js b/node_modules/mkdirp/test/umask_sync.js new file mode 100644 index 0000000..35bd5cb --- /dev/null +++ b/node_modules/mkdirp/test/umask_sync.js @@ -0,0 +1,32 @@ +var mkdirp = require('../'); +var path = require('path'); +var fs = require('fs'); +var test = require('tap').test; + +test('umask sync modes', function (t) { + t.plan(2); + var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); + + var file = '/tmp/' + [x,y,z].join('/'); + + try { + mkdirp.sync(file); + } catch (err) { + t.fail(err); + return t.end(); + } + + path.exists(file, function (ex) { + if (!ex) t.fail('file not created') + else fs.stat(file, function (err, stat) { + if (err) t.fail(err) + else { + t.equal(stat.mode & 0777, (0777 & (~process.umask()))); + t.ok(stat.isDirectory(), 'target not a directory'); + t.end(); + } + }); + }); +}); diff --git a/node_modules/mocha/Readme.md b/node_modules/mocha/Readme.md new file mode 100644 index 0000000..9340cac --- /dev/null +++ b/node_modules/mocha/Readme.md @@ -0,0 +1,172 @@ + [![Build Status](https://secure.travis-ci.org/visionmedia/mocha.png)](http://travis-ci.org/visionmedia/mocha) + + [![Mocha test framework](http://f.cl.ly/items/3l1k0n2A1U3M1I1L210p/Screen%20Shot%202012-02-24%20at%202.21.43%20PM.png)](http://visionmedia.github.io/mocha) + + Mocha is a simple, flexible, fun JavaScript test framework for node.js and the browser. For more information view the [documentation](http://visionmedia.github.io/mocha). + +## Contributors + +``` + + project : mocha + repo age : 2 years, 4 months ago + commits : 1314 + active : 372 days + files : 141 + authors : + 582 TJ Holowaychuk 44.3% + 389 Tj Holowaychuk 29.6% + 46 Travis Jeffery 3.5% + 31 Guillermo Rauch 2.4% + 13 Attila Domokos 1.0% + 10 John Firebaugh 0.8% + 8 Jo Liss 0.6% + 7 Nathan Rajlich 0.5% + 6 Mike Pennisi 0.5% + 6 James Carr 0.5% + 6 Brendan Nee 0.5% + 5 Aaron Heckmann 0.4% + 5 Ryunosuke SATO 0.4% + 4 hokaccha 0.3% + 4 Joshua Krall 0.3% + 4 Xavier Antoviaque 0.3% + 3 Jesse Dailey 0.2% + 3 Forbes Lindesay 0.2% + 3 Sindre Sorhus 0.2% + 3 Cory Thomas 0.2% + 3 Fredrik Enestad 0.2% + 3 Ben Lindsey 0.2% + 3 Tyson Tate 0.2% + 3 Mathieu Desvé 0.2% + 3 Valentin Agachi 0.2% + 3 Wil Moore III 0.2% + 3 Merrick Christensen 0.2% + 3 eiji.ienaga 0.2% + 3 fool2fish 0.2% + 3 Nathan Bowser 0.2% + 3 Paul Miller 0.2% + 2 Juzer Ali 0.2% + 2 Pete Hawkins 0.2% + 2 Jonas Westerlund 0.2% + 2 Arian Stolwijk 0.2% + 2 Quang Van 0.2% + 2 Glen Mailer 0.2% + 2 Justin DuJardin 0.2% + 2 FARKAS Máté 0.2% + 2 Raynos 0.2% + 2 Michael Riley 0.2% + 2 Michael Schoonmaker 0.2% + 2 Domenic Denicola 0.2% + 2 Simon Gaeremynck 0.2% + 2 Konstantin Käfer 0.2% + 2 domenic 0.2% + 2 Paul Armstrong 0.2% + 2 fcrisci 0.2% + 2 Alexander Early 0.2% + 2 Shawn Krisman 0.2% + 2 Brian Beck 0.2% + 2 Nathan Alderson 0.2% + 2 David Henderson 0.2% + 2 Timo Tijhof 0.2% + 2 Ian Storm Taylor 0.2% + 2 travis jeffery 0.2% + 1 Matt Smith 0.1% + 1 Matthew Shanley 0.1% + 1 Nathan Black 0.1% + 1 Phil Sung 0.1% + 1 R56 0.1% + 1 Refael Ackermann 0.1% + 1 Richard Dingwall 0.1% + 1 Romain Prieto 0.1% + 1 Roman Neuhauser 0.1% + 1 Roman Shtylman 0.1% + 1 Russ Bradberry 0.1% + 1 Russell Munson 0.1% + 1 Rustem Mustafin 0.1% + 1 Salehen Shovon Rahman 0.1% + 1 Sasha Koss 0.1% + 1 Seiya Konno 0.1% + 1 Simon Goumaz 0.1% + 1 Standa Opichal 0.1% + 1 Stephen Mathieson 0.1% + 1 Steve Mason 0.1% + 1 Tapiwa Kelvin 0.1% + 1 Teddy Zeenny 0.1% + 1 Tim Ehat 0.1% + 1 Vadim Nikitin 0.1% + 1 Victor Costan 0.1% + 1 Will Langstroth 0.1% + 1 Yanis Wang 0.1% + 1 Yuest Wang 0.1% + 1 abrkn 0.1% + 1 airportyh 0.1% + 1 badunk 0.1% + 1 fengmk2 0.1% + 1 grasGendarme 0.1% + 1 lodr 0.1% + 1 tgautier@yahoo.com 0.1% + 1 traleig1 0.1% + 1 vlad 0.1% + 1 yuitest 0.1% + 1 Adam Crabtree 0.1% + 1 Andreas Brekken 0.1% + 1 Andreas Lind Petersen 0.1% + 1 Andrew Nesbitt 0.1% + 1 Andrey Popp 0.1% + 1 Arnaud Brousseau 0.1% + 1 Atsuya Takagi 0.1% + 1 Austin Birch 0.1% + 1 Bjørge Næss 0.1% + 1 Brian Lalor 0.1% + 1 Brian M. Carlson 0.1% + 1 Brian Moore 0.1% + 1 Bryan Donovan 0.1% + 1 Casey Foster 0.1% + 1 ChrisWren 0.1% + 1 Corey Butler 0.1% + 1 Daniel Stockman 0.1% + 1 Dave McKenna 0.1% + 1 Di Wu 0.1% + 1 Dmitry Shirokov 0.1% + 1 Fedor Indutny 0.1% + 1 Florian Margaine 0.1% + 1 Frederico Silva 0.1% + 1 Fredrik Lindin 0.1% + 1 Gareth Murphy 0.1% + 1 Gavin Mogan 0.1% + 1 Glen Huang 0.1% + 1 Greg Perkins 0.1% + 1 Harry Brundage 0.1% + 1 Herman Junge 0.1% + 1 Ian Young 0.1% + 1 Ivan 0.1% + 1 JP Bochi 0.1% + 1 Jaakko Salonen 0.1% + 1 Jakub Nešetřil 0.1% + 1 James Bowes 0.1% + 1 James Lal 0.1% + 1 Jason Barry 0.1% + 1 Javier Aranda 0.1% + 1 Jeff Kunkle 0.1% + 1 Jeremy Martin 0.1% + 1 Jimmy Cuadra 0.1% + 1 Jonathan Creamer 0.1% + 1 Jussi Virtanen 0.1% + 1 Katie Gengler 0.1% + 1 Kazuhito Hokamura 0.1% + 1 Kirill Korolyov 0.1% + 1 Koen Punt 0.1% + 1 Laszlo Bacsi 0.1% + 1 Liam Newman 0.1% + 1 László Bácsi 0.1% + 1 Maciej Małecki 0.1% + 1 Mal Graty 0.1% + 1 Marc Kuo 0.1% + 1 Matt Robenolt 0.1% +``` + +## Links + + - [Google Group](http://groups.google.com/group/mochajs) + - [Wiki](https://github.com/visionmedia/mocha/wiki) + - Mocha [Extensions and reporters](https://github.com/visionmedia/mocha/wiki) diff --git a/node_modules/mocha/bin/_mocha b/node_modules/mocha/bin/_mocha new file mode 100755 index 0000000..bea6df8 --- /dev/null +++ b/node_modules/mocha/bin/_mocha @@ -0,0 +1,467 @@ +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('commander') + , sprintf = require('util').format + , path = require('path') + , fs = require('fs') + , glob = require('glob') + , resolve = path.resolve + , exists = fs.existsSync || path.existsSync + , Mocha = require('../') + , utils = Mocha.utils + , interfaces = Mocha.interfaces + , join = path.join + , basename = path.basename + , cwd = process.cwd() + , mocha = new Mocha; + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date + , setTimeout = global.setTimeout + , setInterval = global.setInterval + , clearTimeout = global.clearTimeout + , clearInterval = global.clearInterval; + +/** + * Files. + */ + +var files = []; + +/** + * Globals. + */ + +var globals = []; + +/** + * Requires. + */ + +var requires = []; + +/** + * Images. + */ + +var images = { + fail: __dirname + '/../images/error.png' + , pass: __dirname + '/../images/ok.png' +}; + +// options + +program + .version(JSON.parse(fs.readFileSync(__dirname + '/../package.json', 'utf8')).version) + .usage('[debug] [options] [files]') + .option('-r, --require ', 'require the given module') + .option('-R, --reporter ', 'specify the reporter to use', 'dot') + .option('-u, --ui ', 'specify user-interface (bdd|tdd|exports)', 'bdd') + .option('-g, --grep ', 'only run tests matching ') + .option('-i, --invert', 'inverts --grep matches') + .option('-t, --timeout ', 'set test-case timeout in milliseconds [2000]') + .option('-s, --slow ', '"slow" test threshold in milliseconds [75]') + .option('-w, --watch', 'watch files for changes') + .option('-c, --colors', 'force enabling of colors') + .option('-C, --no-colors', 'force disabling of colors') + .option('-G, --growl', 'enable growl notification support') + .option('-d, --debug', "enable node's debugger, synonym for node --debug") + .option('-b, --bail', "bail after first test failure") + .option('-A, --async-only', "force all tests to take a callback (async)") + .option('-S, --sort', "sort test files") + .option('--recursive', 'include sub directories') + .option('--debug-brk', "enable node's debugger breaking on the first line") + .option('--globals ', 'allow the given comma-delimited global [names]', list, []) + .option('--check-leaks', 'check for global variable leaks') + .option('--interfaces', 'display available interfaces') + .option('--reporters', 'display available reporters') + .option('--compilers :,...', 'use the given module(s) to compile files', list, []) + .option('--inline-diffs', 'display actual/expected differences inline within each string') + .option('--no-exit', 'require a clean shutdown of the event loop: mocha will not call process.exit') + +program.name = 'mocha'; + +// init command + +program + .command('init ') + .description('initialize a client-side mocha setup at ') + .action(function(path){ + var mkdir = require('mkdirp'); + mkdir.sync(path); + var css = fs.readFileSync(join(__dirname, '..', 'mocha.css')); + var js = fs.readFileSync(join(__dirname, '..', 'mocha.js')); + var tmpl = fs.readFileSync(join(__dirname, '..', 'lib/template.html')); + fs.writeFileSync(join(path, 'mocha.css'), css); + fs.writeFileSync(join(path, 'mocha.js'), js); + fs.writeFileSync(join(path, 'tests.js'), ''); + fs.writeFileSync(join(path, 'index.html'), tmpl); + process.exit(0); + }); + +// --globals + +program.on('globals', function(val){ + globals = globals.concat(list(val)); +}); + +// --reporters + +program.on('reporters', function(){ + console.log(); + console.log(' dot - dot matrix'); + console.log(' doc - html documentation'); + console.log(' spec - hierarchical spec list'); + console.log(' json - single json object'); + console.log(' progress - progress bar'); + console.log(' list - spec-style listing'); + console.log(' tap - test-anything-protocol'); + console.log(' landing - unicode landing strip'); + console.log(' xunit - xunit reporter'); + console.log(' html-cov - HTML test coverage'); + console.log(' json-cov - JSON test coverage'); + console.log(' min - minimal reporter (great with --watch)'); + console.log(' json-stream - newline delimited json events'); + console.log(' markdown - markdown documentation (github flavour)'); + console.log(' nyan - nyan cat!'); + console.log(); + process.exit(); +}); + +// --interfaces + +program.on('interfaces', function(){ + console.log(''); + console.log(' bdd'); + console.log(' tdd'); + console.log(' qunit'); + console.log(' exports'); + console.log(''); + process.exit(); +}); + +// -r, --require + +module.paths.push(cwd, join(cwd, 'node_modules')); + +program.on('require', function(mod){ + var abs = exists(mod) || exists(mod + '.js'); + if (abs) mod = resolve(mod); + requires.push(mod); +}); + +// mocha.opts support + +try { + var opts = fs.readFileSync('test/mocha.opts', 'utf8') + .trim() + .split(/\s+/); + + process.argv = process.argv + .slice(0, 2) + .concat(opts.concat(process.argv.slice(2))); +} catch (err) { + // ignore +} + +// parse args + +program.parse(process.argv); + +// infinite stack traces + +Error.stackTraceLimit = Infinity; // TODO: config + +// reporter + +mocha.reporter(program.reporter); + +// interface + +mocha.ui(program.ui); + +// load reporter + +try { + Reporter = require('../lib/reporters/' + program.reporter); +} catch (err) { + try { + Reporter = require(program.reporter); + } catch (err) { + throw new Error('reporter "' + program.reporter + '" does not exist'); + } +} + +// --no-colors + +if (!program.colors) mocha.useColors(false); + +// --colors + +if (~process.argv.indexOf('--colors') || + ~process.argv.indexOf('-c')) { + mocha.useColors(true); +} + +// --inline-diffs + +if (program.inlineDiffs) mocha.useInlineDiffs(true); + +// --slow + +if (program.slow) mocha.suite.slow(program.slow); + +// --timeout + +if (program.timeout) mocha.suite.timeout(program.timeout); + +// --bail + +mocha.suite.bail(program.bail); + +// --grep + +if (program.grep) mocha.grep(new RegExp(program.grep)); + +// --invert + +if (program.invert) mocha.invert(); + +// --check-leaks + +if (program.checkLeaks) mocha.checkLeaks(); + +// --growl + +if (program.growl) mocha.growl(); + +// --async-only + +if (program.asyncOnly) mocha.asyncOnly(); + +// --globals + +mocha.globals(globals); + +// custom compiler support + +var extensions = ['js']; +program.compilers.forEach(function(c) { + var compiler = c.split(':') + , ext = compiler[0] + , mod = compiler[1]; + + if (mod[0] == '.') mod = join(process.cwd(), mod); + require(mod); + extensions.push(ext); +}); + +var re = new RegExp('\\.(' + extensions.join('|') + ')$'); + +// requires + +requires.forEach(function(mod) { + require(mod); +}); + +// files + +var files = [] + , args = program.args; + +// default files to test/*.{js,coffee} + +if (!args.length) args.push('test'); + +args.forEach(function(arg){ + files = files.concat(lookupFiles(arg, program.recursive)); +}); + +// resolve + +files = files.map(function(path){ + return resolve(path); +}); + +if (program.sort) { + files.sort(); +} + +// --watch + +var runner; +if (program.watch) { + console.log(); + hideCursor(); + process.on('SIGINT', function(){ + showCursor(); + console.log('\n'); + process.exit(); + }); + + var watchFiles = utils.files(cwd); + var runAgain = false; + + function loadAndRun() { + try { + mocha.files = files; + runAgain = false; + runner = mocha.run(function(){ + runner = null; + if (runAgain) { + rerun(); + } + }); + } catch(e) { + console.log(e.stack); + } + } + + function purge() { + watchFiles.forEach(function(file){ + delete require.cache[file]; + }); + } + + loadAndRun(); + + function rerun() { + purge(); + stop() + mocha.suite = mocha.suite.clone(); + mocha.suite.ctx = new Mocha.Context; + mocha.ui(program.ui); + loadAndRun(); + } + + utils.watch(watchFiles, function(){ + runAgain = true; + if (runner) { + runner.abort(); + } else { + rerun(); + } + }); + + return; +} + +// load + +mocha.files = files; +runner = mocha.run(program.exit ? process.exit : exitLater); + +function exitLater(code) { + process.on('exit', function() { process.exit(code) }) +} + +process.on('SIGINT', function() { runner.abort(); }) + +// enable growl notifications + +function growl(runner, reporter) { + var notify = require('growl'); + + runner.on('end', function(){ + var stats = reporter.stats; + if (stats.failures) { + var msg = stats.failures + ' of ' + runner.total + ' tests failed'; + notify(msg, { name: 'mocha', title: 'Failed', image: images.fail }); + } else { + notify(stats.passes + ' tests passed in ' + stats.duration + 'ms', { + name: 'mocha' + , title: 'Passed' + , image: images.pass + }); + } + }); +} + +/** + * Parse list. + */ + +function list(str) { + return str.split(/ *, */); +} + +/** + * Hide the cursor. + */ + +function hideCursor(){ + process.stdout.write('\u001b[?25l'); +}; + +/** + * Show the cursor. + */ + +function showCursor(){ + process.stdout.write('\u001b[?25h'); +}; + +/** + * Stop play()ing. + */ + +function stop() { + process.stdout.write('\u001b[2K'); + clearInterval(play.timer); +} + +/** + * Lookup file names at the given `path`. + */ + +function lookupFiles(path, recursive) { + var files = []; + + if (!exists(path)) { + if (exists(path + '.js')) { + path += '.js' + } else { + files = glob.sync(path); + if (!files.length) throw new Error("cannot resolve path (or pattern) '" + path + "'"); + return files; + } + } + + var stat = fs.statSync(path); + if (stat.isFile()) return path; + + fs.readdirSync(path).forEach(function(file){ + file = join(path, file); + var stat = fs.statSync(file); + if (stat.isDirectory()) { + if (recursive) files = files.concat(lookupFiles(file, recursive)); + return + } + if (!stat.isFile() || !re.test(file) || basename(file)[0] == '.') return; + files.push(file); + }); + + return files; +} + +/** + * Play the given array of strings. + */ + +function play(arr, interval) { + var len = arr.length + , interval = interval || 100 + , i = 0; + + play.timer = setInterval(function(){ + var str = arr[i++ % len]; + process.stdout.write('\u001b[0G' + str); + }, interval); +} diff --git a/node_modules/mocha/bin/mocha b/node_modules/mocha/bin/mocha new file mode 100755 index 0000000..742d607 --- /dev/null +++ b/node_modules/mocha/bin/mocha @@ -0,0 +1,51 @@ +#!/usr/bin/env node + +/** + * This tiny wrapper file checks for known node flags and appends them + * when found, before invoking the "real" _mocha(1) executable. + */ + +var spawn = require('child_process').spawn + , args = [ __dirname + '/_mocha' ]; + +process.argv.slice(2).forEach(function(arg){ + var flag = arg.split('=')[0]; + + switch (flag) { + case '-d': + args.unshift('--debug'); + break; + case 'debug': + case '--debug': + case '--debug-brk': + args.unshift(arg); + break; + case '-gc': + case '--expose-gc': + args.unshift('--expose-gc'); + break; + case '--gc-global': + case '--harmony': + case '--harmony-proxies': + case '--harmony-collections': + case '--harmony-generators': + case '--prof': + args.unshift(arg); + break; + default: + if (0 == arg.indexOf('--trace')) args.unshift(arg); + else args.push(arg); + break; + } +}); + +var proc = spawn(process.argv[0], args, { customFds: [0,1,2] }); +proc.on('exit', function (code, signal) { + process.on('exit', function(){ + if (signal) { + process.kill(process.pid, signal); + } else { + process.exit(code); + } + }); +}); diff --git a/node_modules/mocha/images/error.png b/node_modules/mocha/images/error.png new file mode 100644 index 0000000000000000000000000000000000000000..a07a1ba5efef3e4be01383485cdd59d87691ae7c GIT binary patch literal 412 zcmeAS@N?(olHy`uVBq!ia0vp^5+KaM3?#3wJbMaAB?S0{xB}@#3=H#t6a&Ky28IX* zhDI;bT+N zJ_d#}3=HROY~H+F81S@RY}C7)_Aw#d|MtVb_a~h&)Rp4=QT2WP6Q!Vh`Tbw)C0L`Hjr0=~ z9$q`dGMD9A%ZpEiDeV&BjQ7mTJ@UL?o6p#BvCvJTmtn!~Z$T%V*(ZO9v7FD-TxB)0 zdg`1chBG#&VzR#-Sg`Tz{B++v?;f1y-of{vSo8emT75L`U_{(iyq;*ak qoLzkFu?=s{K4<0MJ2ut-SB-zNMaS1nOp+JqO9oF@KbLh*2~7Z$dY*9r literal 0 HcmV?d00001 diff --git a/node_modules/mocha/images/ok.png b/node_modules/mocha/images/ok.png new file mode 100644 index 0000000000000000000000000000000000000000..b3623a59946024c48067d73d664e070dbc2d8a32 GIT binary patch literal 388 zcmeAS@N?(olHy`uVBq!ia0vp^5+KaM3?#3wJbMaAB?S0{xJIori(YS*wAUIaKoBJF zvj!rdveN6mWw-t6ABLwLvMapgS$QL{=59##Dd*y=UgdZE^Uk|v9Cc`W76(-P|8)8t zpa!9mAiv!{OM$WnJzX3_DsF8(b5f{TLBu6cm|clU zs#od6hyV36>l!DuJ~i6gRJ|(h>%N=uiCw`>-uwaww$}4;Jh;`b%=GEzCGjs473QC< zoj;vb)**hkbI|rOH-CY(cRg0*&vrd;aO|w5Y!c5c%l3JVM=TdRUpN+^&tQ1$_04MM zy$qe->%PkEb(kh#O!>DBXDc!!9W;kOl4QpsMNCpniSgx7V=EJjg/g, '>'); + n = n.replace(/"/g, '"'); + + return n; + } + + var Diff = function(ignoreWhitespace) { + this.ignoreWhitespace = ignoreWhitespace; + }; + Diff.prototype = { + diff: function(oldString, newString) { + // Handle the identity case (this is due to unrolling editLength == 0 + if (newString === oldString) { + return [{ value: newString }]; + } + if (!newString) { + return [{ value: oldString, removed: true }]; + } + if (!oldString) { + return [{ value: newString, added: true }]; + } + + newString = this.tokenize(newString); + oldString = this.tokenize(oldString); + + var newLen = newString.length, oldLen = oldString.length; + var maxEditLength = newLen + oldLen; + var bestPath = [{ newPos: -1, components: [] }]; + + // Seed editLength = 0 + var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0); + if (bestPath[0].newPos+1 >= newLen && oldPos+1 >= oldLen) { + return bestPath[0].components; + } + + for (var editLength = 1; editLength <= maxEditLength; editLength++) { + for (var diagonalPath = -1*editLength; diagonalPath <= editLength; diagonalPath+=2) { + var basePath; + var addPath = bestPath[diagonalPath-1], + removePath = bestPath[diagonalPath+1]; + oldPos = (removePath ? removePath.newPos : 0) - diagonalPath; + if (addPath) { + // No one else is going to attempt to use this value, clear it + bestPath[diagonalPath-1] = undefined; + } + + var canAdd = addPath && addPath.newPos+1 < newLen; + var canRemove = removePath && 0 <= oldPos && oldPos < oldLen; + if (!canAdd && !canRemove) { + bestPath[diagonalPath] = undefined; + continue; + } + + // Select the diagonal that we want to branch from. We select the prior + // path whose position in the new string is the farthest from the origin + // and does not pass the bounds of the diff graph + if (!canAdd || (canRemove && addPath.newPos < removePath.newPos)) { + basePath = clonePath(removePath); + this.pushComponent(basePath.components, oldString[oldPos], undefined, true); + } else { + basePath = clonePath(addPath); + basePath.newPos++; + this.pushComponent(basePath.components, newString[basePath.newPos], true, undefined); + } + + var oldPos = this.extractCommon(basePath, newString, oldString, diagonalPath); + + if (basePath.newPos+1 >= newLen && oldPos+1 >= oldLen) { + return basePath.components; + } else { + bestPath[diagonalPath] = basePath; + } + } + } + }, + + pushComponent: function(components, value, added, removed) { + var last = components[components.length-1]; + if (last && last.added === added && last.removed === removed) { + // We need to clone here as the component clone operation is just + // as shallow array clone + components[components.length-1] = + {value: this.join(last.value, value), added: added, removed: removed }; + } else { + components.push({value: value, added: added, removed: removed }); + } + }, + extractCommon: function(basePath, newString, oldString, diagonalPath) { + var newLen = newString.length, + oldLen = oldString.length, + newPos = basePath.newPos, + oldPos = newPos - diagonalPath; + while (newPos+1 < newLen && oldPos+1 < oldLen && this.equals(newString[newPos+1], oldString[oldPos+1])) { + newPos++; + oldPos++; + + this.pushComponent(basePath.components, newString[newPos], undefined, undefined); + } + basePath.newPos = newPos; + return oldPos; + }, + + equals: function(left, right) { + var reWhitespace = /\S/; + if (this.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right)) { + return true; + } else { + return left === right; + } + }, + join: function(left, right) { + return left + right; + }, + tokenize: function(value) { + return value; + } + }; + + var CharDiff = new Diff(); + + var WordDiff = new Diff(true); + var WordWithSpaceDiff = new Diff(); + WordDiff.tokenize = WordWithSpaceDiff.tokenize = function(value) { + return removeEmpty(value.split(/(\s+|\b)/)); + }; + + var CssDiff = new Diff(true); + CssDiff.tokenize = function(value) { + return removeEmpty(value.split(/([{}:;,]|\s+)/)); + }; + + var LineDiff = new Diff(); + LineDiff.tokenize = function(value) { + return value.split(/^/m); + }; + + return { + Diff: Diff, + + diffChars: function(oldStr, newStr) { return CharDiff.diff(oldStr, newStr); }, + diffWords: function(oldStr, newStr) { return WordDiff.diff(oldStr, newStr); }, + diffWordsWithSpace: function(oldStr, newStr) { return WordWithSpaceDiff.diff(oldStr, newStr); }, + diffLines: function(oldStr, newStr) { return LineDiff.diff(oldStr, newStr); }, + + diffCss: function(oldStr, newStr) { return CssDiff.diff(oldStr, newStr); }, + + createPatch: function(fileName, oldStr, newStr, oldHeader, newHeader) { + var ret = []; + + ret.push('Index: ' + fileName); + ret.push('==================================================================='); + ret.push('--- ' + fileName + (typeof oldHeader === 'undefined' ? '' : '\t' + oldHeader)); + ret.push('+++ ' + fileName + (typeof newHeader === 'undefined' ? '' : '\t' + newHeader)); + + var diff = LineDiff.diff(oldStr, newStr); + if (!diff[diff.length-1].value) { + diff.pop(); // Remove trailing newline add + } + diff.push({value: '', lines: []}); // Append an empty value to make cleanup easier + + function contextLines(lines) { + return lines.map(function(entry) { return ' ' + entry; }); + } + function eofNL(curRange, i, current) { + var last = diff[diff.length-2], + isLast = i === diff.length-2, + isLastOfType = i === diff.length-3 && (current.added !== last.added || current.removed !== last.removed); + + // Figure out if this is the last line for the given file and missing NL + if (!/\n$/.test(current.value) && (isLast || isLastOfType)) { + curRange.push('\\ No newline at end of file'); + } + } + + var oldRangeStart = 0, newRangeStart = 0, curRange = [], + oldLine = 1, newLine = 1; + for (var i = 0; i < diff.length; i++) { + var current = diff[i], + lines = current.lines || current.value.replace(/\n$/, '').split('\n'); + current.lines = lines; + + if (current.added || current.removed) { + if (!oldRangeStart) { + var prev = diff[i-1]; + oldRangeStart = oldLine; + newRangeStart = newLine; + + if (prev) { + curRange = contextLines(prev.lines.slice(-4)); + oldRangeStart -= curRange.length; + newRangeStart -= curRange.length; + } + } + curRange.push.apply(curRange, lines.map(function(entry) { return (current.added?'+':'-') + entry; })); + eofNL(curRange, i, current); + + if (current.added) { + newLine += lines.length; + } else { + oldLine += lines.length; + } + } else { + if (oldRangeStart) { + // Close out any changes that have been output (or join overlapping) + if (lines.length <= 8 && i < diff.length-2) { + // Overlapping + curRange.push.apply(curRange, contextLines(lines)); + } else { + // end the range and output + var contextSize = Math.min(lines.length, 4); + ret.push( + '@@ -' + oldRangeStart + ',' + (oldLine-oldRangeStart+contextSize) + + ' +' + newRangeStart + ',' + (newLine-newRangeStart+contextSize) + + ' @@'); + ret.push.apply(ret, curRange); + ret.push.apply(ret, contextLines(lines.slice(0, contextSize))); + if (lines.length <= 4) { + eofNL(ret, i, current); + } + + oldRangeStart = 0; newRangeStart = 0; curRange = []; + } + } + oldLine += lines.length; + newLine += lines.length; + } + } + + return ret.join('\n') + '\n'; + }, + + applyPatch: function(oldStr, uniDiff) { + var diffstr = uniDiff.split('\n'); + var diff = []; + var remEOFNL = false, + addEOFNL = false; + + for (var i = (diffstr[0][0]==='I'?4:0); i < diffstr.length; i++) { + if(diffstr[i][0] === '@') { + var meh = diffstr[i].split(/@@ -(\d+),(\d+) \+(\d+),(\d+) @@/); + diff.unshift({ + start:meh[3], + oldlength:meh[2], + oldlines:[], + newlength:meh[4], + newlines:[] + }); + } else if(diffstr[i][0] === '+') { + diff[0].newlines.push(diffstr[i].substr(1)); + } else if(diffstr[i][0] === '-') { + diff[0].oldlines.push(diffstr[i].substr(1)); + } else if(diffstr[i][0] === ' ') { + diff[0].newlines.push(diffstr[i].substr(1)); + diff[0].oldlines.push(diffstr[i].substr(1)); + } else if(diffstr[i][0] === '\\') { + if (diffstr[i-1][0] === '+') { + remEOFNL = true; + } else if(diffstr[i-1][0] === '-') { + addEOFNL = true; + } + } + } + + var str = oldStr.split('\n'); + for (var i = diff.length - 1; i >= 0; i--) { + var d = diff[i]; + for (var j = 0; j < d.oldlength; j++) { + if(str[d.start-1+j] !== d.oldlines[j]) { + return false; + } + } + Array.prototype.splice.apply(str,[d.start-1,+d.oldlength].concat(d.newlines)); + } + + if (remEOFNL) { + while (!str[str.length-1]) { + str.pop(); + } + } else if (addEOFNL) { + str.push(''); + } + return str.join('\n'); + }, + + convertChangesToXML: function(changes){ + var ret = []; + for ( var i = 0; i < changes.length; i++) { + var change = changes[i]; + if (change.added) { + ret.push(''); + } else if (change.removed) { + ret.push(''); + } + + ret.push(escapeHTML(change.value)); + + if (change.added) { + ret.push(''); + } else if (change.removed) { + ret.push(''); + } + } + return ret.join(''); + }, + + // See: http://code.google.com/p/google-diff-match-patch/wiki/API + convertChangesToDMP: function(changes){ + var ret = [], change; + for ( var i = 0; i < changes.length; i++) { + change = changes[i]; + ret.push([(change.added ? 1 : change.removed ? -1 : 0), change.value]); + } + return ret; + } + }; +})(); + +if (typeof module !== 'undefined') { + module.exports = JsDiff; +} diff --git a/node_modules/mocha/lib/browser/events.js b/node_modules/mocha/lib/browser/events.js new file mode 100644 index 0000000..cfbd072 --- /dev/null +++ b/node_modules/mocha/lib/browser/events.js @@ -0,0 +1,178 @@ + +/** + * Module exports. + */ + +exports.EventEmitter = EventEmitter; + +/** + * Check if `obj` is an array. + */ + +function isArray(obj) { + return '[object Array]' == {}.toString.call(obj); +} + +/** + * Event emitter constructor. + * + * @api public + */ + +function EventEmitter(){}; + +/** + * Adds a listener. + * + * @api public + */ + +EventEmitter.prototype.on = function (name, fn) { + if (!this.$events) { + this.$events = {}; + } + + if (!this.$events[name]) { + this.$events[name] = fn; + } else if (isArray(this.$events[name])) { + this.$events[name].push(fn); + } else { + this.$events[name] = [this.$events[name], fn]; + } + + return this; +}; + +EventEmitter.prototype.addListener = EventEmitter.prototype.on; + +/** + * Adds a volatile listener. + * + * @api public + */ + +EventEmitter.prototype.once = function (name, fn) { + var self = this; + + function on () { + self.removeListener(name, on); + fn.apply(this, arguments); + }; + + on.listener = fn; + this.on(name, on); + + return this; +}; + +/** + * Removes a listener. + * + * @api public + */ + +EventEmitter.prototype.removeListener = function (name, fn) { + if (this.$events && this.$events[name]) { + var list = this.$events[name]; + + if (isArray(list)) { + var pos = -1; + + for (var i = 0, l = list.length; i < l; i++) { + if (list[i] === fn || (list[i].listener && list[i].listener === fn)) { + pos = i; + break; + } + } + + if (pos < 0) { + return this; + } + + list.splice(pos, 1); + + if (!list.length) { + delete this.$events[name]; + } + } else if (list === fn || (list.listener && list.listener === fn)) { + delete this.$events[name]; + } + } + + return this; +}; + +/** + * Removes all listeners for an event. + * + * @api public + */ + +EventEmitter.prototype.removeAllListeners = function (name) { + if (name === undefined) { + this.$events = {}; + return this; + } + + if (this.$events && this.$events[name]) { + this.$events[name] = null; + } + + return this; +}; + +/** + * Gets all listeners for a certain event. + * + * @api public + */ + +EventEmitter.prototype.listeners = function (name) { + if (!this.$events) { + this.$events = {}; + } + + if (!this.$events[name]) { + this.$events[name] = []; + } + + if (!isArray(this.$events[name])) { + this.$events[name] = [this.$events[name]]; + } + + return this.$events[name]; +}; + +/** + * Emits an event. + * + * @api public + */ + +EventEmitter.prototype.emit = function (name) { + if (!this.$events) { + return false; + } + + var handler = this.$events[name]; + + if (!handler) { + return false; + } + + var args = [].slice.call(arguments, 1); + + if ('function' == typeof handler) { + handler.apply(this, args); + } else if (isArray(handler)) { + var listeners = handler.slice(); + + for (var i = 0, l = listeners.length; i < l; i++) { + listeners[i].apply(this, args); + } + } else { + return false; + } + + return true; +}; \ No newline at end of file diff --git a/node_modules/mocha/lib/browser/fs.js b/node_modules/mocha/lib/browser/fs.js new file mode 100644 index 0000000..e69de29 diff --git a/node_modules/mocha/lib/browser/path.js b/node_modules/mocha/lib/browser/path.js new file mode 100644 index 0000000..e69de29 diff --git a/node_modules/mocha/lib/browser/progress.js b/node_modules/mocha/lib/browser/progress.js new file mode 100644 index 0000000..90526f7 --- /dev/null +++ b/node_modules/mocha/lib/browser/progress.js @@ -0,0 +1,125 @@ +/** + * Expose `Progress`. + */ + +module.exports = Progress; + +/** + * Initialize a new `Progress` indicator. + */ + +function Progress() { + this.percent = 0; + this.size(0); + this.fontSize(11); + this.font('helvetica, arial, sans-serif'); +} + +/** + * Set progress size to `n`. + * + * @param {Number} n + * @return {Progress} for chaining + * @api public + */ + +Progress.prototype.size = function(n){ + this._size = n; + return this; +}; + +/** + * Set text to `str`. + * + * @param {String} str + * @return {Progress} for chaining + * @api public + */ + +Progress.prototype.text = function(str){ + this._text = str; + return this; +}; + +/** + * Set font size to `n`. + * + * @param {Number} n + * @return {Progress} for chaining + * @api public + */ + +Progress.prototype.fontSize = function(n){ + this._fontSize = n; + return this; +}; + +/** + * Set font `family`. + * + * @param {String} family + * @return {Progress} for chaining + */ + +Progress.prototype.font = function(family){ + this._font = family; + return this; +}; + +/** + * Update percentage to `n`. + * + * @param {Number} n + * @return {Progress} for chaining + */ + +Progress.prototype.update = function(n){ + this.percent = n; + return this; +}; + +/** + * Draw on `ctx`. + * + * @param {CanvasRenderingContext2d} ctx + * @return {Progress} for chaining + */ + +Progress.prototype.draw = function(ctx){ + try { + var percent = Math.min(this.percent, 100) + , size = this._size + , half = size / 2 + , x = half + , y = half + , rad = half - 1 + , fontSize = this._fontSize; + + ctx.font = fontSize + 'px ' + this._font; + + var angle = Math.PI * 2 * (percent / 100); + ctx.clearRect(0, 0, size, size); + + // outer circle + ctx.strokeStyle = '#9f9f9f'; + ctx.beginPath(); + ctx.arc(x, y, rad, 0, angle, false); + ctx.stroke(); + + // inner circle + ctx.strokeStyle = '#eee'; + ctx.beginPath(); + ctx.arc(x, y, rad - 1, 0, angle, true); + ctx.stroke(); + + // text + var text = this._text || (percent | 0) + '%' + , w = ctx.measureText(text).width; + + ctx.fillText( + text + , x - w / 2 + 1 + , y + fontSize / 2 - 1); + } catch (ex) {} //don't fail if we can't render progress + return this; +}; diff --git a/node_modules/mocha/lib/browser/tty.js b/node_modules/mocha/lib/browser/tty.js new file mode 100644 index 0000000..6f5f079 --- /dev/null +++ b/node_modules/mocha/lib/browser/tty.js @@ -0,0 +1,13 @@ + +exports.isatty = function(){ + return true; +}; + +exports.getWindowSize = function(){ + if ('innerHeight' in global) { + return [global.innerHeight, global.innerWidth]; + } else { + // In a Web Worker, the DOM Window is not available. + return [640, 480]; + } +}; diff --git a/node_modules/mocha/lib/context.js b/node_modules/mocha/lib/context.js new file mode 100644 index 0000000..6d6422a --- /dev/null +++ b/node_modules/mocha/lib/context.js @@ -0,0 +1,69 @@ + +/** + * Expose `Context`. + */ + +module.exports = Context; + +/** + * Initialize a new `Context`. + * + * @api private + */ + +function Context(){} + +/** + * Set or get the context `Runnable` to `runnable`. + * + * @param {Runnable} runnable + * @return {Context} + * @api private + */ + +Context.prototype.runnable = function(runnable){ + if (0 == arguments.length) return this._runnable; + this.test = this._runnable = runnable; + return this; +}; + +/** + * Set test timeout `ms`. + * + * @param {Number} ms + * @return {Context} self + * @api private + */ + +Context.prototype.timeout = function(ms){ + this.runnable().timeout(ms); + return this; +}; + +/** + * Set test slowness threshold `ms`. + * + * @param {Number} ms + * @return {Context} self + * @api private + */ + +Context.prototype.slow = function(ms){ + this.runnable().slow(ms); + return this; +}; + +/** + * Inspect the context void of `._runnable`. + * + * @return {String} + * @api private + */ + +Context.prototype.inspect = function(){ + return JSON.stringify(this, function(key, val){ + if ('_runnable' == key) return; + if ('test' == key) return; + return val; + }, 2); +}; diff --git a/node_modules/mocha/lib/hook.js b/node_modules/mocha/lib/hook.js new file mode 100644 index 0000000..814e7b6 --- /dev/null +++ b/node_modules/mocha/lib/hook.js @@ -0,0 +1,49 @@ + +/** + * Module dependencies. + */ + +var Runnable = require('./runnable'); + +/** + * Expose `Hook`. + */ + +module.exports = Hook; + +/** + * Initialize a new `Hook` with the given `title` and callback `fn`. + * + * @param {String} title + * @param {Function} fn + * @api private + */ + +function Hook(title, fn) { + Runnable.call(this, title, fn); + this.type = 'hook'; +} + +/** + * Inherit from `Runnable.prototype`. + */ + +Hook.prototype.__proto__ = Runnable.prototype; + +/** + * Get or set the test `err`. + * + * @param {Error} err + * @return {Error} + * @api public + */ + +Hook.prototype.error = function(err){ + if (0 == arguments.length) { + var err = this._error; + this._error = null; + return err; + } + + this._error = err; +}; diff --git a/node_modules/mocha/lib/interfaces/bdd.js b/node_modules/mocha/lib/interfaces/bdd.js new file mode 100644 index 0000000..3a5b1ed --- /dev/null +++ b/node_modules/mocha/lib/interfaces/bdd.js @@ -0,0 +1,137 @@ + +/** + * Module dependencies. + */ + +var Suite = require('../suite') + , Test = require('../test') + , utils = require('../utils'); + +/** + * BDD-style interface: + * + * describe('Array', function(){ + * describe('#indexOf()', function(){ + * it('should return -1 when not present', function(){ + * + * }); + * + * it('should return the index when present', function(){ + * + * }); + * }); + * }); + * + */ + +module.exports = function(suite){ + var suites = [suite]; + + suite.on('pre-require', function(context, file, mocha){ + + /** + * Execute before running tests. + */ + + context.before = function(fn){ + suites[0].beforeAll(fn); + }; + + /** + * Execute after running tests. + */ + + context.after = function(fn){ + suites[0].afterAll(fn); + }; + + /** + * Execute before each test case. + */ + + context.beforeEach = function(fn){ + suites[0].beforeEach(fn); + }; + + /** + * Execute after each test case. + */ + + context.afterEach = function(fn){ + suites[0].afterEach(fn); + }; + + /** + * Describe a "suite" with the given `title` + * and callback `fn` containing nested suites + * and/or tests. + */ + + context.describe = context.context = function(title, fn){ + var suite = Suite.create(suites[0], title); + suites.unshift(suite); + fn.call(suite); + suites.shift(); + return suite; + }; + + /** + * Pending describe. + */ + + context.xdescribe = + context.xcontext = + context.describe.skip = function(title, fn){ + var suite = Suite.create(suites[0], title); + suite.pending = true; + suites.unshift(suite); + fn.call(suite); + suites.shift(); + }; + + /** + * Exclusive suite. + */ + + context.describe.only = function(title, fn){ + var suite = context.describe(title, fn); + mocha.grep(suite.fullTitle()); + return suite; + }; + + /** + * Describe a specification or test-case + * with the given `title` and callback `fn` + * acting as a thunk. + */ + + context.it = context.specify = function(title, fn){ + var suite = suites[0]; + if (suite.pending) var fn = null; + var test = new Test(title, fn); + suite.addTest(test); + return test; + }; + + /** + * Exclusive test-case. + */ + + context.it.only = function(title, fn){ + var test = context.it(title, fn); + var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; + mocha.grep(new RegExp(reString)); + return test; + }; + + /** + * Pending test case. + */ + + context.xit = + context.xspecify = + context.it.skip = function(title){ + context.it(title); + }; + }); +}; diff --git a/node_modules/mocha/lib/interfaces/exports.js b/node_modules/mocha/lib/interfaces/exports.js new file mode 100644 index 0000000..6b229c0 --- /dev/null +++ b/node_modules/mocha/lib/interfaces/exports.js @@ -0,0 +1,60 @@ + +/** + * Module dependencies. + */ + +var Suite = require('../suite') + , Test = require('../test'); + +/** + * TDD-style interface: + * + * exports.Array = { + * '#indexOf()': { + * 'should return -1 when the value is not present': function(){ + * + * }, + * + * 'should return the correct index when the value is present': function(){ + * + * } + * } + * }; + * + */ + +module.exports = function(suite){ + var suites = [suite]; + + suite.on('require', visit); + + function visit(obj) { + var suite; + for (var key in obj) { + if ('function' == typeof obj[key]) { + var fn = obj[key]; + switch (key) { + case 'before': + suites[0].beforeAll(fn); + break; + case 'after': + suites[0].afterAll(fn); + break; + case 'beforeEach': + suites[0].beforeEach(fn); + break; + case 'afterEach': + suites[0].afterEach(fn); + break; + default: + suites[0].addTest(new Test(key, fn)); + } + } else { + var suite = Suite.create(suites[0], key); + suites.unshift(suite); + visit(obj[key]); + suites.shift(); + } + } + } +}; diff --git a/node_modules/mocha/lib/interfaces/index.js b/node_modules/mocha/lib/interfaces/index.js new file mode 100644 index 0000000..f7b2655 --- /dev/null +++ b/node_modules/mocha/lib/interfaces/index.js @@ -0,0 +1,5 @@ + +exports.bdd = require('./bdd'); +exports.tdd = require('./tdd'); +exports.qunit = require('./qunit'); +exports.exports = require('./exports'); diff --git a/node_modules/mocha/lib/interfaces/qunit.js b/node_modules/mocha/lib/interfaces/qunit.js new file mode 100644 index 0000000..30f6748 --- /dev/null +++ b/node_modules/mocha/lib/interfaces/qunit.js @@ -0,0 +1,122 @@ + +/** + * Module dependencies. + */ + +var Suite = require('../suite') + , Test = require('../test') + , utils = require('../utils'); + +/** + * QUnit-style interface: + * + * suite('Array'); + * + * test('#length', function(){ + * var arr = [1,2,3]; + * ok(arr.length == 3); + * }); + * + * test('#indexOf()', function(){ + * var arr = [1,2,3]; + * ok(arr.indexOf(1) == 0); + * ok(arr.indexOf(2) == 1); + * ok(arr.indexOf(3) == 2); + * }); + * + * suite('String'); + * + * test('#length', function(){ + * ok('foo'.length == 3); + * }); + * + */ + +module.exports = function(suite){ + var suites = [suite]; + + suite.on('pre-require', function(context, file, mocha){ + + /** + * Execute before running tests. + */ + + context.before = function(fn){ + suites[0].beforeAll(fn); + }; + + /** + * Execute after running tests. + */ + + context.after = function(fn){ + suites[0].afterAll(fn); + }; + + /** + * Execute before each test case. + */ + + context.beforeEach = function(fn){ + suites[0].beforeEach(fn); + }; + + /** + * Execute after each test case. + */ + + context.afterEach = function(fn){ + suites[0].afterEach(fn); + }; + + /** + * Describe a "suite" with the given `title`. + */ + + context.suite = function(title){ + if (suites.length > 1) suites.shift(); + var suite = Suite.create(suites[0], title); + suites.unshift(suite); + return suite; + }; + + /** + * Exclusive test-case. + */ + + context.suite.only = function(title, fn){ + var suite = context.suite(title, fn); + mocha.grep(suite.fullTitle()); + }; + + /** + * Describe a specification or test-case + * with the given `title` and callback `fn` + * acting as a thunk. + */ + + context.test = function(title, fn){ + var test = new Test(title, fn); + suites[0].addTest(test); + return test; + }; + + /** + * Exclusive test-case. + */ + + context.test.only = function(title, fn){ + var test = context.test(title, fn); + var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; + mocha.grep(new RegExp(reString)); + }; + + /** + * Pending test case. + */ + + context.test.skip = function(title){ + context.test(title); + }; + }); +}; diff --git a/node_modules/mocha/lib/interfaces/tdd.js b/node_modules/mocha/lib/interfaces/tdd.js new file mode 100644 index 0000000..da5ca2c --- /dev/null +++ b/node_modules/mocha/lib/interfaces/tdd.js @@ -0,0 +1,138 @@ + +/** + * Module dependencies. + */ + +var Suite = require('../suite') + , Test = require('../test') + , utils = require('../utils');; + +/** + * TDD-style interface: + * + * suite('Array', function(){ + * suite('#indexOf()', function(){ + * suiteSetup(function(){ + * + * }); + * + * test('should return -1 when not present', function(){ + * + * }); + * + * test('should return the index when present', function(){ + * + * }); + * + * suiteTeardown(function(){ + * + * }); + * }); + * }); + * + */ + +module.exports = function(suite){ + var suites = [suite]; + + suite.on('pre-require', function(context, file, mocha){ + + /** + * Execute before each test case. + */ + + context.setup = function(fn){ + suites[0].beforeEach(fn); + }; + + /** + * Execute after each test case. + */ + + context.teardown = function(fn){ + suites[0].afterEach(fn); + }; + + /** + * Execute before the suite. + */ + + context.suiteSetup = function(fn){ + suites[0].beforeAll(fn); + }; + + /** + * Execute after the suite. + */ + + context.suiteTeardown = function(fn){ + suites[0].afterAll(fn); + }; + + /** + * Describe a "suite" with the given `title` + * and callback `fn` containing nested suites + * and/or tests. + */ + + context.suite = function(title, fn){ + var suite = Suite.create(suites[0], title); + suites.unshift(suite); + fn.call(suite); + suites.shift(); + return suite; + }; + + /** + * Pending suite. + */ + context.suite.skip = function(title, fn) { + var suite = Suite.create(suites[0], title); + suite.pending = true; + suites.unshift(suite); + fn.call(suite); + suites.shift(); + }; + + /** + * Exclusive test-case. + */ + + context.suite.only = function(title, fn){ + var suite = context.suite(title, fn); + mocha.grep(suite.fullTitle()); + }; + + /** + * Describe a specification or test-case + * with the given `title` and callback `fn` + * acting as a thunk. + */ + + context.test = function(title, fn){ + var suite = suites[0]; + if (suite.pending) var fn = null; + var test = new Test(title, fn); + suite.addTest(test); + return test; + }; + + /** + * Exclusive test-case. + */ + + context.test.only = function(title, fn){ + var test = context.test(title, fn); + var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; + mocha.grep(new RegExp(reString)); + }; + + /** + * Pending test case. + */ + + context.test.skip = function(title){ + context.test(title); + }; + }); +}; diff --git a/node_modules/mocha/lib/mocha.js b/node_modules/mocha/lib/mocha.js new file mode 100644 index 0000000..3bc9bd5 --- /dev/null +++ b/node_modules/mocha/lib/mocha.js @@ -0,0 +1,369 @@ +/*! + * mocha + * Copyright(c) 2011 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var path = require('path') + , utils = require('./utils'); + +/** + * Expose `Mocha`. + */ + +exports = module.exports = Mocha; + +/** + * Expose internals. + */ + +exports.utils = utils; +exports.interfaces = require('./interfaces'); +exports.reporters = require('./reporters'); +exports.Runnable = require('./runnable'); +exports.Context = require('./context'); +exports.Runner = require('./runner'); +exports.Suite = require('./suite'); +exports.Hook = require('./hook'); +exports.Test = require('./test'); + +/** + * Return image `name` path. + * + * @param {String} name + * @return {String} + * @api private + */ + +function image(name) { + return __dirname + '/../images/' + name + '.png'; +} + +/** + * Setup mocha with `options`. + * + * Options: + * + * - `ui` name "bdd", "tdd", "exports" etc + * - `reporter` reporter instance, defaults to `mocha.reporters.Dot` + * - `globals` array of accepted globals + * - `timeout` timeout in milliseconds + * - `bail` bail on the first test failure + * - `slow` milliseconds to wait before considering a test slow + * - `ignoreLeaks` ignore global leaks + * - `grep` string or regexp to filter tests with + * + * @param {Object} options + * @api public + */ + +function Mocha(options) { + options = options || {}; + this.files = []; + this.options = options; + this.grep(options.grep); + this.suite = new exports.Suite('', new exports.Context); + this.ui(options.ui); + this.bail(options.bail); + this.reporter(options.reporter); + if (null != options.timeout) this.timeout(options.timeout); + this.useColors(options.useColors) + if (options.slow) this.slow(options.slow); + + this.suite.on('pre-require', function (context) { + exports.afterEach = context.afterEach || context.teardown; + exports.after = context.after || context.suiteTeardown; + exports.beforeEach = context.beforeEach || context.setup; + exports.before = context.before || context.suiteSetup; + exports.describe = context.describe || context.suite; + exports.it = context.it || context.test; + exports.setup = context.setup || context.beforeEach; + exports.suiteSetup = context.suiteSetup || context.before; + exports.suiteTeardown = context.suiteTeardown || context.after; + exports.suite = context.suite || context.describe; + exports.teardown = context.teardown || context.afterEach; + exports.test = context.test || context.it; + }); +} + +/** + * Enable or disable bailing on the first failure. + * + * @param {Boolean} [bail] + * @api public + */ + +Mocha.prototype.bail = function(bail){ + if (0 == arguments.length) bail = true; + this.suite.bail(bail); + return this; +}; + +/** + * Add test `file`. + * + * @param {String} file + * @api public + */ + +Mocha.prototype.addFile = function(file){ + this.files.push(file); + return this; +}; + +/** + * Set reporter to `reporter`, defaults to "dot". + * + * @param {String|Function} reporter name or constructor + * @api public + */ + +Mocha.prototype.reporter = function(reporter){ + if ('function' == typeof reporter) { + this._reporter = reporter; + } else { + reporter = reporter || 'dot'; + var _reporter; + try { _reporter = require('./reporters/' + reporter); } catch (err) {}; + if (!_reporter) try { _reporter = require(reporter); } catch (err) {}; + if (!_reporter && reporter === 'teamcity') + console.warn('The Teamcity reporter was moved to a package named ' + + 'mocha-teamcity-reporter ' + + '(https://npmjs.org/package/mocha-teamcity-reporter).'); + if (!_reporter) throw new Error('invalid reporter "' + reporter + '"'); + this._reporter = _reporter; + } + return this; +}; + +/** + * Set test UI `name`, defaults to "bdd". + * + * @param {String} bdd + * @api public + */ + +Mocha.prototype.ui = function(name){ + name = name || 'bdd'; + this._ui = exports.interfaces[name]; + if (!this._ui) try { this._ui = require(name); } catch (err) {}; + if (!this._ui) throw new Error('invalid interface "' + name + '"'); + this._ui = this._ui(this.suite); + return this; +}; + +/** + * Load registered files. + * + * @api private + */ + +Mocha.prototype.loadFiles = function(fn){ + var self = this; + var suite = this.suite; + var pending = this.files.length; + this.files.forEach(function(file){ + file = path.resolve(file); + suite.emit('pre-require', global, file, self); + suite.emit('require', require(file), file, self); + suite.emit('post-require', global, file, self); + --pending || (fn && fn()); + }); +}; + +/** + * Enable growl support. + * + * @api private + */ + +Mocha.prototype._growl = function(runner, reporter) { + var notify = require('growl'); + + runner.on('end', function(){ + var stats = reporter.stats; + if (stats.failures) { + var msg = stats.failures + ' of ' + runner.total + ' tests failed'; + notify(msg, { name: 'mocha', title: 'Failed', image: image('error') }); + } else { + notify(stats.passes + ' tests passed in ' + stats.duration + 'ms', { + name: 'mocha' + , title: 'Passed' + , image: image('ok') + }); + } + }); +}; + +/** + * Add regexp to grep, if `re` is a string it is escaped. + * + * @param {RegExp|String} re + * @return {Mocha} + * @api public + */ + +Mocha.prototype.grep = function(re){ + this.options.grep = 'string' == typeof re + ? new RegExp(utils.escapeRegexp(re)) + : re; + return this; +}; + +/** + * Invert `.grep()` matches. + * + * @return {Mocha} + * @api public + */ + +Mocha.prototype.invert = function(){ + this.options.invert = true; + return this; +}; + +/** + * Ignore global leaks. + * + * @param {Boolean} ignore + * @return {Mocha} + * @api public + */ + +Mocha.prototype.ignoreLeaks = function(ignore){ + this.options.ignoreLeaks = !!ignore; + return this; +}; + +/** + * Enable global leak checking. + * + * @return {Mocha} + * @api public + */ + +Mocha.prototype.checkLeaks = function(){ + this.options.ignoreLeaks = false; + return this; +}; + +/** + * Enable growl support. + * + * @return {Mocha} + * @api public + */ + +Mocha.prototype.growl = function(){ + this.options.growl = true; + return this; +}; + +/** + * Ignore `globals` array or string. + * + * @param {Array|String} globals + * @return {Mocha} + * @api public + */ + +Mocha.prototype.globals = function(globals){ + this.options.globals = (this.options.globals || []).concat(globals); + return this; +}; + +/** + * Emit color output. + * + * @param {Boolean} colors + * @return {Mocha} + * @api public + */ + +Mocha.prototype.useColors = function(colors){ + this.options.useColors = arguments.length && colors != undefined + ? colors + : true; + return this; +}; + +/** + * Use inline diffs rather than +/-. + * + * @param {Boolean} inlineDiffs + * @return {Mocha} + * @api public + */ + +Mocha.prototype.useInlineDiffs = function(inlineDiffs) { + this.options.useInlineDiffs = arguments.length && inlineDiffs != undefined + ? inlineDiffs + : false; + return this; +}; + +/** + * Set the timeout in milliseconds. + * + * @param {Number} timeout + * @return {Mocha} + * @api public + */ + +Mocha.prototype.timeout = function(timeout){ + this.suite.timeout(timeout); + return this; +}; + +/** + * Set slowness threshold in milliseconds. + * + * @param {Number} slow + * @return {Mocha} + * @api public + */ + +Mocha.prototype.slow = function(slow){ + this.suite.slow(slow); + return this; +}; + +/** + * Makes all tests async (accepting a callback) + * + * @return {Mocha} + * @api public + */ + +Mocha.prototype.asyncOnly = function(){ + this.options.asyncOnly = true; + return this; +}; + +/** + * Run tests and invoke `fn()` when complete. + * + * @param {Function} fn + * @return {Runner} + * @api public + */ + +Mocha.prototype.run = function(fn){ + if (this.files.length) this.loadFiles(); + var suite = this.suite; + var options = this.options; + var runner = new exports.Runner(suite); + var reporter = new this._reporter(runner); + runner.ignoreLeaks = false !== options.ignoreLeaks; + runner.asyncOnly = options.asyncOnly; + if (options.grep) runner.grep(options.grep, options.invert); + if (options.globals) runner.globals(options.globals); + if (options.growl) this._growl(runner, reporter); + exports.reporters.Base.useColors = options.useColors; + exports.reporters.Base.inlineDiffs = options.useInlineDiffs; + return runner.run(fn); +}; diff --git a/node_modules/mocha/lib/ms.js b/node_modules/mocha/lib/ms.js new file mode 100644 index 0000000..4096637 --- /dev/null +++ b/node_modules/mocha/lib/ms.js @@ -0,0 +1,109 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} options + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options){ + options = options || {}; + if ('string' == typeof val) return parse(val); + return options.long ? longFormat(val) : shortFormat(val); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + var match = /^((?:\d+)?\.?\d+) *(ms|seconds?|s|minutes?|m|hours?|h|days?|d|years?|y)?$/i.exec(str); + if (!match) return; + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 's': + return n * s; + case 'ms': + return n; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function shortFormat(ms) { + if (ms >= d) return Math.round(ms / d) + 'd'; + if (ms >= h) return Math.round(ms / h) + 'h'; + if (ms >= m) return Math.round(ms / m) + 'm'; + if (ms >= s) return Math.round(ms / s) + 's'; + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function longFormat(ms) { + return plural(ms, d, 'day') + || plural(ms, h, 'hour') + || plural(ms, m, 'minute') + || plural(ms, s, 'second') + || ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) return; + if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name; + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/node_modules/mocha/lib/reporters/base.js b/node_modules/mocha/lib/reporters/base.js new file mode 100644 index 0000000..0754fe1 --- /dev/null +++ b/node_modules/mocha/lib/reporters/base.js @@ -0,0 +1,507 @@ + +/** + * Module dependencies. + */ + +var tty = require('tty') + , diff = require('diff') + , ms = require('../ms') + , utils = require('../utils'); + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date + , setTimeout = global.setTimeout + , setInterval = global.setInterval + , clearTimeout = global.clearTimeout + , clearInterval = global.clearInterval; + +/** + * Check if both stdio streams are associated with a tty. + */ + +var isatty = tty.isatty(1) && tty.isatty(2); + +/** + * Expose `Base`. + */ + +exports = module.exports = Base; + +/** + * Enable coloring by default. + */ + +exports.useColors = isatty || (process.env.MOCHA_COLORS !== undefined); + +/** + * Inline diffs instead of +/- + */ + +exports.inlineDiffs = false; + +/** + * Default color map. + */ + +exports.colors = { + 'pass': 90 + , 'fail': 31 + , 'bright pass': 92 + , 'bright fail': 91 + , 'bright yellow': 93 + , 'pending': 36 + , 'suite': 0 + , 'error title': 0 + , 'error message': 31 + , 'error stack': 90 + , 'checkmark': 32 + , 'fast': 90 + , 'medium': 33 + , 'slow': 31 + , 'green': 32 + , 'light': 90 + , 'diff gutter': 90 + , 'diff added': 42 + , 'diff removed': 41 +}; + +/** + * Default symbol map. + */ + +exports.symbols = { + ok: '✓', + err: '✖', + dot: '․' +}; + +// With node.js on Windows: use symbols available in terminal default fonts +if ('win32' == process.platform) { + exports.symbols.ok = '\u221A'; + exports.symbols.err = '\u00D7'; + exports.symbols.dot = '.'; +} + +/** + * Color `str` with the given `type`, + * allowing colors to be disabled, + * as well as user-defined color + * schemes. + * + * @param {String} type + * @param {String} str + * @return {String} + * @api private + */ + +var color = exports.color = function(type, str) { + if (!exports.useColors) return str; + return '\u001b[' + exports.colors[type] + 'm' + str + '\u001b[0m'; +}; + +/** + * Expose term window size, with some + * defaults for when stderr is not a tty. + */ + +exports.window = { + width: isatty + ? process.stdout.getWindowSize + ? process.stdout.getWindowSize(1)[0] + : tty.getWindowSize()[1] + : 75 +}; + +/** + * Expose some basic cursor interactions + * that are common among reporters. + */ + +exports.cursor = { + hide: function(){ + isatty && process.stdout.write('\u001b[?25l'); + }, + + show: function(){ + isatty && process.stdout.write('\u001b[?25h'); + }, + + deleteLine: function(){ + isatty && process.stdout.write('\u001b[2K'); + }, + + beginningOfLine: function(){ + isatty && process.stdout.write('\u001b[0G'); + }, + + CR: function(){ + if (isatty) { + exports.cursor.deleteLine(); + exports.cursor.beginningOfLine(); + } else { + process.stdout.write('\r'); + } + } +}; + +/** + * Outut the given `failures` as a list. + * + * @param {Array} failures + * @api public + */ + +exports.list = function(failures){ + console.error(); + failures.forEach(function(test, i){ + // format + var fmt = color('error title', ' %s) %s:\n') + + color('error message', ' %s') + + color('error stack', '\n%s\n'); + + // msg + var err = test.err + , message = err.message || '' + , stack = err.stack || message + , index = stack.indexOf(message) + message.length + , msg = stack.slice(0, index) + , actual = err.actual + , expected = err.expected + , escape = true; + + // uncaught + if (err.uncaught) { + msg = 'Uncaught ' + msg; + } + + // explicitly show diff + if (err.showDiff && sameType(actual, expected)) { + escape = false; + err.actual = actual = stringify(canonicalize(actual)); + err.expected = expected = stringify(canonicalize(expected)); + } + + // actual / expected diff + if ('string' == typeof actual && 'string' == typeof expected) { + fmt = color('error title', ' %s) %s:\n%s') + color('error stack', '\n%s\n'); + var match = message.match(/^([^:]+): expected/); + msg = '\n ' + color('error message', match ? match[1] : msg); + + if (exports.inlineDiffs) { + msg += inlineDiff(err, escape); + } else { + msg += unifiedDiff(err, escape); + } + } + + // indent stack trace without msg + stack = stack.slice(index ? index + 1 : index) + .replace(/^/gm, ' '); + + console.error(fmt, (i + 1), test.fullTitle(), msg, stack); + }); +}; + +/** + * Initialize a new `Base` reporter. + * + * All other reporters generally + * inherit from this reporter, providing + * stats such as test duration, number + * of tests passed / failed etc. + * + * @param {Runner} runner + * @api public + */ + +function Base(runner) { + var self = this + , stats = this.stats = { suites: 0, tests: 0, passes: 0, pending: 0, failures: 0 } + , failures = this.failures = []; + + if (!runner) return; + this.runner = runner; + + runner.stats = stats; + + runner.on('start', function(){ + stats.start = new Date; + }); + + runner.on('suite', function(suite){ + stats.suites = stats.suites || 0; + suite.root || stats.suites++; + }); + + runner.on('test end', function(test){ + stats.tests = stats.tests || 0; + stats.tests++; + }); + + runner.on('pass', function(test){ + stats.passes = stats.passes || 0; + + var medium = test.slow() / 2; + test.speed = test.duration > test.slow() + ? 'slow' + : test.duration > medium + ? 'medium' + : 'fast'; + + stats.passes++; + }); + + runner.on('fail', function(test, err){ + stats.failures = stats.failures || 0; + stats.failures++; + test.err = err; + failures.push(test); + }); + + runner.on('end', function(){ + stats.end = new Date; + stats.duration = new Date - stats.start; + }); + + runner.on('pending', function(){ + stats.pending++; + }); +} + +/** + * Output common epilogue used by many of + * the bundled reporters. + * + * @api public + */ + +Base.prototype.epilogue = function(){ + var stats = this.stats; + var tests; + var fmt; + + console.log(); + + // passes + fmt = color('bright pass', ' ') + + color('green', ' %d passing') + + color('light', ' (%s)'); + + console.log(fmt, + stats.passes || 0, + ms(stats.duration)); + + // pending + if (stats.pending) { + fmt = color('pending', ' ') + + color('pending', ' %d pending'); + + console.log(fmt, stats.pending); + } + + // failures + if (stats.failures) { + fmt = color('fail', ' %d failing'); + + console.error(fmt, + stats.failures); + + Base.list(this.failures); + console.error(); + } + + console.log(); +}; + +/** + * Pad the given `str` to `len`. + * + * @param {String} str + * @param {String} len + * @return {String} + * @api private + */ + +function pad(str, len) { + str = String(str); + return Array(len - str.length + 1).join(' ') + str; +} + + +/** + * Returns an inline diff between 2 strings with coloured ANSI output + * + * @param {Error} Error with actual/expected + * @return {String} Diff + * @api private + */ + +function inlineDiff(err, escape) { + var msg = errorDiff(err, 'WordsWithSpace', escape); + + // linenos + var lines = msg.split('\n'); + if (lines.length > 4) { + var width = String(lines.length).length; + msg = lines.map(function(str, i){ + return pad(++i, width) + ' |' + ' ' + str; + }).join('\n'); + } + + // legend + msg = '\n' + + color('diff removed', 'actual') + + ' ' + + color('diff added', 'expected') + + '\n\n' + + msg + + '\n'; + + // indent + msg = msg.replace(/^/gm, ' '); + return msg; +} + +/** + * Returns a unified diff between 2 strings + * + * @param {Error} Error with actual/expected + * @return {String} Diff + * @api private + */ + +function unifiedDiff(err, escape) { + var indent = ' '; + function cleanUp(line) { + if (escape) { + line = escapeInvisibles(line); + } + if (line[0] === '+') return indent + colorLines('diff added', line); + if (line[0] === '-') return indent + colorLines('diff removed', line); + if (line.match(/\@\@/)) return null; + if (line.match(/\\ No newline/)) return null; + else return indent + line; + } + function notBlank(line) { + return line != null; + } + msg = diff.createPatch('string', err.actual, err.expected); + var lines = msg.split('\n').splice(4); + return '\n ' + + colorLines('diff added', '+ expected') + ' ' + + colorLines('diff removed', '- actual') + + '\n\n' + + lines.map(cleanUp).filter(notBlank).join('\n'); +} + +/** + * Return a character diff for `err`. + * + * @param {Error} err + * @return {String} + * @api private + */ + +function errorDiff(err, type, escape) { + var actual = escape ? escapeInvisibles(err.actual) : err.actual; + var expected = escape ? escapeInvisibles(err.expected) : err.expected; + return diff['diff' + type](actual, expected).map(function(str){ + if (str.added) return colorLines('diff added', str.value); + if (str.removed) return colorLines('diff removed', str.value); + return str.value; + }).join(''); +} + +/** + * Returns a string with all invisible characters in plain text + * + * @param {String} line + * @return {String} + * @api private + */ +function escapeInvisibles(line) { + return line.replace(/\t/g, '') + .replace(/\r/g, '') + .replace(/\n/g, '\n'); +} + +/** + * Color lines for `str`, using the color `name`. + * + * @param {String} name + * @param {String} str + * @return {String} + * @api private + */ + +function colorLines(name, str) { + return str.split('\n').map(function(str){ + return color(name, str); + }).join('\n'); +} + +/** + * Stringify `obj`. + * + * @param {Object} obj + * @return {String} + * @api private + */ + +function stringify(obj) { + if (obj instanceof RegExp) return obj.toString(); + return JSON.stringify(obj, null, 2); +} + +/** + * Return a new object that has the keys in sorted order. + * @param {Object} obj + * @return {Object} + * @api private + */ + + function canonicalize(obj, stack) { + stack = stack || []; + + if (utils.indexOf(stack, obj) !== -1) return obj; + + var canonicalizedObj; + + if ('[object Array]' == {}.toString.call(obj)) { + stack.push(obj); + canonicalizedObj = utils.map(obj, function(item) { + return canonicalize(item, stack); + }); + stack.pop(); + } else if (typeof obj === 'object' && obj !== null) { + stack.push(obj); + canonicalizedObj = {}; + utils.forEach(utils.keys(obj).sort(), function(key) { + canonicalizedObj[key] = canonicalize(obj[key], stack); + }); + stack.pop(); + } else { + canonicalizedObj = obj; + } + + return canonicalizedObj; + } + +/** + * Check that a / b have the same type. + * + * @param {Object} a + * @param {Object} b + * @return {Boolean} + * @api private + */ + +function sameType(a, b) { + a = Object.prototype.toString.call(a); + b = Object.prototype.toString.call(b); + return a == b; +} + diff --git a/node_modules/mocha/lib/reporters/doc.js b/node_modules/mocha/lib/reporters/doc.js new file mode 100644 index 0000000..2e5bf57 --- /dev/null +++ b/node_modules/mocha/lib/reporters/doc.js @@ -0,0 +1,56 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , utils = require('../utils'); + +/** + * Expose `Doc`. + */ + +exports = module.exports = Doc; + +/** + * Initialize a new `Doc` reporter. + * + * @param {Runner} runner + * @api public + */ + +function Doc(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , total = runner.total + , indents = 2; + + function indent() { + return Array(indents).join(' '); + } + + runner.on('suite', function(suite){ + if (suite.root) return; + ++indents; + console.log('%s
', indent()); + ++indents; + console.log('%s

%s

', indent(), utils.escape(suite.title)); + console.log('%s
', indent()); + }); + + runner.on('suite end', function(suite){ + if (suite.root) return; + console.log('%s
', indent()); + --indents; + console.log('%s
', indent()); + --indents; + }); + + runner.on('pass', function(test){ + console.log('%s
%s
', indent(), utils.escape(test.title)); + var code = utils.escape(utils.clean(test.fn.toString())); + console.log('%s 
%s
', indent(), code); + }); +} diff --git a/node_modules/mocha/lib/reporters/dot.js b/node_modules/mocha/lib/reporters/dot.js new file mode 100644 index 0000000..0c298ba --- /dev/null +++ b/node_modules/mocha/lib/reporters/dot.js @@ -0,0 +1,62 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , color = Base.color; + +/** + * Expose `Dot`. + */ + +exports = module.exports = Dot; + +/** + * Initialize a new `Dot` matrix test reporter. + * + * @param {Runner} runner + * @api public + */ + +function Dot(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , width = Base.window.width * .75 | 0 + , n = 0; + + runner.on('start', function(){ + process.stdout.write('\n '); + }); + + runner.on('pending', function(test){ + process.stdout.write(color('pending', Base.symbols.dot)); + }); + + runner.on('pass', function(test){ + if (++n % width == 0) process.stdout.write('\n '); + if ('slow' == test.speed) { + process.stdout.write(color('bright yellow', Base.symbols.dot)); + } else { + process.stdout.write(color(test.speed, Base.symbols.dot)); + } + }); + + runner.on('fail', function(test, err){ + if (++n % width == 0) process.stdout.write('\n '); + process.stdout.write(color('fail', Base.symbols.dot)); + }); + + runner.on('end', function(){ + console.log(); + self.epilogue(); + }); +} + +/** + * Inherit from `Base.prototype`. + */ + +Dot.prototype.__proto__ = Base.prototype; \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/html-cov.js b/node_modules/mocha/lib/reporters/html-cov.js new file mode 100644 index 0000000..bfb27ff --- /dev/null +++ b/node_modules/mocha/lib/reporters/html-cov.js @@ -0,0 +1,51 @@ + +/** + * Module dependencies. + */ + +var JSONCov = require('./json-cov') + , fs = require('fs'); + +/** + * Expose `HTMLCov`. + */ + +exports = module.exports = HTMLCov; + +/** + * Initialize a new `JsCoverage` reporter. + * + * @param {Runner} runner + * @api public + */ + +function HTMLCov(runner) { + var jade = require('jade') + , file = __dirname + '/templates/coverage.jade' + , str = fs.readFileSync(file, 'utf8') + , fn = jade.compile(str, { filename: file }) + , self = this; + + JSONCov.call(this, runner, false); + + runner.on('end', function(){ + process.stdout.write(fn({ + cov: self.cov + , coverageClass: coverageClass + })); + }); +} + +/** + * Return coverage class for `n`. + * + * @return {String} + * @api private + */ + +function coverageClass(n) { + if (n >= 75) return 'high'; + if (n >= 50) return 'medium'; + if (n >= 25) return 'low'; + return 'terrible'; +} \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/html.js b/node_modules/mocha/lib/reporters/html.js new file mode 100644 index 0000000..873f024 --- /dev/null +++ b/node_modules/mocha/lib/reporters/html.js @@ -0,0 +1,274 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , utils = require('../utils') + , Progress = require('../browser/progress') + , escape = utils.escape; + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date + , setTimeout = global.setTimeout + , setInterval = global.setInterval + , clearTimeout = global.clearTimeout + , clearInterval = global.clearInterval; + +/** + * Expose `HTML`. + */ + +exports = module.exports = HTML; + +/** + * Stats template. + */ + +var statsTemplate = ''; + +/** + * Initialize a new `HTML` reporter. + * + * @param {Runner} runner + * @api public + */ + +function HTML(runner, root) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , total = runner.total + , stat = fragment(statsTemplate) + , items = stat.getElementsByTagName('li') + , passes = items[1].getElementsByTagName('em')[0] + , passesLink = items[1].getElementsByTagName('a')[0] + , failures = items[2].getElementsByTagName('em')[0] + , failuresLink = items[2].getElementsByTagName('a')[0] + , duration = items[3].getElementsByTagName('em')[0] + , canvas = stat.getElementsByTagName('canvas')[0] + , report = fragment('
    ') + , stack = [report] + , progress + , ctx + + root = root || document.getElementById('mocha'); + + if (canvas.getContext) { + var ratio = window.devicePixelRatio || 1; + canvas.style.width = canvas.width; + canvas.style.height = canvas.height; + canvas.width *= ratio; + canvas.height *= ratio; + ctx = canvas.getContext('2d'); + ctx.scale(ratio, ratio); + progress = new Progress; + } + + if (!root) return error('#mocha div missing, add it to your document'); + + // pass toggle + on(passesLink, 'click', function(){ + unhide(); + var name = /pass/.test(report.className) ? '' : ' pass'; + report.className = report.className.replace(/fail|pass/g, '') + name; + if (report.className.trim()) hideSuitesWithout('test pass'); + }); + + // failure toggle + on(failuresLink, 'click', function(){ + unhide(); + var name = /fail/.test(report.className) ? '' : ' fail'; + report.className = report.className.replace(/fail|pass/g, '') + name; + if (report.className.trim()) hideSuitesWithout('test fail'); + }); + + root.appendChild(stat); + root.appendChild(report); + + if (progress) progress.size(40); + + runner.on('suite', function(suite){ + if (suite.root) return; + + // suite + var url = self.suiteURL(suite); + var el = fragment('

  • %s

    • ', url, escape(suite.title)); + + // container + stack[0].appendChild(el); + stack.unshift(document.createElement('ul')); + el.appendChild(stack[0]); + }); + + runner.on('suite end', function(suite){ + if (suite.root) return; + stack.shift(); + }); + + runner.on('fail', function(test, err){ + if ('hook' == test.type) runner.emit('test end', test); + }); + + runner.on('test end', function(test){ + // TODO: add to stats + var percent = stats.tests / this.total * 100 | 0; + if (progress) progress.update(percent).draw(ctx); + + // update stats + var ms = new Date - stats.start; + text(passes, stats.passes); + text(failures, stats.failures); + text(duration, (ms / 1000).toFixed(2)); + + // test + if ('passed' == test.state) { + var url = self.testURL(test); + var el = fragment('

  • %e%ems ‣

    • ', test.speed, test.title, test.duration, url); + } else if (test.pending) { + var el = fragment('

  • %e

    • ', test.title); + } else { + var el = fragment('

  • %e ‣

    • ', test.title, encodeURIComponent(test.fullTitle())); + var str = test.err.stack || test.err.toString(); + + // FF / Opera do not add the message + if (!~str.indexOf(test.err.message)) { + str = test.err.message + '\n' + str; + } + + // <=IE7 stringifies to [Object Error]. Since it can be overloaded, we + // check for the result of the stringifying. + if ('[object Error]' == str) str = test.err.message; + + // Safari doesn't give you a stack. Let's at least provide a source line. + if (!test.err.stack && test.err.sourceURL && test.err.line !== undefined) { + str += "\n(" + test.err.sourceURL + ":" + test.err.line + ")"; + } + + el.appendChild(fragment('
    %e
    ', str)); + } + + // toggle code + // TODO: defer + if (!test.pending) { + var h2 = el.getElementsByTagName('h2')[0]; + + on(h2, 'click', function(){ + pre.style.display = 'none' == pre.style.display + ? 'block' + : 'none'; + }); + + var pre = fragment('
    %e
    ', utils.clean(test.fn.toString())); + el.appendChild(pre); + pre.style.display = 'none'; + } + + // Don't call .appendChild if #mocha-report was already .shift()'ed off the stack. + if (stack[0]) stack[0].appendChild(el); + }); +} + +/** + * Provide suite URL + * + * @param {Object} [suite] + */ + +HTML.prototype.suiteURL = function(suite){ + return '?grep=' + encodeURIComponent(suite.fullTitle()); +}; + +/** + * Provide test URL + * + * @param {Object} [test] + */ + +HTML.prototype.testURL = function(test){ + return '?grep=' + encodeURIComponent(test.fullTitle()); +}; + +/** + * Display error `msg`. + */ + +function error(msg) { + document.body.appendChild(fragment('
    %s
    ', msg)); +} + +/** + * Return a DOM fragment from `html`. + */ + +function fragment(html) { + var args = arguments + , div = document.createElement('div') + , i = 1; + + div.innerHTML = html.replace(/%([se])/g, function(_, type){ + switch (type) { + case 's': return String(args[i++]); + case 'e': return escape(args[i++]); + } + }); + + return div.firstChild; +} + +/** + * Check for suites that do not have elements + * with `classname`, and hide them. + */ + +function hideSuitesWithout(classname) { + var suites = document.getElementsByClassName('suite'); + for (var i = 0; i < suites.length; i++) { + var els = suites[i].getElementsByClassName(classname); + if (0 == els.length) suites[i].className += ' hidden'; + } +} + +/** + * Unhide .hidden suites. + */ + +function unhide() { + var els = document.getElementsByClassName('suite hidden'); + for (var i = 0; i < els.length; ++i) { + els[i].className = els[i].className.replace('suite hidden', 'suite'); + } +} + +/** + * Set `el` text to `str`. + */ + +function text(el, str) { + if (el.textContent) { + el.textContent = str; + } else { + el.innerText = str; + } +} + +/** + * Listen on `event` with callback `fn`. + */ + +function on(el, event, fn) { + if (el.addEventListener) { + el.addEventListener(event, fn, false); + } else { + el.attachEvent('on' + event, fn); + } +} diff --git a/node_modules/mocha/lib/reporters/index.js b/node_modules/mocha/lib/reporters/index.js new file mode 100644 index 0000000..1c4fccf --- /dev/null +++ b/node_modules/mocha/lib/reporters/index.js @@ -0,0 +1,18 @@ + +exports.Base = require('./base'); +exports.Dot = require('./dot'); +exports.Doc = require('./doc'); +exports.TAP = require('./tap'); +exports.JSON = require('./json'); +exports.HTML = require('./html'); +exports.List = require('./list'); +exports.Min = require('./min'); +exports.Spec = require('./spec'); +exports.Nyan = require('./nyan'); +exports.XUnit = require('./xunit'); +exports.Markdown = require('./markdown'); +exports.Progress = require('./progress'); +exports.Landing = require('./landing'); +exports.JSONCov = require('./json-cov'); +exports.HTMLCov = require('./html-cov'); +exports.JSONStream = require('./json-stream'); diff --git a/node_modules/mocha/lib/reporters/json-cov.js b/node_modules/mocha/lib/reporters/json-cov.js new file mode 100644 index 0000000..73d0009 --- /dev/null +++ b/node_modules/mocha/lib/reporters/json-cov.js @@ -0,0 +1,153 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base'); + +/** + * Expose `JSONCov`. + */ + +exports = module.exports = JSONCov; + +/** + * Initialize a new `JsCoverage` reporter. + * + * @param {Runner} runner + * @param {Boolean} output + * @api public + */ + +function JSONCov(runner, output) { + var self = this + , output = 1 == arguments.length ? true : output; + + Base.call(this, runner); + + var tests = [] + , failures = [] + , passes = []; + + runner.on('test end', function(test){ + tests.push(test); + }); + + runner.on('pass', function(test){ + passes.push(test); + }); + + runner.on('fail', function(test){ + failures.push(test); + }); + + runner.on('end', function(){ + var cov = global._$jscoverage || {}; + var result = self.cov = map(cov); + result.stats = self.stats; + result.tests = tests.map(clean); + result.failures = failures.map(clean); + result.passes = passes.map(clean); + if (!output) return; + process.stdout.write(JSON.stringify(result, null, 2 )); + }); +} + +/** + * Map jscoverage data to a JSON structure + * suitable for reporting. + * + * @param {Object} cov + * @return {Object} + * @api private + */ + +function map(cov) { + var ret = { + instrumentation: 'node-jscoverage' + , sloc: 0 + , hits: 0 + , misses: 0 + , coverage: 0 + , files: [] + }; + + for (var filename in cov) { + var data = coverage(filename, cov[filename]); + ret.files.push(data); + ret.hits += data.hits; + ret.misses += data.misses; + ret.sloc += data.sloc; + } + + ret.files.sort(function(a, b) { + return a.filename.localeCompare(b.filename); + }); + + if (ret.sloc > 0) { + ret.coverage = (ret.hits / ret.sloc) * 100; + } + + return ret; +}; + +/** + * Map jscoverage data for a single source file + * to a JSON structure suitable for reporting. + * + * @param {String} filename name of the source file + * @param {Object} data jscoverage coverage data + * @return {Object} + * @api private + */ + +function coverage(filename, data) { + var ret = { + filename: filename, + coverage: 0, + hits: 0, + misses: 0, + sloc: 0, + source: {} + }; + + data.source.forEach(function(line, num){ + num++; + + if (data[num] === 0) { + ret.misses++; + ret.sloc++; + } else if (data[num] !== undefined) { + ret.hits++; + ret.sloc++; + } + + ret.source[num] = { + source: line + , coverage: data[num] === undefined + ? '' + : data[num] + }; + }); + + ret.coverage = ret.hits / ret.sloc * 100; + + return ret; +} + +/** + * Return a plain-object representation of `test` + * free of cyclic properties etc. + * + * @param {Object} test + * @return {Object} + * @api private + */ + +function clean(test) { + return { + title: test.title + , fullTitle: test.fullTitle() + , duration: test.duration + } +} diff --git a/node_modules/mocha/lib/reporters/json-stream.js b/node_modules/mocha/lib/reporters/json-stream.js new file mode 100644 index 0000000..7cb8fbe --- /dev/null +++ b/node_modules/mocha/lib/reporters/json-stream.js @@ -0,0 +1,61 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , color = Base.color; + +/** + * Expose `List`. + */ + +exports = module.exports = List; + +/** + * Initialize a new `List` test reporter. + * + * @param {Runner} runner + * @api public + */ + +function List(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , total = runner.total; + + runner.on('start', function(){ + console.log(JSON.stringify(['start', { total: total }])); + }); + + runner.on('pass', function(test){ + console.log(JSON.stringify(['pass', clean(test)])); + }); + + runner.on('fail', function(test, err){ + console.log(JSON.stringify(['fail', clean(test)])); + }); + + runner.on('end', function(){ + process.stdout.write(JSON.stringify(['end', self.stats])); + }); +} + +/** + * Return a plain-object representation of `test` + * free of cyclic properties etc. + * + * @param {Object} test + * @return {Object} + * @api private + */ + +function clean(test) { + return { + title: test.title + , fullTitle: test.fullTitle() + , duration: test.duration + } +} \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/json.js b/node_modules/mocha/lib/reporters/json.js new file mode 100644 index 0000000..a699f50 --- /dev/null +++ b/node_modules/mocha/lib/reporters/json.js @@ -0,0 +1,70 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `JSON`. + */ + +exports = module.exports = JSONReporter; + +/** + * Initialize a new `JSON` reporter. + * + * @param {Runner} runner + * @api public + */ + +function JSONReporter(runner) { + var self = this; + Base.call(this, runner); + + var tests = [] + , failures = [] + , passes = []; + + runner.on('test end', function(test){ + tests.push(test); + }); + + runner.on('pass', function(test){ + passes.push(test); + }); + + runner.on('fail', function(test){ + failures.push(test); + }); + + runner.on('end', function(){ + var obj = { + stats: self.stats + , tests: tests.map(clean) + , failures: failures.map(clean) + , passes: passes.map(clean) + }; + + process.stdout.write(JSON.stringify(obj, null, 2)); + }); +} + +/** + * Return a plain-object representation of `test` + * free of cyclic properties etc. + * + * @param {Object} test + * @return {Object} + * @api private + */ + +function clean(test) { + return { + title: test.title + , fullTitle: test.fullTitle() + , duration: test.duration + } +} \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/landing.js b/node_modules/mocha/lib/reporters/landing.js new file mode 100644 index 0000000..bf064f6 --- /dev/null +++ b/node_modules/mocha/lib/reporters/landing.js @@ -0,0 +1,97 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `Landing`. + */ + +exports = module.exports = Landing; + +/** + * Airplane color. + */ + +Base.colors.plane = 0; + +/** + * Airplane crash color. + */ + +Base.colors['plane crash'] = 31; + +/** + * Runway color. + */ + +Base.colors.runway = 90; + +/** + * Initialize a new `Landing` reporter. + * + * @param {Runner} runner + * @api public + */ + +function Landing(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , width = Base.window.width * .75 | 0 + , total = runner.total + , stream = process.stdout + , plane = color('plane', '✈') + , crashed = -1 + , n = 0; + + function runway() { + var buf = Array(width).join('-'); + return ' ' + color('runway', buf); + } + + runner.on('start', function(){ + stream.write('\n '); + cursor.hide(); + }); + + runner.on('test end', function(test){ + // check if the plane crashed + var col = -1 == crashed + ? width * ++n / total | 0 + : crashed; + + // show the crash + if ('failed' == test.state) { + plane = color('plane crash', '✈'); + crashed = col; + } + + // render landing strip + stream.write('\u001b[4F\n\n'); + stream.write(runway()); + stream.write('\n '); + stream.write(color('runway', Array(col).join('⋅'))); + stream.write(plane) + stream.write(color('runway', Array(width - col).join('⋅') + '\n')); + stream.write(runway()); + stream.write('\u001b[0m'); + }); + + runner.on('end', function(){ + cursor.show(); + console.log(); + self.epilogue(); + }); +} + +/** + * Inherit from `Base.prototype`. + */ + +Landing.prototype.__proto__ = Base.prototype; \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/list.js b/node_modules/mocha/lib/reporters/list.js new file mode 100644 index 0000000..3328e15 --- /dev/null +++ b/node_modules/mocha/lib/reporters/list.js @@ -0,0 +1,64 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `List`. + */ + +exports = module.exports = List; + +/** + * Initialize a new `List` test reporter. + * + * @param {Runner} runner + * @api public + */ + +function List(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , n = 0; + + runner.on('start', function(){ + console.log(); + }); + + runner.on('test', function(test){ + process.stdout.write(color('pass', ' ' + test.fullTitle() + ': ')); + }); + + runner.on('pending', function(test){ + var fmt = color('checkmark', ' -') + + color('pending', ' %s'); + console.log(fmt, test.fullTitle()); + }); + + runner.on('pass', function(test){ + var fmt = color('checkmark', ' '+Base.symbols.dot) + + color('pass', ' %s: ') + + color(test.speed, '%dms'); + cursor.CR(); + console.log(fmt, test.fullTitle(), test.duration); + }); + + runner.on('fail', function(test, err){ + cursor.CR(); + console.log(color('fail', ' %d) %s'), ++n, test.fullTitle()); + }); + + runner.on('end', self.epilogue.bind(self)); +} + +/** + * Inherit from `Base.prototype`. + */ + +List.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/markdown.js b/node_modules/mocha/lib/reporters/markdown.js new file mode 100644 index 0000000..6383a64 --- /dev/null +++ b/node_modules/mocha/lib/reporters/markdown.js @@ -0,0 +1,91 @@ +/** + * Module dependencies. + */ + +var Base = require('./base') + , utils = require('../utils'); + +/** + * Expose `Markdown`. + */ + +exports = module.exports = Markdown; + +/** + * Initialize a new `Markdown` reporter. + * + * @param {Runner} runner + * @api public + */ + +function Markdown(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , level = 0 + , buf = ''; + + function title(str) { + return Array(level).join('#') + ' ' + str; + } + + function indent() { + return Array(level).join(' '); + } + + function mapTOC(suite, obj) { + var ret = obj; + obj = obj[suite.title] = obj[suite.title] || { suite: suite }; + suite.suites.forEach(function(suite){ + mapTOC(suite, obj); + }); + return ret; + } + + function stringifyTOC(obj, level) { + ++level; + var buf = ''; + var link; + for (var key in obj) { + if ('suite' == key) continue; + if (key) link = ' - [' + key + '](#' + utils.slug(obj[key].suite.fullTitle()) + ')\n'; + if (key) buf += Array(level).join(' ') + link; + buf += stringifyTOC(obj[key], level); + } + --level; + return buf; + } + + function generateTOC(suite) { + var obj = mapTOC(suite, {}); + return stringifyTOC(obj, 0); + } + + generateTOC(runner.suite); + + runner.on('suite', function(suite){ + ++level; + var slug = utils.slug(suite.fullTitle()); + buf += '' + '\n'; + buf += title(suite.title) + '\n'; + }); + + runner.on('suite end', function(suite){ + --level; + }); + + runner.on('pass', function(test){ + var code = utils.clean(test.fn.toString()); + buf += test.title + '.\n'; + buf += '\n```js\n'; + buf += code + '\n'; + buf += '```\n\n'; + }); + + runner.on('end', function(){ + process.stdout.write('# TOC\n'); + process.stdout.write(generateTOC(runner.suite)); + process.stdout.write(buf); + }); +} \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/min.js b/node_modules/mocha/lib/reporters/min.js new file mode 100644 index 0000000..1b6117d --- /dev/null +++ b/node_modules/mocha/lib/reporters/min.js @@ -0,0 +1,38 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base'); + +/** + * Expose `Min`. + */ + +exports = module.exports = Min; + +/** + * Initialize a new `Min` minimal test reporter (best used with --watch). + * + * @param {Runner} runner + * @api public + */ + +function Min(runner) { + Base.call(this, runner); + + runner.on('start', function(){ + // clear screen + process.stdout.write('\u001b[2J'); + // set cursor position + process.stdout.write('\u001b[1;3H'); + }); + + runner.on('end', this.epilogue.bind(this)); +} + +/** + * Inherit from `Base.prototype`. + */ + +Min.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/nyan.js b/node_modules/mocha/lib/reporters/nyan.js new file mode 100644 index 0000000..4501f6b --- /dev/null +++ b/node_modules/mocha/lib/reporters/nyan.js @@ -0,0 +1,260 @@ +/** + * Module dependencies. + */ + +var Base = require('./base') + , color = Base.color; + +/** + * Expose `Dot`. + */ + +exports = module.exports = NyanCat; + +/** + * Initialize a new `Dot` matrix test reporter. + * + * @param {Runner} runner + * @api public + */ + +function NyanCat(runner) { + Base.call(this, runner); + var self = this + , stats = this.stats + , width = Base.window.width * .75 | 0 + , rainbowColors = this.rainbowColors = self.generateColors() + , colorIndex = this.colorIndex = 0 + , numerOfLines = this.numberOfLines = 4 + , trajectories = this.trajectories = [[], [], [], []] + , nyanCatWidth = this.nyanCatWidth = 11 + , trajectoryWidthMax = this.trajectoryWidthMax = (width - nyanCatWidth) + , scoreboardWidth = this.scoreboardWidth = 5 + , tick = this.tick = 0 + , n = 0; + + runner.on('start', function(){ + Base.cursor.hide(); + self.draw(); + }); + + runner.on('pending', function(test){ + self.draw(); + }); + + runner.on('pass', function(test){ + self.draw(); + }); + + runner.on('fail', function(test, err){ + self.draw(); + }); + + runner.on('end', function(){ + Base.cursor.show(); + for (var i = 0; i < self.numberOfLines; i++) write('\n'); + self.epilogue(); + }); +} + +/** + * Draw the nyan cat + * + * @api private + */ + +NyanCat.prototype.draw = function(){ + this.appendRainbow(); + this.drawScoreboard(); + this.drawRainbow(); + this.drawNyanCat(); + this.tick = !this.tick; +}; + +/** + * Draw the "scoreboard" showing the number + * of passes, failures and pending tests. + * + * @api private + */ + +NyanCat.prototype.drawScoreboard = function(){ + var stats = this.stats; + var colors = Base.colors; + + function draw(color, n) { + write(' '); + write('\u001b[' + color + 'm' + n + '\u001b[0m'); + write('\n'); + } + + draw(colors.green, stats.passes); + draw(colors.fail, stats.failures); + draw(colors.pending, stats.pending); + write('\n'); + + this.cursorUp(this.numberOfLines); +}; + +/** + * Append the rainbow. + * + * @api private + */ + +NyanCat.prototype.appendRainbow = function(){ + var segment = this.tick ? '_' : '-'; + var rainbowified = this.rainbowify(segment); + + for (var index = 0; index < this.numberOfLines; index++) { + var trajectory = this.trajectories[index]; + if (trajectory.length >= this.trajectoryWidthMax) trajectory.shift(); + trajectory.push(rainbowified); + } +}; + +/** + * Draw the rainbow. + * + * @api private + */ + +NyanCat.prototype.drawRainbow = function(){ + var self = this; + + this.trajectories.forEach(function(line, index) { + write('\u001b[' + self.scoreboardWidth + 'C'); + write(line.join('')); + write('\n'); + }); + + this.cursorUp(this.numberOfLines); +}; + +/** + * Draw the nyan cat + * + * @api private + */ + +NyanCat.prototype.drawNyanCat = function() { + var self = this; + var startWidth = this.scoreboardWidth + this.trajectories[0].length; + var color = '\u001b[' + startWidth + 'C'; + var padding = ''; + + write(color); + write('_,------,'); + write('\n'); + + write(color); + padding = self.tick ? ' ' : ' '; + write('_|' + padding + '/\\_/\\ '); + write('\n'); + + write(color); + padding = self.tick ? '_' : '__'; + var tail = self.tick ? '~' : '^'; + var face; + write(tail + '|' + padding + this.face() + ' '); + write('\n'); + + write(color); + padding = self.tick ? ' ' : ' '; + write(padding + '"" "" '); + write('\n'); + + this.cursorUp(this.numberOfLines); +}; + +/** + * Draw nyan cat face. + * + * @return {String} + * @api private + */ + +NyanCat.prototype.face = function() { + var stats = this.stats; + if (stats.failures) { + return '( x .x)'; + } else if (stats.pending) { + return '( o .o)'; + } else if(stats.passes) { + return '( ^ .^)'; + } else { + return '( - .-)'; + } +} + +/** + * Move cursor up `n`. + * + * @param {Number} n + * @api private + */ + +NyanCat.prototype.cursorUp = function(n) { + write('\u001b[' + n + 'A'); +}; + +/** + * Move cursor down `n`. + * + * @param {Number} n + * @api private + */ + +NyanCat.prototype.cursorDown = function(n) { + write('\u001b[' + n + 'B'); +}; + +/** + * Generate rainbow colors. + * + * @return {Array} + * @api private + */ + +NyanCat.prototype.generateColors = function(){ + var colors = []; + + for (var i = 0; i < (6 * 7); i++) { + var pi3 = Math.floor(Math.PI / 3); + var n = (i * (1.0 / 6)); + var r = Math.floor(3 * Math.sin(n) + 3); + var g = Math.floor(3 * Math.sin(n + 2 * pi3) + 3); + var b = Math.floor(3 * Math.sin(n + 4 * pi3) + 3); + colors.push(36 * r + 6 * g + b + 16); + } + + return colors; +}; + +/** + * Apply rainbow to the given `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +NyanCat.prototype.rainbowify = function(str){ + var color = this.rainbowColors[this.colorIndex % this.rainbowColors.length]; + this.colorIndex += 1; + return '\u001b[38;5;' + color + 'm' + str + '\u001b[0m'; +}; + +/** + * Stdout helper. + */ + +function write(string) { + process.stdout.write(string); +} + +/** + * Inherit from `Base.prototype`. + */ + +NyanCat.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/progress.js b/node_modules/mocha/lib/reporters/progress.js new file mode 100644 index 0000000..5953638 --- /dev/null +++ b/node_modules/mocha/lib/reporters/progress.js @@ -0,0 +1,86 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `Progress`. + */ + +exports = module.exports = Progress; + +/** + * General progress bar color. + */ + +Base.colors.progress = 90; + +/** + * Initialize a new `Progress` bar test reporter. + * + * @param {Runner} runner + * @param {Object} options + * @api public + */ + +function Progress(runner, options) { + Base.call(this, runner); + + var self = this + , options = options || {} + , stats = this.stats + , width = Base.window.width * .50 | 0 + , total = runner.total + , complete = 0 + , max = Math.max; + + // default chars + options.open = options.open || '['; + options.complete = options.complete || '▬'; + options.incomplete = options.incomplete || Base.symbols.dot; + options.close = options.close || ']'; + options.verbose = false; + + // tests started + runner.on('start', function(){ + console.log(); + cursor.hide(); + }); + + // tests complete + runner.on('test end', function(){ + complete++; + var incomplete = total - complete + , percent = complete / total + , n = width * percent | 0 + , i = width - n; + + cursor.CR(); + process.stdout.write('\u001b[J'); + process.stdout.write(color('progress', ' ' + options.open)); + process.stdout.write(Array(n).join(options.complete)); + process.stdout.write(Array(i).join(options.incomplete)); + process.stdout.write(color('progress', options.close)); + if (options.verbose) { + process.stdout.write(color('progress', ' ' + complete + ' of ' + total)); + } + }); + + // tests are complete, output some stats + // and the failures if any + runner.on('end', function(){ + cursor.show(); + console.log(); + self.epilogue(); + }); +} + +/** + * Inherit from `Base.prototype`. + */ + +Progress.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/spec.js b/node_modules/mocha/lib/reporters/spec.js new file mode 100644 index 0000000..ada25c3 --- /dev/null +++ b/node_modules/mocha/lib/reporters/spec.js @@ -0,0 +1,83 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `Spec`. + */ + +exports = module.exports = Spec; + +/** + * Initialize a new `Spec` test reporter. + * + * @param {Runner} runner + * @api public + */ + +function Spec(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , indents = 0 + , n = 0; + + function indent() { + return Array(indents).join(' ') + } + + runner.on('start', function(){ + console.log(); + }); + + runner.on('suite', function(suite){ + ++indents; + console.log(color('suite', '%s%s'), indent(), suite.title); + }); + + runner.on('suite end', function(suite){ + --indents; + if (1 == indents) console.log(); + }); + + runner.on('pending', function(test){ + var fmt = indent() + color('pending', ' - %s'); + console.log(fmt, test.title); + }); + + runner.on('pass', function(test){ + if ('fast' == test.speed) { + var fmt = indent() + + color('checkmark', ' ' + Base.symbols.ok) + + color('pass', ' %s '); + cursor.CR(); + console.log(fmt, test.title); + } else { + var fmt = indent() + + color('checkmark', ' ' + Base.symbols.ok) + + color('pass', ' %s ') + + color(test.speed, '(%dms)'); + cursor.CR(); + console.log(fmt, test.title, test.duration); + } + }); + + runner.on('fail', function(test, err){ + cursor.CR(); + console.log(indent() + color('fail', ' %d) %s'), ++n, test.title); + }); + + runner.on('end', self.epilogue.bind(self)); +} + +/** + * Inherit from `Base.prototype`. + */ + +Spec.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/tap.js b/node_modules/mocha/lib/reporters/tap.js new file mode 100644 index 0000000..2bcd995 --- /dev/null +++ b/node_modules/mocha/lib/reporters/tap.js @@ -0,0 +1,73 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `TAP`. + */ + +exports = module.exports = TAP; + +/** + * Initialize a new `TAP` reporter. + * + * @param {Runner} runner + * @api public + */ + +function TAP(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , n = 1 + , passes = 0 + , failures = 0; + + runner.on('start', function(){ + var total = runner.grepTotal(runner.suite); + console.log('%d..%d', 1, total); + }); + + runner.on('test end', function(){ + ++n; + }); + + runner.on('pending', function(test){ + console.log('ok %d %s # SKIP -', n, title(test)); + }); + + runner.on('pass', function(test){ + passes++; + console.log('ok %d %s', n, title(test)); + }); + + runner.on('fail', function(test, err){ + failures++; + console.log('not ok %d %s', n, title(test)); + if (err.stack) console.log(err.stack.replace(/^/gm, ' ')); + }); + + runner.on('end', function(){ + console.log('# tests ' + (passes + failures)); + console.log('# pass ' + passes); + console.log('# fail ' + failures); + }); +} + +/** + * Return a TAP-safe title of `test` + * + * @param {Object} test + * @return {String} + * @api private + */ + +function title(test) { + return test.fullTitle().replace(/#/g, ''); +} diff --git a/node_modules/mocha/lib/reporters/templates/coverage.jade b/node_modules/mocha/lib/reporters/templates/coverage.jade new file mode 100644 index 0000000..b78119f --- /dev/null +++ b/node_modules/mocha/lib/reporters/templates/coverage.jade @@ -0,0 +1,50 @@ +!!! 5 +html + head + title Coverage + include script.html + include style.html + body + #coverage + h1#overview Coverage + include menu + + #stats(class=coverageClass(cov.coverage)) + .percentage #{cov.coverage | 0}% + .sloc= cov.sloc + .hits= cov.hits + .misses= cov.misses + + #files + for file in cov.files + .file + h2(id=file.filename)= file.filename + #stats(class=coverageClass(file.coverage)) + .percentage #{file.coverage | 0}% + .sloc= file.sloc + .hits= file.hits + .misses= file.misses + + table#source + thead + tr + th Line + th Hits + th Source + tbody + for line, number in file.source + if line.coverage > 0 + tr.hit + td.line= number + td.hits= line.coverage + td.source= line.source + else if 0 === line.coverage + tr.miss + td.line= number + td.hits 0 + td.source= line.source + else + tr + td.line= number + td.hits + td.source= line.source || ' ' diff --git a/node_modules/mocha/lib/reporters/templates/menu.jade b/node_modules/mocha/lib/reporters/templates/menu.jade new file mode 100644 index 0000000..e9ba464 --- /dev/null +++ b/node_modules/mocha/lib/reporters/templates/menu.jade @@ -0,0 +1,13 @@ +#menu + li + a(href='#overview') overview + for file in cov.files + li + span.cov(class=coverageClass(file.coverage)) #{file.coverage | 0} + a(href='##{file.filename}') + segments = file.filename.split('/') + basename = segments.pop() + if segments.length + span.dirname= segments.join('/') + '/' + span.basename= basename + a#logo(href='http://visionmedia.github.io/mocha/') m diff --git a/node_modules/mocha/lib/reporters/templates/script.html b/node_modules/mocha/lib/reporters/templates/script.html new file mode 100644 index 0000000..073cf79 --- /dev/null +++ b/node_modules/mocha/lib/reporters/templates/script.html @@ -0,0 +1,34 @@ + diff --git a/node_modules/mocha/lib/reporters/templates/style.html b/node_modules/mocha/lib/reporters/templates/style.html new file mode 100644 index 0000000..643c0ab --- /dev/null +++ b/node_modules/mocha/lib/reporters/templates/style.html @@ -0,0 +1,320 @@ + \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/xunit.js b/node_modules/mocha/lib/reporters/xunit.js new file mode 100644 index 0000000..e956380 --- /dev/null +++ b/node_modules/mocha/lib/reporters/xunit.js @@ -0,0 +1,119 @@ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , utils = require('../utils') + , escape = utils.escape; + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date + , setTimeout = global.setTimeout + , setInterval = global.setInterval + , clearTimeout = global.clearTimeout + , clearInterval = global.clearInterval; + +/** + * Expose `XUnit`. + */ + +exports = module.exports = XUnit; + +/** + * Initialize a new `XUnit` reporter. + * + * @param {Runner} runner + * @api public + */ + +function XUnit(runner) { + Base.call(this, runner); + var stats = this.stats + , tests = [] + , self = this; + + runner.on('pending', function(test){ + tests.push(test); + }); + + runner.on('pass', function(test){ + tests.push(test); + }); + + runner.on('fail', function(test){ + tests.push(test); + }); + + runner.on('end', function(){ + console.log(tag('testsuite', { + name: 'Mocha Tests' + , tests: stats.tests + , failures: stats.failures + , errors: stats.failures + , skipped: stats.tests - stats.failures - stats.passes + , timestamp: (new Date).toUTCString() + , time: (stats.duration / 1000) || 0 + }, false)); + + tests.forEach(test); + console.log(''); + }); +} + +/** + * Inherit from `Base.prototype`. + */ + +XUnit.prototype.__proto__ = Base.prototype; + +/** + * Output tag for the given `test.` + */ + +function test(test) { + var attrs = { + classname: test.parent.fullTitle() + , name: test.title + , time: (test.duration / 1000) || 0 + }; + + if ('failed' == test.state) { + var err = test.err; + attrs.message = escape(err.message); + console.log(tag('testcase', attrs, false, tag('failure', attrs, false, cdata(err.stack)))); + } else if (test.pending) { + console.log(tag('testcase', attrs, false, tag('skipped', {}, true))); + } else { + console.log(tag('testcase', attrs, true) ); + } +} + +/** + * HTML tag helper. + */ + +function tag(name, attrs, close, content) { + var end = close ? '/>' : '>' + , pairs = [] + , tag; + + for (var key in attrs) { + pairs.push(key + '="' + escape(attrs[key]) + '"'); + } + + tag = '<' + name + (pairs.length ? ' ' + pairs.join(' ') : '') + end; + if (content) tag += content + ''; +} diff --git a/node_modules/mocha/lib/runnable.js b/node_modules/mocha/lib/runnable.js new file mode 100644 index 0000000..03b8792 --- /dev/null +++ b/node_modules/mocha/lib/runnable.js @@ -0,0 +1,227 @@ + +/** + * Module dependencies. + */ + +var EventEmitter = require('events').EventEmitter + , debug = require('debug')('mocha:runnable') + , milliseconds = require('./ms'); + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date + , setTimeout = global.setTimeout + , setInterval = global.setInterval + , clearTimeout = global.clearTimeout + , clearInterval = global.clearInterval; + +/** + * Object#toString(). + */ + +var toString = Object.prototype.toString; + +/** + * Expose `Runnable`. + */ + +module.exports = Runnable; + +/** + * Initialize a new `Runnable` with the given `title` and callback `fn`. + * + * @param {String} title + * @param {Function} fn + * @api private + */ + +function Runnable(title, fn) { + this.title = title; + this.fn = fn; + this.async = fn && fn.length; + this.sync = ! this.async; + this._timeout = 2000; + this._slow = 75; + this.timedOut = false; +} + +/** + * Inherit from `EventEmitter.prototype`. + */ + +Runnable.prototype.__proto__ = EventEmitter.prototype; + +/** + * Set & get timeout `ms`. + * + * @param {Number|String} ms + * @return {Runnable|Number} ms or self + * @api private + */ + +Runnable.prototype.timeout = function(ms){ + if (0 == arguments.length) return this._timeout; + if ('string' == typeof ms) ms = milliseconds(ms); + debug('timeout %d', ms); + this._timeout = ms; + if (this.timer) this.resetTimeout(); + return this; +}; + +/** + * Set & get slow `ms`. + * + * @param {Number|String} ms + * @return {Runnable|Number} ms or self + * @api private + */ + +Runnable.prototype.slow = function(ms){ + if (0 === arguments.length) return this._slow; + if ('string' == typeof ms) ms = milliseconds(ms); + debug('timeout %d', ms); + this._slow = ms; + return this; +}; + +/** + * Return the full title generated by recursively + * concatenating the parent's full title. + * + * @return {String} + * @api public + */ + +Runnable.prototype.fullTitle = function(){ + return this.parent.fullTitle() + ' ' + this.title; +}; + +/** + * Clear the timeout. + * + * @api private + */ + +Runnable.prototype.clearTimeout = function(){ + clearTimeout(this.timer); +}; + +/** + * Inspect the runnable void of private properties. + * + * @return {String} + * @api private + */ + +Runnable.prototype.inspect = function(){ + return JSON.stringify(this, function(key, val){ + if ('_' == key[0]) return; + if ('parent' == key) return '#'; + if ('ctx' == key) return '#'; + return val; + }, 2); +}; + +/** + * Reset the timeout. + * + * @api private + */ + +Runnable.prototype.resetTimeout = function(){ + var self = this; + var ms = this.timeout() || 1e9; + + this.clearTimeout(); + this.timer = setTimeout(function(){ + self.callback(new Error('timeout of ' + ms + 'ms exceeded')); + self.timedOut = true; + }, ms); +}; + +/** + * Whitelist these globals for this test run + * + * @api private + */ +Runnable.prototype.globals = function(arr){ + var self = this; + this._allowedGlobals = arr; +}; + +/** + * Run the test and invoke `fn(err)`. + * + * @param {Function} fn + * @api private + */ + +Runnable.prototype.run = function(fn){ + var self = this + , ms = this.timeout() + , start = new Date + , ctx = this.ctx + , finished + , emitted; + + if (ctx) ctx.runnable(this); + + // timeout + if (this.async) { + if (ms) { + this.timer = setTimeout(function(){ + done(new Error('timeout of ' + ms + 'ms exceeded')); + self.timedOut = true; + }, ms); + } + } + + // called multiple times + function multiple(err) { + if (emitted) return; + emitted = true; + self.emit('error', err || new Error('done() called multiple times')); + } + + // finished + function done(err) { + if (self.timedOut) return; + if (finished) return multiple(err); + self.clearTimeout(); + self.duration = new Date - start; + finished = true; + fn(err); + } + + // for .resetTimeout() + this.callback = done; + + // async + if (this.async) { + try { + this.fn.call(ctx, function(err){ + if (err instanceof Error || toString.call(err) === "[object Error]") return done(err); + if (null != err) return done(new Error('done() invoked with non-Error: ' + err)); + done(); + }); + } catch (err) { + done(err); + } + return; + } + + if (this.asyncOnly) { + return done(new Error('--async-only option in use without declaring `done()`')); + } + + // sync + try { + if (!this.pending) this.fn.call(ctx); + this.duration = new Date - start; + fn(); + } catch (err) { + fn(err); + } +}; diff --git a/node_modules/mocha/lib/runner.js b/node_modules/mocha/lib/runner.js new file mode 100644 index 0000000..deb442e --- /dev/null +++ b/node_modules/mocha/lib/runner.js @@ -0,0 +1,661 @@ +/** + * Module dependencies. + */ + +var EventEmitter = require('events').EventEmitter + , debug = require('debug')('mocha:runner') + , Test = require('./test') + , utils = require('./utils') + , filter = utils.filter + , keys = utils.keys; + +/** + * Non-enumerable globals. + */ + +var globals = [ + 'setTimeout', + 'clearTimeout', + 'setInterval', + 'clearInterval', + 'XMLHttpRequest', + 'Date' +]; + +/** + * Expose `Runner`. + */ + +module.exports = Runner; + +/** + * Initialize a `Runner` for the given `suite`. + * + * Events: + * + * - `start` execution started + * - `end` execution complete + * - `suite` (suite) test suite execution started + * - `suite end` (suite) all tests (and sub-suites) have finished + * - `test` (test) test execution started + * - `test end` (test) test completed + * - `hook` (hook) hook execution started + * - `hook end` (hook) hook complete + * - `pass` (test) test passed + * - `fail` (test, err) test failed + * - `pending` (test) test pending + * + * @api public + */ + +function Runner(suite) { + var self = this; + this._globals = []; + this._abort = false; + this.suite = suite; + this.total = suite.total(); + this.failures = 0; + this.on('test end', function(test){ self.checkGlobals(test); }); + this.on('hook end', function(hook){ self.checkGlobals(hook); }); + this.grep(/.*/); + this.globals(this.globalProps().concat(extraGlobals())); +} + +/** + * Wrapper for setImmediate, process.nextTick, or browser polyfill. + * + * @param {Function} fn + * @api private + */ + +Runner.immediately = global.setImmediate || process.nextTick; + +/** + * Inherit from `EventEmitter.prototype`. + */ + +Runner.prototype.__proto__ = EventEmitter.prototype; + +/** + * Run tests with full titles matching `re`. Updates runner.total + * with number of tests matched. + * + * @param {RegExp} re + * @param {Boolean} invert + * @return {Runner} for chaining + * @api public + */ + +Runner.prototype.grep = function(re, invert){ + debug('grep %s', re); + this._grep = re; + this._invert = invert; + this.total = this.grepTotal(this.suite); + return this; +}; + +/** + * Returns the number of tests matching the grep search for the + * given suite. + * + * @param {Suite} suite + * @return {Number} + * @api public + */ + +Runner.prototype.grepTotal = function(suite) { + var self = this; + var total = 0; + + suite.eachTest(function(test){ + var match = self._grep.test(test.fullTitle()); + if (self._invert) match = !match; + if (match) total++; + }); + + return total; +}; + +/** + * Return a list of global properties. + * + * @return {Array} + * @api private + */ + +Runner.prototype.globalProps = function() { + var props = utils.keys(global); + + // non-enumerables + for (var i = 0; i < globals.length; ++i) { + if (~utils.indexOf(props, globals[i])) continue; + props.push(globals[i]); + } + + return props; +}; + +/** + * Allow the given `arr` of globals. + * + * @param {Array} arr + * @return {Runner} for chaining + * @api public + */ + +Runner.prototype.globals = function(arr){ + if (0 == arguments.length) return this._globals; + debug('globals %j', arr); + this._globals = this._globals.concat(arr); + return this; +}; + +/** + * Check for global variable leaks. + * + * @api private + */ + +Runner.prototype.checkGlobals = function(test){ + if (this.ignoreLeaks) return; + var ok = this._globals; + + var globals = this.globalProps(); + var isNode = process.kill; + var leaks; + + if (test) { + ok = ok.concat(test._allowedGlobals || []); + } + + if(this.prevGlobalsLength == globals.length) return; + this.prevGlobalsLength = globals.length; + + leaks = filterLeaks(ok, globals); + this._globals = this._globals.concat(leaks); + + if (leaks.length > 1) { + this.fail(test, new Error('global leaks detected: ' + leaks.join(', ') + '')); + } else if (leaks.length) { + this.fail(test, new Error('global leak detected: ' + leaks[0])); + } +}; + +/** + * Fail the given `test`. + * + * @param {Test} test + * @param {Error} err + * @api private + */ + +Runner.prototype.fail = function(test, err){ + ++this.failures; + test.state = 'failed'; + + if ('string' == typeof err) { + err = new Error('the string "' + err + '" was thrown, throw an Error :)'); + } + + this.emit('fail', test, err); +}; + +/** + * Fail the given `hook` with `err`. + * + * Hook failures work in the following pattern: + * - If bail, then exit + * - Failed `before` hook skips all tests in a suite and subsuites, + * but jumps to corresponding `after` hook + * - Failed `before each` hook skips remaining tests in a + * suite and jumps to corresponding `after each` hook, + * which is run only once + * - Failed `after` hook does not alter + * execution order + * - Failed `after each` hook skips remaining tests in a + * suite and subsuites, but executes other `after each` + * hooks + * + * @param {Hook} hook + * @param {Error} err + * @api private + */ + +Runner.prototype.failHook = function(hook, err){ + this.fail(hook, err); + if (this.suite.bail()) { + this.emit('end'); + } +}; + +/** + * Run hook `name` callbacks and then invoke `fn()`. + * + * @param {String} name + * @param {Function} function + * @api private + */ + +Runner.prototype.hook = function(name, fn){ + var suite = this.suite + , hooks = suite['_' + name] + , self = this + , timer; + + function next(i) { + var hook = hooks[i]; + if (!hook) return fn(); + if (self.failures && suite.bail()) return fn(); + self.currentRunnable = hook; + + hook.ctx.currentTest = self.test; + + self.emit('hook', hook); + + hook.on('error', function(err){ + self.failHook(hook, err); + }); + + hook.run(function(err){ + hook.removeAllListeners('error'); + var testError = hook.error(); + if (testError) self.fail(self.test, testError); + if (err) { + self.failHook(hook, err); + + // stop executing hooks, notify callee of hook err + return fn(err); + } + self.emit('hook end', hook); + delete hook.ctx.currentTest; + next(++i); + }); + } + + Runner.immediately(function(){ + next(0); + }); +}; + +/** + * Run hook `name` for the given array of `suites` + * in order, and callback `fn(err, errSuite)`. + * + * @param {String} name + * @param {Array} suites + * @param {Function} fn + * @api private + */ + +Runner.prototype.hooks = function(name, suites, fn){ + var self = this + , orig = this.suite; + + function next(suite) { + self.suite = suite; + + if (!suite) { + self.suite = orig; + return fn(); + } + + self.hook(name, function(err){ + if (err) { + var errSuite = self.suite; + self.suite = orig; + return fn(err, errSuite); + } + + next(suites.pop()); + }); + } + + next(suites.pop()); +}; + +/** + * Run hooks from the top level down. + * + * @param {String} name + * @param {Function} fn + * @api private + */ + +Runner.prototype.hookUp = function(name, fn){ + var suites = [this.suite].concat(this.parents()).reverse(); + this.hooks(name, suites, fn); +}; + +/** + * Run hooks from the bottom up. + * + * @param {String} name + * @param {Function} fn + * @api private + */ + +Runner.prototype.hookDown = function(name, fn){ + var suites = [this.suite].concat(this.parents()); + this.hooks(name, suites, fn); +}; + +/** + * Return an array of parent Suites from + * closest to furthest. + * + * @return {Array} + * @api private + */ + +Runner.prototype.parents = function(){ + var suite = this.suite + , suites = []; + while (suite = suite.parent) suites.push(suite); + return suites; +}; + +/** + * Run the current test and callback `fn(err)`. + * + * @param {Function} fn + * @api private + */ + +Runner.prototype.runTest = function(fn){ + var test = this.test + , self = this; + + if (this.asyncOnly) test.asyncOnly = true; + + try { + test.on('error', function(err){ + self.fail(test, err); + }); + test.run(fn); + } catch (err) { + fn(err); + } +}; + +/** + * Run tests in the given `suite` and invoke + * the callback `fn()` when complete. + * + * @param {Suite} suite + * @param {Function} fn + * @api private + */ + +Runner.prototype.runTests = function(suite, fn){ + var self = this + , tests = suite.tests.slice() + , test; + + + function hookErr(err, errSuite, after) { + // before/after Each hook for errSuite failed: + var orig = self.suite; + + // for failed 'after each' hook start from errSuite parent, + // otherwise start from errSuite itself + self.suite = after ? errSuite.parent : errSuite; + + if (self.suite) { + // call hookUp afterEach + self.hookUp('afterEach', function(err2, errSuite2) { + self.suite = orig; + // some hooks may fail even now + if (err2) return hookErr(err2, errSuite2, true); + // report error suite + fn(errSuite); + }); + } else { + // there is no need calling other 'after each' hooks + self.suite = orig; + fn(errSuite); + } + } + + function next(err, errSuite) { + // if we bail after first err + if (self.failures && suite._bail) return fn(); + + if (self._abort) return fn(); + + if (err) return hookErr(err, errSuite, true); + + // next test + test = tests.shift(); + + // all done + if (!test) return fn(); + + // grep + var match = self._grep.test(test.fullTitle()); + if (self._invert) match = !match; + if (!match) return next(); + + // pending + if (test.pending) { + self.emit('pending', test); + self.emit('test end', test); + return next(); + } + + // execute test and hook(s) + self.emit('test', self.test = test); + self.hookDown('beforeEach', function(err, errSuite){ + + if (err) return hookErr(err, errSuite, false); + + self.currentRunnable = self.test; + self.runTest(function(err){ + test = self.test; + + if (err) { + self.fail(test, err); + self.emit('test end', test); + return self.hookUp('afterEach', next); + } + + test.state = 'passed'; + self.emit('pass', test); + self.emit('test end', test); + self.hookUp('afterEach', next); + }); + }); + } + + this.next = next; + next(); +}; + +/** + * Run the given `suite` and invoke the + * callback `fn()` when complete. + * + * @param {Suite} suite + * @param {Function} fn + * @api private + */ + +Runner.prototype.runSuite = function(suite, fn){ + var total = this.grepTotal(suite) + , self = this + , i = 0; + + debug('run suite %s', suite.fullTitle()); + + if (!total) return fn(); + + this.emit('suite', this.suite = suite); + + function next(errSuite) { + if (errSuite) { + // current suite failed on a hook from errSuite + if (errSuite == suite) { + // if errSuite is current suite + // continue to the next sibling suite + return done(); + } else { + // errSuite is among the parents of current suite + // stop execution of errSuite and all sub-suites + return done(errSuite); + } + } + + if (self._abort) return done(); + + var curr = suite.suites[i++]; + if (!curr) return done(); + self.runSuite(curr, next); + } + + function done(errSuite) { + self.suite = suite; + self.hook('afterAll', function(){ + self.emit('suite end', suite); + fn(errSuite); + }); + } + + this.hook('beforeAll', function(err){ + if (err) return done(); + self.runTests(suite, next); + }); +}; + +/** + * Handle uncaught exceptions. + * + * @param {Error} err + * @api private + */ + +Runner.prototype.uncaught = function(err){ + debug('uncaught exception %s', err.message); + var runnable = this.currentRunnable; + if (!runnable || 'failed' == runnable.state) return; + runnable.clearTimeout(); + err.uncaught = true; + this.fail(runnable, err); + + // recover from test + if ('test' == runnable.type) { + this.emit('test end', runnable); + this.hookUp('afterEach', this.next); + return; + } + + // bail on hooks + this.emit('end'); +}; + +/** + * Run the root suite and invoke `fn(failures)` + * on completion. + * + * @param {Function} fn + * @return {Runner} for chaining + * @api public + */ + +Runner.prototype.run = function(fn){ + var self = this + , fn = fn || function(){}; + + function uncaught(err){ + self.uncaught(err); + } + + debug('start'); + + // callback + this.on('end', function(){ + debug('end'); + process.removeListener('uncaughtException', uncaught); + fn(self.failures); + }); + + // run suites + this.emit('start'); + this.runSuite(this.suite, function(){ + debug('finished running'); + self.emit('end'); + }); + + // uncaught exception + process.on('uncaughtException', uncaught); + + return this; +}; + +/** + * Cleanly abort execution + * + * @return {Runner} for chaining + * @api public + */ +Runner.prototype.abort = function(){ + debug('aborting'); + this._abort = true; +} + +/** + * Filter leaks with the given globals flagged as `ok`. + * + * @param {Array} ok + * @param {Array} globals + * @return {Array} + * @api private + */ + +function filterLeaks(ok, globals) { + return filter(globals, function(key){ + // Firefox and Chrome exposes iframes as index inside the window object + if (/^d+/.test(key)) return false; + + // in firefox + // if runner runs in an iframe, this iframe's window.getInterface method not init at first + // it is assigned in some seconds + if (global.navigator && /^getInterface/.test(key)) return false; + + // an iframe could be approached by window[iframeIndex] + // in ie6,7,8 and opera, iframeIndex is enumerable, this could cause leak + if (global.navigator && /^\d+/.test(key)) return false; + + // Opera and IE expose global variables for HTML element IDs (issue #243) + if (/^mocha-/.test(key)) return false; + + var matched = filter(ok, function(ok){ + if (~ok.indexOf('*')) return 0 == key.indexOf(ok.split('*')[0]); + return key == ok; + }); + return matched.length == 0 && (!global.navigator || 'onerror' !== key); + }); +} + +/** + * Array of globals dependent on the environment. + * + * @return {Array} + * @api private + */ + + function extraGlobals() { + if (typeof(process) === 'object' && + typeof(process.version) === 'string') { + + var nodeVersion = process.version.split('.').reduce(function(a, v) { + return a << 8 | v; + }); + + // 'errno' was renamed to process._errno in v0.9.11. + + if (nodeVersion < 0x00090B) { + return ['errno']; + } + } + + return []; + } diff --git a/node_modules/mocha/lib/suite.js b/node_modules/mocha/lib/suite.js new file mode 100644 index 0000000..869bb88 --- /dev/null +++ b/node_modules/mocha/lib/suite.js @@ -0,0 +1,296 @@ + +/** + * Module dependencies. + */ + +var EventEmitter = require('events').EventEmitter + , debug = require('debug')('mocha:suite') + , milliseconds = require('./ms') + , utils = require('./utils') + , Hook = require('./hook'); + +/** + * Expose `Suite`. + */ + +exports = module.exports = Suite; + +/** + * Create a new `Suite` with the given `title` + * and parent `Suite`. When a suite with the + * same title is already present, that suite + * is returned to provide nicer reporter + * and more flexible meta-testing. + * + * @param {Suite} parent + * @param {String} title + * @return {Suite} + * @api public + */ + +exports.create = function(parent, title){ + var suite = new Suite(title, parent.ctx); + suite.parent = parent; + if (parent.pending) suite.pending = true; + title = suite.fullTitle(); + parent.addSuite(suite); + return suite; +}; + +/** + * Initialize a new `Suite` with the given + * `title` and `ctx`. + * + * @param {String} title + * @param {Context} ctx + * @api private + */ + +function Suite(title, ctx) { + this.title = title; + this.ctx = ctx; + this.suites = []; + this.tests = []; + this.pending = false; + this._beforeEach = []; + this._beforeAll = []; + this._afterEach = []; + this._afterAll = []; + this.root = !title; + this._timeout = 2000; + this._slow = 75; + this._bail = false; +} + +/** + * Inherit from `EventEmitter.prototype`. + */ + +Suite.prototype.__proto__ = EventEmitter.prototype; + +/** + * Return a clone of this `Suite`. + * + * @return {Suite} + * @api private + */ + +Suite.prototype.clone = function(){ + var suite = new Suite(this.title); + debug('clone'); + suite.ctx = this.ctx; + suite.timeout(this.timeout()); + suite.slow(this.slow()); + suite.bail(this.bail()); + return suite; +}; + +/** + * Set timeout `ms` or short-hand such as "2s". + * + * @param {Number|String} ms + * @return {Suite|Number} for chaining + * @api private + */ + +Suite.prototype.timeout = function(ms){ + if (0 == arguments.length) return this._timeout; + if ('string' == typeof ms) ms = milliseconds(ms); + debug('timeout %d', ms); + this._timeout = parseInt(ms, 10); + return this; +}; + +/** + * Set slow `ms` or short-hand such as "2s". + * + * @param {Number|String} ms + * @return {Suite|Number} for chaining + * @api private + */ + +Suite.prototype.slow = function(ms){ + if (0 === arguments.length) return this._slow; + if ('string' == typeof ms) ms = milliseconds(ms); + debug('slow %d', ms); + this._slow = ms; + return this; +}; + +/** + * Sets whether to bail after first error. + * + * @parma {Boolean} bail + * @return {Suite|Number} for chaining + * @api private + */ + +Suite.prototype.bail = function(bail){ + if (0 == arguments.length) return this._bail; + debug('bail %s', bail); + this._bail = bail; + return this; +}; + +/** + * Run `fn(test[, done])` before running tests. + * + * @param {Function} fn + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.beforeAll = function(fn){ + if (this.pending) return this; + var hook = new Hook('"before all" hook', fn); + hook.parent = this; + hook.timeout(this.timeout()); + hook.slow(this.slow()); + hook.ctx = this.ctx; + this._beforeAll.push(hook); + this.emit('beforeAll', hook); + return this; +}; + +/** + * Run `fn(test[, done])` after running tests. + * + * @param {Function} fn + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.afterAll = function(fn){ + if (this.pending) return this; + var hook = new Hook('"after all" hook', fn); + hook.parent = this; + hook.timeout(this.timeout()); + hook.slow(this.slow()); + hook.ctx = this.ctx; + this._afterAll.push(hook); + this.emit('afterAll', hook); + return this; +}; + +/** + * Run `fn(test[, done])` before each test case. + * + * @param {Function} fn + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.beforeEach = function(fn){ + if (this.pending) return this; + var hook = new Hook('"before each" hook', fn); + hook.parent = this; + hook.timeout(this.timeout()); + hook.slow(this.slow()); + hook.ctx = this.ctx; + this._beforeEach.push(hook); + this.emit('beforeEach', hook); + return this; +}; + +/** + * Run `fn(test[, done])` after each test case. + * + * @param {Function} fn + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.afterEach = function(fn){ + if (this.pending) return this; + var hook = new Hook('"after each" hook', fn); + hook.parent = this; + hook.timeout(this.timeout()); + hook.slow(this.slow()); + hook.ctx = this.ctx; + this._afterEach.push(hook); + this.emit('afterEach', hook); + return this; +}; + +/** + * Add a test `suite`. + * + * @param {Suite} suite + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.addSuite = function(suite){ + suite.parent = this; + suite.timeout(this.timeout()); + suite.slow(this.slow()); + suite.bail(this.bail()); + this.suites.push(suite); + this.emit('suite', suite); + return this; +}; + +/** + * Add a `test` to this suite. + * + * @param {Test} test + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.addTest = function(test){ + test.parent = this; + test.timeout(this.timeout()); + test.slow(this.slow()); + test.ctx = this.ctx; + this.tests.push(test); + this.emit('test', test); + return this; +}; + +/** + * Return the full title generated by recursively + * concatenating the parent's full title. + * + * @return {String} + * @api public + */ + +Suite.prototype.fullTitle = function(){ + if (this.parent) { + var full = this.parent.fullTitle(); + if (full) return full + ' ' + this.title; + } + return this.title; +}; + +/** + * Return the total number of tests. + * + * @return {Number} + * @api public + */ + +Suite.prototype.total = function(){ + return utils.reduce(this.suites, function(sum, suite){ + return sum + suite.total(); + }, 0) + this.tests.length; +}; + +/** + * Iterates through each suite recursively to find + * all tests. Applies a function in the format + * `fn(test)`. + * + * @param {Function} fn + * @return {Suite} + * @api private + */ + +Suite.prototype.eachTest = function(fn){ + utils.forEach(this.tests, fn); + utils.forEach(this.suites, function(suite){ + suite.eachTest(fn); + }); + return this; +}; diff --git a/node_modules/mocha/lib/template.html b/node_modules/mocha/lib/template.html new file mode 100644 index 0000000..0590d4a --- /dev/null +++ b/node_modules/mocha/lib/template.html @@ -0,0 +1,18 @@ + + + + Mocha + + + + + +
    + + + + + + diff --git a/node_modules/mocha/lib/test.js b/node_modules/mocha/lib/test.js new file mode 100644 index 0000000..11773e0 --- /dev/null +++ b/node_modules/mocha/lib/test.js @@ -0,0 +1,32 @@ + +/** + * Module dependencies. + */ + +var Runnable = require('./runnable'); + +/** + * Expose `Test`. + */ + +module.exports = Test; + +/** + * Initialize a new `Test` with the given `title` and callback `fn`. + * + * @param {String} title + * @param {Function} fn + * @api private + */ + +function Test(title, fn) { + Runnable.call(this, title, fn); + this.pending = !fn; + this.type = 'test'; +} + +/** + * Inherit from `Runnable.prototype`. + */ + +Test.prototype.__proto__ = Runnable.prototype; diff --git a/node_modules/mocha/lib/utils.js b/node_modules/mocha/lib/utils.js new file mode 100644 index 0000000..37fd5d7 --- /dev/null +++ b/node_modules/mocha/lib/utils.js @@ -0,0 +1,299 @@ +/** + * Module dependencies. + */ + +var fs = require('fs') + , path = require('path') + , join = path.join + , debug = require('debug')('mocha:watch'); + +/** + * Ignored directories. + */ + +var ignore = ['node_modules', '.git']; + +/** + * Escape special characters in the given string of html. + * + * @param {String} html + * @return {String} + * @api private + */ + +exports.escape = function(html){ + return String(html) + .replace(/&/g, '&') + .replace(/"/g, '"') + .replace(//g, '>'); +}; + +/** + * Array#forEach (<=IE8) + * + * @param {Array} array + * @param {Function} fn + * @param {Object} scope + * @api private + */ + +exports.forEach = function(arr, fn, scope){ + for (var i = 0, l = arr.length; i < l; i++) + fn.call(scope, arr[i], i); +}; + +/** + * Array#map (<=IE8) + * + * @param {Array} array + * @param {Function} fn + * @param {Object} scope + * @api private + */ + +exports.map = function(arr, fn, scope){ + var result = []; + for (var i = 0, l = arr.length; i < l; i++) + result.push(fn.call(scope, arr[i], i)); + return result; +}; + +/** + * Array#indexOf (<=IE8) + * + * @parma {Array} arr + * @param {Object} obj to find index of + * @param {Number} start + * @api private + */ + +exports.indexOf = function(arr, obj, start){ + for (var i = start || 0, l = arr.length; i < l; i++) { + if (arr[i] === obj) + return i; + } + return -1; +}; + +/** + * Array#reduce (<=IE8) + * + * @param {Array} array + * @param {Function} fn + * @param {Object} initial value + * @api private + */ + +exports.reduce = function(arr, fn, val){ + var rval = val; + + for (var i = 0, l = arr.length; i < l; i++) { + rval = fn(rval, arr[i], i, arr); + } + + return rval; +}; + +/** + * Array#filter (<=IE8) + * + * @param {Array} array + * @param {Function} fn + * @api private + */ + +exports.filter = function(arr, fn){ + var ret = []; + + for (var i = 0, l = arr.length; i < l; i++) { + var val = arr[i]; + if (fn(val, i, arr)) ret.push(val); + } + + return ret; +}; + +/** + * Object.keys (<=IE8) + * + * @param {Object} obj + * @return {Array} keys + * @api private + */ + +exports.keys = Object.keys || function(obj) { + var keys = [] + , has = Object.prototype.hasOwnProperty // for `window` on <=IE8 + + for (var key in obj) { + if (has.call(obj, key)) { + keys.push(key); + } + } + + return keys; +}; + +/** + * Watch the given `files` for changes + * and invoke `fn(file)` on modification. + * + * @param {Array} files + * @param {Function} fn + * @api private + */ + +exports.watch = function(files, fn){ + var options = { interval: 100 }; + files.forEach(function(file){ + debug('file %s', file); + fs.watchFile(file, options, function(curr, prev){ + if (prev.mtime < curr.mtime) fn(file); + }); + }); +}; + +/** + * Ignored files. + */ + +function ignored(path){ + return !~ignore.indexOf(path); +} + +/** + * Lookup files in the given `dir`. + * + * @return {Array} + * @api private + */ + +exports.files = function(dir, ret){ + ret = ret || []; + + fs.readdirSync(dir) + .filter(ignored) + .forEach(function(path){ + path = join(dir, path); + if (fs.statSync(path).isDirectory()) { + exports.files(path, ret); + } else if (path.match(/\.(js|coffee|litcoffee|coffee.md)$/)) { + ret.push(path); + } + }); + + return ret; +}; + +/** + * Compute a slug from the given `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +exports.slug = function(str){ + return str + .toLowerCase() + .replace(/ +/g, '-') + .replace(/[^-\w]/g, ''); +}; + +/** + * Strip the function definition from `str`, + * and re-indent for pre whitespace. + */ + +exports.clean = function(str) { + str = str + .replace(/\r\n?|[\n\u2028\u2029]/g, "\n").replace(/^\uFEFF/, '') + .replace(/^function *\(.*\) *{/, '') + .replace(/\s+\}$/, ''); + + var spaces = str.match(/^\n?( *)/)[1].length + , tabs = str.match(/^\n?(\t*)/)[1].length + , re = new RegExp('^\n?' + (tabs ? '\t' : ' ') + '{' + (tabs ? tabs : spaces) + '}', 'gm'); + + str = str.replace(re, ''); + + return exports.trim(str); +}; + +/** + * Escape regular expression characters in `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +exports.escapeRegexp = function(str){ + return str.replace(/[-\\^$*+?.()|[\]{}]/g, "\\$&"); +}; + +/** + * Trim the given `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +exports.trim = function(str){ + return str.replace(/^\s+|\s+$/g, ''); +}; + +/** + * Parse the given `qs`. + * + * @param {String} qs + * @return {Object} + * @api private + */ + +exports.parseQuery = function(qs){ + return exports.reduce(qs.replace('?', '').split('&'), function(obj, pair){ + var i = pair.indexOf('=') + , key = pair.slice(0, i) + , val = pair.slice(++i); + + obj[key] = decodeURIComponent(val); + return obj; + }, {}); +}; + +/** + * Highlight the given string of `js`. + * + * @param {String} js + * @return {String} + * @api private + */ + +function highlight(js) { + return js + .replace(//g, '>') + .replace(/\/\/(.*)/gm, '//$1') + .replace(/('.*?')/gm, '$1') + .replace(/(\d+\.\d+)/gm, '$1') + .replace(/(\d+)/gm, '$1') + .replace(/\bnew *(\w+)/gm, 'new $1') + .replace(/\b(function|new|throw|return|var|if|else)\b/gm, '$1') +} + +/** + * Highlight the contents of tag `name`. + * + * @param {String} name + * @api private + */ + +exports.highlightTags = function(name) { + var code = document.getElementsByTagName(name); + for (var i = 0, len = code.length; i < len; ++i) { + code[i].innerHTML = highlight(code[i].innerHTML); + } +}; diff --git a/node_modules/mocha/mocha.css b/node_modules/mocha/mocha.css new file mode 100644 index 0000000..42b9798 --- /dev/null +++ b/node_modules/mocha/mocha.css @@ -0,0 +1,270 @@ +@charset "utf-8"; + +body { + margin:0; +} + +#mocha { + font: 20px/1.5 "Helvetica Neue", Helvetica, Arial, sans-serif; + margin: 60px 50px; +} + +#mocha ul, +#mocha li { + margin: 0; + padding: 0; +} + +#mocha ul { + list-style: none; +} + +#mocha h1, +#mocha h2 { + margin: 0; +} + +#mocha h1 { + margin-top: 15px; + font-size: 1em; + font-weight: 200; +} + +#mocha h1 a { + text-decoration: none; + color: inherit; +} + +#mocha h1 a:hover { + text-decoration: underline; +} + +#mocha .suite .suite h1 { + margin-top: 0; + font-size: .8em; +} + +#mocha .hidden { + display: none; +} + +#mocha h2 { + font-size: 12px; + font-weight: normal; + cursor: pointer; +} + +#mocha .suite { + margin-left: 15px; +} + +#mocha .test { + margin-left: 15px; + overflow: hidden; +} + +#mocha .test.pending:hover h2::after { + content: '(pending)'; + font-family: arial, sans-serif; +} + +#mocha .test.pass.medium .duration { + background: #c09853; +} + +#mocha .test.pass.slow .duration { + background: #b94a48; +} + +#mocha .test.pass::before { + content: '✓'; + font-size: 12px; + display: block; + float: left; + margin-right: 5px; + color: #00d6b2; +} + +#mocha .test.pass .duration { + font-size: 9px; + margin-left: 5px; + padding: 2px 5px; + color: #fff; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.2); + -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,.2); + box-shadow: inset 0 1px 1px rgba(0,0,0,.2); + -webkit-border-radius: 5px; + -moz-border-radius: 5px; + -ms-border-radius: 5px; + -o-border-radius: 5px; + border-radius: 5px; +} + +#mocha .test.pass.fast .duration { + display: none; +} + +#mocha .test.pending { + color: #0b97c4; +} + +#mocha .test.pending::before { + content: '◦'; + color: #0b97c4; +} + +#mocha .test.fail { + color: #c00; +} + +#mocha .test.fail pre { + color: black; +} + +#mocha .test.fail::before { + content: '✖'; + font-size: 12px; + display: block; + float: left; + margin-right: 5px; + color: #c00; +} + +#mocha .test pre.error { + color: #c00; + max-height: 300px; + overflow: auto; +} + +/** + * (1): approximate for browsers not supporting calc + * (2): 42 = 2*15 + 2*10 + 2*1 (padding + margin + border) + * ^^ seriously + */ +#mocha .test pre { + display: block; + float: left; + clear: left; + font: 12px/1.5 monaco, monospace; + margin: 5px; + padding: 15px; + border: 1px solid #eee; + max-width: 85%; /*(1)*/ + max-width: calc(100% - 42px); /*(2)*/ + word-wrap: break-word; + border-bottom-color: #ddd; + -webkit-border-radius: 3px; + -webkit-box-shadow: 0 1px 3px #eee; + -moz-border-radius: 3px; + -moz-box-shadow: 0 1px 3px #eee; + border-radius: 3px; +} + +#mocha .test h2 { + position: relative; +} + +#mocha .test a.replay { + position: absolute; + top: 3px; + right: 0; + text-decoration: none; + vertical-align: middle; + display: block; + width: 15px; + height: 15px; + line-height: 15px; + text-align: center; + background: #eee; + font-size: 15px; + -moz-border-radius: 15px; + border-radius: 15px; + -webkit-transition: opacity 200ms; + -moz-transition: opacity 200ms; + transition: opacity 200ms; + opacity: 0.3; + color: #888; +} + +#mocha .test:hover a.replay { + opacity: 1; +} + +#mocha-report.pass .test.fail { + display: none; +} + +#mocha-report.fail .test.pass { + display: none; +} + +#mocha-report.pending .test.pass, +#mocha-report.pending .test.fail { + display: none; +} +#mocha-report.pending .test.pass.pending { + display: block; +} + +#mocha-error { + color: #c00; + font-size: 1.5em; + font-weight: 100; + letter-spacing: 1px; +} + +#mocha-stats { + position: fixed; + top: 15px; + right: 10px; + font-size: 12px; + margin: 0; + color: #888; + z-index: 1; +} + +#mocha-stats .progress { + float: right; + padding-top: 0; +} + +#mocha-stats em { + color: black; +} + +#mocha-stats a { + text-decoration: none; + color: inherit; +} + +#mocha-stats a:hover { + border-bottom: 1px solid #eee; +} + +#mocha-stats li { + display: inline-block; + margin: 0 5px; + list-style: none; + padding-top: 11px; +} + +#mocha-stats canvas { + width: 40px; + height: 40px; +} + +#mocha code .comment { color: #ddd; } +#mocha code .init { color: #2f6fad; } +#mocha code .string { color: #5890ad; } +#mocha code .keyword { color: #8a6343; } +#mocha code .number { color: #2f6fad; } + +@media screen and (max-device-width: 480px) { + #mocha { + margin: 60px 0px; + } + + #mocha #stats { + position: absolute; + } +} diff --git a/node_modules/mocha/mocha.js b/node_modules/mocha/mocha.js new file mode 100644 index 0000000..3dcdae6 --- /dev/null +++ b/node_modules/mocha/mocha.js @@ -0,0 +1,5812 @@ +;(function(){ + +// CommonJS require() + +function require(p){ + var path = require.resolve(p) + , mod = require.modules[path]; + if (!mod) throw new Error('failed to require "' + p + '"'); + if (!mod.exports) { + mod.exports = {}; + mod.call(mod.exports, mod, mod.exports, require.relative(path)); + } + return mod.exports; + } + +require.modules = {}; + +require.resolve = function (path){ + var orig = path + , reg = path + '.js' + , index = path + '/index.js'; + return require.modules[reg] && reg + || require.modules[index] && index + || orig; + }; + +require.register = function (path, fn){ + require.modules[path] = fn; + }; + +require.relative = function (parent) { + return function(p){ + if ('.' != p.charAt(0)) return require(p); + + var path = parent.split('/') + , segs = p.split('/'); + path.pop(); + + for (var i = 0; i < segs.length; i++) { + var seg = segs[i]; + if ('..' == seg) path.pop(); + else if ('.' != seg) path.push(seg); + } + + return require(path.join('/')); + }; + }; + + +require.register("browser/debug.js", function(module, exports, require){ + +module.exports = function(type){ + return function(){ + } +}; + +}); // module: browser/debug.js + +require.register("browser/diff.js", function(module, exports, require){ +/* See LICENSE file for terms of use */ + +/* + * Text diff implementation. + * + * This library supports the following APIS: + * JsDiff.diffChars: Character by character diff + * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace + * JsDiff.diffLines: Line based diff + * + * JsDiff.diffCss: Diff targeted at CSS content + * + * These methods are based on the implementation proposed in + * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986). + * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927 + */ +var JsDiff = (function() { + /*jshint maxparams: 5*/ + function clonePath(path) { + return { newPos: path.newPos, components: path.components.slice(0) }; + } + function removeEmpty(array) { + var ret = []; + for (var i = 0; i < array.length; i++) { + if (array[i]) { + ret.push(array[i]); + } + } + return ret; + } + function escapeHTML(s) { + var n = s; + n = n.replace(/&/g, '&'); + n = n.replace(//g, '>'); + n = n.replace(/"/g, '"'); + + return n; + } + + var Diff = function(ignoreWhitespace) { + this.ignoreWhitespace = ignoreWhitespace; + }; + Diff.prototype = { + diff: function(oldString, newString) { + // Handle the identity case (this is due to unrolling editLength == 0 + if (newString === oldString) { + return [{ value: newString }]; + } + if (!newString) { + return [{ value: oldString, removed: true }]; + } + if (!oldString) { + return [{ value: newString, added: true }]; + } + + newString = this.tokenize(newString); + oldString = this.tokenize(oldString); + + var newLen = newString.length, oldLen = oldString.length; + var maxEditLength = newLen + oldLen; + var bestPath = [{ newPos: -1, components: [] }]; + + // Seed editLength = 0 + var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0); + if (bestPath[0].newPos+1 >= newLen && oldPos+1 >= oldLen) { + return bestPath[0].components; + } + + for (var editLength = 1; editLength <= maxEditLength; editLength++) { + for (var diagonalPath = -1*editLength; diagonalPath <= editLength; diagonalPath+=2) { + var basePath; + var addPath = bestPath[diagonalPath-1], + removePath = bestPath[diagonalPath+1]; + oldPos = (removePath ? removePath.newPos : 0) - diagonalPath; + if (addPath) { + // No one else is going to attempt to use this value, clear it + bestPath[diagonalPath-1] = undefined; + } + + var canAdd = addPath && addPath.newPos+1 < newLen; + var canRemove = removePath && 0 <= oldPos && oldPos < oldLen; + if (!canAdd && !canRemove) { + bestPath[diagonalPath] = undefined; + continue; + } + + // Select the diagonal that we want to branch from. We select the prior + // path whose position in the new string is the farthest from the origin + // and does not pass the bounds of the diff graph + if (!canAdd || (canRemove && addPath.newPos < removePath.newPos)) { + basePath = clonePath(removePath); + this.pushComponent(basePath.components, oldString[oldPos], undefined, true); + } else { + basePath = clonePath(addPath); + basePath.newPos++; + this.pushComponent(basePath.components, newString[basePath.newPos], true, undefined); + } + + var oldPos = this.extractCommon(basePath, newString, oldString, diagonalPath); + + if (basePath.newPos+1 >= newLen && oldPos+1 >= oldLen) { + return basePath.components; + } else { + bestPath[diagonalPath] = basePath; + } + } + } + }, + + pushComponent: function(components, value, added, removed) { + var last = components[components.length-1]; + if (last && last.added === added && last.removed === removed) { + // We need to clone here as the component clone operation is just + // as shallow array clone + components[components.length-1] = + {value: this.join(last.value, value), added: added, removed: removed }; + } else { + components.push({value: value, added: added, removed: removed }); + } + }, + extractCommon: function(basePath, newString, oldString, diagonalPath) { + var newLen = newString.length, + oldLen = oldString.length, + newPos = basePath.newPos, + oldPos = newPos - diagonalPath; + while (newPos+1 < newLen && oldPos+1 < oldLen && this.equals(newString[newPos+1], oldString[oldPos+1])) { + newPos++; + oldPos++; + + this.pushComponent(basePath.components, newString[newPos], undefined, undefined); + } + basePath.newPos = newPos; + return oldPos; + }, + + equals: function(left, right) { + var reWhitespace = /\S/; + if (this.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right)) { + return true; + } else { + return left === right; + } + }, + join: function(left, right) { + return left + right; + }, + tokenize: function(value) { + return value; + } + }; + + var CharDiff = new Diff(); + + var WordDiff = new Diff(true); + var WordWithSpaceDiff = new Diff(); + WordDiff.tokenize = WordWithSpaceDiff.tokenize = function(value) { + return removeEmpty(value.split(/(\s+|\b)/)); + }; + + var CssDiff = new Diff(true); + CssDiff.tokenize = function(value) { + return removeEmpty(value.split(/([{}:;,]|\s+)/)); + }; + + var LineDiff = new Diff(); + LineDiff.tokenize = function(value) { + return value.split(/^/m); + }; + + return { + Diff: Diff, + + diffChars: function(oldStr, newStr) { return CharDiff.diff(oldStr, newStr); }, + diffWords: function(oldStr, newStr) { return WordDiff.diff(oldStr, newStr); }, + diffWordsWithSpace: function(oldStr, newStr) { return WordWithSpaceDiff.diff(oldStr, newStr); }, + diffLines: function(oldStr, newStr) { return LineDiff.diff(oldStr, newStr); }, + + diffCss: function(oldStr, newStr) { return CssDiff.diff(oldStr, newStr); }, + + createPatch: function(fileName, oldStr, newStr, oldHeader, newHeader) { + var ret = []; + + ret.push('Index: ' + fileName); + ret.push('==================================================================='); + ret.push('--- ' + fileName + (typeof oldHeader === 'undefined' ? '' : '\t' + oldHeader)); + ret.push('+++ ' + fileName + (typeof newHeader === 'undefined' ? '' : '\t' + newHeader)); + + var diff = LineDiff.diff(oldStr, newStr); + if (!diff[diff.length-1].value) { + diff.pop(); // Remove trailing newline add + } + diff.push({value: '', lines: []}); // Append an empty value to make cleanup easier + + function contextLines(lines) { + return lines.map(function(entry) { return ' ' + entry; }); + } + function eofNL(curRange, i, current) { + var last = diff[diff.length-2], + isLast = i === diff.length-2, + isLastOfType = i === diff.length-3 && (current.added !== last.added || current.removed !== last.removed); + + // Figure out if this is the last line for the given file and missing NL + if (!/\n$/.test(current.value) && (isLast || isLastOfType)) { + curRange.push('\\ No newline at end of file'); + } + } + + var oldRangeStart = 0, newRangeStart = 0, curRange = [], + oldLine = 1, newLine = 1; + for (var i = 0; i < diff.length; i++) { + var current = diff[i], + lines = current.lines || current.value.replace(/\n$/, '').split('\n'); + current.lines = lines; + + if (current.added || current.removed) { + if (!oldRangeStart) { + var prev = diff[i-1]; + oldRangeStart = oldLine; + newRangeStart = newLine; + + if (prev) { + curRange = contextLines(prev.lines.slice(-4)); + oldRangeStart -= curRange.length; + newRangeStart -= curRange.length; + } + } + curRange.push.apply(curRange, lines.map(function(entry) { return (current.added?'+':'-') + entry; })); + eofNL(curRange, i, current); + + if (current.added) { + newLine += lines.length; + } else { + oldLine += lines.length; + } + } else { + if (oldRangeStart) { + // Close out any changes that have been output (or join overlapping) + if (lines.length <= 8 && i < diff.length-2) { + // Overlapping + curRange.push.apply(curRange, contextLines(lines)); + } else { + // end the range and output + var contextSize = Math.min(lines.length, 4); + ret.push( + '@@ -' + oldRangeStart + ',' + (oldLine-oldRangeStart+contextSize) + + ' +' + newRangeStart + ',' + (newLine-newRangeStart+contextSize) + + ' @@'); + ret.push.apply(ret, curRange); + ret.push.apply(ret, contextLines(lines.slice(0, contextSize))); + if (lines.length <= 4) { + eofNL(ret, i, current); + } + + oldRangeStart = 0; newRangeStart = 0; curRange = []; + } + } + oldLine += lines.length; + newLine += lines.length; + } + } + + return ret.join('\n') + '\n'; + }, + + applyPatch: function(oldStr, uniDiff) { + var diffstr = uniDiff.split('\n'); + var diff = []; + var remEOFNL = false, + addEOFNL = false; + + for (var i = (diffstr[0][0]==='I'?4:0); i < diffstr.length; i++) { + if(diffstr[i][0] === '@') { + var meh = diffstr[i].split(/@@ -(\d+),(\d+) \+(\d+),(\d+) @@/); + diff.unshift({ + start:meh[3], + oldlength:meh[2], + oldlines:[], + newlength:meh[4], + newlines:[] + }); + } else if(diffstr[i][0] === '+') { + diff[0].newlines.push(diffstr[i].substr(1)); + } else if(diffstr[i][0] === '-') { + diff[0].oldlines.push(diffstr[i].substr(1)); + } else if(diffstr[i][0] === ' ') { + diff[0].newlines.push(diffstr[i].substr(1)); + diff[0].oldlines.push(diffstr[i].substr(1)); + } else if(diffstr[i][0] === '\\') { + if (diffstr[i-1][0] === '+') { + remEOFNL = true; + } else if(diffstr[i-1][0] === '-') { + addEOFNL = true; + } + } + } + + var str = oldStr.split('\n'); + for (var i = diff.length - 1; i >= 0; i--) { + var d = diff[i]; + for (var j = 0; j < d.oldlength; j++) { + if(str[d.start-1+j] !== d.oldlines[j]) { + return false; + } + } + Array.prototype.splice.apply(str,[d.start-1,+d.oldlength].concat(d.newlines)); + } + + if (remEOFNL) { + while (!str[str.length-1]) { + str.pop(); + } + } else if (addEOFNL) { + str.push(''); + } + return str.join('\n'); + }, + + convertChangesToXML: function(changes){ + var ret = []; + for ( var i = 0; i < changes.length; i++) { + var change = changes[i]; + if (change.added) { + ret.push(''); + } else if (change.removed) { + ret.push(''); + } + + ret.push(escapeHTML(change.value)); + + if (change.added) { + ret.push(''); + } else if (change.removed) { + ret.push(''); + } + } + return ret.join(''); + }, + + // See: http://code.google.com/p/google-diff-match-patch/wiki/API + convertChangesToDMP: function(changes){ + var ret = [], change; + for ( var i = 0; i < changes.length; i++) { + change = changes[i]; + ret.push([(change.added ? 1 : change.removed ? -1 : 0), change.value]); + } + return ret; + } + }; +})(); + +if (typeof module !== 'undefined') { + module.exports = JsDiff; +} + +}); // module: browser/diff.js + +require.register("browser/events.js", function(module, exports, require){ + +/** + * Module exports. + */ + +exports.EventEmitter = EventEmitter; + +/** + * Check if `obj` is an array. + */ + +function isArray(obj) { + return '[object Array]' == {}.toString.call(obj); +} + +/** + * Event emitter constructor. + * + * @api public + */ + +function EventEmitter(){}; + +/** + * Adds a listener. + * + * @api public + */ + +EventEmitter.prototype.on = function (name, fn) { + if (!this.$events) { + this.$events = {}; + } + + if (!this.$events[name]) { + this.$events[name] = fn; + } else if (isArray(this.$events[name])) { + this.$events[name].push(fn); + } else { + this.$events[name] = [this.$events[name], fn]; + } + + return this; +}; + +EventEmitter.prototype.addListener = EventEmitter.prototype.on; + +/** + * Adds a volatile listener. + * + * @api public + */ + +EventEmitter.prototype.once = function (name, fn) { + var self = this; + + function on () { + self.removeListener(name, on); + fn.apply(this, arguments); + }; + + on.listener = fn; + this.on(name, on); + + return this; +}; + +/** + * Removes a listener. + * + * @api public + */ + +EventEmitter.prototype.removeListener = function (name, fn) { + if (this.$events && this.$events[name]) { + var list = this.$events[name]; + + if (isArray(list)) { + var pos = -1; + + for (var i = 0, l = list.length; i < l; i++) { + if (list[i] === fn || (list[i].listener && list[i].listener === fn)) { + pos = i; + break; + } + } + + if (pos < 0) { + return this; + } + + list.splice(pos, 1); + + if (!list.length) { + delete this.$events[name]; + } + } else if (list === fn || (list.listener && list.listener === fn)) { + delete this.$events[name]; + } + } + + return this; +}; + +/** + * Removes all listeners for an event. + * + * @api public + */ + +EventEmitter.prototype.removeAllListeners = function (name) { + if (name === undefined) { + this.$events = {}; + return this; + } + + if (this.$events && this.$events[name]) { + this.$events[name] = null; + } + + return this; +}; + +/** + * Gets all listeners for a certain event. + * + * @api public + */ + +EventEmitter.prototype.listeners = function (name) { + if (!this.$events) { + this.$events = {}; + } + + if (!this.$events[name]) { + this.$events[name] = []; + } + + if (!isArray(this.$events[name])) { + this.$events[name] = [this.$events[name]]; + } + + return this.$events[name]; +}; + +/** + * Emits an event. + * + * @api public + */ + +EventEmitter.prototype.emit = function (name) { + if (!this.$events) { + return false; + } + + var handler = this.$events[name]; + + if (!handler) { + return false; + } + + var args = [].slice.call(arguments, 1); + + if ('function' == typeof handler) { + handler.apply(this, args); + } else if (isArray(handler)) { + var listeners = handler.slice(); + + for (var i = 0, l = listeners.length; i < l; i++) { + listeners[i].apply(this, args); + } + } else { + return false; + } + + return true; +}; +}); // module: browser/events.js + +require.register("browser/fs.js", function(module, exports, require){ + +}); // module: browser/fs.js + +require.register("browser/path.js", function(module, exports, require){ + +}); // module: browser/path.js + +require.register("browser/progress.js", function(module, exports, require){ +/** + * Expose `Progress`. + */ + +module.exports = Progress; + +/** + * Initialize a new `Progress` indicator. + */ + +function Progress() { + this.percent = 0; + this.size(0); + this.fontSize(11); + this.font('helvetica, arial, sans-serif'); +} + +/** + * Set progress size to `n`. + * + * @param {Number} n + * @return {Progress} for chaining + * @api public + */ + +Progress.prototype.size = function(n){ + this._size = n; + return this; +}; + +/** + * Set text to `str`. + * + * @param {String} str + * @return {Progress} for chaining + * @api public + */ + +Progress.prototype.text = function(str){ + this._text = str; + return this; +}; + +/** + * Set font size to `n`. + * + * @param {Number} n + * @return {Progress} for chaining + * @api public + */ + +Progress.prototype.fontSize = function(n){ + this._fontSize = n; + return this; +}; + +/** + * Set font `family`. + * + * @param {String} family + * @return {Progress} for chaining + */ + +Progress.prototype.font = function(family){ + this._font = family; + return this; +}; + +/** + * Update percentage to `n`. + * + * @param {Number} n + * @return {Progress} for chaining + */ + +Progress.prototype.update = function(n){ + this.percent = n; + return this; +}; + +/** + * Draw on `ctx`. + * + * @param {CanvasRenderingContext2d} ctx + * @return {Progress} for chaining + */ + +Progress.prototype.draw = function(ctx){ + try { + var percent = Math.min(this.percent, 100) + , size = this._size + , half = size / 2 + , x = half + , y = half + , rad = half - 1 + , fontSize = this._fontSize; + + ctx.font = fontSize + 'px ' + this._font; + + var angle = Math.PI * 2 * (percent / 100); + ctx.clearRect(0, 0, size, size); + + // outer circle + ctx.strokeStyle = '#9f9f9f'; + ctx.beginPath(); + ctx.arc(x, y, rad, 0, angle, false); + ctx.stroke(); + + // inner circle + ctx.strokeStyle = '#eee'; + ctx.beginPath(); + ctx.arc(x, y, rad - 1, 0, angle, true); + ctx.stroke(); + + // text + var text = this._text || (percent | 0) + '%' + , w = ctx.measureText(text).width; + + ctx.fillText( + text + , x - w / 2 + 1 + , y + fontSize / 2 - 1); + } catch (ex) {} //don't fail if we can't render progress + return this; +}; + +}); // module: browser/progress.js + +require.register("browser/tty.js", function(module, exports, require){ + +exports.isatty = function(){ + return true; +}; + +exports.getWindowSize = function(){ + if ('innerHeight' in global) { + return [global.innerHeight, global.innerWidth]; + } else { + // In a Web Worker, the DOM Window is not available. + return [640, 480]; + } +}; + +}); // module: browser/tty.js + +require.register("context.js", function(module, exports, require){ + +/** + * Expose `Context`. + */ + +module.exports = Context; + +/** + * Initialize a new `Context`. + * + * @api private + */ + +function Context(){} + +/** + * Set or get the context `Runnable` to `runnable`. + * + * @param {Runnable} runnable + * @return {Context} + * @api private + */ + +Context.prototype.runnable = function(runnable){ + if (0 == arguments.length) return this._runnable; + this.test = this._runnable = runnable; + return this; +}; + +/** + * Set test timeout `ms`. + * + * @param {Number} ms + * @return {Context} self + * @api private + */ + +Context.prototype.timeout = function(ms){ + this.runnable().timeout(ms); + return this; +}; + +/** + * Set test slowness threshold `ms`. + * + * @param {Number} ms + * @return {Context} self + * @api private + */ + +Context.prototype.slow = function(ms){ + this.runnable().slow(ms); + return this; +}; + +/** + * Inspect the context void of `._runnable`. + * + * @return {String} + * @api private + */ + +Context.prototype.inspect = function(){ + return JSON.stringify(this, function(key, val){ + if ('_runnable' == key) return; + if ('test' == key) return; + return val; + }, 2); +}; + +}); // module: context.js + +require.register("hook.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Runnable = require('./runnable'); + +/** + * Expose `Hook`. + */ + +module.exports = Hook; + +/** + * Initialize a new `Hook` with the given `title` and callback `fn`. + * + * @param {String} title + * @param {Function} fn + * @api private + */ + +function Hook(title, fn) { + Runnable.call(this, title, fn); + this.type = 'hook'; +} + +/** + * Inherit from `Runnable.prototype`. + */ + +function F(){}; +F.prototype = Runnable.prototype; +Hook.prototype = new F; +Hook.prototype.constructor = Hook; + + +/** + * Get or set the test `err`. + * + * @param {Error} err + * @return {Error} + * @api public + */ + +Hook.prototype.error = function(err){ + if (0 == arguments.length) { + var err = this._error; + this._error = null; + return err; + } + + this._error = err; +}; + +}); // module: hook.js + +require.register("interfaces/bdd.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Suite = require('../suite') + , Test = require('../test') + , utils = require('../utils'); + +/** + * BDD-style interface: + * + * describe('Array', function(){ + * describe('#indexOf()', function(){ + * it('should return -1 when not present', function(){ + * + * }); + * + * it('should return the index when present', function(){ + * + * }); + * }); + * }); + * + */ + +module.exports = function(suite){ + var suites = [suite]; + + suite.on('pre-require', function(context, file, mocha){ + + /** + * Execute before running tests. + */ + + context.before = function(fn){ + suites[0].beforeAll(fn); + }; + + /** + * Execute after running tests. + */ + + context.after = function(fn){ + suites[0].afterAll(fn); + }; + + /** + * Execute before each test case. + */ + + context.beforeEach = function(fn){ + suites[0].beforeEach(fn); + }; + + /** + * Execute after each test case. + */ + + context.afterEach = function(fn){ + suites[0].afterEach(fn); + }; + + /** + * Describe a "suite" with the given `title` + * and callback `fn` containing nested suites + * and/or tests. + */ + + context.describe = context.context = function(title, fn){ + var suite = Suite.create(suites[0], title); + suites.unshift(suite); + fn.call(suite); + suites.shift(); + return suite; + }; + + /** + * Pending describe. + */ + + context.xdescribe = + context.xcontext = + context.describe.skip = function(title, fn){ + var suite = Suite.create(suites[0], title); + suite.pending = true; + suites.unshift(suite); + fn.call(suite); + suites.shift(); + }; + + /** + * Exclusive suite. + */ + + context.describe.only = function(title, fn){ + var suite = context.describe(title, fn); + mocha.grep(suite.fullTitle()); + return suite; + }; + + /** + * Describe a specification or test-case + * with the given `title` and callback `fn` + * acting as a thunk. + */ + + context.it = context.specify = function(title, fn){ + var suite = suites[0]; + if (suite.pending) var fn = null; + var test = new Test(title, fn); + suite.addTest(test); + return test; + }; + + /** + * Exclusive test-case. + */ + + context.it.only = function(title, fn){ + var test = context.it(title, fn); + var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; + mocha.grep(new RegExp(reString)); + return test; + }; + + /** + * Pending test case. + */ + + context.xit = + context.xspecify = + context.it.skip = function(title){ + context.it(title); + }; + }); +}; + +}); // module: interfaces/bdd.js + +require.register("interfaces/exports.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Suite = require('../suite') + , Test = require('../test'); + +/** + * TDD-style interface: + * + * exports.Array = { + * '#indexOf()': { + * 'should return -1 when the value is not present': function(){ + * + * }, + * + * 'should return the correct index when the value is present': function(){ + * + * } + * } + * }; + * + */ + +module.exports = function(suite){ + var suites = [suite]; + + suite.on('require', visit); + + function visit(obj) { + var suite; + for (var key in obj) { + if ('function' == typeof obj[key]) { + var fn = obj[key]; + switch (key) { + case 'before': + suites[0].beforeAll(fn); + break; + case 'after': + suites[0].afterAll(fn); + break; + case 'beforeEach': + suites[0].beforeEach(fn); + break; + case 'afterEach': + suites[0].afterEach(fn); + break; + default: + suites[0].addTest(new Test(key, fn)); + } + } else { + var suite = Suite.create(suites[0], key); + suites.unshift(suite); + visit(obj[key]); + suites.shift(); + } + } + } +}; + +}); // module: interfaces/exports.js + +require.register("interfaces/index.js", function(module, exports, require){ + +exports.bdd = require('./bdd'); +exports.tdd = require('./tdd'); +exports.qunit = require('./qunit'); +exports.exports = require('./exports'); + +}); // module: interfaces/index.js + +require.register("interfaces/qunit.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Suite = require('../suite') + , Test = require('../test') + , utils = require('../utils'); + +/** + * QUnit-style interface: + * + * suite('Array'); + * + * test('#length', function(){ + * var arr = [1,2,3]; + * ok(arr.length == 3); + * }); + * + * test('#indexOf()', function(){ + * var arr = [1,2,3]; + * ok(arr.indexOf(1) == 0); + * ok(arr.indexOf(2) == 1); + * ok(arr.indexOf(3) == 2); + * }); + * + * suite('String'); + * + * test('#length', function(){ + * ok('foo'.length == 3); + * }); + * + */ + +module.exports = function(suite){ + var suites = [suite]; + + suite.on('pre-require', function(context, file, mocha){ + + /** + * Execute before running tests. + */ + + context.before = function(fn){ + suites[0].beforeAll(fn); + }; + + /** + * Execute after running tests. + */ + + context.after = function(fn){ + suites[0].afterAll(fn); + }; + + /** + * Execute before each test case. + */ + + context.beforeEach = function(fn){ + suites[0].beforeEach(fn); + }; + + /** + * Execute after each test case. + */ + + context.afterEach = function(fn){ + suites[0].afterEach(fn); + }; + + /** + * Describe a "suite" with the given `title`. + */ + + context.suite = function(title){ + if (suites.length > 1) suites.shift(); + var suite = Suite.create(suites[0], title); + suites.unshift(suite); + return suite; + }; + + /** + * Exclusive test-case. + */ + + context.suite.only = function(title, fn){ + var suite = context.suite(title, fn); + mocha.grep(suite.fullTitle()); + }; + + /** + * Describe a specification or test-case + * with the given `title` and callback `fn` + * acting as a thunk. + */ + + context.test = function(title, fn){ + var test = new Test(title, fn); + suites[0].addTest(test); + return test; + }; + + /** + * Exclusive test-case. + */ + + context.test.only = function(title, fn){ + var test = context.test(title, fn); + var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; + mocha.grep(new RegExp(reString)); + }; + + /** + * Pending test case. + */ + + context.test.skip = function(title){ + context.test(title); + }; + }); +}; + +}); // module: interfaces/qunit.js + +require.register("interfaces/tdd.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Suite = require('../suite') + , Test = require('../test') + , utils = require('../utils');; + +/** + * TDD-style interface: + * + * suite('Array', function(){ + * suite('#indexOf()', function(){ + * suiteSetup(function(){ + * + * }); + * + * test('should return -1 when not present', function(){ + * + * }); + * + * test('should return the index when present', function(){ + * + * }); + * + * suiteTeardown(function(){ + * + * }); + * }); + * }); + * + */ + +module.exports = function(suite){ + var suites = [suite]; + + suite.on('pre-require', function(context, file, mocha){ + + /** + * Execute before each test case. + */ + + context.setup = function(fn){ + suites[0].beforeEach(fn); + }; + + /** + * Execute after each test case. + */ + + context.teardown = function(fn){ + suites[0].afterEach(fn); + }; + + /** + * Execute before the suite. + */ + + context.suiteSetup = function(fn){ + suites[0].beforeAll(fn); + }; + + /** + * Execute after the suite. + */ + + context.suiteTeardown = function(fn){ + suites[0].afterAll(fn); + }; + + /** + * Describe a "suite" with the given `title` + * and callback `fn` containing nested suites + * and/or tests. + */ + + context.suite = function(title, fn){ + var suite = Suite.create(suites[0], title); + suites.unshift(suite); + fn.call(suite); + suites.shift(); + return suite; + }; + + /** + * Pending suite. + */ + context.suite.skip = function(title, fn) { + var suite = Suite.create(suites[0], title); + suite.pending = true; + suites.unshift(suite); + fn.call(suite); + suites.shift(); + }; + + /** + * Exclusive test-case. + */ + + context.suite.only = function(title, fn){ + var suite = context.suite(title, fn); + mocha.grep(suite.fullTitle()); + }; + + /** + * Describe a specification or test-case + * with the given `title` and callback `fn` + * acting as a thunk. + */ + + context.test = function(title, fn){ + var suite = suites[0]; + if (suite.pending) var fn = null; + var test = new Test(title, fn); + suite.addTest(test); + return test; + }; + + /** + * Exclusive test-case. + */ + + context.test.only = function(title, fn){ + var test = context.test(title, fn); + var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; + mocha.grep(new RegExp(reString)); + }; + + /** + * Pending test case. + */ + + context.test.skip = function(title){ + context.test(title); + }; + }); +}; + +}); // module: interfaces/tdd.js + +require.register("mocha.js", function(module, exports, require){ +/*! + * mocha + * Copyright(c) 2011 TJ Holowaychuk + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var path = require('browser/path') + , utils = require('./utils'); + +/** + * Expose `Mocha`. + */ + +exports = module.exports = Mocha; + +/** + * Expose internals. + */ + +exports.utils = utils; +exports.interfaces = require('./interfaces'); +exports.reporters = require('./reporters'); +exports.Runnable = require('./runnable'); +exports.Context = require('./context'); +exports.Runner = require('./runner'); +exports.Suite = require('./suite'); +exports.Hook = require('./hook'); +exports.Test = require('./test'); + +/** + * Return image `name` path. + * + * @param {String} name + * @return {String} + * @api private + */ + +function image(name) { + return __dirname + '/../images/' + name + '.png'; +} + +/** + * Setup mocha with `options`. + * + * Options: + * + * - `ui` name "bdd", "tdd", "exports" etc + * - `reporter` reporter instance, defaults to `mocha.reporters.Dot` + * - `globals` array of accepted globals + * - `timeout` timeout in milliseconds + * - `bail` bail on the first test failure + * - `slow` milliseconds to wait before considering a test slow + * - `ignoreLeaks` ignore global leaks + * - `grep` string or regexp to filter tests with + * + * @param {Object} options + * @api public + */ + +function Mocha(options) { + options = options || {}; + this.files = []; + this.options = options; + this.grep(options.grep); + this.suite = new exports.Suite('', new exports.Context); + this.ui(options.ui); + this.bail(options.bail); + this.reporter(options.reporter); + if (null != options.timeout) this.timeout(options.timeout); + this.useColors(options.useColors) + if (options.slow) this.slow(options.slow); + + this.suite.on('pre-require', function (context) { + exports.afterEach = context.afterEach || context.teardown; + exports.after = context.after || context.suiteTeardown; + exports.beforeEach = context.beforeEach || context.setup; + exports.before = context.before || context.suiteSetup; + exports.describe = context.describe || context.suite; + exports.it = context.it || context.test; + exports.setup = context.setup || context.beforeEach; + exports.suiteSetup = context.suiteSetup || context.before; + exports.suiteTeardown = context.suiteTeardown || context.after; + exports.suite = context.suite || context.describe; + exports.teardown = context.teardown || context.afterEach; + exports.test = context.test || context.it; + }); +} + +/** + * Enable or disable bailing on the first failure. + * + * @param {Boolean} [bail] + * @api public + */ + +Mocha.prototype.bail = function(bail){ + if (0 == arguments.length) bail = true; + this.suite.bail(bail); + return this; +}; + +/** + * Add test `file`. + * + * @param {String} file + * @api public + */ + +Mocha.prototype.addFile = function(file){ + this.files.push(file); + return this; +}; + +/** + * Set reporter to `reporter`, defaults to "dot". + * + * @param {String|Function} reporter name or constructor + * @api public + */ + +Mocha.prototype.reporter = function(reporter){ + if ('function' == typeof reporter) { + this._reporter = reporter; + } else { + reporter = reporter || 'dot'; + var _reporter; + try { _reporter = require('./reporters/' + reporter); } catch (err) {}; + if (!_reporter) try { _reporter = require(reporter); } catch (err) {}; + if (!_reporter && reporter === 'teamcity') + console.warn('The Teamcity reporter was moved to a package named ' + + 'mocha-teamcity-reporter ' + + '(https://npmjs.org/package/mocha-teamcity-reporter).'); + if (!_reporter) throw new Error('invalid reporter "' + reporter + '"'); + this._reporter = _reporter; + } + return this; +}; + +/** + * Set test UI `name`, defaults to "bdd". + * + * @param {String} bdd + * @api public + */ + +Mocha.prototype.ui = function(name){ + name = name || 'bdd'; + this._ui = exports.interfaces[name]; + if (!this._ui) try { this._ui = require(name); } catch (err) {}; + if (!this._ui) throw new Error('invalid interface "' + name + '"'); + this._ui = this._ui(this.suite); + return this; +}; + +/** + * Load registered files. + * + * @api private + */ + +Mocha.prototype.loadFiles = function(fn){ + var self = this; + var suite = this.suite; + var pending = this.files.length; + this.files.forEach(function(file){ + file = path.resolve(file); + suite.emit('pre-require', global, file, self); + suite.emit('require', require(file), file, self); + suite.emit('post-require', global, file, self); + --pending || (fn && fn()); + }); +}; + +/** + * Enable growl support. + * + * @api private + */ + +Mocha.prototype._growl = function(runner, reporter) { + var notify = require('growl'); + + runner.on('end', function(){ + var stats = reporter.stats; + if (stats.failures) { + var msg = stats.failures + ' of ' + runner.total + ' tests failed'; + notify(msg, { name: 'mocha', title: 'Failed', image: image('error') }); + } else { + notify(stats.passes + ' tests passed in ' + stats.duration + 'ms', { + name: 'mocha' + , title: 'Passed' + , image: image('ok') + }); + } + }); +}; + +/** + * Add regexp to grep, if `re` is a string it is escaped. + * + * @param {RegExp|String} re + * @return {Mocha} + * @api public + */ + +Mocha.prototype.grep = function(re){ + this.options.grep = 'string' == typeof re + ? new RegExp(utils.escapeRegexp(re)) + : re; + return this; +}; + +/** + * Invert `.grep()` matches. + * + * @return {Mocha} + * @api public + */ + +Mocha.prototype.invert = function(){ + this.options.invert = true; + return this; +}; + +/** + * Ignore global leaks. + * + * @param {Boolean} ignore + * @return {Mocha} + * @api public + */ + +Mocha.prototype.ignoreLeaks = function(ignore){ + this.options.ignoreLeaks = !!ignore; + return this; +}; + +/** + * Enable global leak checking. + * + * @return {Mocha} + * @api public + */ + +Mocha.prototype.checkLeaks = function(){ + this.options.ignoreLeaks = false; + return this; +}; + +/** + * Enable growl support. + * + * @return {Mocha} + * @api public + */ + +Mocha.prototype.growl = function(){ + this.options.growl = true; + return this; +}; + +/** + * Ignore `globals` array or string. + * + * @param {Array|String} globals + * @return {Mocha} + * @api public + */ + +Mocha.prototype.globals = function(globals){ + this.options.globals = (this.options.globals || []).concat(globals); + return this; +}; + +/** + * Emit color output. + * + * @param {Boolean} colors + * @return {Mocha} + * @api public + */ + +Mocha.prototype.useColors = function(colors){ + this.options.useColors = arguments.length && colors != undefined + ? colors + : true; + return this; +}; + +/** + * Use inline diffs rather than +/-. + * + * @param {Boolean} inlineDiffs + * @return {Mocha} + * @api public + */ + +Mocha.prototype.useInlineDiffs = function(inlineDiffs) { + this.options.useInlineDiffs = arguments.length && inlineDiffs != undefined + ? inlineDiffs + : false; + return this; +}; + +/** + * Set the timeout in milliseconds. + * + * @param {Number} timeout + * @return {Mocha} + * @api public + */ + +Mocha.prototype.timeout = function(timeout){ + this.suite.timeout(timeout); + return this; +}; + +/** + * Set slowness threshold in milliseconds. + * + * @param {Number} slow + * @return {Mocha} + * @api public + */ + +Mocha.prototype.slow = function(slow){ + this.suite.slow(slow); + return this; +}; + +/** + * Makes all tests async (accepting a callback) + * + * @return {Mocha} + * @api public + */ + +Mocha.prototype.asyncOnly = function(){ + this.options.asyncOnly = true; + return this; +}; + +/** + * Run tests and invoke `fn()` when complete. + * + * @param {Function} fn + * @return {Runner} + * @api public + */ + +Mocha.prototype.run = function(fn){ + if (this.files.length) this.loadFiles(); + var suite = this.suite; + var options = this.options; + var runner = new exports.Runner(suite); + var reporter = new this._reporter(runner); + runner.ignoreLeaks = false !== options.ignoreLeaks; + runner.asyncOnly = options.asyncOnly; + if (options.grep) runner.grep(options.grep, options.invert); + if (options.globals) runner.globals(options.globals); + if (options.growl) this._growl(runner, reporter); + exports.reporters.Base.useColors = options.useColors; + exports.reporters.Base.inlineDiffs = options.useInlineDiffs; + return runner.run(fn); +}; + +}); // module: mocha.js + +require.register("ms.js", function(module, exports, require){ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} options + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options){ + options = options || {}; + if ('string' == typeof val) return parse(val); + return options.long ? longFormat(val) : shortFormat(val); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + var match = /^((?:\d+)?\.?\d+) *(ms|seconds?|s|minutes?|m|hours?|h|days?|d|years?|y)?$/i.exec(str); + if (!match) return; + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 's': + return n * s; + case 'ms': + return n; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function shortFormat(ms) { + if (ms >= d) return Math.round(ms / d) + 'd'; + if (ms >= h) return Math.round(ms / h) + 'h'; + if (ms >= m) return Math.round(ms / m) + 'm'; + if (ms >= s) return Math.round(ms / s) + 's'; + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function longFormat(ms) { + return plural(ms, d, 'day') + || plural(ms, h, 'hour') + || plural(ms, m, 'minute') + || plural(ms, s, 'second') + || ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) return; + if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name; + return Math.ceil(ms / n) + ' ' + name + 's'; +} + +}); // module: ms.js + +require.register("reporters/base.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var tty = require('browser/tty') + , diff = require('browser/diff') + , ms = require('../ms') + , utils = require('../utils'); + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date + , setTimeout = global.setTimeout + , setInterval = global.setInterval + , clearTimeout = global.clearTimeout + , clearInterval = global.clearInterval; + +/** + * Check if both stdio streams are associated with a tty. + */ + +var isatty = tty.isatty(1) && tty.isatty(2); + +/** + * Expose `Base`. + */ + +exports = module.exports = Base; + +/** + * Enable coloring by default. + */ + +exports.useColors = isatty || (process.env.MOCHA_COLORS !== undefined); + +/** + * Inline diffs instead of +/- + */ + +exports.inlineDiffs = false; + +/** + * Default color map. + */ + +exports.colors = { + 'pass': 90 + , 'fail': 31 + , 'bright pass': 92 + , 'bright fail': 91 + , 'bright yellow': 93 + , 'pending': 36 + , 'suite': 0 + , 'error title': 0 + , 'error message': 31 + , 'error stack': 90 + , 'checkmark': 32 + , 'fast': 90 + , 'medium': 33 + , 'slow': 31 + , 'green': 32 + , 'light': 90 + , 'diff gutter': 90 + , 'diff added': 42 + , 'diff removed': 41 +}; + +/** + * Default symbol map. + */ + +exports.symbols = { + ok: '✓', + err: '✖', + dot: '․' +}; + +// With node.js on Windows: use symbols available in terminal default fonts +if ('win32' == process.platform) { + exports.symbols.ok = '\u221A'; + exports.symbols.err = '\u00D7'; + exports.symbols.dot = '.'; +} + +/** + * Color `str` with the given `type`, + * allowing colors to be disabled, + * as well as user-defined color + * schemes. + * + * @param {String} type + * @param {String} str + * @return {String} + * @api private + */ + +var color = exports.color = function(type, str) { + if (!exports.useColors) return str; + return '\u001b[' + exports.colors[type] + 'm' + str + '\u001b[0m'; +}; + +/** + * Expose term window size, with some + * defaults for when stderr is not a tty. + */ + +exports.window = { + width: isatty + ? process.stdout.getWindowSize + ? process.stdout.getWindowSize(1)[0] + : tty.getWindowSize()[1] + : 75 +}; + +/** + * Expose some basic cursor interactions + * that are common among reporters. + */ + +exports.cursor = { + hide: function(){ + isatty && process.stdout.write('\u001b[?25l'); + }, + + show: function(){ + isatty && process.stdout.write('\u001b[?25h'); + }, + + deleteLine: function(){ + isatty && process.stdout.write('\u001b[2K'); + }, + + beginningOfLine: function(){ + isatty && process.stdout.write('\u001b[0G'); + }, + + CR: function(){ + if (isatty) { + exports.cursor.deleteLine(); + exports.cursor.beginningOfLine(); + } else { + process.stdout.write('\r'); + } + } +}; + +/** + * Outut the given `failures` as a list. + * + * @param {Array} failures + * @api public + */ + +exports.list = function(failures){ + console.error(); + failures.forEach(function(test, i){ + // format + var fmt = color('error title', ' %s) %s:\n') + + color('error message', ' %s') + + color('error stack', '\n%s\n'); + + // msg + var err = test.err + , message = err.message || '' + , stack = err.stack || message + , index = stack.indexOf(message) + message.length + , msg = stack.slice(0, index) + , actual = err.actual + , expected = err.expected + , escape = true; + + // uncaught + if (err.uncaught) { + msg = 'Uncaught ' + msg; + } + + // explicitly show diff + if (err.showDiff && sameType(actual, expected)) { + escape = false; + err.actual = actual = stringify(canonicalize(actual)); + err.expected = expected = stringify(canonicalize(expected)); + } + + // actual / expected diff + if ('string' == typeof actual && 'string' == typeof expected) { + fmt = color('error title', ' %s) %s:\n%s') + color('error stack', '\n%s\n'); + var match = message.match(/^([^:]+): expected/); + msg = '\n ' + color('error message', match ? match[1] : msg); + + if (exports.inlineDiffs) { + msg += inlineDiff(err, escape); + } else { + msg += unifiedDiff(err, escape); + } + } + + // indent stack trace without msg + stack = stack.slice(index ? index + 1 : index) + .replace(/^/gm, ' '); + + console.error(fmt, (i + 1), test.fullTitle(), msg, stack); + }); +}; + +/** + * Initialize a new `Base` reporter. + * + * All other reporters generally + * inherit from this reporter, providing + * stats such as test duration, number + * of tests passed / failed etc. + * + * @param {Runner} runner + * @api public + */ + +function Base(runner) { + var self = this + , stats = this.stats = { suites: 0, tests: 0, passes: 0, pending: 0, failures: 0 } + , failures = this.failures = []; + + if (!runner) return; + this.runner = runner; + + runner.stats = stats; + + runner.on('start', function(){ + stats.start = new Date; + }); + + runner.on('suite', function(suite){ + stats.suites = stats.suites || 0; + suite.root || stats.suites++; + }); + + runner.on('test end', function(test){ + stats.tests = stats.tests || 0; + stats.tests++; + }); + + runner.on('pass', function(test){ + stats.passes = stats.passes || 0; + + var medium = test.slow() / 2; + test.speed = test.duration > test.slow() + ? 'slow' + : test.duration > medium + ? 'medium' + : 'fast'; + + stats.passes++; + }); + + runner.on('fail', function(test, err){ + stats.failures = stats.failures || 0; + stats.failures++; + test.err = err; + failures.push(test); + }); + + runner.on('end', function(){ + stats.end = new Date; + stats.duration = new Date - stats.start; + }); + + runner.on('pending', function(){ + stats.pending++; + }); +} + +/** + * Output common epilogue used by many of + * the bundled reporters. + * + * @api public + */ + +Base.prototype.epilogue = function(){ + var stats = this.stats; + var tests; + var fmt; + + console.log(); + + // passes + fmt = color('bright pass', ' ') + + color('green', ' %d passing') + + color('light', ' (%s)'); + + console.log(fmt, + stats.passes || 0, + ms(stats.duration)); + + // pending + if (stats.pending) { + fmt = color('pending', ' ') + + color('pending', ' %d pending'); + + console.log(fmt, stats.pending); + } + + // failures + if (stats.failures) { + fmt = color('fail', ' %d failing'); + + console.error(fmt, + stats.failures); + + Base.list(this.failures); + console.error(); + } + + console.log(); +}; + +/** + * Pad the given `str` to `len`. + * + * @param {String} str + * @param {String} len + * @return {String} + * @api private + */ + +function pad(str, len) { + str = String(str); + return Array(len - str.length + 1).join(' ') + str; +} + + +/** + * Returns an inline diff between 2 strings with coloured ANSI output + * + * @param {Error} Error with actual/expected + * @return {String} Diff + * @api private + */ + +function inlineDiff(err, escape) { + var msg = errorDiff(err, 'WordsWithSpace', escape); + + // linenos + var lines = msg.split('\n'); + if (lines.length > 4) { + var width = String(lines.length).length; + msg = lines.map(function(str, i){ + return pad(++i, width) + ' |' + ' ' + str; + }).join('\n'); + } + + // legend + msg = '\n' + + color('diff removed', 'actual') + + ' ' + + color('diff added', 'expected') + + '\n\n' + + msg + + '\n'; + + // indent + msg = msg.replace(/^/gm, ' '); + return msg; +} + +/** + * Returns a unified diff between 2 strings + * + * @param {Error} Error with actual/expected + * @return {String} Diff + * @api private + */ + +function unifiedDiff(err, escape) { + var indent = ' '; + function cleanUp(line) { + if (escape) { + line = escapeInvisibles(line); + } + if (line[0] === '+') return indent + colorLines('diff added', line); + if (line[0] === '-') return indent + colorLines('diff removed', line); + if (line.match(/\@\@/)) return null; + if (line.match(/\\ No newline/)) return null; + else return indent + line; + } + function notBlank(line) { + return line != null; + } + msg = diff.createPatch('string', err.actual, err.expected); + var lines = msg.split('\n').splice(4); + return '\n ' + + colorLines('diff added', '+ expected') + ' ' + + colorLines('diff removed', '- actual') + + '\n\n' + + lines.map(cleanUp).filter(notBlank).join('\n'); +} + +/** + * Return a character diff for `err`. + * + * @param {Error} err + * @return {String} + * @api private + */ + +function errorDiff(err, type, escape) { + var actual = escape ? escapeInvisibles(err.actual) : err.actual; + var expected = escape ? escapeInvisibles(err.expected) : err.expected; + return diff['diff' + type](actual, expected).map(function(str){ + if (str.added) return colorLines('diff added', str.value); + if (str.removed) return colorLines('diff removed', str.value); + return str.value; + }).join(''); +} + +/** + * Returns a string with all invisible characters in plain text + * + * @param {String} line + * @return {String} + * @api private + */ +function escapeInvisibles(line) { + return line.replace(/\t/g, '') + .replace(/\r/g, '') + .replace(/\n/g, '\n'); +} + +/** + * Color lines for `str`, using the color `name`. + * + * @param {String} name + * @param {String} str + * @return {String} + * @api private + */ + +function colorLines(name, str) { + return str.split('\n').map(function(str){ + return color(name, str); + }).join('\n'); +} + +/** + * Stringify `obj`. + * + * @param {Object} obj + * @return {String} + * @api private + */ + +function stringify(obj) { + if (obj instanceof RegExp) return obj.toString(); + return JSON.stringify(obj, null, 2); +} + +/** + * Return a new object that has the keys in sorted order. + * @param {Object} obj + * @return {Object} + * @api private + */ + + function canonicalize(obj, stack) { + stack = stack || []; + + if (utils.indexOf(stack, obj) !== -1) return obj; + + var canonicalizedObj; + + if ('[object Array]' == {}.toString.call(obj)) { + stack.push(obj); + canonicalizedObj = utils.map(obj, function(item) { + return canonicalize(item, stack); + }); + stack.pop(); + } else if (typeof obj === 'object' && obj !== null) { + stack.push(obj); + canonicalizedObj = {}; + utils.forEach(utils.keys(obj).sort(), function(key) { + canonicalizedObj[key] = canonicalize(obj[key], stack); + }); + stack.pop(); + } else { + canonicalizedObj = obj; + } + + return canonicalizedObj; + } + +/** + * Check that a / b have the same type. + * + * @param {Object} a + * @param {Object} b + * @return {Boolean} + * @api private + */ + +function sameType(a, b) { + a = Object.prototype.toString.call(a); + b = Object.prototype.toString.call(b); + return a == b; +} + + +}); // module: reporters/base.js + +require.register("reporters/doc.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , utils = require('../utils'); + +/** + * Expose `Doc`. + */ + +exports = module.exports = Doc; + +/** + * Initialize a new `Doc` reporter. + * + * @param {Runner} runner + * @api public + */ + +function Doc(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , total = runner.total + , indents = 2; + + function indent() { + return Array(indents).join(' '); + } + + runner.on('suite', function(suite){ + if (suite.root) return; + ++indents; + console.log('%s
    ', indent()); + ++indents; + console.log('%s

    %s

    ', indent(), utils.escape(suite.title)); + console.log('%s
    ', indent()); + }); + + runner.on('suite end', function(suite){ + if (suite.root) return; + console.log('%s
    ', indent()); + --indents; + console.log('%s
    ', indent()); + --indents; + }); + + runner.on('pass', function(test){ + console.log('%s
    %s
    ', indent(), utils.escape(test.title)); + var code = utils.escape(utils.clean(test.fn.toString())); + console.log('%s 
    %s
    ', indent(), code); + }); +} + +}); // module: reporters/doc.js + +require.register("reporters/dot.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , color = Base.color; + +/** + * Expose `Dot`. + */ + +exports = module.exports = Dot; + +/** + * Initialize a new `Dot` matrix test reporter. + * + * @param {Runner} runner + * @api public + */ + +function Dot(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , width = Base.window.width * .75 | 0 + , n = 0; + + runner.on('start', function(){ + process.stdout.write('\n '); + }); + + runner.on('pending', function(test){ + process.stdout.write(color('pending', Base.symbols.dot)); + }); + + runner.on('pass', function(test){ + if (++n % width == 0) process.stdout.write('\n '); + if ('slow' == test.speed) { + process.stdout.write(color('bright yellow', Base.symbols.dot)); + } else { + process.stdout.write(color(test.speed, Base.symbols.dot)); + } + }); + + runner.on('fail', function(test, err){ + if (++n % width == 0) process.stdout.write('\n '); + process.stdout.write(color('fail', Base.symbols.dot)); + }); + + runner.on('end', function(){ + console.log(); + self.epilogue(); + }); +} + +/** + * Inherit from `Base.prototype`. + */ + +function F(){}; +F.prototype = Base.prototype; +Dot.prototype = new F; +Dot.prototype.constructor = Dot; + +}); // module: reporters/dot.js + +require.register("reporters/html-cov.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var JSONCov = require('./json-cov') + , fs = require('browser/fs'); + +/** + * Expose `HTMLCov`. + */ + +exports = module.exports = HTMLCov; + +/** + * Initialize a new `JsCoverage` reporter. + * + * @param {Runner} runner + * @api public + */ + +function HTMLCov(runner) { + var jade = require('jade') + , file = __dirname + '/templates/coverage.jade' + , str = fs.readFileSync(file, 'utf8') + , fn = jade.compile(str, { filename: file }) + , self = this; + + JSONCov.call(this, runner, false); + + runner.on('end', function(){ + process.stdout.write(fn({ + cov: self.cov + , coverageClass: coverageClass + })); + }); +} + +/** + * Return coverage class for `n`. + * + * @return {String} + * @api private + */ + +function coverageClass(n) { + if (n >= 75) return 'high'; + if (n >= 50) return 'medium'; + if (n >= 25) return 'low'; + return 'terrible'; +} +}); // module: reporters/html-cov.js + +require.register("reporters/html.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , utils = require('../utils') + , Progress = require('../browser/progress') + , escape = utils.escape; + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date + , setTimeout = global.setTimeout + , setInterval = global.setInterval + , clearTimeout = global.clearTimeout + , clearInterval = global.clearInterval; + +/** + * Expose `HTML`. + */ + +exports = module.exports = HTML; + +/** + * Stats template. + */ + +var statsTemplate = ''; + +/** + * Initialize a new `HTML` reporter. + * + * @param {Runner} runner + * @api public + */ + +function HTML(runner, root) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , total = runner.total + , stat = fragment(statsTemplate) + , items = stat.getElementsByTagName('li') + , passes = items[1].getElementsByTagName('em')[0] + , passesLink = items[1].getElementsByTagName('a')[0] + , failures = items[2].getElementsByTagName('em')[0] + , failuresLink = items[2].getElementsByTagName('a')[0] + , duration = items[3].getElementsByTagName('em')[0] + , canvas = stat.getElementsByTagName('canvas')[0] + , report = fragment('
      ') + , stack = [report] + , progress + , ctx + + root = root || document.getElementById('mocha'); + + if (canvas.getContext) { + var ratio = window.devicePixelRatio || 1; + canvas.style.width = canvas.width; + canvas.style.height = canvas.height; + canvas.width *= ratio; + canvas.height *= ratio; + ctx = canvas.getContext('2d'); + ctx.scale(ratio, ratio); + progress = new Progress; + } + + if (!root) return error('#mocha div missing, add it to your document'); + + // pass toggle + on(passesLink, 'click', function(){ + unhide(); + var name = /pass/.test(report.className) ? '' : ' pass'; + report.className = report.className.replace(/fail|pass/g, '') + name; + if (report.className.trim()) hideSuitesWithout('test pass'); + }); + + // failure toggle + on(failuresLink, 'click', function(){ + unhide(); + var name = /fail/.test(report.className) ? '' : ' fail'; + report.className = report.className.replace(/fail|pass/g, '') + name; + if (report.className.trim()) hideSuitesWithout('test fail'); + }); + + root.appendChild(stat); + root.appendChild(report); + + if (progress) progress.size(40); + + runner.on('suite', function(suite){ + if (suite.root) return; + + // suite + var url = self.suiteURL(suite); + var el = fragment('

    • %s

      • ', url, escape(suite.title)); + + // container + stack[0].appendChild(el); + stack.unshift(document.createElement('ul')); + el.appendChild(stack[0]); + }); + + runner.on('suite end', function(suite){ + if (suite.root) return; + stack.shift(); + }); + + runner.on('fail', function(test, err){ + if ('hook' == test.type) runner.emit('test end', test); + }); + + runner.on('test end', function(test){ + // TODO: add to stats + var percent = stats.tests / this.total * 100 | 0; + if (progress) progress.update(percent).draw(ctx); + + // update stats + var ms = new Date - stats.start; + text(passes, stats.passes); + text(failures, stats.failures); + text(duration, (ms / 1000).toFixed(2)); + + // test + if ('passed' == test.state) { + var url = self.testURL(test); + var el = fragment('

    • %e%ems ‣

      • ', test.speed, test.title, test.duration, url); + } else if (test.pending) { + var el = fragment('

    • %e

      • ', test.title); + } else { + var el = fragment('

    • %e ‣

      • ', test.title, encodeURIComponent(test.fullTitle())); + var str = test.err.stack || test.err.toString(); + + // FF / Opera do not add the message + if (!~str.indexOf(test.err.message)) { + str = test.err.message + '\n' + str; + } + + // <=IE7 stringifies to [Object Error]. Since it can be overloaded, we + // check for the result of the stringifying. + if ('[object Error]' == str) str = test.err.message; + + // Safari doesn't give you a stack. Let's at least provide a source line. + if (!test.err.stack && test.err.sourceURL && test.err.line !== undefined) { + str += "\n(" + test.err.sourceURL + ":" + test.err.line + ")"; + } + + el.appendChild(fragment('
      %e
      ', str)); + } + + // toggle code + // TODO: defer + if (!test.pending) { + var h2 = el.getElementsByTagName('h2')[0]; + + on(h2, 'click', function(){ + pre.style.display = 'none' == pre.style.display + ? 'block' + : 'none'; + }); + + var pre = fragment('
      %e
      ', utils.clean(test.fn.toString())); + el.appendChild(pre); + pre.style.display = 'none'; + } + + // Don't call .appendChild if #mocha-report was already .shift()'ed off the stack. + if (stack[0]) stack[0].appendChild(el); + }); +} + +/** + * Provide suite URL + * + * @param {Object} [suite] + */ + +HTML.prototype.suiteURL = function(suite){ + return '?grep=' + encodeURIComponent(suite.fullTitle()); +}; + +/** + * Provide test URL + * + * @param {Object} [test] + */ + +HTML.prototype.testURL = function(test){ + return '?grep=' + encodeURIComponent(test.fullTitle()); +}; + +/** + * Display error `msg`. + */ + +function error(msg) { + document.body.appendChild(fragment('
      %s
      ', msg)); +} + +/** + * Return a DOM fragment from `html`. + */ + +function fragment(html) { + var args = arguments + , div = document.createElement('div') + , i = 1; + + div.innerHTML = html.replace(/%([se])/g, function(_, type){ + switch (type) { + case 's': return String(args[i++]); + case 'e': return escape(args[i++]); + } + }); + + return div.firstChild; +} + +/** + * Check for suites that do not have elements + * with `classname`, and hide them. + */ + +function hideSuitesWithout(classname) { + var suites = document.getElementsByClassName('suite'); + for (var i = 0; i < suites.length; i++) { + var els = suites[i].getElementsByClassName(classname); + if (0 == els.length) suites[i].className += ' hidden'; + } +} + +/** + * Unhide .hidden suites. + */ + +function unhide() { + var els = document.getElementsByClassName('suite hidden'); + for (var i = 0; i < els.length; ++i) { + els[i].className = els[i].className.replace('suite hidden', 'suite'); + } +} + +/** + * Set `el` text to `str`. + */ + +function text(el, str) { + if (el.textContent) { + el.textContent = str; + } else { + el.innerText = str; + } +} + +/** + * Listen on `event` with callback `fn`. + */ + +function on(el, event, fn) { + if (el.addEventListener) { + el.addEventListener(event, fn, false); + } else { + el.attachEvent('on' + event, fn); + } +} + +}); // module: reporters/html.js + +require.register("reporters/index.js", function(module, exports, require){ + +exports.Base = require('./base'); +exports.Dot = require('./dot'); +exports.Doc = require('./doc'); +exports.TAP = require('./tap'); +exports.JSON = require('./json'); +exports.HTML = require('./html'); +exports.List = require('./list'); +exports.Min = require('./min'); +exports.Spec = require('./spec'); +exports.Nyan = require('./nyan'); +exports.XUnit = require('./xunit'); +exports.Markdown = require('./markdown'); +exports.Progress = require('./progress'); +exports.Landing = require('./landing'); +exports.JSONCov = require('./json-cov'); +exports.HTMLCov = require('./html-cov'); +exports.JSONStream = require('./json-stream'); + +}); // module: reporters/index.js + +require.register("reporters/json-cov.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base'); + +/** + * Expose `JSONCov`. + */ + +exports = module.exports = JSONCov; + +/** + * Initialize a new `JsCoverage` reporter. + * + * @param {Runner} runner + * @param {Boolean} output + * @api public + */ + +function JSONCov(runner, output) { + var self = this + , output = 1 == arguments.length ? true : output; + + Base.call(this, runner); + + var tests = [] + , failures = [] + , passes = []; + + runner.on('test end', function(test){ + tests.push(test); + }); + + runner.on('pass', function(test){ + passes.push(test); + }); + + runner.on('fail', function(test){ + failures.push(test); + }); + + runner.on('end', function(){ + var cov = global._$jscoverage || {}; + var result = self.cov = map(cov); + result.stats = self.stats; + result.tests = tests.map(clean); + result.failures = failures.map(clean); + result.passes = passes.map(clean); + if (!output) return; + process.stdout.write(JSON.stringify(result, null, 2 )); + }); +} + +/** + * Map jscoverage data to a JSON structure + * suitable for reporting. + * + * @param {Object} cov + * @return {Object} + * @api private + */ + +function map(cov) { + var ret = { + instrumentation: 'node-jscoverage' + , sloc: 0 + , hits: 0 + , misses: 0 + , coverage: 0 + , files: [] + }; + + for (var filename in cov) { + var data = coverage(filename, cov[filename]); + ret.files.push(data); + ret.hits += data.hits; + ret.misses += data.misses; + ret.sloc += data.sloc; + } + + ret.files.sort(function(a, b) { + return a.filename.localeCompare(b.filename); + }); + + if (ret.sloc > 0) { + ret.coverage = (ret.hits / ret.sloc) * 100; + } + + return ret; +}; + +/** + * Map jscoverage data for a single source file + * to a JSON structure suitable for reporting. + * + * @param {String} filename name of the source file + * @param {Object} data jscoverage coverage data + * @return {Object} + * @api private + */ + +function coverage(filename, data) { + var ret = { + filename: filename, + coverage: 0, + hits: 0, + misses: 0, + sloc: 0, + source: {} + }; + + data.source.forEach(function(line, num){ + num++; + + if (data[num] === 0) { + ret.misses++; + ret.sloc++; + } else if (data[num] !== undefined) { + ret.hits++; + ret.sloc++; + } + + ret.source[num] = { + source: line + , coverage: data[num] === undefined + ? '' + : data[num] + }; + }); + + ret.coverage = ret.hits / ret.sloc * 100; + + return ret; +} + +/** + * Return a plain-object representation of `test` + * free of cyclic properties etc. + * + * @param {Object} test + * @return {Object} + * @api private + */ + +function clean(test) { + return { + title: test.title + , fullTitle: test.fullTitle() + , duration: test.duration + } +} + +}); // module: reporters/json-cov.js + +require.register("reporters/json-stream.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , color = Base.color; + +/** + * Expose `List`. + */ + +exports = module.exports = List; + +/** + * Initialize a new `List` test reporter. + * + * @param {Runner} runner + * @api public + */ + +function List(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , total = runner.total; + + runner.on('start', function(){ + console.log(JSON.stringify(['start', { total: total }])); + }); + + runner.on('pass', function(test){ + console.log(JSON.stringify(['pass', clean(test)])); + }); + + runner.on('fail', function(test, err){ + console.log(JSON.stringify(['fail', clean(test)])); + }); + + runner.on('end', function(){ + process.stdout.write(JSON.stringify(['end', self.stats])); + }); +} + +/** + * Return a plain-object representation of `test` + * free of cyclic properties etc. + * + * @param {Object} test + * @return {Object} + * @api private + */ + +function clean(test) { + return { + title: test.title + , fullTitle: test.fullTitle() + , duration: test.duration + } +} +}); // module: reporters/json-stream.js + +require.register("reporters/json.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `JSON`. + */ + +exports = module.exports = JSONReporter; + +/** + * Initialize a new `JSON` reporter. + * + * @param {Runner} runner + * @api public + */ + +function JSONReporter(runner) { + var self = this; + Base.call(this, runner); + + var tests = [] + , failures = [] + , passes = []; + + runner.on('test end', function(test){ + tests.push(test); + }); + + runner.on('pass', function(test){ + passes.push(test); + }); + + runner.on('fail', function(test){ + failures.push(test); + }); + + runner.on('end', function(){ + var obj = { + stats: self.stats + , tests: tests.map(clean) + , failures: failures.map(clean) + , passes: passes.map(clean) + }; + + process.stdout.write(JSON.stringify(obj, null, 2)); + }); +} + +/** + * Return a plain-object representation of `test` + * free of cyclic properties etc. + * + * @param {Object} test + * @return {Object} + * @api private + */ + +function clean(test) { + return { + title: test.title + , fullTitle: test.fullTitle() + , duration: test.duration + } +} +}); // module: reporters/json.js + +require.register("reporters/landing.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `Landing`. + */ + +exports = module.exports = Landing; + +/** + * Airplane color. + */ + +Base.colors.plane = 0; + +/** + * Airplane crash color. + */ + +Base.colors['plane crash'] = 31; + +/** + * Runway color. + */ + +Base.colors.runway = 90; + +/** + * Initialize a new `Landing` reporter. + * + * @param {Runner} runner + * @api public + */ + +function Landing(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , width = Base.window.width * .75 | 0 + , total = runner.total + , stream = process.stdout + , plane = color('plane', '✈') + , crashed = -1 + , n = 0; + + function runway() { + var buf = Array(width).join('-'); + return ' ' + color('runway', buf); + } + + runner.on('start', function(){ + stream.write('\n '); + cursor.hide(); + }); + + runner.on('test end', function(test){ + // check if the plane crashed + var col = -1 == crashed + ? width * ++n / total | 0 + : crashed; + + // show the crash + if ('failed' == test.state) { + plane = color('plane crash', '✈'); + crashed = col; + } + + // render landing strip + stream.write('\u001b[4F\n\n'); + stream.write(runway()); + stream.write('\n '); + stream.write(color('runway', Array(col).join('⋅'))); + stream.write(plane) + stream.write(color('runway', Array(width - col).join('⋅') + '\n')); + stream.write(runway()); + stream.write('\u001b[0m'); + }); + + runner.on('end', function(){ + cursor.show(); + console.log(); + self.epilogue(); + }); +} + +/** + * Inherit from `Base.prototype`. + */ + +function F(){}; +F.prototype = Base.prototype; +Landing.prototype = new F; +Landing.prototype.constructor = Landing; + +}); // module: reporters/landing.js + +require.register("reporters/list.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `List`. + */ + +exports = module.exports = List; + +/** + * Initialize a new `List` test reporter. + * + * @param {Runner} runner + * @api public + */ + +function List(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , n = 0; + + runner.on('start', function(){ + console.log(); + }); + + runner.on('test', function(test){ + process.stdout.write(color('pass', ' ' + test.fullTitle() + ': ')); + }); + + runner.on('pending', function(test){ + var fmt = color('checkmark', ' -') + + color('pending', ' %s'); + console.log(fmt, test.fullTitle()); + }); + + runner.on('pass', function(test){ + var fmt = color('checkmark', ' '+Base.symbols.dot) + + color('pass', ' %s: ') + + color(test.speed, '%dms'); + cursor.CR(); + console.log(fmt, test.fullTitle(), test.duration); + }); + + runner.on('fail', function(test, err){ + cursor.CR(); + console.log(color('fail', ' %d) %s'), ++n, test.fullTitle()); + }); + + runner.on('end', self.epilogue.bind(self)); +} + +/** + * Inherit from `Base.prototype`. + */ + +function F(){}; +F.prototype = Base.prototype; +List.prototype = new F; +List.prototype.constructor = List; + + +}); // module: reporters/list.js + +require.register("reporters/markdown.js", function(module, exports, require){ +/** + * Module dependencies. + */ + +var Base = require('./base') + , utils = require('../utils'); + +/** + * Expose `Markdown`. + */ + +exports = module.exports = Markdown; + +/** + * Initialize a new `Markdown` reporter. + * + * @param {Runner} runner + * @api public + */ + +function Markdown(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , level = 0 + , buf = ''; + + function title(str) { + return Array(level).join('#') + ' ' + str; + } + + function indent() { + return Array(level).join(' '); + } + + function mapTOC(suite, obj) { + var ret = obj; + obj = obj[suite.title] = obj[suite.title] || { suite: suite }; + suite.suites.forEach(function(suite){ + mapTOC(suite, obj); + }); + return ret; + } + + function stringifyTOC(obj, level) { + ++level; + var buf = ''; + var link; + for (var key in obj) { + if ('suite' == key) continue; + if (key) link = ' - [' + key + '](#' + utils.slug(obj[key].suite.fullTitle()) + ')\n'; + if (key) buf += Array(level).join(' ') + link; + buf += stringifyTOC(obj[key], level); + } + --level; + return buf; + } + + function generateTOC(suite) { + var obj = mapTOC(suite, {}); + return stringifyTOC(obj, 0); + } + + generateTOC(runner.suite); + + runner.on('suite', function(suite){ + ++level; + var slug = utils.slug(suite.fullTitle()); + buf += '' + '\n'; + buf += title(suite.title) + '\n'; + }); + + runner.on('suite end', function(suite){ + --level; + }); + + runner.on('pass', function(test){ + var code = utils.clean(test.fn.toString()); + buf += test.title + '.\n'; + buf += '\n```js\n'; + buf += code + '\n'; + buf += '```\n\n'; + }); + + runner.on('end', function(){ + process.stdout.write('# TOC\n'); + process.stdout.write(generateTOC(runner.suite)); + process.stdout.write(buf); + }); +} +}); // module: reporters/markdown.js + +require.register("reporters/min.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base'); + +/** + * Expose `Min`. + */ + +exports = module.exports = Min; + +/** + * Initialize a new `Min` minimal test reporter (best used with --watch). + * + * @param {Runner} runner + * @api public + */ + +function Min(runner) { + Base.call(this, runner); + + runner.on('start', function(){ + // clear screen + process.stdout.write('\u001b[2J'); + // set cursor position + process.stdout.write('\u001b[1;3H'); + }); + + runner.on('end', this.epilogue.bind(this)); +} + +/** + * Inherit from `Base.prototype`. + */ + +function F(){}; +F.prototype = Base.prototype; +Min.prototype = new F; +Min.prototype.constructor = Min; + + +}); // module: reporters/min.js + +require.register("reporters/nyan.js", function(module, exports, require){ +/** + * Module dependencies. + */ + +var Base = require('./base') + , color = Base.color; + +/** + * Expose `Dot`. + */ + +exports = module.exports = NyanCat; + +/** + * Initialize a new `Dot` matrix test reporter. + * + * @param {Runner} runner + * @api public + */ + +function NyanCat(runner) { + Base.call(this, runner); + var self = this + , stats = this.stats + , width = Base.window.width * .75 | 0 + , rainbowColors = this.rainbowColors = self.generateColors() + , colorIndex = this.colorIndex = 0 + , numerOfLines = this.numberOfLines = 4 + , trajectories = this.trajectories = [[], [], [], []] + , nyanCatWidth = this.nyanCatWidth = 11 + , trajectoryWidthMax = this.trajectoryWidthMax = (width - nyanCatWidth) + , scoreboardWidth = this.scoreboardWidth = 5 + , tick = this.tick = 0 + , n = 0; + + runner.on('start', function(){ + Base.cursor.hide(); + self.draw(); + }); + + runner.on('pending', function(test){ + self.draw(); + }); + + runner.on('pass', function(test){ + self.draw(); + }); + + runner.on('fail', function(test, err){ + self.draw(); + }); + + runner.on('end', function(){ + Base.cursor.show(); + for (var i = 0; i < self.numberOfLines; i++) write('\n'); + self.epilogue(); + }); +} + +/** + * Draw the nyan cat + * + * @api private + */ + +NyanCat.prototype.draw = function(){ + this.appendRainbow(); + this.drawScoreboard(); + this.drawRainbow(); + this.drawNyanCat(); + this.tick = !this.tick; +}; + +/** + * Draw the "scoreboard" showing the number + * of passes, failures and pending tests. + * + * @api private + */ + +NyanCat.prototype.drawScoreboard = function(){ + var stats = this.stats; + var colors = Base.colors; + + function draw(color, n) { + write(' '); + write('\u001b[' + color + 'm' + n + '\u001b[0m'); + write('\n'); + } + + draw(colors.green, stats.passes); + draw(colors.fail, stats.failures); + draw(colors.pending, stats.pending); + write('\n'); + + this.cursorUp(this.numberOfLines); +}; + +/** + * Append the rainbow. + * + * @api private + */ + +NyanCat.prototype.appendRainbow = function(){ + var segment = this.tick ? '_' : '-'; + var rainbowified = this.rainbowify(segment); + + for (var index = 0; index < this.numberOfLines; index++) { + var trajectory = this.trajectories[index]; + if (trajectory.length >= this.trajectoryWidthMax) trajectory.shift(); + trajectory.push(rainbowified); + } +}; + +/** + * Draw the rainbow. + * + * @api private + */ + +NyanCat.prototype.drawRainbow = function(){ + var self = this; + + this.trajectories.forEach(function(line, index) { + write('\u001b[' + self.scoreboardWidth + 'C'); + write(line.join('')); + write('\n'); + }); + + this.cursorUp(this.numberOfLines); +}; + +/** + * Draw the nyan cat + * + * @api private + */ + +NyanCat.prototype.drawNyanCat = function() { + var self = this; + var startWidth = this.scoreboardWidth + this.trajectories[0].length; + var color = '\u001b[' + startWidth + 'C'; + var padding = ''; + + write(color); + write('_,------,'); + write('\n'); + + write(color); + padding = self.tick ? ' ' : ' '; + write('_|' + padding + '/\\_/\\ '); + write('\n'); + + write(color); + padding = self.tick ? '_' : '__'; + var tail = self.tick ? '~' : '^'; + var face; + write(tail + '|' + padding + this.face() + ' '); + write('\n'); + + write(color); + padding = self.tick ? ' ' : ' '; + write(padding + '"" "" '); + write('\n'); + + this.cursorUp(this.numberOfLines); +}; + +/** + * Draw nyan cat face. + * + * @return {String} + * @api private + */ + +NyanCat.prototype.face = function() { + var stats = this.stats; + if (stats.failures) { + return '( x .x)'; + } else if (stats.pending) { + return '( o .o)'; + } else if(stats.passes) { + return '( ^ .^)'; + } else { + return '( - .-)'; + } +} + +/** + * Move cursor up `n`. + * + * @param {Number} n + * @api private + */ + +NyanCat.prototype.cursorUp = function(n) { + write('\u001b[' + n + 'A'); +}; + +/** + * Move cursor down `n`. + * + * @param {Number} n + * @api private + */ + +NyanCat.prototype.cursorDown = function(n) { + write('\u001b[' + n + 'B'); +}; + +/** + * Generate rainbow colors. + * + * @return {Array} + * @api private + */ + +NyanCat.prototype.generateColors = function(){ + var colors = []; + + for (var i = 0; i < (6 * 7); i++) { + var pi3 = Math.floor(Math.PI / 3); + var n = (i * (1.0 / 6)); + var r = Math.floor(3 * Math.sin(n) + 3); + var g = Math.floor(3 * Math.sin(n + 2 * pi3) + 3); + var b = Math.floor(3 * Math.sin(n + 4 * pi3) + 3); + colors.push(36 * r + 6 * g + b + 16); + } + + return colors; +}; + +/** + * Apply rainbow to the given `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +NyanCat.prototype.rainbowify = function(str){ + var color = this.rainbowColors[this.colorIndex % this.rainbowColors.length]; + this.colorIndex += 1; + return '\u001b[38;5;' + color + 'm' + str + '\u001b[0m'; +}; + +/** + * Stdout helper. + */ + +function write(string) { + process.stdout.write(string); +} + +/** + * Inherit from `Base.prototype`. + */ + +function F(){}; +F.prototype = Base.prototype; +NyanCat.prototype = new F; +NyanCat.prototype.constructor = NyanCat; + + +}); // module: reporters/nyan.js + +require.register("reporters/progress.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `Progress`. + */ + +exports = module.exports = Progress; + +/** + * General progress bar color. + */ + +Base.colors.progress = 90; + +/** + * Initialize a new `Progress` bar test reporter. + * + * @param {Runner} runner + * @param {Object} options + * @api public + */ + +function Progress(runner, options) { + Base.call(this, runner); + + var self = this + , options = options || {} + , stats = this.stats + , width = Base.window.width * .50 | 0 + , total = runner.total + , complete = 0 + , max = Math.max; + + // default chars + options.open = options.open || '['; + options.complete = options.complete || '▬'; + options.incomplete = options.incomplete || Base.symbols.dot; + options.close = options.close || ']'; + options.verbose = false; + + // tests started + runner.on('start', function(){ + console.log(); + cursor.hide(); + }); + + // tests complete + runner.on('test end', function(){ + complete++; + var incomplete = total - complete + , percent = complete / total + , n = width * percent | 0 + , i = width - n; + + cursor.CR(); + process.stdout.write('\u001b[J'); + process.stdout.write(color('progress', ' ' + options.open)); + process.stdout.write(Array(n).join(options.complete)); + process.stdout.write(Array(i).join(options.incomplete)); + process.stdout.write(color('progress', options.close)); + if (options.verbose) { + process.stdout.write(color('progress', ' ' + complete + ' of ' + total)); + } + }); + + // tests are complete, output some stats + // and the failures if any + runner.on('end', function(){ + cursor.show(); + console.log(); + self.epilogue(); + }); +} + +/** + * Inherit from `Base.prototype`. + */ + +function F(){}; +F.prototype = Base.prototype; +Progress.prototype = new F; +Progress.prototype.constructor = Progress; + + +}); // module: reporters/progress.js + +require.register("reporters/spec.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `Spec`. + */ + +exports = module.exports = Spec; + +/** + * Initialize a new `Spec` test reporter. + * + * @param {Runner} runner + * @api public + */ + +function Spec(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , indents = 0 + , n = 0; + + function indent() { + return Array(indents).join(' ') + } + + runner.on('start', function(){ + console.log(); + }); + + runner.on('suite', function(suite){ + ++indents; + console.log(color('suite', '%s%s'), indent(), suite.title); + }); + + runner.on('suite end', function(suite){ + --indents; + if (1 == indents) console.log(); + }); + + runner.on('pending', function(test){ + var fmt = indent() + color('pending', ' - %s'); + console.log(fmt, test.title); + }); + + runner.on('pass', function(test){ + if ('fast' == test.speed) { + var fmt = indent() + + color('checkmark', ' ' + Base.symbols.ok) + + color('pass', ' %s '); + cursor.CR(); + console.log(fmt, test.title); + } else { + var fmt = indent() + + color('checkmark', ' ' + Base.symbols.ok) + + color('pass', ' %s ') + + color(test.speed, '(%dms)'); + cursor.CR(); + console.log(fmt, test.title, test.duration); + } + }); + + runner.on('fail', function(test, err){ + cursor.CR(); + console.log(indent() + color('fail', ' %d) %s'), ++n, test.title); + }); + + runner.on('end', self.epilogue.bind(self)); +} + +/** + * Inherit from `Base.prototype`. + */ + +function F(){}; +F.prototype = Base.prototype; +Spec.prototype = new F; +Spec.prototype.constructor = Spec; + + +}); // module: reporters/spec.js + +require.register("reporters/tap.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , cursor = Base.cursor + , color = Base.color; + +/** + * Expose `TAP`. + */ + +exports = module.exports = TAP; + +/** + * Initialize a new `TAP` reporter. + * + * @param {Runner} runner + * @api public + */ + +function TAP(runner) { + Base.call(this, runner); + + var self = this + , stats = this.stats + , n = 1 + , passes = 0 + , failures = 0; + + runner.on('start', function(){ + var total = runner.grepTotal(runner.suite); + console.log('%d..%d', 1, total); + }); + + runner.on('test end', function(){ + ++n; + }); + + runner.on('pending', function(test){ + console.log('ok %d %s # SKIP -', n, title(test)); + }); + + runner.on('pass', function(test){ + passes++; + console.log('ok %d %s', n, title(test)); + }); + + runner.on('fail', function(test, err){ + failures++; + console.log('not ok %d %s', n, title(test)); + if (err.stack) console.log(err.stack.replace(/^/gm, ' ')); + }); + + runner.on('end', function(){ + console.log('# tests ' + (passes + failures)); + console.log('# pass ' + passes); + console.log('# fail ' + failures); + }); +} + +/** + * Return a TAP-safe title of `test` + * + * @param {Object} test + * @return {String} + * @api private + */ + +function title(test) { + return test.fullTitle().replace(/#/g, ''); +} + +}); // module: reporters/tap.js + +require.register("reporters/xunit.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Base = require('./base') + , utils = require('../utils') + , escape = utils.escape; + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date + , setTimeout = global.setTimeout + , setInterval = global.setInterval + , clearTimeout = global.clearTimeout + , clearInterval = global.clearInterval; + +/** + * Expose `XUnit`. + */ + +exports = module.exports = XUnit; + +/** + * Initialize a new `XUnit` reporter. + * + * @param {Runner} runner + * @api public + */ + +function XUnit(runner) { + Base.call(this, runner); + var stats = this.stats + , tests = [] + , self = this; + + runner.on('pending', function(test){ + tests.push(test); + }); + + runner.on('pass', function(test){ + tests.push(test); + }); + + runner.on('fail', function(test){ + tests.push(test); + }); + + runner.on('end', function(){ + console.log(tag('testsuite', { + name: 'Mocha Tests' + , tests: stats.tests + , failures: stats.failures + , errors: stats.failures + , skipped: stats.tests - stats.failures - stats.passes + , timestamp: (new Date).toUTCString() + , time: (stats.duration / 1000) || 0 + }, false)); + + tests.forEach(test); + console.log(''); + }); +} + +/** + * Inherit from `Base.prototype`. + */ + +function F(){}; +F.prototype = Base.prototype; +XUnit.prototype = new F; +XUnit.prototype.constructor = XUnit; + + +/** + * Output tag for the given `test.` + */ + +function test(test) { + var attrs = { + classname: test.parent.fullTitle() + , name: test.title + , time: (test.duration / 1000) || 0 + }; + + if ('failed' == test.state) { + var err = test.err; + attrs.message = escape(err.message); + console.log(tag('testcase', attrs, false, tag('failure', attrs, false, cdata(err.stack)))); + } else if (test.pending) { + console.log(tag('testcase', attrs, false, tag('skipped', {}, true))); + } else { + console.log(tag('testcase', attrs, true) ); + } +} + +/** + * HTML tag helper. + */ + +function tag(name, attrs, close, content) { + var end = close ? '/>' : '>' + , pairs = [] + , tag; + + for (var key in attrs) { + pairs.push(key + '="' + escape(attrs[key]) + '"'); + } + + tag = '<' + name + (pairs.length ? ' ' + pairs.join(' ') : '') + end; + if (content) tag += content + ''; +} + +}); // module: reporters/xunit.js + +require.register("runnable.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var EventEmitter = require('browser/events').EventEmitter + , debug = require('browser/debug')('mocha:runnable') + , milliseconds = require('./ms'); + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date + , setTimeout = global.setTimeout + , setInterval = global.setInterval + , clearTimeout = global.clearTimeout + , clearInterval = global.clearInterval; + +/** + * Object#toString(). + */ + +var toString = Object.prototype.toString; + +/** + * Expose `Runnable`. + */ + +module.exports = Runnable; + +/** + * Initialize a new `Runnable` with the given `title` and callback `fn`. + * + * @param {String} title + * @param {Function} fn + * @api private + */ + +function Runnable(title, fn) { + this.title = title; + this.fn = fn; + this.async = fn && fn.length; + this.sync = ! this.async; + this._timeout = 2000; + this._slow = 75; + this.timedOut = false; +} + +/** + * Inherit from `EventEmitter.prototype`. + */ + +function F(){}; +F.prototype = EventEmitter.prototype; +Runnable.prototype = new F; +Runnable.prototype.constructor = Runnable; + + +/** + * Set & get timeout `ms`. + * + * @param {Number|String} ms + * @return {Runnable|Number} ms or self + * @api private + */ + +Runnable.prototype.timeout = function(ms){ + if (0 == arguments.length) return this._timeout; + if ('string' == typeof ms) ms = milliseconds(ms); + debug('timeout %d', ms); + this._timeout = ms; + if (this.timer) this.resetTimeout(); + return this; +}; + +/** + * Set & get slow `ms`. + * + * @param {Number|String} ms + * @return {Runnable|Number} ms or self + * @api private + */ + +Runnable.prototype.slow = function(ms){ + if (0 === arguments.length) return this._slow; + if ('string' == typeof ms) ms = milliseconds(ms); + debug('timeout %d', ms); + this._slow = ms; + return this; +}; + +/** + * Return the full title generated by recursively + * concatenating the parent's full title. + * + * @return {String} + * @api public + */ + +Runnable.prototype.fullTitle = function(){ + return this.parent.fullTitle() + ' ' + this.title; +}; + +/** + * Clear the timeout. + * + * @api private + */ + +Runnable.prototype.clearTimeout = function(){ + clearTimeout(this.timer); +}; + +/** + * Inspect the runnable void of private properties. + * + * @return {String} + * @api private + */ + +Runnable.prototype.inspect = function(){ + return JSON.stringify(this, function(key, val){ + if ('_' == key[0]) return; + if ('parent' == key) return '#'; + if ('ctx' == key) return '#'; + return val; + }, 2); +}; + +/** + * Reset the timeout. + * + * @api private + */ + +Runnable.prototype.resetTimeout = function(){ + var self = this; + var ms = this.timeout() || 1e9; + + this.clearTimeout(); + this.timer = setTimeout(function(){ + self.callback(new Error('timeout of ' + ms + 'ms exceeded')); + self.timedOut = true; + }, ms); +}; + +/** + * Whitelist these globals for this test run + * + * @api private + */ +Runnable.prototype.globals = function(arr){ + var self = this; + this._allowedGlobals = arr; +}; + +/** + * Run the test and invoke `fn(err)`. + * + * @param {Function} fn + * @api private + */ + +Runnable.prototype.run = function(fn){ + var self = this + , ms = this.timeout() + , start = new Date + , ctx = this.ctx + , finished + , emitted; + + if (ctx) ctx.runnable(this); + + // timeout + if (this.async) { + if (ms) { + this.timer = setTimeout(function(){ + done(new Error('timeout of ' + ms + 'ms exceeded')); + self.timedOut = true; + }, ms); + } + } + + // called multiple times + function multiple(err) { + if (emitted) return; + emitted = true; + self.emit('error', err || new Error('done() called multiple times')); + } + + // finished + function done(err) { + if (self.timedOut) return; + if (finished) return multiple(err); + self.clearTimeout(); + self.duration = new Date - start; + finished = true; + fn(err); + } + + // for .resetTimeout() + this.callback = done; + + // async + if (this.async) { + try { + this.fn.call(ctx, function(err){ + if (err instanceof Error || toString.call(err) === "[object Error]") return done(err); + if (null != err) return done(new Error('done() invoked with non-Error: ' + err)); + done(); + }); + } catch (err) { + done(err); + } + return; + } + + if (this.asyncOnly) { + return done(new Error('--async-only option in use without declaring `done()`')); + } + + // sync + try { + if (!this.pending) this.fn.call(ctx); + this.duration = new Date - start; + fn(); + } catch (err) { + fn(err); + } +}; + +}); // module: runnable.js + +require.register("runner.js", function(module, exports, require){ +/** + * Module dependencies. + */ + +var EventEmitter = require('browser/events').EventEmitter + , debug = require('browser/debug')('mocha:runner') + , Test = require('./test') + , utils = require('./utils') + , filter = utils.filter + , keys = utils.keys; + +/** + * Non-enumerable globals. + */ + +var globals = [ + 'setTimeout', + 'clearTimeout', + 'setInterval', + 'clearInterval', + 'XMLHttpRequest', + 'Date' +]; + +/** + * Expose `Runner`. + */ + +module.exports = Runner; + +/** + * Initialize a `Runner` for the given `suite`. + * + * Events: + * + * - `start` execution started + * - `end` execution complete + * - `suite` (suite) test suite execution started + * - `suite end` (suite) all tests (and sub-suites) have finished + * - `test` (test) test execution started + * - `test end` (test) test completed + * - `hook` (hook) hook execution started + * - `hook end` (hook) hook complete + * - `pass` (test) test passed + * - `fail` (test, err) test failed + * - `pending` (test) test pending + * + * @api public + */ + +function Runner(suite) { + var self = this; + this._globals = []; + this._abort = false; + this.suite = suite; + this.total = suite.total(); + this.failures = 0; + this.on('test end', function(test){ self.checkGlobals(test); }); + this.on('hook end', function(hook){ self.checkGlobals(hook); }); + this.grep(/.*/); + this.globals(this.globalProps().concat(extraGlobals())); +} + +/** + * Wrapper for setImmediate, process.nextTick, or browser polyfill. + * + * @param {Function} fn + * @api private + */ + +Runner.immediately = global.setImmediate || process.nextTick; + +/** + * Inherit from `EventEmitter.prototype`. + */ + +function F(){}; +F.prototype = EventEmitter.prototype; +Runner.prototype = new F; +Runner.prototype.constructor = Runner; + + +/** + * Run tests with full titles matching `re`. Updates runner.total + * with number of tests matched. + * + * @param {RegExp} re + * @param {Boolean} invert + * @return {Runner} for chaining + * @api public + */ + +Runner.prototype.grep = function(re, invert){ + debug('grep %s', re); + this._grep = re; + this._invert = invert; + this.total = this.grepTotal(this.suite); + return this; +}; + +/** + * Returns the number of tests matching the grep search for the + * given suite. + * + * @param {Suite} suite + * @return {Number} + * @api public + */ + +Runner.prototype.grepTotal = function(suite) { + var self = this; + var total = 0; + + suite.eachTest(function(test){ + var match = self._grep.test(test.fullTitle()); + if (self._invert) match = !match; + if (match) total++; + }); + + return total; +}; + +/** + * Return a list of global properties. + * + * @return {Array} + * @api private + */ + +Runner.prototype.globalProps = function() { + var props = utils.keys(global); + + // non-enumerables + for (var i = 0; i < globals.length; ++i) { + if (~utils.indexOf(props, globals[i])) continue; + props.push(globals[i]); + } + + return props; +}; + +/** + * Allow the given `arr` of globals. + * + * @param {Array} arr + * @return {Runner} for chaining + * @api public + */ + +Runner.prototype.globals = function(arr){ + if (0 == arguments.length) return this._globals; + debug('globals %j', arr); + this._globals = this._globals.concat(arr); + return this; +}; + +/** + * Check for global variable leaks. + * + * @api private + */ + +Runner.prototype.checkGlobals = function(test){ + if (this.ignoreLeaks) return; + var ok = this._globals; + + var globals = this.globalProps(); + var isNode = process.kill; + var leaks; + + if (test) { + ok = ok.concat(test._allowedGlobals || []); + } + + if(this.prevGlobalsLength == globals.length) return; + this.prevGlobalsLength = globals.length; + + leaks = filterLeaks(ok, globals); + this._globals = this._globals.concat(leaks); + + if (leaks.length > 1) { + this.fail(test, new Error('global leaks detected: ' + leaks.join(', ') + '')); + } else if (leaks.length) { + this.fail(test, new Error('global leak detected: ' + leaks[0])); + } +}; + +/** + * Fail the given `test`. + * + * @param {Test} test + * @param {Error} err + * @api private + */ + +Runner.prototype.fail = function(test, err){ + ++this.failures; + test.state = 'failed'; + + if ('string' == typeof err) { + err = new Error('the string "' + err + '" was thrown, throw an Error :)'); + } + + this.emit('fail', test, err); +}; + +/** + * Fail the given `hook` with `err`. + * + * Hook failures work in the following pattern: + * - If bail, then exit + * - Failed `before` hook skips all tests in a suite and subsuites, + * but jumps to corresponding `after` hook + * - Failed `before each` hook skips remaining tests in a + * suite and jumps to corresponding `after each` hook, + * which is run only once + * - Failed `after` hook does not alter + * execution order + * - Failed `after each` hook skips remaining tests in a + * suite and subsuites, but executes other `after each` + * hooks + * + * @param {Hook} hook + * @param {Error} err + * @api private + */ + +Runner.prototype.failHook = function(hook, err){ + this.fail(hook, err); + if (this.suite.bail()) { + this.emit('end'); + } +}; + +/** + * Run hook `name` callbacks and then invoke `fn()`. + * + * @param {String} name + * @param {Function} function + * @api private + */ + +Runner.prototype.hook = function(name, fn){ + var suite = this.suite + , hooks = suite['_' + name] + , self = this + , timer; + + function next(i) { + var hook = hooks[i]; + if (!hook) return fn(); + if (self.failures && suite.bail()) return fn(); + self.currentRunnable = hook; + + hook.ctx.currentTest = self.test; + + self.emit('hook', hook); + + hook.on('error', function(err){ + self.failHook(hook, err); + }); + + hook.run(function(err){ + hook.removeAllListeners('error'); + var testError = hook.error(); + if (testError) self.fail(self.test, testError); + if (err) { + self.failHook(hook, err); + + // stop executing hooks, notify callee of hook err + return fn(err); + } + self.emit('hook end', hook); + delete hook.ctx.currentTest; + next(++i); + }); + } + + Runner.immediately(function(){ + next(0); + }); +}; + +/** + * Run hook `name` for the given array of `suites` + * in order, and callback `fn(err, errSuite)`. + * + * @param {String} name + * @param {Array} suites + * @param {Function} fn + * @api private + */ + +Runner.prototype.hooks = function(name, suites, fn){ + var self = this + , orig = this.suite; + + function next(suite) { + self.suite = suite; + + if (!suite) { + self.suite = orig; + return fn(); + } + + self.hook(name, function(err){ + if (err) { + var errSuite = self.suite; + self.suite = orig; + return fn(err, errSuite); + } + + next(suites.pop()); + }); + } + + next(suites.pop()); +}; + +/** + * Run hooks from the top level down. + * + * @param {String} name + * @param {Function} fn + * @api private + */ + +Runner.prototype.hookUp = function(name, fn){ + var suites = [this.suite].concat(this.parents()).reverse(); + this.hooks(name, suites, fn); +}; + +/** + * Run hooks from the bottom up. + * + * @param {String} name + * @param {Function} fn + * @api private + */ + +Runner.prototype.hookDown = function(name, fn){ + var suites = [this.suite].concat(this.parents()); + this.hooks(name, suites, fn); +}; + +/** + * Return an array of parent Suites from + * closest to furthest. + * + * @return {Array} + * @api private + */ + +Runner.prototype.parents = function(){ + var suite = this.suite + , suites = []; + while (suite = suite.parent) suites.push(suite); + return suites; +}; + +/** + * Run the current test and callback `fn(err)`. + * + * @param {Function} fn + * @api private + */ + +Runner.prototype.runTest = function(fn){ + var test = this.test + , self = this; + + if (this.asyncOnly) test.asyncOnly = true; + + try { + test.on('error', function(err){ + self.fail(test, err); + }); + test.run(fn); + } catch (err) { + fn(err); + } +}; + +/** + * Run tests in the given `suite` and invoke + * the callback `fn()` when complete. + * + * @param {Suite} suite + * @param {Function} fn + * @api private + */ + +Runner.prototype.runTests = function(suite, fn){ + var self = this + , tests = suite.tests.slice() + , test; + + + function hookErr(err, errSuite, after) { + // before/after Each hook for errSuite failed: + var orig = self.suite; + + // for failed 'after each' hook start from errSuite parent, + // otherwise start from errSuite itself + self.suite = after ? errSuite.parent : errSuite; + + if (self.suite) { + // call hookUp afterEach + self.hookUp('afterEach', function(err2, errSuite2) { + self.suite = orig; + // some hooks may fail even now + if (err2) return hookErr(err2, errSuite2, true); + // report error suite + fn(errSuite); + }); + } else { + // there is no need calling other 'after each' hooks + self.suite = orig; + fn(errSuite); + } + } + + function next(err, errSuite) { + // if we bail after first err + if (self.failures && suite._bail) return fn(); + + if (self._abort) return fn(); + + if (err) return hookErr(err, errSuite, true); + + // next test + test = tests.shift(); + + // all done + if (!test) return fn(); + + // grep + var match = self._grep.test(test.fullTitle()); + if (self._invert) match = !match; + if (!match) return next(); + + // pending + if (test.pending) { + self.emit('pending', test); + self.emit('test end', test); + return next(); + } + + // execute test and hook(s) + self.emit('test', self.test = test); + self.hookDown('beforeEach', function(err, errSuite){ + + if (err) return hookErr(err, errSuite, false); + + self.currentRunnable = self.test; + self.runTest(function(err){ + test = self.test; + + if (err) { + self.fail(test, err); + self.emit('test end', test); + return self.hookUp('afterEach', next); + } + + test.state = 'passed'; + self.emit('pass', test); + self.emit('test end', test); + self.hookUp('afterEach', next); + }); + }); + } + + this.next = next; + next(); +}; + +/** + * Run the given `suite` and invoke the + * callback `fn()` when complete. + * + * @param {Suite} suite + * @param {Function} fn + * @api private + */ + +Runner.prototype.runSuite = function(suite, fn){ + var total = this.grepTotal(suite) + , self = this + , i = 0; + + debug('run suite %s', suite.fullTitle()); + + if (!total) return fn(); + + this.emit('suite', this.suite = suite); + + function next(errSuite) { + if (errSuite) { + // current suite failed on a hook from errSuite + if (errSuite == suite) { + // if errSuite is current suite + // continue to the next sibling suite + return done(); + } else { + // errSuite is among the parents of current suite + // stop execution of errSuite and all sub-suites + return done(errSuite); + } + } + + if (self._abort) return done(); + + var curr = suite.suites[i++]; + if (!curr) return done(); + self.runSuite(curr, next); + } + + function done(errSuite) { + self.suite = suite; + self.hook('afterAll', function(){ + self.emit('suite end', suite); + fn(errSuite); + }); + } + + this.hook('beforeAll', function(err){ + if (err) return done(); + self.runTests(suite, next); + }); +}; + +/** + * Handle uncaught exceptions. + * + * @param {Error} err + * @api private + */ + +Runner.prototype.uncaught = function(err){ + debug('uncaught exception %s', err.message); + var runnable = this.currentRunnable; + if (!runnable || 'failed' == runnable.state) return; + runnable.clearTimeout(); + err.uncaught = true; + this.fail(runnable, err); + + // recover from test + if ('test' == runnable.type) { + this.emit('test end', runnable); + this.hookUp('afterEach', this.next); + return; + } + + // bail on hooks + this.emit('end'); +}; + +/** + * Run the root suite and invoke `fn(failures)` + * on completion. + * + * @param {Function} fn + * @return {Runner} for chaining + * @api public + */ + +Runner.prototype.run = function(fn){ + var self = this + , fn = fn || function(){}; + + function uncaught(err){ + self.uncaught(err); + } + + debug('start'); + + // callback + this.on('end', function(){ + debug('end'); + process.removeListener('uncaughtException', uncaught); + fn(self.failures); + }); + + // run suites + this.emit('start'); + this.runSuite(this.suite, function(){ + debug('finished running'); + self.emit('end'); + }); + + // uncaught exception + process.on('uncaughtException', uncaught); + + return this; +}; + +/** + * Cleanly abort execution + * + * @return {Runner} for chaining + * @api public + */ +Runner.prototype.abort = function(){ + debug('aborting'); + this._abort = true; +} + +/** + * Filter leaks with the given globals flagged as `ok`. + * + * @param {Array} ok + * @param {Array} globals + * @return {Array} + * @api private + */ + +function filterLeaks(ok, globals) { + return filter(globals, function(key){ + // Firefox and Chrome exposes iframes as index inside the window object + if (/^d+/.test(key)) return false; + + // in firefox + // if runner runs in an iframe, this iframe's window.getInterface method not init at first + // it is assigned in some seconds + if (global.navigator && /^getInterface/.test(key)) return false; + + // an iframe could be approached by window[iframeIndex] + // in ie6,7,8 and opera, iframeIndex is enumerable, this could cause leak + if (global.navigator && /^\d+/.test(key)) return false; + + // Opera and IE expose global variables for HTML element IDs (issue #243) + if (/^mocha-/.test(key)) return false; + + var matched = filter(ok, function(ok){ + if (~ok.indexOf('*')) return 0 == key.indexOf(ok.split('*')[0]); + return key == ok; + }); + return matched.length == 0 && (!global.navigator || 'onerror' !== key); + }); +} + +/** + * Array of globals dependent on the environment. + * + * @return {Array} + * @api private + */ + + function extraGlobals() { + if (typeof(process) === 'object' && + typeof(process.version) === 'string') { + + var nodeVersion = process.version.split('.').reduce(function(a, v) { + return a << 8 | v; + }); + + // 'errno' was renamed to process._errno in v0.9.11. + + if (nodeVersion < 0x00090B) { + return ['errno']; + } + } + + return []; + } + +}); // module: runner.js + +require.register("suite.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var EventEmitter = require('browser/events').EventEmitter + , debug = require('browser/debug')('mocha:suite') + , milliseconds = require('./ms') + , utils = require('./utils') + , Hook = require('./hook'); + +/** + * Expose `Suite`. + */ + +exports = module.exports = Suite; + +/** + * Create a new `Suite` with the given `title` + * and parent `Suite`. When a suite with the + * same title is already present, that suite + * is returned to provide nicer reporter + * and more flexible meta-testing. + * + * @param {Suite} parent + * @param {String} title + * @return {Suite} + * @api public + */ + +exports.create = function(parent, title){ + var suite = new Suite(title, parent.ctx); + suite.parent = parent; + if (parent.pending) suite.pending = true; + title = suite.fullTitle(); + parent.addSuite(suite); + return suite; +}; + +/** + * Initialize a new `Suite` with the given + * `title` and `ctx`. + * + * @param {String} title + * @param {Context} ctx + * @api private + */ + +function Suite(title, ctx) { + this.title = title; + this.ctx = ctx; + this.suites = []; + this.tests = []; + this.pending = false; + this._beforeEach = []; + this._beforeAll = []; + this._afterEach = []; + this._afterAll = []; + this.root = !title; + this._timeout = 2000; + this._slow = 75; + this._bail = false; +} + +/** + * Inherit from `EventEmitter.prototype`. + */ + +function F(){}; +F.prototype = EventEmitter.prototype; +Suite.prototype = new F; +Suite.prototype.constructor = Suite; + + +/** + * Return a clone of this `Suite`. + * + * @return {Suite} + * @api private + */ + +Suite.prototype.clone = function(){ + var suite = new Suite(this.title); + debug('clone'); + suite.ctx = this.ctx; + suite.timeout(this.timeout()); + suite.slow(this.slow()); + suite.bail(this.bail()); + return suite; +}; + +/** + * Set timeout `ms` or short-hand such as "2s". + * + * @param {Number|String} ms + * @return {Suite|Number} for chaining + * @api private + */ + +Suite.prototype.timeout = function(ms){ + if (0 == arguments.length) return this._timeout; + if ('string' == typeof ms) ms = milliseconds(ms); + debug('timeout %d', ms); + this._timeout = parseInt(ms, 10); + return this; +}; + +/** + * Set slow `ms` or short-hand such as "2s". + * + * @param {Number|String} ms + * @return {Suite|Number} for chaining + * @api private + */ + +Suite.prototype.slow = function(ms){ + if (0 === arguments.length) return this._slow; + if ('string' == typeof ms) ms = milliseconds(ms); + debug('slow %d', ms); + this._slow = ms; + return this; +}; + +/** + * Sets whether to bail after first error. + * + * @parma {Boolean} bail + * @return {Suite|Number} for chaining + * @api private + */ + +Suite.prototype.bail = function(bail){ + if (0 == arguments.length) return this._bail; + debug('bail %s', bail); + this._bail = bail; + return this; +}; + +/** + * Run `fn(test[, done])` before running tests. + * + * @param {Function} fn + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.beforeAll = function(fn){ + if (this.pending) return this; + var hook = new Hook('"before all" hook', fn); + hook.parent = this; + hook.timeout(this.timeout()); + hook.slow(this.slow()); + hook.ctx = this.ctx; + this._beforeAll.push(hook); + this.emit('beforeAll', hook); + return this; +}; + +/** + * Run `fn(test[, done])` after running tests. + * + * @param {Function} fn + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.afterAll = function(fn){ + if (this.pending) return this; + var hook = new Hook('"after all" hook', fn); + hook.parent = this; + hook.timeout(this.timeout()); + hook.slow(this.slow()); + hook.ctx = this.ctx; + this._afterAll.push(hook); + this.emit('afterAll', hook); + return this; +}; + +/** + * Run `fn(test[, done])` before each test case. + * + * @param {Function} fn + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.beforeEach = function(fn){ + if (this.pending) return this; + var hook = new Hook('"before each" hook', fn); + hook.parent = this; + hook.timeout(this.timeout()); + hook.slow(this.slow()); + hook.ctx = this.ctx; + this._beforeEach.push(hook); + this.emit('beforeEach', hook); + return this; +}; + +/** + * Run `fn(test[, done])` after each test case. + * + * @param {Function} fn + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.afterEach = function(fn){ + if (this.pending) return this; + var hook = new Hook('"after each" hook', fn); + hook.parent = this; + hook.timeout(this.timeout()); + hook.slow(this.slow()); + hook.ctx = this.ctx; + this._afterEach.push(hook); + this.emit('afterEach', hook); + return this; +}; + +/** + * Add a test `suite`. + * + * @param {Suite} suite + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.addSuite = function(suite){ + suite.parent = this; + suite.timeout(this.timeout()); + suite.slow(this.slow()); + suite.bail(this.bail()); + this.suites.push(suite); + this.emit('suite', suite); + return this; +}; + +/** + * Add a `test` to this suite. + * + * @param {Test} test + * @return {Suite} for chaining + * @api private + */ + +Suite.prototype.addTest = function(test){ + test.parent = this; + test.timeout(this.timeout()); + test.slow(this.slow()); + test.ctx = this.ctx; + this.tests.push(test); + this.emit('test', test); + return this; +}; + +/** + * Return the full title generated by recursively + * concatenating the parent's full title. + * + * @return {String} + * @api public + */ + +Suite.prototype.fullTitle = function(){ + if (this.parent) { + var full = this.parent.fullTitle(); + if (full) return full + ' ' + this.title; + } + return this.title; +}; + +/** + * Return the total number of tests. + * + * @return {Number} + * @api public + */ + +Suite.prototype.total = function(){ + return utils.reduce(this.suites, function(sum, suite){ + return sum + suite.total(); + }, 0) + this.tests.length; +}; + +/** + * Iterates through each suite recursively to find + * all tests. Applies a function in the format + * `fn(test)`. + * + * @param {Function} fn + * @return {Suite} + * @api private + */ + +Suite.prototype.eachTest = function(fn){ + utils.forEach(this.tests, fn); + utils.forEach(this.suites, function(suite){ + suite.eachTest(fn); + }); + return this; +}; + +}); // module: suite.js + +require.register("test.js", function(module, exports, require){ + +/** + * Module dependencies. + */ + +var Runnable = require('./runnable'); + +/** + * Expose `Test`. + */ + +module.exports = Test; + +/** + * Initialize a new `Test` with the given `title` and callback `fn`. + * + * @param {String} title + * @param {Function} fn + * @api private + */ + +function Test(title, fn) { + Runnable.call(this, title, fn); + this.pending = !fn; + this.type = 'test'; +} + +/** + * Inherit from `Runnable.prototype`. + */ + +function F(){}; +F.prototype = Runnable.prototype; +Test.prototype = new F; +Test.prototype.constructor = Test; + + +}); // module: test.js + +require.register("utils.js", function(module, exports, require){ +/** + * Module dependencies. + */ + +var fs = require('browser/fs') + , path = require('browser/path') + , join = path.join + , debug = require('browser/debug')('mocha:watch'); + +/** + * Ignored directories. + */ + +var ignore = ['node_modules', '.git']; + +/** + * Escape special characters in the given string of html. + * + * @param {String} html + * @return {String} + * @api private + */ + +exports.escape = function(html){ + return String(html) + .replace(/&/g, '&') + .replace(/"/g, '"') + .replace(//g, '>'); +}; + +/** + * Array#forEach (<=IE8) + * + * @param {Array} array + * @param {Function} fn + * @param {Object} scope + * @api private + */ + +exports.forEach = function(arr, fn, scope){ + for (var i = 0, l = arr.length; i < l; i++) + fn.call(scope, arr[i], i); +}; + +/** + * Array#map (<=IE8) + * + * @param {Array} array + * @param {Function} fn + * @param {Object} scope + * @api private + */ + +exports.map = function(arr, fn, scope){ + var result = []; + for (var i = 0, l = arr.length; i < l; i++) + result.push(fn.call(scope, arr[i], i)); + return result; +}; + +/** + * Array#indexOf (<=IE8) + * + * @parma {Array} arr + * @param {Object} obj to find index of + * @param {Number} start + * @api private + */ + +exports.indexOf = function(arr, obj, start){ + for (var i = start || 0, l = arr.length; i < l; i++) { + if (arr[i] === obj) + return i; + } + return -1; +}; + +/** + * Array#reduce (<=IE8) + * + * @param {Array} array + * @param {Function} fn + * @param {Object} initial value + * @api private + */ + +exports.reduce = function(arr, fn, val){ + var rval = val; + + for (var i = 0, l = arr.length; i < l; i++) { + rval = fn(rval, arr[i], i, arr); + } + + return rval; +}; + +/** + * Array#filter (<=IE8) + * + * @param {Array} array + * @param {Function} fn + * @api private + */ + +exports.filter = function(arr, fn){ + var ret = []; + + for (var i = 0, l = arr.length; i < l; i++) { + var val = arr[i]; + if (fn(val, i, arr)) ret.push(val); + } + + return ret; +}; + +/** + * Object.keys (<=IE8) + * + * @param {Object} obj + * @return {Array} keys + * @api private + */ + +exports.keys = Object.keys || function(obj) { + var keys = [] + , has = Object.prototype.hasOwnProperty // for `window` on <=IE8 + + for (var key in obj) { + if (has.call(obj, key)) { + keys.push(key); + } + } + + return keys; +}; + +/** + * Watch the given `files` for changes + * and invoke `fn(file)` on modification. + * + * @param {Array} files + * @param {Function} fn + * @api private + */ + +exports.watch = function(files, fn){ + var options = { interval: 100 }; + files.forEach(function(file){ + debug('file %s', file); + fs.watchFile(file, options, function(curr, prev){ + if (prev.mtime < curr.mtime) fn(file); + }); + }); +}; + +/** + * Ignored files. + */ + +function ignored(path){ + return !~ignore.indexOf(path); +} + +/** + * Lookup files in the given `dir`. + * + * @return {Array} + * @api private + */ + +exports.files = function(dir, ret){ + ret = ret || []; + + fs.readdirSync(dir) + .filter(ignored) + .forEach(function(path){ + path = join(dir, path); + if (fs.statSync(path).isDirectory()) { + exports.files(path, ret); + } else if (path.match(/\.(js|coffee|litcoffee|coffee.md)$/)) { + ret.push(path); + } + }); + + return ret; +}; + +/** + * Compute a slug from the given `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +exports.slug = function(str){ + return str + .toLowerCase() + .replace(/ +/g, '-') + .replace(/[^-\w]/g, ''); +}; + +/** + * Strip the function definition from `str`, + * and re-indent for pre whitespace. + */ + +exports.clean = function(str) { + str = str + .replace(/\r\n?|[\n\u2028\u2029]/g, "\n").replace(/^\uFEFF/, '') + .replace(/^function *\(.*\) *{/, '') + .replace(/\s+\}$/, ''); + + var spaces = str.match(/^\n?( *)/)[1].length + , tabs = str.match(/^\n?(\t*)/)[1].length + , re = new RegExp('^\n?' + (tabs ? '\t' : ' ') + '{' + (tabs ? tabs : spaces) + '}', 'gm'); + + str = str.replace(re, ''); + + return exports.trim(str); +}; + +/** + * Escape regular expression characters in `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +exports.escapeRegexp = function(str){ + return str.replace(/[-\\^$*+?.()|[\]{}]/g, "\\$&"); +}; + +/** + * Trim the given `str`. + * + * @param {String} str + * @return {String} + * @api private + */ + +exports.trim = function(str){ + return str.replace(/^\s+|\s+$/g, ''); +}; + +/** + * Parse the given `qs`. + * + * @param {String} qs + * @return {Object} + * @api private + */ + +exports.parseQuery = function(qs){ + return exports.reduce(qs.replace('?', '').split('&'), function(obj, pair){ + var i = pair.indexOf('=') + , key = pair.slice(0, i) + , val = pair.slice(++i); + + obj[key] = decodeURIComponent(val); + return obj; + }, {}); +}; + +/** + * Highlight the given string of `js`. + * + * @param {String} js + * @return {String} + * @api private + */ + +function highlight(js) { + return js + .replace(//g, '>') + .replace(/\/\/(.*)/gm, '//$1') + .replace(/('.*?')/gm, '$1') + .replace(/(\d+\.\d+)/gm, '$1') + .replace(/(\d+)/gm, '$1') + .replace(/\bnew *(\w+)/gm, 'new $1') + .replace(/\b(function|new|throw|return|var|if|else)\b/gm, '$1') +} + +/** + * Highlight the contents of tag `name`. + * + * @param {String} name + * @api private + */ + +exports.highlightTags = function(name) { + var code = document.getElementsByTagName(name); + for (var i = 0, len = code.length; i < len; ++i) { + code[i].innerHTML = highlight(code[i].innerHTML); + } +}; + +}); // module: utils.js +// The global object is "self" in Web Workers. +global = (function() { return this; })(); + +/** + * Save timer references to avoid Sinon interfering (see GH-237). + */ + +var Date = global.Date; +var setTimeout = global.setTimeout; +var setInterval = global.setInterval; +var clearTimeout = global.clearTimeout; +var clearInterval = global.clearInterval; + +/** + * Node shims. + * + * These are meant only to allow + * mocha.js to run untouched, not + * to allow running node code in + * the browser. + */ + +var process = {}; +process.exit = function(status){}; +process.stdout = {}; + +var uncaughtExceptionHandlers = []; + +/** + * Remove uncaughtException listener. + */ + +process.removeListener = function(e, fn){ + if ('uncaughtException' == e) { + global.onerror = function() {}; + var i = Mocha.utils.indexOf(uncaughtExceptionHandlers, fn); + if (i != -1) { uncaughtExceptionHandlers.splice(i, 1); } + } +}; + +/** + * Implements uncaughtException listener. + */ + +process.on = function(e, fn){ + if ('uncaughtException' == e) { + global.onerror = function(err, url, line){ + fn(new Error(err + ' (' + url + ':' + line + ')')); + return true; + }; + uncaughtExceptionHandlers.push(fn); + } +}; + +/** + * Expose mocha. + */ + +var Mocha = global.Mocha = require('mocha'), + mocha = global.mocha = new Mocha({ reporter: 'html' }); + +// The BDD UI is registered by default, but no UI will be functional in the +// browser without an explicit call to the overridden `mocha.ui` (see below). +// Ensure that this default UI does not expose its methods to the global scope. +mocha.suite.removeAllListeners('pre-require'); + +var immediateQueue = [] + , immediateTimeout; + +function timeslice() { + var immediateStart = new Date().getTime(); + while (immediateQueue.length && (new Date().getTime() - immediateStart) < 100) { + immediateQueue.shift()(); + } + if (immediateQueue.length) { + immediateTimeout = setTimeout(timeslice, 0); + } else { + immediateTimeout = null; + } +} + +/** + * High-performance override of Runner.immediately. + */ + +Mocha.Runner.immediately = function(callback) { + immediateQueue.push(callback); + if (!immediateTimeout) { + immediateTimeout = setTimeout(timeslice, 0); + } +}; + +/** + * Function to allow assertion libraries to throw errors directly into mocha. + * This is useful when running tests in a browser because window.onerror will + * only receive the 'message' attribute of the Error. + */ +mocha.throwError = function(err) { + Mocha.utils.forEach(uncaughtExceptionHandlers, function (fn) { + fn(err); + }); + throw err; +}; + +/** + * Override ui to ensure that the ui functions are initialized. + * Normally this would happen in Mocha.prototype.loadFiles. + */ + +mocha.ui = function(ui){ + Mocha.prototype.ui.call(this, ui); + this.suite.emit('pre-require', global, null, this); + return this; +}; + +/** + * Setup mocha with the given setting options. + */ + +mocha.setup = function(opts){ + if ('string' == typeof opts) opts = { ui: opts }; + for (var opt in opts) this[opt](opts[opt]); + return this; +}; + +/** + * Run mocha, returning the Runner. + */ + +mocha.run = function(fn){ + var options = mocha.options; + mocha.globals('location'); + + var query = Mocha.utils.parseQuery(global.location.search || ''); + if (query.grep) mocha.grep(query.grep); + if (query.invert) mocha.invert(); + + return Mocha.prototype.run.call(mocha, function(){ + // The DOM Document is not available in Web Workers. + if (global.document) { + Mocha.utils.highlightTags('code'); + } + if (fn) fn(); + }); +}; + +/** + * Expose the process shim. + */ + +Mocha.process = process; +})(); \ No newline at end of file diff --git a/node_modules/mocha/node_modules/.bin/jade b/node_modules/mocha/node_modules/.bin/jade new file mode 120000 index 0000000..2d08320 --- /dev/null +++ b/node_modules/mocha/node_modules/.bin/jade @@ -0,0 +1 @@ +../../../jade/bin/jade \ No newline at end of file diff --git a/node_modules/mocha/package.json b/node_modules/mocha/package.json new file mode 100644 index 0000000..2f5f07a --- /dev/null +++ b/node_modules/mocha/package.json @@ -0,0 +1,49 @@ +{ + "name": "mocha", + "version": "1.17.1", + "description": "simple, flexible, fun test framework", + "keywords": [ + "mocha", + "test", + "bdd", + "tdd", + "tap" + ], + "author": "TJ Holowaychuk ", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/mocha.git" + }, + "main": "./index", + "bin": { + "mocha": "./bin/mocha", + "_mocha": "./bin/_mocha" + }, + "engines": { + "node": ">= 0.4.x" + }, + "scripts": { + "test": "make test-all" + }, + "dependencies": { + "commander": "2.0.0", + "growl": "1.7.x", + "jade": "0.26.3", + "diff": "1.0.7", + "debug": "*", + "mkdirp": "0.3.5", + "glob": "3.2.3" + }, + "devDependencies": { + "should": ">= 2.0.x", + "coffee-script": "1.2" + }, + "files": [ + "bin", + "images", + "lib", + "index.js", + "mocha.css", + "mocha.js" + ] +} diff --git a/node_modules/ms/index.js b/node_modules/ms/index.js new file mode 100644 index 0000000..6a522b1 --- /dev/null +++ b/node_modules/ms/index.js @@ -0,0 +1,152 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd'; + } + if (ms >= h) { + return Math.round(ms / h) + 'h'; + } + if (ms >= m) { + return Math.round(ms / m) + 'm'; + } + if (ms >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) { + return; + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name; + } + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/node_modules/ms/license.md b/node_modules/ms/license.md new file mode 100644 index 0000000..69b6125 --- /dev/null +++ b/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/ms/package.json b/node_modules/ms/package.json new file mode 100644 index 0000000..6a31c81 --- /dev/null +++ b/node_modules/ms/package.json @@ -0,0 +1,37 @@ +{ + "name": "ms", + "version": "2.0.0", + "description": "Tiny milisecond conversion utility", + "repository": "zeit/ms", + "main": "./index", + "files": [ + "index.js" + ], + "scripts": { + "precommit": "lint-staged", + "lint": "eslint lib/* bin/*", + "test": "mocha tests.js" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "license": "MIT", + "devDependencies": { + "eslint": "3.19.0", + "expect.js": "0.3.1", + "husky": "0.13.3", + "lint-staged": "3.4.1", + "mocha": "3.4.1" + } +} diff --git a/node_modules/ms/readme.md b/node_modules/ms/readme.md new file mode 100644 index 0000000..84a9974 --- /dev/null +++ b/node_modules/ms/readme.md @@ -0,0 +1,51 @@ +# ms + +[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) +[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +``` + +### Convert from milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +### Time format written-out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [node](https://nodejs.org) and in the browser. +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. + +## Caught a bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/sigmund/LICENSE b/node_modules/sigmund/LICENSE new file mode 100644 index 0000000..19129e3 --- /dev/null +++ b/node_modules/sigmund/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/sigmund/README.md b/node_modules/sigmund/README.md new file mode 100644 index 0000000..25a38a5 --- /dev/null +++ b/node_modules/sigmund/README.md @@ -0,0 +1,53 @@ +# sigmund + +Quick and dirty signatures for Objects. + +This is like a much faster `deepEquals` comparison, which returns a +string key suitable for caches and the like. + +## Usage + +```javascript +function doSomething (someObj) { + var key = sigmund(someObj, maxDepth) // max depth defaults to 10 + var cached = cache.get(key) + if (cached) return cached + + var result = expensiveCalculation(someObj) + cache.set(key, result) + return result +} +``` + +The resulting key will be as unique and reproducible as calling +`JSON.stringify` or `util.inspect` on the object, but is much faster. +In order to achieve this speed, some differences are glossed over. +For example, the object `{0:'foo'}` will be treated identically to the +array `['foo']`. + +Also, just as there is no way to summon the soul from the scribblings +of a cocaine-addled psychoanalyst, there is no way to revive the object +from the signature string that sigmund gives you. In fact, it's +barely even readable. + +As with `util.inspect` and `JSON.stringify`, larger objects will +produce larger signature strings. + +Because sigmund is a bit less strict than the more thorough +alternatives, the strings will be shorter, and also there is a +slightly higher chance for collisions. For example, these objects +have the same signature: + + var obj1 = {a:'b',c:/def/,g:['h','i',{j:'',k:'l'}]} + var obj2 = {a:'b',c:'/def/',g:['h','i','{jkl']} + +Like a good Freudian, sigmund is most effective when you already have +some understanding of what you're looking for. It can help you help +yourself, but you must be willing to do some work as well. + +Cycles are handled, and cyclical objects are silently omitted (though +the key is included in the signature output.) + +The second argument is the maximum depth, which defaults to 10, +because that is the maximum object traversal depth covered by most +insurance carriers. diff --git a/node_modules/sigmund/bench.js b/node_modules/sigmund/bench.js new file mode 100644 index 0000000..5acfd6d --- /dev/null +++ b/node_modules/sigmund/bench.js @@ -0,0 +1,283 @@ +// different ways to id objects +// use a req/res pair, since it's crazy deep and cyclical + +// sparseFE10 and sigmund are usually pretty close, which is to be expected, +// since they are essentially the same algorithm, except that sigmund handles +// regular expression objects properly. + + +var http = require('http') +var util = require('util') +var sigmund = require('./sigmund.js') +var sreq, sres, creq, cres, test + +http.createServer(function (q, s) { + sreq = q + sres = s + sres.end('ok') + this.close(function () { setTimeout(function () { + start() + }, 200) }) +}).listen(1337, function () { + creq = http.get({ port: 1337 }) + creq.on('response', function (s) { cres = s }) +}) + +function start () { + test = [sreq, sres, creq, cres] + // test = sreq + // sreq.sres = sres + // sreq.creq = creq + // sreq.cres = cres + + for (var i in exports.compare) { + console.log(i) + var hash = exports.compare[i]() + console.log(hash) + console.log(hash.length) + console.log('') + } + + require('bench').runMain() +} + +function customWs (obj, md, d) { + d = d || 0 + var to = typeof obj + if (to === 'undefined' || to === 'function' || to === null) return '' + if (d > md || !obj || to !== 'object') return ('' + obj).replace(/[\n ]+/g, '') + + if (Array.isArray(obj)) { + return obj.map(function (i, _, __) { + return customWs(i, md, d + 1) + }).reduce(function (a, b) { return a + b }, '') + } + + var keys = Object.keys(obj) + return keys.map(function (k, _, __) { + return k + ':' + customWs(obj[k], md, d + 1) + }).reduce(function (a, b) { return a + b }, '') +} + +function custom (obj, md, d) { + d = d || 0 + var to = typeof obj + if (to === 'undefined' || to === 'function' || to === null) return '' + if (d > md || !obj || to !== 'object') return '' + obj + + if (Array.isArray(obj)) { + return obj.map(function (i, _, __) { + return custom(i, md, d + 1) + }).reduce(function (a, b) { return a + b }, '') + } + + var keys = Object.keys(obj) + return keys.map(function (k, _, __) { + return k + ':' + custom(obj[k], md, d + 1) + }).reduce(function (a, b) { return a + b }, '') +} + +function sparseFE2 (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + Object.keys(v).forEach(function (k, _, __) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') return + var to = typeof v[k] + if (to === 'function' || to === 'undefined') return + soFar += k + ':' + ch(v[k], depth + 1) + }) + soFar += '}' + } + ch(obj, 0) + return soFar +} + +function sparseFE (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + Object.keys(v).forEach(function (k, _, __) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') return + var to = typeof v[k] + if (to === 'function' || to === 'undefined') return + soFar += k + ch(v[k], depth + 1) + }) + } + ch(obj, 0) + return soFar +} + +function sparse (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + for (var k in v) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') continue + var to = typeof v[k] + if (to === 'function' || to === 'undefined') continue + soFar += k + ch(v[k], depth + 1) + } + } + ch(obj, 0) + return soFar +} + +function noCommas (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + for (var k in v) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') continue + var to = typeof v[k] + if (to === 'function' || to === 'undefined') continue + soFar += k + ':' + ch(v[k], depth + 1) + } + soFar += '}' + } + ch(obj, 0) + return soFar +} + + +function flatten (obj, maxDepth) { + var seen = [] + var soFar = '' + function ch (v, depth) { + if (depth > maxDepth) return + if (typeof v === 'function' || typeof v === 'undefined') return + if (typeof v !== 'object' || !v) { + soFar += v + return + } + if (seen.indexOf(v) !== -1 || depth === maxDepth) return + seen.push(v) + soFar += '{' + for (var k in v) { + // pseudo-private values. skip those. + if (k.charAt(0) === '_') continue + var to = typeof v[k] + if (to === 'function' || to === 'undefined') continue + soFar += k + ':' + ch(v[k], depth + 1) + soFar += ',' + } + soFar += '}' + } + ch(obj, 0) + return soFar +} + +exports.compare = +{ + // 'custom 2': function () { + // return custom(test, 2, 0) + // }, + // 'customWs 2': function () { + // return customWs(test, 2, 0) + // }, + 'JSON.stringify (guarded)': function () { + var seen = [] + return JSON.stringify(test, function (k, v) { + if (typeof v !== 'object' || !v) return v + if (seen.indexOf(v) !== -1) return undefined + seen.push(v) + return v + }) + }, + + 'flatten 10': function () { + return flatten(test, 10) + }, + + // 'flattenFE 10': function () { + // return flattenFE(test, 10) + // }, + + 'noCommas 10': function () { + return noCommas(test, 10) + }, + + 'sparse 10': function () { + return sparse(test, 10) + }, + + 'sparseFE 10': function () { + return sparseFE(test, 10) + }, + + 'sparseFE2 10': function () { + return sparseFE2(test, 10) + }, + + sigmund: function() { + return sigmund(test, 10) + }, + + + // 'util.inspect 1': function () { + // return util.inspect(test, false, 1, false) + // }, + // 'util.inspect undefined': function () { + // util.inspect(test) + // }, + // 'util.inspect 2': function () { + // util.inspect(test, false, 2, false) + // }, + // 'util.inspect 3': function () { + // util.inspect(test, false, 3, false) + // }, + // 'util.inspect 4': function () { + // util.inspect(test, false, 4, false) + // }, + // 'util.inspect Infinity': function () { + // util.inspect(test, false, Infinity, false) + // } +} + +/** results +**/ diff --git a/node_modules/sigmund/package.json b/node_modules/sigmund/package.json new file mode 100644 index 0000000..d69a8e2 --- /dev/null +++ b/node_modules/sigmund/package.json @@ -0,0 +1,30 @@ +{ + "name": "sigmund", + "version": "1.0.1", + "description": "Quick and dirty signatures for Objects.", + "main": "sigmund.js", + "directories": { + "test": "test" + }, + "dependencies": {}, + "devDependencies": { + "tap": "~0.3.0" + }, + "scripts": { + "test": "tap test/*.js", + "bench": "node bench.js" + }, + "repository": { + "type": "git", + "url": "git://github.com/isaacs/sigmund" + }, + "keywords": [ + "object", + "signature", + "key", + "data", + "psychoanalysis" + ], + "author": "Isaac Z. Schlueter (http://blog.izs.me/)", + "license": "ISC" +} diff --git a/node_modules/sigmund/sigmund.js b/node_modules/sigmund/sigmund.js new file mode 100644 index 0000000..82c7ab8 --- /dev/null +++ b/node_modules/sigmund/sigmund.js @@ -0,0 +1,39 @@ +module.exports = sigmund +function sigmund (subject, maxSessions) { + maxSessions = maxSessions || 10; + var notes = []; + var analysis = ''; + var RE = RegExp; + + function psychoAnalyze (subject, session) { + if (session > maxSessions) return; + + if (typeof subject === 'function' || + typeof subject === 'undefined') { + return; + } + + if (typeof subject !== 'object' || !subject || + (subject instanceof RE)) { + analysis += subject; + return; + } + + if (notes.indexOf(subject) !== -1 || session === maxSessions) return; + + notes.push(subject); + analysis += '{'; + Object.keys(subject).forEach(function (issue, _, __) { + // pseudo-private values. skip those. + if (issue.charAt(0) === '_') return; + var to = typeof subject[issue]; + if (to === 'function' || to === 'undefined') return; + analysis += issue; + psychoAnalyze(subject[issue], session + 1); + }); + } + psychoAnalyze(subject, 0); + return analysis; +} + +// vim: set softtabstop=4 shiftwidth=4: diff --git a/node_modules/sigmund/test/basic.js b/node_modules/sigmund/test/basic.js new file mode 100644 index 0000000..50c53a1 --- /dev/null +++ b/node_modules/sigmund/test/basic.js @@ -0,0 +1,24 @@ +var test = require('tap').test +var sigmund = require('../sigmund.js') + + +// occasionally there are duplicates +// that's an acceptable edge-case. JSON.stringify and util.inspect +// have some collision potential as well, though less, and collision +// detection is expensive. +var hash = '{abc/def/g{0h1i2{jkl' +var obj1 = {a:'b',c:/def/,g:['h','i',{j:'',k:'l'}]} +var obj2 = {a:'b',c:'/def/',g:['h','i','{jkl']} + +var obj3 = JSON.parse(JSON.stringify(obj1)) +obj3.c = /def/ +obj3.g[2].cycle = obj3 +var cycleHash = '{abc/def/g{0h1i2{jklcycle' + +test('basic', function (t) { + t.equal(sigmund(obj1), hash) + t.equal(sigmund(obj2), hash) + t.equal(sigmund(obj3), cycleHash) + t.end() +}) + diff --git a/package.json b/package.json index 21695f0..1f3d7b9 100644 --- a/package.json +++ b/package.json @@ -11,12 +11,13 @@ "test": "make test" }, "devDependencies": { - "mocha": "1.17.1", - "better-assert": "~1.0.0" + "better-assert": "~1.0.0", + "mocha": "1.17.1" }, "author": "Gal Koren", "license": "MIT", "dependencies": { - "better-assert": "~1.0.0" + "better-assert": "~1.0.0", + "expect.js": "^0.3.1" } } diff --git a/test.js b/test.js index 50a361d..be447df 100644 --- a/test.js +++ b/test.js @@ -25,6 +25,9 @@ describe('my suite', function(){ expect(query.query).to.be('foo=bar'); expect(query.path).to.be('/foo/bar'); expect(query.relative).to.be('/foo/bar?foo=bar'); + expect(query.queryKey.foo).to.be('bar'); + expect(query.pathNames[0]).to.be('foo'); + expect(query.pathNames[1]).to.be('bar'); expect(localhost.protocol).to.be(''); expect(localhost.host).to.be('localhost'); expect(localhost.port).to.be('8080'); diff --git a/yarn.lock b/yarn.lock new file mode 100644 index 0000000..f184724 --- /dev/null +++ b/yarn.lock @@ -0,0 +1,101 @@ +# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. +# yarn lockfile v1 + + +better-assert@~1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/better-assert/-/better-assert-1.0.2.tgz#40866b9e1b9e0b55b481894311e68faffaebc522" + dependencies: + callsite "1.0.0" + +callsite@1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/callsite/-/callsite-1.0.0.tgz#280398e5d664bd74038b6f0905153e6e8af1bc20" + +commander@0.6.1: + version "0.6.1" + resolved "https://registry.yarnpkg.com/commander/-/commander-0.6.1.tgz#fa68a14f6a945d54dbbe50d8cdb3320e9e3b1a06" + +commander@2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/commander/-/commander-2.0.0.tgz#d1b86f901f8b64bd941bdeadaf924530393be928" + +debug@*: + version "3.0.1" + resolved "https://registry.yarnpkg.com/debug/-/debug-3.0.1.tgz#0564c612b521dc92d9f2988f0549e34f9c98db64" + dependencies: + ms "2.0.0" + +diff@1.0.7: + version "1.0.7" + resolved "https://registry.yarnpkg.com/diff/-/diff-1.0.7.tgz#24bbb001c4a7d5522169e7cabdb2c2814ed91cf4" + +expect.js@^0.3.1: + version "0.3.1" + resolved "https://registry.yarnpkg.com/expect.js/-/expect.js-0.3.1.tgz#b0a59a0d2eff5437544ebf0ceaa6015841d09b5b" + +glob@3.2.3: + version "3.2.3" + resolved "https://registry.yarnpkg.com/glob/-/glob-3.2.3.tgz#e313eeb249c7affaa5c475286b0e115b59839467" + dependencies: + graceful-fs "~2.0.0" + inherits "2" + minimatch "~0.2.11" + +graceful-fs@~2.0.0: + version "2.0.3" + resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-2.0.3.tgz#7cd2cdb228a4a3f36e95efa6cc142de7d1a136d0" + +growl@1.7.x: + version "1.7.0" + resolved "https://registry.yarnpkg.com/growl/-/growl-1.7.0.tgz#de2d66136d002e112ba70f3f10c31cf7c350b2da" + +inherits@2: + version "2.0.3" + resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de" + +jade@0.26.3: + version "0.26.3" + resolved "https://registry.yarnpkg.com/jade/-/jade-0.26.3.tgz#8f10d7977d8d79f2f6ff862a81b0513ccb25686c" + dependencies: + commander "0.6.1" + mkdirp "0.3.0" + +lru-cache@2: + version "2.7.3" + resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-2.7.3.tgz#6d4524e8b955f95d4f5b58851ce21dd72fb4e952" + +minimatch@~0.2.11: + version "0.2.14" + resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-0.2.14.tgz#c74e780574f63c6f9a090e90efbe6ef53a6a756a" + dependencies: + lru-cache "2" + sigmund "~1.0.0" + +mkdirp@0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.0.tgz#1bbf5ab1ba827af23575143490426455f481fe1e" + +mkdirp@0.3.5: + version "0.3.5" + resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.5.tgz#de3e5f8961c88c787ee1368df849ac4413eca8d7" + +mocha@1.17.1: + version "1.17.1" + resolved "https://registry.yarnpkg.com/mocha/-/mocha-1.17.1.tgz#7f7671d68526d074b7bae660c9099f87e0ea1ccb" + dependencies: + commander "2.0.0" + debug "*" + diff "1.0.7" + glob "3.2.3" + growl "1.7.x" + jade "0.26.3" + mkdirp "0.3.5" + +ms@2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" + +sigmund@~1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/sigmund/-/sigmund-1.0.1.tgz#3ff21f198cad2175f9f3b781853fd94d0d19b590" From 65d4d521f3a8e281ca23355638b738c1a5d7447e Mon Sep 17 00:00:00 2001 From: Francisco Madeira Date: Wed, 20 Sep 2017 12:29:56 +0100 Subject: [PATCH 2/6] remove node_modules folder --- node_modules/.bin/_mocha | 1 - node_modules/.bin/jade | 1 - node_modules/.bin/mocha | 1 - node_modules/.yarn-integrity | 35 - node_modules/better-assert/.npmignore | 4 - node_modules/better-assert/History.md | 15 - node_modules/better-assert/Makefile | 5 - node_modules/better-assert/Readme.md | 61 - node_modules/better-assert/example.js | 10 - node_modules/better-assert/index.js | 38 - node_modules/better-assert/package.json | 27 - node_modules/callsite/.npmignore | 4 - node_modules/callsite/History.md | 10 - node_modules/callsite/Makefile | 6 - node_modules/callsite/Readme.md | 44 - node_modules/callsite/index.js | 10 - node_modules/callsite/package.json | 11 - node_modules/commander/History.md | 179 - node_modules/commander/Readme.md | 195 - node_modules/commander/index.js | 847 --- node_modules/commander/package.json | 12 - node_modules/debug/.coveralls.yml | 1 - node_modules/debug/.eslintrc | 14 - node_modules/debug/.npmignore | 9 - node_modules/debug/.travis.yml | 20 - node_modules/debug/CHANGELOG.md | 378 -- node_modules/debug/LICENSE | 19 - node_modules/debug/Makefile | 58 - node_modules/debug/README.md | 367 -- node_modules/debug/component.json | 19 - node_modules/debug/karma.conf.js | 70 - node_modules/debug/node.js | 1 - node_modules/debug/package.json | 49 - node_modules/debug/src/browser.js | 195 - node_modules/debug/src/debug.js | 225 - node_modules/debug/src/index.js | 10 - node_modules/debug/src/node.js | 177 - node_modules/diff/README.md | 101 - node_modules/diff/diff.js | 354 - node_modules/diff/package.json | 42 - node_modules/expect.js/.npmignore | 3 - node_modules/expect.js/History.md | 54 - node_modules/expect.js/README.md | 263 - node_modules/expect.js/index.js | 1284 ---- node_modules/expect.js/package.json | 13 - node_modules/glob/.npmignore | 2 - node_modules/glob/.travis.yml | 3 - node_modules/glob/LICENSE | 27 - node_modules/glob/README.md | 250 - node_modules/glob/examples/g.js | 9 - node_modules/glob/examples/usr-local.js | 9 - node_modules/glob/glob.js | 675 -- node_modules/glob/package.json | 28 - node_modules/glob/test/00-setup.js | 176 - node_modules/glob/test/bash-comparison.js | 63 - node_modules/glob/test/bash-results.json | 350 - node_modules/glob/test/cwd-test.js | 55 - node_modules/glob/test/globstar-match.js | 19 - node_modules/glob/test/mark.js | 74 - node_modules/glob/test/nocase-nomagic.js | 113 - node_modules/glob/test/pause-resume.js | 73 - node_modules/glob/test/root-nomount.js | 39 - node_modules/glob/test/root.js | 46 - node_modules/glob/test/stat.js | 32 - node_modules/glob/test/zz-cleanup.js | 11 - node_modules/graceful-fs/.npmignore | 1 - node_modules/graceful-fs/LICENSE | 27 - node_modules/graceful-fs/README.md | 26 - node_modules/graceful-fs/graceful-fs.js | 160 - node_modules/graceful-fs/package.json | 37 - node_modules/graceful-fs/polyfills.js | 228 - node_modules/graceful-fs/test/open.js | 39 - node_modules/graceful-fs/test/readdir-sort.js | 21 - node_modules/growl/History.md | 63 - node_modules/growl/Readme.md | 99 - node_modules/growl/lib/growl.js | 234 - node_modules/growl/package.json | 7 - node_modules/growl/test.js | 20 - node_modules/inherits/LICENSE | 16 - node_modules/inherits/README.md | 42 - node_modules/inherits/inherits.js | 7 - node_modules/inherits/inherits_browser.js | 23 - node_modules/inherits/package.json | 29 - node_modules/jade/.npmignore | 15 - node_modules/jade/LICENSE | 22 - node_modules/jade/bin/jade | 147 - node_modules/jade/index.js | 4 - node_modules/jade/jade.js | 3586 ---------- node_modules/jade/jade.md | 510 -- node_modules/jade/jade.min.js | 2 - node_modules/jade/lib/compiler.js | 642 -- node_modules/jade/lib/doctypes.js | 18 - node_modules/jade/lib/filters.js | 97 - node_modules/jade/lib/inline-tags.js | 28 - node_modules/jade/lib/jade.js | 237 - node_modules/jade/lib/lexer.js | 771 --- node_modules/jade/lib/nodes/attrs.js | 77 - node_modules/jade/lib/nodes/block-comment.js | 33 - node_modules/jade/lib/nodes/block.js | 121 - node_modules/jade/lib/nodes/case.js | 43 - node_modules/jade/lib/nodes/code.js | 35 - node_modules/jade/lib/nodes/comment.js | 32 - node_modules/jade/lib/nodes/doctype.js | 29 - node_modules/jade/lib/nodes/each.js | 35 - node_modules/jade/lib/nodes/filter.js | 35 - node_modules/jade/lib/nodes/index.js | 20 - node_modules/jade/lib/nodes/literal.js | 32 - node_modules/jade/lib/nodes/mixin.js | 36 - node_modules/jade/lib/nodes/node.js | 25 - node_modules/jade/lib/nodes/tag.js | 95 - node_modules/jade/lib/nodes/text.js | 36 - node_modules/jade/lib/parser.js | 710 -- node_modules/jade/lib/runtime.js | 174 - node_modules/jade/lib/self-closing.js | 19 - node_modules/jade/lib/utils.js | 49 - .../jade/node_modules/commander/.npmignore | 4 - .../jade/node_modules/commander/.travis.yml | 4 - .../jade/node_modules/commander/History.md | 107 - .../jade/node_modules/commander/Makefile | 7 - .../jade/node_modules/commander/Readme.md | 262 - .../jade/node_modules/commander/index.js | 2 - .../node_modules/commander/lib/commander.js | 1026 --- .../jade/node_modules/commander/package.json | 13 - .../jade/node_modules/mkdirp/.gitignore | 2 - .../jade/node_modules/mkdirp/.gitignore.orig | 2 - .../jade/node_modules/mkdirp/.gitignore.rej | 5 - node_modules/jade/node_modules/mkdirp/LICENSE | 21 - .../jade/node_modules/mkdirp/README.markdown | 54 - .../jade/node_modules/mkdirp/examples/pow.js | 6 - .../node_modules/mkdirp/examples/pow.js.orig | 6 - .../node_modules/mkdirp/examples/pow.js.rej | 19 - .../jade/node_modules/mkdirp/index.js | 79 - .../jade/node_modules/mkdirp/package.json | 23 - .../jade/node_modules/mkdirp/test/chmod.js | 38 - .../jade/node_modules/mkdirp/test/clobber.js | 37 - .../jade/node_modules/mkdirp/test/mkdirp.js | 28 - .../jade/node_modules/mkdirp/test/perm.js | 32 - .../node_modules/mkdirp/test/perm_sync.js | 39 - .../jade/node_modules/mkdirp/test/race.js | 41 - .../jade/node_modules/mkdirp/test/rel.js | 32 - .../jade/node_modules/mkdirp/test/sync.js | 27 - .../jade/node_modules/mkdirp/test/umask.js | 28 - .../node_modules/mkdirp/test/umask_sync.js | 27 - node_modules/jade/package.json | 29 - node_modules/jade/runtime.js | 179 - node_modules/jade/runtime.min.js | 1 - node_modules/jade/test.jade | 7 - node_modules/jade/testing/head.jade | 5 - node_modules/jade/testing/index.jade | 22 - node_modules/jade/testing/index.js | 11 - node_modules/jade/testing/layout.jade | 6 - node_modules/jade/testing/user.jade | 7 - node_modules/jade/testing/user.js | 27 - node_modules/lru-cache/.npmignore | 1 - node_modules/lru-cache/.travis.yml | 8 - node_modules/lru-cache/CONTRIBUTORS | 14 - node_modules/lru-cache/LICENSE | 15 - node_modules/lru-cache/README.md | 137 - node_modules/lru-cache/lib/lru-cache.js | 334 - node_modules/lru-cache/package.json | 21 - node_modules/lru-cache/test/basic.js | 396 -- node_modules/lru-cache/test/foreach.js | 120 - node_modules/lru-cache/test/memory-leak.js | 51 - node_modules/lru-cache/test/serialize.js | 216 - node_modules/minimatch/.npmignore | 1 - node_modules/minimatch/LICENSE | 23 - node_modules/minimatch/README.md | 218 - node_modules/minimatch/minimatch.js | 1055 --- node_modules/minimatch/package.json | 28 - node_modules/minimatch/test/basic.js | 399 -- node_modules/minimatch/test/brace-expand.js | 33 - node_modules/minimatch/test/caching.js | 14 - node_modules/minimatch/test/defaults.js | 274 - .../test/extglob-ending-with-state-char.js | 8 - node_modules/mkdirp/.npmignore | 2 - node_modules/mkdirp/.travis.yml | 5 - node_modules/mkdirp/LICENSE | 21 - node_modules/mkdirp/examples/pow.js | 6 - node_modules/mkdirp/index.js | 82 - node_modules/mkdirp/package.json | 22 - node_modules/mkdirp/readme.markdown | 63 - node_modules/mkdirp/test/chmod.js | 38 - node_modules/mkdirp/test/clobber.js | 37 - node_modules/mkdirp/test/mkdirp.js | 28 - node_modules/mkdirp/test/perm.js | 32 - node_modules/mkdirp/test/perm_sync.js | 39 - node_modules/mkdirp/test/race.js | 41 - node_modules/mkdirp/test/rel.js | 32 - node_modules/mkdirp/test/return.js | 25 - node_modules/mkdirp/test/return_sync.js | 24 - node_modules/mkdirp/test/root.js | 18 - node_modules/mkdirp/test/sync.js | 32 - node_modules/mkdirp/test/umask.js | 28 - node_modules/mkdirp/test/umask_sync.js | 32 - node_modules/mocha/Readme.md | 172 - node_modules/mocha/bin/_mocha | 467 -- node_modules/mocha/bin/mocha | 51 - node_modules/mocha/images/error.png | Bin 412 -> 0 bytes node_modules/mocha/images/ok.png | Bin 388 -> 0 bytes node_modules/mocha/index.js | 4 - node_modules/mocha/lib/browser/debug.js | 5 - node_modules/mocha/lib/browser/diff.js | 354 - node_modules/mocha/lib/browser/events.js | 178 - node_modules/mocha/lib/browser/fs.js | 0 node_modules/mocha/lib/browser/path.js | 0 node_modules/mocha/lib/browser/progress.js | 125 - node_modules/mocha/lib/browser/tty.js | 13 - node_modules/mocha/lib/context.js | 69 - node_modules/mocha/lib/hook.js | 49 - node_modules/mocha/lib/interfaces/bdd.js | 137 - node_modules/mocha/lib/interfaces/exports.js | 60 - node_modules/mocha/lib/interfaces/index.js | 5 - node_modules/mocha/lib/interfaces/qunit.js | 122 - node_modules/mocha/lib/interfaces/tdd.js | 138 - node_modules/mocha/lib/mocha.js | 369 -- node_modules/mocha/lib/ms.js | 109 - node_modules/mocha/lib/reporters/base.js | 507 -- node_modules/mocha/lib/reporters/doc.js | 56 - node_modules/mocha/lib/reporters/dot.js | 62 - node_modules/mocha/lib/reporters/html-cov.js | 51 - node_modules/mocha/lib/reporters/html.js | 274 - node_modules/mocha/lib/reporters/index.js | 18 - node_modules/mocha/lib/reporters/json-cov.js | 153 - .../mocha/lib/reporters/json-stream.js | 61 - node_modules/mocha/lib/reporters/json.js | 70 - node_modules/mocha/lib/reporters/landing.js | 97 - node_modules/mocha/lib/reporters/list.js | 64 - node_modules/mocha/lib/reporters/markdown.js | 91 - node_modules/mocha/lib/reporters/min.js | 38 - node_modules/mocha/lib/reporters/nyan.js | 260 - node_modules/mocha/lib/reporters/progress.js | 86 - node_modules/mocha/lib/reporters/spec.js | 83 - node_modules/mocha/lib/reporters/tap.js | 73 - .../lib/reporters/templates/coverage.jade | 50 - .../mocha/lib/reporters/templates/menu.jade | 13 - .../mocha/lib/reporters/templates/script.html | 34 - .../mocha/lib/reporters/templates/style.html | 320 - node_modules/mocha/lib/reporters/xunit.js | 119 - node_modules/mocha/lib/runnable.js | 227 - node_modules/mocha/lib/runner.js | 661 -- node_modules/mocha/lib/suite.js | 296 - node_modules/mocha/lib/template.html | 18 - node_modules/mocha/lib/test.js | 32 - node_modules/mocha/lib/utils.js | 299 - node_modules/mocha/mocha.css | 270 - node_modules/mocha/mocha.js | 5812 ----------------- node_modules/mocha/node_modules/.bin/jade | 1 - node_modules/mocha/package.json | 49 - node_modules/ms/index.js | 152 - node_modules/ms/license.md | 21 - node_modules/ms/package.json | 37 - node_modules/ms/readme.md | 51 - node_modules/sigmund/LICENSE | 15 - node_modules/sigmund/README.md | 53 - node_modules/sigmund/bench.js | 283 - node_modules/sigmund/package.json | 30 - node_modules/sigmund/sigmund.js | 39 - node_modules/sigmund/test/basic.js | 24 - 258 files changed, 35705 deletions(-) delete mode 120000 node_modules/.bin/_mocha delete mode 120000 node_modules/.bin/jade delete mode 120000 node_modules/.bin/mocha delete mode 100644 node_modules/.yarn-integrity delete mode 100644 node_modules/better-assert/.npmignore delete mode 100644 node_modules/better-assert/History.md delete mode 100644 node_modules/better-assert/Makefile delete mode 100644 node_modules/better-assert/Readme.md delete mode 100644 node_modules/better-assert/example.js delete mode 100644 node_modules/better-assert/index.js delete mode 100644 node_modules/better-assert/package.json delete mode 100644 node_modules/callsite/.npmignore delete mode 100644 node_modules/callsite/History.md delete mode 100644 node_modules/callsite/Makefile delete mode 100644 node_modules/callsite/Readme.md delete mode 100644 node_modules/callsite/index.js delete mode 100644 node_modules/callsite/package.json delete mode 100644 node_modules/commander/History.md delete mode 100644 node_modules/commander/Readme.md delete mode 100644 node_modules/commander/index.js delete mode 100644 node_modules/commander/package.json delete mode 100644 node_modules/debug/.coveralls.yml delete mode 100644 node_modules/debug/.eslintrc delete mode 100644 node_modules/debug/.npmignore delete mode 100644 node_modules/debug/.travis.yml delete mode 100644 node_modules/debug/CHANGELOG.md delete mode 100644 node_modules/debug/LICENSE delete mode 100644 node_modules/debug/Makefile delete mode 100644 node_modules/debug/README.md delete mode 100644 node_modules/debug/component.json delete mode 100644 node_modules/debug/karma.conf.js delete mode 100644 node_modules/debug/node.js delete mode 100644 node_modules/debug/package.json delete mode 100644 node_modules/debug/src/browser.js delete mode 100644 node_modules/debug/src/debug.js delete mode 100644 node_modules/debug/src/index.js delete mode 100644 node_modules/debug/src/node.js delete mode 100644 node_modules/diff/README.md delete mode 100644 node_modules/diff/diff.js delete mode 100644 node_modules/diff/package.json delete mode 100644 node_modules/expect.js/.npmignore delete mode 100644 node_modules/expect.js/History.md delete mode 100644 node_modules/expect.js/README.md delete mode 100644 node_modules/expect.js/index.js delete mode 100644 node_modules/expect.js/package.json delete mode 100644 node_modules/glob/.npmignore delete mode 100644 node_modules/glob/.travis.yml delete mode 100644 node_modules/glob/LICENSE delete mode 100644 node_modules/glob/README.md delete mode 100644 node_modules/glob/examples/g.js delete mode 100644 node_modules/glob/examples/usr-local.js delete mode 100644 node_modules/glob/glob.js delete mode 100644 node_modules/glob/package.json delete mode 100644 node_modules/glob/test/00-setup.js delete mode 100644 node_modules/glob/test/bash-comparison.js delete mode 100644 node_modules/glob/test/bash-results.json delete mode 100644 node_modules/glob/test/cwd-test.js delete mode 100644 node_modules/glob/test/globstar-match.js delete mode 100644 node_modules/glob/test/mark.js delete mode 100644 node_modules/glob/test/nocase-nomagic.js delete mode 100644 node_modules/glob/test/pause-resume.js delete mode 100644 node_modules/glob/test/root-nomount.js delete mode 100644 node_modules/glob/test/root.js delete mode 100644 node_modules/glob/test/stat.js delete mode 100644 node_modules/glob/test/zz-cleanup.js delete mode 100644 node_modules/graceful-fs/.npmignore delete mode 100644 node_modules/graceful-fs/LICENSE delete mode 100644 node_modules/graceful-fs/README.md delete mode 100644 node_modules/graceful-fs/graceful-fs.js delete mode 100644 node_modules/graceful-fs/package.json delete mode 100644 node_modules/graceful-fs/polyfills.js delete mode 100644 node_modules/graceful-fs/test/open.js delete mode 100644 node_modules/graceful-fs/test/readdir-sort.js delete mode 100644 node_modules/growl/History.md delete mode 100644 node_modules/growl/Readme.md delete mode 100644 node_modules/growl/lib/growl.js delete mode 100644 node_modules/growl/package.json delete mode 100644 node_modules/growl/test.js delete mode 100644 node_modules/inherits/LICENSE delete mode 100644 node_modules/inherits/README.md delete mode 100644 node_modules/inherits/inherits.js delete mode 100644 node_modules/inherits/inherits_browser.js delete mode 100644 node_modules/inherits/package.json delete mode 100644 node_modules/jade/.npmignore delete mode 100644 node_modules/jade/LICENSE delete mode 100755 node_modules/jade/bin/jade delete mode 100644 node_modules/jade/index.js delete mode 100644 node_modules/jade/jade.js delete mode 100644 node_modules/jade/jade.md delete mode 100644 node_modules/jade/jade.min.js delete mode 100644 node_modules/jade/lib/compiler.js delete mode 100644 node_modules/jade/lib/doctypes.js delete mode 100644 node_modules/jade/lib/filters.js delete mode 100644 node_modules/jade/lib/inline-tags.js delete mode 100644 node_modules/jade/lib/jade.js delete mode 100644 node_modules/jade/lib/lexer.js delete mode 100644 node_modules/jade/lib/nodes/attrs.js delete mode 100644 node_modules/jade/lib/nodes/block-comment.js delete mode 100644 node_modules/jade/lib/nodes/block.js delete mode 100644 node_modules/jade/lib/nodes/case.js delete mode 100644 node_modules/jade/lib/nodes/code.js delete mode 100644 node_modules/jade/lib/nodes/comment.js delete mode 100644 node_modules/jade/lib/nodes/doctype.js delete mode 100644 node_modules/jade/lib/nodes/each.js delete mode 100644 node_modules/jade/lib/nodes/filter.js delete mode 100644 node_modules/jade/lib/nodes/index.js delete mode 100644 node_modules/jade/lib/nodes/literal.js delete mode 100644 node_modules/jade/lib/nodes/mixin.js delete mode 100644 node_modules/jade/lib/nodes/node.js delete mode 100644 node_modules/jade/lib/nodes/tag.js delete mode 100644 node_modules/jade/lib/nodes/text.js delete mode 100644 node_modules/jade/lib/parser.js delete mode 100644 node_modules/jade/lib/runtime.js delete mode 100644 node_modules/jade/lib/self-closing.js delete mode 100644 node_modules/jade/lib/utils.js delete mode 100644 node_modules/jade/node_modules/commander/.npmignore delete mode 100644 node_modules/jade/node_modules/commander/.travis.yml delete mode 100644 node_modules/jade/node_modules/commander/History.md delete mode 100644 node_modules/jade/node_modules/commander/Makefile delete mode 100644 node_modules/jade/node_modules/commander/Readme.md delete mode 100644 node_modules/jade/node_modules/commander/index.js delete mode 100644 node_modules/jade/node_modules/commander/lib/commander.js delete mode 100644 node_modules/jade/node_modules/commander/package.json delete mode 100644 node_modules/jade/node_modules/mkdirp/.gitignore delete mode 100644 node_modules/jade/node_modules/mkdirp/.gitignore.orig delete mode 100644 node_modules/jade/node_modules/mkdirp/.gitignore.rej delete mode 100644 node_modules/jade/node_modules/mkdirp/LICENSE delete mode 100644 node_modules/jade/node_modules/mkdirp/README.markdown delete mode 100644 node_modules/jade/node_modules/mkdirp/examples/pow.js delete mode 100644 node_modules/jade/node_modules/mkdirp/examples/pow.js.orig delete mode 100644 node_modules/jade/node_modules/mkdirp/examples/pow.js.rej delete mode 100644 node_modules/jade/node_modules/mkdirp/index.js delete mode 100644 node_modules/jade/node_modules/mkdirp/package.json delete mode 100644 node_modules/jade/node_modules/mkdirp/test/chmod.js delete mode 100644 node_modules/jade/node_modules/mkdirp/test/clobber.js delete mode 100644 node_modules/jade/node_modules/mkdirp/test/mkdirp.js delete mode 100644 node_modules/jade/node_modules/mkdirp/test/perm.js delete mode 100644 node_modules/jade/node_modules/mkdirp/test/perm_sync.js delete mode 100644 node_modules/jade/node_modules/mkdirp/test/race.js delete mode 100644 node_modules/jade/node_modules/mkdirp/test/rel.js delete mode 100644 node_modules/jade/node_modules/mkdirp/test/sync.js delete mode 100644 node_modules/jade/node_modules/mkdirp/test/umask.js delete mode 100644 node_modules/jade/node_modules/mkdirp/test/umask_sync.js delete mode 100644 node_modules/jade/package.json delete mode 100644 node_modules/jade/runtime.js delete mode 100644 node_modules/jade/runtime.min.js delete mode 100644 node_modules/jade/test.jade delete mode 100644 node_modules/jade/testing/head.jade delete mode 100644 node_modules/jade/testing/index.jade delete mode 100644 node_modules/jade/testing/index.js delete mode 100644 node_modules/jade/testing/layout.jade delete mode 100644 node_modules/jade/testing/user.jade delete mode 100644 node_modules/jade/testing/user.js delete mode 100644 node_modules/lru-cache/.npmignore delete mode 100644 node_modules/lru-cache/.travis.yml delete mode 100644 node_modules/lru-cache/CONTRIBUTORS delete mode 100644 node_modules/lru-cache/LICENSE delete mode 100644 node_modules/lru-cache/README.md delete mode 100644 node_modules/lru-cache/lib/lru-cache.js delete mode 100644 node_modules/lru-cache/package.json delete mode 100644 node_modules/lru-cache/test/basic.js delete mode 100644 node_modules/lru-cache/test/foreach.js delete mode 100644 node_modules/lru-cache/test/memory-leak.js delete mode 100644 node_modules/lru-cache/test/serialize.js delete mode 100644 node_modules/minimatch/.npmignore delete mode 100644 node_modules/minimatch/LICENSE delete mode 100644 node_modules/minimatch/README.md delete mode 100644 node_modules/minimatch/minimatch.js delete mode 100644 node_modules/minimatch/package.json delete mode 100644 node_modules/minimatch/test/basic.js delete mode 100644 node_modules/minimatch/test/brace-expand.js delete mode 100644 node_modules/minimatch/test/caching.js delete mode 100644 node_modules/minimatch/test/defaults.js delete mode 100644 node_modules/minimatch/test/extglob-ending-with-state-char.js delete mode 100644 node_modules/mkdirp/.npmignore delete mode 100644 node_modules/mkdirp/.travis.yml delete mode 100644 node_modules/mkdirp/LICENSE delete mode 100644 node_modules/mkdirp/examples/pow.js delete mode 100644 node_modules/mkdirp/index.js delete mode 100644 node_modules/mkdirp/package.json delete mode 100644 node_modules/mkdirp/readme.markdown delete mode 100644 node_modules/mkdirp/test/chmod.js delete mode 100644 node_modules/mkdirp/test/clobber.js delete mode 100644 node_modules/mkdirp/test/mkdirp.js delete mode 100644 node_modules/mkdirp/test/perm.js delete mode 100644 node_modules/mkdirp/test/perm_sync.js delete mode 100644 node_modules/mkdirp/test/race.js delete mode 100644 node_modules/mkdirp/test/rel.js delete mode 100644 node_modules/mkdirp/test/return.js delete mode 100644 node_modules/mkdirp/test/return_sync.js delete mode 100644 node_modules/mkdirp/test/root.js delete mode 100644 node_modules/mkdirp/test/sync.js delete mode 100644 node_modules/mkdirp/test/umask.js delete mode 100644 node_modules/mkdirp/test/umask_sync.js delete mode 100644 node_modules/mocha/Readme.md delete mode 100755 node_modules/mocha/bin/_mocha delete mode 100755 node_modules/mocha/bin/mocha delete mode 100644 node_modules/mocha/images/error.png delete mode 100644 node_modules/mocha/images/ok.png delete mode 100644 node_modules/mocha/index.js delete mode 100644 node_modules/mocha/lib/browser/debug.js delete mode 100644 node_modules/mocha/lib/browser/diff.js delete mode 100644 node_modules/mocha/lib/browser/events.js delete mode 100644 node_modules/mocha/lib/browser/fs.js delete mode 100644 node_modules/mocha/lib/browser/path.js delete mode 100644 node_modules/mocha/lib/browser/progress.js delete mode 100644 node_modules/mocha/lib/browser/tty.js delete mode 100644 node_modules/mocha/lib/context.js delete mode 100644 node_modules/mocha/lib/hook.js delete mode 100644 node_modules/mocha/lib/interfaces/bdd.js delete mode 100644 node_modules/mocha/lib/interfaces/exports.js delete mode 100644 node_modules/mocha/lib/interfaces/index.js delete mode 100644 node_modules/mocha/lib/interfaces/qunit.js delete mode 100644 node_modules/mocha/lib/interfaces/tdd.js delete mode 100644 node_modules/mocha/lib/mocha.js delete mode 100644 node_modules/mocha/lib/ms.js delete mode 100644 node_modules/mocha/lib/reporters/base.js delete mode 100644 node_modules/mocha/lib/reporters/doc.js delete mode 100644 node_modules/mocha/lib/reporters/dot.js delete mode 100644 node_modules/mocha/lib/reporters/html-cov.js delete mode 100644 node_modules/mocha/lib/reporters/html.js delete mode 100644 node_modules/mocha/lib/reporters/index.js delete mode 100644 node_modules/mocha/lib/reporters/json-cov.js delete mode 100644 node_modules/mocha/lib/reporters/json-stream.js delete mode 100644 node_modules/mocha/lib/reporters/json.js delete mode 100644 node_modules/mocha/lib/reporters/landing.js delete mode 100644 node_modules/mocha/lib/reporters/list.js delete mode 100644 node_modules/mocha/lib/reporters/markdown.js delete mode 100644 node_modules/mocha/lib/reporters/min.js delete mode 100644 node_modules/mocha/lib/reporters/nyan.js delete mode 100644 node_modules/mocha/lib/reporters/progress.js delete mode 100644 node_modules/mocha/lib/reporters/spec.js delete mode 100644 node_modules/mocha/lib/reporters/tap.js delete mode 100644 node_modules/mocha/lib/reporters/templates/coverage.jade delete mode 100644 node_modules/mocha/lib/reporters/templates/menu.jade delete mode 100644 node_modules/mocha/lib/reporters/templates/script.html delete mode 100644 node_modules/mocha/lib/reporters/templates/style.html delete mode 100644 node_modules/mocha/lib/reporters/xunit.js delete mode 100644 node_modules/mocha/lib/runnable.js delete mode 100644 node_modules/mocha/lib/runner.js delete mode 100644 node_modules/mocha/lib/suite.js delete mode 100644 node_modules/mocha/lib/template.html delete mode 100644 node_modules/mocha/lib/test.js delete mode 100644 node_modules/mocha/lib/utils.js delete mode 100644 node_modules/mocha/mocha.css delete mode 100644 node_modules/mocha/mocha.js delete mode 120000 node_modules/mocha/node_modules/.bin/jade delete mode 100644 node_modules/mocha/package.json delete mode 100644 node_modules/ms/index.js delete mode 100644 node_modules/ms/license.md delete mode 100644 node_modules/ms/package.json delete mode 100644 node_modules/ms/readme.md delete mode 100644 node_modules/sigmund/LICENSE delete mode 100644 node_modules/sigmund/README.md delete mode 100644 node_modules/sigmund/bench.js delete mode 100644 node_modules/sigmund/package.json delete mode 100644 node_modules/sigmund/sigmund.js delete mode 100644 node_modules/sigmund/test/basic.js diff --git a/node_modules/.bin/_mocha b/node_modules/.bin/_mocha deleted file mode 120000 index f2a54ff..0000000 --- a/node_modules/.bin/_mocha +++ /dev/null @@ -1 +0,0 @@ -../mocha/bin/_mocha \ No newline at end of file diff --git a/node_modules/.bin/jade b/node_modules/.bin/jade deleted file mode 120000 index 571fae7..0000000 --- a/node_modules/.bin/jade +++ /dev/null @@ -1 +0,0 @@ -../jade/bin/jade \ No newline at end of file diff --git a/node_modules/.bin/mocha b/node_modules/.bin/mocha deleted file mode 120000 index 43c668d..0000000 --- a/node_modules/.bin/mocha +++ /dev/null @@ -1 +0,0 @@ -../mocha/bin/mocha \ No newline at end of file diff --git a/node_modules/.yarn-integrity b/node_modules/.yarn-integrity deleted file mode 100644 index 643563d..0000000 --- a/node_modules/.yarn-integrity +++ /dev/null @@ -1,35 +0,0 @@ -{ - "modulesFolders": [ - "node_modules" - ], - "flags": [], - "linkedModules": [], - "topLevelPatterns": [ - "better-assert@~1.0.0", - "expect.js@^0.3.1", - "mocha@1.17.1" - ], - "lockfileEntries": { - "better-assert@~1.0.0": "https://registry.yarnpkg.com/better-assert/-/better-assert-1.0.2.tgz#40866b9e1b9e0b55b481894311e68faffaebc522", - "callsite@1.0.0": "https://registry.yarnpkg.com/callsite/-/callsite-1.0.0.tgz#280398e5d664bd74038b6f0905153e6e8af1bc20", - "commander@0.6.1": "https://registry.yarnpkg.com/commander/-/commander-0.6.1.tgz#fa68a14f6a945d54dbbe50d8cdb3320e9e3b1a06", - "commander@2.0.0": "https://registry.yarnpkg.com/commander/-/commander-2.0.0.tgz#d1b86f901f8b64bd941bdeadaf924530393be928", - "debug@*": "https://registry.yarnpkg.com/debug/-/debug-3.0.1.tgz#0564c612b521dc92d9f2988f0549e34f9c98db64", - "diff@1.0.7": "https://registry.yarnpkg.com/diff/-/diff-1.0.7.tgz#24bbb001c4a7d5522169e7cabdb2c2814ed91cf4", - "expect.js@^0.3.1": "https://registry.yarnpkg.com/expect.js/-/expect.js-0.3.1.tgz#b0a59a0d2eff5437544ebf0ceaa6015841d09b5b", - "glob@3.2.3": "https://registry.yarnpkg.com/glob/-/glob-3.2.3.tgz#e313eeb249c7affaa5c475286b0e115b59839467", - "graceful-fs@~2.0.0": "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-2.0.3.tgz#7cd2cdb228a4a3f36e95efa6cc142de7d1a136d0", - "growl@1.7.x": "https://registry.yarnpkg.com/growl/-/growl-1.7.0.tgz#de2d66136d002e112ba70f3f10c31cf7c350b2da", - "inherits@2": "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de", - "jade@0.26.3": "https://registry.yarnpkg.com/jade/-/jade-0.26.3.tgz#8f10d7977d8d79f2f6ff862a81b0513ccb25686c", - "lru-cache@2": "https://registry.yarnpkg.com/lru-cache/-/lru-cache-2.7.3.tgz#6d4524e8b955f95d4f5b58851ce21dd72fb4e952", - "minimatch@~0.2.11": "https://registry.yarnpkg.com/minimatch/-/minimatch-0.2.14.tgz#c74e780574f63c6f9a090e90efbe6ef53a6a756a", - "mkdirp@0.3.0": "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.0.tgz#1bbf5ab1ba827af23575143490426455f481fe1e", - "mkdirp@0.3.5": "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.5.tgz#de3e5f8961c88c787ee1368df849ac4413eca8d7", - "mocha@1.17.1": "https://registry.yarnpkg.com/mocha/-/mocha-1.17.1.tgz#7f7671d68526d074b7bae660c9099f87e0ea1ccb", - "ms@2.0.0": "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8", - "sigmund@~1.0.0": "https://registry.yarnpkg.com/sigmund/-/sigmund-1.0.1.tgz#3ff21f198cad2175f9f3b781853fd94d0d19b590" - }, - "files": [], - "artifacts": {} -} \ No newline at end of file diff --git a/node_modules/better-assert/.npmignore b/node_modules/better-assert/.npmignore deleted file mode 100644 index f1250e5..0000000 --- a/node_modules/better-assert/.npmignore +++ /dev/null @@ -1,4 +0,0 @@ -support -test -examples -*.sock diff --git a/node_modules/better-assert/History.md b/node_modules/better-assert/History.md deleted file mode 100644 index cbb579b..0000000 --- a/node_modules/better-assert/History.md +++ /dev/null @@ -1,15 +0,0 @@ - -1.0.0 / 2013-02-03 -================== - - * Stop using the removed magic __stack global getter - -0.1.0 / 2012-10-04 -================== - - * add throwing of AssertionError for test frameworks etc - -0.0.1 / 2010-01-03 -================== - - * Initial release diff --git a/node_modules/better-assert/Makefile b/node_modules/better-assert/Makefile deleted file mode 100644 index 36a3ed7..0000000 --- a/node_modules/better-assert/Makefile +++ /dev/null @@ -1,5 +0,0 @@ - -test: - @echo "populate me" - -.PHONY: test \ No newline at end of file diff --git a/node_modules/better-assert/Readme.md b/node_modules/better-assert/Readme.md deleted file mode 100644 index d8d3a63..0000000 --- a/node_modules/better-assert/Readme.md +++ /dev/null @@ -1,61 +0,0 @@ - -# better-assert - - Better c-style assertions using [callsite](https://github.com/visionmedia/callsite) for - self-documenting failure messages. - -## Installation - - $ npm install better-assert - -## Example - - By default assertions are enabled, however the __NO_ASSERT__ environment variable - will deactivate them when truthy. - -```js -var assert = require('better-assert'); - -test(); - -function test() { - var user = { name: 'tobi' }; - assert('tobi' == user.name); - assert('number' == typeof user.age); -} - -AssertionError: 'number' == typeof user.age - at test (/Users/tj/projects/better-assert/example.js:9:3) - at Object. (/Users/tj/projects/better-assert/example.js:4:1) - at Module._compile (module.js:449:26) - at Object.Module._extensions..js (module.js:467:10) - at Module.load (module.js:356:32) - at Function.Module._load (module.js:312:12) - at Module.runMain (module.js:492:10) - at process.startup.processNextTick.process._tickCallback (node.js:244:9) -``` - -## License - -(The MIT License) - -Copyright (c) 2012 TJ Holowaychuk <tj@vision-media.ca> - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/better-assert/example.js b/node_modules/better-assert/example.js deleted file mode 100644 index 688c29e..0000000 --- a/node_modules/better-assert/example.js +++ /dev/null @@ -1,10 +0,0 @@ - -var assert = require('./'); - -test(); - -function test() { - var user = { name: 'tobi' }; - assert('tobi' == user.name); - assert('number' == typeof user.age); -} \ No newline at end of file diff --git a/node_modules/better-assert/index.js b/node_modules/better-assert/index.js deleted file mode 100644 index fd1c9b7..0000000 --- a/node_modules/better-assert/index.js +++ /dev/null @@ -1,38 +0,0 @@ -/** - * Module dependencies. - */ - -var AssertionError = require('assert').AssertionError - , callsite = require('callsite') - , fs = require('fs') - -/** - * Expose `assert`. - */ - -module.exports = process.env.NO_ASSERT - ? function(){} - : assert; - -/** - * Assert the given `expr`. - */ - -function assert(expr) { - if (expr) return; - - var stack = callsite(); - var call = stack[1]; - var file = call.getFileName(); - var lineno = call.getLineNumber(); - var src = fs.readFileSync(file, 'utf8'); - var line = src.split('\n')[lineno-1]; - var src = line.match(/assert\((.*)\)/)[1]; - - var err = new AssertionError({ - message: src, - stackStartFunction: stack[0].getFunction() - }); - - throw err; -} diff --git a/node_modules/better-assert/package.json b/node_modules/better-assert/package.json deleted file mode 100644 index ae04635..0000000 --- a/node_modules/better-assert/package.json +++ /dev/null @@ -1,27 +0,0 @@ -{ - "name": "better-assert", - "version": "1.0.2", - "description": "Better assertions for node, reporting the expr, filename, lineno etc", - "keywords": [ - "assert", - "stack", - "trace", - "debug" - ], - "author": "TJ Holowaychuk ", - "contributors": [ - "TonyHe ", - "ForbesLindesay" - ], - "dependencies": { - "callsite": "1.0.0" - }, - "repository": { - "type": "git", - "url": "https://github.com/visionmedia/better-assert.git" - }, - "main": "index", - "engines": { - "node": "*" - } -} diff --git a/node_modules/callsite/.npmignore b/node_modules/callsite/.npmignore deleted file mode 100644 index f1250e5..0000000 --- a/node_modules/callsite/.npmignore +++ /dev/null @@ -1,4 +0,0 @@ -support -test -examples -*.sock diff --git a/node_modules/callsite/History.md b/node_modules/callsite/History.md deleted file mode 100644 index 4994198..0000000 --- a/node_modules/callsite/History.md +++ /dev/null @@ -1,10 +0,0 @@ - -1.0.0 / 2013-01-24 -================== - - * remove lame magical getters - -0.0.1 / 2010-01-03 -================== - - * Initial release diff --git a/node_modules/callsite/Makefile b/node_modules/callsite/Makefile deleted file mode 100644 index 634e372..0000000 --- a/node_modules/callsite/Makefile +++ /dev/null @@ -1,6 +0,0 @@ - -test: - @./node_modules/.bin/mocha \ - --require should - -.PHONY: test \ No newline at end of file diff --git a/node_modules/callsite/Readme.md b/node_modules/callsite/Readme.md deleted file mode 100644 index 0dbd16a..0000000 --- a/node_modules/callsite/Readme.md +++ /dev/null @@ -1,44 +0,0 @@ -# callstack - - Access to v8's "raw" `CallSite`s. - -## Installation - - $ npm install callsite - -## Example - -```js -var stack = require('callsite'); - -foo(); - -function foo() { - bar(); -} - -function bar() { - baz(); -} - -function baz() { - console.log(); - stack().forEach(function(site){ - console.log(' \033[36m%s\033[90m in %s:%d\033[0m' - , site.getFunctionName() || 'anonymous' - , site.getFileName() - , site.getLineNumber()); - }); - console.log(); -} -``` - -## Why? - - Because you can do weird, stupid, clever, wacky things such as: - - - [better-assert](https://github.com/visionmedia/better-assert) - -## License - - MIT diff --git a/node_modules/callsite/index.js b/node_modules/callsite/index.js deleted file mode 100644 index d3ee6f8..0000000 --- a/node_modules/callsite/index.js +++ /dev/null @@ -1,10 +0,0 @@ - -module.exports = function(){ - var orig = Error.prepareStackTrace; - Error.prepareStackTrace = function(_, stack){ return stack; }; - var err = new Error; - Error.captureStackTrace(err, arguments.callee); - var stack = err.stack; - Error.prepareStackTrace = orig; - return stack; -}; diff --git a/node_modules/callsite/package.json b/node_modules/callsite/package.json deleted file mode 100644 index 348434e..0000000 --- a/node_modules/callsite/package.json +++ /dev/null @@ -1,11 +0,0 @@ -{ - "name": "callsite" - , "version": "1.0.0" - , "description": "access to v8's CallSites" - , "keywords": ["stack", "trace", "line"] - , "author": "TJ Holowaychuk " - , "dependencies": {} - , "devDependencies": { "mocha": "*", "should": "*" } - , "main": "index" - , "engines": { "node": "*" } -} diff --git a/node_modules/commander/History.md b/node_modules/commander/History.md deleted file mode 100644 index 2e66582..0000000 --- a/node_modules/commander/History.md +++ /dev/null @@ -1,179 +0,0 @@ - -2.0.0 / 2013-07-18 -================== - - * remove input methods (.prompt, .confirm, etc) - -1.3.2 / 2013-07-18 -================== - - * add support for sub-commands to co-exist with the original command - -1.3.1 / 2013-07-18 -================== - - * add quick .runningCommand hack so you can opt-out of other logic when running a sub command - -1.3.0 / 2013-07-09 -================== - - * add EACCES error handling - * fix sub-command --help - -1.2.0 / 2013-06-13 -================== - - * allow "-" hyphen as an option argument - * support for RegExp coercion - -1.1.1 / 2012-11-20 -================== - - * add more sub-command padding - * fix .usage() when args are present. Closes #106 - -1.1.0 / 2012-11-16 -================== - - * add git-style executable subcommand support. Closes #94 - -1.0.5 / 2012-10-09 -================== - - * fix `--name` clobbering. Closes #92 - * fix examples/help. Closes #89 - -1.0.4 / 2012-09-03 -================== - - * add `outputHelp()` method. - -1.0.3 / 2012-08-30 -================== - - * remove invalid .version() defaulting - -1.0.2 / 2012-08-24 -================== - - * add `--foo=bar` support [arv] - * fix password on node 0.8.8. Make backward compatible with 0.6 [focusaurus] - -1.0.1 / 2012-08-03 -================== - - * fix issue #56 - * fix tty.setRawMode(mode) was moved to tty.ReadStream#setRawMode() (i.e. process.stdin.setRawMode()) - -1.0.0 / 2012-07-05 -================== - - * add support for optional option descriptions - * add defaulting of `.version()` to package.json's version - -0.6.1 / 2012-06-01 -================== - - * Added: append (yes or no) on confirmation - * Added: allow node.js v0.7.x - -0.6.0 / 2012-04-10 -================== - - * Added `.prompt(obj, callback)` support. Closes #49 - * Added default support to .choose(). Closes #41 - * Fixed the choice example - -0.5.1 / 2011-12-20 -================== - - * Fixed `password()` for recent nodes. Closes #36 - -0.5.0 / 2011-12-04 -================== - - * Added sub-command option support [itay] - -0.4.3 / 2011-12-04 -================== - - * Fixed custom help ordering. Closes #32 - -0.4.2 / 2011-11-24 -================== - - * Added travis support - * Fixed: line-buffered input automatically trimmed. Closes #31 - -0.4.1 / 2011-11-18 -================== - - * Removed listening for "close" on --help - -0.4.0 / 2011-11-15 -================== - - * Added support for `--`. Closes #24 - -0.3.3 / 2011-11-14 -================== - - * Fixed: wait for close event when writing help info [Jerry Hamlet] - -0.3.2 / 2011-11-01 -================== - - * Fixed long flag definitions with values [felixge] - -0.3.1 / 2011-10-31 -================== - - * Changed `--version` short flag to `-V` from `-v` - * Changed `.version()` so it's configurable [felixge] - -0.3.0 / 2011-10-31 -================== - - * Added support for long flags only. Closes #18 - -0.2.1 / 2011-10-24 -================== - - * "node": ">= 0.4.x < 0.7.0". Closes #20 - -0.2.0 / 2011-09-26 -================== - - * Allow for defaults that are not just boolean. Default peassignment only occurs for --no-*, optional, and required arguments. [Jim Isaacs] - -0.1.0 / 2011-08-24 -================== - - * Added support for custom `--help` output - -0.0.5 / 2011-08-18 -================== - - * Changed: when the user enters nothing prompt for password again - * Fixed issue with passwords beginning with numbers [NuckChorris] - -0.0.4 / 2011-08-15 -================== - - * Fixed `Commander#args` - -0.0.3 / 2011-08-15 -================== - - * Added default option value support - -0.0.2 / 2011-08-15 -================== - - * Added mask support to `Command#password(str[, mask], fn)` - * Added `Command#password(str, fn)` - -0.0.1 / 2010-01-03 -================== - - * Initial release diff --git a/node_modules/commander/Readme.md b/node_modules/commander/Readme.md deleted file mode 100644 index d164401..0000000 --- a/node_modules/commander/Readme.md +++ /dev/null @@ -1,195 +0,0 @@ -# Commander.js - - The complete solution for [node.js](http://nodejs.org) command-line interfaces, inspired by Ruby's [commander](https://github.com/visionmedia/commander). - - [![Build Status](https://secure.travis-ci.org/visionmedia/commander.js.png)](http://travis-ci.org/visionmedia/commander.js) - -## Installation - - $ npm install commander - -## Option parsing - - Options with commander are defined with the `.option()` method, also serving as documentation for the options. The example below parses args and options from `process.argv`, leaving remaining args as the `program.args` array which were not consumed by options. - -```js -#!/usr/bin/env node - -/** - * Module dependencies. - */ - -var program = require('commander'); - -program - .version('0.0.1') - .option('-p, --peppers', 'Add peppers') - .option('-P, --pineapple', 'Add pineapple') - .option('-b, --bbq', 'Add bbq sauce') - .option('-c, --cheese [type]', 'Add the specified type of cheese [marble]', 'marble') - .parse(process.argv); - -console.log('you ordered a pizza with:'); -if (program.peppers) console.log(' - peppers'); -if (program.pineapple) console.log(' - pineapple'); -if (program.bbq) console.log(' - bbq'); -console.log(' - %s cheese', program.cheese); -``` - - Short flags may be passed as a single arg, for example `-abc` is equivalent to `-a -b -c`. Multi-word options such as "--template-engine" are camel-cased, becoming `program.templateEngine` etc. - -## Automated --help - - The help information is auto-generated based on the information commander already knows about your program, so the following `--help` info is for free: - -``` - $ ./examples/pizza --help - - Usage: pizza [options] - - Options: - - -V, --version output the version number - -p, --peppers Add peppers - -P, --pineapple Add pineapple - -b, --bbq Add bbq sauce - -c, --cheese Add the specified type of cheese [marble] - -h, --help output usage information - -``` - -## Coercion - -```js -function range(val) { - return val.split('..').map(Number); -} - -function list(val) { - return val.split(','); -} - -program - .version('0.0.1') - .usage('[options] ') - .option('-i, --integer ', 'An integer argument', parseInt) - .option('-f, --float ', 'A float argument', parseFloat) - .option('-r, --range ..', 'A range', range) - .option('-l, --list ', 'A list', list) - .option('-o, --optional [value]', 'An optional value') - .parse(process.argv); - -console.log(' int: %j', program.integer); -console.log(' float: %j', program.float); -console.log(' optional: %j', program.optional); -program.range = program.range || []; -console.log(' range: %j..%j', program.range[0], program.range[1]); -console.log(' list: %j', program.list); -console.log(' args: %j', program.args); -``` - -## Custom help - - You can display arbitrary `-h, --help` information - by listening for "--help". Commander will automatically - exit once you are done so that the remainder of your program - does not execute causing undesired behaviours, for example - in the following executable "stuff" will not output when - `--help` is used. - -```js -#!/usr/bin/env node - -/** - * Module dependencies. - */ - -var program = require('../'); - -function list(val) { - return val.split(',').map(Number); -} - -program - .version('0.0.1') - .option('-f, --foo', 'enable some foo') - .option('-b, --bar', 'enable some bar') - .option('-B, --baz', 'enable some baz'); - -// must be before .parse() since -// node's emit() is immediate - -program.on('--help', function(){ - console.log(' Examples:'); - console.log(''); - console.log(' $ custom-help --help'); - console.log(' $ custom-help -h'); - console.log(''); -}); - -program.parse(process.argv); - -console.log('stuff'); -``` - -yielding the following help output: - -``` - -Usage: custom-help [options] - -Options: - - -h, --help output usage information - -V, --version output the version number - -f, --foo enable some foo - -b, --bar enable some bar - -B, --baz enable some baz - -Examples: - - $ custom-help --help - $ custom-help -h - -``` - -## .outputHelp() - - Output help information without exiting. - -## .help() - - Output help information and exit immediately. - -## Links - - - [API documentation](http://visionmedia.github.com/commander.js/) - - [ascii tables](https://github.com/LearnBoost/cli-table) - - [progress bars](https://github.com/visionmedia/node-progress) - - [more progress bars](https://github.com/substack/node-multimeter) - - [examples](https://github.com/visionmedia/commander.js/tree/master/examples) - -## License - -(The MIT License) - -Copyright (c) 2011 TJ Holowaychuk <tj@vision-media.ca> - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/commander/index.js b/node_modules/commander/index.js deleted file mode 100644 index d5778a7..0000000 --- a/node_modules/commander/index.js +++ /dev/null @@ -1,847 +0,0 @@ - -/** - * Module dependencies. - */ - -var EventEmitter = require('events').EventEmitter; -var spawn = require('child_process').spawn; -var fs = require('fs'); -var exists = fs.existsSync; -var path = require('path'); -var dirname = path.dirname; -var basename = path.basename; - -/** - * Expose the root command. - */ - -exports = module.exports = new Command; - -/** - * Expose `Command`. - */ - -exports.Command = Command; - -/** - * Expose `Option`. - */ - -exports.Option = Option; - -/** - * Initialize a new `Option` with the given `flags` and `description`. - * - * @param {String} flags - * @param {String} description - * @api public - */ - -function Option(flags, description) { - this.flags = flags; - this.required = ~flags.indexOf('<'); - this.optional = ~flags.indexOf('['); - this.bool = !~flags.indexOf('-no-'); - flags = flags.split(/[ ,|]+/); - if (flags.length > 1 && !/^[[<]/.test(flags[1])) this.short = flags.shift(); - this.long = flags.shift(); - this.description = description || ''; -} - -/** - * Return option name. - * - * @return {String} - * @api private - */ - -Option.prototype.name = function(){ - return this.long - .replace('--', '') - .replace('no-', ''); -}; - -/** - * Check if `arg` matches the short or long flag. - * - * @param {String} arg - * @return {Boolean} - * @api private - */ - -Option.prototype.is = function(arg){ - return arg == this.short - || arg == this.long; -}; - -/** - * Initialize a new `Command`. - * - * @param {String} name - * @api public - */ - -function Command(name) { - this.commands = []; - this.options = []; - this._execs = []; - this._args = []; - this._name = name; -} - -/** - * Inherit from `EventEmitter.prototype`. - */ - -Command.prototype.__proto__ = EventEmitter.prototype; - -/** - * Add command `name`. - * - * The `.action()` callback is invoked when the - * command `name` is specified via __ARGV__, - * and the remaining arguments are applied to the - * function for access. - * - * When the `name` is "*" an un-matched command - * will be passed as the first arg, followed by - * the rest of __ARGV__ remaining. - * - * Examples: - * - * program - * .version('0.0.1') - * .option('-C, --chdir ', 'change the working directory') - * .option('-c, --config ', 'set config path. defaults to ./deploy.conf') - * .option('-T, --no-tests', 'ignore test hook') - * - * program - * .command('setup') - * .description('run remote setup commands') - * .action(function(){ - * console.log('setup'); - * }); - * - * program - * .command('exec ') - * .description('run the given remote command') - * .action(function(cmd){ - * console.log('exec "%s"', cmd); - * }); - * - * program - * .command('*') - * .description('deploy the given env') - * .action(function(env){ - * console.log('deploying "%s"', env); - * }); - * - * program.parse(process.argv); - * - * @param {String} name - * @param {String} [desc] - * @return {Command} the new command - * @api public - */ - -Command.prototype.command = function(name, desc){ - var args = name.split(/ +/); - var cmd = new Command(args.shift()); - if (desc) cmd.description(desc); - if (desc) this.executables = true; - if (desc) this._execs[cmd._name] = true; - this.commands.push(cmd); - cmd.parseExpectedArgs(args); - cmd.parent = this; - if (desc) return this; - return cmd; -}; - -/** - * Add an implicit `help [cmd]` subcommand - * which invokes `--help` for the given command. - * - * @api private - */ - -Command.prototype.addImplicitHelpCommand = function() { - this.command('help [cmd]', 'display help for [cmd]'); -}; - -/** - * Parse expected `args`. - * - * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`. - * - * @param {Array} args - * @return {Command} for chaining - * @api public - */ - -Command.prototype.parseExpectedArgs = function(args){ - if (!args.length) return; - var self = this; - args.forEach(function(arg){ - switch (arg[0]) { - case '<': - self._args.push({ required: true, name: arg.slice(1, -1) }); - break; - case '[': - self._args.push({ required: false, name: arg.slice(1, -1) }); - break; - } - }); - return this; -}; - -/** - * Register callback `fn` for the command. - * - * Examples: - * - * program - * .command('help') - * .description('display verbose help') - * .action(function(){ - * // output help here - * }); - * - * @param {Function} fn - * @return {Command} for chaining - * @api public - */ - -Command.prototype.action = function(fn){ - var self = this; - this.parent.on(this._name, function(args, unknown){ - // Parse any so-far unknown options - unknown = unknown || []; - var parsed = self.parseOptions(unknown); - - // Output help if necessary - outputHelpIfNecessary(self, parsed.unknown); - - // If there are still any unknown options, then we simply - // die, unless someone asked for help, in which case we give it - // to them, and then we die. - if (parsed.unknown.length > 0) { - self.unknownOption(parsed.unknown[0]); - } - - // Leftover arguments need to be pushed back. Fixes issue #56 - if (parsed.args.length) args = parsed.args.concat(args); - - self._args.forEach(function(arg, i){ - if (arg.required && null == args[i]) { - self.missingArgument(arg.name); - } - }); - - // Always append ourselves to the end of the arguments, - // to make sure we match the number of arguments the user - // expects - if (self._args.length) { - args[self._args.length] = self; - } else { - args.push(self); - } - - fn.apply(this, args); - }); - return this; -}; - -/** - * Define option with `flags`, `description` and optional - * coercion `fn`. - * - * The `flags` string should contain both the short and long flags, - * separated by comma, a pipe or space. The following are all valid - * all will output this way when `--help` is used. - * - * "-p, --pepper" - * "-p|--pepper" - * "-p --pepper" - * - * Examples: - * - * // simple boolean defaulting to false - * program.option('-p, --pepper', 'add pepper'); - * - * --pepper - * program.pepper - * // => Boolean - * - * // simple boolean defaulting to false - * program.option('-C, --no-cheese', 'remove cheese'); - * - * program.cheese - * // => true - * - * --no-cheese - * program.cheese - * // => true - * - * // required argument - * program.option('-C, --chdir ', 'change the working directory'); - * - * --chdir /tmp - * program.chdir - * // => "/tmp" - * - * // optional argument - * program.option('-c, --cheese [type]', 'add cheese [marble]'); - * - * @param {String} flags - * @param {String} description - * @param {Function|Mixed} fn or default - * @param {Mixed} defaultValue - * @return {Command} for chaining - * @api public - */ - -Command.prototype.option = function(flags, description, fn, defaultValue){ - var self = this - , option = new Option(flags, description) - , oname = option.name() - , name = camelcase(oname); - - // default as 3rd arg - if ('function' != typeof fn) defaultValue = fn, fn = null; - - // preassign default value only for --no-*, [optional], or - if (false == option.bool || option.optional || option.required) { - // when --no-* we make sure default is true - if (false == option.bool) defaultValue = true; - // preassign only if we have a default - if (undefined !== defaultValue) self[name] = defaultValue; - } - - // register the option - this.options.push(option); - - // when it's passed assign the value - // and conditionally invoke the callback - this.on(oname, function(val){ - // coercion - if (null != val && fn) val = fn(val); - - // unassigned or bool - if ('boolean' == typeof self[name] || 'undefined' == typeof self[name]) { - // if no value, bool true, and we have a default, then use it! - if (null == val) { - self[name] = option.bool - ? defaultValue || true - : false; - } else { - self[name] = val; - } - } else if (null !== val) { - // reassign - self[name] = val; - } - }); - - return this; -}; - -/** - * Parse `argv`, settings options and invoking commands when defined. - * - * @param {Array} argv - * @return {Command} for chaining - * @api public - */ - -Command.prototype.parse = function(argv){ - // implicit help - if (this.executables) this.addImplicitHelpCommand(); - - // store raw args - this.rawArgs = argv; - - // guess name - this._name = this._name || basename(argv[1]); - - // process argv - var parsed = this.parseOptions(this.normalize(argv.slice(2))); - var args = this.args = parsed.args; - - var result = this.parseArgs(this.args, parsed.unknown); - - // executable sub-commands - var name = result.args[0]; - if (this._execs[name]) return this.executeSubCommand(argv, args, parsed.unknown); - - return result; -}; - -/** - * Execute a sub-command executable. - * - * @param {Array} argv - * @param {Array} args - * @param {Array} unknown - * @api private - */ - -Command.prototype.executeSubCommand = function(argv, args, unknown) { - args = args.concat(unknown); - - if (!args.length) this.help(); - if ('help' == args[0] && 1 == args.length) this.help(); - - // --help - if ('help' == args[0]) { - args[0] = args[1]; - args[1] = '--help'; - } - - // executable - var dir = dirname(argv[1]); - var bin = basename(argv[1]) + '-' + args[0]; - - // check for ./ first - var local = path.join(dir, bin); - - // run it - args = args.slice(1); - var proc = spawn(local, args, { stdio: 'inherit', customFds: [0, 1, 2] }); - proc.on('error', function(err){ - if (err.code == "ENOENT") { - console.error('\n %s(1) does not exist, try --help\n', bin); - } else if (err.code == "EACCES") { - console.error('\n %s(1) not executable. try chmod or run with root\n', bin); - } - }); - - this.runningCommand = proc; -}; - -/** - * Normalize `args`, splitting joined short flags. For example - * the arg "-abc" is equivalent to "-a -b -c". - * This also normalizes equal sign and splits "--abc=def" into "--abc def". - * - * @param {Array} args - * @return {Array} - * @api private - */ - -Command.prototype.normalize = function(args){ - var ret = [] - , arg - , index; - - for (var i = 0, len = args.length; i < len; ++i) { - arg = args[i]; - if (arg.length > 1 && '-' == arg[0] && '-' != arg[1]) { - arg.slice(1).split('').forEach(function(c){ - ret.push('-' + c); - }); - } else if (/^--/.test(arg) && ~(index = arg.indexOf('='))) { - ret.push(arg.slice(0, index), arg.slice(index + 1)); - } else { - ret.push(arg); - } - } - - return ret; -}; - -/** - * Parse command `args`. - * - * When listener(s) are available those - * callbacks are invoked, otherwise the "*" - * event is emitted and those actions are invoked. - * - * @param {Array} args - * @return {Command} for chaining - * @api private - */ - -Command.prototype.parseArgs = function(args, unknown){ - var cmds = this.commands - , len = cmds.length - , name; - - if (args.length) { - name = args[0]; - if (this.listeners(name).length) { - this.emit(args.shift(), args, unknown); - } else { - this.emit('*', args); - } - } else { - outputHelpIfNecessary(this, unknown); - - // If there were no args and we have unknown options, - // then they are extraneous and we need to error. - if (unknown.length > 0) { - this.unknownOption(unknown[0]); - } - } - - return this; -}; - -/** - * Return an option matching `arg` if any. - * - * @param {String} arg - * @return {Option} - * @api private - */ - -Command.prototype.optionFor = function(arg){ - for (var i = 0, len = this.options.length; i < len; ++i) { - if (this.options[i].is(arg)) { - return this.options[i]; - } - } -}; - -/** - * Parse options from `argv` returning `argv` - * void of these options. - * - * @param {Array} argv - * @return {Array} - * @api public - */ - -Command.prototype.parseOptions = function(argv){ - var args = [] - , len = argv.length - , literal - , option - , arg; - - var unknownOptions = []; - - // parse options - for (var i = 0; i < len; ++i) { - arg = argv[i]; - - // literal args after -- - if ('--' == arg) { - literal = true; - continue; - } - - if (literal) { - args.push(arg); - continue; - } - - // find matching Option - option = this.optionFor(arg); - - // option is defined - if (option) { - // requires arg - if (option.required) { - arg = argv[++i]; - if (null == arg) return this.optionMissingArgument(option); - if ('-' == arg[0] && '-' != arg) return this.optionMissingArgument(option, arg); - this.emit(option.name(), arg); - // optional arg - } else if (option.optional) { - arg = argv[i+1]; - if (null == arg || ('-' == arg[0] && '-' != arg)) { - arg = null; - } else { - ++i; - } - this.emit(option.name(), arg); - // bool - } else { - this.emit(option.name()); - } - continue; - } - - // looks like an option - if (arg.length > 1 && '-' == arg[0]) { - unknownOptions.push(arg); - - // If the next argument looks like it might be - // an argument for this option, we pass it on. - // If it isn't, then it'll simply be ignored - if (argv[i+1] && '-' != argv[i+1][0]) { - unknownOptions.push(argv[++i]); - } - continue; - } - - // arg - args.push(arg); - } - - return { args: args, unknown: unknownOptions }; -}; - -/** - * Argument `name` is missing. - * - * @param {String} name - * @api private - */ - -Command.prototype.missingArgument = function(name){ - console.error(); - console.error(" error: missing required argument `%s'", name); - console.error(); - process.exit(1); -}; - -/** - * `Option` is missing an argument, but received `flag` or nothing. - * - * @param {String} option - * @param {String} flag - * @api private - */ - -Command.prototype.optionMissingArgument = function(option, flag){ - console.error(); - if (flag) { - console.error(" error: option `%s' argument missing, got `%s'", option.flags, flag); - } else { - console.error(" error: option `%s' argument missing", option.flags); - } - console.error(); - process.exit(1); -}; - -/** - * Unknown option `flag`. - * - * @param {String} flag - * @api private - */ - -Command.prototype.unknownOption = function(flag){ - console.error(); - console.error(" error: unknown option `%s'", flag); - console.error(); - process.exit(1); -}; - - -/** - * Set the program version to `str`. - * - * This method auto-registers the "-V, --version" flag - * which will print the version number when passed. - * - * @param {String} str - * @param {String} flags - * @return {Command} for chaining - * @api public - */ - -Command.prototype.version = function(str, flags){ - if (0 == arguments.length) return this._version; - this._version = str; - flags = flags || '-V, --version'; - this.option(flags, 'output the version number'); - this.on('version', function(){ - console.log(str); - process.exit(0); - }); - return this; -}; - -/** - * Set the description `str`. - * - * @param {String} str - * @return {String|Command} - * @api public - */ - -Command.prototype.description = function(str){ - if (0 == arguments.length) return this._description; - this._description = str; - return this; -}; - -/** - * Set / get the command usage `str`. - * - * @param {String} str - * @return {String|Command} - * @api public - */ - -Command.prototype.usage = function(str){ - var args = this._args.map(function(arg){ - return arg.required - ? '<' + arg.name + '>' - : '[' + arg.name + ']'; - }); - - var usage = '[options' - + (this.commands.length ? '] [command' : '') - + ']' - + (this._args.length ? ' ' + args : ''); - - if (0 == arguments.length) return this._usage || usage; - this._usage = str; - - return this; -}; - -/** - * Return the largest option length. - * - * @return {Number} - * @api private - */ - -Command.prototype.largestOptionLength = function(){ - return this.options.reduce(function(max, option){ - return Math.max(max, option.flags.length); - }, 0); -}; - -/** - * Return help for options. - * - * @return {String} - * @api private - */ - -Command.prototype.optionHelp = function(){ - var width = this.largestOptionLength(); - - // Prepend the help information - return [pad('-h, --help', width) + ' ' + 'output usage information'] - .concat(this.options.map(function(option){ - return pad(option.flags, width) - + ' ' + option.description; - })) - .join('\n'); -}; - -/** - * Return command help documentation. - * - * @return {String} - * @api private - */ - -Command.prototype.commandHelp = function(){ - if (!this.commands.length) return ''; - return [ - '' - , ' Commands:' - , '' - , this.commands.map(function(cmd){ - var args = cmd._args.map(function(arg){ - return arg.required - ? '<' + arg.name + '>' - : '[' + arg.name + ']'; - }).join(' '); - - return pad(cmd._name - + (cmd.options.length - ? ' [options]' - : '') + ' ' + args, 22) - + (cmd.description() - ? ' ' + cmd.description() - : ''); - }).join('\n').replace(/^/gm, ' ') - , '' - ].join('\n'); -}; - -/** - * Return program help documentation. - * - * @return {String} - * @api private - */ - -Command.prototype.helpInformation = function(){ - return [ - '' - , ' Usage: ' + this._name + ' ' + this.usage() - , '' + this.commandHelp() - , ' Options:' - , '' - , '' + this.optionHelp().replace(/^/gm, ' ') - , '' - , '' - ].join('\n'); -}; - -/** - * Output help information for this command - * - * @api public - */ - -Command.prototype.outputHelp = function(){ - process.stdout.write(this.helpInformation()); - this.emit('--help'); -}; - -/** - * Output help information and exit. - * - * @api public - */ - -Command.prototype.help = function(){ - this.outputHelp(); - process.exit(); -}; - -/** - * Camel-case the given `flag` - * - * @param {String} flag - * @return {String} - * @api private - */ - -function camelcase(flag) { - return flag.split('-').reduce(function(str, word){ - return str + word[0].toUpperCase() + word.slice(1); - }); -} - -/** - * Pad `str` to `width`. - * - * @param {String} str - * @param {Number} width - * @return {String} - * @api private - */ - -function pad(str, width) { - var len = Math.max(0, width - str.length); - return str + Array(len + 1).join(' '); -} - -/** - * Output help information if necessary - * - * @param {Command} command to output help for - * @param {Array} array of options to search for -h or --help - * @api private - */ - -function outputHelpIfNecessary(cmd, options) { - options = options || []; - for (var i = 0; i < options.length; i++) { - if (options[i] == '--help' || options[i] == '-h') { - cmd.outputHelp(); - process.exit(0); - } - } -} diff --git a/node_modules/commander/package.json b/node_modules/commander/package.json deleted file mode 100644 index 1fe85bd..0000000 --- a/node_modules/commander/package.json +++ /dev/null @@ -1,12 +0,0 @@ -{ - "name": "commander" - , "version": "2.0.0" - , "description": "the complete solution for node.js command-line programs" - , "keywords": ["command", "option", "parser", "prompt", "stdin"] - , "author": "TJ Holowaychuk " - , "repository": { "type": "git", "url": "https://github.com/visionmedia/commander.js.git" } - , "devDependencies": { "should": ">= 0.0.1" } - , "scripts": { "test": "make test" } - , "main": "index" - , "engines": { "node": ">= 0.6.x" } -} diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml deleted file mode 100644 index 20a7068..0000000 --- a/node_modules/debug/.coveralls.yml +++ /dev/null @@ -1 +0,0 @@ -repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc deleted file mode 100644 index 146371e..0000000 --- a/node_modules/debug/.eslintrc +++ /dev/null @@ -1,14 +0,0 @@ -{ - "env": { - "browser": true, - "node": true - }, - "globals": { - "chrome": true - }, - "rules": { - "no-console": 0, - "no-empty": [1, { "allowEmptyCatch": true }] - }, - "extends": "eslint:recommended" -} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore deleted file mode 100644 index 5f60eec..0000000 --- a/node_modules/debug/.npmignore +++ /dev/null @@ -1,9 +0,0 @@ -support -test -examples -example -*.sock -dist -yarn.lock -coverage -bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml deleted file mode 100644 index a764300..0000000 --- a/node_modules/debug/.travis.yml +++ /dev/null @@ -1,20 +0,0 @@ -sudo: false - -language: node_js - -node_js: - - "4" - - "6" - - "8" - -install: - - make install - -script: - - make lint - - make test - -matrix: - include: - - node_js: '8' - env: BROWSER=1 diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md deleted file mode 100644 index a1c0eaf..0000000 --- a/node_modules/debug/CHANGELOG.md +++ /dev/null @@ -1,378 +0,0 @@ - -3.0.1 / 2017-08-24 -================== - - * Fix: Disable colors in Edge and Internet Explorer (#489) - -3.0.0 / 2017-08-08 -================== - - * Breaking: Remove DEBUG_FD (#406) - * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418) - * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408) - * Addition: document `enabled` flag (#465) - * Addition: add 256 colors mode (#481) - * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440) - * Update: component: update "ms" to v2.0.0 - * Update: separate the Node and Browser tests in Travis-CI - * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots - * Update: separate Node.js and web browser examples for organization - * Update: update "browserify" to v14.4.0 - * Fix: fix Readme typo (#473) - -2.6.8 / 2017-05-18 -================== - - * Fix: Check for undefined on browser globals (#462, @marbemac) - -2.6.7 / 2017-05-16 -================== - - * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) - * Fix: Inline extend function in node implementation (#452, @dougwilson) - * Docs: Fix typo (#455, @msasad) - -2.6.5 / 2017-04-27 -================== - - * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) - * Misc: clean up browser reference checks (#447, @thebigredgeek) - * Misc: add npm-debug.log to .gitignore (@thebigredgeek) - - -2.6.4 / 2017-04-20 -================== - - * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) - * Chore: ignore bower.json in npm installations. (#437, @joaovieira) - * Misc: update "ms" to v0.7.3 (@tootallnate) - -2.6.3 / 2017-03-13 -================== - - * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) - * Docs: Changelog fix (@thebigredgeek) - -2.6.2 / 2017-03-10 -================== - - * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) - * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) - * Docs: Add Slackin invite badge (@tootallnate) - -2.6.1 / 2017-02-10 -================== - - * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error - * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) - * Fix: IE8 "Expected identifier" error (#414, @vgoma) - * Fix: Namespaces would not disable once enabled (#409, @musikov) - -2.6.0 / 2016-12-28 -================== - - * Fix: added better null pointer checks for browser useColors (@thebigredgeek) - * Improvement: removed explicit `window.debug` export (#404, @tootallnate) - * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) - -2.5.2 / 2016-12-25 -================== - - * Fix: reference error on window within webworkers (#393, @KlausTrainer) - * Docs: fixed README typo (#391, @lurch) - * Docs: added notice about v3 api discussion (@thebigredgeek) - -2.5.1 / 2016-12-20 -================== - - * Fix: babel-core compatibility - -2.5.0 / 2016-12-20 -================== - - * Fix: wrong reference in bower file (@thebigredgeek) - * Fix: webworker compatibility (@thebigredgeek) - * Fix: output formatting issue (#388, @kribblo) - * Fix: babel-loader compatibility (#383, @escwald) - * Misc: removed built asset from repo and publications (@thebigredgeek) - * Misc: moved source files to /src (#378, @yamikuronue) - * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) - * Test: coveralls integration (#378, @yamikuronue) - * Docs: simplified language in the opening paragraph (#373, @yamikuronue) - -2.4.5 / 2016-12-17 -================== - - * Fix: `navigator` undefined in Rhino (#376, @jochenberger) - * Fix: custom log function (#379, @hsiliev) - * Improvement: bit of cleanup + linting fixes (@thebigredgeek) - * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) - * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) - -2.4.4 / 2016-12-14 -================== - - * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) - -2.4.3 / 2016-12-14 -================== - - * Fix: navigation.userAgent error for react native (#364, @escwald) - -2.4.2 / 2016-12-14 -================== - - * Fix: browser colors (#367, @tootallnate) - * Misc: travis ci integration (@thebigredgeek) - * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) - -2.4.1 / 2016-12-13 -================== - - * Fix: typo that broke the package (#356) - -2.4.0 / 2016-12-13 -================== - - * Fix: bower.json references unbuilt src entry point (#342, @justmatt) - * Fix: revert "handle regex special characters" (@tootallnate) - * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) - * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) - * Improvement: allow colors in workers (#335, @botverse) - * Improvement: use same color for same namespace. (#338, @lchenay) - -2.3.3 / 2016-11-09 -================== - - * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) - * Fix: Returning `localStorage` saved values (#331, Levi Thomason) - * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) - -2.3.2 / 2016-11-09 -================== - - * Fix: be super-safe in index.js as well (@TooTallNate) - * Fix: should check whether process exists (Tom Newby) - -2.3.1 / 2016-11-09 -================== - - * Fix: Added electron compatibility (#324, @paulcbetts) - * Improvement: Added performance optimizations (@tootallnate) - * Readme: Corrected PowerShell environment variable example (#252, @gimre) - * Misc: Removed yarn lock file from source control (#321, @fengmk2) - -2.3.0 / 2016-11-07 -================== - - * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) - * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) - * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) - * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) - * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) - * Package: Update "ms" to 0.7.2 (#315, @DevSide) - * Package: removed superfluous version property from bower.json (#207 @kkirsche) - * Readme: fix USE_COLORS to DEBUG_COLORS - * Readme: Doc fixes for format string sugar (#269, @mlucool) - * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) - * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) - * Readme: better docs for browser support (#224, @matthewmueller) - * Tooling: Added yarn integration for development (#317, @thebigredgeek) - * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) - * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) - * Misc: Updated contributors (@thebigredgeek) - -2.2.0 / 2015-05-09 -================== - - * package: update "ms" to v0.7.1 (#202, @dougwilson) - * README: add logging to file example (#193, @DanielOchoa) - * README: fixed a typo (#191, @amir-s) - * browser: expose `storage` (#190, @stephenmathieson) - * Makefile: add a `distclean` target (#189, @stephenmathieson) - -2.1.3 / 2015-03-13 -================== - - * Updated stdout/stderr example (#186) - * Updated example/stdout.js to match debug current behaviour - * Renamed example/stderr.js to stdout.js - * Update Readme.md (#184) - * replace high intensity foreground color for bold (#182, #183) - -2.1.2 / 2015-03-01 -================== - - * dist: recompile - * update "ms" to v0.7.0 - * package: update "browserify" to v9.0.3 - * component: fix "ms.js" repo location - * changed bower package name - * updated documentation about using debug in a browser - * fix: security error on safari (#167, #168, @yields) - -2.1.1 / 2014-12-29 -================== - - * browser: use `typeof` to check for `console` existence - * browser: check for `console.log` truthiness (fix IE 8/9) - * browser: add support for Chrome apps - * Readme: added Windows usage remarks - * Add `bower.json` to properly support bower install - -2.1.0 / 2014-10-15 -================== - - * node: implement `DEBUG_FD` env variable support - * package: update "browserify" to v6.1.0 - * package: add "license" field to package.json (#135, @panuhorsmalahti) - -2.0.0 / 2014-09-01 -================== - - * package: update "browserify" to v5.11.0 - * node: use stderr rather than stdout for logging (#29, @stephenmathieson) - -1.0.4 / 2014-07-15 -================== - - * dist: recompile - * example: remove `console.info()` log usage - * example: add "Content-Type" UTF-8 header to browser example - * browser: place %c marker after the space character - * browser: reset the "content" color via `color: inherit` - * browser: add colors support for Firefox >= v31 - * debug: prefer an instance `log()` function over the global one (#119) - * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) - -1.0.3 / 2014-07-09 -================== - - * Add support for multiple wildcards in namespaces (#122, @seegno) - * browser: fix lint - -1.0.2 / 2014-06-10 -================== - - * browser: update color palette (#113, @gscottolson) - * common: make console logging function configurable (#108, @timoxley) - * node: fix %o colors on old node <= 0.8.x - * Makefile: find node path using shell/which (#109, @timoxley) - -1.0.1 / 2014-06-06 -================== - - * browser: use `removeItem()` to clear localStorage - * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) - * package: add "contributors" section - * node: fix comment typo - * README: list authors - -1.0.0 / 2014-06-04 -================== - - * make ms diff be global, not be scope - * debug: ignore empty strings in enable() - * node: make DEBUG_COLORS able to disable coloring - * *: export the `colors` array - * npmignore: don't publish the `dist` dir - * Makefile: refactor to use browserify - * package: add "browserify" as a dev dependency - * Readme: add Web Inspector Colors section - * node: reset terminal color for the debug content - * node: map "%o" to `util.inspect()` - * browser: map "%j" to `JSON.stringify()` - * debug: add custom "formatters" - * debug: use "ms" module for humanizing the diff - * Readme: add "bash" syntax highlighting - * browser: add Firebug color support - * browser: add colors for WebKit browsers - * node: apply log to `console` - * rewrite: abstract common logic for Node & browsers - * add .jshintrc file - -0.8.1 / 2014-04-14 -================== - - * package: re-add the "component" section - -0.8.0 / 2014-03-30 -================== - - * add `enable()` method for nodejs. Closes #27 - * change from stderr to stdout - * remove unnecessary index.js file - -0.7.4 / 2013-11-13 -================== - - * remove "browserify" key from package.json (fixes something in browserify) - -0.7.3 / 2013-10-30 -================== - - * fix: catch localStorage security error when cookies are blocked (Chrome) - * add debug(err) support. Closes #46 - * add .browser prop to package.json. Closes #42 - -0.7.2 / 2013-02-06 -================== - - * fix package.json - * fix: Mobile Safari (private mode) is broken with debug - * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript - -0.7.1 / 2013-02-05 -================== - - * add repository URL to package.json - * add DEBUG_COLORED to force colored output - * add browserify support - * fix component. Closes #24 - -0.7.0 / 2012-05-04 -================== - - * Added .component to package.json - * Added debug.component.js build - -0.6.0 / 2012-03-16 -================== - - * Added support for "-" prefix in DEBUG [Vinay Pulim] - * Added `.enabled` flag to the node version [TooTallNate] - -0.5.0 / 2012-02-02 -================== - - * Added: humanize diffs. Closes #8 - * Added `debug.disable()` to the CS variant - * Removed padding. Closes #10 - * Fixed: persist client-side variant again. Closes #9 - -0.4.0 / 2012-02-01 -================== - - * Added browser variant support for older browsers [TooTallNate] - * Added `debug.enable('project:*')` to browser variant [TooTallNate] - * Added padding to diff (moved it to the right) - -0.3.0 / 2012-01-26 -================== - - * Added millisecond diff when isatty, otherwise UTC string - -0.2.0 / 2012-01-22 -================== - - * Added wildcard support - -0.1.0 / 2011-12-02 -================== - - * Added: remove colors unless stderr isatty [TooTallNate] - -0.0.1 / 2010-01-03 -================== - - * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE deleted file mode 100644 index 658c933..0000000 --- a/node_modules/debug/LICENSE +++ /dev/null @@ -1,19 +0,0 @@ -(The MIT License) - -Copyright (c) 2014 TJ Holowaychuk - -Permission is hereby granted, free of charge, to any person obtaining a copy of this software -and associated documentation files (the 'Software'), to deal in the Software without restriction, -including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, -and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, -subject to the following conditions: - -The above copyright notice and this permission notice shall be included in all copies or substantial -portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT -LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, -WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. - diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile deleted file mode 100644 index 3ddd136..0000000 --- a/node_modules/debug/Makefile +++ /dev/null @@ -1,58 +0,0 @@ -# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 -THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) -THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) - -# BIN directory -BIN := $(THIS_DIR)/node_modules/.bin - -# Path -PATH := node_modules/.bin:$(PATH) -SHELL := /bin/bash - -# applications -NODE ?= $(shell which node) -YARN ?= $(shell which yarn) -PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) -BROWSERIFY ?= $(NODE) $(BIN)/browserify - -install: node_modules - -browser: dist/debug.js - -node_modules: package.json - @NODE_ENV= $(PKG) install - @touch node_modules - -dist/debug.js: src/*.js node_modules - @mkdir -p dist - @$(BROWSERIFY) \ - --standalone debug \ - . > dist/debug.js - -lint: - @eslint *.js src/*.js - -test-node: - @istanbul cover node_modules/mocha/bin/_mocha -- test/**.js - @cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js - -test-browser: - @$(MAKE) browser - @karma start --single-run - -test-all: - @concurrently \ - "make test-node" \ - "make test-browser" - -test: - @if [ "x$(BROWSER)" = "x" ]; then \ - $(MAKE) test-node; \ - else \ - $(MAKE) test-browser; \ - fi - -clean: - rimraf dist coverage - -.PHONY: browser install clean lint test test-all test-node test-browser diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md deleted file mode 100644 index 1f3b08e..0000000 --- a/node_modules/debug/README.md +++ /dev/null @@ -1,367 +0,0 @@ -# debug -[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) -[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) - - - -A tiny JavaScript debugging utility modelled after Node.js core's debugging -technique. Works in Node.js and web browsers. - -## Installation - -```bash -$ npm install debug -``` - -## Usage - -`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. - -Example [_app.js_](./examples/node/app.js): - -```js -var debug = require('debug')('http') - , http = require('http') - , name = 'My App'; - -// fake app - -debug('booting %o', name); - -http.createServer(function(req, res){ - debug(req.method + ' ' + req.url); - res.end('hello\n'); -}).listen(3000, function(){ - debug('listening'); -}); - -// fake worker of some kind - -require('./worker'); -``` - -Example [_worker.js_](./examples/node/worker.js): - -```js -var a = require('debug')('worker:a') - , b = require('debug')('worker:b'); - -function work() { - a('doing lots of uninteresting work'); - setTimeout(work, Math.random() * 1000); -} - -work(); - -function workb() { - b('doing some work'); - setTimeout(workb, Math.random() * 2000); -} - -workb(); -``` - -The `DEBUG` environment variable is then used to enable these based on space or -comma-delimited names. - -Here are some examples: - -screen shot 2017-08-08 at 12 53 04 pm -screen shot 2017-08-08 at 12 53 38 pm -screen shot 2017-08-08 at 12 53 25 pm - -#### Windows note - -On Windows the environment variable is set using the `set` command. - -```cmd -set DEBUG=*,-not_this -``` - -Note that PowerShell uses different syntax to set environment variables. - -```cmd -$env:DEBUG = "*,-not_this" -``` - -Then, run the program to be debugged as usual. - - -## Namespace Colors - -Every debug instance has a color generated for it based on its namespace name. -This helps when visually parsing the debug output to identify which debug instance -a debug line belongs to. - -#### Node.js - -In Node.js, colors are enabled when stderr is a TTY. You also _should_ install -the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, -otherwise debug will only use a small handful of basic colors. - - - -#### Web Browser - -Colors are also enabled on "Web Inspectors" that understand the `%c` formatting -option. These are WebKit web inspectors, Firefox ([since version -31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) -and the Firebug plugin for Firefox (any version). - - - - -## Millisecond diff - -When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. - - - -When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: - - - - -## Conventions - -If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. - -## Wildcards - -The `*` character may be used as a wildcard. Suppose for example your library has -debuggers named "connect:bodyParser", "connect:compress", "connect:session", -instead of listing all three with -`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do -`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. - -You can also exclude specific debuggers by prefixing them with a "-" character. -For example, `DEBUG=*,-connect:*` would include all debuggers except those -starting with "connect:". - -## Environment Variables - -When running through Node.js, you can set a few environment variables that will -change the behavior of the debug logging: - -| Name | Purpose | -|-----------|-------------------------------------------------| -| `DEBUG` | Enables/disables specific debugging namespaces. | -| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | -| `DEBUG_DEPTH` | Object inspection depth. | -| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | - - -__Note:__ The environment variables beginning with `DEBUG_` end up being -converted into an Options object that gets used with `%o`/`%O` formatters. -See the Node.js documentation for -[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) -for the complete list. - -## Formatters - -Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. -Below are the officially supported formatters: - -| Formatter | Representation | -|-----------|----------------| -| `%O` | Pretty-print an Object on multiple lines. | -| `%o` | Pretty-print an Object all on a single line. | -| `%s` | String. | -| `%d` | Number (both integer and float). | -| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | -| `%%` | Single percent sign ('%'). This does not consume an argument. | - - -### Custom formatters - -You can add custom formatters by extending the `debug.formatters` object. -For example, if you wanted to add support for rendering a Buffer as hex with -`%h`, you could do something like: - -```js -const createDebug = require('debug') -createDebug.formatters.h = (v) => { - return v.toString('hex') -} - -// …elsewhere -const debug = createDebug('foo') -debug('this is hex: %h', new Buffer('hello world')) -// foo this is hex: 68656c6c6f20776f726c6421 +0ms -``` - - -## Browser Support - -You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), -or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), -if you don't want to build it yourself. - -Debug's enable state is currently persisted by `localStorage`. -Consider the situation shown below where you have `worker:a` and `worker:b`, -and wish to debug both. You can enable this using `localStorage.debug`: - -```js -localStorage.debug = 'worker:*' -``` - -And then refresh the page. - -```js -a = debug('worker:a'); -b = debug('worker:b'); - -setInterval(function(){ - a('doing some work'); -}, 1000); - -setInterval(function(){ - b('doing some work'); -}, 1200); -``` - - -## Output streams - - By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: - -Example [_stdout.js_](./examples/node/stdout.js): - -```js -var debug = require('debug'); -var error = debug('app:error'); - -// by default stderr is used -error('goes to stderr!'); - -var log = debug('app:log'); -// set this namespace to log via console.log -log.log = console.log.bind(console); // don't forget to bind to console! -log('goes to stdout'); -error('still goes to stderr!'); - -// set all output to go via console.info -// overrides all per-namespace log settings -debug.log = console.info.bind(console); -error('now goes to stdout via console.info'); -log('still goes to stdout, but via console.info now'); -``` - -## Checking whether a debug target is enabled - -After you've created a debug instance, you can determine whether or not it is -enabled by checking the `enabled` property: - -```javascript -const debug = require('debug')('http'); - -if (debug.enabled) { - // do stuff... -} -``` - -You can also manually toggle this property to force the debug instance to be -enabled or disabled. - - -## Authors - - - TJ Holowaychuk - - Nathan Rajlich - - Andrew Rhyne - -## Backers - -Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -## Sponsors - -Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -## License - -(The MIT License) - -Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/component.json b/node_modules/debug/component.json deleted file mode 100644 index a2e9ad3..0000000 --- a/node_modules/debug/component.json +++ /dev/null @@ -1,19 +0,0 @@ -{ - "name": "debug", - "repo": "visionmedia/debug", - "description": "small debugging utility", - "version": "3.0.1", - "keywords": [ - "debug", - "log", - "debugger" - ], - "main": "src/browser.js", - "scripts": [ - "src/browser.js", - "src/debug.js" - ], - "dependencies": { - "rauchg/ms.js": "2.0.0" - } -} diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js deleted file mode 100644 index 103a82d..0000000 --- a/node_modules/debug/karma.conf.js +++ /dev/null @@ -1,70 +0,0 @@ -// Karma configuration -// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) - -module.exports = function(config) { - config.set({ - - // base path that will be used to resolve all patterns (eg. files, exclude) - basePath: '', - - - // frameworks to use - // available frameworks: https://npmjs.org/browse/keyword/karma-adapter - frameworks: ['mocha', 'chai', 'sinon'], - - - // list of files / patterns to load in the browser - files: [ - 'dist/debug.js', - 'test/*spec.js' - ], - - - // list of files to exclude - exclude: [ - 'src/node.js' - ], - - - // preprocess matching files before serving them to the browser - // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor - preprocessors: { - }, - - // test results reporter to use - // possible values: 'dots', 'progress' - // available reporters: https://npmjs.org/browse/keyword/karma-reporter - reporters: ['progress'], - - - // web server port - port: 9876, - - - // enable / disable colors in the output (reporters and logs) - colors: true, - - - // level of logging - // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG - logLevel: config.LOG_INFO, - - - // enable / disable watching file and executing tests whenever any file changes - autoWatch: true, - - - // start these browsers - // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher - browsers: ['PhantomJS'], - - - // Continuous Integration mode - // if true, Karma captures browsers, runs the tests and exits - singleRun: false, - - // Concurrency level - // how many browser should be started simultaneous - concurrency: Infinity - }) -} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js deleted file mode 100644 index 7fc36fe..0000000 --- a/node_modules/debug/node.js +++ /dev/null @@ -1 +0,0 @@ -module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json deleted file mode 100644 index 1514200..0000000 --- a/node_modules/debug/package.json +++ /dev/null @@ -1,49 +0,0 @@ -{ - "name": "debug", - "version": "3.0.1", - "repository": { - "type": "git", - "url": "git://github.com/visionmedia/debug.git" - }, - "description": "small debugging utility", - "keywords": [ - "debug", - "log", - "debugger" - ], - "author": "TJ Holowaychuk ", - "contributors": [ - "Nathan Rajlich (http://n8.io)", - "Andrew Rhyne " - ], - "license": "MIT", - "dependencies": { - "ms": "2.0.0" - }, - "devDependencies": { - "browserify": "14.4.0", - "chai": "^3.5.0", - "concurrently": "^3.1.0", - "coveralls": "^2.11.15", - "eslint": "^3.12.1", - "istanbul": "^0.4.5", - "karma": "^1.3.0", - "karma-chai": "^0.1.0", - "karma-mocha": "^1.3.0", - "karma-phantomjs-launcher": "^1.0.2", - "karma-sinon": "^1.0.5", - "mocha": "^3.2.0", - "mocha-lcov-reporter": "^1.2.0", - "rimraf": "^2.5.4", - "sinon": "^1.17.6", - "sinon-chai": "^2.8.0" - }, - "main": "./src/index.js", - "browser": "./src/browser.js", - "component": { - "scripts": { - "debug/index.js": "browser.js", - "debug/debug.js": "debug.js" - } - } -} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js deleted file mode 100644 index f5149ff..0000000 --- a/node_modules/debug/src/browser.js +++ /dev/null @@ -1,195 +0,0 @@ -/** - * This is the web browser implementation of `debug()`. - * - * Expose `debug()` as the module. - */ - -exports = module.exports = require('./debug'); -exports.log = log; -exports.formatArgs = formatArgs; -exports.save = save; -exports.load = load; -exports.useColors = useColors; -exports.storage = 'undefined' != typeof chrome - && 'undefined' != typeof chrome.storage - ? chrome.storage.local - : localstorage(); - -/** - * Colors. - */ - -exports.colors = [ - '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', - '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', - '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', - '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', - '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', - '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', - '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', - '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', - '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', - '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', - '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33' -]; - -/** - * Currently only WebKit-based Web Inspectors, Firefox >= v31, - * and the Firebug extension (any Firefox version) are known - * to support "%c" CSS customizations. - * - * TODO: add a `localStorage` variable to explicitly enable/disable colors - */ - -function useColors() { - // NB: In an Electron preload script, document will be defined but not fully - // initialized. Since we know we're in Chrome, we'll just detect this case - // explicitly - if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { - return true; - } - - // Internet Explorer and Edge do not support colors. - if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { - return false; - } - - // is webkit? http://stackoverflow.com/a/16459606/376773 - // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 - return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || - // is firebug? http://stackoverflow.com/a/398120/376773 - (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || - // is firefox >= v31? - // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages - (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || - // double check webkit in userAgent just in case we are in a worker - (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); -} - -/** - * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. - */ - -exports.formatters.j = function(v) { - try { - return JSON.stringify(v); - } catch (err) { - return '[UnexpectedJSONParseError]: ' + err.message; - } -}; - - -/** - * Colorize log arguments if enabled. - * - * @api public - */ - -function formatArgs(args) { - var useColors = this.useColors; - - args[0] = (useColors ? '%c' : '') - + this.namespace - + (useColors ? ' %c' : ' ') - + args[0] - + (useColors ? '%c ' : ' ') - + '+' + exports.humanize(this.diff); - - if (!useColors) return; - - var c = 'color: ' + this.color; - args.splice(1, 0, c, 'color: inherit') - - // the final "%c" is somewhat tricky, because there could be other - // arguments passed either before or after the %c, so we need to - // figure out the correct index to insert the CSS into - var index = 0; - var lastC = 0; - args[0].replace(/%[a-zA-Z%]/g, function(match) { - if ('%%' === match) return; - index++; - if ('%c' === match) { - // we only are interested in the *last* %c - // (the user may have provided their own) - lastC = index; - } - }); - - args.splice(lastC, 0, c); -} - -/** - * Invokes `console.log()` when available. - * No-op when `console.log` is not a "function". - * - * @api public - */ - -function log() { - // this hackery is required for IE8/9, where - // the `console.log` function doesn't have 'apply' - return 'object' === typeof console - && console.log - && Function.prototype.apply.call(console.log, console, arguments); -} - -/** - * Save `namespaces`. - * - * @param {String} namespaces - * @api private - */ - -function save(namespaces) { - try { - if (null == namespaces) { - exports.storage.removeItem('debug'); - } else { - exports.storage.debug = namespaces; - } - } catch(e) {} -} - -/** - * Load `namespaces`. - * - * @return {String} returns the previously persisted debug modes - * @api private - */ - -function load() { - var r; - try { - r = exports.storage.debug; - } catch(e) {} - - // If debug isn't set in LS, and we're in Electron, try to load $DEBUG - if (!r && typeof process !== 'undefined' && 'env' in process) { - r = process.env.DEBUG; - } - - return r; -} - -/** - * Enable namespaces listed in `localStorage.debug` initially. - */ - -exports.enable(load()); - -/** - * Localstorage attempts to return the localstorage. - * - * This is necessary because safari throws - * when a user disables cookies/localstorage - * and you attempt to access it. - * - * @return {LocalStorage} - * @api private - */ - -function localstorage() { - try { - return window.localStorage; - } catch (e) {} -} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js deleted file mode 100644 index 77e6384..0000000 --- a/node_modules/debug/src/debug.js +++ /dev/null @@ -1,225 +0,0 @@ - -/** - * This is the common logic for both the Node.js and web browser - * implementations of `debug()`. - * - * Expose `debug()` as the module. - */ - -exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; -exports.coerce = coerce; -exports.disable = disable; -exports.enable = enable; -exports.enabled = enabled; -exports.humanize = require('ms'); - -/** - * Active `debug` instances. - */ -exports.instances = []; - -/** - * The currently active debug mode names, and names to skip. - */ - -exports.names = []; -exports.skips = []; - -/** - * Map of special "%n" handling functions, for the debug "format" argument. - * - * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". - */ - -exports.formatters = {}; - -/** - * Select a color. - * @param {String} namespace - * @return {Number} - * @api private - */ - -function selectColor(namespace) { - var hash = 0, i; - - for (i in namespace) { - hash = ((hash << 5) - hash) + namespace.charCodeAt(i); - hash |= 0; // Convert to 32bit integer - } - - return exports.colors[Math.abs(hash) % exports.colors.length]; -} - -/** - * Create a debugger with the given `namespace`. - * - * @param {String} namespace - * @return {Function} - * @api public - */ - -function createDebug(namespace) { - - var prevTime; - - function debug() { - // disabled? - if (!debug.enabled) return; - - var self = debug; - - // set `diff` timestamp - var curr = +new Date(); - var ms = curr - (prevTime || curr); - self.diff = ms; - self.prev = prevTime; - self.curr = curr; - prevTime = curr; - - // turn the `arguments` into a proper Array - var args = new Array(arguments.length); - for (var i = 0; i < args.length; i++) { - args[i] = arguments[i]; - } - - args[0] = exports.coerce(args[0]); - - if ('string' !== typeof args[0]) { - // anything else let's inspect with %O - args.unshift('%O'); - } - - // apply any `formatters` transformations - var index = 0; - args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { - // if we encounter an escaped % then don't increase the array index - if (match === '%%') return match; - index++; - var formatter = exports.formatters[format]; - if ('function' === typeof formatter) { - var val = args[index]; - match = formatter.call(self, val); - - // now we need to remove `args[index]` since it's inlined in the `format` - args.splice(index, 1); - index--; - } - return match; - }); - - // apply env-specific formatting (colors, etc.) - exports.formatArgs.call(self, args); - - var logFn = debug.log || exports.log || console.log.bind(console); - logFn.apply(self, args); - } - - debug.namespace = namespace; - debug.enabled = exports.enabled(namespace); - debug.useColors = exports.useColors(); - debug.color = selectColor(namespace); - debug.destroy = destroy; - - // env-specific initialization logic for debug instances - if ('function' === typeof exports.init) { - exports.init(debug); - } - - exports.instances.push(debug); - - return debug; -} - -function destroy () { - var index = exports.instances.indexOf(this); - if (index !== -1) { - exports.instances.splice(index, 1); - return true; - } else { - return false; - } -} - -/** - * Enables a debug mode by namespaces. This can include modes - * separated by a colon and wildcards. - * - * @param {String} namespaces - * @api public - */ - -function enable(namespaces) { - exports.save(namespaces); - - exports.names = []; - exports.skips = []; - - var i; - var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); - var len = split.length; - - for (i = 0; i < len; i++) { - if (!split[i]) continue; // ignore empty strings - namespaces = split[i].replace(/\*/g, '.*?'); - if (namespaces[0] === '-') { - exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); - } else { - exports.names.push(new RegExp('^' + namespaces + '$')); - } - } - - for (i = 0; i < exports.instances.length; i++) { - var instance = exports.instances[i]; - instance.enabled = exports.enabled(instance.namespace); - } -} - -/** - * Disable debug output. - * - * @api public - */ - -function disable() { - exports.enable(''); -} - -/** - * Returns true if the given mode name is enabled, false otherwise. - * - * @param {String} name - * @return {Boolean} - * @api public - */ - -function enabled(name) { - if (name[name.length - 1] === '*') { - return true; - } - var i, len; - for (i = 0, len = exports.skips.length; i < len; i++) { - if (exports.skips[i].test(name)) { - return false; - } - } - for (i = 0, len = exports.names.length; i < len; i++) { - if (exports.names[i].test(name)) { - return true; - } - } - return false; -} - -/** - * Coerce `val`. - * - * @param {Mixed} val - * @return {Mixed} - * @api private - */ - -function coerce(val) { - if (val instanceof Error) return val.stack || val.message; - return val; -} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js deleted file mode 100644 index e12cf4d..0000000 --- a/node_modules/debug/src/index.js +++ /dev/null @@ -1,10 +0,0 @@ -/** - * Detect Electron renderer process, which is node, but we should - * treat as a browser. - */ - -if (typeof process !== 'undefined' && process.type === 'renderer') { - module.exports = require('./browser.js'); -} else { - module.exports = require('./node.js'); -} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js deleted file mode 100644 index b85ec7e..0000000 --- a/node_modules/debug/src/node.js +++ /dev/null @@ -1,177 +0,0 @@ -/** - * Module dependencies. - */ - -var tty = require('tty'); -var util = require('util'); - -/** - * This is the Node.js implementation of `debug()`. - * - * Expose `debug()` as the module. - */ - -exports = module.exports = require('./debug'); -exports.init = init; -exports.log = log; -exports.formatArgs = formatArgs; -exports.save = save; -exports.load = load; -exports.useColors = useColors; - -/** - * Colors. - */ - -exports.colors = [ 6, 2, 3, 4, 5, 1 ]; - -try { - var supportsColor = require('supports-color'); - if (supportsColor && supportsColor.level >= 2) { - exports.colors = [ - 20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, - 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, - 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, - 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, - 205, 206, 207, 208, 209, 214, 215, 220, 221 - ]; - } -} catch (err) { - // swallow - we only care if `supports-color` is available; it doesn't have to be. -} - -/** - * Build up the default `inspectOpts` object from the environment variables. - * - * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js - */ - -exports.inspectOpts = Object.keys(process.env).filter(function (key) { - return /^debug_/i.test(key); -}).reduce(function (obj, key) { - // camel-case - var prop = key - .substring(6) - .toLowerCase() - .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); - - // coerce string value into JS value - var val = process.env[key]; - if (/^(yes|on|true|enabled)$/i.test(val)) val = true; - else if (/^(no|off|false|disabled)$/i.test(val)) val = false; - else if (val === 'null') val = null; - else val = Number(val); - - obj[prop] = val; - return obj; -}, {}); - -/** - * Is stdout a TTY? Colored output is enabled when `true`. - */ - -function useColors() { - return 'colors' in exports.inspectOpts - ? Boolean(exports.inspectOpts.colors) - : tty.isatty(process.stderr.fd); -} - -/** - * Map %o to `util.inspect()`, all on a single line. - */ - -exports.formatters.o = function(v) { - this.inspectOpts.colors = this.useColors; - return util.inspect(v, this.inspectOpts) - .replace(/\s*\n\s*/g, ' '); -}; - -/** - * Map %o to `util.inspect()`, allowing multiple lines if needed. - */ - -exports.formatters.O = function(v) { - this.inspectOpts.colors = this.useColors; - return util.inspect(v, this.inspectOpts); -}; - -/** - * Adds ANSI color escape codes if enabled. - * - * @api public - */ - -function formatArgs(args) { - var name = this.namespace; - var useColors = this.useColors; - - if (useColors) { - var c = this.color; - var colorCode = '\u001b[3' + (c < 8 ? c : '8;5;' + c); - var prefix = ' ' + colorCode + ';1m' + name + ' ' + '\u001b[0m'; - - args[0] = prefix + args[0].split('\n').join('\n' + prefix); - args.push(colorCode + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); - } else { - args[0] = new Date().toISOString() - + ' ' + name + ' ' + args[0]; - } -} - -/** - * Invokes `util.format()` with the specified arguments and writes to stderr. - */ - -function log() { - return process.stderr.write(util.format.apply(util, arguments) + '\n'); -} - -/** - * Save `namespaces`. - * - * @param {String} namespaces - * @api private - */ - -function save(namespaces) { - if (null == namespaces) { - // If you set a process.env field to null or undefined, it gets cast to the - // string 'null' or 'undefined'. Just delete instead. - delete process.env.DEBUG; - } else { - process.env.DEBUG = namespaces; - } -} - -/** - * Load `namespaces`. - * - * @return {String} returns the previously persisted debug modes - * @api private - */ - -function load() { - return process.env.DEBUG; -} - -/** - * Init logic for `debug` instances. - * - * Create a new `inspectOpts` object in case `useColors` is set - * differently for a particular `debug` instance. - */ - -function init (debug) { - debug.inspectOpts = {}; - - var keys = Object.keys(exports.inspectOpts); - for (var i = 0; i < keys.length; i++) { - debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; - } -} - -/** - * Enable namespaces listed in `process.env.DEBUG` initially. - */ - -exports.enable(load()); diff --git a/node_modules/diff/README.md b/node_modules/diff/README.md deleted file mode 100644 index 95bd8da..0000000 --- a/node_modules/diff/README.md +++ /dev/null @@ -1,101 +0,0 @@ -# jsdiff - -[![Build Status](https://secure.travis-ci.org/kpdecker/jsdiff.png)](http://travis-ci.org/kpdecker/jsdiff) - -A javascript text differencing implementation. - -Based on the algorithm proposed in -["An O(ND) Difference Algorithm and its Variations" (Myers, 1986)](http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927). - -## Installation - - npm install diff - -or - - git clone git://github.com/kpdecker/jsdiff.git - -## API - -* JsDiff.diffChars(oldStr, newStr) - Diffs two blocks of text, comparing character by character. - - Returns a list of change objects (See below). - -* JsDiff.diffWords(oldStr, newStr) - Diffs two blocks of text, comparing word by word. - - Returns a list of change objects (See below). - -* JsDiff.diffLines(oldStr, newStr) - Diffs two blocks of text, comparing line by line. - - Returns a list of change objects (See below). - -* JsDiff.diffCss(oldStr, newStr) - Diffs two blocks of text, comparing CSS tokens. - - Returns a list of change objects (See below). - -* JsDiff.createPatch(fileName, oldStr, newStr, oldHeader, newHeader) - Creates a unified diff patch. - - Parameters: - * fileName : String to be output in the filename sections of the patch - * oldStr : Original string value - * newStr : New string value - * oldHeader : Additional information to include in the old file header - * newHeader : Additional information to include in thew new file header - -* JsDiff.applyPatch(oldStr, diffStr) - Applies a unified diff patch. - - Return a string containing new version of provided data. - -* convertChangesToXML(changes) - Converts a list of changes to a serialized XML format - -### Change Objects -Many of the methods above return change objects. These objects are consist of the following fields: - -* value: Text content -* added: True if the value was inserted into the new string -* removed: True of the value was removed from the old string - -Note that some cases may omit a particular flag field. Comparison on the flag fields should always be done in a truthy or falsy manner. - -## [Example](http://kpdecker.github.com/jsdiff) - -## License - -Software License Agreement (BSD License) - -Copyright (c) 2009-2011, Kevin Decker kpdecker@gmail.com - -All rights reserved. - -Redistribution and use of this software in source and binary forms, with or without modification, -are permitted provided that the following conditions are met: - -* Redistributions of source code must retain the above - copyright notice, this list of conditions and the - following disclaimer. - -* Redistributions in binary form must reproduce the above - copyright notice, this list of conditions and the - following disclaimer in the documentation and/or other - materials provided with the distribution. - -* Neither the name of Kevin Decker nor the names of its - contributors may be used to endorse or promote products - derived from this software without specific prior - written permission. - -THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR -IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND -FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR -CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL -DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, -DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER -IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT -OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/diff/diff.js b/node_modules/diff/diff.js deleted file mode 100644 index a34c22a..0000000 --- a/node_modules/diff/diff.js +++ /dev/null @@ -1,354 +0,0 @@ -/* See LICENSE file for terms of use */ - -/* - * Text diff implementation. - * - * This library supports the following APIS: - * JsDiff.diffChars: Character by character diff - * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace - * JsDiff.diffLines: Line based diff - * - * JsDiff.diffCss: Diff targeted at CSS content - * - * These methods are based on the implementation proposed in - * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986). - * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927 - */ -var JsDiff = (function() { - /*jshint maxparams: 5*/ - function clonePath(path) { - return { newPos: path.newPos, components: path.components.slice(0) }; - } - function removeEmpty(array) { - var ret = []; - for (var i = 0; i < array.length; i++) { - if (array[i]) { - ret.push(array[i]); - } - } - return ret; - } - function escapeHTML(s) { - var n = s; - n = n.replace(/&/g, '&'); - n = n.replace(//g, '>'); - n = n.replace(/"/g, '"'); - - return n; - } - - var Diff = function(ignoreWhitespace) { - this.ignoreWhitespace = ignoreWhitespace; - }; - Diff.prototype = { - diff: function(oldString, newString) { - // Handle the identity case (this is due to unrolling editLength == 0 - if (newString === oldString) { - return [{ value: newString }]; - } - if (!newString) { - return [{ value: oldString, removed: true }]; - } - if (!oldString) { - return [{ value: newString, added: true }]; - } - - newString = this.tokenize(newString); - oldString = this.tokenize(oldString); - - var newLen = newString.length, oldLen = oldString.length; - var maxEditLength = newLen + oldLen; - var bestPath = [{ newPos: -1, components: [] }]; - - // Seed editLength = 0 - var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0); - if (bestPath[0].newPos+1 >= newLen && oldPos+1 >= oldLen) { - return bestPath[0].components; - } - - for (var editLength = 1; editLength <= maxEditLength; editLength++) { - for (var diagonalPath = -1*editLength; diagonalPath <= editLength; diagonalPath+=2) { - var basePath; - var addPath = bestPath[diagonalPath-1], - removePath = bestPath[diagonalPath+1]; - oldPos = (removePath ? removePath.newPos : 0) - diagonalPath; - if (addPath) { - // No one else is going to attempt to use this value, clear it - bestPath[diagonalPath-1] = undefined; - } - - var canAdd = addPath && addPath.newPos+1 < newLen; - var canRemove = removePath && 0 <= oldPos && oldPos < oldLen; - if (!canAdd && !canRemove) { - bestPath[diagonalPath] = undefined; - continue; - } - - // Select the diagonal that we want to branch from. We select the prior - // path whose position in the new string is the farthest from the origin - // and does not pass the bounds of the diff graph - if (!canAdd || (canRemove && addPath.newPos < removePath.newPos)) { - basePath = clonePath(removePath); - this.pushComponent(basePath.components, oldString[oldPos], undefined, true); - } else { - basePath = clonePath(addPath); - basePath.newPos++; - this.pushComponent(basePath.components, newString[basePath.newPos], true, undefined); - } - - var oldPos = this.extractCommon(basePath, newString, oldString, diagonalPath); - - if (basePath.newPos+1 >= newLen && oldPos+1 >= oldLen) { - return basePath.components; - } else { - bestPath[diagonalPath] = basePath; - } - } - } - }, - - pushComponent: function(components, value, added, removed) { - var last = components[components.length-1]; - if (last && last.added === added && last.removed === removed) { - // We need to clone here as the component clone operation is just - // as shallow array clone - components[components.length-1] = - {value: this.join(last.value, value), added: added, removed: removed }; - } else { - components.push({value: value, added: added, removed: removed }); - } - }, - extractCommon: function(basePath, newString, oldString, diagonalPath) { - var newLen = newString.length, - oldLen = oldString.length, - newPos = basePath.newPos, - oldPos = newPos - diagonalPath; - while (newPos+1 < newLen && oldPos+1 < oldLen && this.equals(newString[newPos+1], oldString[oldPos+1])) { - newPos++; - oldPos++; - - this.pushComponent(basePath.components, newString[newPos], undefined, undefined); - } - basePath.newPos = newPos; - return oldPos; - }, - - equals: function(left, right) { - var reWhitespace = /\S/; - if (this.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right)) { - return true; - } else { - return left === right; - } - }, - join: function(left, right) { - return left + right; - }, - tokenize: function(value) { - return value; - } - }; - - var CharDiff = new Diff(); - - var WordDiff = new Diff(true); - var WordWithSpaceDiff = new Diff(); - WordDiff.tokenize = WordWithSpaceDiff.tokenize = function(value) { - return removeEmpty(value.split(/(\s+|\b)/)); - }; - - var CssDiff = new Diff(true); - CssDiff.tokenize = function(value) { - return removeEmpty(value.split(/([{}:;,]|\s+)/)); - }; - - var LineDiff = new Diff(); - LineDiff.tokenize = function(value) { - return value.split(/^/m); - }; - - return { - Diff: Diff, - - diffChars: function(oldStr, newStr) { return CharDiff.diff(oldStr, newStr); }, - diffWords: function(oldStr, newStr) { return WordDiff.diff(oldStr, newStr); }, - diffWordsWithSpace: function(oldStr, newStr) { return WordWithSpaceDiff.diff(oldStr, newStr); }, - diffLines: function(oldStr, newStr) { return LineDiff.diff(oldStr, newStr); }, - - diffCss: function(oldStr, newStr) { return CssDiff.diff(oldStr, newStr); }, - - createPatch: function(fileName, oldStr, newStr, oldHeader, newHeader) { - var ret = []; - - ret.push('Index: ' + fileName); - ret.push('==================================================================='); - ret.push('--- ' + fileName + (typeof oldHeader === 'undefined' ? '' : '\t' + oldHeader)); - ret.push('+++ ' + fileName + (typeof newHeader === 'undefined' ? '' : '\t' + newHeader)); - - var diff = LineDiff.diff(oldStr, newStr); - if (!diff[diff.length-1].value) { - diff.pop(); // Remove trailing newline add - } - diff.push({value: '', lines: []}); // Append an empty value to make cleanup easier - - function contextLines(lines) { - return lines.map(function(entry) { return ' ' + entry; }); - } - function eofNL(curRange, i, current) { - var last = diff[diff.length-2], - isLast = i === diff.length-2, - isLastOfType = i === diff.length-3 && (current.added !== last.added || current.removed !== last.removed); - - // Figure out if this is the last line for the given file and missing NL - if (!/\n$/.test(current.value) && (isLast || isLastOfType)) { - curRange.push('\\ No newline at end of file'); - } - } - - var oldRangeStart = 0, newRangeStart = 0, curRange = [], - oldLine = 1, newLine = 1; - for (var i = 0; i < diff.length; i++) { - var current = diff[i], - lines = current.lines || current.value.replace(/\n$/, '').split('\n'); - current.lines = lines; - - if (current.added || current.removed) { - if (!oldRangeStart) { - var prev = diff[i-1]; - oldRangeStart = oldLine; - newRangeStart = newLine; - - if (prev) { - curRange = contextLines(prev.lines.slice(-4)); - oldRangeStart -= curRange.length; - newRangeStart -= curRange.length; - } - } - curRange.push.apply(curRange, lines.map(function(entry) { return (current.added?'+':'-') + entry; })); - eofNL(curRange, i, current); - - if (current.added) { - newLine += lines.length; - } else { - oldLine += lines.length; - } - } else { - if (oldRangeStart) { - // Close out any changes that have been output (or join overlapping) - if (lines.length <= 8 && i < diff.length-2) { - // Overlapping - curRange.push.apply(curRange, contextLines(lines)); - } else { - // end the range and output - var contextSize = Math.min(lines.length, 4); - ret.push( - '@@ -' + oldRangeStart + ',' + (oldLine-oldRangeStart+contextSize) - + ' +' + newRangeStart + ',' + (newLine-newRangeStart+contextSize) - + ' @@'); - ret.push.apply(ret, curRange); - ret.push.apply(ret, contextLines(lines.slice(0, contextSize))); - if (lines.length <= 4) { - eofNL(ret, i, current); - } - - oldRangeStart = 0; newRangeStart = 0; curRange = []; - } - } - oldLine += lines.length; - newLine += lines.length; - } - } - - return ret.join('\n') + '\n'; - }, - - applyPatch: function(oldStr, uniDiff) { - var diffstr = uniDiff.split('\n'); - var diff = []; - var remEOFNL = false, - addEOFNL = false; - - for (var i = (diffstr[0][0]==='I'?4:0); i < diffstr.length; i++) { - if(diffstr[i][0] === '@') { - var meh = diffstr[i].split(/@@ -(\d+),(\d+) \+(\d+),(\d+) @@/); - diff.unshift({ - start:meh[3], - oldlength:meh[2], - oldlines:[], - newlength:meh[4], - newlines:[] - }); - } else if(diffstr[i][0] === '+') { - diff[0].newlines.push(diffstr[i].substr(1)); - } else if(diffstr[i][0] === '-') { - diff[0].oldlines.push(diffstr[i].substr(1)); - } else if(diffstr[i][0] === ' ') { - diff[0].newlines.push(diffstr[i].substr(1)); - diff[0].oldlines.push(diffstr[i].substr(1)); - } else if(diffstr[i][0] === '\\') { - if (diffstr[i-1][0] === '+') { - remEOFNL = true; - } else if(diffstr[i-1][0] === '-') { - addEOFNL = true; - } - } - } - - var str = oldStr.split('\n'); - for (var i = diff.length - 1; i >= 0; i--) { - var d = diff[i]; - for (var j = 0; j < d.oldlength; j++) { - if(str[d.start-1+j] !== d.oldlines[j]) { - return false; - } - } - Array.prototype.splice.apply(str,[d.start-1,+d.oldlength].concat(d.newlines)); - } - - if (remEOFNL) { - while (!str[str.length-1]) { - str.pop(); - } - } else if (addEOFNL) { - str.push(''); - } - return str.join('\n'); - }, - - convertChangesToXML: function(changes){ - var ret = []; - for ( var i = 0; i < changes.length; i++) { - var change = changes[i]; - if (change.added) { - ret.push(''); - } else if (change.removed) { - ret.push(''); - } - - ret.push(escapeHTML(change.value)); - - if (change.added) { - ret.push(''); - } else if (change.removed) { - ret.push(''); - } - } - return ret.join(''); - }, - - // See: http://code.google.com/p/google-diff-match-patch/wiki/API - convertChangesToDMP: function(changes){ - var ret = [], change; - for ( var i = 0; i < changes.length; i++) { - change = changes[i]; - ret.push([(change.added ? 1 : change.removed ? -1 : 0), change.value]); - } - return ret; - } - }; -})(); - -if (typeof module !== 'undefined') { - module.exports = JsDiff; -} diff --git a/node_modules/diff/package.json b/node_modules/diff/package.json deleted file mode 100644 index 4c5d6fc..0000000 --- a/node_modules/diff/package.json +++ /dev/null @@ -1,42 +0,0 @@ -{ - "name": "diff", - "version": "1.0.7", - "description": "A javascript text diff implementation.", - "keywords": [ - "diff", - "javascript" - ], - "maintainers": [ - "Kevin Decker (http://incaseofstairs.com)" - ], - "bugs": { - "email": "kpdecker@gmail.com", - "url": "http://github.com/kpdecker/jsdiff/issues" - }, - "licenses": [ - { - "type": "BSD", - "url": "http://github.com/kpdecker/jsdiff/blob/master/LICENSE" - } - ], - "repository": { - "type": "git", - "url": "git://github.com/kpdecker/jsdiff.git" - }, - "engines": { - "node": ">=0.3.1" - }, - "main": "./diff", - "scripts": { - "test": "node_modules/.bin/mocha test/*.js" - }, - "dependencies": {}, - "devDependencies": { - "mocha": "~1.6", - "should": "~1.2" - }, - "optionalDependencies": {}, - "files": [ - "diff.js" - ] -} diff --git a/node_modules/expect.js/.npmignore b/node_modules/expect.js/.npmignore deleted file mode 100644 index 26ef5d8..0000000 --- a/node_modules/expect.js/.npmignore +++ /dev/null @@ -1,3 +0,0 @@ -support -test -Makefile diff --git a/node_modules/expect.js/History.md b/node_modules/expect.js/History.md deleted file mode 100644 index e03f91f..0000000 --- a/node_modules/expect.js/History.md +++ /dev/null @@ -1,54 +0,0 @@ - -0.3.0 / 2014-02-20 -================== - - * renmaed to `index.js` - * added repository to package.json - * remove unused variable and merge - * simpify isDate() and remove unnecessary semicolon. - * Add .withArgs() syntax for building scenario - * eql(): fix wrong order of actual vs. expected. - * Added formatting for Error objects - * Add support for 'regexp' type and eql comparison of regular expressions. - * Better to follow the same coding style - * Use 'showDiff' flag - * Add 'actual' & 'expected' property to the thrown error - * Pass .fail() unit test - * Ignore 'script*' global leak in chrome - * Exposed object stringification function - * Use isRegExp in Assertion::throwException. Fix #25 - * Cleaned up local variables - -0.2.0 / 2012-10-19 -================== - - * fix isRegExp bug in some edge cases - * add closure to all assertion messages deferring costly inspects - until there is actually a failure - * fix `make test` for recent mochas - * add inspect() case for DOM elements - * relax failure msg null check - * add explicit failure through `expect().fail()` - * clarified all `empty` functionality in README example - * added docs for throwException fn/regexp signatures - -0.1.2 / 2012-02-04 -================== - - * Added regexp matching support for exceptions. - * Added support for throwException callback. - * Added `throwError` synonym to `throwException`. - * Added object support for `.empty`. - * Fixed `.a('object')` with nulls, and english error in error message. - * Fix bug `indexOf` (IE). [hokaccha] - * Fixed object property checking with `undefined` as value. [vovik] - -0.1.1 / 2011-12-18 -================== - - * Fixed typo - -0.1.0 / 2011-12-18 -================== - - * Initial import diff --git a/node_modules/expect.js/README.md b/node_modules/expect.js/README.md deleted file mode 100644 index 2683ed3..0000000 --- a/node_modules/expect.js/README.md +++ /dev/null @@ -1,263 +0,0 @@ -# Expect - -Minimalistic BDD assertion toolkit based on -[should.js](http://github.com/visionmedia/should.js) - -```js -expect(window.r).to.be(undefined); -expect({ a: 'b' }).to.eql({ a: 'b' }) -expect(5).to.be.a('number'); -expect([]).to.be.an('array'); -expect(window).not.to.be.an(Image); -``` - -## Features - -- Cross-browser: works on IE6+, Firefox, Safari, Chrome, Opera. -- Compatible with all test frameworks. -- Node.JS ready (`require('expect.js')`). -- Standalone. Single global with no prototype extensions or shims. - -## How to use - -### Node - -Install it with NPM or add it to your `package.json`: - -``` -$ npm install expect.js -``` - -Then: - -```js -var expect = require('expect.js'); -``` - -### Browser - -Expose the `expect.js` found at the top level of this repository. - -```html - -``` - -## API - -**ok**: asserts that the value is _truthy_ or not - -```js -expect(1).to.be.ok(); -expect(true).to.be.ok(); -expect({}).to.be.ok(); -expect(0).to.not.be.ok(); -``` - -**be** / **equal**: asserts `===` equality - -```js -expect(1).to.be(1) -expect(NaN).not.to.equal(NaN); -expect(1).not.to.be(true) -expect('1').to.not.be(1); -``` - -**eql**: asserts loose equality that works with objects - -```js -expect({ a: 'b' }).to.eql({ a: 'b' }); -expect(1).to.eql('1'); -``` - -**a**/**an**: asserts `typeof` with support for `array` type and `instanceof` - -```js -// typeof with optional `array` -expect(5).to.be.a('number'); -expect([]).to.be.an('array'); // works -expect([]).to.be.an('object'); // works too, since it uses `typeof` - -// constructors -expect(5).to.be.a(Number); -expect([]).to.be.an(Array); -expect(tobi).to.be.a(Ferret); -expect(person).to.be.a(Mammal); -``` - -**match**: asserts `String` regular expression match - -```js -expect(program.version).to.match(/[0-9]+\.[0-9]+\.[0-9]+/); -``` - -**contain**: asserts indexOf for an array or string - -```js -expect([1, 2]).to.contain(1); -expect('hello world').to.contain('world'); -``` - -**length**: asserts array `.length` - -```js -expect([]).to.have.length(0); -expect([1,2,3]).to.have.length(3); -``` - -**empty**: asserts that an array is empty or not - -```js -expect([]).to.be.empty(); -expect({}).to.be.empty(); -expect({ length: 0, duck: 'typing' }).to.be.empty(); -expect({ my: 'object' }).to.not.be.empty(); -expect([1,2,3]).to.not.be.empty(); -``` - -**property**: asserts presence of an own property (and value optionally) - -```js -expect(window).to.have.property('expect') -expect(window).to.have.property('expect', expect) -expect({a: 'b'}).to.have.property('a'); -``` - -**key**/**keys**: asserts the presence of a key. Supports the `only` modifier - -```js -expect({ a: 'b' }).to.have.key('a'); -expect({ a: 'b', c: 'd' }).to.only.have.keys('a', 'c'); -expect({ a: 'b', c: 'd' }).to.only.have.keys(['a', 'c']); -expect({ a: 'b', c: 'd' }).to.not.only.have.key('a'); -``` - -**throwException**/**throwError**: asserts that the `Function` throws or not when called - -```js -expect(fn).to.throwError(); // synonym of throwException -expect(fn).to.throwException(function (e) { // get the exception object - expect(e).to.be.a(SyntaxError); -}); -expect(fn).to.throwException(/matches the exception message/); -expect(fn2).to.not.throwException(); -``` - -**withArgs**: creates anonymous function to call fn with arguments - -```js -expect(fn).withArgs(invalid, arg).to.throwException(); -expect(fn).withArgs(valid, arg).to.not.throwException(); -``` - -**within**: asserts a number within a range - -```js -expect(1).to.be.within(0, Infinity); -``` - -**greaterThan**/**above**: asserts `>` - -```js -expect(3).to.be.above(0); -expect(5).to.be.greaterThan(3); -``` - -**lessThan**/**below**: asserts `<` - -```js -expect(0).to.be.below(3); -expect(1).to.be.lessThan(3); -``` - -**fail**: explicitly forces failure. - -```js -expect().fail() -expect().fail("Custom failure message") -``` - -## Using with a test framework - -For example, if you create a test suite with -[mocha](http://github.com/visionmedia/mocha). - -Let's say we wanted to test the following program: - -**math.js** - -```js -function add (a, b) { return a + b; }; -``` - -Our test file would look like this: - -```js -describe('test suite', function () { - it('should expose a function', function () { - expect(add).to.be.a('function'); - }); - - it('should do math', function () { - expect(add(1, 3)).to.equal(4); - }); -}); -``` - -If a certain expectation fails, an exception will be raised which gets captured -and shown/processed by the test runner. - -## Differences with should.js - -- No need for static `should` methods like `should.strictEqual`. For example, - `expect(obj).to.be(undefined)` works well. -- Some API simplifications / changes. -- API changes related to browser compatibility. - -## Running tests - -Clone the repository and install the developer dependencies: - -``` -git clone git://github.com/LearnBoost/expect.js.git expect -cd expect && npm install -``` - -### Node - -`make test` - -### Browser - -`make test-browser` - -and point your browser(s) to `http://localhost:3000/test/` - -## Credits - -(The MIT License) - -Copyright (c) 2011 Guillermo Rauch <guillermo@learnboost.com> - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. - -### 3rd-party - -Heavily borrows from [should.js](http://github.com/visionmedia/should.js) by TJ -Holowaychuck - MIT. diff --git a/node_modules/expect.js/index.js b/node_modules/expect.js/index.js deleted file mode 100644 index b1e921d..0000000 --- a/node_modules/expect.js/index.js +++ /dev/null @@ -1,1284 +0,0 @@ -(function (global, module) { - - var exports = module.exports; - - /** - * Exports. - */ - - module.exports = expect; - expect.Assertion = Assertion; - - /** - * Exports version. - */ - - expect.version = '0.3.1'; - - /** - * Possible assertion flags. - */ - - var flags = { - not: ['to', 'be', 'have', 'include', 'only'] - , to: ['be', 'have', 'include', 'only', 'not'] - , only: ['have'] - , have: ['own'] - , be: ['an'] - }; - - function expect (obj) { - return new Assertion(obj); - } - - /** - * Constructor - * - * @api private - */ - - function Assertion (obj, flag, parent) { - this.obj = obj; - this.flags = {}; - - if (undefined != parent) { - this.flags[flag] = true; - - for (var i in parent.flags) { - if (parent.flags.hasOwnProperty(i)) { - this.flags[i] = true; - } - } - } - - var $flags = flag ? flags[flag] : keys(flags) - , self = this; - - if ($flags) { - for (var i = 0, l = $flags.length; i < l; i++) { - // avoid recursion - if (this.flags[$flags[i]]) continue; - - var name = $flags[i] - , assertion = new Assertion(this.obj, name, this) - - if ('function' == typeof Assertion.prototype[name]) { - // clone the function, make sure we dont touch the prot reference - var old = this[name]; - this[name] = function () { - return old.apply(self, arguments); - }; - - for (var fn in Assertion.prototype) { - if (Assertion.prototype.hasOwnProperty(fn) && fn != name) { - this[name][fn] = bind(assertion[fn], assertion); - } - } - } else { - this[name] = assertion; - } - } - } - } - - /** - * Performs an assertion - * - * @api private - */ - - Assertion.prototype.assert = function (truth, msg, error, expected) { - var msg = this.flags.not ? error : msg - , ok = this.flags.not ? !truth : truth - , err; - - if (!ok) { - err = new Error(msg.call(this)); - if (arguments.length > 3) { - err.actual = this.obj; - err.expected = expected; - err.showDiff = true; - } - throw err; - } - - this.and = new Assertion(this.obj); - }; - - /** - * Check if the value is truthy - * - * @api public - */ - - Assertion.prototype.ok = function () { - this.assert( - !!this.obj - , function(){ return 'expected ' + i(this.obj) + ' to be truthy' } - , function(){ return 'expected ' + i(this.obj) + ' to be falsy' }); - }; - - /** - * Creates an anonymous function which calls fn with arguments. - * - * @api public - */ - - Assertion.prototype.withArgs = function() { - expect(this.obj).to.be.a('function'); - var fn = this.obj; - var args = Array.prototype.slice.call(arguments); - return expect(function() { fn.apply(null, args); }); - }; - - /** - * Assert that the function throws. - * - * @param {Function|RegExp} callback, or regexp to match error string against - * @api public - */ - - Assertion.prototype.throwError = - Assertion.prototype.throwException = function (fn) { - expect(this.obj).to.be.a('function'); - - var thrown = false - , not = this.flags.not; - - try { - this.obj(); - } catch (e) { - if (isRegExp(fn)) { - var subject = 'string' == typeof e ? e : e.message; - if (not) { - expect(subject).to.not.match(fn); - } else { - expect(subject).to.match(fn); - } - } else if ('function' == typeof fn) { - fn(e); - } - thrown = true; - } - - if (isRegExp(fn) && not) { - // in the presence of a matcher, ensure the `not` only applies to - // the matching. - this.flags.not = false; - } - - var name = this.obj.name || 'fn'; - this.assert( - thrown - , function(){ return 'expected ' + name + ' to throw an exception' } - , function(){ return 'expected ' + name + ' not to throw an exception' }); - }; - - /** - * Checks if the array is empty. - * - * @api public - */ - - Assertion.prototype.empty = function () { - var expectation; - - if ('object' == typeof this.obj && null !== this.obj && !isArray(this.obj)) { - if ('number' == typeof this.obj.length) { - expectation = !this.obj.length; - } else { - expectation = !keys(this.obj).length; - } - } else { - if ('string' != typeof this.obj) { - expect(this.obj).to.be.an('object'); - } - - expect(this.obj).to.have.property('length'); - expectation = !this.obj.length; - } - - this.assert( - expectation - , function(){ return 'expected ' + i(this.obj) + ' to be empty' } - , function(){ return 'expected ' + i(this.obj) + ' to not be empty' }); - return this; - }; - - /** - * Checks if the obj exactly equals another. - * - * @api public - */ - - Assertion.prototype.be = - Assertion.prototype.equal = function (obj) { - this.assert( - obj === this.obj - , function(){ return 'expected ' + i(this.obj) + ' to equal ' + i(obj) } - , function(){ return 'expected ' + i(this.obj) + ' to not equal ' + i(obj) }); - return this; - }; - - /** - * Checks if the obj sortof equals another. - * - * @api public - */ - - Assertion.prototype.eql = function (obj) { - this.assert( - expect.eql(this.obj, obj) - , function(){ return 'expected ' + i(this.obj) + ' to sort of equal ' + i(obj) } - , function(){ return 'expected ' + i(this.obj) + ' to sort of not equal ' + i(obj) } - , obj); - return this; - }; - - /** - * Assert within start to finish (inclusive). - * - * @param {Number} start - * @param {Number} finish - * @api public - */ - - Assertion.prototype.within = function (start, finish) { - var range = start + '..' + finish; - this.assert( - this.obj >= start && this.obj <= finish - , function(){ return 'expected ' + i(this.obj) + ' to be within ' + range } - , function(){ return 'expected ' + i(this.obj) + ' to not be within ' + range }); - return this; - }; - - /** - * Assert typeof / instance of - * - * @api public - */ - - Assertion.prototype.a = - Assertion.prototype.an = function (type) { - if ('string' == typeof type) { - // proper english in error msg - var n = /^[aeiou]/.test(type) ? 'n' : ''; - - // typeof with support for 'array' - this.assert( - 'array' == type ? isArray(this.obj) : - 'regexp' == type ? isRegExp(this.obj) : - 'object' == type - ? 'object' == typeof this.obj && null !== this.obj - : type == typeof this.obj - , function(){ return 'expected ' + i(this.obj) + ' to be a' + n + ' ' + type } - , function(){ return 'expected ' + i(this.obj) + ' not to be a' + n + ' ' + type }); - } else { - // instanceof - var name = type.name || 'supplied constructor'; - this.assert( - this.obj instanceof type - , function(){ return 'expected ' + i(this.obj) + ' to be an instance of ' + name } - , function(){ return 'expected ' + i(this.obj) + ' not to be an instance of ' + name }); - } - - return this; - }; - - /** - * Assert numeric value above _n_. - * - * @param {Number} n - * @api public - */ - - Assertion.prototype.greaterThan = - Assertion.prototype.above = function (n) { - this.assert( - this.obj > n - , function(){ return 'expected ' + i(this.obj) + ' to be above ' + n } - , function(){ return 'expected ' + i(this.obj) + ' to be below ' + n }); - return this; - }; - - /** - * Assert numeric value below _n_. - * - * @param {Number} n - * @api public - */ - - Assertion.prototype.lessThan = - Assertion.prototype.below = function (n) { - this.assert( - this.obj < n - , function(){ return 'expected ' + i(this.obj) + ' to be below ' + n } - , function(){ return 'expected ' + i(this.obj) + ' to be above ' + n }); - return this; - }; - - /** - * Assert string value matches _regexp_. - * - * @param {RegExp} regexp - * @api public - */ - - Assertion.prototype.match = function (regexp) { - this.assert( - regexp.exec(this.obj) - , function(){ return 'expected ' + i(this.obj) + ' to match ' + regexp } - , function(){ return 'expected ' + i(this.obj) + ' not to match ' + regexp }); - return this; - }; - - /** - * Assert property "length" exists and has value of _n_. - * - * @param {Number} n - * @api public - */ - - Assertion.prototype.length = function (n) { - expect(this.obj).to.have.property('length'); - var len = this.obj.length; - this.assert( - n == len - , function(){ return 'expected ' + i(this.obj) + ' to have a length of ' + n + ' but got ' + len } - , function(){ return 'expected ' + i(this.obj) + ' to not have a length of ' + len }); - return this; - }; - - /** - * Assert property _name_ exists, with optional _val_. - * - * @param {String} name - * @param {Mixed} val - * @api public - */ - - Assertion.prototype.property = function (name, val) { - if (this.flags.own) { - this.assert( - Object.prototype.hasOwnProperty.call(this.obj, name) - , function(){ return 'expected ' + i(this.obj) + ' to have own property ' + i(name) } - , function(){ return 'expected ' + i(this.obj) + ' to not have own property ' + i(name) }); - return this; - } - - if (this.flags.not && undefined !== val) { - if (undefined === this.obj[name]) { - throw new Error(i(this.obj) + ' has no property ' + i(name)); - } - } else { - var hasProp; - try { - hasProp = name in this.obj - } catch (e) { - hasProp = undefined !== this.obj[name] - } - - this.assert( - hasProp - , function(){ return 'expected ' + i(this.obj) + ' to have a property ' + i(name) } - , function(){ return 'expected ' + i(this.obj) + ' to not have a property ' + i(name) }); - } - - if (undefined !== val) { - this.assert( - val === this.obj[name] - , function(){ return 'expected ' + i(this.obj) + ' to have a property ' + i(name) - + ' of ' + i(val) + ', but got ' + i(this.obj[name]) } - , function(){ return 'expected ' + i(this.obj) + ' to not have a property ' + i(name) - + ' of ' + i(val) }); - } - - this.obj = this.obj[name]; - return this; - }; - - /** - * Assert that the array contains _obj_ or string contains _obj_. - * - * @param {Mixed} obj|string - * @api public - */ - - Assertion.prototype.string = - Assertion.prototype.contain = function (obj) { - if ('string' == typeof this.obj) { - this.assert( - ~this.obj.indexOf(obj) - , function(){ return 'expected ' + i(this.obj) + ' to contain ' + i(obj) } - , function(){ return 'expected ' + i(this.obj) + ' to not contain ' + i(obj) }); - } else { - this.assert( - ~indexOf(this.obj, obj) - , function(){ return 'expected ' + i(this.obj) + ' to contain ' + i(obj) } - , function(){ return 'expected ' + i(this.obj) + ' to not contain ' + i(obj) }); - } - return this; - }; - - /** - * Assert exact keys or inclusion of keys by using - * the `.own` modifier. - * - * @param {Array|String ...} keys - * @api public - */ - - Assertion.prototype.key = - Assertion.prototype.keys = function ($keys) { - var str - , ok = true; - - $keys = isArray($keys) - ? $keys - : Array.prototype.slice.call(arguments); - - if (!$keys.length) throw new Error('keys required'); - - var actual = keys(this.obj) - , len = $keys.length; - - // Inclusion - ok = every($keys, function (key) { - return ~indexOf(actual, key); - }); - - // Strict - if (!this.flags.not && this.flags.only) { - ok = ok && $keys.length == actual.length; - } - - // Key string - if (len > 1) { - $keys = map($keys, function (key) { - return i(key); - }); - var last = $keys.pop(); - str = $keys.join(', ') + ', and ' + last; - } else { - str = i($keys[0]); - } - - // Form - str = (len > 1 ? 'keys ' : 'key ') + str; - - // Have / include - str = (!this.flags.only ? 'include ' : 'only have ') + str; - - // Assertion - this.assert( - ok - , function(){ return 'expected ' + i(this.obj) + ' to ' + str } - , function(){ return 'expected ' + i(this.obj) + ' to not ' + str }); - - return this; - }; - - /** - * Assert a failure. - * - * @param {String ...} custom message - * @api public - */ - Assertion.prototype.fail = function (msg) { - var error = function() { return msg || "explicit failure"; } - this.assert(false, error, error); - return this; - }; - - /** - * Function bind implementation. - */ - - function bind (fn, scope) { - return function () { - return fn.apply(scope, arguments); - } - } - - /** - * Array every compatibility - * - * @see bit.ly/5Fq1N2 - * @api public - */ - - function every (arr, fn, thisObj) { - var scope = thisObj || global; - for (var i = 0, j = arr.length; i < j; ++i) { - if (!fn.call(scope, arr[i], i, arr)) { - return false; - } - } - return true; - } - - /** - * Array indexOf compatibility. - * - * @see bit.ly/a5Dxa2 - * @api public - */ - - function indexOf (arr, o, i) { - if (Array.prototype.indexOf) { - return Array.prototype.indexOf.call(arr, o, i); - } - - if (arr.length === undefined) { - return -1; - } - - for (var j = arr.length, i = i < 0 ? i + j < 0 ? 0 : i + j : i || 0 - ; i < j && arr[i] !== o; i++); - - return j <= i ? -1 : i; - } - - // https://gist.github.com/1044128/ - var getOuterHTML = function(element) { - if ('outerHTML' in element) return element.outerHTML; - var ns = "http://www.w3.org/1999/xhtml"; - var container = document.createElementNS(ns, '_'); - var xmlSerializer = new XMLSerializer(); - var html; - if (document.xmlVersion) { - return xmlSerializer.serializeToString(element); - } else { - container.appendChild(element.cloneNode(false)); - html = container.innerHTML.replace('><', '>' + element.innerHTML + '<'); - container.innerHTML = ''; - return html; - } - }; - - // Returns true if object is a DOM element. - var isDOMElement = function (object) { - if (typeof HTMLElement === 'object') { - return object instanceof HTMLElement; - } else { - return object && - typeof object === 'object' && - object.nodeType === 1 && - typeof object.nodeName === 'string'; - } - }; - - /** - * Inspects an object. - * - * @see taken from node.js `util` module (copyright Joyent, MIT license) - * @api private - */ - - function i (obj, showHidden, depth) { - var seen = []; - - function stylize (str) { - return str; - } - - function format (value, recurseTimes) { - // Provide a hook for user-specified inspect functions. - // Check that value is an object with an inspect function on it - if (value && typeof value.inspect === 'function' && - // Filter out the util module, it's inspect function is special - value !== exports && - // Also filter out any prototype objects using the circular check. - !(value.constructor && value.constructor.prototype === value)) { - return value.inspect(recurseTimes); - } - - // Primitive types cannot have properties - switch (typeof value) { - case 'undefined': - return stylize('undefined', 'undefined'); - - case 'string': - var simple = '\'' + json.stringify(value).replace(/^"|"$/g, '') - .replace(/'/g, "\\'") - .replace(/\\"/g, '"') + '\''; - return stylize(simple, 'string'); - - case 'number': - return stylize('' + value, 'number'); - - case 'boolean': - return stylize('' + value, 'boolean'); - } - // For some reason typeof null is "object", so special case here. - if (value === null) { - return stylize('null', 'null'); - } - - if (isDOMElement(value)) { - return getOuterHTML(value); - } - - // Look up the keys of the object. - var visible_keys = keys(value); - var $keys = showHidden ? Object.getOwnPropertyNames(value) : visible_keys; - - // Functions without properties can be shortcutted. - if (typeof value === 'function' && $keys.length === 0) { - if (isRegExp(value)) { - return stylize('' + value, 'regexp'); - } else { - var name = value.name ? ': ' + value.name : ''; - return stylize('[Function' + name + ']', 'special'); - } - } - - // Dates without properties can be shortcutted - if (isDate(value) && $keys.length === 0) { - return stylize(value.toUTCString(), 'date'); - } - - // Error objects can be shortcutted - if (value instanceof Error) { - return stylize("["+value.toString()+"]", 'Error'); - } - - var base, type, braces; - // Determine the object type - if (isArray(value)) { - type = 'Array'; - braces = ['[', ']']; - } else { - type = 'Object'; - braces = ['{', '}']; - } - - // Make functions say that they are functions - if (typeof value === 'function') { - var n = value.name ? ': ' + value.name : ''; - base = (isRegExp(value)) ? ' ' + value : ' [Function' + n + ']'; - } else { - base = ''; - } - - // Make dates with properties first say the date - if (isDate(value)) { - base = ' ' + value.toUTCString(); - } - - if ($keys.length === 0) { - return braces[0] + base + braces[1]; - } - - if (recurseTimes < 0) { - if (isRegExp(value)) { - return stylize('' + value, 'regexp'); - } else { - return stylize('[Object]', 'special'); - } - } - - seen.push(value); - - var output = map($keys, function (key) { - var name, str; - if (value.__lookupGetter__) { - if (value.__lookupGetter__(key)) { - if (value.__lookupSetter__(key)) { - str = stylize('[Getter/Setter]', 'special'); - } else { - str = stylize('[Getter]', 'special'); - } - } else { - if (value.__lookupSetter__(key)) { - str = stylize('[Setter]', 'special'); - } - } - } - if (indexOf(visible_keys, key) < 0) { - name = '[' + key + ']'; - } - if (!str) { - if (indexOf(seen, value[key]) < 0) { - if (recurseTimes === null) { - str = format(value[key]); - } else { - str = format(value[key], recurseTimes - 1); - } - if (str.indexOf('\n') > -1) { - if (isArray(value)) { - str = map(str.split('\n'), function (line) { - return ' ' + line; - }).join('\n').substr(2); - } else { - str = '\n' + map(str.split('\n'), function (line) { - return ' ' + line; - }).join('\n'); - } - } - } else { - str = stylize('[Circular]', 'special'); - } - } - if (typeof name === 'undefined') { - if (type === 'Array' && key.match(/^\d+$/)) { - return str; - } - name = json.stringify('' + key); - if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) { - name = name.substr(1, name.length - 2); - name = stylize(name, 'name'); - } else { - name = name.replace(/'/g, "\\'") - .replace(/\\"/g, '"') - .replace(/(^"|"$)/g, "'"); - name = stylize(name, 'string'); - } - } - - return name + ': ' + str; - }); - - seen.pop(); - - var numLinesEst = 0; - var length = reduce(output, function (prev, cur) { - numLinesEst++; - if (indexOf(cur, '\n') >= 0) numLinesEst++; - return prev + cur.length + 1; - }, 0); - - if (length > 50) { - output = braces[0] + - (base === '' ? '' : base + '\n ') + - ' ' + - output.join(',\n ') + - ' ' + - braces[1]; - - } else { - output = braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1]; - } - - return output; - } - return format(obj, (typeof depth === 'undefined' ? 2 : depth)); - } - - expect.stringify = i; - - function isArray (ar) { - return Object.prototype.toString.call(ar) === '[object Array]'; - } - - function isRegExp(re) { - var s; - try { - s = '' + re; - } catch (e) { - return false; - } - - return re instanceof RegExp || // easy case - // duck-type for context-switching evalcx case - typeof(re) === 'function' && - re.constructor.name === 'RegExp' && - re.compile && - re.test && - re.exec && - s.match(/^\/.*\/[gim]{0,3}$/); - } - - function isDate(d) { - return d instanceof Date; - } - - function keys (obj) { - if (Object.keys) { - return Object.keys(obj); - } - - var keys = []; - - for (var i in obj) { - if (Object.prototype.hasOwnProperty.call(obj, i)) { - keys.push(i); - } - } - - return keys; - } - - function map (arr, mapper, that) { - if (Array.prototype.map) { - return Array.prototype.map.call(arr, mapper, that); - } - - var other= new Array(arr.length); - - for (var i= 0, n = arr.length; i= 2) { - var rv = arguments[1]; - } else { - do { - if (i in this) { - rv = this[i++]; - break; - } - - // if array contains no values, no initial value to return - if (++i >= len) - throw new TypeError(); - } while (true); - } - - for (; i < len; i++) { - if (i in this) - rv = fun.call(null, rv, this[i], i, this); - } - - return rv; - } - - /** - * Asserts deep equality - * - * @see taken from node.js `assert` module (copyright Joyent, MIT license) - * @api private - */ - - expect.eql = function eql(actual, expected) { - // 7.1. All identical values are equivalent, as determined by ===. - if (actual === expected) { - return true; - } else if ('undefined' != typeof Buffer - && Buffer.isBuffer(actual) && Buffer.isBuffer(expected)) { - if (actual.length != expected.length) return false; - - for (var i = 0; i < actual.length; i++) { - if (actual[i] !== expected[i]) return false; - } - - return true; - - // 7.2. If the expected value is a Date object, the actual value is - // equivalent if it is also a Date object that refers to the same time. - } else if (actual instanceof Date && expected instanceof Date) { - return actual.getTime() === expected.getTime(); - - // 7.3. Other pairs that do not both pass typeof value == "object", - // equivalence is determined by ==. - } else if (typeof actual != 'object' && typeof expected != 'object') { - return actual == expected; - // If both are regular expression use the special `regExpEquiv` method - // to determine equivalence. - } else if (isRegExp(actual) && isRegExp(expected)) { - return regExpEquiv(actual, expected); - // 7.4. For all other Object pairs, including Array objects, equivalence is - // determined by having the same number of owned properties (as verified - // with Object.prototype.hasOwnProperty.call), the same set of keys - // (although not necessarily the same order), equivalent values for every - // corresponding key, and an identical "prototype" property. Note: this - // accounts for both named and indexed properties on Arrays. - } else { - return objEquiv(actual, expected); - } - }; - - function isUndefinedOrNull (value) { - return value === null || value === undefined; - } - - function isArguments (object) { - return Object.prototype.toString.call(object) == '[object Arguments]'; - } - - function regExpEquiv (a, b) { - return a.source === b.source && a.global === b.global && - a.ignoreCase === b.ignoreCase && a.multiline === b.multiline; - } - - function objEquiv (a, b) { - if (isUndefinedOrNull(a) || isUndefinedOrNull(b)) - return false; - // an identical "prototype" property. - if (a.prototype !== b.prototype) return false; - //~~~I've managed to break Object.keys through screwy arguments passing. - // Converting to array solves the problem. - if (isArguments(a)) { - if (!isArguments(b)) { - return false; - } - a = pSlice.call(a); - b = pSlice.call(b); - return expect.eql(a, b); - } - try{ - var ka = keys(a), - kb = keys(b), - key, i; - } catch (e) {//happens when one is a string literal and the other isn't - return false; - } - // having the same number of owned properties (keys incorporates hasOwnProperty) - if (ka.length != kb.length) - return false; - //the same set of keys (although not necessarily the same order), - ka.sort(); - kb.sort(); - //~~~cheap key test - for (i = ka.length - 1; i >= 0; i--) { - if (ka[i] != kb[i]) - return false; - } - //equivalent values for every corresponding key, and - //~~~possibly expensive deep test - for (i = ka.length - 1; i >= 0; i--) { - key = ka[i]; - if (!expect.eql(a[key], b[key])) - return false; - } - return true; - } - - var json = (function () { - "use strict"; - - if ('object' == typeof JSON && JSON.parse && JSON.stringify) { - return { - parse: nativeJSON.parse - , stringify: nativeJSON.stringify - } - } - - var JSON = {}; - - function f(n) { - // Format integers to have at least two digits. - return n < 10 ? '0' + n : n; - } - - function date(d, key) { - return isFinite(d.valueOf()) ? - d.getUTCFullYear() + '-' + - f(d.getUTCMonth() + 1) + '-' + - f(d.getUTCDate()) + 'T' + - f(d.getUTCHours()) + ':' + - f(d.getUTCMinutes()) + ':' + - f(d.getUTCSeconds()) + 'Z' : null; - } - - var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, - escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, - gap, - indent, - meta = { // table of character substitutions - '\b': '\\b', - '\t': '\\t', - '\n': '\\n', - '\f': '\\f', - '\r': '\\r', - '"' : '\\"', - '\\': '\\\\' - }, - rep; - - - function quote(string) { - - // If the string contains no control characters, no quote characters, and no - // backslash characters, then we can safely slap some quotes around it. - // Otherwise we must also replace the offending characters with safe escape - // sequences. - - escapable.lastIndex = 0; - return escapable.test(string) ? '"' + string.replace(escapable, function (a) { - var c = meta[a]; - return typeof c === 'string' ? c : - '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); - }) + '"' : '"' + string + '"'; - } - - - function str(key, holder) { - - // Produce a string from holder[key]. - - var i, // The loop counter. - k, // The member key. - v, // The member value. - length, - mind = gap, - partial, - value = holder[key]; - - // If the value has a toJSON method, call it to obtain a replacement value. - - if (value instanceof Date) { - value = date(key); - } - - // If we were called with a replacer function, then call the replacer to - // obtain a replacement value. - - if (typeof rep === 'function') { - value = rep.call(holder, key, value); - } - - // What happens next depends on the value's type. - - switch (typeof value) { - case 'string': - return quote(value); - - case 'number': - - // JSON numbers must be finite. Encode non-finite numbers as null. - - return isFinite(value) ? String(value) : 'null'; - - case 'boolean': - case 'null': - - // If the value is a boolean or null, convert it to a string. Note: - // typeof null does not produce 'null'. The case is included here in - // the remote chance that this gets fixed someday. - - return String(value); - - // If the type is 'object', we might be dealing with an object or an array or - // null. - - case 'object': - - // Due to a specification blunder in ECMAScript, typeof null is 'object', - // so watch out for that case. - - if (!value) { - return 'null'; - } - - // Make an array to hold the partial results of stringifying this object value. - - gap += indent; - partial = []; - - // Is the value an array? - - if (Object.prototype.toString.apply(value) === '[object Array]') { - - // The value is an array. Stringify every element. Use null as a placeholder - // for non-JSON values. - - length = value.length; - for (i = 0; i < length; i += 1) { - partial[i] = str(i, value) || 'null'; - } - - // Join all of the elements together, separated with commas, and wrap them in - // brackets. - - v = partial.length === 0 ? '[]' : gap ? - '[\n' + gap + partial.join(',\n' + gap) + '\n' + mind + ']' : - '[' + partial.join(',') + ']'; - gap = mind; - return v; - } - - // If the replacer is an array, use it to select the members to be stringified. - - if (rep && typeof rep === 'object') { - length = rep.length; - for (i = 0; i < length; i += 1) { - if (typeof rep[i] === 'string') { - k = rep[i]; - v = str(k, value); - if (v) { - partial.push(quote(k) + (gap ? ': ' : ':') + v); - } - } - } - } else { - - // Otherwise, iterate through all of the keys in the object. - - for (k in value) { - if (Object.prototype.hasOwnProperty.call(value, k)) { - v = str(k, value); - if (v) { - partial.push(quote(k) + (gap ? ': ' : ':') + v); - } - } - } - } - - // Join all of the member texts together, separated with commas, - // and wrap them in braces. - - v = partial.length === 0 ? '{}' : gap ? - '{\n' + gap + partial.join(',\n' + gap) + '\n' + mind + '}' : - '{' + partial.join(',') + '}'; - gap = mind; - return v; - } - } - - // If the JSON object does not yet have a stringify method, give it one. - - JSON.stringify = function (value, replacer, space) { - - // The stringify method takes a value and an optional replacer, and an optional - // space parameter, and returns a JSON text. The replacer can be a function - // that can replace values, or an array of strings that will select the keys. - // A default replacer method can be provided. Use of the space parameter can - // produce text that is more easily readable. - - var i; - gap = ''; - indent = ''; - - // If the space parameter is a number, make an indent string containing that - // many spaces. - - if (typeof space === 'number') { - for (i = 0; i < space; i += 1) { - indent += ' '; - } - - // If the space parameter is a string, it will be used as the indent string. - - } else if (typeof space === 'string') { - indent = space; - } - - // If there is a replacer, it must be a function or an array. - // Otherwise, throw an error. - - rep = replacer; - if (replacer && typeof replacer !== 'function' && - (typeof replacer !== 'object' || - typeof replacer.length !== 'number')) { - throw new Error('JSON.stringify'); - } - - // Make a fake root object containing our value under the key of ''. - // Return the result of stringifying the value. - - return str('', {'': value}); - }; - - // If the JSON object does not yet have a parse method, give it one. - - JSON.parse = function (text, reviver) { - // The parse method takes a text and an optional reviver function, and returns - // a JavaScript value if the text is a valid JSON text. - - var j; - - function walk(holder, key) { - - // The walk method is used to recursively walk the resulting structure so - // that modifications can be made. - - var k, v, value = holder[key]; - if (value && typeof value === 'object') { - for (k in value) { - if (Object.prototype.hasOwnProperty.call(value, k)) { - v = walk(value, k); - if (v !== undefined) { - value[k] = v; - } else { - delete value[k]; - } - } - } - } - return reviver.call(holder, key, value); - } - - - // Parsing happens in four stages. In the first stage, we replace certain - // Unicode characters with escape sequences. JavaScript handles many characters - // incorrectly, either silently deleting them, or treating them as line endings. - - text = String(text); - cx.lastIndex = 0; - if (cx.test(text)) { - text = text.replace(cx, function (a) { - return '\\u' + - ('0000' + a.charCodeAt(0).toString(16)).slice(-4); - }); - } - - // In the second stage, we run the text against regular expressions that look - // for non-JSON patterns. We are especially concerned with '()' and 'new' - // because they can cause invocation, and '=' because it can cause mutation. - // But just to be safe, we want to reject all unexpected forms. - - // We split the second stage into 4 regexp operations in order to work around - // crippling inefficiencies in IE's and Safari's regexp engines. First we - // replace the JSON backslash pairs with '@' (a non-JSON character). Second, we - // replace all simple value tokens with ']' characters. Third, we delete all - // open brackets that follow a colon or comma or that begin the text. Finally, - // we look to see that the remaining characters are only whitespace or ']' or - // ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval. - - if (/^[\],:{}\s]*$/ - .test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@') - .replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']') - .replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) { - - // In the third stage we use the eval function to compile the text into a - // JavaScript structure. The '{' operator is subject to a syntactic ambiguity - // in JavaScript: it can begin a block or an object literal. We wrap the text - // in parens to eliminate the ambiguity. - - j = eval('(' + text + ')'); - - // In the optional fourth stage, we recursively walk the new structure, passing - // each name/value pair to a reviver function for possible transformation. - - return typeof reviver === 'function' ? - walk({'': j}, '') : j; - } - - // If the text is not JSON parseable, then a SyntaxError is thrown. - - throw new SyntaxError('JSON.parse'); - }; - - return JSON; - })(); - - if ('undefined' != typeof window) { - window.expect = module.exports; - } - -})( - this - , 'undefined' != typeof module ? module : {exports: {}} -); diff --git a/node_modules/expect.js/package.json b/node_modules/expect.js/package.json deleted file mode 100644 index 3ad39f7..0000000 --- a/node_modules/expect.js/package.json +++ /dev/null @@ -1,13 +0,0 @@ -{ - "name": "expect.js" - , "version": "0.3.1" - , "description": "BDD style assertions for node and the browser." - , "repository": { - "type": "git", - "url": "git://github.com/LearnBoost/expect.js.git" - } - , "devDependencies": { - "mocha": "*" - , "serve": "*" - } -} diff --git a/node_modules/glob/.npmignore b/node_modules/glob/.npmignore deleted file mode 100644 index 2af4b71..0000000 --- a/node_modules/glob/.npmignore +++ /dev/null @@ -1,2 +0,0 @@ -.*.swp -test/a/ diff --git a/node_modules/glob/.travis.yml b/node_modules/glob/.travis.yml deleted file mode 100644 index baa0031..0000000 --- a/node_modules/glob/.travis.yml +++ /dev/null @@ -1,3 +0,0 @@ -language: node_js -node_js: - - 0.8 diff --git a/node_modules/glob/LICENSE b/node_modules/glob/LICENSE deleted file mode 100644 index 0c44ae7..0000000 --- a/node_modules/glob/LICENSE +++ /dev/null @@ -1,27 +0,0 @@ -Copyright (c) Isaac Z. Schlueter ("Author") -All rights reserved. - -The BSD License - -Redistribution and use in source and binary forms, with or without -modification, are permitted provided that the following conditions -are met: - -1. Redistributions of source code must retain the above copyright - notice, this list of conditions and the following disclaimer. - -2. Redistributions in binary form must reproduce the above copyright - notice, this list of conditions and the following disclaimer in the - documentation and/or other materials provided with the distribution. - -THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND -ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE -IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR -PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS -BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR -CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF -SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR -BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, -WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE -OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN -IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/glob/README.md b/node_modules/glob/README.md deleted file mode 100644 index cc69164..0000000 --- a/node_modules/glob/README.md +++ /dev/null @@ -1,250 +0,0 @@ -# Glob - -Match files using the patterns the shell uses, like stars and stuff. - -This is a glob implementation in JavaScript. It uses the `minimatch` -library to do its matching. - -## Attention: node-glob users! - -The API has changed dramatically between 2.x and 3.x. This library is -now 100% JavaScript, and the integer flags have been replaced with an -options object. - -Also, there's an event emitter class, proper tests, and all the other -things you've come to expect from node modules. - -And best of all, no compilation! - -## Usage - -```javascript -var glob = require("glob") - -// options is optional -glob("**/*.js", options, function (er, files) { - // files is an array of filenames. - // If the `nonull` option is set, and nothing - // was found, then files is ["**/*.js"] - // er is an error object or null. -}) -``` - -## Features - -Please see the [minimatch -documentation](https://github.com/isaacs/minimatch) for more details. - -Supports these glob features: - -* Brace Expansion -* Extended glob matching -* "Globstar" `**` matching - -See: - -* `man sh` -* `man bash` -* `man 3 fnmatch` -* `man 5 gitignore` -* [minimatch documentation](https://github.com/isaacs/minimatch) - -## glob(pattern, [options], cb) - -* `pattern` {String} Pattern to be matched -* `options` {Object} -* `cb` {Function} - * `err` {Error | null} - * `matches` {Array} filenames found matching the pattern - -Perform an asynchronous glob search. - -## glob.sync(pattern, [options]) - -* `pattern` {String} Pattern to be matched -* `options` {Object} -* return: {Array} filenames found matching the pattern - -Perform a synchronous glob search. - -## Class: glob.Glob - -Create a Glob object by instanting the `glob.Glob` class. - -```javascript -var Glob = require("glob").Glob -var mg = new Glob(pattern, options, cb) -``` - -It's an EventEmitter, and starts walking the filesystem to find matches -immediately. - -### new glob.Glob(pattern, [options], [cb]) - -* `pattern` {String} pattern to search for -* `options` {Object} -* `cb` {Function} Called when an error occurs, or matches are found - * `err` {Error | null} - * `matches` {Array} filenames found matching the pattern - -Note that if the `sync` flag is set in the options, then matches will -be immediately available on the `g.found` member. - -### Properties - -* `minimatch` The minimatch object that the glob uses. -* `options` The options object passed in. -* `error` The error encountered. When an error is encountered, the - glob object is in an undefined state, and should be discarded. -* `aborted` Boolean which is set to true when calling `abort()`. There - is no way at this time to continue a glob search after aborting, but - you can re-use the statCache to avoid having to duplicate syscalls. -* `statCache` Collection of all the stat results the glob search - performed. -* `cache` Convenience object. Each field has the following possible - values: - * `false` - Path does not exist - * `true` - Path exists - * `1` - Path exists, and is not a directory - * `2` - Path exists, and is a directory - * `[file, entries, ...]` - Path exists, is a directory, and the - array value is the results of `fs.readdir` - -### Events - -* `end` When the matching is finished, this is emitted with all the - matches found. If the `nonull` option is set, and no match was found, - then the `matches` list contains the original pattern. The matches - are sorted, unless the `nosort` flag is set. -* `match` Every time a match is found, this is emitted with the matched. -* `error` Emitted when an unexpected error is encountered, or whenever - any fs error occurs if `options.strict` is set. -* `abort` When `abort()` is called, this event is raised. - -### Methods - -* `abort` Stop the search. - -### Options - -All the options that can be passed to Minimatch can also be passed to -Glob to change pattern matching behavior. Also, some have been added, -or have glob-specific ramifications. - -All options are false by default, unless otherwise noted. - -All options are added to the glob object, as well. - -* `cwd` The current working directory in which to search. Defaults - to `process.cwd()`. -* `root` The place where patterns starting with `/` will be mounted - onto. Defaults to `path.resolve(options.cwd, "/")` (`/` on Unix - systems, and `C:\` or some such on Windows.) -* `dot` Include `.dot` files in normal matches and `globstar` matches. - Note that an explicit dot in a portion of the pattern will always - match dot files. -* `nomount` By default, a pattern starting with a forward-slash will be - "mounted" onto the root setting, so that a valid filesystem path is - returned. Set this flag to disable that behavior. -* `mark` Add a `/` character to directory matches. Note that this - requires additional stat calls. -* `nosort` Don't sort the results. -* `stat` Set to true to stat *all* results. This reduces performance - somewhat, and is completely unnecessary, unless `readdir` is presumed - to be an untrustworthy indicator of file existence. It will cause - ELOOP to be triggered one level sooner in the case of cyclical - symbolic links. -* `silent` When an unusual error is encountered - when attempting to read a directory, a warning will be printed to - stderr. Set the `silent` option to true to suppress these warnings. -* `strict` When an unusual error is encountered - when attempting to read a directory, the process will just continue on - in search of other matches. Set the `strict` option to raise an error - in these cases. -* `cache` See `cache` property above. Pass in a previously generated - cache object to save some fs calls. -* `statCache` A cache of results of filesystem information, to prevent - unnecessary stat calls. While it should not normally be necessary to - set this, you may pass the statCache from one glob() call to the - options object of another, if you know that the filesystem will not - change between calls. (See "Race Conditions" below.) -* `sync` Perform a synchronous glob search. -* `nounique` In some cases, brace-expanded patterns can result in the - same file showing up multiple times in the result set. By default, - this implementation prevents duplicates in the result set. - Set this flag to disable that behavior. -* `nonull` Set to never return an empty set, instead returning a set - containing the pattern itself. This is the default in glob(3). -* `nocase` Perform a case-insensitive match. Note that case-insensitive - filesystems will sometimes result in glob returning results that are - case-insensitively matched anyway, since readdir and stat will not - raise an error. -* `debug` Set to enable debug logging in minimatch and glob. -* `globDebug` Set to enable debug logging in glob, but not minimatch. - -## Comparisons to other fnmatch/glob implementations - -While strict compliance with the existing standards is a worthwhile -goal, some discrepancies exist between node-glob and other -implementations, and are intentional. - -If the pattern starts with a `!` character, then it is negated. Set the -`nonegate` flag to suppress this behavior, and treat leading `!` -characters normally. This is perhaps relevant if you wish to start the -pattern with a negative extglob pattern like `!(a|B)`. Multiple `!` -characters at the start of a pattern will negate the pattern multiple -times. - -If a pattern starts with `#`, then it is treated as a comment, and -will not match anything. Use `\#` to match a literal `#` at the -start of a line, or set the `nocomment` flag to suppress this behavior. - -The double-star character `**` is supported by default, unless the -`noglobstar` flag is set. This is supported in the manner of bsdglob -and bash 4.1, where `**` only has special significance if it is the only -thing in a path part. That is, `a/**/b` will match `a/x/y/b`, but -`a/**b` will not. - -If an escaped pattern has no matches, and the `nonull` flag is set, -then glob returns the pattern as-provided, rather than -interpreting the character escapes. For example, -`glob.match([], "\\*a\\?")` will return `"\\*a\\?"` rather than -`"*a?"`. This is akin to setting the `nullglob` option in bash, except -that it does not resolve escaped pattern characters. - -If brace expansion is not disabled, then it is performed before any -other interpretation of the glob pattern. Thus, a pattern like -`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded -**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are -checked for validity. Since those two are valid, matching proceeds. - -## Windows - -**Please only use forward-slashes in glob expressions.** - -Though windows uses either `/` or `\` as its path separator, only `/` -characters are used by this glob implementation. You must use -forward-slashes **only** in glob expressions. Back-slashes will always -be interpreted as escape characters, not path separators. - -Results from absolute patterns such as `/foo/*` are mounted onto the -root setting using `path.join`. On windows, this will by default result -in `/foo/*` matching `C:\foo\bar.txt`. - -## Race Conditions - -Glob searching, by its very nature, is susceptible to race conditions, -since it relies on directory walking and such. - -As a result, it is possible that a file that exists when glob looks for -it may have been deleted or modified by the time it returns the result. - -As part of its internal implementation, this program caches all stat -and readdir calls that it makes, in order to cut down on system -overhead. However, this also makes it even more susceptible to races, -especially if the cache or statCache objects are reused between glob -calls. - -Users are thus advised not to use a glob result as a guarantee of -filesystem state in the face of rapid changes. For the vast majority -of operations, this is never a problem. diff --git a/node_modules/glob/examples/g.js b/node_modules/glob/examples/g.js deleted file mode 100644 index be122df..0000000 --- a/node_modules/glob/examples/g.js +++ /dev/null @@ -1,9 +0,0 @@ -var Glob = require("../").Glob - -var pattern = "test/a/**/[cg]/../[cg]" -console.log(pattern) - -var mg = new Glob(pattern, {mark: true, sync:true}, function (er, matches) { - console.log("matches", matches) -}) -console.log("after") diff --git a/node_modules/glob/examples/usr-local.js b/node_modules/glob/examples/usr-local.js deleted file mode 100644 index 327a425..0000000 --- a/node_modules/glob/examples/usr-local.js +++ /dev/null @@ -1,9 +0,0 @@ -var Glob = require("../").Glob - -var pattern = "{./*/*,/*,/usr/local/*}" -console.log(pattern) - -var mg = new Glob(pattern, {mark: true}, function (er, matches) { - console.log("matches", matches) -}) -console.log("after") diff --git a/node_modules/glob/glob.js b/node_modules/glob/glob.js deleted file mode 100644 index f0118a4..0000000 --- a/node_modules/glob/glob.js +++ /dev/null @@ -1,675 +0,0 @@ -// Approach: -// -// 1. Get the minimatch set -// 2. For each pattern in the set, PROCESS(pattern) -// 3. Store matches per-set, then uniq them -// -// PROCESS(pattern) -// Get the first [n] items from pattern that are all strings -// Join these together. This is PREFIX. -// If there is no more remaining, then stat(PREFIX) and -// add to matches if it succeeds. END. -// readdir(PREFIX) as ENTRIES -// If fails, END -// If pattern[n] is GLOBSTAR -// // handle the case where the globstar match is empty -// // by pruning it out, and testing the resulting pattern -// PROCESS(pattern[0..n] + pattern[n+1 .. $]) -// // handle other cases. -// for ENTRY in ENTRIES (not dotfiles) -// // attach globstar + tail onto the entry -// PROCESS(pattern[0..n] + ENTRY + pattern[n .. $]) -// -// else // not globstar -// for ENTRY in ENTRIES (not dotfiles, unless pattern[n] is dot) -// Test ENTRY against pattern[n] -// If fails, continue -// If passes, PROCESS(pattern[0..n] + item + pattern[n+1 .. $]) -// -// Caveat: -// Cache all stats and readdirs results to minimize syscall. Since all -// we ever care about is existence and directory-ness, we can just keep -// `true` for files, and [children,...] for directories, or `false` for -// things that don't exist. - - - -module.exports = glob - -var fs = require("graceful-fs") -, minimatch = require("minimatch") -, Minimatch = minimatch.Minimatch -, inherits = require("inherits") -, EE = require("events").EventEmitter -, path = require("path") -, isDir = {} -, assert = require("assert").ok - -function glob (pattern, options, cb) { - if (typeof options === "function") cb = options, options = {} - if (!options) options = {} - - if (typeof options === "number") { - deprecated() - return - } - - var g = new Glob(pattern, options, cb) - return g.sync ? g.found : g -} - -glob.fnmatch = deprecated - -function deprecated () { - throw new Error("glob's interface has changed. Please see the docs.") -} - -glob.sync = globSync -function globSync (pattern, options) { - if (typeof options === "number") { - deprecated() - return - } - - options = options || {} - options.sync = true - return glob(pattern, options) -} - - -glob.Glob = Glob -inherits(Glob, EE) -function Glob (pattern, options, cb) { - if (!(this instanceof Glob)) { - return new Glob(pattern, options, cb) - } - - if (typeof cb === "function") { - this.on("error", cb) - this.on("end", function (matches) { - cb(null, matches) - }) - } - - options = options || {} - - this.EOF = {} - this._emitQueue = [] - - this.maxDepth = options.maxDepth || 1000 - this.maxLength = options.maxLength || Infinity - this.cache = options.cache || {} - this.statCache = options.statCache || {} - - this.changedCwd = false - var cwd = process.cwd() - if (!options.hasOwnProperty("cwd")) this.cwd = cwd - else { - this.cwd = options.cwd - this.changedCwd = path.resolve(options.cwd) !== cwd - } - - this.root = options.root || path.resolve(this.cwd, "/") - this.root = path.resolve(this.root) - if (process.platform === "win32") - this.root = this.root.replace(/\\/g, "/") - - this.nomount = !!options.nomount - - if (!pattern) { - throw new Error("must provide pattern") - } - - // base-matching: just use globstar for that. - if (options.matchBase && -1 === pattern.indexOf("/")) { - if (options.noglobstar) { - throw new Error("base matching requires globstar") - } - pattern = "**/" + pattern - } - - this.strict = options.strict !== false - this.dot = !!options.dot - this.mark = !!options.mark - this.sync = !!options.sync - this.nounique = !!options.nounique - this.nonull = !!options.nonull - this.nosort = !!options.nosort - this.nocase = !!options.nocase - this.stat = !!options.stat - - this.debug = !!options.debug || !!options.globDebug - if (this.debug) - this.log = console.error - - this.silent = !!options.silent - - var mm = this.minimatch = new Minimatch(pattern, options) - this.options = mm.options - pattern = this.pattern = mm.pattern - - this.error = null - this.aborted = false - - // list of all the patterns that ** has resolved do, so - // we can avoid visiting multiple times. - this._globstars = {} - - EE.call(this) - - // process each pattern in the minimatch set - var n = this.minimatch.set.length - - // The matches are stored as {: true,...} so that - // duplicates are automagically pruned. - // Later, we do an Object.keys() on these. - // Keep them as a list so we can fill in when nonull is set. - this.matches = new Array(n) - - this.minimatch.set.forEach(iterator.bind(this)) - function iterator (pattern, i, set) { - this._process(pattern, 0, i, function (er) { - if (er) this.emit("error", er) - if (-- n <= 0) this._finish() - }) - } -} - -Glob.prototype.log = function () {} - -Glob.prototype._finish = function () { - assert(this instanceof Glob) - - var nou = this.nounique - , all = nou ? [] : {} - - for (var i = 0, l = this.matches.length; i < l; i ++) { - var matches = this.matches[i] - this.log("matches[%d] =", i, matches) - // do like the shell, and spit out the literal glob - if (!matches) { - if (this.nonull) { - var literal = this.minimatch.globSet[i] - if (nou) all.push(literal) - else all[literal] = true - } - } else { - // had matches - var m = Object.keys(matches) - if (nou) all.push.apply(all, m) - else m.forEach(function (m) { - all[m] = true - }) - } - } - - if (!nou) all = Object.keys(all) - - if (!this.nosort) { - all = all.sort(this.nocase ? alphasorti : alphasort) - } - - if (this.mark) { - // at *some* point we statted all of these - all = all.map(function (m) { - var sc = this.cache[m] - if (!sc) - return m - var isDir = (Array.isArray(sc) || sc === 2) - if (isDir && m.slice(-1) !== "/") { - return m + "/" - } - if (!isDir && m.slice(-1) === "/") { - return m.replace(/\/+$/, "") - } - return m - }, this) - } - - this.log("emitting end", all) - - this.EOF = this.found = all - this.emitMatch(this.EOF) -} - -function alphasorti (a, b) { - a = a.toLowerCase() - b = b.toLowerCase() - return alphasort(a, b) -} - -function alphasort (a, b) { - return a > b ? 1 : a < b ? -1 : 0 -} - -Glob.prototype.abort = function () { - this.aborted = true - this.emit("abort") -} - -Glob.prototype.pause = function () { - if (this.paused) return - if (this.sync) - this.emit("error", new Error("Can't pause/resume sync glob")) - this.paused = true - this.emit("pause") -} - -Glob.prototype.resume = function () { - if (!this.paused) return - if (this.sync) - this.emit("error", new Error("Can't pause/resume sync glob")) - this.paused = false - this.emit("resume") - this._processEmitQueue() - //process.nextTick(this.emit.bind(this, "resume")) -} - -Glob.prototype.emitMatch = function (m) { - if (!this.stat || this.statCache[m] || m === this.EOF) { - this._emitQueue.push(m) - this._processEmitQueue() - } else { - this._stat(m, function(exists, isDir) { - if (exists) { - this._emitQueue.push(m) - this._processEmitQueue() - } - }) - } -} - -Glob.prototype._processEmitQueue = function (m) { - while (!this._processingEmitQueue && - !this.paused) { - this._processingEmitQueue = true - var m = this._emitQueue.shift() - if (!m) { - this._processingEmitQueue = false - break - } - - this.log('emit!', m === this.EOF ? "end" : "match") - - this.emit(m === this.EOF ? "end" : "match", m) - this._processingEmitQueue = false - } -} - -Glob.prototype._process = function (pattern, depth, index, cb_) { - assert(this instanceof Glob) - - var cb = function cb (er, res) { - assert(this instanceof Glob) - if (this.paused) { - if (!this._processQueue) { - this._processQueue = [] - this.once("resume", function () { - var q = this._processQueue - this._processQueue = null - q.forEach(function (cb) { cb() }) - }) - } - this._processQueue.push(cb_.bind(this, er, res)) - } else { - cb_.call(this, er, res) - } - }.bind(this) - - if (this.aborted) return cb() - - if (depth > this.maxDepth) return cb() - - // Get the first [n] parts of pattern that are all strings. - var n = 0 - while (typeof pattern[n] === "string") { - n ++ - } - // now n is the index of the first one that is *not* a string. - - // see if there's anything else - var prefix - switch (n) { - // if not, then this is rather simple - case pattern.length: - prefix = pattern.join("/") - this._stat(prefix, function (exists, isDir) { - // either it's there, or it isn't. - // nothing more to do, either way. - if (exists) { - if (prefix && isAbsolute(prefix) && !this.nomount) { - if (prefix.charAt(0) === "/") { - prefix = path.join(this.root, prefix) - } else { - prefix = path.resolve(this.root, prefix) - } - } - - if (process.platform === "win32") - prefix = prefix.replace(/\\/g, "/") - - this.matches[index] = this.matches[index] || {} - this.matches[index][prefix] = true - this.emitMatch(prefix) - } - return cb() - }) - return - - case 0: - // pattern *starts* with some non-trivial item. - // going to readdir(cwd), but not include the prefix in matches. - prefix = null - break - - default: - // pattern has some string bits in the front. - // whatever it starts with, whether that's "absolute" like /foo/bar, - // or "relative" like "../baz" - prefix = pattern.slice(0, n) - prefix = prefix.join("/") - break - } - - // get the list of entries. - var read - if (prefix === null) read = "." - else if (isAbsolute(prefix) || isAbsolute(pattern.join("/"))) { - if (!prefix || !isAbsolute(prefix)) { - prefix = path.join("/", prefix) - } - read = prefix = path.resolve(prefix) - - // if (process.platform === "win32") - // read = prefix = prefix.replace(/^[a-zA-Z]:|\\/g, "/") - - this.log('absolute: ', prefix, this.root, pattern, read) - } else { - read = prefix - } - - this.log('readdir(%j)', read, this.cwd, this.root) - - return this._readdir(read, function (er, entries) { - if (er) { - // not a directory! - // this means that, whatever else comes after this, it can never match - return cb() - } - - // globstar is special - if (pattern[n] === minimatch.GLOBSTAR) { - // test without the globstar, and with every child both below - // and replacing the globstar. - var s = [ pattern.slice(0, n).concat(pattern.slice(n + 1)) ] - entries.forEach(function (e) { - if (e.charAt(0) === "." && !this.dot) return - // instead of the globstar - s.push(pattern.slice(0, n).concat(e).concat(pattern.slice(n + 1))) - // below the globstar - s.push(pattern.slice(0, n).concat(e).concat(pattern.slice(n))) - }, this) - - s = s.filter(function (pattern) { - var key = gsKey(pattern) - var seen = !this._globstars[key] - this._globstars[key] = true - return seen - }, this) - - if (!s.length) - return cb() - - // now asyncForEach over this - var l = s.length - , errState = null - s.forEach(function (gsPattern) { - this._process(gsPattern, depth + 1, index, function (er) { - if (errState) return - if (er) return cb(errState = er) - if (--l <= 0) return cb() - }) - }, this) - - return - } - - // not a globstar - // It will only match dot entries if it starts with a dot, or if - // dot is set. Stuff like @(.foo|.bar) isn't allowed. - var pn = pattern[n] - var rawGlob = pattern[n]._glob - , dotOk = this.dot || rawGlob.charAt(0) === "." - - entries = entries.filter(function (e) { - return (e.charAt(0) !== "." || dotOk) && - e.match(pattern[n]) - }) - - // If n === pattern.length - 1, then there's no need for the extra stat - // *unless* the user has specified "mark" or "stat" explicitly. - // We know that they exist, since the readdir returned them. - if (n === pattern.length - 1 && - !this.mark && - !this.stat) { - entries.forEach(function (e) { - if (prefix) { - if (prefix !== "/") e = prefix + "/" + e - else e = prefix + e - } - if (e.charAt(0) === "/" && !this.nomount) { - e = path.join(this.root, e) - } - - if (process.platform === "win32") - e = e.replace(/\\/g, "/") - - this.matches[index] = this.matches[index] || {} - this.matches[index][e] = true - this.emitMatch(e) - }, this) - return cb.call(this) - } - - - // now test all the remaining entries as stand-ins for that part - // of the pattern. - var l = entries.length - , errState = null - if (l === 0) return cb() // no matches possible - entries.forEach(function (e) { - var p = pattern.slice(0, n).concat(e).concat(pattern.slice(n + 1)) - this._process(p, depth + 1, index, function (er) { - if (errState) return - if (er) return cb(errState = er) - if (--l === 0) return cb.call(this) - }) - }, this) - }) - -} - -function gsKey (pattern) { - return '**' + pattern.map(function (p) { - return (p === minimatch.GLOBSTAR) ? '**' : (''+p) - }).join('/') -} - -Glob.prototype._stat = function (f, cb) { - assert(this instanceof Glob) - var abs = f - if (f.charAt(0) === "/") { - abs = path.join(this.root, f) - } else if (this.changedCwd) { - abs = path.resolve(this.cwd, f) - } - - if (f.length > this.maxLength) { - var er = new Error("Path name too long") - er.code = "ENAMETOOLONG" - er.path = f - return this._afterStat(f, abs, cb, er) - } - - this.log('stat', [this.cwd, f, '=', abs]) - - if (!this.stat && this.cache.hasOwnProperty(f)) { - var exists = this.cache[f] - , isDir = exists && (Array.isArray(exists) || exists === 2) - if (this.sync) return cb.call(this, !!exists, isDir) - return process.nextTick(cb.bind(this, !!exists, isDir)) - } - - var stat = this.statCache[abs] - if (this.sync || stat) { - var er - try { - stat = fs.statSync(abs) - } catch (e) { - er = e - } - this._afterStat(f, abs, cb, er, stat) - } else { - fs.stat(abs, this._afterStat.bind(this, f, abs, cb)) - } -} - -Glob.prototype._afterStat = function (f, abs, cb, er, stat) { - var exists - assert(this instanceof Glob) - - if (abs.slice(-1) === "/" && stat && !stat.isDirectory()) { - this.log("should be ENOTDIR, fake it") - - er = new Error("ENOTDIR, not a directory '" + abs + "'") - er.path = abs - er.code = "ENOTDIR" - stat = null - } - - var emit = !this.statCache[abs] - this.statCache[abs] = stat - - if (er || !stat) { - exists = false - } else { - exists = stat.isDirectory() ? 2 : 1 - if (emit) - this.emit('stat', f, stat) - } - this.cache[f] = this.cache[f] || exists - cb.call(this, !!exists, exists === 2) -} - -Glob.prototype._readdir = function (f, cb) { - assert(this instanceof Glob) - var abs = f - if (f.charAt(0) === "/") { - abs = path.join(this.root, f) - } else if (isAbsolute(f)) { - abs = f - } else if (this.changedCwd) { - abs = path.resolve(this.cwd, f) - } - - if (f.length > this.maxLength) { - var er = new Error("Path name too long") - er.code = "ENAMETOOLONG" - er.path = f - return this._afterReaddir(f, abs, cb, er) - } - - this.log('readdir', [this.cwd, f, abs]) - if (this.cache.hasOwnProperty(f)) { - var c = this.cache[f] - if (Array.isArray(c)) { - if (this.sync) return cb.call(this, null, c) - return process.nextTick(cb.bind(this, null, c)) - } - - if (!c || c === 1) { - // either ENOENT or ENOTDIR - var code = c ? "ENOTDIR" : "ENOENT" - , er = new Error((c ? "Not a directory" : "Not found") + ": " + f) - er.path = f - er.code = code - this.log(f, er) - if (this.sync) return cb.call(this, er) - return process.nextTick(cb.bind(this, er)) - } - - // at this point, c === 2, meaning it's a dir, but we haven't - // had to read it yet, or c === true, meaning it's *something* - // but we don't have any idea what. Need to read it, either way. - } - - if (this.sync) { - var er, entries - try { - entries = fs.readdirSync(abs) - } catch (e) { - er = e - } - return this._afterReaddir(f, abs, cb, er, entries) - } - - fs.readdir(abs, this._afterReaddir.bind(this, f, abs, cb)) -} - -Glob.prototype._afterReaddir = function (f, abs, cb, er, entries) { - assert(this instanceof Glob) - if (entries && !er) { - this.cache[f] = entries - // if we haven't asked to stat everything for suresies, then just - // assume that everything in there exists, so we can avoid - // having to stat it a second time. This also gets us one step - // further into ELOOP territory. - if (!this.mark && !this.stat) { - entries.forEach(function (e) { - if (f === "/") e = f + e - else e = f + "/" + e - this.cache[e] = true - }, this) - } - - return cb.call(this, er, entries) - } - - // now handle errors, and cache the information - if (er) switch (er.code) { - case "ENOTDIR": // totally normal. means it *does* exist. - this.cache[f] = 1 - return cb.call(this, er) - case "ENOENT": // not terribly unusual - case "ELOOP": - case "ENAMETOOLONG": - case "UNKNOWN": - this.cache[f] = false - return cb.call(this, er) - default: // some unusual error. Treat as failure. - this.cache[f] = false - if (this.strict) this.emit("error", er) - if (!this.silent) console.error("glob error", er) - return cb.call(this, er) - } -} - -var isAbsolute = process.platform === "win32" ? absWin : absUnix - -function absWin (p) { - if (absUnix(p)) return true - // pull off the device/UNC bit from a windows path. - // from node's lib/path.js - var splitDeviceRe = - /^([a-zA-Z]:|[\\\/]{2}[^\\\/]+[\\\/]+[^\\\/]+)?([\\\/])?([\s\S]*?)$/ - , result = splitDeviceRe.exec(p) - , device = result[1] || '' - , isUnc = device && device.charAt(1) !== ':' - , isAbsolute = !!result[2] || isUnc // UNC paths are always absolute - - return isAbsolute -} - -function absUnix (p) { - return p.charAt(0) === "/" || p === "" -} diff --git a/node_modules/glob/package.json b/node_modules/glob/package.json deleted file mode 100644 index 91ab140..0000000 --- a/node_modules/glob/package.json +++ /dev/null @@ -1,28 +0,0 @@ -{ - "author": "Isaac Z. Schlueter (http://blog.izs.me/)", - "name": "glob", - "description": "a little globber", - "version": "3.2.3", - "repository": { - "type": "git", - "url": "git://github.com/isaacs/node-glob.git" - }, - "main": "glob.js", - "engines": { - "node": "*" - }, - "dependencies": { - "minimatch": "~0.2.11", - "graceful-fs": "~2.0.0", - "inherits": "2" - }, - "devDependencies": { - "tap": "~0.4.0", - "mkdirp": "0", - "rimraf": "1" - }, - "scripts": { - "test": "tap test/*.js" - }, - "license": "BSD" -} diff --git a/node_modules/glob/test/00-setup.js b/node_modules/glob/test/00-setup.js deleted file mode 100644 index 245afaf..0000000 --- a/node_modules/glob/test/00-setup.js +++ /dev/null @@ -1,176 +0,0 @@ -// just a little pre-run script to set up the fixtures. -// zz-finish cleans it up - -var mkdirp = require("mkdirp") -var path = require("path") -var i = 0 -var tap = require("tap") -var fs = require("fs") -var rimraf = require("rimraf") - -var files = -[ "a/.abcdef/x/y/z/a" -, "a/abcdef/g/h" -, "a/abcfed/g/h" -, "a/b/c/d" -, "a/bc/e/f" -, "a/c/d/c/b" -, "a/cb/e/f" -] - -var symlinkTo = path.resolve(__dirname, "a/symlink/a/b/c") -var symlinkFrom = "../.." - -files = files.map(function (f) { - return path.resolve(__dirname, f) -}) - -tap.test("remove fixtures", function (t) { - rimraf(path.resolve(__dirname, "a"), function (er) { - t.ifError(er, "remove fixtures") - t.end() - }) -}) - -files.forEach(function (f) { - tap.test(f, function (t) { - var d = path.dirname(f) - mkdirp(d, 0755, function (er) { - if (er) { - t.fail(er) - return t.bailout() - } - fs.writeFile(f, "i like tests", function (er) { - t.ifError(er, "make file") - t.end() - }) - }) - }) -}) - -if (process.platform !== "win32") { - tap.test("symlinky", function (t) { - var d = path.dirname(symlinkTo) - console.error("mkdirp", d) - mkdirp(d, 0755, function (er) { - t.ifError(er) - fs.symlink(symlinkFrom, symlinkTo, "dir", function (er) { - t.ifError(er, "make symlink") - t.end() - }) - }) - }) -} - -;["foo","bar","baz","asdf","quux","qwer","rewq"].forEach(function (w) { - w = "/tmp/glob-test/" + w - tap.test("create " + w, function (t) { - mkdirp(w, function (er) { - if (er) - throw er - t.pass(w) - t.end() - }) - }) -}) - - -// generate the bash pattern test-fixtures if possible -if (process.platform === "win32" || !process.env.TEST_REGEN) { - console.error("Windows, or TEST_REGEN unset. Using cached fixtures.") - return -} - -var spawn = require("child_process").spawn; -var globs = - // put more patterns here. - // anything that would be directly in / should be in /tmp/glob-test - ["test/a/*/+(c|g)/./d" - ,"test/a/**/[cg]/../[cg]" - ,"test/a/{b,c,d,e,f}/**/g" - ,"test/a/b/**" - ,"test/**/g" - ,"test/a/abc{fed,def}/g/h" - ,"test/a/abc{fed/g,def}/**/" - ,"test/a/abc{fed/g,def}/**///**/" - ,"test/**/a/**/" - ,"test/+(a|b|c)/a{/,bc*}/**" - ,"test/*/*/*/f" - ,"test/**/f" - ,"test/a/symlink/a/b/c/a/b/c/a/b/c//a/b/c////a/b/c/**/b/c/**" - ,"{./*/*,/tmp/glob-test/*}" - ,"{/tmp/glob-test/*,*}" // evil owl face! how you taunt me! - ,"test/a/!(symlink)/**" - ] -var bashOutput = {} -var fs = require("fs") - -globs.forEach(function (pattern) { - tap.test("generate fixture " + pattern, function (t) { - var cmd = "shopt -s globstar && " + - "shopt -s extglob && " + - "shopt -s nullglob && " + - // "shopt >&2; " + - "eval \'for i in " + pattern + "; do echo $i; done\'" - var cp = spawn("bash", ["-c", cmd], { cwd: path.dirname(__dirname) }) - var out = [] - cp.stdout.on("data", function (c) { - out.push(c) - }) - cp.stderr.pipe(process.stderr) - cp.on("close", function (code) { - out = flatten(out) - if (!out) - out = [] - else - out = cleanResults(out.split(/\r*\n/)) - - bashOutput[pattern] = out - t.notOk(code, "bash test should finish nicely") - t.end() - }) - }) -}) - -tap.test("save fixtures", function (t) { - var fname = path.resolve(__dirname, "bash-results.json") - var data = JSON.stringify(bashOutput, null, 2) + "\n" - fs.writeFile(fname, data, function (er) { - t.ifError(er) - t.end() - }) -}) - -function cleanResults (m) { - // normalize discrepancies in ordering, duplication, - // and ending slashes. - return m.map(function (m) { - return m.replace(/\/+/g, "/").replace(/\/$/, "") - }).sort(alphasort).reduce(function (set, f) { - if (f !== set[set.length - 1]) set.push(f) - return set - }, []).sort(alphasort).map(function (f) { - // de-windows - return (process.platform !== 'win32') ? f - : f.replace(/^[a-zA-Z]:\\\\/, '/').replace(/\\/g, '/') - }) -} - -function flatten (chunks) { - var s = 0 - chunks.forEach(function (c) { s += c.length }) - var out = new Buffer(s) - s = 0 - chunks.forEach(function (c) { - c.copy(out, s) - s += c.length - }) - - return out.toString().trim() -} - -function alphasort (a, b) { - a = a.toLowerCase() - b = b.toLowerCase() - return a > b ? 1 : a < b ? -1 : 0 -} diff --git a/node_modules/glob/test/bash-comparison.js b/node_modules/glob/test/bash-comparison.js deleted file mode 100644 index 239ed1a..0000000 --- a/node_modules/glob/test/bash-comparison.js +++ /dev/null @@ -1,63 +0,0 @@ -// basic test -// show that it does the same thing by default as the shell. -var tap = require("tap") -, child_process = require("child_process") -, bashResults = require("./bash-results.json") -, globs = Object.keys(bashResults) -, glob = require("../") -, path = require("path") - -// run from the root of the project -// this is usually where you're at anyway, but be sure. -process.chdir(path.resolve(__dirname, "..")) - -function alphasort (a, b) { - a = a.toLowerCase() - b = b.toLowerCase() - return a > b ? 1 : a < b ? -1 : 0 -} - -globs.forEach(function (pattern) { - var expect = bashResults[pattern] - // anything regarding the symlink thing will fail on windows, so just skip it - if (process.platform === "win32" && - expect.some(function (m) { - return /\/symlink\//.test(m) - })) - return - - tap.test(pattern, function (t) { - glob(pattern, function (er, matches) { - if (er) - throw er - - // sort and unmark, just to match the shell results - matches = cleanResults(matches) - - t.deepEqual(matches, expect, pattern) - t.end() - }) - }) - - tap.test(pattern + " sync", function (t) { - var matches = cleanResults(glob.sync(pattern)) - - t.deepEqual(matches, expect, "should match shell") - t.end() - }) -}) - -function cleanResults (m) { - // normalize discrepancies in ordering, duplication, - // and ending slashes. - return m.map(function (m) { - return m.replace(/\/+/g, "/").replace(/\/$/, "") - }).sort(alphasort).reduce(function (set, f) { - if (f !== set[set.length - 1]) set.push(f) - return set - }, []).sort(alphasort).map(function (f) { - // de-windows - return (process.platform !== 'win32') ? f - : f.replace(/^[a-zA-Z]:[\/\\]+/, '/').replace(/[\\\/]+/g, '/') - }) -} diff --git a/node_modules/glob/test/bash-results.json b/node_modules/glob/test/bash-results.json deleted file mode 100644 index a9bc347..0000000 --- a/node_modules/glob/test/bash-results.json +++ /dev/null @@ -1,350 +0,0 @@ -{ - "test/a/*/+(c|g)/./d": [ - "test/a/b/c/./d" - ], - "test/a/**/[cg]/../[cg]": [ - "test/a/abcdef/g/../g", - "test/a/abcfed/g/../g", - "test/a/b/c/../c", - "test/a/c/../c", - "test/a/c/d/c/../c", - "test/a/symlink/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c" - ], - "test/a/{b,c,d,e,f}/**/g": [], - "test/a/b/**": [ - "test/a/b", - "test/a/b/c", - "test/a/b/c/d" - ], - "test/**/g": [ - "test/a/abcdef/g", - "test/a/abcfed/g" - ], - "test/a/abc{fed,def}/g/h": [ - "test/a/abcdef/g/h", - "test/a/abcfed/g/h" - ], - "test/a/abc{fed/g,def}/**/": [ - "test/a/abcdef", - "test/a/abcdef/g", - "test/a/abcfed/g" - ], - "test/a/abc{fed/g,def}/**///**/": [ - "test/a/abcdef", - "test/a/abcdef/g", - "test/a/abcfed/g" - ], - "test/**/a/**/": [ - "test/a", - "test/a/abcdef", - "test/a/abcdef/g", - "test/a/abcfed", - "test/a/abcfed/g", - "test/a/b", - "test/a/b/c", - "test/a/bc", - "test/a/bc/e", - "test/a/c", - "test/a/c/d", - "test/a/c/d/c", - "test/a/cb", - "test/a/cb/e", - "test/a/symlink", - "test/a/symlink/a", - "test/a/symlink/a/b", - "test/a/symlink/a/b/c", - "test/a/symlink/a/b/c/a", - "test/a/symlink/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b" - ], - "test/+(a|b|c)/a{/,bc*}/**": [ - "test/a/abcdef", - "test/a/abcdef/g", - "test/a/abcdef/g/h", - "test/a/abcfed", - "test/a/abcfed/g", - "test/a/abcfed/g/h" - ], - "test/*/*/*/f": [ - "test/a/bc/e/f", - "test/a/cb/e/f" - ], - "test/**/f": [ - "test/a/bc/e/f", - "test/a/cb/e/f" - ], - "test/a/symlink/a/b/c/a/b/c/a/b/c//a/b/c////a/b/c/**/b/c/**": [ - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b", - "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c" - ], - "{./*/*,/tmp/glob-test/*}": [ - "./examples/g.js", - "./examples/usr-local.js", - "./node_modules/graceful-fs", - "./node_modules/inherits", - "./node_modules/minimatch", - "./node_modules/mkdirp", - "./node_modules/rimraf", - "./node_modules/tap", - "./test/00-setup.js", - "./test/a", - "./test/bash-comparison.js", - "./test/bash-results.json", - "./test/cwd-test.js", - "./test/globstar-match.js", - "./test/mark.js", - "./test/nocase-nomagic.js", - "./test/pause-resume.js", - "./test/root-nomount.js", - "./test/root.js", - "./test/stat.js", - "./test/zz-cleanup.js", - "/tmp/glob-test/asdf", - "/tmp/glob-test/bar", - "/tmp/glob-test/baz", - "/tmp/glob-test/foo", - "/tmp/glob-test/quux", - "/tmp/glob-test/qwer", - "/tmp/glob-test/rewq" - ], - "{/tmp/glob-test/*,*}": [ - "/tmp/glob-test/asdf", - "/tmp/glob-test/bar", - "/tmp/glob-test/baz", - "/tmp/glob-test/foo", - "/tmp/glob-test/quux", - "/tmp/glob-test/qwer", - "/tmp/glob-test/rewq", - "examples", - "glob.js", - "LICENSE", - "node_modules", - "package.json", - "README.md", - "test" - ], - "test/a/!(symlink)/**": [ - "test/a/abcdef", - "test/a/abcdef/g", - "test/a/abcdef/g/h", - "test/a/abcfed", - "test/a/abcfed/g", - "test/a/abcfed/g/h", - "test/a/b", - "test/a/b/c", - "test/a/b/c/d", - "test/a/bc", - "test/a/bc/e", - "test/a/bc/e/f", - "test/a/c", - "test/a/c/d", - "test/a/c/d/c", - "test/a/c/d/c/b", - "test/a/cb", - "test/a/cb/e", - "test/a/cb/e/f" - ] -} diff --git a/node_modules/glob/test/cwd-test.js b/node_modules/glob/test/cwd-test.js deleted file mode 100644 index 352c27e..0000000 --- a/node_modules/glob/test/cwd-test.js +++ /dev/null @@ -1,55 +0,0 @@ -var tap = require("tap") - -var origCwd = process.cwd() -process.chdir(__dirname) - -tap.test("changing cwd and searching for **/d", function (t) { - var glob = require('../') - var path = require('path') - t.test('.', function (t) { - glob('**/d', function (er, matches) { - t.ifError(er) - t.like(matches, [ 'a/b/c/d', 'a/c/d' ]) - t.end() - }) - }) - - t.test('a', function (t) { - glob('**/d', {cwd:path.resolve('a')}, function (er, matches) { - t.ifError(er) - t.like(matches, [ 'b/c/d', 'c/d' ]) - t.end() - }) - }) - - t.test('a/b', function (t) { - glob('**/d', {cwd:path.resolve('a/b')}, function (er, matches) { - t.ifError(er) - t.like(matches, [ 'c/d' ]) - t.end() - }) - }) - - t.test('a/b/', function (t) { - glob('**/d', {cwd:path.resolve('a/b/')}, function (er, matches) { - t.ifError(er) - t.like(matches, [ 'c/d' ]) - t.end() - }) - }) - - t.test('.', function (t) { - glob('**/d', {cwd: process.cwd()}, function (er, matches) { - t.ifError(er) - t.like(matches, [ 'a/b/c/d', 'a/c/d' ]) - t.end() - }) - }) - - t.test('cd -', function (t) { - process.chdir(origCwd) - t.end() - }) - - t.end() -}) diff --git a/node_modules/glob/test/globstar-match.js b/node_modules/glob/test/globstar-match.js deleted file mode 100644 index 9b234fa..0000000 --- a/node_modules/glob/test/globstar-match.js +++ /dev/null @@ -1,19 +0,0 @@ -var Glob = require("../glob.js").Glob -var test = require('tap').test - -test('globstar should not have dupe matches', function(t) { - var pattern = 'a/**/[gh]' - var g = new Glob(pattern, { cwd: __dirname }) - var matches = [] - g.on('match', function(m) { - console.error('match %j', m) - matches.push(m) - }) - g.on('end', function(set) { - console.error('set', set) - matches = matches.sort() - set = set.sort() - t.same(matches, set, 'should have same set of matches') - t.end() - }) -}) diff --git a/node_modules/glob/test/mark.js b/node_modules/glob/test/mark.js deleted file mode 100644 index ed68a33..0000000 --- a/node_modules/glob/test/mark.js +++ /dev/null @@ -1,74 +0,0 @@ -var test = require("tap").test -var glob = require('../') -process.chdir(__dirname) - -test("mark, no / on pattern", function (t) { - glob("a/*", {mark: true}, function (er, results) { - if (er) - throw er - var expect = [ 'a/abcdef/', - 'a/abcfed/', - 'a/b/', - 'a/bc/', - 'a/c/', - 'a/cb/' ] - - if (process.platform !== "win32") - expect.push('a/symlink/') - - t.same(results, expect) - t.end() - }) -}) - -test("mark=false, no / on pattern", function (t) { - glob("a/*", function (er, results) { - if (er) - throw er - var expect = [ 'a/abcdef', - 'a/abcfed', - 'a/b', - 'a/bc', - 'a/c', - 'a/cb' ] - - if (process.platform !== "win32") - expect.push('a/symlink') - t.same(results, expect) - t.end() - }) -}) - -test("mark=true, / on pattern", function (t) { - glob("a/*/", {mark: true}, function (er, results) { - if (er) - throw er - var expect = [ 'a/abcdef/', - 'a/abcfed/', - 'a/b/', - 'a/bc/', - 'a/c/', - 'a/cb/' ] - if (process.platform !== "win32") - expect.push('a/symlink/') - t.same(results, expect) - t.end() - }) -}) - -test("mark=false, / on pattern", function (t) { - glob("a/*/", function (er, results) { - if (er) - throw er - var expect = [ 'a/abcdef/', - 'a/abcfed/', - 'a/b/', - 'a/bc/', - 'a/c/', - 'a/cb/' ] - if (process.platform !== "win32") - expect.push('a/symlink/') - t.same(results, expect) - t.end() - }) -}) diff --git a/node_modules/glob/test/nocase-nomagic.js b/node_modules/glob/test/nocase-nomagic.js deleted file mode 100644 index d862970..0000000 --- a/node_modules/glob/test/nocase-nomagic.js +++ /dev/null @@ -1,113 +0,0 @@ -var fs = require('graceful-fs'); -var test = require('tap').test; -var glob = require('../'); - -test('mock fs', function(t) { - var stat = fs.stat - var statSync = fs.statSync - var readdir = fs.readdir - var readdirSync = fs.readdirSync - - function fakeStat(path) { - var ret - switch (path.toLowerCase()) { - case '/tmp': case '/tmp/': - ret = { isDirectory: function() { return true } } - break - case '/tmp/a': - ret = { isDirectory: function() { return false } } - break - } - return ret - } - - fs.stat = function(path, cb) { - var f = fakeStat(path); - if (f) { - process.nextTick(function() { - cb(null, f) - }) - } else { - stat.call(fs, path, cb) - } - } - - fs.statSync = function(path) { - return fakeStat(path) || statSync.call(fs, path) - } - - function fakeReaddir(path) { - var ret - switch (path.toLowerCase()) { - case '/tmp': case '/tmp/': - ret = [ 'a', 'A' ] - break - case '/': - ret = ['tmp', 'tMp', 'tMP', 'TMP'] - } - return ret - } - - fs.readdir = function(path, cb) { - var f = fakeReaddir(path) - if (f) - process.nextTick(function() { - cb(null, f) - }) - else - readdir.call(fs, path, cb) - } - - fs.readdirSync = function(path) { - return fakeReaddir(path) || readdirSync.call(fs, path) - } - - t.pass('mocked') - t.end() -}) - -test('nocase, nomagic', function(t) { - var n = 2 - var want = [ '/TMP/A', - '/TMP/a', - '/tMP/A', - '/tMP/a', - '/tMp/A', - '/tMp/a', - '/tmp/A', - '/tmp/a' ] - glob('/tmp/a', { nocase: true }, function(er, res) { - if (er) - throw er - t.same(res.sort(), want) - if (--n === 0) t.end() - }) - glob('/tmp/A', { nocase: true }, function(er, res) { - if (er) - throw er - t.same(res.sort(), want) - if (--n === 0) t.end() - }) -}) - -test('nocase, with some magic', function(t) { - t.plan(2) - var want = [ '/TMP/A', - '/TMP/a', - '/tMP/A', - '/tMP/a', - '/tMp/A', - '/tMp/a', - '/tmp/A', - '/tmp/a' ] - glob('/tmp/*', { nocase: true }, function(er, res) { - if (er) - throw er - t.same(res.sort(), want) - }) - glob('/tmp/*', { nocase: true }, function(er, res) { - if (er) - throw er - t.same(res.sort(), want) - }) -}) diff --git a/node_modules/glob/test/pause-resume.js b/node_modules/glob/test/pause-resume.js deleted file mode 100644 index e1ffbab..0000000 --- a/node_modules/glob/test/pause-resume.js +++ /dev/null @@ -1,73 +0,0 @@ -// show that no match events happen while paused. -var tap = require("tap") -, child_process = require("child_process") -// just some gnarly pattern with lots of matches -, pattern = "test/a/!(symlink)/**" -, bashResults = require("./bash-results.json") -, patterns = Object.keys(bashResults) -, glob = require("../") -, Glob = glob.Glob -, path = require("path") - -// run from the root of the project -// this is usually where you're at anyway, but be sure. -process.chdir(path.resolve(__dirname, "..")) - -function alphasort (a, b) { - a = a.toLowerCase() - b = b.toLowerCase() - return a > b ? 1 : a < b ? -1 : 0 -} - -function cleanResults (m) { - // normalize discrepancies in ordering, duplication, - // and ending slashes. - return m.map(function (m) { - return m.replace(/\/+/g, "/").replace(/\/$/, "") - }).sort(alphasort).reduce(function (set, f) { - if (f !== set[set.length - 1]) set.push(f) - return set - }, []).sort(alphasort).map(function (f) { - // de-windows - return (process.platform !== 'win32') ? f - : f.replace(/^[a-zA-Z]:\\\\/, '/').replace(/\\/g, '/') - }) -} - -var globResults = [] -tap.test("use a Glob object, and pause/resume it", function (t) { - var g = new Glob(pattern) - , paused = false - , res = [] - , expect = bashResults[pattern] - - g.on("pause", function () { - console.error("pause") - }) - - g.on("resume", function () { - console.error("resume") - }) - - g.on("match", function (m) { - t.notOk(g.paused, "must not be paused") - globResults.push(m) - g.pause() - t.ok(g.paused, "must be paused") - setTimeout(g.resume.bind(g), 10) - }) - - g.on("end", function (matches) { - t.pass("reached glob end") - globResults = cleanResults(globResults) - matches = cleanResults(matches) - t.deepEqual(matches, globResults, - "end event matches should be the same as match events") - - t.deepEqual(matches, expect, - "glob matches should be the same as bash results") - - t.end() - }) -}) - diff --git a/node_modules/glob/test/root-nomount.js b/node_modules/glob/test/root-nomount.js deleted file mode 100644 index 3ac5979..0000000 --- a/node_modules/glob/test/root-nomount.js +++ /dev/null @@ -1,39 +0,0 @@ -var tap = require("tap") - -var origCwd = process.cwd() -process.chdir(__dirname) - -tap.test("changing root and searching for /b*/**", function (t) { - var glob = require('../') - var path = require('path') - t.test('.', function (t) { - glob('/b*/**', { globDebug: true, root: '.', nomount: true }, function (er, matches) { - t.ifError(er) - t.like(matches, []) - t.end() - }) - }) - - t.test('a', function (t) { - glob('/b*/**', { globDebug: true, root: path.resolve('a'), nomount: true }, function (er, matches) { - t.ifError(er) - t.like(matches, [ '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' ]) - t.end() - }) - }) - - t.test('root=a, cwd=a/b', function (t) { - glob('/b*/**', { globDebug: true, root: 'a', cwd: path.resolve('a/b'), nomount: true }, function (er, matches) { - t.ifError(er) - t.like(matches, [ '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' ]) - t.end() - }) - }) - - t.test('cd -', function (t) { - process.chdir(origCwd) - t.end() - }) - - t.end() -}) diff --git a/node_modules/glob/test/root.js b/node_modules/glob/test/root.js deleted file mode 100644 index 95c23f9..0000000 --- a/node_modules/glob/test/root.js +++ /dev/null @@ -1,46 +0,0 @@ -var t = require("tap") - -var origCwd = process.cwd() -process.chdir(__dirname) - -var glob = require('../') -var path = require('path') - -t.test('.', function (t) { - glob('/b*/**', { globDebug: true, root: '.' }, function (er, matches) { - t.ifError(er) - t.like(matches, []) - t.end() - }) -}) - - -t.test('a', function (t) { - console.error("root=" + path.resolve('a')) - glob('/b*/**', { globDebug: true, root: path.resolve('a') }, function (er, matches) { - t.ifError(er) - var wanted = [ - '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' - ].map(function (m) { - return path.join(path.resolve('a'), m).replace(/\\/g, '/') - }) - - t.like(matches, wanted) - t.end() - }) -}) - -t.test('root=a, cwd=a/b', function (t) { - glob('/b*/**', { globDebug: true, root: 'a', cwd: path.resolve('a/b') }, function (er, matches) { - t.ifError(er) - t.like(matches, [ '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' ].map(function (m) { - return path.join(path.resolve('a'), m).replace(/\\/g, '/') - })) - t.end() - }) -}) - -t.test('cd -', function (t) { - process.chdir(origCwd) - t.end() -}) diff --git a/node_modules/glob/test/stat.js b/node_modules/glob/test/stat.js deleted file mode 100644 index 6291711..0000000 --- a/node_modules/glob/test/stat.js +++ /dev/null @@ -1,32 +0,0 @@ -var glob = require('../') -var test = require('tap').test -var path = require('path') - -test('stat all the things', function(t) { - var g = new glob.Glob('a/*abc*/**', { stat: true, cwd: __dirname }) - var matches = [] - g.on('match', function(m) { - matches.push(m) - }) - var stats = [] - g.on('stat', function(m) { - stats.push(m) - }) - g.on('end', function(eof) { - stats = stats.sort() - matches = matches.sort() - eof = eof.sort() - t.same(stats, matches) - t.same(eof, matches) - var cache = Object.keys(this.statCache) - t.same(cache.map(function (f) { - return path.relative(__dirname, f) - }).sort(), matches) - - cache.forEach(function(c) { - t.equal(typeof this.statCache[c], 'object') - }, this) - - t.end() - }) -}) diff --git a/node_modules/glob/test/zz-cleanup.js b/node_modules/glob/test/zz-cleanup.js deleted file mode 100644 index e085f0f..0000000 --- a/node_modules/glob/test/zz-cleanup.js +++ /dev/null @@ -1,11 +0,0 @@ -// remove the fixtures -var tap = require("tap") -, rimraf = require("rimraf") -, path = require("path") - -tap.test("cleanup fixtures", function (t) { - rimraf(path.resolve(__dirname, "a"), function (er) { - t.ifError(er, "removed") - t.end() - }) -}) diff --git a/node_modules/graceful-fs/.npmignore b/node_modules/graceful-fs/.npmignore deleted file mode 100644 index c2658d7..0000000 --- a/node_modules/graceful-fs/.npmignore +++ /dev/null @@ -1 +0,0 @@ -node_modules/ diff --git a/node_modules/graceful-fs/LICENSE b/node_modules/graceful-fs/LICENSE deleted file mode 100644 index 0c44ae7..0000000 --- a/node_modules/graceful-fs/LICENSE +++ /dev/null @@ -1,27 +0,0 @@ -Copyright (c) Isaac Z. Schlueter ("Author") -All rights reserved. - -The BSD License - -Redistribution and use in source and binary forms, with or without -modification, are permitted provided that the following conditions -are met: - -1. Redistributions of source code must retain the above copyright - notice, this list of conditions and the following disclaimer. - -2. Redistributions in binary form must reproduce the above copyright - notice, this list of conditions and the following disclaimer in the - documentation and/or other materials provided with the distribution. - -THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND -ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE -IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR -PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS -BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR -CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF -SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR -BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, -WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE -OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN -IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/graceful-fs/README.md b/node_modules/graceful-fs/README.md deleted file mode 100644 index eb1a109..0000000 --- a/node_modules/graceful-fs/README.md +++ /dev/null @@ -1,26 +0,0 @@ -# graceful-fs - -graceful-fs functions as a drop-in replacement for the fs module, -making various improvements. - -The improvements are meant to normalize behavior across different -platforms and environments, and to make filesystem access more -resilient to errors. - -## Improvements over fs module - -graceful-fs: - -* Queues up `open` and `readdir` calls, and retries them once - something closes if there is an EMFILE error from too many file - descriptors. -* fixes `lchmod` for Node versions prior to 0.6.2. -* implements `fs.lutimes` if possible. Otherwise it becomes a noop. -* ignores `EINVAL` and `EPERM` errors in `chown`, `fchown` or - `lchown` if the user isn't root. -* makes `lchmod` and `lchown` become noops, if not available. -* retries reading a file if `read` results in EAGAIN error. - -On Windows, it retries renaming a file for up to one second if `EACCESS` -or `EPERM` error occurs, likely because antivirus software has locked -the directory. diff --git a/node_modules/graceful-fs/graceful-fs.js b/node_modules/graceful-fs/graceful-fs.js deleted file mode 100644 index c84db91..0000000 --- a/node_modules/graceful-fs/graceful-fs.js +++ /dev/null @@ -1,160 +0,0 @@ -// Monkey-patching the fs module. -// It's ugly, but there is simply no other way to do this. -var fs = module.exports = require('fs') - -var assert = require('assert') - -// fix up some busted stuff, mostly on windows and old nodes -require('./polyfills.js') - -// The EMFILE enqueuing stuff - -var util = require('util') - -function noop () {} - -var debug = noop -if (util.debuglog) - debug = util.debuglog('gfs') -else if (/\bgfs\b/i.test(process.env.NODE_DEBUG || '')) - debug = function() { - var m = util.format.apply(util, arguments) - m = 'GFS: ' + m.split(/\n/).join('\nGFS: ') - console.error(m) - } - -if (/\bgfs\b/i.test(process.env.NODE_DEBUG || '')) { - process.on('exit', function() { - debug('fds', fds) - debug(queue) - assert.equal(queue.length, 0) - }) -} - - -var originalOpen = fs.open -fs.open = open - -function open(path, flags, mode, cb) { - if (typeof mode === "function") cb = mode, mode = null - if (typeof cb !== "function") cb = noop - new OpenReq(path, flags, mode, cb) -} - -function OpenReq(path, flags, mode, cb) { - this.path = path - this.flags = flags - this.mode = mode - this.cb = cb - Req.call(this) -} - -util.inherits(OpenReq, Req) - -OpenReq.prototype.process = function() { - originalOpen.call(fs, this.path, this.flags, this.mode, this.done) -} - -var fds = {} -OpenReq.prototype.done = function(er, fd) { - debug('open done', er, fd) - if (fd) - fds['fd' + fd] = this.path - Req.prototype.done.call(this, er, fd) -} - - -var originalReaddir = fs.readdir -fs.readdir = readdir - -function readdir(path, cb) { - if (typeof cb !== "function") cb = noop - new ReaddirReq(path, cb) -} - -function ReaddirReq(path, cb) { - this.path = path - this.cb = cb - Req.call(this) -} - -util.inherits(ReaddirReq, Req) - -ReaddirReq.prototype.process = function() { - originalReaddir.call(fs, this.path, this.done) -} - -ReaddirReq.prototype.done = function(er, files) { - if (files && files.sort) - files = files.sort() - Req.prototype.done.call(this, er, files) - onclose() -} - - -var originalClose = fs.close -fs.close = close - -function close (fd, cb) { - debug('close', fd) - if (typeof cb !== "function") cb = noop - delete fds['fd' + fd] - originalClose.call(fs, fd, function(er) { - onclose() - cb(er) - }) -} - - -var originalCloseSync = fs.closeSync -fs.closeSync = closeSync - -function closeSync (fd) { - try { - return originalCloseSync(fd) - } finally { - onclose() - } -} - - -// Req class -function Req () { - // start processing - this.done = this.done.bind(this) - this.failures = 0 - this.process() -} - -Req.prototype.done = function (er, result) { - var tryAgain = false - if (er) { - var code = er.code - var tryAgain = code === "EMFILE" - if (process.platform === "win32") - tryAgain = tryAgain || code === "OK" - } - - if (tryAgain) { - this.failures ++ - enqueue(this) - } else { - var cb = this.cb - cb(er, result) - } -} - -var queue = [] - -function enqueue(req) { - queue.push(req) - debug('enqueue %d %s', queue.length, req.constructor.name, req) -} - -function onclose() { - var req = queue.shift() - if (req) { - debug('process', req.constructor.name, req) - req.process() - } -} diff --git a/node_modules/graceful-fs/package.json b/node_modules/graceful-fs/package.json deleted file mode 100644 index 2f02893..0000000 --- a/node_modules/graceful-fs/package.json +++ /dev/null @@ -1,37 +0,0 @@ -{ - "author": "Isaac Z. Schlueter (http://blog.izs.me)", - "name": "graceful-fs", - "description": "A drop-in replacement for fs, making various improvements.", - "version": "2.0.3", - "repository": { - "type": "git", - "url": "git://github.com/isaacs/node-graceful-fs.git" - }, - "main": "graceful-fs.js", - "engines": { - "node": ">=0.4.0" - }, - "directories": { - "test": "test" - }, - "scripts": { - "test": "tap test/*.js" - }, - "keywords": [ - "fs", - "module", - "reading", - "retry", - "retries", - "queue", - "error", - "errors", - "handling", - "EMFILE", - "EAGAIN", - "EINVAL", - "EPERM", - "EACCESS" - ], - "license": "BSD" -} diff --git a/node_modules/graceful-fs/polyfills.js b/node_modules/graceful-fs/polyfills.js deleted file mode 100644 index afc83b3..0000000 --- a/node_modules/graceful-fs/polyfills.js +++ /dev/null @@ -1,228 +0,0 @@ -var fs = require('fs') -var constants = require('constants') - -var origCwd = process.cwd -var cwd = null -process.cwd = function() { - if (!cwd) - cwd = origCwd.call(process) - return cwd -} -var chdir = process.chdir -process.chdir = function(d) { - cwd = null - chdir.call(process, d) -} - -// (re-)implement some things that are known busted or missing. - -// lchmod, broken prior to 0.6.2 -// back-port the fix here. -if (constants.hasOwnProperty('O_SYMLINK') && - process.version.match(/^v0\.6\.[0-2]|^v0\.5\./)) { - fs.lchmod = function (path, mode, callback) { - callback = callback || noop - fs.open( path - , constants.O_WRONLY | constants.O_SYMLINK - , mode - , function (err, fd) { - if (err) { - callback(err) - return - } - // prefer to return the chmod error, if one occurs, - // but still try to close, and report closing errors if they occur. - fs.fchmod(fd, mode, function (err) { - fs.close(fd, function(err2) { - callback(err || err2) - }) - }) - }) - } - - fs.lchmodSync = function (path, mode) { - var fd = fs.openSync(path, constants.O_WRONLY | constants.O_SYMLINK, mode) - - // prefer to return the chmod error, if one occurs, - // but still try to close, and report closing errors if they occur. - var err, err2 - try { - var ret = fs.fchmodSync(fd, mode) - } catch (er) { - err = er - } - try { - fs.closeSync(fd) - } catch (er) { - err2 = er - } - if (err || err2) throw (err || err2) - return ret - } -} - - -// lutimes implementation, or no-op -if (!fs.lutimes) { - if (constants.hasOwnProperty("O_SYMLINK")) { - fs.lutimes = function (path, at, mt, cb) { - fs.open(path, constants.O_SYMLINK, function (er, fd) { - cb = cb || noop - if (er) return cb(er) - fs.futimes(fd, at, mt, function (er) { - fs.close(fd, function (er2) { - return cb(er || er2) - }) - }) - }) - } - - fs.lutimesSync = function (path, at, mt) { - var fd = fs.openSync(path, constants.O_SYMLINK) - , err - , err2 - , ret - - try { - var ret = fs.futimesSync(fd, at, mt) - } catch (er) { - err = er - } - try { - fs.closeSync(fd) - } catch (er) { - err2 = er - } - if (err || err2) throw (err || err2) - return ret - } - - } else if (fs.utimensat && constants.hasOwnProperty("AT_SYMLINK_NOFOLLOW")) { - // maybe utimensat will be bound soonish? - fs.lutimes = function (path, at, mt, cb) { - fs.utimensat(path, at, mt, constants.AT_SYMLINK_NOFOLLOW, cb) - } - - fs.lutimesSync = function (path, at, mt) { - return fs.utimensatSync(path, at, mt, constants.AT_SYMLINK_NOFOLLOW) - } - - } else { - fs.lutimes = function (_a, _b, _c, cb) { process.nextTick(cb) } - fs.lutimesSync = function () {} - } -} - - -// https://github.com/isaacs/node-graceful-fs/issues/4 -// Chown should not fail on einval or eperm if non-root. - -fs.chown = chownFix(fs.chown) -fs.fchown = chownFix(fs.fchown) -fs.lchown = chownFix(fs.lchown) - -fs.chownSync = chownFixSync(fs.chownSync) -fs.fchownSync = chownFixSync(fs.fchownSync) -fs.lchownSync = chownFixSync(fs.lchownSync) - -function chownFix (orig) { - if (!orig) return orig - return function (target, uid, gid, cb) { - return orig.call(fs, target, uid, gid, function (er, res) { - if (chownErOk(er)) er = null - cb(er, res) - }) - } -} - -function chownFixSync (orig) { - if (!orig) return orig - return function (target, uid, gid) { - try { - return orig.call(fs, target, uid, gid) - } catch (er) { - if (!chownErOk(er)) throw er - } - } -} - -function chownErOk (er) { - // if there's no getuid, or if getuid() is something other than 0, - // and the error is EINVAL or EPERM, then just ignore it. - // This specific case is a silent failure in cp, install, tar, - // and most other unix tools that manage permissions. - // When running as root, or if other types of errors are encountered, - // then it's strict. - if (!er || (!process.getuid || process.getuid() !== 0) - && (er.code === "EINVAL" || er.code === "EPERM")) return true -} - - -// if lchmod/lchown do not exist, then make them no-ops -if (!fs.lchmod) { - fs.lchmod = function (path, mode, cb) { - process.nextTick(cb) - } - fs.lchmodSync = function () {} -} -if (!fs.lchown) { - fs.lchown = function (path, uid, gid, cb) { - process.nextTick(cb) - } - fs.lchownSync = function () {} -} - - - -// on Windows, A/V software can lock the directory, causing this -// to fail with an EACCES or EPERM if the directory contains newly -// created files. Try again on failure, for up to 1 second. -if (process.platform === "win32") { - var rename_ = fs.rename - fs.rename = function rename (from, to, cb) { - var start = Date.now() - rename_(from, to, function CB (er) { - if (er - && (er.code === "EACCES" || er.code === "EPERM") - && Date.now() - start < 1000) { - return rename_(from, to, CB) - } - cb(er) - }) - } -} - - -// if read() returns EAGAIN, then just try it again. -var read = fs.read -fs.read = function (fd, buffer, offset, length, position, callback_) { - var callback - if (callback_ && typeof callback_ === 'function') { - var eagCounter = 0 - callback = function (er, _, __) { - if (er && er.code === 'EAGAIN' && eagCounter < 10) { - eagCounter ++ - return read.call(fs, fd, buffer, offset, length, position, callback) - } - callback_.apply(this, arguments) - } - } - return read.call(fs, fd, buffer, offset, length, position, callback) -} - -var readSync = fs.readSync -fs.readSync = function (fd, buffer, offset, length, position) { - var eagCounter = 0 - while (true) { - try { - return readSync.call(fs, fd, buffer, offset, length, position) - } catch (er) { - if (er.code === 'EAGAIN' && eagCounter < 10) { - eagCounter ++ - continue - } - throw er - } - } -} - diff --git a/node_modules/graceful-fs/test/open.js b/node_modules/graceful-fs/test/open.js deleted file mode 100644 index 104f36b..0000000 --- a/node_modules/graceful-fs/test/open.js +++ /dev/null @@ -1,39 +0,0 @@ -var test = require('tap').test -var fs = require('../graceful-fs.js') - -test('graceful fs is monkeypatched fs', function (t) { - t.equal(fs, require('fs')) - t.end() -}) - -test('open an existing file works', function (t) { - var fd = fs.openSync(__filename, 'r') - fs.closeSync(fd) - fs.open(__filename, 'r', function (er, fd) { - if (er) throw er - fs.close(fd, function (er) { - if (er) throw er - t.pass('works') - t.end() - }) - }) -}) - -test('open a non-existing file throws', function (t) { - var er - try { - var fd = fs.openSync('this file does not exist', 'r') - } catch (x) { - er = x - } - t.ok(er, 'should throw') - t.notOk(fd, 'should not get an fd') - t.equal(er.code, 'ENOENT') - - fs.open('neither does this file', 'r', function (er, fd) { - t.ok(er, 'should throw') - t.notOk(fd, 'should not get an fd') - t.equal(er.code, 'ENOENT') - t.end() - }) -}) diff --git a/node_modules/graceful-fs/test/readdir-sort.js b/node_modules/graceful-fs/test/readdir-sort.js deleted file mode 100644 index aeaedf1..0000000 --- a/node_modules/graceful-fs/test/readdir-sort.js +++ /dev/null @@ -1,21 +0,0 @@ -var test = require("tap").test -var fs = require("fs") - -var readdir = fs.readdir -fs.readdir = function(path, cb) { - process.nextTick(function() { - cb(null, ["b", "z", "a"]) - }) -} - -var g = require("../") - -test("readdir reorder", function (t) { - g.readdir("whatevers", function (er, files) { - if (er) - throw er - console.error(files) - t.same(files, [ "a", "b", "z" ]) - t.end() - }) -}) diff --git a/node_modules/growl/History.md b/node_modules/growl/History.md deleted file mode 100644 index a4b7b49..0000000 --- a/node_modules/growl/History.md +++ /dev/null @@ -1,63 +0,0 @@ - -1.7.0 / 2012-12-30 -================== - - * support transient notifications in Gnome - -1.6.1 / 2012-09-25 -================== - - * restore compatibility with node < 0.8 [fgnass] - -1.6.0 / 2012-09-06 -================== - - * add notification center support [drudge] - -1.5.1 / 2012-04-08 -================== - - * Merge pull request #16 from KyleAMathews/patch-1 - * Fixes #15 - -1.5.0 / 2012-02-08 -================== - - * Added windows support [perfusorius] - -1.4.1 / 2011-12-28 -================== - - * Fixed: dont exit(). Closes #9 - -1.4.0 / 2011-12-17 -================== - - * Changed API: `growl.notify()` -> `growl()` - -1.3.0 / 2011-12-17 -================== - - * Added support for Ubuntu/Debian/Linux users [niftylettuce] - * Fixed: send notifications even if title not specified [alessioalex] - -1.2.0 / 2011-10-06 -================== - - * Add support for priority. - -1.1.0 / 2011-03-15 -================== - - * Added optional callbacks - * Added parsing of version - -1.0.1 / 2010-03-26 -================== - - * Fixed; sys.exec -> child_process.exec to support latest node - -1.0.0 / 2010-03-19 -================== - - * Initial release diff --git a/node_modules/growl/Readme.md b/node_modules/growl/Readme.md deleted file mode 100644 index 48d717c..0000000 --- a/node_modules/growl/Readme.md +++ /dev/null @@ -1,99 +0,0 @@ -# Growl for nodejs - -Growl support for Nodejs. This is essentially a port of my [Ruby Growl Library](http://github.com/visionmedia/growl). Ubuntu/Linux support added thanks to [@niftylettuce](http://github.com/niftylettuce). - -## Installation - -### Install - -### Mac OS X (Darwin): - - Install [growlnotify(1)](http://growl.info/extras.php#growlnotify). On OS X 10.8, Notification Center is supported using [terminal-notifier](https://github.com/alloy/terminal-notifier). To install: - - $ sudo gem install terminal-notifier - - Install [npm](http://npmjs.org/) and run: - - $ npm install growl - -### Ubuntu (Linux): - - Install `notify-send` through the [libnotify-bin](http://packages.ubuntu.com/libnotify-bin) package: - - $ sudo apt-get install libnotify-bin - - Install [npm](http://npmjs.org/) and run: - - $ npm install growl - -### Windows: - - Download and install [Growl for Windows](http://www.growlforwindows.com/gfw/default.aspx) - - Download [growlnotify](http://www.growlforwindows.com/gfw/help/growlnotify.aspx) - **IMPORTANT :** Unpack growlnotify to a folder that is present in your path! - - Install [npm](http://npmjs.org/) and run: - - $ npm install growl - -## Examples - -Callback functions are optional - - var growl = require('growl') - growl('You have mail!') - growl('5 new messages', { sticky: true }) - growl('5 new emails', { title: 'Email Client', image: 'Safari', sticky: true }) - growl('Message with title', { title: 'Title'}) - growl('Set priority', { priority: 2 }) - growl('Show Safari icon', { image: 'Safari' }) - growl('Show icon', { image: 'path/to/icon.icns' }) - growl('Show image', { image: 'path/to/my.image.png' }) - growl('Show png filesystem icon', { image: 'png' }) - growl('Show pdf filesystem icon', { image: 'article.pdf' }) - growl('Show pdf filesystem icon', { image: 'article.pdf' }, function(err){ - // ... notified - }) - -## Options - - - title - - notification title - - name - - application name - - priority - - priority for the notification (default is 0) - - sticky - - weither or not the notification should remainin until closed - - image - - Auto-detects the context: - - path to an icon sets --iconpath - - path to an image sets --image - - capitalized word sets --appIcon - - filename uses extname as --icon - - otherwise treated as --icon - -## License - -(The MIT License) - -Copyright (c) 2009 TJ Holowaychuk - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/growl/lib/growl.js b/node_modules/growl/lib/growl.js deleted file mode 100644 index 04f4f9b..0000000 --- a/node_modules/growl/lib/growl.js +++ /dev/null @@ -1,234 +0,0 @@ -// Growl - Copyright TJ Holowaychuk (MIT Licensed) - -/** - * Module dependencies. - */ - -var exec = require('child_process').exec - , fs = require('fs') - , path = require('path') - , exists = fs.existsSync || path.existsSync - , os = require('os') - , quote = JSON.stringify - , cmd; - -function which(name) { - var paths = process.env.PATH.split(':'); - var loc; - - for (var i = 0, len = paths.length; i < len; ++i) { - loc = path.join(paths[i], name); - if (exists(loc)) return loc; - } -} - -switch(os.type()) { - case 'Darwin': - if (which('terminal-notifier')) { - cmd = { - type: "Darwin-NotificationCenter" - , pkg: "terminal-notifier" - , msg: '-message' - , title: '-title' - , subtitle: '-subtitle' - , priority: { - cmd: '-execute' - , range: [] - } - }; - } else { - cmd = { - type: "Darwin-Growl" - , pkg: "growlnotify" - , msg: '-m' - , sticky: '--sticky' - , priority: { - cmd: '--priority' - , range: [ - -2 - , -1 - , 0 - , 1 - , 2 - , "Very Low" - , "Moderate" - , "Normal" - , "High" - , "Emergency" - ] - } - }; - } - break; - case 'Linux': - cmd = { - type: "Linux" - , pkg: "notify-send" - , msg: '' - , sticky: '-t 0' - , icon: '-i' - , priority: { - cmd: '-u' - , range: [ - "low" - , "normal" - , "critical" - ] - } - }; - break; - case 'Windows_NT': - cmd = { - type: "Windows" - , pkg: "growlnotify" - , msg: '' - , sticky: '/s:true' - , title: '/t:' - , icon: '/i:' - , priority: { - cmd: '/p:' - , range: [ - -2 - , -1 - , 0 - , 1 - , 2 - ] - } - }; - break; -} - -/** - * Expose `growl`. - */ - -exports = module.exports = growl; - -/** - * Node-growl version. - */ - -exports.version = '1.4.1' - -/** - * Send growl notification _msg_ with _options_. - * - * Options: - * - * - title Notification title - * - sticky Make the notification stick (defaults to false) - * - priority Specify an int or named key (default is 0) - * - name Application name (defaults to growlnotify) - * - image - * - path to an icon sets --iconpath - * - path to an image sets --image - * - capitalized word sets --appIcon - * - filename uses extname as --icon - * - otherwise treated as --icon - * - * Examples: - * - * growl('New email') - * growl('5 new emails', { title: 'Thunderbird' }) - * growl('Email sent', function(){ - * // ... notification sent - * }) - * - * @param {string} msg - * @param {object} options - * @param {function} fn - * @api public - */ - -function growl(msg, options, fn) { - var image - , args - , options = options || {} - , fn = fn || function(){}; - - // noop - if (!cmd) return fn(new Error('growl not supported on this platform')); - args = [cmd.pkg]; - - // image - if (image = options.image) { - switch(cmd.type) { - case 'Darwin-Growl': - var flag, ext = path.extname(image).substr(1) - flag = flag || ext == 'icns' && 'iconpath' - flag = flag || /^[A-Z]/.test(image) && 'appIcon' - flag = flag || /^png|gif|jpe?g$/.test(ext) && 'image' - flag = flag || ext && (image = ext) && 'icon' - flag = flag || 'icon' - args.push('--' + flag, image) - break; - case 'Linux': - args.push(cmd.icon + " " + image); - // libnotify defaults to sticky, set a hint for transient notifications - if (!options.sticky) args.push('--hint=int:transient:1'); - break; - case 'Windows': - args.push(cmd.icon + quote(image)); - break; - } - } - - // sticky - if (options.sticky) args.push(cmd.sticky); - - // priority - if (options.priority) { - var priority = options.priority + ''; - var checkindexOf = cmd.priority.range.indexOf(priority); - if (~cmd.priority.range.indexOf(priority)) { - args.push(cmd.priority, options.priority); - } - } - - // name - if (options.name && cmd.type === "Darwin-Growl") { - args.push('--name', options.name); - } - - switch(cmd.type) { - case 'Darwin-Growl': - args.push(cmd.msg); - args.push(quote(msg)); - if (options.title) args.push(quote(options.title)); - break; - case 'Darwin-NotificationCenter': - args.push(cmd.msg); - args.push(quote(msg)); - if (options.title) { - args.push(cmd.title); - args.push(quote(options.title)); - } - if (options.subtitle) { - args.push(cmd.subtitle); - args.push(quote(options.title)); - } - break; - case 'Darwin-Growl': - args.push(cmd.msg); - args.push(quote(msg)); - if (options.title) args.push(quote(options.title)); - break; - case 'Linux': - if (options.title) { - args.push(quote(options.title)); - args.push(cmd.msg); - args.push(quote(msg)); - } else { - args.push(quote(msg)); - } - break; - case 'Windows': - args.push(quote(msg)); - if (options.title) args.push(cmd.title + quote(options.title)); - break; - } - - // execute - exec(args.join(' '), fn); -}; diff --git a/node_modules/growl/package.json b/node_modules/growl/package.json deleted file mode 100644 index 9fe713a..0000000 --- a/node_modules/growl/package.json +++ /dev/null @@ -1,7 +0,0 @@ -{ - "name": "growl", - "version": "1.7.0", - "description": "Growl unobtrusive notifications", - "author": "TJ Holowaychuk ", - "main": "./lib/growl.js" -} diff --git a/node_modules/growl/test.js b/node_modules/growl/test.js deleted file mode 100644 index cf22d90..0000000 --- a/node_modules/growl/test.js +++ /dev/null @@ -1,20 +0,0 @@ - -var growl = require('./lib/growl') - -growl('You have mail!') -growl('5 new messages', { sticky: true }) -growl('5 new emails', { title: 'Email Client', image: 'Safari', sticky: true }) -growl('Message with title', { title: 'Title'}) -growl('Set priority', { priority: 2 }) -growl('Show Safari icon', { image: 'Safari' }) -growl('Show icon', { image: 'path/to/icon.icns' }) -growl('Show image', { image: 'path/to/my.image.png' }) -growl('Show png filesystem icon', { image: 'png' }) -growl('Show pdf filesystem icon', { image: 'article.pdf' }) -growl('Show pdf filesystem icon', { image: 'article.pdf' }, function(){ - console.log('callback'); -}) -growl('Show pdf filesystem icon', { title: 'Use show()', image: 'article.pdf' }) -growl('here \' are \n some \\ characters that " need escaping', {}, function(error, stdout, stderr) { - if (error !== null) throw new Error('escaping failed:\n' + stdout + stderr); -}) diff --git a/node_modules/inherits/LICENSE b/node_modules/inherits/LICENSE deleted file mode 100644 index dea3013..0000000 --- a/node_modules/inherits/LICENSE +++ /dev/null @@ -1,16 +0,0 @@ -The ISC License - -Copyright (c) Isaac Z. Schlueter - -Permission to use, copy, modify, and/or distribute this software for any -purpose with or without fee is hereby granted, provided that the above -copyright notice and this permission notice appear in all copies. - -THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH -REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND -FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, -INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM -LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR -OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR -PERFORMANCE OF THIS SOFTWARE. - diff --git a/node_modules/inherits/README.md b/node_modules/inherits/README.md deleted file mode 100644 index b1c5665..0000000 --- a/node_modules/inherits/README.md +++ /dev/null @@ -1,42 +0,0 @@ -Browser-friendly inheritance fully compatible with standard node.js -[inherits](http://nodejs.org/api/util.html#util_util_inherits_constructor_superconstructor). - -This package exports standard `inherits` from node.js `util` module in -node environment, but also provides alternative browser-friendly -implementation through [browser -field](https://gist.github.com/shtylman/4339901). Alternative -implementation is a literal copy of standard one located in standalone -module to avoid requiring of `util`. It also has a shim for old -browsers with no `Object.create` support. - -While keeping you sure you are using standard `inherits` -implementation in node.js environment, it allows bundlers such as -[browserify](https://github.com/substack/node-browserify) to not -include full `util` package to your client code if all you need is -just `inherits` function. It worth, because browser shim for `util` -package is large and `inherits` is often the single function you need -from it. - -It's recommended to use this package instead of -`require('util').inherits` for any code that has chances to be used -not only in node.js but in browser too. - -## usage - -```js -var inherits = require('inherits'); -// then use exactly as the standard one -``` - -## note on version ~1.0 - -Version ~1.0 had completely different motivation and is not compatible -neither with 2.0 nor with standard node.js `inherits`. - -If you are using version ~1.0 and planning to switch to ~2.0, be -careful: - -* new version uses `super_` instead of `super` for referencing - superclass -* new version overwrites current prototype while old one preserves any - existing fields on it diff --git a/node_modules/inherits/inherits.js b/node_modules/inherits/inherits.js deleted file mode 100644 index 3b94763..0000000 --- a/node_modules/inherits/inherits.js +++ /dev/null @@ -1,7 +0,0 @@ -try { - var util = require('util'); - if (typeof util.inherits !== 'function') throw ''; - module.exports = util.inherits; -} catch (e) { - module.exports = require('./inherits_browser.js'); -} diff --git a/node_modules/inherits/inherits_browser.js b/node_modules/inherits/inherits_browser.js deleted file mode 100644 index c1e78a7..0000000 --- a/node_modules/inherits/inherits_browser.js +++ /dev/null @@ -1,23 +0,0 @@ -if (typeof Object.create === 'function') { - // implementation from standard node.js 'util' module - module.exports = function inherits(ctor, superCtor) { - ctor.super_ = superCtor - ctor.prototype = Object.create(superCtor.prototype, { - constructor: { - value: ctor, - enumerable: false, - writable: true, - configurable: true - } - }); - }; -} else { - // old school shim for old browsers - module.exports = function inherits(ctor, superCtor) { - ctor.super_ = superCtor - var TempCtor = function () {} - TempCtor.prototype = superCtor.prototype - ctor.prototype = new TempCtor() - ctor.prototype.constructor = ctor - } -} diff --git a/node_modules/inherits/package.json b/node_modules/inherits/package.json deleted file mode 100644 index 7cf62b9..0000000 --- a/node_modules/inherits/package.json +++ /dev/null @@ -1,29 +0,0 @@ -{ - "name": "inherits", - "description": "Browser-friendly inheritance fully compatible with standard node.js inherits()", - "version": "2.0.3", - "keywords": [ - "inheritance", - "class", - "klass", - "oop", - "object-oriented", - "inherits", - "browser", - "browserify" - ], - "main": "./inherits.js", - "browser": "./inherits_browser.js", - "repository": "git://github.com/isaacs/inherits", - "license": "ISC", - "scripts": { - "test": "node test" - }, - "devDependencies": { - "tap": "^7.1.0" - }, - "files": [ - "inherits.js", - "inherits_browser.js" - ] -} diff --git a/node_modules/jade/.npmignore b/node_modules/jade/.npmignore deleted file mode 100644 index b9af3d4..0000000 --- a/node_modules/jade/.npmignore +++ /dev/null @@ -1,15 +0,0 @@ -test -support -benchmarks -examples -lib-cov -coverage.html -.gitmodules -.travis.yml -History.md -Readme.md -Makefile -test/ -support/ -benchmarks/ -examples/ diff --git a/node_modules/jade/LICENSE b/node_modules/jade/LICENSE deleted file mode 100644 index 8ad0e0d..0000000 --- a/node_modules/jade/LICENSE +++ /dev/null @@ -1,22 +0,0 @@ -(The MIT License) - -Copyright (c) 2009-2010 TJ Holowaychuk - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/jade/bin/jade b/node_modules/jade/bin/jade deleted file mode 100755 index 7e6002f..0000000 --- a/node_modules/jade/bin/jade +++ /dev/null @@ -1,147 +0,0 @@ -#!/usr/bin/env node - -/** - * Module dependencies. - */ - -var fs = require('fs') - , program = require('commander') - , path = require('path') - , basename = path.basename - , dirname = path.dirname - , resolve = path.resolve - , join = path.join - , mkdirp = require('mkdirp') - , jade = require('../'); - -// jade options - -var options = {}; - -// options - -program - .version(jade.version) - .usage('[options] [dir|file ...]') - .option('-o, --obj ', 'javascript options object') - .option('-O, --out ', 'output the compiled html to ') - .option('-p, --path ', 'filename used to resolve includes') - .option('-P, --pretty', 'compile pretty html output') - .option('-c, --client', 'compile for client-side runtime.js') - .option('-D, --no-debug', 'compile without debugging (smaller functions)') - -program.on('--help', function(){ - console.log(' Examples:'); - console.log(''); - console.log(' # translate jade the templates dir'); - console.log(' $ jade templates'); - console.log(''); - console.log(' # create {foo,bar}.html'); - console.log(' $ jade {foo,bar}.jade'); - console.log(''); - console.log(' # jade over stdio'); - console.log(' $ jade < my.jade > my.html'); - console.log(''); - console.log(' # jade over stdio'); - console.log(' $ echo "h1 Jade!" | jade'); - console.log(''); - console.log(' # foo, bar dirs rendering to /tmp'); - console.log(' $ jade foo bar --out /tmp '); - console.log(''); -}); - -program.parse(process.argv); - -// options given, parse them - -if (program.obj) options = eval('(' + program.obj + ')'); - -// --filename - -if (program.path) options.filename = program.path; - -// --no-debug - -options.compileDebug = program.debug; - -// --client - -options.client = program.client; - -// --pretty - -options.pretty = program.pretty; - -// left-over args are file paths - -var files = program.args; - -// compile files - -if (files.length) { - console.log(); - files.forEach(renderFile); - process.on('exit', console.log); -// stdio -} else { - stdin(); -} - -/** - * Compile from stdin. - */ - -function stdin() { - var buf = ''; - process.stdin.setEncoding('utf8'); - process.stdin.on('data', function(chunk){ buf += chunk; }); - process.stdin.on('end', function(){ - var fn = jade.compile(buf, options); - var output = options.client - ? fn.toString() - : fn(options); - process.stdout.write(output); - }).resume(); -} - -/** - * Process the given path, compiling the jade files found. - * Always walk the subdirectories. - */ - -function renderFile(path) { - var re = /\.jade$/; - fs.lstat(path, function(err, stat) { - if (err) throw err; - // Found jade file - if (stat.isFile() && re.test(path)) { - fs.readFile(path, 'utf8', function(err, str){ - if (err) throw err; - options.filename = path; - var fn = jade.compile(str, options); - var extname = options.client ? '.js' : '.html'; - path = path.replace(re, extname); - if (program.out) path = join(program.out, basename(path)); - var dir = resolve(dirname(path)); - mkdirp(dir, 0755, function(err){ - if (err) throw err; - var output = options.client - ? fn.toString() - : fn(options); - fs.writeFile(path, output, function(err){ - if (err) throw err; - console.log(' \033[90mrendered \033[36m%s\033[0m', path); - }); - }); - }); - // Found directory - } else if (stat.isDirectory()) { - fs.readdir(path, function(err, files) { - if (err) throw err; - files.map(function(filename) { - return path + '/' + filename; - }).forEach(renderFile); - }); - } - }); -} diff --git a/node_modules/jade/index.js b/node_modules/jade/index.js deleted file mode 100644 index 8ad059f..0000000 --- a/node_modules/jade/index.js +++ /dev/null @@ -1,4 +0,0 @@ - -module.exports = process.env.JADE_COV - ? require('./lib-cov/jade') - : require('./lib/jade'); \ No newline at end of file diff --git a/node_modules/jade/jade.js b/node_modules/jade/jade.js deleted file mode 100644 index 1983a20..0000000 --- a/node_modules/jade/jade.js +++ /dev/null @@ -1,3586 +0,0 @@ -(function() { - -// CommonJS require() - -function require(p){ - var path = require.resolve(p) - , mod = require.modules[path]; - if (!mod) throw new Error('failed to require "' + p + '"'); - if (!mod.exports) { - mod.exports = {}; - mod.call(mod.exports, mod, mod.exports, require.relative(path)); - } - return mod.exports; - } - -require.modules = {}; - -require.resolve = function (path){ - var orig = path - , reg = path + '.js' - , index = path + '/index.js'; - return require.modules[reg] && reg - || require.modules[index] && index - || orig; - }; - -require.register = function (path, fn){ - require.modules[path] = fn; - }; - -require.relative = function (parent) { - return function(p){ - if ('.' != p.charAt(0)) return require(p); - - var path = parent.split('/') - , segs = p.split('/'); - path.pop(); - - for (var i = 0; i < segs.length; i++) { - var seg = segs[i]; - if ('..' == seg) path.pop(); - else if ('.' != seg) path.push(seg); - } - - return require(path.join('/')); - }; - }; - - -require.register("compiler.js", function(module, exports, require){ - -/*! - * Jade - Compiler - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var nodes = require('./nodes') - , filters = require('./filters') - , doctypes = require('./doctypes') - , selfClosing = require('./self-closing') - , runtime = require('./runtime') - , utils = require('./utils'); - - - if (!Object.keys) { - Object.keys = function(obj){ - var arr = []; - for (var key in obj) { - if (obj.hasOwnProperty(key)) { - arr.push(key); - } - } - return arr; - } - } - - if (!String.prototype.trimLeft) { - String.prototype.trimLeft = function(){ - return this.replace(/^\s+/, ''); - } - } - - - -/** - * Initialize `Compiler` with the given `node`. - * - * @param {Node} node - * @param {Object} options - * @api public - */ - -var Compiler = module.exports = function Compiler(node, options) { - this.options = options = options || {}; - this.node = node; - this.hasCompiledDoctype = false; - this.hasCompiledTag = false; - this.pp = options.pretty || false; - this.debug = false !== options.compileDebug; - this.indents = 0; - this.parentIndents = 0; - if (options.doctype) this.setDoctype(options.doctype); -}; - -/** - * Compiler prototype. - */ - -Compiler.prototype = { - - /** - * Compile parse tree to JavaScript. - * - * @api public - */ - - compile: function(){ - this.buf = ['var interp;']; - if (this.pp) this.buf.push("var __indent = [];"); - this.lastBufferedIdx = -1; - this.visit(this.node); - return this.buf.join('\n'); - }, - - /** - * Sets the default doctype `name`. Sets terse mode to `true` when - * html 5 is used, causing self-closing tags to end with ">" vs "/>", - * and boolean attributes are not mirrored. - * - * @param {string} name - * @api public - */ - - setDoctype: function(name){ - var doctype = doctypes[(name || 'default').toLowerCase()]; - doctype = doctype || ''; - this.doctype = doctype; - this.terse = '5' == name || 'html' == name; - this.xml = 0 == this.doctype.indexOf(' 1 && !escape && block.nodes[0].isText && block.nodes[1].isText) - this.prettyIndent(1, true); - - for (var i = 0; i < len; ++i) { - // Pretty print text - if (pp && i > 0 && !escape && block.nodes[i].isText && block.nodes[i-1].isText) - this.prettyIndent(1, false); - - this.visit(block.nodes[i]); - // Multiple text nodes are separated by newlines - if (block.nodes[i+1] && block.nodes[i].isText && block.nodes[i+1].isText) - this.buffer('\\n'); - } - }, - - /** - * Visit `doctype`. Sets terse mode to `true` when html 5 - * is used, causing self-closing tags to end with ">" vs "/>", - * and boolean attributes are not mirrored. - * - * @param {Doctype} doctype - * @api public - */ - - visitDoctype: function(doctype){ - if (doctype && (doctype.val || !this.doctype)) { - this.setDoctype(doctype.val || 'default'); - } - - if (this.doctype) this.buffer(this.doctype); - this.hasCompiledDoctype = true; - }, - - /** - * Visit `mixin`, generating a function that - * may be called within the template. - * - * @param {Mixin} mixin - * @api public - */ - - visitMixin: function(mixin){ - var name = mixin.name.replace(/-/g, '_') + '_mixin' - , args = mixin.args || '' - , block = mixin.block - , attrs = mixin.attrs - , pp = this.pp; - - if (mixin.call) { - if (pp) this.buf.push("__indent.push('" + Array(this.indents + 1).join(' ') + "');") - if (block || attrs.length) { - - this.buf.push(name + '.call({'); - - if (block) { - this.buf.push('block: function(){'); - - // Render block with no indents, dynamically added when rendered - this.parentIndents++; - var _indents = this.indents; - this.indents = 0; - this.visit(mixin.block); - this.indents = _indents; - this.parentIndents--; - - if (attrs.length) { - this.buf.push('},'); - } else { - this.buf.push('}'); - } - } - - if (attrs.length) { - var val = this.attrs(attrs); - if (val.inherits) { - this.buf.push('attributes: merge({' + val.buf - + '}, attributes), escaped: merge(' + val.escaped + ', escaped, true)'); - } else { - this.buf.push('attributes: {' + val.buf + '}, escaped: ' + val.escaped); - } - } - - if (args) { - this.buf.push('}, ' + args + ');'); - } else { - this.buf.push('});'); - } - - } else { - this.buf.push(name + '(' + args + ');'); - } - if (pp) this.buf.push("__indent.pop();") - } else { - this.buf.push('var ' + name + ' = function(' + args + '){'); - this.buf.push('var block = this.block, attributes = this.attributes || {}, escaped = this.escaped || {};'); - this.parentIndents++; - this.visit(block); - this.parentIndents--; - this.buf.push('};'); - } - }, - - /** - * Visit `tag` buffering tag markup, generating - * attributes, visiting the `tag`'s code and block. - * - * @param {Tag} tag - * @api public - */ - - visitTag: function(tag){ - this.indents++; - var name = tag.name - , pp = this.pp; - - if (tag.buffer) name = "' + (" + name + ") + '"; - - if (!this.hasCompiledTag) { - if (!this.hasCompiledDoctype && 'html' == name) { - this.visitDoctype(); - } - this.hasCompiledTag = true; - } - - // pretty print - if (pp && !tag.isInline()) - this.prettyIndent(0, true); - - if ((~selfClosing.indexOf(name) || tag.selfClosing) && !this.xml) { - this.buffer('<' + name); - this.visitAttributes(tag.attrs); - this.terse - ? this.buffer('>') - : this.buffer('/>'); - } else { - // Optimize attributes buffering - if (tag.attrs.length) { - this.buffer('<' + name); - if (tag.attrs.length) this.visitAttributes(tag.attrs); - this.buffer('>'); - } else { - this.buffer('<' + name + '>'); - } - if (tag.code) this.visitCode(tag.code); - this.escape = 'pre' == tag.name; - this.visit(tag.block); - - // pretty print - if (pp && !tag.isInline() && 'pre' != tag.name && !tag.canInline()) - this.prettyIndent(0, true); - - this.buffer(''); - } - this.indents--; - }, - - /** - * Visit `filter`, throwing when the filter does not exist. - * - * @param {Filter} filter - * @api public - */ - - visitFilter: function(filter){ - var fn = filters[filter.name]; - - // unknown filter - if (!fn) { - if (filter.isASTFilter) { - throw new Error('unknown ast filter "' + filter.name + ':"'); - } else { - throw new Error('unknown filter ":' + filter.name + '"'); - } - } - - if (filter.isASTFilter) { - this.buf.push(fn(filter.block, this, filter.attrs)); - } else { - var text = filter.block.nodes.map(function(node){ return node.val }).join('\n'); - filter.attrs = filter.attrs || {}; - filter.attrs.filename = this.options.filename; - this.buffer(utils.text(fn(text, filter.attrs))); - } - }, - - /** - * Visit `text` node. - * - * @param {Text} text - * @api public - */ - - visitText: function(text){ - text = utils.text(text.val.replace(/\\/g, '\\\\')); - if (this.escape) text = escape(text); - this.buffer(text); - }, - - /** - * Visit a `comment`, only buffering when the buffer flag is set. - * - * @param {Comment} comment - * @api public - */ - - visitComment: function(comment){ - if (!comment.buffer) return; - if (this.pp) this.prettyIndent(1, true); - this.buffer(''); - }, - - /** - * Visit a `BlockComment`. - * - * @param {Comment} comment - * @api public - */ - - visitBlockComment: function(comment){ - if (!comment.buffer) return; - if (0 == comment.val.trim().indexOf('if')) { - this.buffer(''); - } else { - this.buffer(''); - } - }, - - /** - * Visit `code`, respecting buffer / escape flags. - * If the code is followed by a block, wrap it in - * a self-calling function. - * - * @param {Code} code - * @api public - */ - - visitCode: function(code){ - // Wrap code blocks with {}. - // we only wrap unbuffered code blocks ATM - // since they are usually flow control - - // Buffer code - if (code.buffer) { - var val = code.val.trimLeft(); - this.buf.push('var __val__ = ' + val); - val = 'null == __val__ ? "" : __val__'; - if (code.escape) val = 'escape(' + val + ')'; - this.buf.push("buf.push(" + val + ");"); - } else { - this.buf.push(code.val); - } - - // Block support - if (code.block) { - if (!code.buffer) this.buf.push('{'); - this.visit(code.block); - if (!code.buffer) this.buf.push('}'); - } - }, - - /** - * Visit `each` block. - * - * @param {Each} each - * @api public - */ - - visitEach: function(each){ - this.buf.push('' - + '// iterate ' + each.obj + '\n' - + ';(function(){\n' - + ' if (\'number\' == typeof ' + each.obj + '.length) {\n' - + ' for (var ' + each.key + ' = 0, $$l = ' + each.obj + '.length; ' + each.key + ' < $$l; ' + each.key + '++) {\n' - + ' var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n'); - - this.visit(each.block); - - this.buf.push('' - + ' }\n' - + ' } else {\n' - + ' for (var ' + each.key + ' in ' + each.obj + ') {\n' - + ' if (' + each.obj + '.hasOwnProperty(' + each.key + ')){' - + ' var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n'); - - this.visit(each.block); - - this.buf.push(' }\n'); - - this.buf.push(' }\n }\n}).call(this);\n'); - }, - - /** - * Visit `attrs`. - * - * @param {Array} attrs - * @api public - */ - - visitAttributes: function(attrs){ - var val = this.attrs(attrs); - if (val.inherits) { - this.buf.push("buf.push(attrs(merge({ " + val.buf + - " }, attributes), merge(" + val.escaped + ", escaped, true)));"); - } else if (val.constant) { - eval('var buf={' + val.buf + '};'); - this.buffer(runtime.attrs(buf, JSON.parse(val.escaped)), true); - } else { - this.buf.push("buf.push(attrs({ " + val.buf + " }, " + val.escaped + "));"); - } - }, - - /** - * Compile attributes. - */ - - attrs: function(attrs){ - var buf = [] - , classes = [] - , escaped = {} - , constant = attrs.every(function(attr){ return isConstant(attr.val) }) - , inherits = false; - - if (this.terse) buf.push('terse: true'); - - attrs.forEach(function(attr){ - if (attr.name == 'attributes') return inherits = true; - escaped[attr.name] = attr.escaped; - if (attr.name == 'class') { - classes.push('(' + attr.val + ')'); - } else { - var pair = "'" + attr.name + "':(" + attr.val + ')'; - buf.push(pair); - } - }); - - if (classes.length) { - classes = classes.join(" + ' ' + "); - buf.push("class: " + classes); - } - - return { - buf: buf.join(', ').replace('class:', '"class":'), - escaped: JSON.stringify(escaped), - inherits: inherits, - constant: constant - }; - } -}; - -/** - * Check if expression can be evaluated to a constant - * - * @param {String} expression - * @return {Boolean} - * @api private - */ - -function isConstant(val){ - // Check strings/literals - if (/^ *("([^"\\]*(\\.[^"\\]*)*)"|'([^'\\]*(\\.[^'\\]*)*)'|true|false|null|undefined) *$/i.test(val)) - return true; - - // Check numbers - if (!isNaN(Number(val))) - return true; - - // Check arrays - var matches; - if (matches = /^ *\[(.*)\] *$/.exec(val)) - return matches[1].split(',').every(isConstant); - - return false; -} - -/** - * Escape the given string of `html`. - * - * @param {String} html - * @return {String} - * @api private - */ - -function escape(html){ - return String(html) - .replace(/&(?!\w+;)/g, '&') - .replace(//g, '>') - .replace(/"/g, '"'); -} -}); // module: compiler.js - -require.register("doctypes.js", function(module, exports, require){ - -/*! - * Jade - doctypes - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -module.exports = { - '5': '' - , 'default': '' - , 'xml': '' - , 'transitional': '' - , 'strict': '' - , 'frameset': '' - , '1.1': '' - , 'basic': '' - , 'mobile': '' -}; -}); // module: doctypes.js - -require.register("filters.js", function(module, exports, require){ - -/*! - * Jade - filters - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -module.exports = { - - /** - * Wrap text with CDATA block. - */ - - cdata: function(str){ - return ''; - }, - - /** - * Transform sass to css, wrapped in style tags. - */ - - sass: function(str){ - str = str.replace(/\\n/g, '\n'); - var sass = require('sass').render(str).replace(/\n/g, '\\n'); - return ''; - }, - - /** - * Transform stylus to css, wrapped in style tags. - */ - - stylus: function(str, options){ - var ret; - str = str.replace(/\\n/g, '\n'); - var stylus = require('stylus'); - stylus(str, options).render(function(err, css){ - if (err) throw err; - ret = css.replace(/\n/g, '\\n'); - }); - return ''; - }, - - /** - * Transform less to css, wrapped in style tags. - */ - - less: function(str){ - var ret; - str = str.replace(/\\n/g, '\n'); - require('less').render(str, function(err, css){ - if (err) throw err; - ret = ''; - }); - return ret; - }, - - /** - * Transform markdown to html. - */ - - markdown: function(str){ - var md; - - // support markdown / discount - try { - md = require('markdown'); - } catch (err){ - try { - md = require('discount'); - } catch (err) { - try { - md = require('markdown-js'); - } catch (err) { - try { - md = require('marked'); - } catch (err) { - throw new - Error('Cannot find markdown library, install markdown, discount, or marked.'); - } - } - } - } - - str = str.replace(/\\n/g, '\n'); - return md.parse(str).replace(/\n/g, '\\n').replace(/'/g,'''); - }, - - /** - * Transform coffeescript to javascript. - */ - - coffeescript: function(str){ - str = str.replace(/\\n/g, '\n'); - var js = require('coffee-script').compile(str).replace(/\\/g, '\\\\').replace(/\n/g, '\\n'); - return ''; - } -}; - -}); // module: filters.js - -require.register("inline-tags.js", function(module, exports, require){ - -/*! - * Jade - inline tags - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -module.exports = [ - 'a' - , 'abbr' - , 'acronym' - , 'b' - , 'br' - , 'code' - , 'em' - , 'font' - , 'i' - , 'img' - , 'ins' - , 'kbd' - , 'map' - , 'samp' - , 'small' - , 'span' - , 'strong' - , 'sub' - , 'sup' -]; -}); // module: inline-tags.js - -require.register("jade.js", function(module, exports, require){ -/*! - * Jade - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Parser = require('./parser') - , Lexer = require('./lexer') - , Compiler = require('./compiler') - , runtime = require('./runtime') - -/** - * Library version. - */ - -exports.version = '0.26.1'; - -/** - * Expose self closing tags. - */ - -exports.selfClosing = require('./self-closing'); - -/** - * Default supported doctypes. - */ - -exports.doctypes = require('./doctypes'); - -/** - * Text filters. - */ - -exports.filters = require('./filters'); - -/** - * Utilities. - */ - -exports.utils = require('./utils'); - -/** - * Expose `Compiler`. - */ - -exports.Compiler = Compiler; - -/** - * Expose `Parser`. - */ - -exports.Parser = Parser; - -/** - * Expose `Lexer`. - */ - -exports.Lexer = Lexer; - -/** - * Nodes. - */ - -exports.nodes = require('./nodes'); - -/** - * Jade runtime helpers. - */ - -exports.runtime = runtime; - -/** - * Template function cache. - */ - -exports.cache = {}; - -/** - * Parse the given `str` of jade and return a function body. - * - * @param {String} str - * @param {Object} options - * @return {String} - * @api private - */ - -function parse(str, options){ - try { - // Parse - var parser = new Parser(str, options.filename, options); - - // Compile - var compiler = new (options.compiler || Compiler)(parser.parse(), options) - , js = compiler.compile(); - - // Debug compiler - if (options.debug) { - console.error('\nCompiled Function:\n\n\033[90m%s\033[0m', js.replace(/^/gm, ' ')); - } - - return '' - + 'var buf = [];\n' - + (options.self - ? 'var self = locals || {};\n' + js - : 'with (locals || {}) {\n' + js + '\n}\n') - + 'return buf.join("");'; - } catch (err) { - parser = parser.context(); - runtime.rethrow(err, parser.filename, parser.lexer.lineno); - } -} - -/** - * Compile a `Function` representation of the given jade `str`. - * - * Options: - * - * - `compileDebug` when `false` debugging code is stripped from the compiled template - * - `client` when `true` the helper functions `escape()` etc will reference `jade.escape()` - * for use with the Jade client-side runtime.js - * - * @param {String} str - * @param {Options} options - * @return {Function} - * @api public - */ - -exports.compile = function(str, options){ - var options = options || {} - , client = options.client - , filename = options.filename - ? JSON.stringify(options.filename) - : 'undefined' - , fn; - - if (options.compileDebug !== false) { - fn = [ - 'var __jade = [{ lineno: 1, filename: ' + filename + ' }];' - , 'try {' - , parse(String(str), options) - , '} catch (err) {' - , ' rethrow(err, __jade[0].filename, __jade[0].lineno);' - , '}' - ].join('\n'); - } else { - fn = parse(String(str), options); - } - - if (client) { - fn = 'attrs = attrs || jade.attrs; escape = escape || jade.escape; rethrow = rethrow || jade.rethrow; merge = merge || jade.merge;\n' + fn; - } - - fn = new Function('locals, attrs, escape, rethrow, merge', fn); - - if (client) return fn; - - return function(locals){ - return fn(locals, runtime.attrs, runtime.escape, runtime.rethrow, runtime.merge); - }; -}; - -/** - * Render the given `str` of jade and invoke - * the callback `fn(err, str)`. - * - * Options: - * - * - `cache` enable template caching - * - `filename` filename required for `include` / `extends` and caching - * - * @param {String} str - * @param {Object|Function} options or fn - * @param {Function} fn - * @api public - */ - -exports.render = function(str, options, fn){ - // swap args - if ('function' == typeof options) { - fn = options, options = {}; - } - - // cache requires .filename - if (options.cache && !options.filename) { - return fn(new Error('the "filename" option is required for caching')); - } - - try { - var path = options.filename; - var tmpl = options.cache - ? exports.cache[path] || (exports.cache[path] = exports.compile(str, options)) - : exports.compile(str, options); - fn(null, tmpl(options)); - } catch (err) { - fn(err); - } -}; - -/** - * Render a Jade file at the given `path` and callback `fn(err, str)`. - * - * @param {String} path - * @param {Object|Function} options or callback - * @param {Function} fn - * @api public - */ - -exports.renderFile = function(path, options, fn){ - var key = path + ':string'; - - if ('function' == typeof options) { - fn = options, options = {}; - } - - try { - options.filename = path; - var str = options.cache - ? exports.cache[key] || (exports.cache[key] = fs.readFileSync(path, 'utf8')) - : fs.readFileSync(path, 'utf8'); - exports.render(str, options, fn); - } catch (err) { - fn(err); - } -}; - -/** - * Express support. - */ - -exports.__express = exports.renderFile; - -}); // module: jade.js - -require.register("lexer.js", function(module, exports, require){ - -/*! - * Jade - Lexer - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Initialize `Lexer` with the given `str`. - * - * Options: - * - * - `colons` allow colons for attr delimiters - * - * @param {String} str - * @param {Object} options - * @api private - */ - -var Lexer = module.exports = function Lexer(str, options) { - options = options || {}; - this.input = str.replace(/\r\n|\r/g, '\n'); - this.colons = options.colons; - this.deferredTokens = []; - this.lastIndents = 0; - this.lineno = 1; - this.stash = []; - this.indentStack = []; - this.indentRe = null; - this.pipeless = false; -}; - -/** - * Lexer prototype. - */ - -Lexer.prototype = { - - /** - * Construct a token with the given `type` and `val`. - * - * @param {String} type - * @param {String} val - * @return {Object} - * @api private - */ - - tok: function(type, val){ - return { - type: type - , line: this.lineno - , val: val - } - }, - - /** - * Consume the given `len` of input. - * - * @param {Number} len - * @api private - */ - - consume: function(len){ - this.input = this.input.substr(len); - }, - - /** - * Scan for `type` with the given `regexp`. - * - * @param {String} type - * @param {RegExp} regexp - * @return {Object} - * @api private - */ - - scan: function(regexp, type){ - var captures; - if (captures = regexp.exec(this.input)) { - this.consume(captures[0].length); - return this.tok(type, captures[1]); - } - }, - - /** - * Defer the given `tok`. - * - * @param {Object} tok - * @api private - */ - - defer: function(tok){ - this.deferredTokens.push(tok); - }, - - /** - * Lookahead `n` tokens. - * - * @param {Number} n - * @return {Object} - * @api private - */ - - lookahead: function(n){ - var fetch = n - this.stash.length; - while (fetch-- > 0) this.stash.push(this.next()); - return this.stash[--n]; - }, - - /** - * Return the indexOf `start` / `end` delimiters. - * - * @param {String} start - * @param {String} end - * @return {Number} - * @api private - */ - - indexOfDelimiters: function(start, end){ - var str = this.input - , nstart = 0 - , nend = 0 - , pos = 0; - for (var i = 0, len = str.length; i < len; ++i) { - if (start == str.charAt(i)) { - ++nstart; - } else if (end == str.charAt(i)) { - if (++nend == nstart) { - pos = i; - break; - } - } - } - return pos; - }, - - /** - * Stashed token. - */ - - stashed: function() { - return this.stash.length - && this.stash.shift(); - }, - - /** - * Deferred token. - */ - - deferred: function() { - return this.deferredTokens.length - && this.deferredTokens.shift(); - }, - - /** - * end-of-source. - */ - - eos: function() { - if (this.input.length) return; - if (this.indentStack.length) { - this.indentStack.shift(); - return this.tok('outdent'); - } else { - return this.tok('eos'); - } - }, - - /** - * Blank line. - */ - - blank: function() { - var captures; - if (captures = /^\n *\n/.exec(this.input)) { - this.consume(captures[0].length - 1); - if (this.pipeless) return this.tok('text', ''); - return this.next(); - } - }, - - /** - * Comment. - */ - - comment: function() { - var captures; - if (captures = /^ *\/\/(-)?([^\n]*)/.exec(this.input)) { - this.consume(captures[0].length); - var tok = this.tok('comment', captures[2]); - tok.buffer = '-' != captures[1]; - return tok; - } - }, - - /** - * Interpolated tag. - */ - - interpolation: function() { - var captures; - if (captures = /^#\{(.*?)\}/.exec(this.input)) { - this.consume(captures[0].length); - return this.tok('interpolation', captures[1]); - } - }, - - /** - * Tag. - */ - - tag: function() { - var captures; - if (captures = /^(\w[-:\w]*)(\/?)/.exec(this.input)) { - this.consume(captures[0].length); - var tok, name = captures[1]; - if (':' == name[name.length - 1]) { - name = name.slice(0, -1); - tok = this.tok('tag', name); - this.defer(this.tok(':')); - while (' ' == this.input[0]) this.input = this.input.substr(1); - } else { - tok = this.tok('tag', name); - } - tok.selfClosing = !! captures[2]; - return tok; - } - }, - - /** - * Filter. - */ - - filter: function() { - return this.scan(/^:(\w+)/, 'filter'); - }, - - /** - * Doctype. - */ - - doctype: function() { - return this.scan(/^(?:!!!|doctype) *([^\n]+)?/, 'doctype'); - }, - - /** - * Id. - */ - - id: function() { - return this.scan(/^#([\w-]+)/, 'id'); - }, - - /** - * Class. - */ - - className: function() { - return this.scan(/^\.([\w-]+)/, 'class'); - }, - - /** - * Text. - */ - - text: function() { - return this.scan(/^(?:\| ?| ?)?([^\n]+)/, 'text'); - }, - - /** - * Extends. - */ - - "extends": function() { - return this.scan(/^extends? +([^\n]+)/, 'extends'); - }, - - /** - * Block prepend. - */ - - prepend: function() { - var captures; - if (captures = /^prepend +([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - var mode = 'prepend' - , name = captures[1] - , tok = this.tok('block', name); - tok.mode = mode; - return tok; - } - }, - - /** - * Block append. - */ - - append: function() { - var captures; - if (captures = /^append +([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - var mode = 'append' - , name = captures[1] - , tok = this.tok('block', name); - tok.mode = mode; - return tok; - } - }, - - /** - * Block. - */ - - block: function() { - var captures; - if (captures = /^block\b *(?:(prepend|append) +)?([^\n]*)/.exec(this.input)) { - this.consume(captures[0].length); - var mode = captures[1] || 'replace' - , name = captures[2] - , tok = this.tok('block', name); - - tok.mode = mode; - return tok; - } - }, - - /** - * Yield. - */ - - yield: function() { - return this.scan(/^yield */, 'yield'); - }, - - /** - * Include. - */ - - include: function() { - return this.scan(/^include +([^\n]+)/, 'include'); - }, - - /** - * Case. - */ - - "case": function() { - return this.scan(/^case +([^\n]+)/, 'case'); - }, - - /** - * When. - */ - - when: function() { - return this.scan(/^when +([^:\n]+)/, 'when'); - }, - - /** - * Default. - */ - - "default": function() { - return this.scan(/^default */, 'default'); - }, - - /** - * Assignment. - */ - - assignment: function() { - var captures; - if (captures = /^(\w+) += *([^;\n]+)( *;? *)/.exec(this.input)) { - this.consume(captures[0].length); - var name = captures[1] - , val = captures[2]; - return this.tok('code', 'var ' + name + ' = (' + val + ');'); - } - }, - - /** - * Call mixin. - */ - - call: function(){ - var captures; - if (captures = /^\+([-\w]+)/.exec(this.input)) { - this.consume(captures[0].length); - var tok = this.tok('call', captures[1]); - - // Check for args (not attributes) - if (captures = /^ *\((.*?)\)/.exec(this.input)) { - if (!/^ *[-\w]+ *=/.test(captures[1])) { - this.consume(captures[0].length); - tok.args = captures[1]; - } - } - - return tok; - } - }, - - /** - * Mixin. - */ - - mixin: function(){ - var captures; - if (captures = /^mixin +([-\w]+)(?: *\((.*)\))?/.exec(this.input)) { - this.consume(captures[0].length); - var tok = this.tok('mixin', captures[1]); - tok.args = captures[2]; - return tok; - } - }, - - /** - * Conditional. - */ - - conditional: function() { - var captures; - if (captures = /^(if|unless|else if|else)\b([^\n]*)/.exec(this.input)) { - this.consume(captures[0].length); - var type = captures[1] - , js = captures[2]; - - switch (type) { - case 'if': js = 'if (' + js + ')'; break; - case 'unless': js = 'if (!(' + js + '))'; break; - case 'else if': js = 'else if (' + js + ')'; break; - case 'else': js = 'else'; break; - } - - return this.tok('code', js); - } - }, - - /** - * While. - */ - - "while": function() { - var captures; - if (captures = /^while +([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - return this.tok('code', 'while (' + captures[1] + ')'); - } - }, - - /** - * Each. - */ - - each: function() { - var captures; - if (captures = /^(?:- *)?(?:each|for) +(\w+)(?: *, *(\w+))? * in *([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - var tok = this.tok('each', captures[1]); - tok.key = captures[2] || '$index'; - tok.code = captures[3]; - return tok; - } - }, - - /** - * Code. - */ - - code: function() { - var captures; - if (captures = /^(!?=|-)([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - var flags = captures[1]; - captures[1] = captures[2]; - var tok = this.tok('code', captures[1]); - tok.escape = flags[0] === '='; - tok.buffer = flags[0] === '=' || flags[1] === '='; - return tok; - } - }, - - /** - * Attributes. - */ - - attrs: function() { - if ('(' == this.input.charAt(0)) { - var index = this.indexOfDelimiters('(', ')') - , str = this.input.substr(1, index-1) - , tok = this.tok('attrs') - , len = str.length - , colons = this.colons - , states = ['key'] - , escapedAttr - , key = '' - , val = '' - , quote - , c - , p; - - function state(){ - return states[states.length - 1]; - } - - function interpolate(attr) { - return attr.replace(/#\{([^}]+)\}/g, function(_, expr){ - return quote + " + (" + expr + ") + " + quote; - }); - } - - this.consume(index + 1); - tok.attrs = {}; - tok.escaped = {}; - - function parse(c) { - var real = c; - // TODO: remove when people fix ":" - if (colons && ':' == c) c = '='; - switch (c) { - case ',': - case '\n': - switch (state()) { - case 'expr': - case 'array': - case 'string': - case 'object': - val += c; - break; - default: - states.push('key'); - val = val.trim(); - key = key.trim(); - if ('' == key) return; - key = key.replace(/^['"]|['"]$/g, '').replace('!', ''); - tok.escaped[key] = escapedAttr; - tok.attrs[key] = '' == val - ? true - : interpolate(val); - key = val = ''; - } - break; - case '=': - switch (state()) { - case 'key char': - key += real; - break; - case 'val': - case 'expr': - case 'array': - case 'string': - case 'object': - val += real; - break; - default: - escapedAttr = '!' != p; - states.push('val'); - } - break; - case '(': - if ('val' == state() - || 'expr' == state()) states.push('expr'); - val += c; - break; - case ')': - if ('expr' == state() - || 'val' == state()) states.pop(); - val += c; - break; - case '{': - if ('val' == state()) states.push('object'); - val += c; - break; - case '}': - if ('object' == state()) states.pop(); - val += c; - break; - case '[': - if ('val' == state()) states.push('array'); - val += c; - break; - case ']': - if ('array' == state()) states.pop(); - val += c; - break; - case '"': - case "'": - switch (state()) { - case 'key': - states.push('key char'); - break; - case 'key char': - states.pop(); - break; - case 'string': - if (c == quote) states.pop(); - val += c; - break; - default: - states.push('string'); - val += c; - quote = c; - } - break; - case '': - break; - default: - switch (state()) { - case 'key': - case 'key char': - key += c; - break; - default: - val += c; - } - } - p = c; - } - - for (var i = 0; i < len; ++i) { - parse(str.charAt(i)); - } - - parse(','); - - if ('/' == this.input.charAt(0)) { - this.consume(1); - tok.selfClosing = true; - } - - return tok; - } - }, - - /** - * Indent | Outdent | Newline. - */ - - indent: function() { - var captures, re; - - // established regexp - if (this.indentRe) { - captures = this.indentRe.exec(this.input); - // determine regexp - } else { - // tabs - re = /^\n(\t*) */; - captures = re.exec(this.input); - - // spaces - if (captures && !captures[1].length) { - re = /^\n( *)/; - captures = re.exec(this.input); - } - - // established - if (captures && captures[1].length) this.indentRe = re; - } - - if (captures) { - var tok - , indents = captures[1].length; - - ++this.lineno; - this.consume(indents + 1); - - if (' ' == this.input[0] || '\t' == this.input[0]) { - throw new Error('Invalid indentation, you can use tabs or spaces but not both'); - } - - // blank line - if ('\n' == this.input[0]) return this.tok('newline'); - - // outdent - if (this.indentStack.length && indents < this.indentStack[0]) { - while (this.indentStack.length && this.indentStack[0] > indents) { - this.stash.push(this.tok('outdent')); - this.indentStack.shift(); - } - tok = this.stash.pop(); - // indent - } else if (indents && indents != this.indentStack[0]) { - this.indentStack.unshift(indents); - tok = this.tok('indent', indents); - // newline - } else { - tok = this.tok('newline'); - } - - return tok; - } - }, - - /** - * Pipe-less text consumed only when - * pipeless is true; - */ - - pipelessText: function() { - if (this.pipeless) { - if ('\n' == this.input[0]) return; - var i = this.input.indexOf('\n'); - if (-1 == i) i = this.input.length; - var str = this.input.substr(0, i); - this.consume(str.length); - return this.tok('text', str); - } - }, - - /** - * ':' - */ - - colon: function() { - return this.scan(/^: */, ':'); - }, - - /** - * Return the next token object, or those - * previously stashed by lookahead. - * - * @return {Object} - * @api private - */ - - advance: function(){ - return this.stashed() - || this.next(); - }, - - /** - * Return the next token object. - * - * @return {Object} - * @api private - */ - - next: function() { - return this.deferred() - || this.blank() - || this.eos() - || this.pipelessText() - || this.yield() - || this.doctype() - || this.interpolation() - || this["case"]() - || this.when() - || this["default"]() - || this["extends"]() - || this.append() - || this.prepend() - || this.block() - || this.include() - || this.mixin() - || this.call() - || this.conditional() - || this.each() - || this["while"]() - || this.assignment() - || this.tag() - || this.filter() - || this.code() - || this.id() - || this.className() - || this.attrs() - || this.indent() - || this.comment() - || this.colon() - || this.text(); - } -}; - -}); // module: lexer.js - -require.register("nodes/attrs.js", function(module, exports, require){ - -/*! - * Jade - nodes - Attrs - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'), - Block = require('./block'); - -/** - * Initialize a `Attrs` node. - * - * @api public - */ - -var Attrs = module.exports = function Attrs() { - this.attrs = []; -}; - -/** - * Inherit from `Node`. - */ - -Attrs.prototype = new Node; -Attrs.prototype.constructor = Attrs; - - -/** - * Set attribute `name` to `val`, keep in mind these become - * part of a raw js object literal, so to quote a value you must - * '"quote me"', otherwise or example 'user.name' is literal JavaScript. - * - * @param {String} name - * @param {String} val - * @param {Boolean} escaped - * @return {Tag} for chaining - * @api public - */ - -Attrs.prototype.setAttribute = function(name, val, escaped){ - this.attrs.push({ name: name, val: val, escaped: escaped }); - return this; -}; - -/** - * Remove attribute `name` when present. - * - * @param {String} name - * @api public - */ - -Attrs.prototype.removeAttribute = function(name){ - for (var i = 0, len = this.attrs.length; i < len; ++i) { - if (this.attrs[i] && this.attrs[i].name == name) { - delete this.attrs[i]; - } - } -}; - -/** - * Get attribute value by `name`. - * - * @param {String} name - * @return {String} - * @api public - */ - -Attrs.prototype.getAttribute = function(name){ - for (var i = 0, len = this.attrs.length; i < len; ++i) { - if (this.attrs[i] && this.attrs[i].name == name) { - return this.attrs[i].val; - } - } -}; - -}); // module: nodes/attrs.js - -require.register("nodes/block-comment.js", function(module, exports, require){ - -/*! - * Jade - nodes - BlockComment - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `BlockComment` with the given `block`. - * - * @param {String} val - * @param {Block} block - * @param {Boolean} buffer - * @api public - */ - -var BlockComment = module.exports = function BlockComment(val, block, buffer) { - this.block = block; - this.val = val; - this.buffer = buffer; -}; - -/** - * Inherit from `Node`. - */ - -BlockComment.prototype = new Node; -BlockComment.prototype.constructor = BlockComment; - -}); // module: nodes/block-comment.js - -require.register("nodes/block.js", function(module, exports, require){ - -/*! - * Jade - nodes - Block - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a new `Block` with an optional `node`. - * - * @param {Node} node - * @api public - */ - -var Block = module.exports = function Block(node){ - this.nodes = []; - if (node) this.push(node); -}; - -/** - * Inherit from `Node`. - */ - -Block.prototype = new Node; -Block.prototype.constructor = Block; - - -/** - * Block flag. - */ - -Block.prototype.isBlock = true; - -/** - * Replace the nodes in `other` with the nodes - * in `this` block. - * - * @param {Block} other - * @api private - */ - -Block.prototype.replace = function(other){ - other.nodes = this.nodes; -}; - -/** - * Pust the given `node`. - * - * @param {Node} node - * @return {Number} - * @api public - */ - -Block.prototype.push = function(node){ - return this.nodes.push(node); -}; - -/** - * Check if this block is empty. - * - * @return {Boolean} - * @api public - */ - -Block.prototype.isEmpty = function(){ - return 0 == this.nodes.length; -}; - -/** - * Unshift the given `node`. - * - * @param {Node} node - * @return {Number} - * @api public - */ - -Block.prototype.unshift = function(node){ - return this.nodes.unshift(node); -}; - -/** - * Return the "last" block, or the first `yield` node. - * - * @return {Block} - * @api private - */ - -Block.prototype.includeBlock = function(){ - var ret = this - , node; - - for (var i = 0, len = this.nodes.length; i < len; ++i) { - node = this.nodes[i]; - if (node.yield) return node; - else if (node.textOnly) continue; - else if (node.includeBlock) ret = node.includeBlock(); - else if (node.block && !node.block.isEmpty()) ret = node.block.includeBlock(); - } - - return ret; -}; - -/** - * Return a clone of this block. - * - * @return {Block} - * @api private - */ - -Block.prototype.clone = function(){ - var clone = new Block; - for (var i = 0, len = this.nodes.length; i < len; ++i) { - clone.push(this.nodes[i].clone()); - } - return clone; -}; - - -}); // module: nodes/block.js - -require.register("nodes/case.js", function(module, exports, require){ - -/*! - * Jade - nodes - Case - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a new `Case` with `expr`. - * - * @param {String} expr - * @api public - */ - -var Case = exports = module.exports = function Case(expr, block){ - this.expr = expr; - this.block = block; -}; - -/** - * Inherit from `Node`. - */ - -Case.prototype = new Node; -Case.prototype.constructor = Case; - - -var When = exports.When = function When(expr, block){ - this.expr = expr; - this.block = block; - this.debug = false; -}; - -/** - * Inherit from `Node`. - */ - -When.prototype = new Node; -When.prototype.constructor = When; - - - -}); // module: nodes/case.js - -require.register("nodes/code.js", function(module, exports, require){ - -/*! - * Jade - nodes - Code - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Code` node with the given code `val`. - * Code may also be optionally buffered and escaped. - * - * @param {String} val - * @param {Boolean} buffer - * @param {Boolean} escape - * @api public - */ - -var Code = module.exports = function Code(val, buffer, escape) { - this.val = val; - this.buffer = buffer; - this.escape = escape; - if (val.match(/^ *else/)) this.debug = false; -}; - -/** - * Inherit from `Node`. - */ - -Code.prototype = new Node; -Code.prototype.constructor = Code; - -}); // module: nodes/code.js - -require.register("nodes/comment.js", function(module, exports, require){ - -/*! - * Jade - nodes - Comment - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Comment` with the given `val`, optionally `buffer`, - * otherwise the comment may render in the output. - * - * @param {String} val - * @param {Boolean} buffer - * @api public - */ - -var Comment = module.exports = function Comment(val, buffer) { - this.val = val; - this.buffer = buffer; -}; - -/** - * Inherit from `Node`. - */ - -Comment.prototype = new Node; -Comment.prototype.constructor = Comment; - -}); // module: nodes/comment.js - -require.register("nodes/doctype.js", function(module, exports, require){ - -/*! - * Jade - nodes - Doctype - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Doctype` with the given `val`. - * - * @param {String} val - * @api public - */ - -var Doctype = module.exports = function Doctype(val) { - this.val = val; -}; - -/** - * Inherit from `Node`. - */ - -Doctype.prototype = new Node; -Doctype.prototype.constructor = Doctype; - -}); // module: nodes/doctype.js - -require.register("nodes/each.js", function(module, exports, require){ - -/*! - * Jade - nodes - Each - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize an `Each` node, representing iteration - * - * @param {String} obj - * @param {String} val - * @param {String} key - * @param {Block} block - * @api public - */ - -var Each = module.exports = function Each(obj, val, key, block) { - this.obj = obj; - this.val = val; - this.key = key; - this.block = block; -}; - -/** - * Inherit from `Node`. - */ - -Each.prototype = new Node; -Each.prototype.constructor = Each; - -}); // module: nodes/each.js - -require.register("nodes/filter.js", function(module, exports, require){ - -/*! - * Jade - nodes - Filter - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node') - , Block = require('./block'); - -/** - * Initialize a `Filter` node with the given - * filter `name` and `block`. - * - * @param {String} name - * @param {Block|Node} block - * @api public - */ - -var Filter = module.exports = function Filter(name, block, attrs) { - this.name = name; - this.block = block; - this.attrs = attrs; - this.isASTFilter = !block.nodes.every(function(node){ return node.isText }); -}; - -/** - * Inherit from `Node`. - */ - -Filter.prototype = new Node; -Filter.prototype.constructor = Filter; - -}); // module: nodes/filter.js - -require.register("nodes/index.js", function(module, exports, require){ - -/*! - * Jade - nodes - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -exports.Node = require('./node'); -exports.Tag = require('./tag'); -exports.Code = require('./code'); -exports.Each = require('./each'); -exports.Case = require('./case'); -exports.Text = require('./text'); -exports.Block = require('./block'); -exports.Mixin = require('./mixin'); -exports.Filter = require('./filter'); -exports.Comment = require('./comment'); -exports.Literal = require('./literal'); -exports.BlockComment = require('./block-comment'); -exports.Doctype = require('./doctype'); - -}); // module: nodes/index.js - -require.register("nodes/literal.js", function(module, exports, require){ - -/*! - * Jade - nodes - Literal - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Literal` node with the given `str. - * - * @param {String} str - * @api public - */ - -var Literal = module.exports = function Literal(str) { - this.str = str - .replace(/\\/g, "\\\\") - .replace(/\n|\r\n/g, "\\n") - .replace(/'/g, "\\'"); -}; - -/** - * Inherit from `Node`. - */ - -Literal.prototype = new Node; -Literal.prototype.constructor = Literal; - - -}); // module: nodes/literal.js - -require.register("nodes/mixin.js", function(module, exports, require){ - -/*! - * Jade - nodes - Mixin - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Attrs = require('./attrs'); - -/** - * Initialize a new `Mixin` with `name` and `block`. - * - * @param {String} name - * @param {String} args - * @param {Block} block - * @api public - */ - -var Mixin = module.exports = function Mixin(name, args, block, call){ - this.name = name; - this.args = args; - this.block = block; - this.attrs = []; - this.call = call; -}; - -/** - * Inherit from `Attrs`. - */ - -Mixin.prototype = new Attrs; -Mixin.prototype.constructor = Mixin; - - - -}); // module: nodes/mixin.js - -require.register("nodes/node.js", function(module, exports, require){ - -/*! - * Jade - nodes - Node - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Initialize a `Node`. - * - * @api public - */ - -var Node = module.exports = function Node(){}; - -/** - * Clone this node (return itself) - * - * @return {Node} - * @api private - */ - -Node.prototype.clone = function(){ - return this; -}; - -}); // module: nodes/node.js - -require.register("nodes/tag.js", function(module, exports, require){ - -/*! - * Jade - nodes - Tag - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Attrs = require('./attrs'), - Block = require('./block'), - inlineTags = require('../inline-tags'); - -/** - * Initialize a `Tag` node with the given tag `name` and optional `block`. - * - * @param {String} name - * @param {Block} block - * @api public - */ - -var Tag = module.exports = function Tag(name, block) { - this.name = name; - this.attrs = []; - this.block = block || new Block; -}; - -/** - * Inherit from `Attrs`. - */ - -Tag.prototype = new Attrs; -Tag.prototype.constructor = Tag; - - -/** - * Clone this tag. - * - * @return {Tag} - * @api private - */ - -Tag.prototype.clone = function(){ - var clone = new Tag(this.name, this.block.clone()); - clone.line = this.line; - clone.attrs = this.attrs; - clone.textOnly = this.textOnly; - return clone; -}; - -/** - * Check if this tag is an inline tag. - * - * @return {Boolean} - * @api private - */ - -Tag.prototype.isInline = function(){ - return ~inlineTags.indexOf(this.name); -}; - -/** - * Check if this tag's contents can be inlined. Used for pretty printing. - * - * @return {Boolean} - * @api private - */ - -Tag.prototype.canInline = function(){ - var nodes = this.block.nodes; - - function isInline(node){ - // Recurse if the node is a block - if (node.isBlock) return node.nodes.every(isInline); - return node.isText || (node.isInline && node.isInline()); - } - - // Empty tag - if (!nodes.length) return true; - - // Text-only or inline-only tag - if (1 == nodes.length) return isInline(nodes[0]); - - // Multi-line inline-only tag - if (this.block.nodes.every(isInline)) { - for (var i = 1, len = nodes.length; i < len; ++i) { - if (nodes[i-1].isText && nodes[i].isText) - return false; - } - return true; - } - - // Mixed tag - return false; -}; -}); // module: nodes/tag.js - -require.register("nodes/text.js", function(module, exports, require){ - -/*! - * Jade - nodes - Text - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Text` node with optional `line`. - * - * @param {String} line - * @api public - */ - -var Text = module.exports = function Text(line) { - this.val = ''; - if ('string' == typeof line) this.val = line; -}; - -/** - * Inherit from `Node`. - */ - -Text.prototype = new Node; -Text.prototype.constructor = Text; - - -/** - * Flag as text. - */ - -Text.prototype.isText = true; -}); // module: nodes/text.js - -require.register("parser.js", function(module, exports, require){ - -/*! - * Jade - Parser - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Lexer = require('./lexer') - , nodes = require('./nodes'); - -/** - * Initialize `Parser` with the given input `str` and `filename`. - * - * @param {String} str - * @param {String} filename - * @param {Object} options - * @api public - */ - -var Parser = exports = module.exports = function Parser(str, filename, options){ - this.input = str; - this.lexer = new Lexer(str, options); - this.filename = filename; - this.blocks = {}; - this.mixins = {}; - this.options = options; - this.contexts = [this]; -}; - -/** - * Tags that may not contain tags. - */ - -var textOnly = exports.textOnly = ['script', 'style']; - -/** - * Parser prototype. - */ - -Parser.prototype = { - - /** - * Push `parser` onto the context stack, - * or pop and return a `Parser`. - */ - - context: function(parser){ - if (parser) { - this.contexts.push(parser); - } else { - return this.contexts.pop(); - } - }, - - /** - * Return the next token object. - * - * @return {Object} - * @api private - */ - - advance: function(){ - return this.lexer.advance(); - }, - - /** - * Skip `n` tokens. - * - * @param {Number} n - * @api private - */ - - skip: function(n){ - while (n--) this.advance(); - }, - - /** - * Single token lookahead. - * - * @return {Object} - * @api private - */ - - peek: function() { - return this.lookahead(1); - }, - - /** - * Return lexer lineno. - * - * @return {Number} - * @api private - */ - - line: function() { - return this.lexer.lineno; - }, - - /** - * `n` token lookahead. - * - * @param {Number} n - * @return {Object} - * @api private - */ - - lookahead: function(n){ - return this.lexer.lookahead(n); - }, - - /** - * Parse input returning a string of js for evaluation. - * - * @return {String} - * @api public - */ - - parse: function(){ - var block = new nodes.Block, parser; - block.line = this.line(); - - while ('eos' != this.peek().type) { - if ('newline' == this.peek().type) { - this.advance(); - } else { - block.push(this.parseExpr()); - } - } - - if (parser = this.extending) { - this.context(parser); - var ast = parser.parse(); - this.context(); - // hoist mixins - for (var name in this.mixins) - ast.unshift(this.mixins[name]); - return ast; - } - - return block; - }, - - /** - * Expect the given type, or throw an exception. - * - * @param {String} type - * @api private - */ - - expect: function(type){ - if (this.peek().type === type) { - return this.advance(); - } else { - throw new Error('expected "' + type + '", but got "' + this.peek().type + '"'); - } - }, - - /** - * Accept the given `type`. - * - * @param {String} type - * @api private - */ - - accept: function(type){ - if (this.peek().type === type) { - return this.advance(); - } - }, - - /** - * tag - * | doctype - * | mixin - * | include - * | filter - * | comment - * | text - * | each - * | code - * | yield - * | id - * | class - * | interpolation - */ - - parseExpr: function(){ - switch (this.peek().type) { - case 'tag': - return this.parseTag(); - case 'mixin': - return this.parseMixin(); - case 'block': - return this.parseBlock(); - case 'case': - return this.parseCase(); - case 'when': - return this.parseWhen(); - case 'default': - return this.parseDefault(); - case 'extends': - return this.parseExtends(); - case 'include': - return this.parseInclude(); - case 'doctype': - return this.parseDoctype(); - case 'filter': - return this.parseFilter(); - case 'comment': - return this.parseComment(); - case 'text': - return this.parseText(); - case 'each': - return this.parseEach(); - case 'code': - return this.parseCode(); - case 'call': - return this.parseCall(); - case 'interpolation': - return this.parseInterpolation(); - case 'yield': - this.advance(); - var block = new nodes.Block; - block.yield = true; - return block; - case 'id': - case 'class': - var tok = this.advance(); - this.lexer.defer(this.lexer.tok('tag', 'div')); - this.lexer.defer(tok); - return this.parseExpr(); - default: - throw new Error('unexpected token "' + this.peek().type + '"'); - } - }, - - /** - * Text - */ - - parseText: function(){ - var tok = this.expect('text') - , node = new nodes.Text(tok.val); - node.line = this.line(); - return node; - }, - - /** - * ':' expr - * | block - */ - - parseBlockExpansion: function(){ - if (':' == this.peek().type) { - this.advance(); - return new nodes.Block(this.parseExpr()); - } else { - return this.block(); - } - }, - - /** - * case - */ - - parseCase: function(){ - var val = this.expect('case').val - , node = new nodes.Case(val); - node.line = this.line(); - node.block = this.block(); - return node; - }, - - /** - * when - */ - - parseWhen: function(){ - var val = this.expect('when').val - return new nodes.Case.When(val, this.parseBlockExpansion()); - }, - - /** - * default - */ - - parseDefault: function(){ - this.expect('default'); - return new nodes.Case.When('default', this.parseBlockExpansion()); - }, - - /** - * code - */ - - parseCode: function(){ - var tok = this.expect('code') - , node = new nodes.Code(tok.val, tok.buffer, tok.escape) - , block - , i = 1; - node.line = this.line(); - while (this.lookahead(i) && 'newline' == this.lookahead(i).type) ++i; - block = 'indent' == this.lookahead(i).type; - if (block) { - this.skip(i-1); - node.block = this.block(); - } - return node; - }, - - /** - * comment - */ - - parseComment: function(){ - var tok = this.expect('comment') - , node; - - if ('indent' == this.peek().type) { - node = new nodes.BlockComment(tok.val, this.block(), tok.buffer); - } else { - node = new nodes.Comment(tok.val, tok.buffer); - } - - node.line = this.line(); - return node; - }, - - /** - * doctype - */ - - parseDoctype: function(){ - var tok = this.expect('doctype') - , node = new nodes.Doctype(tok.val); - node.line = this.line(); - return node; - }, - - /** - * filter attrs? text-block - */ - - parseFilter: function(){ - var block - , tok = this.expect('filter') - , attrs = this.accept('attrs'); - - this.lexer.pipeless = true; - block = this.parseTextBlock(); - this.lexer.pipeless = false; - - var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs); - node.line = this.line(); - return node; - }, - - /** - * tag ':' attrs? block - */ - - parseASTFilter: function(){ - var block - , tok = this.expect('tag') - , attrs = this.accept('attrs'); - - this.expect(':'); - block = this.block(); - - var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs); - node.line = this.line(); - return node; - }, - - /** - * each block - */ - - parseEach: function(){ - var tok = this.expect('each') - , node = new nodes.Each(tok.code, tok.val, tok.key); - node.line = this.line(); - node.block = this.block(); - return node; - }, - - /** - * 'extends' name - */ - - parseExtends: function(){ - var path = require('path') - , fs = require('fs') - , dirname = path.dirname - , basename = path.basename - , join = path.join; - - if (!this.filename) - throw new Error('the "filename" option is required to extend templates'); - - var path = this.expect('extends').val.trim() - , dir = dirname(this.filename); - - var path = join(dir, path + '.jade') - , str = fs.readFileSync(path, 'utf8') - , parser = new Parser(str, path, this.options); - - parser.blocks = this.blocks; - parser.contexts = this.contexts; - this.extending = parser; - - // TODO: null node - return new nodes.Literal(''); - }, - - /** - * 'block' name block - */ - - parseBlock: function(){ - var block = this.expect('block') - , mode = block.mode - , name = block.val.trim(); - - block = 'indent' == this.peek().type - ? this.block() - : new nodes.Block(new nodes.Literal('')); - - var prev = this.blocks[name]; - - if (prev) { - switch (prev.mode) { - case 'append': - block.nodes = block.nodes.concat(prev.nodes); - prev = block; - break; - case 'prepend': - block.nodes = prev.nodes.concat(block.nodes); - prev = block; - break; - } - } - - block.mode = mode; - return this.blocks[name] = prev || block; - }, - - /** - * include block? - */ - - parseInclude: function(){ - var path = require('path') - , fs = require('fs') - , dirname = path.dirname - , basename = path.basename - , join = path.join; - - var path = this.expect('include').val.trim() - , dir = dirname(this.filename); - - if (!this.filename) - throw new Error('the "filename" option is required to use includes'); - - // no extension - if (!~basename(path).indexOf('.')) { - path += '.jade'; - } - - // non-jade - if ('.jade' != path.substr(-5)) { - var path = join(dir, path) - , str = fs.readFileSync(path, 'utf8'); - return new nodes.Literal(str); - } - - var path = join(dir, path) - , str = fs.readFileSync(path, 'utf8') - , parser = new Parser(str, path, this.options); - parser.blocks = this.blocks; - parser.mixins = this.mixins; - - this.context(parser); - var ast = parser.parse(); - this.context(); - ast.filename = path; - - if ('indent' == this.peek().type) { - ast.includeBlock().push(this.block()); - } - - return ast; - }, - - /** - * call ident block - */ - - parseCall: function(){ - var tok = this.expect('call') - , name = tok.val - , args = tok.args - , mixin = new nodes.Mixin(name, args, new nodes.Block, true); - - this.tag(mixin); - if (mixin.block.isEmpty()) mixin.block = null; - return mixin; - }, - - /** - * mixin block - */ - - parseMixin: function(){ - var tok = this.expect('mixin') - , name = tok.val - , args = tok.args - , mixin; - - // definition - if ('indent' == this.peek().type) { - mixin = new nodes.Mixin(name, args, this.block(), false); - this.mixins[name] = mixin; - return mixin; - // call - } else { - return new nodes.Mixin(name, args, null, true); - } - }, - - /** - * indent (text | newline)* outdent - */ - - parseTextBlock: function(){ - var block = new nodes.Block; - block.line = this.line(); - var spaces = this.expect('indent').val; - if (null == this._spaces) this._spaces = spaces; - var indent = Array(spaces - this._spaces + 1).join(' '); - while ('outdent' != this.peek().type) { - switch (this.peek().type) { - case 'newline': - this.advance(); - break; - case 'indent': - this.parseTextBlock().nodes.forEach(function(node){ - block.push(node); - }); - break; - default: - var text = new nodes.Text(indent + this.advance().val); - text.line = this.line(); - block.push(text); - } - } - - if (spaces == this._spaces) this._spaces = null; - this.expect('outdent'); - return block; - }, - - /** - * indent expr* outdent - */ - - block: function(){ - var block = new nodes.Block; - block.line = this.line(); - this.expect('indent'); - while ('outdent' != this.peek().type) { - if ('newline' == this.peek().type) { - this.advance(); - } else { - block.push(this.parseExpr()); - } - } - this.expect('outdent'); - return block; - }, - - /** - * interpolation (attrs | class | id)* (text | code | ':')? newline* block? - */ - - parseInterpolation: function(){ - var tok = this.advance(); - var tag = new nodes.Tag(tok.val); - tag.buffer = true; - return this.tag(tag); - }, - - /** - * tag (attrs | class | id)* (text | code | ':')? newline* block? - */ - - parseTag: function(){ - // ast-filter look-ahead - var i = 2; - if ('attrs' == this.lookahead(i).type) ++i; - if (':' == this.lookahead(i).type) { - if ('indent' == this.lookahead(++i).type) { - return this.parseASTFilter(); - } - } - - var tok = this.advance() - , tag = new nodes.Tag(tok.val); - - tag.selfClosing = tok.selfClosing; - - return this.tag(tag); - }, - - /** - * Parse tag. - */ - - tag: function(tag){ - var dot; - - tag.line = this.line(); - - // (attrs | class | id)* - out: - while (true) { - switch (this.peek().type) { - case 'id': - case 'class': - var tok = this.advance(); - tag.setAttribute(tok.type, "'" + tok.val + "'"); - continue; - case 'attrs': - var tok = this.advance() - , obj = tok.attrs - , escaped = tok.escaped - , names = Object.keys(obj); - - if (tok.selfClosing) tag.selfClosing = true; - - for (var i = 0, len = names.length; i < len; ++i) { - var name = names[i] - , val = obj[name]; - tag.setAttribute(name, val, escaped[name]); - } - continue; - default: - break out; - } - } - - // check immediate '.' - if ('.' == this.peek().val) { - dot = tag.textOnly = true; - this.advance(); - } - - // (text | code | ':')? - switch (this.peek().type) { - case 'text': - tag.block.push(this.parseText()); - break; - case 'code': - tag.code = this.parseCode(); - break; - case ':': - this.advance(); - tag.block = new nodes.Block; - tag.block.push(this.parseExpr()); - break; - } - - // newline* - while ('newline' == this.peek().type) this.advance(); - - tag.textOnly = tag.textOnly || ~textOnly.indexOf(tag.name); - - // script special-case - if ('script' == tag.name) { - var type = tag.getAttribute('type'); - if (!dot && type && 'text/javascript' != type.replace(/^['"]|['"]$/g, '')) { - tag.textOnly = false; - } - } - - // block? - if ('indent' == this.peek().type) { - if (tag.textOnly) { - this.lexer.pipeless = true; - tag.block = this.parseTextBlock(); - this.lexer.pipeless = false; - } else { - var block = this.block(); - if (tag.block) { - for (var i = 0, len = block.nodes.length; i < len; ++i) { - tag.block.push(block.nodes[i]); - } - } else { - tag.block = block; - } - } - } - - return tag; - } -}; - -}); // module: parser.js - -require.register("runtime.js", function(module, exports, require){ - -/*! - * Jade - runtime - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Lame Array.isArray() polyfill for now. - */ - -if (!Array.isArray) { - Array.isArray = function(arr){ - return '[object Array]' == Object.prototype.toString.call(arr); - }; -} - -/** - * Lame Object.keys() polyfill for now. - */ - -if (!Object.keys) { - Object.keys = function(obj){ - var arr = []; - for (var key in obj) { - if (obj.hasOwnProperty(key)) { - arr.push(key); - } - } - return arr; - } -} - -/** - * Merge two attribute objects giving precedence - * to values in object `b`. Classes are special-cased - * allowing for arrays and merging/joining appropriately - * resulting in a string. - * - * @param {Object} a - * @param {Object} b - * @return {Object} a - * @api private - */ - -exports.merge = function merge(a, b) { - var ac = a['class']; - var bc = b['class']; - - if (ac || bc) { - ac = ac || []; - bc = bc || []; - if (!Array.isArray(ac)) ac = [ac]; - if (!Array.isArray(bc)) bc = [bc]; - ac = ac.filter(nulls); - bc = bc.filter(nulls); - a['class'] = ac.concat(bc).join(' '); - } - - for (var key in b) { - if (key != 'class') { - a[key] = b[key]; - } - } - - return a; -}; - -/** - * Filter null `val`s. - * - * @param {Mixed} val - * @return {Mixed} - * @api private - */ - -function nulls(val) { - return val != null; -} - -/** - * Render the given attributes object. - * - * @param {Object} obj - * @param {Object} escaped - * @return {String} - * @api private - */ - -exports.attrs = function attrs(obj, escaped){ - var buf = [] - , terse = obj.terse; - - delete obj.terse; - var keys = Object.keys(obj) - , len = keys.length; - - if (len) { - buf.push(''); - for (var i = 0; i < len; ++i) { - var key = keys[i] - , val = obj[key]; - - if ('boolean' == typeof val || null == val) { - if (val) { - terse - ? buf.push(key) - : buf.push(key + '="' + key + '"'); - } - } else if (0 == key.indexOf('data') && 'string' != typeof val) { - buf.push(key + "='" + JSON.stringify(val) + "'"); - } else if ('class' == key && Array.isArray(val)) { - buf.push(key + '="' + exports.escape(val.join(' ')) + '"'); - } else if (escaped && escaped[key]) { - buf.push(key + '="' + exports.escape(val) + '"'); - } else { - buf.push(key + '="' + val + '"'); - } - } - } - - return buf.join(' '); -}; - -/** - * Escape the given string of `html`. - * - * @param {String} html - * @return {String} - * @api private - */ - -exports.escape = function escape(html){ - return String(html) - .replace(/&(?!(\w+|\#\d+);)/g, '&') - .replace(//g, '>') - .replace(/"/g, '"'); -}; - -/** - * Re-throw the given `err` in context to the - * the jade in `filename` at the given `lineno`. - * - * @param {Error} err - * @param {String} filename - * @param {String} lineno - * @api private - */ - -exports.rethrow = function rethrow(err, filename, lineno){ - if (!filename) throw err; - - var context = 3 - , str = require('fs').readFileSync(filename, 'utf8') - , lines = str.split('\n') - , start = Math.max(lineno - context, 0) - , end = Math.min(lines.length, lineno + context); - - // Error context - var context = lines.slice(start, end).map(function(line, i){ - var curr = i + start + 1; - return (curr == lineno ? ' > ' : ' ') - + curr - + '| ' - + line; - }).join('\n'); - - // Alter exception message - err.path = filename; - err.message = (filename || 'Jade') + ':' + lineno - + '\n' + context + '\n\n' + err.message; - throw err; -}; - -}); // module: runtime.js - -require.register("self-closing.js", function(module, exports, require){ - -/*! - * Jade - self closing tags - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -module.exports = [ - 'meta' - , 'img' - , 'link' - , 'input' - , 'source' - , 'area' - , 'base' - , 'col' - , 'br' - , 'hr' -]; -}); // module: self-closing.js - -require.register("utils.js", function(module, exports, require){ - -/*! - * Jade - utils - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Convert interpolation in the given string to JavaScript. - * - * @param {String} str - * @return {String} - * @api private - */ - -var interpolate = exports.interpolate = function(str){ - return str.replace(/(\\)?([#!]){(.*?)}/g, function(str, escape, flag, code){ - return escape - ? str - : "' + " - + ('!' == flag ? '' : 'escape') - + "((interp = " + code.replace(/\\'/g, "'") - + ") == null ? '' : interp) + '"; - }); -}; - -/** - * Escape single quotes in `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -var escape = exports.escape = function(str) { - return str.replace(/'/g, "\\'"); -}; - -/** - * Interpolate, and escape the given `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -exports.text = function(str){ - return interpolate(escape(str)); -}; -}); // module: utils.js - -window.jade = require("jade"); -})(); diff --git a/node_modules/jade/jade.md b/node_modules/jade/jade.md deleted file mode 100644 index 051dc03..0000000 --- a/node_modules/jade/jade.md +++ /dev/null @@ -1,510 +0,0 @@ - -# Jade - - The jade template engine for node.js - -## Synopsis - - jade [-h|--help] [-v|--version] [-o|--obj STR] - [-O|--out DIR] [-p|--path PATH] [-P|--pretty] - [-c|--client] [-D|--no-debug] - -## Examples - - translate jade the templates dir - - $ jade templates - - create {foo,bar}.html - - $ jade {foo,bar}.jade - - jade over stdio - - $ jade < my.jade > my.html - - jade over s - - $ echo "h1 Jade!" | jade - - foo, bar dirs rendering to /tmp - - $ jade foo bar --out /tmp - - compile client-side templates without debugging - instrumentation, making the output javascript - very light-weight. This requires runtime.js - in your projects. - - $ jade --client --no-debug < my.jade - -## Tags - - Tags are simply nested via whitespace, closing - tags defined for you. These indents are called "blocks". - - ul - li - a Foo - li - a Bar - - You may have several tags in one "block": - - ul - li - a Foo - a Bar - a Baz - -## Self-closing Tags - - Some tags are flagged as self-closing by default, such - as `meta`, `link`, and so on. To explicitly self-close - a tag simply append the `/` character: - - foo/ - foo(bar='baz')/ - - Would yield: - - - - -## Attributes - - Tag attributes look similar to HTML, however - the values are regular JavaScript, here are - some examples: - - a(href='google.com') Google - a(class='button', href='google.com') Google - - As mentioned the attribute values are just JavaScript, - this means ternary operations and other JavaScript expressions - work just fine: - - body(class=user.authenticated ? 'authenticated' : 'anonymous') - a(href=user.website || 'http://google.com') - - Multiple lines work too: - - input(type='checkbox', - name='agreement', - checked) - - Multiple lines without the comma work fine: - - input(type='checkbox' - name='agreement' - checked) - - Funky whitespace? fine: - - input( - type='checkbox' - name='agreement' - checked) - -## Boolean attributes - - Boolean attributes are mirrored by Jade, and accept - bools, aka _true_ or _false_. When no value is specified - _true_ is assumed. For example: - - input(type="checkbox", checked) - // => "" - - For example if the checkbox was for an agreement, perhaps `user.agreed` - was _true_ the following would also output 'checked="checked"': - - input(type="checkbox", checked=user.agreed) - -## Class attributes - - The _class_ attribute accepts an array of classes, - this can be handy when generated from a javascript - function etc: - - classes = ['foo', 'bar', 'baz'] - a(class=classes) - // => "" - -## Class literal - - Classes may be defined using a ".CLASSNAME" syntax: - - .button - // => "
      " - - Or chained: - - .large.button - // => "
      " - - The previous defaulted to divs, however you - may also specify the tag type: - - h1.title My Title - // => "

      My Title

      " - -## Id literal - - Much like the class literal there's an id literal: - - #user-1 - // => "
      " - - Again we may specify the tag as well: - - ul#menu - li: a(href='/home') Home - li: a(href='/store') Store - li: a(href='/contact') Contact - - Finally all of these may be used in any combination, - the following are all valid tags: - - a.button#contact(style: 'color: red') Contact - a.button(style: 'color: red')#contact Contact - a(style: 'color: red').button#contact Contact - -## Block expansion - - Jade supports the concept of "block expansion", in which - using a trailing ":" after a tag will inject a block: - - ul - li: a Foo - li: a Bar - li: a Baz - -## Text - - Arbitrary text may follow tags: - - p Welcome to my site - - yields: - -

      Welcome to my site

      - -## Pipe text - - Another form of text is "pipe" text. Pipes act - as the text margin for large bodies of text. - - p - | This is a large - | body of text for - | this tag. - | - | Nothing too - | exciting. - - yields: - -

      This is a large - body of text for - this tag. - - Nothing too - exciting. -

      - - Using pipes we can also specify regular Jade tags - within the text: - - p - | Click to visit - a(href='http://google.com') Google - | if you want. - -## Text only tags - - As an alternative to pipe text you may add - a trailing "." to indicate that the block - contains nothing but plain-text, no tags: - - p. - This is a large - body of text for - this tag. - - Nothing too - exciting. - - Some tags are text-only by default, for example - _script_, _textarea_, and _style_ tags do not - contain nested HTML so Jade implies the trailing ".": - - script - if (foo) { - bar(); - } - - style - body { - padding: 50px; - font: 14px Helvetica; - } - -## Template script tags - - Sometimes it's useful to define HTML in script - tags using Jade, typically for client-side templates. - - To do this simply give the _script_ tag an arbitrary - _type_ attribute such as _text/x-template_: - - script(type='text/template') - h1 Look! - p Jade still works in here! - -## Interpolation - - Both plain-text and piped-text support interpolation, - which comes in two forms, escapes and non-escaped. The - following will output the _user.name_ in the paragraph - but HTML within it will be escaped to prevent XSS attacks: - - p Welcome #{user.name} - - The following syntax is identical however it will _not_ escape - HTML, and should only be used with strings that you trust: - - p Welcome !{user.name} - -## Inline HTML - - Sometimes constructing small inline snippets of HTML - in Jade can be annoying, luckily we can add plain - HTML as well: - - p Welcome #{user.name} - -## Code - - To buffer output with Jade simply use _=_ at the beginning - of a line or after a tag. This method escapes any HTML - present in the string. - - p= user.description - - To buffer output unescaped use the _!=_ variant, but again - be careful of XSS. - - p!= user.description - - The final way to mess with JavaScript code in Jade is the unbuffered - _-_, which can be used for conditionals, defining variables etc: - - - var user = { description: 'foo bar baz' } - #user - - if (user.description) { - h2 Description - p.description= user.description - - } - - When compiled blocks are wrapped in anonymous functions, so the - following is also valid, without braces: - - - var user = { description: 'foo bar baz' } - #user - - if (user.description) - h2 Description - p.description= user.description - - If you really want you could even use `.forEach()` and others: - - - users.forEach(function(user){ - .user - h2= user.name - p User #{user.name} is #{user.age} years old - - }) - - Taking this further Jade provides some syntax for conditionals, - iteration, switch statements etc. Let's look at those next! - -## Assignment - - Jade's first-class assignment is simple, simply use the _=_ - operator and Jade will _var_ it for you. The following are equivalent: - - - var user = { name: 'tobi' } - user = { name: 'tobi' } - -## Conditionals - - Jade's first-class conditional syntax allows for optional - parenthesis, and you may now omit the leading _-_ otherwise - it's identical, still just regular javascript: - - user = { description: 'foo bar baz' } - #user - if user.description - h2 Description - p.description= user.description - - Jade provides the negated version, _unless_ as well, the following - are equivalent: - - - if (!(user.isAnonymous)) - p You're logged in as #{user.name} - - unless user.isAnonymous - p You're logged in as #{user.name} - -## Iteration - - JavaScript's _for_ loops don't look very declarative, so Jade - also provides its own _for_ loop construct, aliased as _each_: - - for user in users - .user - h2= user.name - p user #{user.name} is #{user.age} year old - - As mentioned _each_ is identical: - - each user in users - .user - h2= user.name - - If necessary the index is available as well: - - for user, i in users - .user(class='user-#{i}') - h2= user.name - - Remember, it's just JavaScript: - - ul#letters - for letter in ['a', 'b', 'c'] - li= letter - -## Mixins - - Mixins provide a way to define jade "functions" which "mix in" - their contents when called. This is useful for abstracting - out large fragments of Jade. - - The simplest possible mixin which accepts no arguments might - look like this: - - mixin hello - p Hello - - You use a mixin by placing `+` before the name: - - +hello - - For something a little more dynamic, mixins can take - arguments, the mixin itself is converted to a javascript - function internally: - - mixin hello(user) - p Hello #{user} - - +hello('Tobi') - - Yields: - -

      Hello Tobi

      - - Mixins may optionally take blocks, when a block is passed - its contents becomes the implicit `block` argument. For - example here is a mixin passed a block, and also invoked - without passing a block: - - mixin article(title) - .article - .article-wrapper - h1= title - if block - block - else - p No content provided - - +article('Hello world') - - +article('Hello world') - p This is my - p Amazing article - - yields: - -
      -
      -

      Hello world

      -

      No content provided

      -
      -
      - -
      -
      -

      Hello world

      -

      This is my

      -

      Amazing article

      -
      -
      - - Mixins can even take attributes, just like a tag. When - attributes are passed they become the implicit `attributes` - argument. Individual attributes can be accessed just like - normal object properties: - - mixin centered - .centered(class=attributes.class) - block - - +centered.bold Hello world - - +centered.red - p This is my - p Amazing article - - yields: - -
      Hello world
      -
      -

      This is my

      -

      Amazing article

      -
      - - If you use `attributes` directly, *all* passed attributes - get used: - - mixin link - a.menu(attributes) - block - - +link.highlight(href='#top') Top - +link#sec1.plain(href='#section1') Section 1 - +link#sec2.plain(href='#section2') Section 2 - - yields: - - Top - Section 1 - Section 2 - - If you pass arguments, they must directly follow the mixin: - - mixin list(arr) - if block - .title - block - ul(attributes) - each item in arr - li= item - - +list(['foo', 'bar', 'baz'])(id='myList', class='bold') - - yields: - -
        -
      • foo
        • -
      • bar
        • -
      • baz
        • -
      diff --git a/node_modules/jade/jade.min.js b/node_modules/jade/jade.min.js deleted file mode 100644 index 72e4535..0000000 --- a/node_modules/jade/jade.min.js +++ /dev/null @@ -1,2 +0,0 @@ -(function(){function require(p){var path=require.resolve(p),mod=require.modules[path];if(!mod)throw new Error('failed to require "'+p+'"');return mod.exports||(mod.exports={},mod.call(mod.exports,mod,mod.exports,require.relative(path))),mod.exports}require.modules={},require.resolve=function(path){var orig=path,reg=path+".js",index=path+"/index.js";return require.modules[reg]&®||require.modules[index]&&index||orig},require.register=function(path,fn){require.modules[path]=fn},require.relative=function(parent){return function(p){if("."!=p.charAt(0))return require(p);var path=parent.split("/"),segs=p.split("/");path.pop();for(var i=0;i",this.doctype=doctype,this.terse="5"==name||"html"==name,this.xml=0==this.doctype.indexOf("1&&!escape&&block.nodes[0].isText&&block.nodes[1].isText&&this.prettyIndent(1,!0);for(var i=0;i0&&!escape&&block.nodes[i].isText&&block.nodes[i-1].isText&&this.prettyIndent(1,!1),this.visit(block.nodes[i]),block.nodes[i+1]&&block.nodes[i].isText&&block.nodes[i+1].isText&&this.buffer("\\n")},visitDoctype:function(doctype){doctype&&(doctype.val||!this.doctype)&&this.setDoctype(doctype.val||"default"),this.doctype&&this.buffer(this.doctype),this.hasCompiledDoctype=!0},visitMixin:function(mixin){var name=mixin.name.replace(/-/g,"_")+"_mixin",args=mixin.args||"",block=mixin.block,attrs=mixin.attrs,pp=this.pp;if(mixin.call){pp&&this.buf.push("__indent.push('"+Array(this.indents+1).join(" ")+"');");if(block||attrs.length){this.buf.push(name+".call({");if(block){this.buf.push("block: function(){"),this.parentIndents++;var _indents=this.indents;this.indents=0,this.visit(mixin.block),this.indents=_indents,this.parentIndents--,attrs.length?this.buf.push("},"):this.buf.push("}")}if(attrs.length){var val=this.attrs(attrs);val.inherits?this.buf.push("attributes: merge({"+val.buf+"}, attributes), escaped: merge("+val.escaped+", escaped, true)"):this.buf.push("attributes: {"+val.buf+"}, escaped: "+val.escaped)}args?this.buf.push("}, "+args+");"):this.buf.push("});")}else this.buf.push(name+"("+args+");");pp&&this.buf.push("__indent.pop();")}else this.buf.push("var "+name+" = function("+args+"){"),this.buf.push("var block = this.block, attributes = this.attributes || {}, escaped = this.escaped || {};"),this.parentIndents++,this.visit(block),this.parentIndents--,this.buf.push("};")},visitTag:function(tag){this.indents++;var name=tag.name,pp=this.pp;tag.buffer&&(name="' + ("+name+") + '"),this.hasCompiledTag||(!this.hasCompiledDoctype&&"html"==name&&this.visitDoctype(),this.hasCompiledTag=!0),pp&&!tag.isInline()&&this.prettyIndent(0,!0),(~selfClosing.indexOf(name)||tag.selfClosing)&&!this.xml?(this.buffer("<"+name),this.visitAttributes(tag.attrs),this.terse?this.buffer(">"):this.buffer("/>")):(tag.attrs.length?(this.buffer("<"+name),tag.attrs.length&&this.visitAttributes(tag.attrs),this.buffer(">")):this.buffer("<"+name+">"),tag.code&&this.visitCode(tag.code),this.escape="pre"==tag.name,this.visit(tag.block),pp&&!tag.isInline()&&"pre"!=tag.name&&!tag.canInline()&&this.prettyIndent(0,!0),this.buffer("")),this.indents--},visitFilter:function(filter){var fn=filters[filter.name];if(!fn)throw filter.isASTFilter?new Error('unknown ast filter "'+filter.name+':"'):new Error('unknown filter ":'+filter.name+'"');if(filter.isASTFilter)this.buf.push(fn(filter.block,this,filter.attrs));else{var text=filter.block.nodes.map(function(node){return node.val}).join("\n");filter.attrs=filter.attrs||{},filter.attrs.filename=this.options.filename,this.buffer(utils.text(fn(text,filter.attrs)))}},visitText:function(text){text=utils.text(text.val.replace(/\\/g,"\\\\")),this.escape&&(text=escape(text)),this.buffer(text)},visitComment:function(comment){if(!comment.buffer)return;this.pp&&this.prettyIndent(1,!0),this.buffer("")},visitBlockComment:function(comment){if(!comment.buffer)return;0==comment.val.trim().indexOf("if")?(this.buffer("")):(this.buffer(""))},visitCode:function(code){if(code.buffer){var val=code.val.trimLeft();this.buf.push("var __val__ = "+val),val='null == __val__ ? "" : __val__',code.escape&&(val="escape("+val+")"),this.buf.push("buf.push("+val+");")}else this.buf.push(code.val);code.block&&(code.buffer||this.buf.push("{"),this.visit(code.block),code.buffer||this.buf.push("}"))},visitEach:function(each){this.buf.push("// iterate "+each.obj+"\n"+";(function(){\n"+" if ('number' == typeof "+each.obj+".length) {\n"+" for (var "+each.key+" = 0, $$l = "+each.obj+".length; "+each.key+" < $$l; "+each.key+"++) {\n"+" var "+each.val+" = "+each.obj+"["+each.key+"];\n"),this.visit(each.block),this.buf.push(" }\n } else {\n for (var "+each.key+" in "+each.obj+") {\n"+" if ("+each.obj+".hasOwnProperty("+each.key+")){"+" var "+each.val+" = "+each.obj+"["+each.key+"];\n"),this.visit(each.block),this.buf.push(" }\n"),this.buf.push(" }\n }\n}).call(this);\n")},visitAttributes:function(attrs){var val=this.attrs(attrs);val.inherits?this.buf.push("buf.push(attrs(merge({ "+val.buf+" }, attributes), merge("+val.escaped+", escaped, true)));"):val.constant?(eval("var buf={"+val.buf+"};"),this.buffer(runtime.attrs(buf,JSON.parse(val.escaped)),!0)):this.buf.push("buf.push(attrs({ "+val.buf+" }, "+val.escaped+"));")},attrs:function(attrs){var buf=[],classes=[],escaped={},constant=attrs.every(function(attr){return isConstant(attr.val)}),inherits=!1;return this.terse&&buf.push("terse: true"),attrs.forEach(function(attr){if(attr.name=="attributes")return inherits=!0;escaped[attr.name]=attr.escaped;if(attr.name=="class")classes.push("("+attr.val+")");else{var pair="'"+attr.name+"':("+attr.val+")";buf.push(pair)}}),classes.length&&(classes=classes.join(" + ' ' + "),buf.push("class: "+classes)),{buf:buf.join(", ").replace("class:",'"class":'),escaped:JSON.stringify(escaped),inherits:inherits,constant:constant}}};function isConstant(val){if(/^ *("([^"\\]*(\\.[^"\\]*)*)"|'([^'\\]*(\\.[^'\\]*)*)'|true|false|null|undefined) *$/i.test(val))return!0;if(!isNaN(Number(val)))return!0;var matches;return(matches=/^ *\[(.*)\] *$/.exec(val))?matches[1].split(",").every(isConstant):!1}function escape(html){return String(html).replace(/&(?!\w+;)/g,"&").replace(//g,">").replace(/"/g,""")}}),require.register("doctypes.js",function(module,exports,require){module.exports={5:"","default":"",xml:'',transitional:'',strict:'',frameset:'',1.1:'',basic:'',mobile:''}}),require.register("filters.js",function(module,exports,require){module.exports={cdata:function(str){return""},sass:function(str){str=str.replace(/\\n/g,"\n");var sass=require("sass").render(str).replace(/\n/g,"\\n");return'"},stylus:function(str,options){var ret;str=str.replace(/\\n/g,"\n");var stylus=require("stylus");return stylus(str,options).render(function(err,css){if(err)throw err;ret=css.replace(/\n/g,"\\n")}),'"},less:function(str){var ret;return str=str.replace(/\\n/g,"\n"),require("less").render(str,function(err,css){if(err)throw err;ret='"}),ret},markdown:function(str){var md;try{md=require("markdown")}catch(err){try{md=require("discount")}catch(err){try{md=require("markdown-js")}catch(err){try{md=require("marked")}catch(err){throw new Error("Cannot find markdown library, install markdown, discount, or marked.")}}}}return str=str.replace(/\\n/g,"\n"),md.parse(str).replace(/\n/g,"\\n").replace(/'/g,"'")},coffeescript:function(str){str=str.replace(/\\n/g,"\n");var js=require("coffee-script").compile(str).replace(/\\/g,"\\\\").replace(/\n/g,"\\n");return'"}}}),require.register("inline-tags.js",function(module,exports,require){module.exports=["a","abbr","acronym","b","br","code","em","font","i","img","ins","kbd","map","samp","small","span","strong","sub","sup"]}),require.register("jade.js",function(module,exports,require){var Parser=require("./parser"),Lexer=require("./lexer"),Compiler=require("./compiler"),runtime=require("./runtime");exports.version="0.26.1",exports.selfClosing=require("./self-closing"),exports.doctypes=require("./doctypes"),exports.filters=require("./filters"),exports.utils=require("./utils"),exports.Compiler=Compiler,exports.Parser=Parser,exports.Lexer=Lexer,exports.nodes=require("./nodes"),exports.runtime=runtime,exports.cache={};function parse(str,options){try{var parser=new Parser(str,options.filename,options),compiler=new(options.compiler||Compiler)(parser.parse(),options),js=compiler.compile();return options.debug&&console.error("\nCompiled Function:\n\n%s",js.replace(/^/gm," ")),"var buf = [];\n"+(options.self?"var self = locals || {};\n"+js:"with (locals || {}) {\n"+js+"\n}\n")+'return buf.join("");'}catch(err){parser=parser.context(),runtime.rethrow(err,parser.filename,parser.lexer.lineno)}}exports.compile=function(str,options){var options=options||{},client=options.client,filename=options.filename?JSON.stringify(options.filename):"undefined",fn;return options.compileDebug!==!1?fn=["var __jade = [{ lineno: 1, filename: "+filename+" }];","try {",parse(String(str),options),"} catch (err) {"," rethrow(err, __jade[0].filename, __jade[0].lineno);","}"].join("\n"):fn=parse(String(str),options),client&&(fn="attrs = attrs || jade.attrs; escape = escape || jade.escape; rethrow = rethrow || jade.rethrow; merge = merge || jade.merge;\n"+fn),fn=new Function("locals, attrs, escape, rethrow, merge",fn),client?fn:function(locals){return fn(locals,runtime.attrs,runtime.escape,runtime.rethrow,runtime.merge)}},exports.render=function(str,options,fn){"function"==typeof options&&(fn=options,options={});if(options.cache&&!options.filename)return fn(new Error('the "filename" option is required for caching'));try{var path=options.filename,tmpl=options.cache?exports.cache[path]||(exports.cache[path]=exports.compile(str,options)):exports.compile(str,options);fn(null,tmpl(options))}catch(err){fn(err)}},exports.renderFile=function(path,options,fn){var key=path+":string";"function"==typeof options&&(fn=options,options={});try{options.filename=path;var str=options.cache?exports.cache[key]||(exports.cache[key]=fs.readFileSync(path,"utf8")):fs.readFileSync(path,"utf8");exports.render(str,options,fn)}catch(err){fn(err)}},exports.__express=exports.renderFile}),require.register("lexer.js",function(module,exports,require){var Lexer=module.exports=function Lexer(str,options){options=options||{},this.input=str.replace(/\r\n|\r/g,"\n"),this.colons=options.colons,this.deferredTokens=[],this.lastIndents=0,this.lineno=1,this.stash=[],this.indentStack=[],this.indentRe=null,this.pipeless=!1};Lexer.prototype={tok:function(type,val){return{type:type,line:this.lineno,val:val}},consume:function(len){this.input=this.input.substr(len)},scan:function(regexp,type){var captures;if(captures=regexp.exec(this.input))return this.consume(captures[0].length),this.tok(type,captures[1])},defer:function(tok){this.deferredTokens.push(tok)},lookahead:function(n){var fetch=n-this.stash.length;while(fetch-->0)this.stash.push(this.next());return this.stash[--n]},indexOfDelimiters:function(start,end){var str=this.input,nstart=0,nend=0,pos=0;for(var i=0,len=str.length;iindents)this.stash.push(this.tok("outdent")),this.indentStack.shift();tok=this.stash.pop()}else indents&&indents!=this.indentStack[0]?(this.indentStack.unshift(indents),tok=this.tok("indent",indents)):tok=this.tok("newline");return tok}},pipelessText:function(){if(this.pipeless){if("\n"==this.input[0])return;var i=this.input.indexOf("\n");-1==i&&(i=this.input.length);var str=this.input.substr(0,i);return this.consume(str.length),this.tok("text",str)}},colon:function(){return this.scan(/^: */,":")},advance:function(){return this.stashed()||this.next()},next:function(){return this.deferred()||this.blank()||this.eos()||this.pipelessText()||this.yield()||this.doctype()||this.interpolation()||this["case"]()||this.when()||this["default"]()||this["extends"]()||this.append()||this.prepend()||this.block()||this.include()||this.mixin()||this.call()||this.conditional()||this.each()||this["while"]()||this.assignment()||this.tag()||this.filter()||this.code()||this.id()||this.className()||this.attrs()||this.indent()||this.comment()||this.colon()||this.text()}}}),require.register("nodes/attrs.js",function(module,exports,require){var Node=require("./node"),Block=require("./block"),Attrs=module.exports=function Attrs(){this.attrs=[]};Attrs.prototype=new Node,Attrs.prototype.constructor=Attrs,Attrs.prototype.setAttribute=function(name,val,escaped){return this.attrs.push({name:name,val:val,escaped:escaped}),this},Attrs.prototype.removeAttribute=function(name){for(var i=0,len=this.attrs.length;i/g,">").replace(/"/g,""")},exports.rethrow=function rethrow(err,filename,lineno){if(!filename)throw err;var context=3,str=require("fs").readFileSync(filename,"utf8"),lines=str.split("\n"),start=Math.max(lineno-context,0),end=Math.min(lines.length,lineno+context),context=lines.slice(start,end).map(function(line,i){var curr=i+start+1;return(curr==lineno?" > ":" ")+curr+"| "+line}).join("\n");throw err.path=filename,err.message=(filename||"Jade")+":"+lineno+"\n"+context+"\n\n"+err.message,err}}),require.register("self-closing.js",function(module,exports,require){module.exports=["meta","img","link","input","source","area","base","col","br","hr"]}),require.register("utils.js",function(module,exports,require){var interpolate=exports.interpolate=function(str){return str.replace(/(\\)?([#!]){(.*?)}/g,function(str,escape,flag,code){return escape?str:"' + "+("!"==flag?"":"escape")+"((interp = "+code.replace(/\\'/g,"'")+") == null ? '' : interp) + '"})},escape=exports.escape=function(str){return str.replace(/'/g,"\\'")};exports.text=function(str){return interpolate(escape(str))}}),window.jade=require("jade")})(); \ No newline at end of file diff --git a/node_modules/jade/lib/compiler.js b/node_modules/jade/lib/compiler.js deleted file mode 100644 index 516ac83..0000000 --- a/node_modules/jade/lib/compiler.js +++ /dev/null @@ -1,642 +0,0 @@ - -/*! - * Jade - Compiler - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var nodes = require('./nodes') - , filters = require('./filters') - , doctypes = require('./doctypes') - , selfClosing = require('./self-closing') - , runtime = require('./runtime') - , utils = require('./utils'); - -// if browser -// -// if (!Object.keys) { -// Object.keys = function(obj){ -// var arr = []; -// for (var key in obj) { -// if (obj.hasOwnProperty(key)) { -// arr.push(key); -// } -// } -// return arr; -// } -// } -// -// if (!String.prototype.trimLeft) { -// String.prototype.trimLeft = function(){ -// return this.replace(/^\s+/, ''); -// } -// } -// -// end - - -/** - * Initialize `Compiler` with the given `node`. - * - * @param {Node} node - * @param {Object} options - * @api public - */ - -var Compiler = module.exports = function Compiler(node, options) { - this.options = options = options || {}; - this.node = node; - this.hasCompiledDoctype = false; - this.hasCompiledTag = false; - this.pp = options.pretty || false; - this.debug = false !== options.compileDebug; - this.indents = 0; - this.parentIndents = 0; - if (options.doctype) this.setDoctype(options.doctype); -}; - -/** - * Compiler prototype. - */ - -Compiler.prototype = { - - /** - * Compile parse tree to JavaScript. - * - * @api public - */ - - compile: function(){ - this.buf = ['var interp;']; - if (this.pp) this.buf.push("var __indent = [];"); - this.lastBufferedIdx = -1; - this.visit(this.node); - return this.buf.join('\n'); - }, - - /** - * Sets the default doctype `name`. Sets terse mode to `true` when - * html 5 is used, causing self-closing tags to end with ">" vs "/>", - * and boolean attributes are not mirrored. - * - * @param {string} name - * @api public - */ - - setDoctype: function(name){ - var doctype = doctypes[(name || 'default').toLowerCase()]; - doctype = doctype || ''; - this.doctype = doctype; - this.terse = '5' == name || 'html' == name; - this.xml = 0 == this.doctype.indexOf(' 1 && !escape && block.nodes[0].isText && block.nodes[1].isText) - this.prettyIndent(1, true); - - for (var i = 0; i < len; ++i) { - // Pretty print text - if (pp && i > 0 && !escape && block.nodes[i].isText && block.nodes[i-1].isText) - this.prettyIndent(1, false); - - this.visit(block.nodes[i]); - // Multiple text nodes are separated by newlines - if (block.nodes[i+1] && block.nodes[i].isText && block.nodes[i+1].isText) - this.buffer('\\n'); - } - }, - - /** - * Visit `doctype`. Sets terse mode to `true` when html 5 - * is used, causing self-closing tags to end with ">" vs "/>", - * and boolean attributes are not mirrored. - * - * @param {Doctype} doctype - * @api public - */ - - visitDoctype: function(doctype){ - if (doctype && (doctype.val || !this.doctype)) { - this.setDoctype(doctype.val || 'default'); - } - - if (this.doctype) this.buffer(this.doctype); - this.hasCompiledDoctype = true; - }, - - /** - * Visit `mixin`, generating a function that - * may be called within the template. - * - * @param {Mixin} mixin - * @api public - */ - - visitMixin: function(mixin){ - var name = mixin.name.replace(/-/g, '_') + '_mixin' - , args = mixin.args || '' - , block = mixin.block - , attrs = mixin.attrs - , pp = this.pp; - - if (mixin.call) { - if (pp) this.buf.push("__indent.push('" + Array(this.indents + 1).join(' ') + "');") - if (block || attrs.length) { - - this.buf.push(name + '.call({'); - - if (block) { - this.buf.push('block: function(){'); - - // Render block with no indents, dynamically added when rendered - this.parentIndents++; - var _indents = this.indents; - this.indents = 0; - this.visit(mixin.block); - this.indents = _indents; - this.parentIndents--; - - if (attrs.length) { - this.buf.push('},'); - } else { - this.buf.push('}'); - } - } - - if (attrs.length) { - var val = this.attrs(attrs); - if (val.inherits) { - this.buf.push('attributes: merge({' + val.buf - + '}, attributes), escaped: merge(' + val.escaped + ', escaped, true)'); - } else { - this.buf.push('attributes: {' + val.buf + '}, escaped: ' + val.escaped); - } - } - - if (args) { - this.buf.push('}, ' + args + ');'); - } else { - this.buf.push('});'); - } - - } else { - this.buf.push(name + '(' + args + ');'); - } - if (pp) this.buf.push("__indent.pop();") - } else { - this.buf.push('var ' + name + ' = function(' + args + '){'); - this.buf.push('var block = this.block, attributes = this.attributes || {}, escaped = this.escaped || {};'); - this.parentIndents++; - this.visit(block); - this.parentIndents--; - this.buf.push('};'); - } - }, - - /** - * Visit `tag` buffering tag markup, generating - * attributes, visiting the `tag`'s code and block. - * - * @param {Tag} tag - * @api public - */ - - visitTag: function(tag){ - this.indents++; - var name = tag.name - , pp = this.pp; - - if (tag.buffer) name = "' + (" + name + ") + '"; - - if (!this.hasCompiledTag) { - if (!this.hasCompiledDoctype && 'html' == name) { - this.visitDoctype(); - } - this.hasCompiledTag = true; - } - - // pretty print - if (pp && !tag.isInline()) - this.prettyIndent(0, true); - - if ((~selfClosing.indexOf(name) || tag.selfClosing) && !this.xml) { - this.buffer('<' + name); - this.visitAttributes(tag.attrs); - this.terse - ? this.buffer('>') - : this.buffer('/>'); - } else { - // Optimize attributes buffering - if (tag.attrs.length) { - this.buffer('<' + name); - if (tag.attrs.length) this.visitAttributes(tag.attrs); - this.buffer('>'); - } else { - this.buffer('<' + name + '>'); - } - if (tag.code) this.visitCode(tag.code); - this.escape = 'pre' == tag.name; - this.visit(tag.block); - - // pretty print - if (pp && !tag.isInline() && 'pre' != tag.name && !tag.canInline()) - this.prettyIndent(0, true); - - this.buffer(''); - } - this.indents--; - }, - - /** - * Visit `filter`, throwing when the filter does not exist. - * - * @param {Filter} filter - * @api public - */ - - visitFilter: function(filter){ - var fn = filters[filter.name]; - - // unknown filter - if (!fn) { - if (filter.isASTFilter) { - throw new Error('unknown ast filter "' + filter.name + ':"'); - } else { - throw new Error('unknown filter ":' + filter.name + '"'); - } - } - - if (filter.isASTFilter) { - this.buf.push(fn(filter.block, this, filter.attrs)); - } else { - var text = filter.block.nodes.map(function(node){ return node.val }).join('\n'); - filter.attrs = filter.attrs || {}; - filter.attrs.filename = this.options.filename; - this.buffer(utils.text(fn(text, filter.attrs))); - } - }, - - /** - * Visit `text` node. - * - * @param {Text} text - * @api public - */ - - visitText: function(text){ - text = utils.text(text.val.replace(/\\/g, '\\\\')); - if (this.escape) text = escape(text); - this.buffer(text); - }, - - /** - * Visit a `comment`, only buffering when the buffer flag is set. - * - * @param {Comment} comment - * @api public - */ - - visitComment: function(comment){ - if (!comment.buffer) return; - if (this.pp) this.prettyIndent(1, true); - this.buffer(''); - }, - - /** - * Visit a `BlockComment`. - * - * @param {Comment} comment - * @api public - */ - - visitBlockComment: function(comment){ - if (!comment.buffer) return; - if (0 == comment.val.trim().indexOf('if')) { - this.buffer(''); - } else { - this.buffer(''); - } - }, - - /** - * Visit `code`, respecting buffer / escape flags. - * If the code is followed by a block, wrap it in - * a self-calling function. - * - * @param {Code} code - * @api public - */ - - visitCode: function(code){ - // Wrap code blocks with {}. - // we only wrap unbuffered code blocks ATM - // since they are usually flow control - - // Buffer code - if (code.buffer) { - var val = code.val.trimLeft(); - this.buf.push('var __val__ = ' + val); - val = 'null == __val__ ? "" : __val__'; - if (code.escape) val = 'escape(' + val + ')'; - this.buf.push("buf.push(" + val + ");"); - } else { - this.buf.push(code.val); - } - - // Block support - if (code.block) { - if (!code.buffer) this.buf.push('{'); - this.visit(code.block); - if (!code.buffer) this.buf.push('}'); - } - }, - - /** - * Visit `each` block. - * - * @param {Each} each - * @api public - */ - - visitEach: function(each){ - this.buf.push('' - + '// iterate ' + each.obj + '\n' - + ';(function(){\n' - + ' if (\'number\' == typeof ' + each.obj + '.length) {\n' - + ' for (var ' + each.key + ' = 0, $$l = ' + each.obj + '.length; ' + each.key + ' < $$l; ' + each.key + '++) {\n' - + ' var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n'); - - this.visit(each.block); - - this.buf.push('' - + ' }\n' - + ' } else {\n' - + ' for (var ' + each.key + ' in ' + each.obj + ') {\n' - // if browser - // + ' if (' + each.obj + '.hasOwnProperty(' + each.key + ')){' - // end - + ' var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n'); - - this.visit(each.block); - - // if browser - // this.buf.push(' }\n'); - // end - - this.buf.push(' }\n }\n}).call(this);\n'); - }, - - /** - * Visit `attrs`. - * - * @param {Array} attrs - * @api public - */ - - visitAttributes: function(attrs){ - var val = this.attrs(attrs); - if (val.inherits) { - this.buf.push("buf.push(attrs(merge({ " + val.buf + - " }, attributes), merge(" + val.escaped + ", escaped, true)));"); - } else if (val.constant) { - eval('var buf={' + val.buf + '};'); - this.buffer(runtime.attrs(buf, JSON.parse(val.escaped)), true); - } else { - this.buf.push("buf.push(attrs({ " + val.buf + " }, " + val.escaped + "));"); - } - }, - - /** - * Compile attributes. - */ - - attrs: function(attrs){ - var buf = [] - , classes = [] - , escaped = {} - , constant = attrs.every(function(attr){ return isConstant(attr.val) }) - , inherits = false; - - if (this.terse) buf.push('terse: true'); - - attrs.forEach(function(attr){ - if (attr.name == 'attributes') return inherits = true; - escaped[attr.name] = attr.escaped; - if (attr.name == 'class') { - classes.push('(' + attr.val + ')'); - } else { - var pair = "'" + attr.name + "':(" + attr.val + ')'; - buf.push(pair); - } - }); - - if (classes.length) { - classes = classes.join(" + ' ' + "); - buf.push("class: " + classes); - } - - return { - buf: buf.join(', ').replace('class:', '"class":'), - escaped: JSON.stringify(escaped), - inherits: inherits, - constant: constant - }; - } -}; - -/** - * Check if expression can be evaluated to a constant - * - * @param {String} expression - * @return {Boolean} - * @api private - */ - -function isConstant(val){ - // Check strings/literals - if (/^ *("([^"\\]*(\\.[^"\\]*)*)"|'([^'\\]*(\\.[^'\\]*)*)'|true|false|null|undefined) *$/i.test(val)) - return true; - - // Check numbers - if (!isNaN(Number(val))) - return true; - - // Check arrays - var matches; - if (matches = /^ *\[(.*)\] *$/.exec(val)) - return matches[1].split(',').every(isConstant); - - return false; -} - -/** - * Escape the given string of `html`. - * - * @param {String} html - * @return {String} - * @api private - */ - -function escape(html){ - return String(html) - .replace(/&(?!\w+;)/g, '&') - .replace(//g, '>') - .replace(/"/g, '"'); -} \ No newline at end of file diff --git a/node_modules/jade/lib/doctypes.js b/node_modules/jade/lib/doctypes.js deleted file mode 100644 index e87ca1e..0000000 --- a/node_modules/jade/lib/doctypes.js +++ /dev/null @@ -1,18 +0,0 @@ - -/*! - * Jade - doctypes - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -module.exports = { - '5': '' - , 'default': '' - , 'xml': '' - , 'transitional': '' - , 'strict': '' - , 'frameset': '' - , '1.1': '' - , 'basic': '' - , 'mobile': '' -}; \ No newline at end of file diff --git a/node_modules/jade/lib/filters.js b/node_modules/jade/lib/filters.js deleted file mode 100644 index fdb634c..0000000 --- a/node_modules/jade/lib/filters.js +++ /dev/null @@ -1,97 +0,0 @@ - -/*! - * Jade - filters - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -module.exports = { - - /** - * Wrap text with CDATA block. - */ - - cdata: function(str){ - return ''; - }, - - /** - * Transform sass to css, wrapped in style tags. - */ - - sass: function(str){ - str = str.replace(/\\n/g, '\n'); - var sass = require('sass').render(str).replace(/\n/g, '\\n'); - return ''; - }, - - /** - * Transform stylus to css, wrapped in style tags. - */ - - stylus: function(str, options){ - var ret; - str = str.replace(/\\n/g, '\n'); - var stylus = require('stylus'); - stylus(str, options).render(function(err, css){ - if (err) throw err; - ret = css.replace(/\n/g, '\\n'); - }); - return ''; - }, - - /** - * Transform less to css, wrapped in style tags. - */ - - less: function(str){ - var ret; - str = str.replace(/\\n/g, '\n'); - require('less').render(str, function(err, css){ - if (err) throw err; - ret = ''; - }); - return ret; - }, - - /** - * Transform markdown to html. - */ - - markdown: function(str){ - var md; - - // support markdown / discount - try { - md = require('markdown'); - } catch (err){ - try { - md = require('discount'); - } catch (err) { - try { - md = require('markdown-js'); - } catch (err) { - try { - md = require('marked'); - } catch (err) { - throw new - Error('Cannot find markdown library, install markdown, discount, or marked.'); - } - } - } - } - - str = str.replace(/\\n/g, '\n'); - return md.parse(str).replace(/\n/g, '\\n').replace(/'/g,'''); - }, - - /** - * Transform coffeescript to javascript. - */ - - coffeescript: function(str){ - str = str.replace(/\\n/g, '\n'); - var js = require('coffee-script').compile(str).replace(/\\/g, '\\\\').replace(/\n/g, '\\n'); - return ''; - } -}; diff --git a/node_modules/jade/lib/inline-tags.js b/node_modules/jade/lib/inline-tags.js deleted file mode 100644 index 491de0b..0000000 --- a/node_modules/jade/lib/inline-tags.js +++ /dev/null @@ -1,28 +0,0 @@ - -/*! - * Jade - inline tags - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -module.exports = [ - 'a' - , 'abbr' - , 'acronym' - , 'b' - , 'br' - , 'code' - , 'em' - , 'font' - , 'i' - , 'img' - , 'ins' - , 'kbd' - , 'map' - , 'samp' - , 'small' - , 'span' - , 'strong' - , 'sub' - , 'sup' -]; \ No newline at end of file diff --git a/node_modules/jade/lib/jade.js b/node_modules/jade/lib/jade.js deleted file mode 100644 index 00f0abb..0000000 --- a/node_modules/jade/lib/jade.js +++ /dev/null @@ -1,237 +0,0 @@ -/*! - * Jade - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Parser = require('./parser') - , Lexer = require('./lexer') - , Compiler = require('./compiler') - , runtime = require('./runtime') -// if node - , fs = require('fs'); -// end - -/** - * Library version. - */ - -exports.version = '0.26.3'; - -/** - * Expose self closing tags. - */ - -exports.selfClosing = require('./self-closing'); - -/** - * Default supported doctypes. - */ - -exports.doctypes = require('./doctypes'); - -/** - * Text filters. - */ - -exports.filters = require('./filters'); - -/** - * Utilities. - */ - -exports.utils = require('./utils'); - -/** - * Expose `Compiler`. - */ - -exports.Compiler = Compiler; - -/** - * Expose `Parser`. - */ - -exports.Parser = Parser; - -/** - * Expose `Lexer`. - */ - -exports.Lexer = Lexer; - -/** - * Nodes. - */ - -exports.nodes = require('./nodes'); - -/** - * Jade runtime helpers. - */ - -exports.runtime = runtime; - -/** - * Template function cache. - */ - -exports.cache = {}; - -/** - * Parse the given `str` of jade and return a function body. - * - * @param {String} str - * @param {Object} options - * @return {String} - * @api private - */ - -function parse(str, options){ - try { - // Parse - var parser = new Parser(str, options.filename, options); - - // Compile - var compiler = new (options.compiler || Compiler)(parser.parse(), options) - , js = compiler.compile(); - - // Debug compiler - if (options.debug) { - console.error('\nCompiled Function:\n\n\033[90m%s\033[0m', js.replace(/^/gm, ' ')); - } - - return '' - + 'var buf = [];\n' - + (options.self - ? 'var self = locals || {};\n' + js - : 'with (locals || {}) {\n' + js + '\n}\n') - + 'return buf.join("");'; - } catch (err) { - parser = parser.context(); - runtime.rethrow(err, parser.filename, parser.lexer.lineno); - } -} - -/** - * Compile a `Function` representation of the given jade `str`. - * - * Options: - * - * - `compileDebug` when `false` debugging code is stripped from the compiled template - * - `client` when `true` the helper functions `escape()` etc will reference `jade.escape()` - * for use with the Jade client-side runtime.js - * - * @param {String} str - * @param {Options} options - * @return {Function} - * @api public - */ - -exports.compile = function(str, options){ - var options = options || {} - , client = options.client - , filename = options.filename - ? JSON.stringify(options.filename) - : 'undefined' - , fn; - - if (options.compileDebug !== false) { - fn = [ - 'var __jade = [{ lineno: 1, filename: ' + filename + ' }];' - , 'try {' - , parse(String(str), options) - , '} catch (err) {' - , ' rethrow(err, __jade[0].filename, __jade[0].lineno);' - , '}' - ].join('\n'); - } else { - fn = parse(String(str), options); - } - - if (client) { - fn = 'attrs = attrs || jade.attrs; escape = escape || jade.escape; rethrow = rethrow || jade.rethrow; merge = merge || jade.merge;\n' + fn; - } - - fn = new Function('locals, attrs, escape, rethrow, merge', fn); - - if (client) return fn; - - return function(locals){ - return fn(locals, runtime.attrs, runtime.escape, runtime.rethrow, runtime.merge); - }; -}; - -/** - * Render the given `str` of jade and invoke - * the callback `fn(err, str)`. - * - * Options: - * - * - `cache` enable template caching - * - `filename` filename required for `include` / `extends` and caching - * - * @param {String} str - * @param {Object|Function} options or fn - * @param {Function} fn - * @api public - */ - -exports.render = function(str, options, fn){ - // swap args - if ('function' == typeof options) { - fn = options, options = {}; - } - - // cache requires .filename - if (options.cache && !options.filename) { - return fn(new Error('the "filename" option is required for caching')); - } - - try { - var path = options.filename; - var tmpl = options.cache - ? exports.cache[path] || (exports.cache[path] = exports.compile(str, options)) - : exports.compile(str, options); - fn(null, tmpl(options)); - } catch (err) { - fn(err); - } -}; - -/** - * Render a Jade file at the given `path` and callback `fn(err, str)`. - * - * @param {String} path - * @param {Object|Function} options or callback - * @param {Function} fn - * @api public - */ - -exports.renderFile = function(path, options, fn){ - var key = path + ':string'; - - if ('function' == typeof options) { - fn = options, options = {}; - } - - try { - options.filename = path; - var str = options.cache - ? exports.cache[key] || (exports.cache[key] = fs.readFileSync(path, 'utf8')) - : fs.readFileSync(path, 'utf8'); - exports.render(str, options, fn); - } catch (err) { - fn(err); - } -}; - -/** - * Express support. - */ - -exports.__express = exports.renderFile; diff --git a/node_modules/jade/lib/lexer.js b/node_modules/jade/lib/lexer.js deleted file mode 100644 index bca314a..0000000 --- a/node_modules/jade/lib/lexer.js +++ /dev/null @@ -1,771 +0,0 @@ - -/*! - * Jade - Lexer - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Initialize `Lexer` with the given `str`. - * - * Options: - * - * - `colons` allow colons for attr delimiters - * - * @param {String} str - * @param {Object} options - * @api private - */ - -var Lexer = module.exports = function Lexer(str, options) { - options = options || {}; - this.input = str.replace(/\r\n|\r/g, '\n'); - this.colons = options.colons; - this.deferredTokens = []; - this.lastIndents = 0; - this.lineno = 1; - this.stash = []; - this.indentStack = []; - this.indentRe = null; - this.pipeless = false; -}; - -/** - * Lexer prototype. - */ - -Lexer.prototype = { - - /** - * Construct a token with the given `type` and `val`. - * - * @param {String} type - * @param {String} val - * @return {Object} - * @api private - */ - - tok: function(type, val){ - return { - type: type - , line: this.lineno - , val: val - } - }, - - /** - * Consume the given `len` of input. - * - * @param {Number} len - * @api private - */ - - consume: function(len){ - this.input = this.input.substr(len); - }, - - /** - * Scan for `type` with the given `regexp`. - * - * @param {String} type - * @param {RegExp} regexp - * @return {Object} - * @api private - */ - - scan: function(regexp, type){ - var captures; - if (captures = regexp.exec(this.input)) { - this.consume(captures[0].length); - return this.tok(type, captures[1]); - } - }, - - /** - * Defer the given `tok`. - * - * @param {Object} tok - * @api private - */ - - defer: function(tok){ - this.deferredTokens.push(tok); - }, - - /** - * Lookahead `n` tokens. - * - * @param {Number} n - * @return {Object} - * @api private - */ - - lookahead: function(n){ - var fetch = n - this.stash.length; - while (fetch-- > 0) this.stash.push(this.next()); - return this.stash[--n]; - }, - - /** - * Return the indexOf `start` / `end` delimiters. - * - * @param {String} start - * @param {String} end - * @return {Number} - * @api private - */ - - indexOfDelimiters: function(start, end){ - var str = this.input - , nstart = 0 - , nend = 0 - , pos = 0; - for (var i = 0, len = str.length; i < len; ++i) { - if (start == str.charAt(i)) { - ++nstart; - } else if (end == str.charAt(i)) { - if (++nend == nstart) { - pos = i; - break; - } - } - } - return pos; - }, - - /** - * Stashed token. - */ - - stashed: function() { - return this.stash.length - && this.stash.shift(); - }, - - /** - * Deferred token. - */ - - deferred: function() { - return this.deferredTokens.length - && this.deferredTokens.shift(); - }, - - /** - * end-of-source. - */ - - eos: function() { - if (this.input.length) return; - if (this.indentStack.length) { - this.indentStack.shift(); - return this.tok('outdent'); - } else { - return this.tok('eos'); - } - }, - - /** - * Blank line. - */ - - blank: function() { - var captures; - if (captures = /^\n *\n/.exec(this.input)) { - this.consume(captures[0].length - 1); - if (this.pipeless) return this.tok('text', ''); - return this.next(); - } - }, - - /** - * Comment. - */ - - comment: function() { - var captures; - if (captures = /^ *\/\/(-)?([^\n]*)/.exec(this.input)) { - this.consume(captures[0].length); - var tok = this.tok('comment', captures[2]); - tok.buffer = '-' != captures[1]; - return tok; - } - }, - - /** - * Interpolated tag. - */ - - interpolation: function() { - var captures; - if (captures = /^#\{(.*?)\}/.exec(this.input)) { - this.consume(captures[0].length); - return this.tok('interpolation', captures[1]); - } - }, - - /** - * Tag. - */ - - tag: function() { - var captures; - if (captures = /^(\w[-:\w]*)(\/?)/.exec(this.input)) { - this.consume(captures[0].length); - var tok, name = captures[1]; - if (':' == name[name.length - 1]) { - name = name.slice(0, -1); - tok = this.tok('tag', name); - this.defer(this.tok(':')); - while (' ' == this.input[0]) this.input = this.input.substr(1); - } else { - tok = this.tok('tag', name); - } - tok.selfClosing = !! captures[2]; - return tok; - } - }, - - /** - * Filter. - */ - - filter: function() { - return this.scan(/^:(\w+)/, 'filter'); - }, - - /** - * Doctype. - */ - - doctype: function() { - return this.scan(/^(?:!!!|doctype) *([^\n]+)?/, 'doctype'); - }, - - /** - * Id. - */ - - id: function() { - return this.scan(/^#([\w-]+)/, 'id'); - }, - - /** - * Class. - */ - - className: function() { - return this.scan(/^\.([\w-]+)/, 'class'); - }, - - /** - * Text. - */ - - text: function() { - return this.scan(/^(?:\| ?| ?)?([^\n]+)/, 'text'); - }, - - /** - * Extends. - */ - - "extends": function() { - return this.scan(/^extends? +([^\n]+)/, 'extends'); - }, - - /** - * Block prepend. - */ - - prepend: function() { - var captures; - if (captures = /^prepend +([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - var mode = 'prepend' - , name = captures[1] - , tok = this.tok('block', name); - tok.mode = mode; - return tok; - } - }, - - /** - * Block append. - */ - - append: function() { - var captures; - if (captures = /^append +([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - var mode = 'append' - , name = captures[1] - , tok = this.tok('block', name); - tok.mode = mode; - return tok; - } - }, - - /** - * Block. - */ - - block: function() { - var captures; - if (captures = /^block\b *(?:(prepend|append) +)?([^\n]*)/.exec(this.input)) { - this.consume(captures[0].length); - var mode = captures[1] || 'replace' - , name = captures[2] - , tok = this.tok('block', name); - - tok.mode = mode; - return tok; - } - }, - - /** - * Yield. - */ - - yield: function() { - return this.scan(/^yield */, 'yield'); - }, - - /** - * Include. - */ - - include: function() { - return this.scan(/^include +([^\n]+)/, 'include'); - }, - - /** - * Case. - */ - - "case": function() { - return this.scan(/^case +([^\n]+)/, 'case'); - }, - - /** - * When. - */ - - when: function() { - return this.scan(/^when +([^:\n]+)/, 'when'); - }, - - /** - * Default. - */ - - "default": function() { - return this.scan(/^default */, 'default'); - }, - - /** - * Assignment. - */ - - assignment: function() { - var captures; - if (captures = /^(\w+) += *([^;\n]+)( *;? *)/.exec(this.input)) { - this.consume(captures[0].length); - var name = captures[1] - , val = captures[2]; - return this.tok('code', 'var ' + name + ' = (' + val + ');'); - } - }, - - /** - * Call mixin. - */ - - call: function(){ - var captures; - if (captures = /^\+([-\w]+)/.exec(this.input)) { - this.consume(captures[0].length); - var tok = this.tok('call', captures[1]); - - // Check for args (not attributes) - if (captures = /^ *\((.*?)\)/.exec(this.input)) { - if (!/^ *[-\w]+ *=/.test(captures[1])) { - this.consume(captures[0].length); - tok.args = captures[1]; - } - } - - return tok; - } - }, - - /** - * Mixin. - */ - - mixin: function(){ - var captures; - if (captures = /^mixin +([-\w]+)(?: *\((.*)\))?/.exec(this.input)) { - this.consume(captures[0].length); - var tok = this.tok('mixin', captures[1]); - tok.args = captures[2]; - return tok; - } - }, - - /** - * Conditional. - */ - - conditional: function() { - var captures; - if (captures = /^(if|unless|else if|else)\b([^\n]*)/.exec(this.input)) { - this.consume(captures[0].length); - var type = captures[1] - , js = captures[2]; - - switch (type) { - case 'if': js = 'if (' + js + ')'; break; - case 'unless': js = 'if (!(' + js + '))'; break; - case 'else if': js = 'else if (' + js + ')'; break; - case 'else': js = 'else'; break; - } - - return this.tok('code', js); - } - }, - - /** - * While. - */ - - "while": function() { - var captures; - if (captures = /^while +([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - return this.tok('code', 'while (' + captures[1] + ')'); - } - }, - - /** - * Each. - */ - - each: function() { - var captures; - if (captures = /^(?:- *)?(?:each|for) +(\w+)(?: *, *(\w+))? * in *([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - var tok = this.tok('each', captures[1]); - tok.key = captures[2] || '$index'; - tok.code = captures[3]; - return tok; - } - }, - - /** - * Code. - */ - - code: function() { - var captures; - if (captures = /^(!?=|-)([^\n]+)/.exec(this.input)) { - this.consume(captures[0].length); - var flags = captures[1]; - captures[1] = captures[2]; - var tok = this.tok('code', captures[1]); - tok.escape = flags[0] === '='; - tok.buffer = flags[0] === '=' || flags[1] === '='; - return tok; - } - }, - - /** - * Attributes. - */ - - attrs: function() { - if ('(' == this.input.charAt(0)) { - var index = this.indexOfDelimiters('(', ')') - , str = this.input.substr(1, index-1) - , tok = this.tok('attrs') - , len = str.length - , colons = this.colons - , states = ['key'] - , escapedAttr - , key = '' - , val = '' - , quote - , c - , p; - - function state(){ - return states[states.length - 1]; - } - - function interpolate(attr) { - return attr.replace(/#\{([^}]+)\}/g, function(_, expr){ - return quote + " + (" + expr + ") + " + quote; - }); - } - - this.consume(index + 1); - tok.attrs = {}; - tok.escaped = {}; - - function parse(c) { - var real = c; - // TODO: remove when people fix ":" - if (colons && ':' == c) c = '='; - switch (c) { - case ',': - case '\n': - switch (state()) { - case 'expr': - case 'array': - case 'string': - case 'object': - val += c; - break; - default: - states.push('key'); - val = val.trim(); - key = key.trim(); - if ('' == key) return; - key = key.replace(/^['"]|['"]$/g, '').replace('!', ''); - tok.escaped[key] = escapedAttr; - tok.attrs[key] = '' == val - ? true - : interpolate(val); - key = val = ''; - } - break; - case '=': - switch (state()) { - case 'key char': - key += real; - break; - case 'val': - case 'expr': - case 'array': - case 'string': - case 'object': - val += real; - break; - default: - escapedAttr = '!' != p; - states.push('val'); - } - break; - case '(': - if ('val' == state() - || 'expr' == state()) states.push('expr'); - val += c; - break; - case ')': - if ('expr' == state() - || 'val' == state()) states.pop(); - val += c; - break; - case '{': - if ('val' == state()) states.push('object'); - val += c; - break; - case '}': - if ('object' == state()) states.pop(); - val += c; - break; - case '[': - if ('val' == state()) states.push('array'); - val += c; - break; - case ']': - if ('array' == state()) states.pop(); - val += c; - break; - case '"': - case "'": - switch (state()) { - case 'key': - states.push('key char'); - break; - case 'key char': - states.pop(); - break; - case 'string': - if (c == quote) states.pop(); - val += c; - break; - default: - states.push('string'); - val += c; - quote = c; - } - break; - case '': - break; - default: - switch (state()) { - case 'key': - case 'key char': - key += c; - break; - default: - val += c; - } - } - p = c; - } - - for (var i = 0; i < len; ++i) { - parse(str.charAt(i)); - } - - parse(','); - - if ('/' == this.input.charAt(0)) { - this.consume(1); - tok.selfClosing = true; - } - - return tok; - } - }, - - /** - * Indent | Outdent | Newline. - */ - - indent: function() { - var captures, re; - - // established regexp - if (this.indentRe) { - captures = this.indentRe.exec(this.input); - // determine regexp - } else { - // tabs - re = /^\n(\t*) */; - captures = re.exec(this.input); - - // spaces - if (captures && !captures[1].length) { - re = /^\n( *)/; - captures = re.exec(this.input); - } - - // established - if (captures && captures[1].length) this.indentRe = re; - } - - if (captures) { - var tok - , indents = captures[1].length; - - ++this.lineno; - this.consume(indents + 1); - - if (' ' == this.input[0] || '\t' == this.input[0]) { - throw new Error('Invalid indentation, you can use tabs or spaces but not both'); - } - - // blank line - if ('\n' == this.input[0]) return this.tok('newline'); - - // outdent - if (this.indentStack.length && indents < this.indentStack[0]) { - while (this.indentStack.length && this.indentStack[0] > indents) { - this.stash.push(this.tok('outdent')); - this.indentStack.shift(); - } - tok = this.stash.pop(); - // indent - } else if (indents && indents != this.indentStack[0]) { - this.indentStack.unshift(indents); - tok = this.tok('indent', indents); - // newline - } else { - tok = this.tok('newline'); - } - - return tok; - } - }, - - /** - * Pipe-less text consumed only when - * pipeless is true; - */ - - pipelessText: function() { - if (this.pipeless) { - if ('\n' == this.input[0]) return; - var i = this.input.indexOf('\n'); - if (-1 == i) i = this.input.length; - var str = this.input.substr(0, i); - this.consume(str.length); - return this.tok('text', str); - } - }, - - /** - * ':' - */ - - colon: function() { - return this.scan(/^: */, ':'); - }, - - /** - * Return the next token object, or those - * previously stashed by lookahead. - * - * @return {Object} - * @api private - */ - - advance: function(){ - return this.stashed() - || this.next(); - }, - - /** - * Return the next token object. - * - * @return {Object} - * @api private - */ - - next: function() { - return this.deferred() - || this.blank() - || this.eos() - || this.pipelessText() - || this.yield() - || this.doctype() - || this.interpolation() - || this["case"]() - || this.when() - || this["default"]() - || this["extends"]() - || this.append() - || this.prepend() - || this.block() - || this.include() - || this.mixin() - || this.call() - || this.conditional() - || this.each() - || this["while"]() - || this.assignment() - || this.tag() - || this.filter() - || this.code() - || this.id() - || this.className() - || this.attrs() - || this.indent() - || this.comment() - || this.colon() - || this.text(); - } -}; diff --git a/node_modules/jade/lib/nodes/attrs.js b/node_modules/jade/lib/nodes/attrs.js deleted file mode 100644 index 5de9b59..0000000 --- a/node_modules/jade/lib/nodes/attrs.js +++ /dev/null @@ -1,77 +0,0 @@ - -/*! - * Jade - nodes - Attrs - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'), - Block = require('./block'); - -/** - * Initialize a `Attrs` node. - * - * @api public - */ - -var Attrs = module.exports = function Attrs() { - this.attrs = []; -}; - -/** - * Inherit from `Node`. - */ - -Attrs.prototype.__proto__ = Node.prototype; - -/** - * Set attribute `name` to `val`, keep in mind these become - * part of a raw js object literal, so to quote a value you must - * '"quote me"', otherwise or example 'user.name' is literal JavaScript. - * - * @param {String} name - * @param {String} val - * @param {Boolean} escaped - * @return {Tag} for chaining - * @api public - */ - -Attrs.prototype.setAttribute = function(name, val, escaped){ - this.attrs.push({ name: name, val: val, escaped: escaped }); - return this; -}; - -/** - * Remove attribute `name` when present. - * - * @param {String} name - * @api public - */ - -Attrs.prototype.removeAttribute = function(name){ - for (var i = 0, len = this.attrs.length; i < len; ++i) { - if (this.attrs[i] && this.attrs[i].name == name) { - delete this.attrs[i]; - } - } -}; - -/** - * Get attribute value by `name`. - * - * @param {String} name - * @return {String} - * @api public - */ - -Attrs.prototype.getAttribute = function(name){ - for (var i = 0, len = this.attrs.length; i < len; ++i) { - if (this.attrs[i] && this.attrs[i].name == name) { - return this.attrs[i].val; - } - } -}; diff --git a/node_modules/jade/lib/nodes/block-comment.js b/node_modules/jade/lib/nodes/block-comment.js deleted file mode 100644 index 4f41e4a..0000000 --- a/node_modules/jade/lib/nodes/block-comment.js +++ /dev/null @@ -1,33 +0,0 @@ - -/*! - * Jade - nodes - BlockComment - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `BlockComment` with the given `block`. - * - * @param {String} val - * @param {Block} block - * @param {Boolean} buffer - * @api public - */ - -var BlockComment = module.exports = function BlockComment(val, block, buffer) { - this.block = block; - this.val = val; - this.buffer = buffer; -}; - -/** - * Inherit from `Node`. - */ - -BlockComment.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/block.js b/node_modules/jade/lib/nodes/block.js deleted file mode 100644 index bb00a1d..0000000 --- a/node_modules/jade/lib/nodes/block.js +++ /dev/null @@ -1,121 +0,0 @@ - -/*! - * Jade - nodes - Block - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a new `Block` with an optional `node`. - * - * @param {Node} node - * @api public - */ - -var Block = module.exports = function Block(node){ - this.nodes = []; - if (node) this.push(node); -}; - -/** - * Inherit from `Node`. - */ - -Block.prototype.__proto__ = Node.prototype; - -/** - * Block flag. - */ - -Block.prototype.isBlock = true; - -/** - * Replace the nodes in `other` with the nodes - * in `this` block. - * - * @param {Block} other - * @api private - */ - -Block.prototype.replace = function(other){ - other.nodes = this.nodes; -}; - -/** - * Pust the given `node`. - * - * @param {Node} node - * @return {Number} - * @api public - */ - -Block.prototype.push = function(node){ - return this.nodes.push(node); -}; - -/** - * Check if this block is empty. - * - * @return {Boolean} - * @api public - */ - -Block.prototype.isEmpty = function(){ - return 0 == this.nodes.length; -}; - -/** - * Unshift the given `node`. - * - * @param {Node} node - * @return {Number} - * @api public - */ - -Block.prototype.unshift = function(node){ - return this.nodes.unshift(node); -}; - -/** - * Return the "last" block, or the first `yield` node. - * - * @return {Block} - * @api private - */ - -Block.prototype.includeBlock = function(){ - var ret = this - , node; - - for (var i = 0, len = this.nodes.length; i < len; ++i) { - node = this.nodes[i]; - if (node.yield) return node; - else if (node.textOnly) continue; - else if (node.includeBlock) ret = node.includeBlock(); - else if (node.block && !node.block.isEmpty()) ret = node.block.includeBlock(); - } - - return ret; -}; - -/** - * Return a clone of this block. - * - * @return {Block} - * @api private - */ - -Block.prototype.clone = function(){ - var clone = new Block; - for (var i = 0, len = this.nodes.length; i < len; ++i) { - clone.push(this.nodes[i].clone()); - } - return clone; -}; - diff --git a/node_modules/jade/lib/nodes/case.js b/node_modules/jade/lib/nodes/case.js deleted file mode 100644 index 08ff033..0000000 --- a/node_modules/jade/lib/nodes/case.js +++ /dev/null @@ -1,43 +0,0 @@ - -/*! - * Jade - nodes - Case - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a new `Case` with `expr`. - * - * @param {String} expr - * @api public - */ - -var Case = exports = module.exports = function Case(expr, block){ - this.expr = expr; - this.block = block; -}; - -/** - * Inherit from `Node`. - */ - -Case.prototype.__proto__ = Node.prototype; - -var When = exports.When = function When(expr, block){ - this.expr = expr; - this.block = block; - this.debug = false; -}; - -/** - * Inherit from `Node`. - */ - -When.prototype.__proto__ = Node.prototype; - diff --git a/node_modules/jade/lib/nodes/code.js b/node_modules/jade/lib/nodes/code.js deleted file mode 100644 index babc675..0000000 --- a/node_modules/jade/lib/nodes/code.js +++ /dev/null @@ -1,35 +0,0 @@ - -/*! - * Jade - nodes - Code - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Code` node with the given code `val`. - * Code may also be optionally buffered and escaped. - * - * @param {String} val - * @param {Boolean} buffer - * @param {Boolean} escape - * @api public - */ - -var Code = module.exports = function Code(val, buffer, escape) { - this.val = val; - this.buffer = buffer; - this.escape = escape; - if (val.match(/^ *else/)) this.debug = false; -}; - -/** - * Inherit from `Node`. - */ - -Code.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/comment.js b/node_modules/jade/lib/nodes/comment.js deleted file mode 100644 index 2e1469e..0000000 --- a/node_modules/jade/lib/nodes/comment.js +++ /dev/null @@ -1,32 +0,0 @@ - -/*! - * Jade - nodes - Comment - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Comment` with the given `val`, optionally `buffer`, - * otherwise the comment may render in the output. - * - * @param {String} val - * @param {Boolean} buffer - * @api public - */ - -var Comment = module.exports = function Comment(val, buffer) { - this.val = val; - this.buffer = buffer; -}; - -/** - * Inherit from `Node`. - */ - -Comment.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/doctype.js b/node_modules/jade/lib/nodes/doctype.js deleted file mode 100644 index b8f33e5..0000000 --- a/node_modules/jade/lib/nodes/doctype.js +++ /dev/null @@ -1,29 +0,0 @@ - -/*! - * Jade - nodes - Doctype - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Doctype` with the given `val`. - * - * @param {String} val - * @api public - */ - -var Doctype = module.exports = function Doctype(val) { - this.val = val; -}; - -/** - * Inherit from `Node`. - */ - -Doctype.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/each.js b/node_modules/jade/lib/nodes/each.js deleted file mode 100644 index f54101f..0000000 --- a/node_modules/jade/lib/nodes/each.js +++ /dev/null @@ -1,35 +0,0 @@ - -/*! - * Jade - nodes - Each - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize an `Each` node, representing iteration - * - * @param {String} obj - * @param {String} val - * @param {String} key - * @param {Block} block - * @api public - */ - -var Each = module.exports = function Each(obj, val, key, block) { - this.obj = obj; - this.val = val; - this.key = key; - this.block = block; -}; - -/** - * Inherit from `Node`. - */ - -Each.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/filter.js b/node_modules/jade/lib/nodes/filter.js deleted file mode 100644 index 851a004..0000000 --- a/node_modules/jade/lib/nodes/filter.js +++ /dev/null @@ -1,35 +0,0 @@ - -/*! - * Jade - nodes - Filter - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node') - , Block = require('./block'); - -/** - * Initialize a `Filter` node with the given - * filter `name` and `block`. - * - * @param {String} name - * @param {Block|Node} block - * @api public - */ - -var Filter = module.exports = function Filter(name, block, attrs) { - this.name = name; - this.block = block; - this.attrs = attrs; - this.isASTFilter = !block.nodes.every(function(node){ return node.isText }); -}; - -/** - * Inherit from `Node`. - */ - -Filter.prototype.__proto__ = Node.prototype; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/index.js b/node_modules/jade/lib/nodes/index.js deleted file mode 100644 index 386ad2f..0000000 --- a/node_modules/jade/lib/nodes/index.js +++ /dev/null @@ -1,20 +0,0 @@ - -/*! - * Jade - nodes - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -exports.Node = require('./node'); -exports.Tag = require('./tag'); -exports.Code = require('./code'); -exports.Each = require('./each'); -exports.Case = require('./case'); -exports.Text = require('./text'); -exports.Block = require('./block'); -exports.Mixin = require('./mixin'); -exports.Filter = require('./filter'); -exports.Comment = require('./comment'); -exports.Literal = require('./literal'); -exports.BlockComment = require('./block-comment'); -exports.Doctype = require('./doctype'); diff --git a/node_modules/jade/lib/nodes/literal.js b/node_modules/jade/lib/nodes/literal.js deleted file mode 100644 index fde586b..0000000 --- a/node_modules/jade/lib/nodes/literal.js +++ /dev/null @@ -1,32 +0,0 @@ - -/*! - * Jade - nodes - Literal - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Literal` node with the given `str. - * - * @param {String} str - * @api public - */ - -var Literal = module.exports = function Literal(str) { - this.str = str - .replace(/\\/g, "\\\\") - .replace(/\n|\r\n/g, "\\n") - .replace(/'/g, "\\'"); -}; - -/** - * Inherit from `Node`. - */ - -Literal.prototype.__proto__ = Node.prototype; diff --git a/node_modules/jade/lib/nodes/mixin.js b/node_modules/jade/lib/nodes/mixin.js deleted file mode 100644 index 8407bc7..0000000 --- a/node_modules/jade/lib/nodes/mixin.js +++ /dev/null @@ -1,36 +0,0 @@ - -/*! - * Jade - nodes - Mixin - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Attrs = require('./attrs'); - -/** - * Initialize a new `Mixin` with `name` and `block`. - * - * @param {String} name - * @param {String} args - * @param {Block} block - * @api public - */ - -var Mixin = module.exports = function Mixin(name, args, block, call){ - this.name = name; - this.args = args; - this.block = block; - this.attrs = []; - this.call = call; -}; - -/** - * Inherit from `Attrs`. - */ - -Mixin.prototype.__proto__ = Attrs.prototype; - diff --git a/node_modules/jade/lib/nodes/node.js b/node_modules/jade/lib/nodes/node.js deleted file mode 100644 index e98f042..0000000 --- a/node_modules/jade/lib/nodes/node.js +++ /dev/null @@ -1,25 +0,0 @@ - -/*! - * Jade - nodes - Node - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Initialize a `Node`. - * - * @api public - */ - -var Node = module.exports = function Node(){}; - -/** - * Clone this node (return itself) - * - * @return {Node} - * @api private - */ - -Node.prototype.clone = function(){ - return this; -}; diff --git a/node_modules/jade/lib/nodes/tag.js b/node_modules/jade/lib/nodes/tag.js deleted file mode 100644 index 4b6728a..0000000 --- a/node_modules/jade/lib/nodes/tag.js +++ /dev/null @@ -1,95 +0,0 @@ - -/*! - * Jade - nodes - Tag - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Attrs = require('./attrs'), - Block = require('./block'), - inlineTags = require('../inline-tags'); - -/** - * Initialize a `Tag` node with the given tag `name` and optional `block`. - * - * @param {String} name - * @param {Block} block - * @api public - */ - -var Tag = module.exports = function Tag(name, block) { - this.name = name; - this.attrs = []; - this.block = block || new Block; -}; - -/** - * Inherit from `Attrs`. - */ - -Tag.prototype.__proto__ = Attrs.prototype; - -/** - * Clone this tag. - * - * @return {Tag} - * @api private - */ - -Tag.prototype.clone = function(){ - var clone = new Tag(this.name, this.block.clone()); - clone.line = this.line; - clone.attrs = this.attrs; - clone.textOnly = this.textOnly; - return clone; -}; - -/** - * Check if this tag is an inline tag. - * - * @return {Boolean} - * @api private - */ - -Tag.prototype.isInline = function(){ - return ~inlineTags.indexOf(this.name); -}; - -/** - * Check if this tag's contents can be inlined. Used for pretty printing. - * - * @return {Boolean} - * @api private - */ - -Tag.prototype.canInline = function(){ - var nodes = this.block.nodes; - - function isInline(node){ - // Recurse if the node is a block - if (node.isBlock) return node.nodes.every(isInline); - return node.isText || (node.isInline && node.isInline()); - } - - // Empty tag - if (!nodes.length) return true; - - // Text-only or inline-only tag - if (1 == nodes.length) return isInline(nodes[0]); - - // Multi-line inline-only tag - if (this.block.nodes.every(isInline)) { - for (var i = 1, len = nodes.length; i < len; ++i) { - if (nodes[i-1].isText && nodes[i].isText) - return false; - } - return true; - } - - // Mixed tag - return false; -}; \ No newline at end of file diff --git a/node_modules/jade/lib/nodes/text.js b/node_modules/jade/lib/nodes/text.js deleted file mode 100644 index 3b5dd55..0000000 --- a/node_modules/jade/lib/nodes/text.js +++ /dev/null @@ -1,36 +0,0 @@ - -/*! - * Jade - nodes - Text - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Node = require('./node'); - -/** - * Initialize a `Text` node with optional `line`. - * - * @param {String} line - * @api public - */ - -var Text = module.exports = function Text(line) { - this.val = ''; - if ('string' == typeof line) this.val = line; -}; - -/** - * Inherit from `Node`. - */ - -Text.prototype.__proto__ = Node.prototype; - -/** - * Flag as text. - */ - -Text.prototype.isText = true; \ No newline at end of file diff --git a/node_modules/jade/lib/parser.js b/node_modules/jade/lib/parser.js deleted file mode 100644 index 92f2af0..0000000 --- a/node_modules/jade/lib/parser.js +++ /dev/null @@ -1,710 +0,0 @@ - -/*! - * Jade - Parser - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var Lexer = require('./lexer') - , nodes = require('./nodes'); - -/** - * Initialize `Parser` with the given input `str` and `filename`. - * - * @param {String} str - * @param {String} filename - * @param {Object} options - * @api public - */ - -var Parser = exports = module.exports = function Parser(str, filename, options){ - this.input = str; - this.lexer = new Lexer(str, options); - this.filename = filename; - this.blocks = {}; - this.mixins = {}; - this.options = options; - this.contexts = [this]; -}; - -/** - * Tags that may not contain tags. - */ - -var textOnly = exports.textOnly = ['script', 'style']; - -/** - * Parser prototype. - */ - -Parser.prototype = { - - /** - * Push `parser` onto the context stack, - * or pop and return a `Parser`. - */ - - context: function(parser){ - if (parser) { - this.contexts.push(parser); - } else { - return this.contexts.pop(); - } - }, - - /** - * Return the next token object. - * - * @return {Object} - * @api private - */ - - advance: function(){ - return this.lexer.advance(); - }, - - /** - * Skip `n` tokens. - * - * @param {Number} n - * @api private - */ - - skip: function(n){ - while (n--) this.advance(); - }, - - /** - * Single token lookahead. - * - * @return {Object} - * @api private - */ - - peek: function() { - return this.lookahead(1); - }, - - /** - * Return lexer lineno. - * - * @return {Number} - * @api private - */ - - line: function() { - return this.lexer.lineno; - }, - - /** - * `n` token lookahead. - * - * @param {Number} n - * @return {Object} - * @api private - */ - - lookahead: function(n){ - return this.lexer.lookahead(n); - }, - - /** - * Parse input returning a string of js for evaluation. - * - * @return {String} - * @api public - */ - - parse: function(){ - var block = new nodes.Block, parser; - block.line = this.line(); - - while ('eos' != this.peek().type) { - if ('newline' == this.peek().type) { - this.advance(); - } else { - block.push(this.parseExpr()); - } - } - - if (parser = this.extending) { - this.context(parser); - var ast = parser.parse(); - this.context(); - // hoist mixins - for (var name in this.mixins) - ast.unshift(this.mixins[name]); - return ast; - } - - return block; - }, - - /** - * Expect the given type, or throw an exception. - * - * @param {String} type - * @api private - */ - - expect: function(type){ - if (this.peek().type === type) { - return this.advance(); - } else { - throw new Error('expected "' + type + '", but got "' + this.peek().type + '"'); - } - }, - - /** - * Accept the given `type`. - * - * @param {String} type - * @api private - */ - - accept: function(type){ - if (this.peek().type === type) { - return this.advance(); - } - }, - - /** - * tag - * | doctype - * | mixin - * | include - * | filter - * | comment - * | text - * | each - * | code - * | yield - * | id - * | class - * | interpolation - */ - - parseExpr: function(){ - switch (this.peek().type) { - case 'tag': - return this.parseTag(); - case 'mixin': - return this.parseMixin(); - case 'block': - return this.parseBlock(); - case 'case': - return this.parseCase(); - case 'when': - return this.parseWhen(); - case 'default': - return this.parseDefault(); - case 'extends': - return this.parseExtends(); - case 'include': - return this.parseInclude(); - case 'doctype': - return this.parseDoctype(); - case 'filter': - return this.parseFilter(); - case 'comment': - return this.parseComment(); - case 'text': - return this.parseText(); - case 'each': - return this.parseEach(); - case 'code': - return this.parseCode(); - case 'call': - return this.parseCall(); - case 'interpolation': - return this.parseInterpolation(); - case 'yield': - this.advance(); - var block = new nodes.Block; - block.yield = true; - return block; - case 'id': - case 'class': - var tok = this.advance(); - this.lexer.defer(this.lexer.tok('tag', 'div')); - this.lexer.defer(tok); - return this.parseExpr(); - default: - throw new Error('unexpected token "' + this.peek().type + '"'); - } - }, - - /** - * Text - */ - - parseText: function(){ - var tok = this.expect('text') - , node = new nodes.Text(tok.val); - node.line = this.line(); - return node; - }, - - /** - * ':' expr - * | block - */ - - parseBlockExpansion: function(){ - if (':' == this.peek().type) { - this.advance(); - return new nodes.Block(this.parseExpr()); - } else { - return this.block(); - } - }, - - /** - * case - */ - - parseCase: function(){ - var val = this.expect('case').val - , node = new nodes.Case(val); - node.line = this.line(); - node.block = this.block(); - return node; - }, - - /** - * when - */ - - parseWhen: function(){ - var val = this.expect('when').val - return new nodes.Case.When(val, this.parseBlockExpansion()); - }, - - /** - * default - */ - - parseDefault: function(){ - this.expect('default'); - return new nodes.Case.When('default', this.parseBlockExpansion()); - }, - - /** - * code - */ - - parseCode: function(){ - var tok = this.expect('code') - , node = new nodes.Code(tok.val, tok.buffer, tok.escape) - , block - , i = 1; - node.line = this.line(); - while (this.lookahead(i) && 'newline' == this.lookahead(i).type) ++i; - block = 'indent' == this.lookahead(i).type; - if (block) { - this.skip(i-1); - node.block = this.block(); - } - return node; - }, - - /** - * comment - */ - - parseComment: function(){ - var tok = this.expect('comment') - , node; - - if ('indent' == this.peek().type) { - node = new nodes.BlockComment(tok.val, this.block(), tok.buffer); - } else { - node = new nodes.Comment(tok.val, tok.buffer); - } - - node.line = this.line(); - return node; - }, - - /** - * doctype - */ - - parseDoctype: function(){ - var tok = this.expect('doctype') - , node = new nodes.Doctype(tok.val); - node.line = this.line(); - return node; - }, - - /** - * filter attrs? text-block - */ - - parseFilter: function(){ - var block - , tok = this.expect('filter') - , attrs = this.accept('attrs'); - - this.lexer.pipeless = true; - block = this.parseTextBlock(); - this.lexer.pipeless = false; - - var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs); - node.line = this.line(); - return node; - }, - - /** - * tag ':' attrs? block - */ - - parseASTFilter: function(){ - var block - , tok = this.expect('tag') - , attrs = this.accept('attrs'); - - this.expect(':'); - block = this.block(); - - var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs); - node.line = this.line(); - return node; - }, - - /** - * each block - */ - - parseEach: function(){ - var tok = this.expect('each') - , node = new nodes.Each(tok.code, tok.val, tok.key); - node.line = this.line(); - node.block = this.block(); - return node; - }, - - /** - * 'extends' name - */ - - parseExtends: function(){ - var path = require('path') - , fs = require('fs') - , dirname = path.dirname - , basename = path.basename - , join = path.join; - - if (!this.filename) - throw new Error('the "filename" option is required to extend templates'); - - var path = this.expect('extends').val.trim() - , dir = dirname(this.filename); - - var path = join(dir, path + '.jade') - , str = fs.readFileSync(path, 'utf8') - , parser = new Parser(str, path, this.options); - - parser.blocks = this.blocks; - parser.contexts = this.contexts; - this.extending = parser; - - // TODO: null node - return new nodes.Literal(''); - }, - - /** - * 'block' name block - */ - - parseBlock: function(){ - var block = this.expect('block') - , mode = block.mode - , name = block.val.trim(); - - block = 'indent' == this.peek().type - ? this.block() - : new nodes.Block(new nodes.Literal('')); - - var prev = this.blocks[name]; - - if (prev) { - switch (prev.mode) { - case 'append': - block.nodes = block.nodes.concat(prev.nodes); - prev = block; - break; - case 'prepend': - block.nodes = prev.nodes.concat(block.nodes); - prev = block; - break; - } - } - - block.mode = mode; - return this.blocks[name] = prev || block; - }, - - /** - * include block? - */ - - parseInclude: function(){ - var path = require('path') - , fs = require('fs') - , dirname = path.dirname - , basename = path.basename - , join = path.join; - - var path = this.expect('include').val.trim() - , dir = dirname(this.filename); - - if (!this.filename) - throw new Error('the "filename" option is required to use includes'); - - // no extension - if (!~basename(path).indexOf('.')) { - path += '.jade'; - } - - // non-jade - if ('.jade' != path.substr(-5)) { - var path = join(dir, path) - , str = fs.readFileSync(path, 'utf8'); - return new nodes.Literal(str); - } - - var path = join(dir, path) - , str = fs.readFileSync(path, 'utf8') - , parser = new Parser(str, path, this.options); - parser.blocks = this.blocks; - parser.mixins = this.mixins; - - this.context(parser); - var ast = parser.parse(); - this.context(); - ast.filename = path; - - if ('indent' == this.peek().type) { - ast.includeBlock().push(this.block()); - } - - return ast; - }, - - /** - * call ident block - */ - - parseCall: function(){ - var tok = this.expect('call') - , name = tok.val - , args = tok.args - , mixin = new nodes.Mixin(name, args, new nodes.Block, true); - - this.tag(mixin); - if (mixin.block.isEmpty()) mixin.block = null; - return mixin; - }, - - /** - * mixin block - */ - - parseMixin: function(){ - var tok = this.expect('mixin') - , name = tok.val - , args = tok.args - , mixin; - - // definition - if ('indent' == this.peek().type) { - mixin = new nodes.Mixin(name, args, this.block(), false); - this.mixins[name] = mixin; - return mixin; - // call - } else { - return new nodes.Mixin(name, args, null, true); - } - }, - - /** - * indent (text | newline)* outdent - */ - - parseTextBlock: function(){ - var block = new nodes.Block; - block.line = this.line(); - var spaces = this.expect('indent').val; - if (null == this._spaces) this._spaces = spaces; - var indent = Array(spaces - this._spaces + 1).join(' '); - while ('outdent' != this.peek().type) { - switch (this.peek().type) { - case 'newline': - this.advance(); - break; - case 'indent': - this.parseTextBlock().nodes.forEach(function(node){ - block.push(node); - }); - break; - default: - var text = new nodes.Text(indent + this.advance().val); - text.line = this.line(); - block.push(text); - } - } - - if (spaces == this._spaces) this._spaces = null; - this.expect('outdent'); - return block; - }, - - /** - * indent expr* outdent - */ - - block: function(){ - var block = new nodes.Block; - block.line = this.line(); - this.expect('indent'); - while ('outdent' != this.peek().type) { - if ('newline' == this.peek().type) { - this.advance(); - } else { - block.push(this.parseExpr()); - } - } - this.expect('outdent'); - return block; - }, - - /** - * interpolation (attrs | class | id)* (text | code | ':')? newline* block? - */ - - parseInterpolation: function(){ - var tok = this.advance(); - var tag = new nodes.Tag(tok.val); - tag.buffer = true; - return this.tag(tag); - }, - - /** - * tag (attrs | class | id)* (text | code | ':')? newline* block? - */ - - parseTag: function(){ - // ast-filter look-ahead - var i = 2; - if ('attrs' == this.lookahead(i).type) ++i; - if (':' == this.lookahead(i).type) { - if ('indent' == this.lookahead(++i).type) { - return this.parseASTFilter(); - } - } - - var tok = this.advance() - , tag = new nodes.Tag(tok.val); - - tag.selfClosing = tok.selfClosing; - - return this.tag(tag); - }, - - /** - * Parse tag. - */ - - tag: function(tag){ - var dot; - - tag.line = this.line(); - - // (attrs | class | id)* - out: - while (true) { - switch (this.peek().type) { - case 'id': - case 'class': - var tok = this.advance(); - tag.setAttribute(tok.type, "'" + tok.val + "'"); - continue; - case 'attrs': - var tok = this.advance() - , obj = tok.attrs - , escaped = tok.escaped - , names = Object.keys(obj); - - if (tok.selfClosing) tag.selfClosing = true; - - for (var i = 0, len = names.length; i < len; ++i) { - var name = names[i] - , val = obj[name]; - tag.setAttribute(name, val, escaped[name]); - } - continue; - default: - break out; - } - } - - // check immediate '.' - if ('.' == this.peek().val) { - dot = tag.textOnly = true; - this.advance(); - } - - // (text | code | ':')? - switch (this.peek().type) { - case 'text': - tag.block.push(this.parseText()); - break; - case 'code': - tag.code = this.parseCode(); - break; - case ':': - this.advance(); - tag.block = new nodes.Block; - tag.block.push(this.parseExpr()); - break; - } - - // newline* - while ('newline' == this.peek().type) this.advance(); - - tag.textOnly = tag.textOnly || ~textOnly.indexOf(tag.name); - - // script special-case - if ('script' == tag.name) { - var type = tag.getAttribute('type'); - if (!dot && type && 'text/javascript' != type.replace(/^['"]|['"]$/g, '')) { - tag.textOnly = false; - } - } - - // block? - if ('indent' == this.peek().type) { - if (tag.textOnly) { - this.lexer.pipeless = true; - tag.block = this.parseTextBlock(); - this.lexer.pipeless = false; - } else { - var block = this.block(); - if (tag.block) { - for (var i = 0, len = block.nodes.length; i < len; ++i) { - tag.block.push(block.nodes[i]); - } - } else { - tag.block = block; - } - } - } - - return tag; - } -}; diff --git a/node_modules/jade/lib/runtime.js b/node_modules/jade/lib/runtime.js deleted file mode 100644 index fb711f5..0000000 --- a/node_modules/jade/lib/runtime.js +++ /dev/null @@ -1,174 +0,0 @@ - -/*! - * Jade - runtime - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Lame Array.isArray() polyfill for now. - */ - -if (!Array.isArray) { - Array.isArray = function(arr){ - return '[object Array]' == Object.prototype.toString.call(arr); - }; -} - -/** - * Lame Object.keys() polyfill for now. - */ - -if (!Object.keys) { - Object.keys = function(obj){ - var arr = []; - for (var key in obj) { - if (obj.hasOwnProperty(key)) { - arr.push(key); - } - } - return arr; - } -} - -/** - * Merge two attribute objects giving precedence - * to values in object `b`. Classes are special-cased - * allowing for arrays and merging/joining appropriately - * resulting in a string. - * - * @param {Object} a - * @param {Object} b - * @return {Object} a - * @api private - */ - -exports.merge = function merge(a, b) { - var ac = a['class']; - var bc = b['class']; - - if (ac || bc) { - ac = ac || []; - bc = bc || []; - if (!Array.isArray(ac)) ac = [ac]; - if (!Array.isArray(bc)) bc = [bc]; - ac = ac.filter(nulls); - bc = bc.filter(nulls); - a['class'] = ac.concat(bc).join(' '); - } - - for (var key in b) { - if (key != 'class') { - a[key] = b[key]; - } - } - - return a; -}; - -/** - * Filter null `val`s. - * - * @param {Mixed} val - * @return {Mixed} - * @api private - */ - -function nulls(val) { - return val != null; -} - -/** - * Render the given attributes object. - * - * @param {Object} obj - * @param {Object} escaped - * @return {String} - * @api private - */ - -exports.attrs = function attrs(obj, escaped){ - var buf = [] - , terse = obj.terse; - - delete obj.terse; - var keys = Object.keys(obj) - , len = keys.length; - - if (len) { - buf.push(''); - for (var i = 0; i < len; ++i) { - var key = keys[i] - , val = obj[key]; - - if ('boolean' == typeof val || null == val) { - if (val) { - terse - ? buf.push(key) - : buf.push(key + '="' + key + '"'); - } - } else if (0 == key.indexOf('data') && 'string' != typeof val) { - buf.push(key + "='" + JSON.stringify(val) + "'"); - } else if ('class' == key && Array.isArray(val)) { - buf.push(key + '="' + exports.escape(val.join(' ')) + '"'); - } else if (escaped && escaped[key]) { - buf.push(key + '="' + exports.escape(val) + '"'); - } else { - buf.push(key + '="' + val + '"'); - } - } - } - - return buf.join(' '); -}; - -/** - * Escape the given string of `html`. - * - * @param {String} html - * @return {String} - * @api private - */ - -exports.escape = function escape(html){ - return String(html) - .replace(/&(?!(\w+|\#\d+);)/g, '&') - .replace(//g, '>') - .replace(/"/g, '"'); -}; - -/** - * Re-throw the given `err` in context to the - * the jade in `filename` at the given `lineno`. - * - * @param {Error} err - * @param {String} filename - * @param {String} lineno - * @api private - */ - -exports.rethrow = function rethrow(err, filename, lineno){ - if (!filename) throw err; - - var context = 3 - , str = require('fs').readFileSync(filename, 'utf8') - , lines = str.split('\n') - , start = Math.max(lineno - context, 0) - , end = Math.min(lines.length, lineno + context); - - // Error context - var context = lines.slice(start, end).map(function(line, i){ - var curr = i + start + 1; - return (curr == lineno ? ' > ' : ' ') - + curr - + '| ' - + line; - }).join('\n'); - - // Alter exception message - err.path = filename; - err.message = (filename || 'Jade') + ':' + lineno - + '\n' + context + '\n\n' + err.message; - throw err; -}; diff --git a/node_modules/jade/lib/self-closing.js b/node_modules/jade/lib/self-closing.js deleted file mode 100644 index 0548771..0000000 --- a/node_modules/jade/lib/self-closing.js +++ /dev/null @@ -1,19 +0,0 @@ - -/*! - * Jade - self closing tags - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -module.exports = [ - 'meta' - , 'img' - , 'link' - , 'input' - , 'source' - , 'area' - , 'base' - , 'col' - , 'br' - , 'hr' -]; \ No newline at end of file diff --git a/node_modules/jade/lib/utils.js b/node_modules/jade/lib/utils.js deleted file mode 100644 index ff46d02..0000000 --- a/node_modules/jade/lib/utils.js +++ /dev/null @@ -1,49 +0,0 @@ - -/*! - * Jade - utils - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Convert interpolation in the given string to JavaScript. - * - * @param {String} str - * @return {String} - * @api private - */ - -var interpolate = exports.interpolate = function(str){ - return str.replace(/(\\)?([#!]){(.*?)}/g, function(str, escape, flag, code){ - return escape - ? str - : "' + " - + ('!' == flag ? '' : 'escape') - + "((interp = " + code.replace(/\\'/g, "'") - + ") == null ? '' : interp) + '"; - }); -}; - -/** - * Escape single quotes in `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -var escape = exports.escape = function(str) { - return str.replace(/'/g, "\\'"); -}; - -/** - * Interpolate, and escape the given `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -exports.text = function(str){ - return interpolate(escape(str)); -}; \ No newline at end of file diff --git a/node_modules/jade/node_modules/commander/.npmignore b/node_modules/jade/node_modules/commander/.npmignore deleted file mode 100644 index f1250e5..0000000 --- a/node_modules/jade/node_modules/commander/.npmignore +++ /dev/null @@ -1,4 +0,0 @@ -support -test -examples -*.sock diff --git a/node_modules/jade/node_modules/commander/.travis.yml b/node_modules/jade/node_modules/commander/.travis.yml deleted file mode 100644 index f1d0f13..0000000 --- a/node_modules/jade/node_modules/commander/.travis.yml +++ /dev/null @@ -1,4 +0,0 @@ -language: node_js -node_js: - - 0.4 - - 0.6 diff --git a/node_modules/jade/node_modules/commander/History.md b/node_modules/jade/node_modules/commander/History.md deleted file mode 100644 index 4961d2e..0000000 --- a/node_modules/jade/node_modules/commander/History.md +++ /dev/null @@ -1,107 +0,0 @@ - -0.6.1 / 2012-06-01 -================== - - * Added: append (yes or no) on confirmation - * Added: allow node.js v0.7.x - -0.6.0 / 2012-04-10 -================== - - * Added `.prompt(obj, callback)` support. Closes #49 - * Added default support to .choose(). Closes #41 - * Fixed the choice example - -0.5.1 / 2011-12-20 -================== - - * Fixed `password()` for recent nodes. Closes #36 - -0.5.0 / 2011-12-04 -================== - - * Added sub-command option support [itay] - -0.4.3 / 2011-12-04 -================== - - * Fixed custom help ordering. Closes #32 - -0.4.2 / 2011-11-24 -================== - - * Added travis support - * Fixed: line-buffered input automatically trimmed. Closes #31 - -0.4.1 / 2011-11-18 -================== - - * Removed listening for "close" on --help - -0.4.0 / 2011-11-15 -================== - - * Added support for `--`. Closes #24 - -0.3.3 / 2011-11-14 -================== - - * Fixed: wait for close event when writing help info [Jerry Hamlet] - -0.3.2 / 2011-11-01 -================== - - * Fixed long flag definitions with values [felixge] - -0.3.1 / 2011-10-31 -================== - - * Changed `--version` short flag to `-V` from `-v` - * Changed `.version()` so it's configurable [felixge] - -0.3.0 / 2011-10-31 -================== - - * Added support for long flags only. Closes #18 - -0.2.1 / 2011-10-24 -================== - - * "node": ">= 0.4.x < 0.7.0". Closes #20 - -0.2.0 / 2011-09-26 -================== - - * Allow for defaults that are not just boolean. Default peassignment only occurs for --no-*, optional, and required arguments. [Jim Isaacs] - -0.1.0 / 2011-08-24 -================== - - * Added support for custom `--help` output - -0.0.5 / 2011-08-18 -================== - - * Changed: when the user enters nothing prompt for password again - * Fixed issue with passwords beginning with numbers [NuckChorris] - -0.0.4 / 2011-08-15 -================== - - * Fixed `Commander#args` - -0.0.3 / 2011-08-15 -================== - - * Added default option value support - -0.0.2 / 2011-08-15 -================== - - * Added mask support to `Command#password(str[, mask], fn)` - * Added `Command#password(str, fn)` - -0.0.1 / 2010-01-03 -================== - - * Initial release diff --git a/node_modules/jade/node_modules/commander/Makefile b/node_modules/jade/node_modules/commander/Makefile deleted file mode 100644 index 0074625..0000000 --- a/node_modules/jade/node_modules/commander/Makefile +++ /dev/null @@ -1,7 +0,0 @@ - -TESTS = $(shell find test/test.*.js) - -test: - @./test/run $(TESTS) - -.PHONY: test \ No newline at end of file diff --git a/node_modules/jade/node_modules/commander/Readme.md b/node_modules/jade/node_modules/commander/Readme.md deleted file mode 100644 index b8328c3..0000000 --- a/node_modules/jade/node_modules/commander/Readme.md +++ /dev/null @@ -1,262 +0,0 @@ -# Commander.js - - The complete solution for [node.js](http://nodejs.org) command-line interfaces, inspired by Ruby's [commander](https://github.com/visionmedia/commander). - - [![Build Status](https://secure.travis-ci.org/visionmedia/commander.js.png)](http://travis-ci.org/visionmedia/commander.js) - -## Installation - - $ npm install commander - -## Option parsing - - Options with commander are defined with the `.option()` method, also serving as documentation for the options. The example below parses args and options from `process.argv`, leaving remaining args as the `program.args` array which were not consumed by options. - -```js -#!/usr/bin/env node - -/** - * Module dependencies. - */ - -var program = require('commander'); - -program - .version('0.0.1') - .option('-p, --peppers', 'Add peppers') - .option('-P, --pineapple', 'Add pineapple') - .option('-b, --bbq', 'Add bbq sauce') - .option('-c, --cheese [type]', 'Add the specified type of cheese [marble]', 'marble') - .parse(process.argv); - -console.log('you ordered a pizza with:'); -if (program.peppers) console.log(' - peppers'); -if (program.pineapple) console.log(' - pineappe'); -if (program.bbq) console.log(' - bbq'); -console.log(' - %s cheese', program.cheese); -``` - - Short flags may be passed as a single arg, for example `-abc` is equivalent to `-a -b -c`. Multi-word options such as "--template-engine" are camel-cased, becoming `program.templateEngine` etc. - -## Automated --help - - The help information is auto-generated based on the information commander already knows about your program, so the following `--help` info is for free: - -``` - $ ./examples/pizza --help - - Usage: pizza [options] - - Options: - - -V, --version output the version number - -p, --peppers Add peppers - -P, --pineapple Add pineappe - -b, --bbq Add bbq sauce - -c, --cheese Add the specified type of cheese [marble] - -h, --help output usage information - -``` - -## Coercion - -```js -function range(val) { - return val.split('..').map(Number); -} - -function list(val) { - return val.split(','); -} - -program - .version('0.0.1') - .usage('[options] ') - .option('-i, --integer ', 'An integer argument', parseInt) - .option('-f, --float ', 'A float argument', parseFloat) - .option('-r, --range ..', 'A range', range) - .option('-l, --list ', 'A list', list) - .option('-o, --optional [value]', 'An optional value') - .parse(process.argv); - -console.log(' int: %j', program.integer); -console.log(' float: %j', program.float); -console.log(' optional: %j', program.optional); -program.range = program.range || []; -console.log(' range: %j..%j', program.range[0], program.range[1]); -console.log(' list: %j', program.list); -console.log(' args: %j', program.args); -``` - -## Custom help - - You can display arbitrary `-h, --help` information - by listening for "--help". Commander will automatically - exit once you are done so that the remainder of your program - does not execute causing undesired behaviours, for example - in the following executable "stuff" will not output when - `--help` is used. - -```js -#!/usr/bin/env node - -/** - * Module dependencies. - */ - -var program = require('../'); - -function list(val) { - return val.split(',').map(Number); -} - -program - .version('0.0.1') - .option('-f, --foo', 'enable some foo') - .option('-b, --bar', 'enable some bar') - .option('-B, --baz', 'enable some baz'); - -// must be before .parse() since -// node's emit() is immediate - -program.on('--help', function(){ - console.log(' Examples:'); - console.log(''); - console.log(' $ custom-help --help'); - console.log(' $ custom-help -h'); - console.log(''); -}); - -program.parse(process.argv); - -console.log('stuff'); -``` - -yielding the following help output: - -``` - -Usage: custom-help [options] - -Options: - - -h, --help output usage information - -V, --version output the version number - -f, --foo enable some foo - -b, --bar enable some bar - -B, --baz enable some baz - -Examples: - - $ custom-help --help - $ custom-help -h - -``` - -## .prompt(msg, fn) - - Single-line prompt: - -```js -program.prompt('name: ', function(name){ - console.log('hi %s', name); -}); -``` - - Multi-line prompt: - -```js -program.prompt('description:', function(name){ - console.log('hi %s', name); -}); -``` - - Coercion: - -```js -program.prompt('Age: ', Number, function(age){ - console.log('age: %j', age); -}); -``` - -```js -program.prompt('Birthdate: ', Date, function(date){ - console.log('date: %s', date); -}); -``` - -## .password(msg[, mask], fn) - -Prompt for password without echoing: - -```js -program.password('Password: ', function(pass){ - console.log('got "%s"', pass); - process.stdin.destroy(); -}); -``` - -Prompt for password with mask char "*": - -```js -program.password('Password: ', '*', function(pass){ - console.log('got "%s"', pass); - process.stdin.destroy(); -}); -``` - -## .confirm(msg, fn) - - Confirm with the given `msg`: - -```js -program.confirm('continue? ', function(ok){ - console.log(' got %j', ok); -}); -``` - -## .choose(list, fn) - - Let the user choose from a `list`: - -```js -var list = ['tobi', 'loki', 'jane', 'manny', 'luna']; - -console.log('Choose the coolest pet:'); -program.choose(list, function(i){ - console.log('you chose %d "%s"', i, list[i]); -}); -``` - -## Links - - - [API documentation](http://visionmedia.github.com/commander.js/) - - [ascii tables](https://github.com/LearnBoost/cli-table) - - [progress bars](https://github.com/visionmedia/node-progress) - - [more progress bars](https://github.com/substack/node-multimeter) - - [examples](https://github.com/visionmedia/commander.js/tree/master/examples) - -## License - -(The MIT License) - -Copyright (c) 2011 TJ Holowaychuk <tj@vision-media.ca> - -Permission is hereby granted, free of charge, to any person obtaining -a copy of this software and associated documentation files (the -'Software'), to deal in the Software without restriction, including -without limitation the rights to use, copy, modify, merge, publish, -distribute, sublicense, and/or sell copies of the Software, and to -permit persons to whom the Software is furnished to do so, subject to -the following conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY -CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, -TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE -SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/jade/node_modules/commander/index.js b/node_modules/jade/node_modules/commander/index.js deleted file mode 100644 index 06ec1e4..0000000 --- a/node_modules/jade/node_modules/commander/index.js +++ /dev/null @@ -1,2 +0,0 @@ - -module.exports = require('./lib/commander'); \ No newline at end of file diff --git a/node_modules/jade/node_modules/commander/lib/commander.js b/node_modules/jade/node_modules/commander/lib/commander.js deleted file mode 100644 index 5ba87eb..0000000 --- a/node_modules/jade/node_modules/commander/lib/commander.js +++ /dev/null @@ -1,1026 +0,0 @@ - -/*! - * commander - * Copyright(c) 2011 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var EventEmitter = require('events').EventEmitter - , path = require('path') - , tty = require('tty') - , basename = path.basename; - -/** - * Expose the root command. - */ - -exports = module.exports = new Command; - -/** - * Expose `Command`. - */ - -exports.Command = Command; - -/** - * Expose `Option`. - */ - -exports.Option = Option; - -/** - * Initialize a new `Option` with the given `flags` and `description`. - * - * @param {String} flags - * @param {String} description - * @api public - */ - -function Option(flags, description) { - this.flags = flags; - this.required = ~flags.indexOf('<'); - this.optional = ~flags.indexOf('['); - this.bool = !~flags.indexOf('-no-'); - flags = flags.split(/[ ,|]+/); - if (flags.length > 1 && !/^[[<]/.test(flags[1])) this.short = flags.shift(); - this.long = flags.shift(); - this.description = description; -} - -/** - * Return option name. - * - * @return {String} - * @api private - */ - -Option.prototype.name = function(){ - return this.long - .replace('--', '') - .replace('no-', ''); -}; - -/** - * Check if `arg` matches the short or long flag. - * - * @param {String} arg - * @return {Boolean} - * @api private - */ - -Option.prototype.is = function(arg){ - return arg == this.short - || arg == this.long; -}; - -/** - * Initialize a new `Command`. - * - * @param {String} name - * @api public - */ - -function Command(name) { - this.commands = []; - this.options = []; - this.args = []; - this.name = name; -} - -/** - * Inherit from `EventEmitter.prototype`. - */ - -Command.prototype.__proto__ = EventEmitter.prototype; - -/** - * Add command `name`. - * - * The `.action()` callback is invoked when the - * command `name` is specified via __ARGV__, - * and the remaining arguments are applied to the - * function for access. - * - * When the `name` is "*" an un-matched command - * will be passed as the first arg, followed by - * the rest of __ARGV__ remaining. - * - * Examples: - * - * program - * .version('0.0.1') - * .option('-C, --chdir ', 'change the working directory') - * .option('-c, --config ', 'set config path. defaults to ./deploy.conf') - * .option('-T, --no-tests', 'ignore test hook') - * - * program - * .command('setup') - * .description('run remote setup commands') - * .action(function(){ - * console.log('setup'); - * }); - * - * program - * .command('exec ') - * .description('run the given remote command') - * .action(function(cmd){ - * console.log('exec "%s"', cmd); - * }); - * - * program - * .command('*') - * .description('deploy the given env') - * .action(function(env){ - * console.log('deploying "%s"', env); - * }); - * - * program.parse(process.argv); - * - * @param {String} name - * @return {Command} the new command - * @api public - */ - -Command.prototype.command = function(name){ - var args = name.split(/ +/); - var cmd = new Command(args.shift()); - this.commands.push(cmd); - cmd.parseExpectedArgs(args); - cmd.parent = this; - return cmd; -}; - -/** - * Parse expected `args`. - * - * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`. - * - * @param {Array} args - * @return {Command} for chaining - * @api public - */ - -Command.prototype.parseExpectedArgs = function(args){ - if (!args.length) return; - var self = this; - args.forEach(function(arg){ - switch (arg[0]) { - case '<': - self.args.push({ required: true, name: arg.slice(1, -1) }); - break; - case '[': - self.args.push({ required: false, name: arg.slice(1, -1) }); - break; - } - }); - return this; -}; - -/** - * Register callback `fn` for the command. - * - * Examples: - * - * program - * .command('help') - * .description('display verbose help') - * .action(function(){ - * // output help here - * }); - * - * @param {Function} fn - * @return {Command} for chaining - * @api public - */ - -Command.prototype.action = function(fn){ - var self = this; - this.parent.on(this.name, function(args, unknown){ - // Parse any so-far unknown options - unknown = unknown || []; - var parsed = self.parseOptions(unknown); - - // Output help if necessary - outputHelpIfNecessary(self, parsed.unknown); - - // If there are still any unknown options, then we simply - // die, unless someone asked for help, in which case we give it - // to them, and then we die. - if (parsed.unknown.length > 0) { - self.unknownOption(parsed.unknown[0]); - } - - self.args.forEach(function(arg, i){ - if (arg.required && null == args[i]) { - self.missingArgument(arg.name); - } - }); - - // Always append ourselves to the end of the arguments, - // to make sure we match the number of arguments the user - // expects - if (self.args.length) { - args[self.args.length] = self; - } else { - args.push(self); - } - - fn.apply(this, args); - }); - return this; -}; - -/** - * Define option with `flags`, `description` and optional - * coercion `fn`. - * - * The `flags` string should contain both the short and long flags, - * separated by comma, a pipe or space. The following are all valid - * all will output this way when `--help` is used. - * - * "-p, --pepper" - * "-p|--pepper" - * "-p --pepper" - * - * Examples: - * - * // simple boolean defaulting to false - * program.option('-p, --pepper', 'add pepper'); - * - * --pepper - * program.pepper - * // => Boolean - * - * // simple boolean defaulting to false - * program.option('-C, --no-cheese', 'remove cheese'); - * - * program.cheese - * // => true - * - * --no-cheese - * program.cheese - * // => true - * - * // required argument - * program.option('-C, --chdir ', 'change the working directory'); - * - * --chdir /tmp - * program.chdir - * // => "/tmp" - * - * // optional argument - * program.option('-c, --cheese [type]', 'add cheese [marble]'); - * - * @param {String} flags - * @param {String} description - * @param {Function|Mixed} fn or default - * @param {Mixed} defaultValue - * @return {Command} for chaining - * @api public - */ - -Command.prototype.option = function(flags, description, fn, defaultValue){ - var self = this - , option = new Option(flags, description) - , oname = option.name() - , name = camelcase(oname); - - // default as 3rd arg - if ('function' != typeof fn) defaultValue = fn, fn = null; - - // preassign default value only for --no-*, [optional], or - if (false == option.bool || option.optional || option.required) { - // when --no-* we make sure default is true - if (false == option.bool) defaultValue = true; - // preassign only if we have a default - if (undefined !== defaultValue) self[name] = defaultValue; - } - - // register the option - this.options.push(option); - - // when it's passed assign the value - // and conditionally invoke the callback - this.on(oname, function(val){ - // coercion - if (null != val && fn) val = fn(val); - - // unassigned or bool - if ('boolean' == typeof self[name] || 'undefined' == typeof self[name]) { - // if no value, bool true, and we have a default, then use it! - if (null == val) { - self[name] = option.bool - ? defaultValue || true - : false; - } else { - self[name] = val; - } - } else if (null !== val) { - // reassign - self[name] = val; - } - }); - - return this; -}; - -/** - * Parse `argv`, settings options and invoking commands when defined. - * - * @param {Array} argv - * @return {Command} for chaining - * @api public - */ - -Command.prototype.parse = function(argv){ - // store raw args - this.rawArgs = argv; - - // guess name - if (!this.name) this.name = basename(argv[1]); - - // process argv - var parsed = this.parseOptions(this.normalize(argv.slice(2))); - this.args = parsed.args; - return this.parseArgs(this.args, parsed.unknown); -}; - -/** - * Normalize `args`, splitting joined short flags. For example - * the arg "-abc" is equivalent to "-a -b -c". - * - * @param {Array} args - * @return {Array} - * @api private - */ - -Command.prototype.normalize = function(args){ - var ret = [] - , arg; - - for (var i = 0, len = args.length; i < len; ++i) { - arg = args[i]; - if (arg.length > 1 && '-' == arg[0] && '-' != arg[1]) { - arg.slice(1).split('').forEach(function(c){ - ret.push('-' + c); - }); - } else { - ret.push(arg); - } - } - - return ret; -}; - -/** - * Parse command `args`. - * - * When listener(s) are available those - * callbacks are invoked, otherwise the "*" - * event is emitted and those actions are invoked. - * - * @param {Array} args - * @return {Command} for chaining - * @api private - */ - -Command.prototype.parseArgs = function(args, unknown){ - var cmds = this.commands - , len = cmds.length - , name; - - if (args.length) { - name = args[0]; - if (this.listeners(name).length) { - this.emit(args.shift(), args, unknown); - } else { - this.emit('*', args); - } - } else { - outputHelpIfNecessary(this, unknown); - - // If there were no args and we have unknown options, - // then they are extraneous and we need to error. - if (unknown.length > 0) { - this.unknownOption(unknown[0]); - } - } - - return this; -}; - -/** - * Return an option matching `arg` if any. - * - * @param {String} arg - * @return {Option} - * @api private - */ - -Command.prototype.optionFor = function(arg){ - for (var i = 0, len = this.options.length; i < len; ++i) { - if (this.options[i].is(arg)) { - return this.options[i]; - } - } -}; - -/** - * Parse options from `argv` returning `argv` - * void of these options. - * - * @param {Array} argv - * @return {Array} - * @api public - */ - -Command.prototype.parseOptions = function(argv){ - var args = [] - , len = argv.length - , literal - , option - , arg; - - var unknownOptions = []; - - // parse options - for (var i = 0; i < len; ++i) { - arg = argv[i]; - - // literal args after -- - if ('--' == arg) { - literal = true; - continue; - } - - if (literal) { - args.push(arg); - continue; - } - - // find matching Option - option = this.optionFor(arg); - - // option is defined - if (option) { - // requires arg - if (option.required) { - arg = argv[++i]; - if (null == arg) return this.optionMissingArgument(option); - if ('-' == arg[0]) return this.optionMissingArgument(option, arg); - this.emit(option.name(), arg); - // optional arg - } else if (option.optional) { - arg = argv[i+1]; - if (null == arg || '-' == arg[0]) { - arg = null; - } else { - ++i; - } - this.emit(option.name(), arg); - // bool - } else { - this.emit(option.name()); - } - continue; - } - - // looks like an option - if (arg.length > 1 && '-' == arg[0]) { - unknownOptions.push(arg); - - // If the next argument looks like it might be - // an argument for this option, we pass it on. - // If it isn't, then it'll simply be ignored - if (argv[i+1] && '-' != argv[i+1][0]) { - unknownOptions.push(argv[++i]); - } - continue; - } - - // arg - args.push(arg); - } - - return { args: args, unknown: unknownOptions }; -}; - -/** - * Argument `name` is missing. - * - * @param {String} name - * @api private - */ - -Command.prototype.missingArgument = function(name){ - console.error(); - console.error(" error: missing required argument `%s'", name); - console.error(); - process.exit(1); -}; - -/** - * `Option` is missing an argument, but received `flag` or nothing. - * - * @param {String} option - * @param {String} flag - * @api private - */ - -Command.prototype.optionMissingArgument = function(option, flag){ - console.error(); - if (flag) { - console.error(" error: option `%s' argument missing, got `%s'", option.flags, flag); - } else { - console.error(" error: option `%s' argument missing", option.flags); - } - console.error(); - process.exit(1); -}; - -/** - * Unknown option `flag`. - * - * @param {String} flag - * @api private - */ - -Command.prototype.unknownOption = function(flag){ - console.error(); - console.error(" error: unknown option `%s'", flag); - console.error(); - process.exit(1); -}; - -/** - * Set the program version to `str`. - * - * This method auto-registers the "-V, --version" flag - * which will print the version number when passed. - * - * @param {String} str - * @param {String} flags - * @return {Command} for chaining - * @api public - */ - -Command.prototype.version = function(str, flags){ - if (0 == arguments.length) return this._version; - this._version = str; - flags = flags || '-V, --version'; - this.option(flags, 'output the version number'); - this.on('version', function(){ - console.log(str); - process.exit(0); - }); - return this; -}; - -/** - * Set the description `str`. - * - * @param {String} str - * @return {String|Command} - * @api public - */ - -Command.prototype.description = function(str){ - if (0 == arguments.length) return this._description; - this._description = str; - return this; -}; - -/** - * Set / get the command usage `str`. - * - * @param {String} str - * @return {String|Command} - * @api public - */ - -Command.prototype.usage = function(str){ - var args = this.args.map(function(arg){ - return arg.required - ? '<' + arg.name + '>' - : '[' + arg.name + ']'; - }); - - var usage = '[options' - + (this.commands.length ? '] [command' : '') - + ']' - + (this.args.length ? ' ' + args : ''); - if (0 == arguments.length) return this._usage || usage; - this._usage = str; - - return this; -}; - -/** - * Return the largest option length. - * - * @return {Number} - * @api private - */ - -Command.prototype.largestOptionLength = function(){ - return this.options.reduce(function(max, option){ - return Math.max(max, option.flags.length); - }, 0); -}; - -/** - * Return help for options. - * - * @return {String} - * @api private - */ - -Command.prototype.optionHelp = function(){ - var width = this.largestOptionLength(); - - // Prepend the help information - return [pad('-h, --help', width) + ' ' + 'output usage information'] - .concat(this.options.map(function(option){ - return pad(option.flags, width) - + ' ' + option.description; - })) - .join('\n'); -}; - -/** - * Return command help documentation. - * - * @return {String} - * @api private - */ - -Command.prototype.commandHelp = function(){ - if (!this.commands.length) return ''; - return [ - '' - , ' Commands:' - , '' - , this.commands.map(function(cmd){ - var args = cmd.args.map(function(arg){ - return arg.required - ? '<' + arg.name + '>' - : '[' + arg.name + ']'; - }).join(' '); - - return cmd.name - + (cmd.options.length - ? ' [options]' - : '') + ' ' + args - + (cmd.description() - ? '\n' + cmd.description() - : ''); - }).join('\n\n').replace(/^/gm, ' ') - , '' - ].join('\n'); -}; - -/** - * Return program help documentation. - * - * @return {String} - * @api private - */ - -Command.prototype.helpInformation = function(){ - return [ - '' - , ' Usage: ' + this.name + ' ' + this.usage() - , '' + this.commandHelp() - , ' Options:' - , '' - , '' + this.optionHelp().replace(/^/gm, ' ') - , '' - , '' - ].join('\n'); -}; - -/** - * Prompt for a `Number`. - * - * @param {String} str - * @param {Function} fn - * @api private - */ - -Command.prototype.promptForNumber = function(str, fn){ - var self = this; - this.promptSingleLine(str, function parseNumber(val){ - val = Number(val); - if (isNaN(val)) return self.promptSingleLine(str + '(must be a number) ', parseNumber); - fn(val); - }); -}; - -/** - * Prompt for a `Date`. - * - * @param {String} str - * @param {Function} fn - * @api private - */ - -Command.prototype.promptForDate = function(str, fn){ - var self = this; - this.promptSingleLine(str, function parseDate(val){ - val = new Date(val); - if (isNaN(val.getTime())) return self.promptSingleLine(str + '(must be a date) ', parseDate); - fn(val); - }); -}; - -/** - * Single-line prompt. - * - * @param {String} str - * @param {Function} fn - * @api private - */ - -Command.prototype.promptSingleLine = function(str, fn){ - if ('function' == typeof arguments[2]) { - return this['promptFor' + (fn.name || fn)](str, arguments[2]); - } - - process.stdout.write(str); - process.stdin.setEncoding('utf8'); - process.stdin.once('data', function(val){ - fn(val.trim()); - }).resume(); -}; - -/** - * Multi-line prompt. - * - * @param {String} str - * @param {Function} fn - * @api private - */ - -Command.prototype.promptMultiLine = function(str, fn){ - var buf = []; - console.log(str); - process.stdin.setEncoding('utf8'); - process.stdin.on('data', function(val){ - if ('\n' == val || '\r\n' == val) { - process.stdin.removeAllListeners('data'); - fn(buf.join('\n')); - } else { - buf.push(val.trimRight()); - } - }).resume(); -}; - -/** - * Prompt `str` and callback `fn(val)` - * - * Commander supports single-line and multi-line prompts. - * To issue a single-line prompt simply add white-space - * to the end of `str`, something like "name: ", whereas - * for a multi-line prompt omit this "description:". - * - * - * Examples: - * - * program.prompt('Username: ', function(name){ - * console.log('hi %s', name); - * }); - * - * program.prompt('Description:', function(desc){ - * console.log('description was "%s"', desc.trim()); - * }); - * - * @param {String|Object} str - * @param {Function} fn - * @api public - */ - -Command.prototype.prompt = function(str, fn){ - var self = this; - - if ('string' == typeof str) { - if (/ $/.test(str)) return this.promptSingleLine.apply(this, arguments); - this.promptMultiLine(str, fn); - } else { - var keys = Object.keys(str) - , obj = {}; - - function next() { - var key = keys.shift() - , label = str[key]; - - if (!key) return fn(obj); - self.prompt(label, function(val){ - obj[key] = val; - next(); - }); - } - - next(); - } -}; - -/** - * Prompt for password with `str`, `mask` char and callback `fn(val)`. - * - * The mask string defaults to '', aka no output is - * written while typing, you may want to use "*" etc. - * - * Examples: - * - * program.password('Password: ', function(pass){ - * console.log('got "%s"', pass); - * process.stdin.destroy(); - * }); - * - * program.password('Password: ', '*', function(pass){ - * console.log('got "%s"', pass); - * process.stdin.destroy(); - * }); - * - * @param {String} str - * @param {String} mask - * @param {Function} fn - * @api public - */ - -Command.prototype.password = function(str, mask, fn){ - var self = this - , buf = ''; - - // default mask - if ('function' == typeof mask) { - fn = mask; - mask = ''; - } - - process.stdin.resume(); - tty.setRawMode(true); - process.stdout.write(str); - - // keypress - process.stdin.on('keypress', function(c, key){ - if (key && 'enter' == key.name) { - console.log(); - process.stdin.removeAllListeners('keypress'); - tty.setRawMode(false); - if (!buf.trim().length) return self.password(str, mask, fn); - fn(buf); - return; - } - - if (key && key.ctrl && 'c' == key.name) { - console.log('%s', buf); - process.exit(); - } - - process.stdout.write(mask); - buf += c; - }).resume(); -}; - -/** - * Confirmation prompt with `str` and callback `fn(bool)` - * - * Examples: - * - * program.confirm('continue? ', function(ok){ - * console.log(' got %j', ok); - * process.stdin.destroy(); - * }); - * - * @param {String} str - * @param {Function} fn - * @api public - */ - - -Command.prototype.confirm = function(str, fn, verbose){ - var self = this; - this.prompt(str, function(ok){ - if (!ok.trim()) { - if (!verbose) str += '(yes or no) '; - return self.confirm(str, fn, true); - } - fn(parseBool(ok)); - }); -}; - -/** - * Choice prompt with `list` of items and callback `fn(index, item)` - * - * Examples: - * - * var list = ['tobi', 'loki', 'jane', 'manny', 'luna']; - * - * console.log('Choose the coolest pet:'); - * program.choose(list, function(i){ - * console.log('you chose %d "%s"', i, list[i]); - * process.stdin.destroy(); - * }); - * - * @param {Array} list - * @param {Number|Function} index or fn - * @param {Function} fn - * @api public - */ - -Command.prototype.choose = function(list, index, fn){ - var self = this - , hasDefault = 'number' == typeof index; - - if (!hasDefault) { - fn = index; - index = null; - } - - list.forEach(function(item, i){ - if (hasDefault && i == index) { - console.log('* %d) %s', i + 1, item); - } else { - console.log(' %d) %s', i + 1, item); - } - }); - - function again() { - self.prompt(' : ', function(val){ - val = parseInt(val, 10) - 1; - if (hasDefault && isNaN(val)) val = index; - - if (null == list[val]) { - again(); - } else { - fn(val, list[val]); - } - }); - } - - again(); -}; - -/** - * Camel-case the given `flag` - * - * @param {String} flag - * @return {String} - * @api private - */ - -function camelcase(flag) { - return flag.split('-').reduce(function(str, word){ - return str + word[0].toUpperCase() + word.slice(1); - }); -} - -/** - * Parse a boolean `str`. - * - * @param {String} str - * @return {Boolean} - * @api private - */ - -function parseBool(str) { - return /^y|yes|ok|true$/i.test(str); -} - -/** - * Pad `str` to `width`. - * - * @param {String} str - * @param {Number} width - * @return {String} - * @api private - */ - -function pad(str, width) { - var len = Math.max(0, width - str.length); - return str + Array(len + 1).join(' '); -} - -/** - * Output help information if necessary - * - * @param {Command} command to output help for - * @param {Array} array of options to search for -h or --help - * @api private - */ - -function outputHelpIfNecessary(cmd, options) { - options = options || []; - for (var i = 0; i < options.length; i++) { - if (options[i] == '--help' || options[i] == '-h') { - process.stdout.write(cmd.helpInformation()); - cmd.emit('--help'); - process.exit(0); - } - } -} diff --git a/node_modules/jade/node_modules/commander/package.json b/node_modules/jade/node_modules/commander/package.json deleted file mode 100644 index 7161a8b..0000000 --- a/node_modules/jade/node_modules/commander/package.json +++ /dev/null @@ -1,13 +0,0 @@ -{ - "name": "commander" - , "version": "0.6.1" - , "description": "the complete solution for node.js command-line programs" - , "keywords": ["command", "option", "parser", "prompt", "stdin"] - , "author": "TJ Holowaychuk " - , "repository": { "type": "git", "url": "https://github.com/visionmedia/commander.js.git" } - , "dependencies": {} - , "devDependencies": { "should": ">= 0.0.1" } - , "scripts": { "test": "make test" } - , "main": "index" - , "engines": { "node": ">= 0.4.x" } -} \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/.gitignore b/node_modules/jade/node_modules/mkdirp/.gitignore deleted file mode 100644 index 9303c34..0000000 --- a/node_modules/jade/node_modules/mkdirp/.gitignore +++ /dev/null @@ -1,2 +0,0 @@ -node_modules/ -npm-debug.log \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/.gitignore.orig b/node_modules/jade/node_modules/mkdirp/.gitignore.orig deleted file mode 100644 index 9303c34..0000000 --- a/node_modules/jade/node_modules/mkdirp/.gitignore.orig +++ /dev/null @@ -1,2 +0,0 @@ -node_modules/ -npm-debug.log \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/.gitignore.rej b/node_modules/jade/node_modules/mkdirp/.gitignore.rej deleted file mode 100644 index 69244ff..0000000 --- a/node_modules/jade/node_modules/mkdirp/.gitignore.rej +++ /dev/null @@ -1,5 +0,0 @@ ---- /dev/null -+++ .gitignore -@@ -0,0 +1,2 @@ -+node_modules/ -+npm-debug.log \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/LICENSE b/node_modules/jade/node_modules/mkdirp/LICENSE deleted file mode 100644 index 432d1ae..0000000 --- a/node_modules/jade/node_modules/mkdirp/LICENSE +++ /dev/null @@ -1,21 +0,0 @@ -Copyright 2010 James Halliday (mail@substack.net) - -This project is free software released under the MIT/X11 license: - -Permission is hereby granted, free of charge, to any person obtaining a copy -of this software and associated documentation files (the "Software"), to deal -in the Software without restriction, including without limitation the rights -to use, copy, modify, merge, publish, distribute, sublicense, and/or sell -copies of the Software, and to permit persons to whom the Software is -furnished to do so, subject to the following conditions: - -The above copyright notice and this permission notice shall be included in -all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR -IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, -FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE -AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, -OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN -THE SOFTWARE. diff --git a/node_modules/jade/node_modules/mkdirp/README.markdown b/node_modules/jade/node_modules/mkdirp/README.markdown deleted file mode 100644 index b4dd75f..0000000 --- a/node_modules/jade/node_modules/mkdirp/README.markdown +++ /dev/null @@ -1,54 +0,0 @@ -mkdirp -====== - -Like `mkdir -p`, but in node.js! - -example -======= - -pow.js ------- - var mkdirp = require('mkdirp'); - - mkdirp('/tmp/foo/bar/baz', function (err) { - if (err) console.error(err) - else console.log('pow!') - }); - -Output - pow! - -And now /tmp/foo/bar/baz exists, huzzah! - -methods -======= - -var mkdirp = require('mkdirp'); - -mkdirp(dir, mode, cb) ---------------------- - -Create a new directory and any necessary subdirectories at `dir` with octal -permission string `mode`. - -If `mode` isn't specified, it defaults to `0777 & (~process.umask())`. - -mkdirp.sync(dir, mode) ----------------------- - -Synchronously create a new directory and any necessary subdirectories at `dir` -with octal permission string `mode`. - -If `mode` isn't specified, it defaults to `0777 & (~process.umask())`. - -install -======= - -With [npm](http://npmjs.org) do: - - npm install mkdirp - -license -======= - -MIT/X11 diff --git a/node_modules/jade/node_modules/mkdirp/examples/pow.js b/node_modules/jade/node_modules/mkdirp/examples/pow.js deleted file mode 100644 index e692421..0000000 --- a/node_modules/jade/node_modules/mkdirp/examples/pow.js +++ /dev/null @@ -1,6 +0,0 @@ -var mkdirp = require('mkdirp'); - -mkdirp('/tmp/foo/bar/baz', function (err) { - if (err) console.error(err) - else console.log('pow!') -}); diff --git a/node_modules/jade/node_modules/mkdirp/examples/pow.js.orig b/node_modules/jade/node_modules/mkdirp/examples/pow.js.orig deleted file mode 100644 index 7741462..0000000 --- a/node_modules/jade/node_modules/mkdirp/examples/pow.js.orig +++ /dev/null @@ -1,6 +0,0 @@ -var mkdirp = require('mkdirp'); - -mkdirp('/tmp/foo/bar/baz', 0755, function (err) { - if (err) console.error(err) - else console.log('pow!') -}); diff --git a/node_modules/jade/node_modules/mkdirp/examples/pow.js.rej b/node_modules/jade/node_modules/mkdirp/examples/pow.js.rej deleted file mode 100644 index 81e7f43..0000000 --- a/node_modules/jade/node_modules/mkdirp/examples/pow.js.rej +++ /dev/null @@ -1,19 +0,0 @@ ---- examples/pow.js -+++ examples/pow.js -@@ -1,6 +1,15 @@ --var mkdirp = require('mkdirp').mkdirp; -+var mkdirp = require('../').mkdirp, -+ mkdirpSync = require('../').mkdirpSync; - - mkdirp('/tmp/foo/bar/baz', 0755, function (err) { - if (err) console.error(err) - else console.log('pow!') - }); -+ -+try { -+ mkdirpSync('/tmp/bar/foo/baz', 0755); -+ console.log('double pow!'); -+} -+catch (ex) { -+ console.log(ex); -+} \ No newline at end of file diff --git a/node_modules/jade/node_modules/mkdirp/index.js b/node_modules/jade/node_modules/mkdirp/index.js deleted file mode 100644 index 25f43ad..0000000 --- a/node_modules/jade/node_modules/mkdirp/index.js +++ /dev/null @@ -1,79 +0,0 @@ -var path = require('path'); -var fs = require('fs'); - -module.exports = mkdirP.mkdirp = mkdirP.mkdirP = mkdirP; - -function mkdirP (p, mode, f) { - if (typeof mode === 'function' || mode === undefined) { - f = mode; - mode = 0777 & (~process.umask()); - } - - var cb = f || function () {}; - if (typeof mode === 'string') mode = parseInt(mode, 8); - p = path.resolve(p); - - fs.mkdir(p, mode, function (er) { - if (!er) return cb(); - switch (er.code) { - case 'ENOENT': - mkdirP(path.dirname(p), mode, function (er) { - if (er) cb(er); - else mkdirP(p, mode, cb); - }); - break; - - case 'EEXIST': - fs.stat(p, function (er2, stat) { - // if the stat fails, then that's super weird. - // let the original EEXIST be the failure reason. - if (er2 || !stat.isDirectory()) cb(er) - else cb(); - }); - break; - - default: - cb(er); - break; - } - }); -} - -mkdirP.sync = function sync (p, mode) { - if (mode === undefined) { - mode = 0777 & (~process.umask()); - } - - if (typeof mode === 'string') mode = parseInt(mode, 8); - p = path.resolve(p); - - try { - fs.mkdirSync(p, mode) - } - catch (err0) { - switch (err0.code) { - case 'ENOENT' : - var err1 = sync(path.dirname(p), mode) - if (err1) throw err1; - else return sync(p, mode); - break; - - case 'EEXIST' : - var stat; - try { - stat = fs.statSync(p); - } - catch (err1) { - throw err0 - } - if (!stat.isDirectory()) throw err0; - else return null; - break; - default : - throw err0 - break; - } - } - - return null; -}; diff --git a/node_modules/jade/node_modules/mkdirp/package.json b/node_modules/jade/node_modules/mkdirp/package.json deleted file mode 100644 index 1bf9ac7..0000000 --- a/node_modules/jade/node_modules/mkdirp/package.json +++ /dev/null @@ -1,23 +0,0 @@ -{ - "name" : "mkdirp", - "description" : "Recursively mkdir, like `mkdir -p`", - "version" : "0.3.0", - "author" : "James Halliday (http://substack.net)", - "main" : "./index", - "keywords" : [ - "mkdir", - "directory" - ], - "repository" : { - "type" : "git", - "url" : "http://github.com/substack/node-mkdirp.git" - }, - "scripts" : { - "test" : "tap test/*.js" - }, - "devDependencies" : { - "tap" : "0.0.x" - }, - "license" : "MIT/X11", - "engines": { "node": "*" } -} diff --git a/node_modules/jade/node_modules/mkdirp/test/chmod.js b/node_modules/jade/node_modules/mkdirp/test/chmod.js deleted file mode 100644 index 520dcb8..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/chmod.js +++ /dev/null @@ -1,38 +0,0 @@ -var mkdirp = require('../').mkdirp; -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -var ps = [ '', 'tmp' ]; - -for (var i = 0; i < 25; i++) { - var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - ps.push(dir); -} - -var file = ps.join('/'); - -test('chmod-pre', function (t) { - var mode = 0744 - mkdirp(file, mode, function (er) { - t.ifError(er, 'should not error'); - fs.stat(file, function (er, stat) { - t.ifError(er, 'should exist'); - t.ok(stat && stat.isDirectory(), 'should be directory'); - t.equal(stat && stat.mode & 0777, mode, 'should be 0744'); - t.end(); - }); - }); -}); - -test('chmod', function (t) { - var mode = 0755 - mkdirp(file, mode, function (er) { - t.ifError(er, 'should not error'); - fs.stat(file, function (er, stat) { - t.ifError(er, 'should exist'); - t.ok(stat && stat.isDirectory(), 'should be directory'); - t.end(); - }); - }); -}); diff --git a/node_modules/jade/node_modules/mkdirp/test/clobber.js b/node_modules/jade/node_modules/mkdirp/test/clobber.js deleted file mode 100644 index 0eb7099..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/clobber.js +++ /dev/null @@ -1,37 +0,0 @@ -var mkdirp = require('../').mkdirp; -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -var ps = [ '', 'tmp' ]; - -for (var i = 0; i < 25; i++) { - var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - ps.push(dir); -} - -var file = ps.join('/'); - -// a file in the way -var itw = ps.slice(0, 3).join('/'); - - -test('clobber-pre', function (t) { - console.error("about to write to "+itw) - fs.writeFileSync(itw, 'I AM IN THE WAY, THE TRUTH, AND THE LIGHT.'); - - fs.stat(itw, function (er, stat) { - t.ifError(er) - t.ok(stat && stat.isFile(), 'should be file') - t.end() - }) -}) - -test('clobber', function (t) { - t.plan(2); - mkdirp(file, 0755, function (err) { - t.ok(err); - t.equal(err.code, 'ENOTDIR'); - t.end(); - }); -}); diff --git a/node_modules/jade/node_modules/mkdirp/test/mkdirp.js b/node_modules/jade/node_modules/mkdirp/test/mkdirp.js deleted file mode 100644 index b07cd70..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/mkdirp.js +++ /dev/null @@ -1,28 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('woo', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - mkdirp(file, 0755, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) - }); -}); diff --git a/node_modules/jade/node_modules/mkdirp/test/perm.js b/node_modules/jade/node_modules/mkdirp/test/perm.js deleted file mode 100644 index 23a7abb..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/perm.js +++ /dev/null @@ -1,32 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('async perm', function (t) { - t.plan(2); - var file = '/tmp/' + (Math.random() * (1<<30)).toString(16); - - mkdirp(file, 0755, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) - }); -}); - -test('async root perm', function (t) { - mkdirp('/tmp', 0755, function (err) { - if (err) t.fail(err); - t.end(); - }); - t.end(); -}); diff --git a/node_modules/jade/node_modules/mkdirp/test/perm_sync.js b/node_modules/jade/node_modules/mkdirp/test/perm_sync.js deleted file mode 100644 index f685f60..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/perm_sync.js +++ /dev/null @@ -1,39 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('sync perm', function (t) { - t.plan(2); - var file = '/tmp/' + (Math.random() * (1<<30)).toString(16) + '.json'; - - mkdirp.sync(file, 0755); - path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }); -}); - -test('sync root perm', function (t) { - t.plan(1); - - var file = '/tmp'; - mkdirp.sync(file, 0755); - path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }); -}); diff --git a/node_modules/jade/node_modules/mkdirp/test/race.js b/node_modules/jade/node_modules/mkdirp/test/race.js deleted file mode 100644 index 96a0447..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/race.js +++ /dev/null @@ -1,41 +0,0 @@ -var mkdirp = require('../').mkdirp; -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('race', function (t) { - t.plan(4); - var ps = [ '', 'tmp' ]; - - for (var i = 0; i < 25; i++) { - var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - ps.push(dir); - } - var file = ps.join('/'); - - var res = 2; - mk(file, function () { - if (--res === 0) t.end(); - }); - - mk(file, function () { - if (--res === 0) t.end(); - }); - - function mk (file, cb) { - mkdirp(file, 0755, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - if (cb) cb(); - } - }) - }) - }); - } -}); diff --git a/node_modules/jade/node_modules/mkdirp/test/rel.js b/node_modules/jade/node_modules/mkdirp/test/rel.js deleted file mode 100644 index 7985824..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/rel.js +++ /dev/null @@ -1,32 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('rel', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var cwd = process.cwd(); - process.chdir('/tmp'); - - var file = [x,y,z].join('/'); - - mkdirp(file, 0755, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - process.chdir(cwd); - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) - }); -}); diff --git a/node_modules/jade/node_modules/mkdirp/test/sync.js b/node_modules/jade/node_modules/mkdirp/test/sync.js deleted file mode 100644 index e0e389d..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/sync.js +++ /dev/null @@ -1,27 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('sync', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - var err = mkdirp.sync(file, 0755); - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) -}); diff --git a/node_modules/jade/node_modules/mkdirp/test/umask.js b/node_modules/jade/node_modules/mkdirp/test/umask.js deleted file mode 100644 index 64ccafe..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/umask.js +++ /dev/null @@ -1,28 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('implicit mode from umask', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - mkdirp(file, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0777 & (~process.umask())); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) - }); -}); diff --git a/node_modules/jade/node_modules/mkdirp/test/umask_sync.js b/node_modules/jade/node_modules/mkdirp/test/umask_sync.js deleted file mode 100644 index 83cba56..0000000 --- a/node_modules/jade/node_modules/mkdirp/test/umask_sync.js +++ /dev/null @@ -1,27 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('umask sync modes', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - var err = mkdirp.sync(file); - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, (0777 & (~process.umask()))); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) -}); diff --git a/node_modules/jade/package.json b/node_modules/jade/package.json deleted file mode 100644 index e91d8ac..0000000 --- a/node_modules/jade/package.json +++ /dev/null @@ -1,29 +0,0 @@ -{ - "name": "jade", - "description": "Jade template engine", - "version": "0.26.3", - "author": "TJ Holowaychuk ", - "repository": "git://github.com/visionmedia/jade", - "main": "./index.js", - "bin": { "jade": "./bin/jade" }, - "man": "./jade.1", - "dependencies": { - "commander": "0.6.1", - "mkdirp": "0.3.0" - }, - "devDependencies": { - "mocha": "*", - "markdown": "*", - "stylus": "*", - "uubench": "*", - "should": "*", - "less": "*", - "uglify-js": "*" - }, - "component": { - "scripts": { - "jade": "runtime.js" - } - }, - "scripts" : { "prepublish" : "npm prune" } -} diff --git a/node_modules/jade/runtime.js b/node_modules/jade/runtime.js deleted file mode 100644 index 0f54907..0000000 --- a/node_modules/jade/runtime.js +++ /dev/null @@ -1,179 +0,0 @@ - -jade = (function(exports){ -/*! - * Jade - runtime - * Copyright(c) 2010 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Lame Array.isArray() polyfill for now. - */ - -if (!Array.isArray) { - Array.isArray = function(arr){ - return '[object Array]' == Object.prototype.toString.call(arr); - }; -} - -/** - * Lame Object.keys() polyfill for now. - */ - -if (!Object.keys) { - Object.keys = function(obj){ - var arr = []; - for (var key in obj) { - if (obj.hasOwnProperty(key)) { - arr.push(key); - } - } - return arr; - } -} - -/** - * Merge two attribute objects giving precedence - * to values in object `b`. Classes are special-cased - * allowing for arrays and merging/joining appropriately - * resulting in a string. - * - * @param {Object} a - * @param {Object} b - * @return {Object} a - * @api private - */ - -exports.merge = function merge(a, b) { - var ac = a['class']; - var bc = b['class']; - - if (ac || bc) { - ac = ac || []; - bc = bc || []; - if (!Array.isArray(ac)) ac = [ac]; - if (!Array.isArray(bc)) bc = [bc]; - ac = ac.filter(nulls); - bc = bc.filter(nulls); - a['class'] = ac.concat(bc).join(' '); - } - - for (var key in b) { - if (key != 'class') { - a[key] = b[key]; - } - } - - return a; -}; - -/** - * Filter null `val`s. - * - * @param {Mixed} val - * @return {Mixed} - * @api private - */ - -function nulls(val) { - return val != null; -} - -/** - * Render the given attributes object. - * - * @param {Object} obj - * @param {Object} escaped - * @return {String} - * @api private - */ - -exports.attrs = function attrs(obj, escaped){ - var buf = [] - , terse = obj.terse; - - delete obj.terse; - var keys = Object.keys(obj) - , len = keys.length; - - if (len) { - buf.push(''); - for (var i = 0; i < len; ++i) { - var key = keys[i] - , val = obj[key]; - - if ('boolean' == typeof val || null == val) { - if (val) { - terse - ? buf.push(key) - : buf.push(key + '="' + key + '"'); - } - } else if (0 == key.indexOf('data') && 'string' != typeof val) { - buf.push(key + "='" + JSON.stringify(val) + "'"); - } else if ('class' == key && Array.isArray(val)) { - buf.push(key + '="' + exports.escape(val.join(' ')) + '"'); - } else if (escaped && escaped[key]) { - buf.push(key + '="' + exports.escape(val) + '"'); - } else { - buf.push(key + '="' + val + '"'); - } - } - } - - return buf.join(' '); -}; - -/** - * Escape the given string of `html`. - * - * @param {String} html - * @return {String} - * @api private - */ - -exports.escape = function escape(html){ - return String(html) - .replace(/&(?!(\w+|\#\d+);)/g, '&') - .replace(//g, '>') - .replace(/"/g, '"'); -}; - -/** - * Re-throw the given `err` in context to the - * the jade in `filename` at the given `lineno`. - * - * @param {Error} err - * @param {String} filename - * @param {String} lineno - * @api private - */ - -exports.rethrow = function rethrow(err, filename, lineno){ - if (!filename) throw err; - - var context = 3 - , str = require('fs').readFileSync(filename, 'utf8') - , lines = str.split('\n') - , start = Math.max(lineno - context, 0) - , end = Math.min(lines.length, lineno + context); - - // Error context - var context = lines.slice(start, end).map(function(line, i){ - var curr = i + start + 1; - return (curr == lineno ? ' > ' : ' ') - + curr - + '| ' - + line; - }).join('\n'); - - // Alter exception message - err.path = filename; - err.message = (filename || 'Jade') + ':' + lineno - + '\n' + context + '\n\n' + err.message; - throw err; -}; - - return exports; - -})({}); diff --git a/node_modules/jade/runtime.min.js b/node_modules/jade/runtime.min.js deleted file mode 100644 index 1714efb..0000000 --- a/node_modules/jade/runtime.min.js +++ /dev/null @@ -1 +0,0 @@ -jade=function(exports){Array.isArray||(Array.isArray=function(arr){return"[object Array]"==Object.prototype.toString.call(arr)}),Object.keys||(Object.keys=function(obj){var arr=[];for(var key in obj)obj.hasOwnProperty(key)&&arr.push(key);return arr}),exports.merge=function merge(a,b){var ac=a["class"],bc=b["class"];if(ac||bc)ac=ac||[],bc=bc||[],Array.isArray(ac)||(ac=[ac]),Array.isArray(bc)||(bc=[bc]),ac=ac.filter(nulls),bc=bc.filter(nulls),a["class"]=ac.concat(bc).join(" ");for(var key in b)key!="class"&&(a[key]=b[key]);return a};function nulls(val){return val!=null}return exports.attrs=function attrs(obj,escaped){var buf=[],terse=obj.terse;delete obj.terse;var keys=Object.keys(obj),len=keys.length;if(len){buf.push("");for(var i=0;i/g,">").replace(/"/g,""")},exports.rethrow=function rethrow(err,filename,lineno){if(!filename)throw err;var context=3,str=require("fs").readFileSync(filename,"utf8"),lines=str.split("\n"),start=Math.max(lineno-context,0),end=Math.min(lines.length,lineno+context),context=lines.slice(start,end).map(function(line,i){var curr=i+start+1;return(curr==lineno?" > ":" ")+curr+"| "+line}).join("\n");throw err.path=filename,err.message=(filename||"Jade")+":"+lineno+"\n"+context+"\n\n"+err.message,err},exports}({}); \ No newline at end of file diff --git a/node_modules/jade/test.jade b/node_modules/jade/test.jade deleted file mode 100644 index b3a8988..0000000 --- a/node_modules/jade/test.jade +++ /dev/null @@ -1,7 +0,0 @@ -p. - This is a large - body of text for - this tag. - - Nothing too - exciting. \ No newline at end of file diff --git a/node_modules/jade/testing/head.jade b/node_modules/jade/testing/head.jade deleted file mode 100644 index 8515406..0000000 --- a/node_modules/jade/testing/head.jade +++ /dev/null @@ -1,5 +0,0 @@ -head - script(src='/jquery.js') - yield - if false - script(src='/jquery.ui.js') diff --git a/node_modules/jade/testing/index.jade b/node_modules/jade/testing/index.jade deleted file mode 100644 index 1032c5f..0000000 --- a/node_modules/jade/testing/index.jade +++ /dev/null @@ -1,22 +0,0 @@ - -tag = 'p' -foo = 'bar' - -#{tag} value -#{tag}(foo='bar') value -#{foo ? 'a' : 'li'}(something) here - -mixin item(icon) - li - if attributes.href - a(attributes) - img.icon(src=icon) - block - else - span(attributes) - img.icon(src=icon) - block - -ul - +item('contact') Contact - +item(href='/contact') Contact diff --git a/node_modules/jade/testing/index.js b/node_modules/jade/testing/index.js deleted file mode 100644 index 226e8c0..0000000 --- a/node_modules/jade/testing/index.js +++ /dev/null @@ -1,11 +0,0 @@ - -/** - * Module dependencies. - */ - -var jade = require('../'); - -jade.renderFile('testing/index.jade', { pretty: true, debug: true, compileDebug: false }, function(err, str){ - if (err) throw err; - console.log(str); -}); \ No newline at end of file diff --git a/node_modules/jade/testing/layout.jade b/node_modules/jade/testing/layout.jade deleted file mode 100644 index 6923cf1..0000000 --- a/node_modules/jade/testing/layout.jade +++ /dev/null @@ -1,6 +0,0 @@ -html - include head - script(src='/caustic.js') - script(src='/app.js') - body - block content \ No newline at end of file diff --git a/node_modules/jade/testing/user.jade b/node_modules/jade/testing/user.jade deleted file mode 100644 index 3c636b7..0000000 --- a/node_modules/jade/testing/user.jade +++ /dev/null @@ -1,7 +0,0 @@ -h1 Tobi -p Is a ferret - -ul - li: a foo - li: a bar - li: a baz \ No newline at end of file diff --git a/node_modules/jade/testing/user.js b/node_modules/jade/testing/user.js deleted file mode 100644 index 2ecc45e..0000000 --- a/node_modules/jade/testing/user.js +++ /dev/null @@ -1,27 +0,0 @@ -function anonymous(locals, attrs, escape, rethrow) { -var attrs = jade.attrs, escape = jade.escape, rethrow = jade.rethrow; -var __jade = [{ lineno: 1, filename: "testing/user.jade" }]; -try { -var buf = []; -with (locals || {}) { -var interp; -__jade.unshift({ lineno: 1, filename: __jade[0].filename }); -__jade.unshift({ lineno: 1, filename: __jade[0].filename }); -buf.push('

      Tobi'); -__jade.unshift({ lineno: undefined, filename: __jade[0].filename }); -__jade.shift(); -buf.push('

      '); -__jade.shift(); -__jade.unshift({ lineno: 2, filename: __jade[0].filename }); -buf.push('

      Is a ferret'); -__jade.unshift({ lineno: undefined, filename: __jade[0].filename }); -__jade.shift(); -buf.push('

      '); -__jade.shift(); -__jade.shift(); -} -return buf.join(""); -} catch (err) { - rethrow(err, __jade[0].filename, __jade[0].lineno); -} -} \ No newline at end of file diff --git a/node_modules/lru-cache/.npmignore b/node_modules/lru-cache/.npmignore deleted file mode 100644 index 07e6e47..0000000 --- a/node_modules/lru-cache/.npmignore +++ /dev/null @@ -1 +0,0 @@ -/node_modules diff --git a/node_modules/lru-cache/.travis.yml b/node_modules/lru-cache/.travis.yml deleted file mode 100644 index 4af02b3..0000000 --- a/node_modules/lru-cache/.travis.yml +++ /dev/null @@ -1,8 +0,0 @@ -language: node_js -node_js: - - '0.8' - - '0.10' - - '0.12' - - 'iojs' -before_install: - - npm install -g npm@latest diff --git a/node_modules/lru-cache/CONTRIBUTORS b/node_modules/lru-cache/CONTRIBUTORS deleted file mode 100644 index 4a0bc50..0000000 --- a/node_modules/lru-cache/CONTRIBUTORS +++ /dev/null @@ -1,14 +0,0 @@ -# Authors, sorted by whether or not they are me -Isaac Z. Schlueter -Brian Cottingham -Carlos Brito Lage -Jesse Dailey -Kevin O'Hara -Marco Rogers -Mark Cavage -Marko Mikulicic -Nathan Rajlich -Satheesh Natesan -Trent Mick -ashleybrener -n4kz diff --git a/node_modules/lru-cache/LICENSE b/node_modules/lru-cache/LICENSE deleted file mode 100644 index 19129e3..0000000 --- a/node_modules/lru-cache/LICENSE +++ /dev/null @@ -1,15 +0,0 @@ -The ISC License - -Copyright (c) Isaac Z. Schlueter and Contributors - -Permission to use, copy, modify, and/or distribute this software for any -purpose with or without fee is hereby granted, provided that the above -copyright notice and this permission notice appear in all copies. - -THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES -WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF -MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR -ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES -WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN -ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR -IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/lru-cache/README.md b/node_modules/lru-cache/README.md deleted file mode 100644 index c06814e..0000000 --- a/node_modules/lru-cache/README.md +++ /dev/null @@ -1,137 +0,0 @@ -# lru cache - -A cache object that deletes the least-recently-used items. - -## Usage: - -```javascript -var LRU = require("lru-cache") - , options = { max: 500 - , length: function (n) { return n * 2 } - , dispose: function (key, n) { n.close() } - , maxAge: 1000 * 60 * 60 } - , cache = LRU(options) - , otherCache = LRU(50) // sets just the max size - -cache.set("key", "value") -cache.get("key") // "value" - -cache.reset() // empty the cache -``` - -If you put more stuff in it, then items will fall out. - -If you try to put an oversized thing in it, then it'll fall out right -away. - -## Keys should always be Strings or Numbers - -Note: this module will print warnings to `console.error` if you use a -key that is not a String or Number. Because items are stored in an -object, which coerces keys to a string, it won't go well for you if -you try to use a key that is not a unique string, it'll cause surprise -collisions. For example: - -```JavaScript -// Bad Example! Dont' do this! -var cache = LRU() -var a = {} -var b = {} -cache.set(a, 'this is a') -cache.set(b, 'this is b') -console.log(cache.get(a)) // prints: 'this is b' -``` - -## Options - -* `max` The maximum size of the cache, checked by applying the length - function to all values in the cache. Not setting this is kind of - silly, since that's the whole purpose of this lib, but it defaults - to `Infinity`. -* `maxAge` Maximum age in ms. Items are not pro-actively pruned out - as they age, but if you try to get an item that is too old, it'll - drop it and return undefined instead of giving it to you. -* `length` Function that is used to calculate the length of stored - items. If you're storing strings or buffers, then you probably want - to do something like `function(n){return n.length}`. The default is - `function(n){return 1}`, which is fine if you want to store `max` - like-sized things. -* `dispose` Function that is called on items when they are dropped - from the cache. This can be handy if you want to close file - descriptors or do other cleanup tasks when items are no longer - accessible. Called with `key, value`. It's called *before* - actually removing the item from the internal cache, so if you want - to immediately put it back in, you'll have to do that in a - `nextTick` or `setTimeout` callback or it won't do anything. -* `stale` By default, if you set a `maxAge`, it'll only actually pull - stale items out of the cache when you `get(key)`. (That is, it's - not pre-emptively doing a `setTimeout` or anything.) If you set - `stale:true`, it'll return the stale value before deleting it. If - you don't set this, then it'll return `undefined` when you try to - get a stale entry, as if it had already been deleted. - -## API - -* `set(key, value, maxAge)` -* `get(key) => value` - - Both of these will update the "recently used"-ness of the key. - They do what you think. `max` is optional and overrides the - cache `max` option if provided. - -* `peek(key)` - - Returns the key value (or `undefined` if not found) without - updating the "recently used"-ness of the key. - - (If you find yourself using this a lot, you *might* be using the - wrong sort of data structure, but there are some use cases where - it's handy.) - -* `del(key)` - - Deletes a key out of the cache. - -* `reset()` - - Clear the cache entirely, throwing away all values. - -* `has(key)` - - Check if a key is in the cache, without updating the recent-ness - or deleting it for being stale. - -* `forEach(function(value,key,cache), [thisp])` - - Just like `Array.prototype.forEach`. Iterates over all the keys - in the cache, in order of recent-ness. (Ie, more recently used - items are iterated over first.) - -* `keys()` - - Return an array of the keys in the cache. - -* `values()` - - Return an array of the values in the cache. - -* `length()` - - Return total length of objects in cache taking into account - `length` options function. - -* `itemCount` - - Return total quantity of objects currently in cache. Note, that - `stale` (see options) items are returned as part of this item - count. - -* `dump()` - - Return an array of the cache entries ready for serialization and usage - with 'destinationCache.load(arr)`. - -* `load(cacheEntriesArray)` - - Loads another cache entries array, obtained with `sourceCache.dump()`, - into the cache. The destination cache is reset before loading new entries diff --git a/node_modules/lru-cache/lib/lru-cache.js b/node_modules/lru-cache/lib/lru-cache.js deleted file mode 100644 index 2bbe653..0000000 --- a/node_modules/lru-cache/lib/lru-cache.js +++ /dev/null @@ -1,334 +0,0 @@ -;(function () { // closure for web browsers - -if (typeof module === 'object' && module.exports) { - module.exports = LRUCache -} else { - // just set the global for non-node platforms. - this.LRUCache = LRUCache -} - -function hOP (obj, key) { - return Object.prototype.hasOwnProperty.call(obj, key) -} - -function naiveLength () { return 1 } - -var didTypeWarning = false -function typeCheckKey(key) { - if (!didTypeWarning && typeof key !== 'string' && typeof key !== 'number') { - didTypeWarning = true - console.error(new TypeError("LRU: key must be a string or number. Almost certainly a bug! " + typeof key).stack) - } -} - -function LRUCache (options) { - if (!(this instanceof LRUCache)) - return new LRUCache(options) - - if (typeof options === 'number') - options = { max: options } - - if (!options) - options = {} - - this._max = options.max - // Kind of weird to have a default max of Infinity, but oh well. - if (!this._max || !(typeof this._max === "number") || this._max <= 0 ) - this._max = Infinity - - this._lengthCalculator = options.length || naiveLength - if (typeof this._lengthCalculator !== "function") - this._lengthCalculator = naiveLength - - this._allowStale = options.stale || false - this._maxAge = options.maxAge || null - this._dispose = options.dispose - this.reset() -} - -// resize the cache when the max changes. -Object.defineProperty(LRUCache.prototype, "max", - { set : function (mL) { - if (!mL || !(typeof mL === "number") || mL <= 0 ) mL = Infinity - this._max = mL - if (this._length > this._max) trim(this) - } - , get : function () { return this._max } - , enumerable : true - }) - -// resize the cache when the lengthCalculator changes. -Object.defineProperty(LRUCache.prototype, "lengthCalculator", - { set : function (lC) { - if (typeof lC !== "function") { - this._lengthCalculator = naiveLength - this._length = this._itemCount - for (var key in this._cache) { - this._cache[key].length = 1 - } - } else { - this._lengthCalculator = lC - this._length = 0 - for (var key in this._cache) { - this._cache[key].length = this._lengthCalculator(this._cache[key].value) - this._length += this._cache[key].length - } - } - - if (this._length > this._max) trim(this) - } - , get : function () { return this._lengthCalculator } - , enumerable : true - }) - -Object.defineProperty(LRUCache.prototype, "length", - { get : function () { return this._length } - , enumerable : true - }) - - -Object.defineProperty(LRUCache.prototype, "itemCount", - { get : function () { return this._itemCount } - , enumerable : true - }) - -LRUCache.prototype.forEach = function (fn, thisp) { - thisp = thisp || this - var i = 0 - var itemCount = this._itemCount - - for (var k = this._mru - 1; k >= 0 && i < itemCount; k--) if (this._lruList[k]) { - i++ - var hit = this._lruList[k] - if (isStale(this, hit)) { - del(this, hit) - if (!this._allowStale) hit = undefined - } - if (hit) { - fn.call(thisp, hit.value, hit.key, this) - } - } -} - -LRUCache.prototype.keys = function () { - var keys = new Array(this._itemCount) - var i = 0 - for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) { - var hit = this._lruList[k] - keys[i++] = hit.key - } - return keys -} - -LRUCache.prototype.values = function () { - var values = new Array(this._itemCount) - var i = 0 - for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) { - var hit = this._lruList[k] - values[i++] = hit.value - } - return values -} - -LRUCache.prototype.reset = function () { - if (this._dispose && this._cache) { - for (var k in this._cache) { - this._dispose(k, this._cache[k].value) - } - } - - this._cache = Object.create(null) // hash of items by key - this._lruList = Object.create(null) // list of items in order of use recency - this._mru = 0 // most recently used - this._lru = 0 // least recently used - this._length = 0 // number of items in the list - this._itemCount = 0 -} - -LRUCache.prototype.dump = function () { - var arr = [] - var i = 0 - - for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) { - var hit = this._lruList[k] - if (!isStale(this, hit)) { - //Do not store staled hits - ++i - arr.push({ - k: hit.key, - v: hit.value, - e: hit.now + (hit.maxAge || 0) - }); - } - } - //arr has the most read first - return arr -} - -LRUCache.prototype.dumpLru = function () { - return this._lruList -} - -LRUCache.prototype.set = function (key, value, maxAge) { - maxAge = maxAge || this._maxAge - typeCheckKey(key) - - var now = maxAge ? Date.now() : 0 - var len = this._lengthCalculator(value) - - if (hOP(this._cache, key)) { - if (len > this._max) { - del(this, this._cache[key]) - return false - } - // dispose of the old one before overwriting - if (this._dispose) - this._dispose(key, this._cache[key].value) - - this._cache[key].now = now - this._cache[key].maxAge = maxAge - this._cache[key].value = value - this._length += (len - this._cache[key].length) - this._cache[key].length = len - this.get(key) - - if (this._length > this._max) - trim(this) - - return true - } - - var hit = new Entry(key, value, this._mru++, len, now, maxAge) - - // oversized objects fall out of cache automatically. - if (hit.length > this._max) { - if (this._dispose) this._dispose(key, value) - return false - } - - this._length += hit.length - this._lruList[hit.lu] = this._cache[key] = hit - this._itemCount ++ - - if (this._length > this._max) - trim(this) - - return true -} - -LRUCache.prototype.has = function (key) { - typeCheckKey(key) - if (!hOP(this._cache, key)) return false - var hit = this._cache[key] - if (isStale(this, hit)) { - return false - } - return true -} - -LRUCache.prototype.get = function (key) { - typeCheckKey(key) - return get(this, key, true) -} - -LRUCache.prototype.peek = function (key) { - typeCheckKey(key) - return get(this, key, false) -} - -LRUCache.prototype.pop = function () { - var hit = this._lruList[this._lru] - del(this, hit) - return hit || null -} - -LRUCache.prototype.del = function (key) { - typeCheckKey(key) - del(this, this._cache[key]) -} - -LRUCache.prototype.load = function (arr) { - //reset the cache - this.reset(); - - var now = Date.now() - //A previous serialized cache has the most recent items first - for (var l = arr.length - 1; l >= 0; l-- ) { - var hit = arr[l] - typeCheckKey(hit.k) - var expiresAt = hit.e || 0 - if (expiresAt === 0) { - //the item was created without expiration in a non aged cache - this.set(hit.k, hit.v) - } else { - var maxAge = expiresAt - now - //dont add already expired items - if (maxAge > 0) this.set(hit.k, hit.v, maxAge) - } - } -} - -function get (self, key, doUse) { - typeCheckKey(key) - var hit = self._cache[key] - if (hit) { - if (isStale(self, hit)) { - del(self, hit) - if (!self._allowStale) hit = undefined - } else { - if (doUse) use(self, hit) - } - if (hit) hit = hit.value - } - return hit -} - -function isStale(self, hit) { - if (!hit || (!hit.maxAge && !self._maxAge)) return false - var stale = false; - var diff = Date.now() - hit.now - if (hit.maxAge) { - stale = diff > hit.maxAge - } else { - stale = self._maxAge && (diff > self._maxAge) - } - return stale; -} - -function use (self, hit) { - shiftLU(self, hit) - hit.lu = self._mru ++ - self._lruList[hit.lu] = hit -} - -function trim (self) { - while (self._lru < self._mru && self._length > self._max) - del(self, self._lruList[self._lru]) -} - -function shiftLU (self, hit) { - delete self._lruList[ hit.lu ] - while (self._lru < self._mru && !self._lruList[self._lru]) self._lru ++ -} - -function del (self, hit) { - if (hit) { - if (self._dispose) self._dispose(hit.key, hit.value) - self._length -= hit.length - self._itemCount -- - delete self._cache[ hit.key ] - shiftLU(self, hit) - } -} - -// classy, since V8 prefers predictable objects. -function Entry (key, value, lu, length, now, maxAge) { - this.key = key - this.value = value - this.lu = lu - this.length = length - this.now = now - if (maxAge) this.maxAge = maxAge -} - -})() diff --git a/node_modules/lru-cache/package.json b/node_modules/lru-cache/package.json deleted file mode 100644 index 189e33d..0000000 --- a/node_modules/lru-cache/package.json +++ /dev/null @@ -1,21 +0,0 @@ -{ - "name": "lru-cache", - "description": "A cache object that deletes the least-recently-used items.", - "version": "2.7.3", - "author": "Isaac Z. Schlueter ", - "keywords": [ - "mru", - "lru", - "cache" - ], - "scripts": { - "test": "tap test --gc" - }, - "main": "lib/lru-cache.js", - "repository": "git://github.com/isaacs/node-lru-cache.git", - "devDependencies": { - "tap": "^1.2.0", - "weak": "" - }, - "license": "ISC" -} diff --git a/node_modules/lru-cache/test/basic.js b/node_modules/lru-cache/test/basic.js deleted file mode 100644 index b47225f..0000000 --- a/node_modules/lru-cache/test/basic.js +++ /dev/null @@ -1,396 +0,0 @@ -var test = require("tap").test - , LRU = require("../") - -test("basic", function (t) { - var cache = new LRU({max: 10}) - cache.set("key", "value") - t.equal(cache.get("key"), "value") - t.equal(cache.get("nada"), undefined) - t.equal(cache.length, 1) - t.equal(cache.max, 10) - t.end() -}) - -test("least recently set", function (t) { - var cache = new LRU(2) - cache.set("a", "A") - cache.set("b", "B") - cache.set("c", "C") - t.equal(cache.get("c"), "C") - t.equal(cache.get("b"), "B") - t.equal(cache.get("a"), undefined) - t.end() -}) - -test("lru recently gotten", function (t) { - var cache = new LRU(2) - cache.set("a", "A") - cache.set("b", "B") - cache.get("a") - cache.set("c", "C") - t.equal(cache.get("c"), "C") - t.equal(cache.get("b"), undefined) - t.equal(cache.get("a"), "A") - t.end() -}) - -test("del", function (t) { - var cache = new LRU(2) - cache.set("a", "A") - cache.del("a") - t.equal(cache.get("a"), undefined) - t.end() -}) - -test("max", function (t) { - var cache = new LRU(3) - - // test changing the max, verify that the LRU items get dropped. - cache.max = 100 - for (var i = 0; i < 100; i ++) cache.set(i, i) - t.equal(cache.length, 100) - for (var i = 0; i < 100; i ++) { - t.equal(cache.get(i), i) - } - cache.max = 3 - t.equal(cache.length, 3) - for (var i = 0; i < 97; i ++) { - t.equal(cache.get(i), undefined) - } - for (var i = 98; i < 100; i ++) { - t.equal(cache.get(i), i) - } - - // now remove the max restriction, and try again. - cache.max = "hello" - for (var i = 0; i < 100; i ++) cache.set(i, i) - t.equal(cache.length, 100) - for (var i = 0; i < 100; i ++) { - t.equal(cache.get(i), i) - } - // should trigger an immediate resize - cache.max = 3 - t.equal(cache.length, 3) - for (var i = 0; i < 97; i ++) { - t.equal(cache.get(i), undefined) - } - for (var i = 98; i < 100; i ++) { - t.equal(cache.get(i), i) - } - t.end() -}) - -test("reset", function (t) { - var cache = new LRU(10) - cache.set("a", "A") - cache.set("b", "B") - cache.reset() - t.equal(cache.length, 0) - t.equal(cache.max, 10) - t.equal(cache.get("a"), undefined) - t.equal(cache.get("b"), undefined) - t.end() -}) - - -test("basic with weighed length", function (t) { - var cache = new LRU({ - max: 100, - length: function (item) { return item.size } - }) - cache.set("key", {val: "value", size: 50}) - t.equal(cache.get("key").val, "value") - t.equal(cache.get("nada"), undefined) - t.equal(cache.lengthCalculator(cache.get("key")), 50) - t.equal(cache.length, 50) - t.equal(cache.max, 100) - t.end() -}) - - -test("weighed length item too large", function (t) { - var cache = new LRU({ - max: 10, - length: function (item) { return item.size } - }) - t.equal(cache.max, 10) - - // should fall out immediately - cache.set("key", {val: "value", size: 50}) - - t.equal(cache.length, 0) - t.equal(cache.get("key"), undefined) - t.end() -}) - -test("least recently set with weighed length", function (t) { - var cache = new LRU({ - max:8, - length: function (item) { return item.length } - }) - cache.set("a", "A") - cache.set("b", "BB") - cache.set("c", "CCC") - cache.set("d", "DDDD") - t.equal(cache.get("d"), "DDDD") - t.equal(cache.get("c"), "CCC") - t.equal(cache.get("b"), undefined) - t.equal(cache.get("a"), undefined) - t.end() -}) - -test("lru recently gotten with weighed length", function (t) { - var cache = new LRU({ - max: 8, - length: function (item) { return item.length } - }) - cache.set("a", "A") - cache.set("b", "BB") - cache.set("c", "CCC") - cache.get("a") - cache.get("b") - cache.set("d", "DDDD") - t.equal(cache.get("c"), undefined) - t.equal(cache.get("d"), "DDDD") - t.equal(cache.get("b"), "BB") - t.equal(cache.get("a"), "A") - t.end() -}) - -test("lru recently updated with weighed length", function (t) { - var cache = new LRU({ - max: 8, - length: function (item) { return item.length } - }) - cache.set("a", "A") - cache.set("b", "BB") - cache.set("c", "CCC") - t.equal(cache.length, 6) //CCC BB A - cache.set("a", "+A") - t.equal(cache.length, 7) //+A CCC BB - cache.set("b", "++BB") - t.equal(cache.length, 6) //++BB +A - t.equal(cache.get("c"), undefined) - - cache.set("c", "oversized") - t.equal(cache.length, 6) //++BB +A - t.equal(cache.get("c"), undefined) - - cache.set("a", "oversized") - t.equal(cache.length, 4) //++BB - t.equal(cache.get("a"), undefined) - t.equal(cache.get("b"), "++BB") - t.end() -}) - -test("set returns proper booleans", function(t) { - var cache = new LRU({ - max: 5, - length: function (item) { return item.length } - }) - - t.equal(cache.set("a", "A"), true) - - // should return false for max exceeded - t.equal(cache.set("b", "donuts"), false) - - t.equal(cache.set("b", "B"), true) - t.equal(cache.set("c", "CCCC"), true) - t.end() -}) - -test("drop the old items", function(t) { - var cache = new LRU({ - max: 5, - maxAge: 50 - }) - - cache.set("a", "A") - - setTimeout(function () { - cache.set("b", "b") - t.equal(cache.get("a"), "A") - }, 25) - - setTimeout(function () { - cache.set("c", "C") - // timed out - t.notOk(cache.get("a")) - }, 60 + 25) - - setTimeout(function () { - t.notOk(cache.get("b")) - t.equal(cache.get("c"), "C") - }, 90) - - setTimeout(function () { - t.notOk(cache.get("c")) - t.end() - }, 155) -}) - -test("individual item can have it's own maxAge", function(t) { - var cache = new LRU({ - max: 5, - maxAge: 50 - }) - - cache.set("a", "A", 20) - setTimeout(function () { - t.notOk(cache.get("a")) - t.end() - }, 25) -}) - -test("individual item can have it's own maxAge > cache's", function(t) { - var cache = new LRU({ - max: 5, - maxAge: 20 - }) - - cache.set("a", "A", 50) - setTimeout(function () { - t.equal(cache.get("a"), "A") - t.end() - }, 25) -}) - -test("disposal function", function(t) { - var disposed = false - var cache = new LRU({ - max: 1, - dispose: function (k, n) { - disposed = n - } - }) - - cache.set(1, 1) - cache.set(2, 2) - t.equal(disposed, 1) - cache.set(3, 3) - t.equal(disposed, 2) - cache.reset() - t.equal(disposed, 3) - t.end() -}) - -test("disposal function on too big of item", function(t) { - var disposed = false - var cache = new LRU({ - max: 1, - length: function (k) { - return k.length - }, - dispose: function (k, n) { - disposed = n - } - }) - var obj = [ 1, 2 ] - - t.equal(disposed, false) - cache.set("obj", obj) - t.equal(disposed, obj) - t.end() -}) - -test("has()", function(t) { - var cache = new LRU({ - max: 1, - maxAge: 10 - }) - - cache.set('foo', 'bar') - t.equal(cache.has('foo'), true) - cache.set('blu', 'baz') - t.equal(cache.has('foo'), false) - t.equal(cache.has('blu'), true) - setTimeout(function() { - t.equal(cache.has('blu'), false) - t.end() - }, 15) -}) - -test("stale", function(t) { - var cache = new LRU({ - maxAge: 10, - stale: true - }) - - cache.set('foo', 'bar') - t.equal(cache.get('foo'), 'bar') - t.equal(cache.has('foo'), true) - setTimeout(function() { - t.equal(cache.has('foo'), false) - t.equal(cache.get('foo'), 'bar') - t.equal(cache.get('foo'), undefined) - t.end() - }, 15) -}) - -test("lru update via set", function(t) { - var cache = LRU({ max: 2 }); - - cache.set('foo', 1); - cache.set('bar', 2); - cache.del('bar'); - cache.set('baz', 3); - cache.set('qux', 4); - - t.equal(cache.get('foo'), undefined) - t.equal(cache.get('bar'), undefined) - t.equal(cache.get('baz'), 3) - t.equal(cache.get('qux'), 4) - t.end() -}) - -test("least recently set w/ peek", function (t) { - var cache = new LRU(2) - cache.set("a", "A") - cache.set("b", "B") - t.equal(cache.peek("a"), "A") - cache.set("c", "C") - t.equal(cache.get("c"), "C") - t.equal(cache.get("b"), "B") - t.equal(cache.get("a"), undefined) - t.end() -}) - -test("pop the least used item", function (t) { - var cache = new LRU(3) - , last - - cache.set("a", "A") - cache.set("b", "B") - cache.set("c", "C") - - t.equal(cache.length, 3) - t.equal(cache.max, 3) - - // Ensure we pop a, c, b - cache.get("b", "B") - - last = cache.pop() - t.equal(last.key, "a") - t.equal(last.value, "A") - t.equal(cache.length, 2) - t.equal(cache.max, 3) - - last = cache.pop() - t.equal(last.key, "c") - t.equal(last.value, "C") - t.equal(cache.length, 1) - t.equal(cache.max, 3) - - last = cache.pop() - t.equal(last.key, "b") - t.equal(last.value, "B") - t.equal(cache.length, 0) - t.equal(cache.max, 3) - - last = cache.pop() - t.equal(last, null) - t.equal(cache.length, 0) - t.equal(cache.max, 3) - - t.end() -}) diff --git a/node_modules/lru-cache/test/foreach.js b/node_modules/lru-cache/test/foreach.js deleted file mode 100644 index 4190417..0000000 --- a/node_modules/lru-cache/test/foreach.js +++ /dev/null @@ -1,120 +0,0 @@ -var test = require('tap').test -var LRU = require('../') - -test('forEach', function (t) { - var l = new LRU(5) - for (var i = 0; i < 10; i ++) { - l.set(i.toString(), i.toString(2)) - } - - var i = 9 - l.forEach(function (val, key, cache) { - t.equal(cache, l) - t.equal(key, i.toString()) - t.equal(val, i.toString(2)) - i -= 1 - }) - - // get in order of most recently used - l.get(6) - l.get(8) - - var order = [ 8, 6, 9, 7, 5 ] - var i = 0 - - l.forEach(function (val, key, cache) { - var j = order[i ++] - t.equal(cache, l) - t.equal(key, j.toString()) - t.equal(val, j.toString(2)) - }) - t.equal(i, order.length); - - t.end() -}) - -test('keys() and values()', function (t) { - var l = new LRU(5) - for (var i = 0; i < 10; i ++) { - l.set(i.toString(), i.toString(2)) - } - - t.similar(l.keys(), ['9', '8', '7', '6', '5']) - t.similar(l.values(), ['1001', '1000', '111', '110', '101']) - - // get in order of most recently used - l.get(6) - l.get(8) - - t.similar(l.keys(), ['8', '6', '9', '7', '5']) - t.similar(l.values(), ['1000', '110', '1001', '111', '101']) - - t.end() -}) - -test('all entries are iterated over', function(t) { - var l = new LRU(5) - for (var i = 0; i < 10; i ++) { - l.set(i.toString(), i.toString(2)) - } - - var i = 0 - l.forEach(function (val, key, cache) { - if (i > 0) { - cache.del(key) - } - i += 1 - }) - - t.equal(i, 5) - t.equal(l.keys().length, 1) - - t.end() -}) - -test('all stale entries are removed', function(t) { - var l = new LRU({ max: 5, maxAge: -5, stale: true }) - for (var i = 0; i < 10; i ++) { - l.set(i.toString(), i.toString(2)) - } - - var i = 0 - l.forEach(function () { - i += 1 - }) - - t.equal(i, 5) - t.equal(l.keys().length, 0) - - t.end() -}) - -test('expires', function (t) { - var l = new LRU({ - max: 10, - maxAge: 50 - }) - for (var i = 0; i < 10; i++) { - l.set(i.toString(), i.toString(2), ((i % 2) ? 25 : undefined)) - } - - var i = 0 - var order = [ 8, 6, 4, 2, 0 ] - setTimeout(function () { - l.forEach(function (val, key, cache) { - var j = order[i++] - t.equal(cache, l) - t.equal(key, j.toString()) - t.equal(val, j.toString(2)) - }) - t.equal(i, order.length); - - setTimeout(function () { - var count = 0; - l.forEach(function (val, key, cache) { count++; }) - t.equal(0, count); - t.end() - }, 25) - - }, 26) -}) diff --git a/node_modules/lru-cache/test/memory-leak.js b/node_modules/lru-cache/test/memory-leak.js deleted file mode 100644 index b5912f6..0000000 --- a/node_modules/lru-cache/test/memory-leak.js +++ /dev/null @@ -1,51 +0,0 @@ -#!/usr/bin/env node --expose_gc - - -var weak = require('weak'); -var test = require('tap').test -var LRU = require('../') -var l = new LRU({ max: 10 }) -var refs = 0 -function X() { - refs ++ - weak(this, deref) -} - -function deref() { - refs -- -} - -test('no leaks', function (t) { - // fill up the cache - for (var i = 0; i < 100; i++) { - l.set(i, new X); - // throw some gets in there, too. - if (i % 2 === 0) - l.get(i / 2) - } - - gc() - - var start = process.memoryUsage() - - // capture the memory - var startRefs = refs - - // do it again, but more - for (var i = 0; i < 10000; i++) { - l.set(i, new X); - // throw some gets in there, too. - if (i % 2 === 0) - l.get(i / 2) - } - - gc() - - var end = process.memoryUsage() - t.equal(refs, startRefs, 'no leaky refs') - - console.error('start: %j\n' + - 'end: %j', start, end); - t.pass(); - t.end(); -}) diff --git a/node_modules/lru-cache/test/serialize.js b/node_modules/lru-cache/test/serialize.js deleted file mode 100644 index 1094194..0000000 --- a/node_modules/lru-cache/test/serialize.js +++ /dev/null @@ -1,216 +0,0 @@ -var test = require('tap').test -var LRU = require('../') - -test('dump', function (t) { - var cache = new LRU() - - t.equal(cache.dump().length, 0, "nothing in dump for empty cache") - - cache.set("a", "A") - cache.set("b", "B") - t.deepEqual(cache.dump(), [ - { k: "b", v: "B", e: 0 }, - { k: "a", v: "A", e: 0 } - ]) - - cache.set("a", "A"); - t.deepEqual(cache.dump(), [ - { k: "a", v: "A", e: 0 }, - { k: "b", v: "B", e: 0 } - ]) - - cache.get("b"); - t.deepEqual(cache.dump(), [ - { k: "b", v: "B", e: 0 }, - { k: "a", v: "A", e: 0 } - ]) - - cache.del("a"); - t.deepEqual(cache.dump(), [ - { k: "b", v: "B", e: 0 } - ]) - - t.end() -}) - -test("do not dump stale items", function(t) { - var cache = new LRU({ - max: 5, - maxAge: 50 - }) - - //expires at 50 - cache.set("a", "A") - - setTimeout(function () { - //expires at 75 - cache.set("b", "B") - var s = cache.dump() - t.equal(s.length, 2) - t.equal(s[0].k, "b") - t.equal(s[1].k, "a") - }, 25) - - setTimeout(function () { - //expires at 110 - cache.set("c", "C") - var s = cache.dump() - t.equal(s.length, 2) - t.equal(s[0].k, "c") - t.equal(s[1].k, "b") - }, 60) - - setTimeout(function () { - //expires at 130 - cache.set("d", "D", 40) - var s = cache.dump() - t.equal(s.length, 2) - t.equal(s[0].k, "d") - t.equal(s[1].k, "c") - }, 90) - - setTimeout(function () { - var s = cache.dump() - t.equal(s.length, 1) - t.equal(s[0].k, "d") - }, 120) - - setTimeout(function () { - var s = cache.dump() - t.deepEqual(s, []) - t.end() - }, 155) -}) - -test("load basic cache", function(t) { - var cache = new LRU(), - copy = new LRU() - - cache.set("a", "A") - cache.set("b", "B") - - copy.load(cache.dump()) - t.deepEquals(cache.dump(), copy.dump()) - - t.end() -}) - - -test("load staled cache", function(t) { - var cache = new LRU({maxAge: 50}), - copy = new LRU({maxAge: 50}), - arr - - //expires at 50 - cache.set("a", "A") - setTimeout(function () { - //expires at 80 - cache.set("b", "B") - arr = cache.dump() - t.equal(arr.length, 2) - }, 30) - - setTimeout(function () { - copy.load(arr) - t.equal(copy.get("a"), undefined) - t.equal(copy.get("b"), "B") - }, 60) - - setTimeout(function () { - t.equal(copy.get("b"), undefined) - t.end() - }, 90) -}) - -test("load to other size cache", function(t) { - var cache = new LRU({max: 2}), - copy = new LRU({max: 1}) - - cache.set("a", "A") - cache.set("b", "B") - - copy.load(cache.dump()) - t.equal(copy.get("a"), undefined) - t.equal(copy.get("b"), "B") - - //update the last read from original cache - cache.get("a") - copy.load(cache.dump()) - t.equal(copy.get("a"), "A") - t.equal(copy.get("b"), undefined) - - t.end() -}) - - -test("load to other age cache", function(t) { - var cache = new LRU({maxAge: 50}), - aged = new LRU({maxAge: 100}), - simple = new LRU(), - arr, - expired - - //created at 0 - //a would be valid till 0 + 50 - cache.set("a", "A") - setTimeout(function () { - //created at 20 - //b would be valid till 20 + 50 - cache.set("b", "B") - //b would be valid till 20 + 70 - cache.set("c", "C", 70) - arr = cache.dump() - t.equal(arr.length, 3) - }, 20) - - setTimeout(function () { - t.equal(cache.get("a"), undefined) - t.equal(cache.get("b"), "B") - t.equal(cache.get("c"), "C") - - aged.load(arr) - t.equal(aged.get("a"), undefined) - t.equal(aged.get("b"), "B") - t.equal(aged.get("c"), "C") - - simple.load(arr) - t.equal(simple.get("a"), undefined) - t.equal(simple.get("b"), "B") - t.equal(simple.get("c"), "C") - }, 60) - - setTimeout(function () { - t.equal(cache.get("a"), undefined) - t.equal(cache.get("b"), undefined) - t.equal(cache.get("c"), "C") - - aged.load(arr) - t.equal(aged.get("a"), undefined) - t.equal(aged.get("b"), undefined) - t.equal(aged.get("c"), "C") - - simple.load(arr) - t.equal(simple.get("a"), undefined) - t.equal(simple.get("b"), undefined) - t.equal(simple.get("c"), "C") - }, 80) - - setTimeout(function () { - t.equal(cache.get("a"), undefined) - t.equal(cache.get("b"), undefined) - t.equal(cache.get("c"), undefined) - - aged.load(arr) - t.equal(aged.get("a"), undefined) - t.equal(aged.get("b"), undefined) - t.equal(aged.get("c"), undefined) - - simple.load(arr) - t.equal(simple.get("a"), undefined) - t.equal(simple.get("b"), undefined) - t.equal(simple.get("c"), undefined) - t.end() - }, 100) - -}) - diff --git a/node_modules/minimatch/.npmignore b/node_modules/minimatch/.npmignore deleted file mode 100644 index 3c3629e..0000000 --- a/node_modules/minimatch/.npmignore +++ /dev/null @@ -1 +0,0 @@ -node_modules diff --git a/node_modules/minimatch/LICENSE b/node_modules/minimatch/LICENSE deleted file mode 100644 index 05a4010..0000000 --- a/node_modules/minimatch/LICENSE +++ /dev/null @@ -1,23 +0,0 @@ -Copyright 2009, 2010, 2011 Isaac Z. Schlueter. -All rights reserved. - -Permission is hereby granted, free of charge, to any person -obtaining a copy of this software and associated documentation -files (the "Software"), to deal in the Software without -restriction, including without limitation the rights to use, -copy, modify, merge, publish, distribute, sublicense, and/or sell -copies of the Software, and to permit persons to whom the -Software is furnished to do so, subject to the following -conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES -OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND -NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT -HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, -WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING -FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR -OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/minimatch/README.md b/node_modules/minimatch/README.md deleted file mode 100644 index 978268e..0000000 --- a/node_modules/minimatch/README.md +++ /dev/null @@ -1,218 +0,0 @@ -# minimatch - -A minimal matching utility. - -[![Build Status](https://secure.travis-ci.org/isaacs/minimatch.png)](http://travis-ci.org/isaacs/minimatch) - - -This is the matching library used internally by npm. - -Eventually, it will replace the C binding in node-glob. - -It works by converting glob expressions into JavaScript `RegExp` -objects. - -## Usage - -```javascript -var minimatch = require("minimatch") - -minimatch("bar.foo", "*.foo") // true! -minimatch("bar.foo", "*.bar") // false! -minimatch("bar.foo", "*.+(bar|foo)", { debug: true }) // true, and noisy! -``` - -## Features - -Supports these glob features: - -* Brace Expansion -* Extended glob matching -* "Globstar" `**` matching - -See: - -* `man sh` -* `man bash` -* `man 3 fnmatch` -* `man 5 gitignore` - -## Minimatch Class - -Create a minimatch object by instanting the `minimatch.Minimatch` class. - -```javascript -var Minimatch = require("minimatch").Minimatch -var mm = new Minimatch(pattern, options) -``` - -### Properties - -* `pattern` The original pattern the minimatch object represents. -* `options` The options supplied to the constructor. -* `set` A 2-dimensional array of regexp or string expressions. - Each row in the - array corresponds to a brace-expanded pattern. Each item in the row - corresponds to a single path-part. For example, the pattern - `{a,b/c}/d` would expand to a set of patterns like: - - [ [ a, d ] - , [ b, c, d ] ] - - If a portion of the pattern doesn't have any "magic" in it - (that is, it's something like `"foo"` rather than `fo*o?`), then it - will be left as a string rather than converted to a regular - expression. - -* `regexp` Created by the `makeRe` method. A single regular expression - expressing the entire pattern. This is useful in cases where you wish - to use the pattern somewhat like `fnmatch(3)` with `FNM_PATH` enabled. -* `negate` True if the pattern is negated. -* `comment` True if the pattern is a comment. -* `empty` True if the pattern is `""`. - -### Methods - -* `makeRe` Generate the `regexp` member if necessary, and return it. - Will return `false` if the pattern is invalid. -* `match(fname)` Return true if the filename matches the pattern, or - false otherwise. -* `matchOne(fileArray, patternArray, partial)` Take a `/`-split - filename, and match it against a single row in the `regExpSet`. This - method is mainly for internal use, but is exposed so that it can be - used by a glob-walker that needs to avoid excessive filesystem calls. - -All other methods are internal, and will be called as necessary. - -## Functions - -The top-level exported function has a `cache` property, which is an LRU -cache set to store 100 items. So, calling these methods repeatedly -with the same pattern and options will use the same Minimatch object, -saving the cost of parsing it multiple times. - -### minimatch(path, pattern, options) - -Main export. Tests a path against the pattern using the options. - -```javascript -var isJS = minimatch(file, "*.js", { matchBase: true }) -``` - -### minimatch.filter(pattern, options) - -Returns a function that tests its -supplied argument, suitable for use with `Array.filter`. Example: - -```javascript -var javascripts = fileList.filter(minimatch.filter("*.js", {matchBase: true})) -``` - -### minimatch.match(list, pattern, options) - -Match against the list of -files, in the style of fnmatch or glob. If nothing is matched, and -options.nonull is set, then return a list containing the pattern itself. - -```javascript -var javascripts = minimatch.match(fileList, "*.js", {matchBase: true})) -``` - -### minimatch.makeRe(pattern, options) - -Make a regular expression object from the pattern. - -## Options - -All options are `false` by default. - -### debug - -Dump a ton of stuff to stderr. - -### nobrace - -Do not expand `{a,b}` and `{1..3}` brace sets. - -### noglobstar - -Disable `**` matching against multiple folder names. - -### dot - -Allow patterns to match filenames starting with a period, even if -the pattern does not explicitly have a period in that spot. - -Note that by default, `a/**/b` will **not** match `a/.d/b`, unless `dot` -is set. - -### noext - -Disable "extglob" style patterns like `+(a|b)`. - -### nocase - -Perform a case-insensitive match. - -### nonull - -When a match is not found by `minimatch.match`, return a list containing -the pattern itself. When set, an empty list is returned if there are -no matches. - -### matchBase - -If set, then patterns without slashes will be matched -against the basename of the path if it contains slashes. For example, -`a?b` would match the path `/xyz/123/acb`, but not `/xyz/acb/123`. - -### nocomment - -Suppress the behavior of treating `#` at the start of a pattern as a -comment. - -### nonegate - -Suppress the behavior of treating a leading `!` character as negation. - -### flipNegate - -Returns from negate expressions the same as if they were not negated. -(Ie, true on a hit, false on a miss.) - - -## Comparisons to other fnmatch/glob implementations - -While strict compliance with the existing standards is a worthwhile -goal, some discrepancies exist between minimatch and other -implementations, and are intentional. - -If the pattern starts with a `!` character, then it is negated. Set the -`nonegate` flag to suppress this behavior, and treat leading `!` -characters normally. This is perhaps relevant if you wish to start the -pattern with a negative extglob pattern like `!(a|B)`. Multiple `!` -characters at the start of a pattern will negate the pattern multiple -times. - -If a pattern starts with `#`, then it is treated as a comment, and -will not match anything. Use `\#` to match a literal `#` at the -start of a line, or set the `nocomment` flag to suppress this behavior. - -The double-star character `**` is supported by default, unless the -`noglobstar` flag is set. This is supported in the manner of bsdglob -and bash 4.1, where `**` only has special significance if it is the only -thing in a path part. That is, `a/**/b` will match `a/x/y/b`, but -`a/**b` will not. - -If an escaped pattern has no matches, and the `nonull` flag is set, -then minimatch.match returns the pattern as-provided, rather than -interpreting the character escapes. For example, -`minimatch.match([], "\\*a\\?")` will return `"\\*a\\?"` rather than -`"*a?"`. This is akin to setting the `nullglob` option in bash, except -that it does not resolve escaped pattern characters. - -If brace expansion is not disabled, then it is performed before any -other interpretation of the glob pattern. Thus, a pattern like -`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded -**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are -checked for validity. Since those two are valid, matching proceeds. diff --git a/node_modules/minimatch/minimatch.js b/node_modules/minimatch/minimatch.js deleted file mode 100644 index c633f89..0000000 --- a/node_modules/minimatch/minimatch.js +++ /dev/null @@ -1,1055 +0,0 @@ -;(function (require, exports, module, platform) { - -if (module) module.exports = minimatch -else exports.minimatch = minimatch - -if (!require) { - require = function (id) { - switch (id) { - case "sigmund": return function sigmund (obj) { - return JSON.stringify(obj) - } - case "path": return { basename: function (f) { - f = f.split(/[\/\\]/) - var e = f.pop() - if (!e) e = f.pop() - return e - }} - case "lru-cache": return function LRUCache () { - // not quite an LRU, but still space-limited. - var cache = {} - var cnt = 0 - this.set = function (k, v) { - cnt ++ - if (cnt >= 100) cache = {} - cache[k] = v - } - this.get = function (k) { return cache[k] } - } - } - } -} - -minimatch.Minimatch = Minimatch - -var LRU = require("lru-cache") - , cache = minimatch.cache = new LRU({max: 100}) - , GLOBSTAR = minimatch.GLOBSTAR = Minimatch.GLOBSTAR = {} - , sigmund = require("sigmund") - -var path = require("path") - // any single thing other than / - // don't need to escape / when using new RegExp() - , qmark = "[^/]" - - // * => any number of characters - , star = qmark + "*?" - - // ** when dots are allowed. Anything goes, except .. and . - // not (^ or / followed by one or two dots followed by $ or /), - // followed by anything, any number of times. - , twoStarDot = "(?:(?!(?:\\\/|^)(?:\\.{1,2})($|\\\/)).)*?" - - // not a ^ or / followed by a dot, - // followed by anything, any number of times. - , twoStarNoDot = "(?:(?!(?:\\\/|^)\\.).)*?" - - // characters that need to be escaped in RegExp. - , reSpecials = charSet("().*{}+?[]^$\\!") - -// "abc" -> { a:true, b:true, c:true } -function charSet (s) { - return s.split("").reduce(function (set, c) { - set[c] = true - return set - }, {}) -} - -// normalizes slashes. -var slashSplit = /\/+/ - -minimatch.filter = filter -function filter (pattern, options) { - options = options || {} - return function (p, i, list) { - return minimatch(p, pattern, options) - } -} - -function ext (a, b) { - a = a || {} - b = b || {} - var t = {} - Object.keys(b).forEach(function (k) { - t[k] = b[k] - }) - Object.keys(a).forEach(function (k) { - t[k] = a[k] - }) - return t -} - -minimatch.defaults = function (def) { - if (!def || !Object.keys(def).length) return minimatch - - var orig = minimatch - - var m = function minimatch (p, pattern, options) { - return orig.minimatch(p, pattern, ext(def, options)) - } - - m.Minimatch = function Minimatch (pattern, options) { - return new orig.Minimatch(pattern, ext(def, options)) - } - - return m -} - -Minimatch.defaults = function (def) { - if (!def || !Object.keys(def).length) return Minimatch - return minimatch.defaults(def).Minimatch -} - - -function minimatch (p, pattern, options) { - if (typeof pattern !== "string") { - throw new TypeError("glob pattern string required") - } - - if (!options) options = {} - - // shortcut: comments match nothing. - if (!options.nocomment && pattern.charAt(0) === "#") { - return false - } - - // "" only matches "" - if (pattern.trim() === "") return p === "" - - return new Minimatch(pattern, options).match(p) -} - -function Minimatch (pattern, options) { - if (!(this instanceof Minimatch)) { - return new Minimatch(pattern, options, cache) - } - - if (typeof pattern !== "string") { - throw new TypeError("glob pattern string required") - } - - if (!options) options = {} - pattern = pattern.trim() - - // windows: need to use /, not \ - // On other platforms, \ is a valid (albeit bad) filename char. - if (platform === "win32") { - pattern = pattern.split("\\").join("/") - } - - // lru storage. - // these things aren't particularly big, but walking down the string - // and turning it into a regexp can get pretty costly. - var cacheKey = pattern + "\n" + sigmund(options) - var cached = minimatch.cache.get(cacheKey) - if (cached) return cached - minimatch.cache.set(cacheKey, this) - - this.options = options - this.set = [] - this.pattern = pattern - this.regexp = null - this.negate = false - this.comment = false - this.empty = false - - // make the set of regexps etc. - this.make() -} - -Minimatch.prototype.debug = function() {} - -Minimatch.prototype.make = make -function make () { - // don't do it more than once. - if (this._made) return - - var pattern = this.pattern - var options = this.options - - // empty patterns and comments match nothing. - if (!options.nocomment && pattern.charAt(0) === "#") { - this.comment = true - return - } - if (!pattern) { - this.empty = true - return - } - - // step 1: figure out negation, etc. - this.parseNegate() - - // step 2: expand braces - var set = this.globSet = this.braceExpand() - - if (options.debug) this.debug = console.error - - this.debug(this.pattern, set) - - // step 3: now we have a set, so turn each one into a series of path-portion - // matching patterns. - // These will be regexps, except in the case of "**", which is - // set to the GLOBSTAR object for globstar behavior, - // and will not contain any / characters - set = this.globParts = set.map(function (s) { - return s.split(slashSplit) - }) - - this.debug(this.pattern, set) - - // glob --> regexps - set = set.map(function (s, si, set) { - return s.map(this.parse, this) - }, this) - - this.debug(this.pattern, set) - - // filter out everything that didn't compile properly. - set = set.filter(function (s) { - return -1 === s.indexOf(false) - }) - - this.debug(this.pattern, set) - - this.set = set -} - -Minimatch.prototype.parseNegate = parseNegate -function parseNegate () { - var pattern = this.pattern - , negate = false - , options = this.options - , negateOffset = 0 - - if (options.nonegate) return - - for ( var i = 0, l = pattern.length - ; i < l && pattern.charAt(i) === "!" - ; i ++) { - negate = !negate - negateOffset ++ - } - - if (negateOffset) this.pattern = pattern.substr(negateOffset) - this.negate = negate -} - -// Brace expansion: -// a{b,c}d -> abd acd -// a{b,}c -> abc ac -// a{0..3}d -> a0d a1d a2d a3d -// a{b,c{d,e}f}g -> abg acdfg acefg -// a{b,c}d{e,f}g -> abdeg acdeg abdeg abdfg -// -// Invalid sets are not expanded. -// a{2..}b -> a{2..}b -// a{b}c -> a{b}c -minimatch.braceExpand = function (pattern, options) { - return new Minimatch(pattern, options).braceExpand() -} - -Minimatch.prototype.braceExpand = braceExpand -function braceExpand (pattern, options) { - options = options || this.options - pattern = typeof pattern === "undefined" - ? this.pattern : pattern - - if (typeof pattern === "undefined") { - throw new Error("undefined pattern") - } - - if (options.nobrace || - !pattern.match(/\{.*\}/)) { - // shortcut. no need to expand. - return [pattern] - } - - var escaping = false - - // examples and comments refer to this crazy pattern: - // a{b,c{d,e},{f,g}h}x{y,z} - // expected: - // abxy - // abxz - // acdxy - // acdxz - // acexy - // acexz - // afhxy - // afhxz - // aghxy - // aghxz - - // everything before the first \{ is just a prefix. - // So, we pluck that off, and work with the rest, - // and then prepend it to everything we find. - if (pattern.charAt(0) !== "{") { - this.debug(pattern) - var prefix = null - for (var i = 0, l = pattern.length; i < l; i ++) { - var c = pattern.charAt(i) - this.debug(i, c) - if (c === "\\") { - escaping = !escaping - } else if (c === "{" && !escaping) { - prefix = pattern.substr(0, i) - break - } - } - - // actually no sets, all { were escaped. - if (prefix === null) { - this.debug("no sets") - return [pattern] - } - - var tail = braceExpand.call(this, pattern.substr(i), options) - return tail.map(function (t) { - return prefix + t - }) - } - - // now we have something like: - // {b,c{d,e},{f,g}h}x{y,z} - // walk through the set, expanding each part, until - // the set ends. then, we'll expand the suffix. - // If the set only has a single member, then'll put the {} back - - // first, handle numeric sets, since they're easier - var numset = pattern.match(/^\{(-?[0-9]+)\.\.(-?[0-9]+)\}/) - if (numset) { - this.debug("numset", numset[1], numset[2]) - var suf = braceExpand.call(this, pattern.substr(numset[0].length), options) - , start = +numset[1] - , end = +numset[2] - , inc = start > end ? -1 : 1 - , set = [] - for (var i = start; i != (end + inc); i += inc) { - // append all the suffixes - for (var ii = 0, ll = suf.length; ii < ll; ii ++) { - set.push(i + suf[ii]) - } - } - return set - } - - // ok, walk through the set - // We hope, somewhat optimistically, that there - // will be a } at the end. - // If the closing brace isn't found, then the pattern is - // interpreted as braceExpand("\\" + pattern) so that - // the leading \{ will be interpreted literally. - var i = 1 // skip the \{ - , depth = 1 - , set = [] - , member = "" - , sawEnd = false - , escaping = false - - function addMember () { - set.push(member) - member = "" - } - - this.debug("Entering for") - FOR: for (i = 1, l = pattern.length; i < l; i ++) { - var c = pattern.charAt(i) - this.debug("", i, c) - - if (escaping) { - escaping = false - member += "\\" + c - } else { - switch (c) { - case "\\": - escaping = true - continue - - case "{": - depth ++ - member += "{" - continue - - case "}": - depth -- - // if this closes the actual set, then we're done - if (depth === 0) { - addMember() - // pluck off the close-brace - i ++ - break FOR - } else { - member += c - continue - } - - case ",": - if (depth === 1) { - addMember() - } else { - member += c - } - continue - - default: - member += c - continue - } // switch - } // else - } // for - - // now we've either finished the set, and the suffix is - // pattern.substr(i), or we have *not* closed the set, - // and need to escape the leading brace - if (depth !== 0) { - this.debug("didn't close", pattern) - return braceExpand.call(this, "\\" + pattern, options) - } - - // x{y,z} -> ["xy", "xz"] - this.debug("set", set) - this.debug("suffix", pattern.substr(i)) - var suf = braceExpand.call(this, pattern.substr(i), options) - // ["b", "c{d,e}","{f,g}h"] -> - // [["b"], ["cd", "ce"], ["fh", "gh"]] - var addBraces = set.length === 1 - this.debug("set pre-expanded", set) - set = set.map(function (p) { - return braceExpand.call(this, p, options) - }, this) - this.debug("set expanded", set) - - - // [["b"], ["cd", "ce"], ["fh", "gh"]] -> - // ["b", "cd", "ce", "fh", "gh"] - set = set.reduce(function (l, r) { - return l.concat(r) - }) - - if (addBraces) { - set = set.map(function (s) { - return "{" + s + "}" - }) - } - - // now attach the suffixes. - var ret = [] - for (var i = 0, l = set.length; i < l; i ++) { - for (var ii = 0, ll = suf.length; ii < ll; ii ++) { - ret.push(set[i] + suf[ii]) - } - } - return ret -} - -// parse a component of the expanded set. -// At this point, no pattern may contain "/" in it -// so we're going to return a 2d array, where each entry is the full -// pattern, split on '/', and then turned into a regular expression. -// A regexp is made at the end which joins each array with an -// escaped /, and another full one which joins each regexp with |. -// -// Following the lead of Bash 4.1, note that "**" only has special meaning -// when it is the *only* thing in a path portion. Otherwise, any series -// of * is equivalent to a single *. Globstar behavior is enabled by -// default, and can be disabled by setting options.noglobstar. -Minimatch.prototype.parse = parse -var SUBPARSE = {} -function parse (pattern, isSub) { - var options = this.options - - // shortcuts - if (!options.noglobstar && pattern === "**") return GLOBSTAR - if (pattern === "") return "" - - var re = "" - , hasMagic = !!options.nocase - , escaping = false - // ? => one single character - , patternListStack = [] - , plType - , stateChar - , inClass = false - , reClassStart = -1 - , classStart = -1 - // . and .. never match anything that doesn't start with ., - // even when options.dot is set. - , patternStart = pattern.charAt(0) === "." ? "" // anything - // not (start or / followed by . or .. followed by / or end) - : options.dot ? "(?!(?:^|\\\/)\\.{1,2}(?:$|\\\/))" - : "(?!\\.)" - , self = this - - function clearStateChar () { - if (stateChar) { - // we had some state-tracking character - // that wasn't consumed by this pass. - switch (stateChar) { - case "*": - re += star - hasMagic = true - break - case "?": - re += qmark - hasMagic = true - break - default: - re += "\\"+stateChar - break - } - self.debug('clearStateChar %j %j', stateChar, re) - stateChar = false - } - } - - for ( var i = 0, len = pattern.length, c - ; (i < len) && (c = pattern.charAt(i)) - ; i ++ ) { - - this.debug("%s\t%s %s %j", pattern, i, re, c) - - // skip over any that are escaped. - if (escaping && reSpecials[c]) { - re += "\\" + c - escaping = false - continue - } - - SWITCH: switch (c) { - case "/": - // completely not allowed, even escaped. - // Should already be path-split by now. - return false - - case "\\": - clearStateChar() - escaping = true - continue - - // the various stateChar values - // for the "extglob" stuff. - case "?": - case "*": - case "+": - case "@": - case "!": - this.debug("%s\t%s %s %j <-- stateChar", pattern, i, re, c) - - // all of those are literals inside a class, except that - // the glob [!a] means [^a] in regexp - if (inClass) { - this.debug(' in class') - if (c === "!" && i === classStart + 1) c = "^" - re += c - continue - } - - // if we already have a stateChar, then it means - // that there was something like ** or +? in there. - // Handle the stateChar, then proceed with this one. - self.debug('call clearStateChar %j', stateChar) - clearStateChar() - stateChar = c - // if extglob is disabled, then +(asdf|foo) isn't a thing. - // just clear the statechar *now*, rather than even diving into - // the patternList stuff. - if (options.noext) clearStateChar() - continue - - case "(": - if (inClass) { - re += "(" - continue - } - - if (!stateChar) { - re += "\\(" - continue - } - - plType = stateChar - patternListStack.push({ type: plType - , start: i - 1 - , reStart: re.length }) - // negation is (?:(?!js)[^/]*) - re += stateChar === "!" ? "(?:(?!" : "(?:" - this.debug('plType %j %j', stateChar, re) - stateChar = false - continue - - case ")": - if (inClass || !patternListStack.length) { - re += "\\)" - continue - } - - clearStateChar() - hasMagic = true - re += ")" - plType = patternListStack.pop().type - // negation is (?:(?!js)[^/]*) - // The others are (?:) - switch (plType) { - case "!": - re += "[^/]*?)" - break - case "?": - case "+": - case "*": re += plType - case "@": break // the default anyway - } - continue - - case "|": - if (inClass || !patternListStack.length || escaping) { - re += "\\|" - escaping = false - continue - } - - clearStateChar() - re += "|" - continue - - // these are mostly the same in regexp and glob - case "[": - // swallow any state-tracking char before the [ - clearStateChar() - - if (inClass) { - re += "\\" + c - continue - } - - inClass = true - classStart = i - reClassStart = re.length - re += c - continue - - case "]": - // a right bracket shall lose its special - // meaning and represent itself in - // a bracket expression if it occurs - // first in the list. -- POSIX.2 2.8.3.2 - if (i === classStart + 1 || !inClass) { - re += "\\" + c - escaping = false - continue - } - - // finish up the class. - hasMagic = true - inClass = false - re += c - continue - - default: - // swallow any state char that wasn't consumed - clearStateChar() - - if (escaping) { - // no need - escaping = false - } else if (reSpecials[c] - && !(c === "^" && inClass)) { - re += "\\" - } - - re += c - - } // switch - } // for - - - // handle the case where we left a class open. - // "[abc" is valid, equivalent to "\[abc" - if (inClass) { - // split where the last [ was, and escape it - // this is a huge pita. We now have to re-walk - // the contents of the would-be class to re-translate - // any characters that were passed through as-is - var cs = pattern.substr(classStart + 1) - , sp = this.parse(cs, SUBPARSE) - re = re.substr(0, reClassStart) + "\\[" + sp[0] - hasMagic = hasMagic || sp[1] - } - - // handle the case where we had a +( thing at the *end* - // of the pattern. - // each pattern list stack adds 3 chars, and we need to go through - // and escape any | chars that were passed through as-is for the regexp. - // Go through and escape them, taking care not to double-escape any - // | chars that were already escaped. - var pl - while (pl = patternListStack.pop()) { - var tail = re.slice(pl.reStart + 3) - // maybe some even number of \, then maybe 1 \, followed by a | - tail = tail.replace(/((?:\\{2})*)(\\?)\|/g, function (_, $1, $2) { - if (!$2) { - // the | isn't already escaped, so escape it. - $2 = "\\" - } - - // need to escape all those slashes *again*, without escaping the - // one that we need for escaping the | character. As it works out, - // escaping an even number of slashes can be done by simply repeating - // it exactly after itself. That's why this trick works. - // - // I am sorry that you have to see this. - return $1 + $1 + $2 + "|" - }) - - this.debug("tail=%j\n %s", tail, tail) - var t = pl.type === "*" ? star - : pl.type === "?" ? qmark - : "\\" + pl.type - - hasMagic = true - re = re.slice(0, pl.reStart) - + t + "\\(" - + tail - } - - // handle trailing things that only matter at the very end. - clearStateChar() - if (escaping) { - // trailing \\ - re += "\\\\" - } - - // only need to apply the nodot start if the re starts with - // something that could conceivably capture a dot - var addPatternStart = false - switch (re.charAt(0)) { - case ".": - case "[": - case "(": addPatternStart = true - } - - // if the re is not "" at this point, then we need to make sure - // it doesn't match against an empty path part. - // Otherwise a/* will match a/, which it should not. - if (re !== "" && hasMagic) re = "(?=.)" + re - - if (addPatternStart) re = patternStart + re - - // parsing just a piece of a larger pattern. - if (isSub === SUBPARSE) { - return [ re, hasMagic ] - } - - // skip the regexp for non-magical patterns - // unescape anything in it, though, so that it'll be - // an exact match against a file etc. - if (!hasMagic) { - return globUnescape(pattern) - } - - var flags = options.nocase ? "i" : "" - , regExp = new RegExp("^" + re + "$", flags) - - regExp._glob = pattern - regExp._src = re - - return regExp -} - -minimatch.makeRe = function (pattern, options) { - return new Minimatch(pattern, options || {}).makeRe() -} - -Minimatch.prototype.makeRe = makeRe -function makeRe () { - if (this.regexp || this.regexp === false) return this.regexp - - // at this point, this.set is a 2d array of partial - // pattern strings, or "**". - // - // It's better to use .match(). This function shouldn't - // be used, really, but it's pretty convenient sometimes, - // when you just want to work with a regex. - var set = this.set - - if (!set.length) return this.regexp = false - var options = this.options - - var twoStar = options.noglobstar ? star - : options.dot ? twoStarDot - : twoStarNoDot - , flags = options.nocase ? "i" : "" - - var re = set.map(function (pattern) { - return pattern.map(function (p) { - return (p === GLOBSTAR) ? twoStar - : (typeof p === "string") ? regExpEscape(p) - : p._src - }).join("\\\/") - }).join("|") - - // must match entire pattern - // ending in a * or ** will make it less strict. - re = "^(?:" + re + ")$" - - // can match anything, as long as it's not this. - if (this.negate) re = "^(?!" + re + ").*$" - - try { - return this.regexp = new RegExp(re, flags) - } catch (ex) { - return this.regexp = false - } -} - -minimatch.match = function (list, pattern, options) { - var mm = new Minimatch(pattern, options) - list = list.filter(function (f) { - return mm.match(f) - }) - if (options.nonull && !list.length) { - list.push(pattern) - } - return list -} - -Minimatch.prototype.match = match -function match (f, partial) { - this.debug("match", f, this.pattern) - // short-circuit in the case of busted things. - // comments, etc. - if (this.comment) return false - if (this.empty) return f === "" - - if (f === "/" && partial) return true - - var options = this.options - - // windows: need to use /, not \ - // On other platforms, \ is a valid (albeit bad) filename char. - if (platform === "win32") { - f = f.split("\\").join("/") - } - - // treat the test path as a set of pathparts. - f = f.split(slashSplit) - this.debug(this.pattern, "split", f) - - // just ONE of the pattern sets in this.set needs to match - // in order for it to be valid. If negating, then just one - // match means that we have failed. - // Either way, return on the first hit. - - var set = this.set - this.debug(this.pattern, "set", set) - - var splitFile = path.basename(f.join("/")).split("/") - - for (var i = 0, l = set.length; i < l; i ++) { - var pattern = set[i], file = f - if (options.matchBase && pattern.length === 1) { - file = splitFile - } - var hit = this.matchOne(file, pattern, partial) - if (hit) { - if (options.flipNegate) return true - return !this.negate - } - } - - // didn't get any hits. this is success if it's a negative - // pattern, failure otherwise. - if (options.flipNegate) return false - return this.negate -} - -// set partial to true to test if, for example, -// "/a/b" matches the start of "/*/b/*/d" -// Partial means, if you run out of file before you run -// out of pattern, then that's fine, as long as all -// the parts match. -Minimatch.prototype.matchOne = function (file, pattern, partial) { - var options = this.options - - this.debug("matchOne", - { "this": this - , file: file - , pattern: pattern }) - - this.debug("matchOne", file.length, pattern.length) - - for ( var fi = 0 - , pi = 0 - , fl = file.length - , pl = pattern.length - ; (fi < fl) && (pi < pl) - ; fi ++, pi ++ ) { - - this.debug("matchOne loop") - var p = pattern[pi] - , f = file[fi] - - this.debug(pattern, p, f) - - // should be impossible. - // some invalid regexp stuff in the set. - if (p === false) return false - - if (p === GLOBSTAR) { - this.debug('GLOBSTAR', [pattern, p, f]) - - // "**" - // a/**/b/**/c would match the following: - // a/b/x/y/z/c - // a/x/y/z/b/c - // a/b/x/b/x/c - // a/b/c - // To do this, take the rest of the pattern after - // the **, and see if it would match the file remainder. - // If so, return success. - // If not, the ** "swallows" a segment, and try again. - // This is recursively awful. - // - // a/**/b/**/c matching a/b/x/y/z/c - // - a matches a - // - doublestar - // - matchOne(b/x/y/z/c, b/**/c) - // - b matches b - // - doublestar - // - matchOne(x/y/z/c, c) -> no - // - matchOne(y/z/c, c) -> no - // - matchOne(z/c, c) -> no - // - matchOne(c, c) yes, hit - var fr = fi - , pr = pi + 1 - if (pr === pl) { - this.debug('** at the end') - // a ** at the end will just swallow the rest. - // We have found a match. - // however, it will not swallow /.x, unless - // options.dot is set. - // . and .. are *never* matched by **, for explosively - // exponential reasons. - for ( ; fi < fl; fi ++) { - if (file[fi] === "." || file[fi] === ".." || - (!options.dot && file[fi].charAt(0) === ".")) return false - } - return true - } - - // ok, let's see if we can swallow whatever we can. - WHILE: while (fr < fl) { - var swallowee = file[fr] - - this.debug('\nglobstar while', - file, fr, pattern, pr, swallowee) - - // XXX remove this slice. Just pass the start index. - if (this.matchOne(file.slice(fr), pattern.slice(pr), partial)) { - this.debug('globstar found match!', fr, fl, swallowee) - // found a match. - return true - } else { - // can't swallow "." or ".." ever. - // can only swallow ".foo" when explicitly asked. - if (swallowee === "." || swallowee === ".." || - (!options.dot && swallowee.charAt(0) === ".")) { - this.debug("dot detected!", file, fr, pattern, pr) - break WHILE - } - - // ** swallows a segment, and continue. - this.debug('globstar swallow a segment, and continue') - fr ++ - } - } - // no match was found. - // However, in partial mode, we can't say this is necessarily over. - // If there's more *pattern* left, then - if (partial) { - // ran out of file - this.debug("\n>>> no match, partial?", file, fr, pattern, pr) - if (fr === fl) return true - } - return false - } - - // something other than ** - // non-magic patterns just have to match exactly - // patterns with magic have been turned into regexps. - var hit - if (typeof p === "string") { - if (options.nocase) { - hit = f.toLowerCase() === p.toLowerCase() - } else { - hit = f === p - } - this.debug("string match", p, f, hit) - } else { - hit = f.match(p) - this.debug("pattern match", p, f, hit) - } - - if (!hit) return false - } - - // Note: ending in / means that we'll get a final "" - // at the end of the pattern. This can only match a - // corresponding "" at the end of the file. - // If the file ends in /, then it can only match a - // a pattern that ends in /, unless the pattern just - // doesn't have any more for it. But, a/b/ should *not* - // match "a/b/*", even though "" matches against the - // [^/]*? pattern, except in partial mode, where it might - // simply not be reached yet. - // However, a/b/ should still satisfy a/* - - // now either we fell off the end of the pattern, or we're done. - if (fi === fl && pi === pl) { - // ran out of pattern and filename at the same time. - // an exact hit! - return true - } else if (fi === fl) { - // ran out of file, but still had pattern left. - // this is ok if we're doing the match as part of - // a glob fs traversal. - return partial - } else if (pi === pl) { - // ran out of pattern, still have file left. - // this is only acceptable if we're on the very last - // empty segment of a file with a trailing slash. - // a/* should match a/b/ - var emptyFileEnd = (fi === fl - 1) && (file[fi] === "") - return emptyFileEnd - } - - // should be unreachable. - throw new Error("wtf?") -} - - -// replace stuff like \* with * -function globUnescape (s) { - return s.replace(/\\(.)/g, "$1") -} - - -function regExpEscape (s) { - return s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&") -} - -})( typeof require === "function" ? require : null, - this, - typeof module === "object" ? module : null, - typeof process === "object" ? process.platform : "win32" - ) diff --git a/node_modules/minimatch/package.json b/node_modules/minimatch/package.json deleted file mode 100644 index 814cb0a..0000000 --- a/node_modules/minimatch/package.json +++ /dev/null @@ -1,28 +0,0 @@ -{ - "author": "Isaac Z. Schlueter (http://blog.izs.me)", - "name": "minimatch", - "description": "a glob matcher in javascript", - "version": "0.2.14", - "repository": { - "type": "git", - "url": "git://github.com/isaacs/minimatch.git" - }, - "main": "minimatch.js", - "scripts": { - "test": "tap test/*.js" - }, - "engines": { - "node": "*" - }, - "dependencies": { - "lru-cache": "2", - "sigmund": "~1.0.0" - }, - "devDependencies": { - "tap": "" - }, - "license": { - "type": "MIT", - "url": "http://github.com/isaacs/minimatch/raw/master/LICENSE" - } -} diff --git a/node_modules/minimatch/test/basic.js b/node_modules/minimatch/test/basic.js deleted file mode 100644 index ae7ac73..0000000 --- a/node_modules/minimatch/test/basic.js +++ /dev/null @@ -1,399 +0,0 @@ -// http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test -// -// TODO: Some of these tests do very bad things with backslashes, and will -// most likely fail badly on windows. They should probably be skipped. - -var tap = require("tap") - , globalBefore = Object.keys(global) - , mm = require("../") - , files = [ "a", "b", "c", "d", "abc" - , "abd", "abe", "bb", "bcd" - , "ca", "cb", "dd", "de" - , "bdir/", "bdir/cfile"] - , next = files.concat([ "a-b", "aXb" - , ".x", ".y" ]) - - -var patterns = - [ "http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test" - , ["a*", ["a", "abc", "abd", "abe"]] - , ["X*", ["X*"], {nonull: true}] - - // allow null glob expansion - , ["X*", []] - - // isaacs: Slightly different than bash/sh/ksh - // \\* is not un-escaped to literal "*" in a failed match, - // but it does make it get treated as a literal star - , ["\\*", ["\\*"], {nonull: true}] - , ["\\**", ["\\**"], {nonull: true}] - , ["\\*\\*", ["\\*\\*"], {nonull: true}] - - , ["b*/", ["bdir/"]] - , ["c*", ["c", "ca", "cb"]] - , ["**", files] - - , ["\\.\\./*/", ["\\.\\./*/"], {nonull: true}] - , ["s/\\..*//", ["s/\\..*//"], {nonull: true}] - - , "legendary larry crashes bashes" - , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/" - , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"], {nonull: true}] - , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/" - , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"], {nonull: true}] - - , "character classes" - , ["[a-c]b*", ["abc", "abd", "abe", "bb", "cb"]] - , ["[a-y]*[^c]", ["abd", "abe", "bb", "bcd", - "bdir/", "ca", "cb", "dd", "de"]] - , ["a*[^c]", ["abd", "abe"]] - , function () { files.push("a-b", "aXb") } - , ["a[X-]b", ["a-b", "aXb"]] - , function () { files.push(".x", ".y") } - , ["[^a-c]*", ["d", "dd", "de"]] - , function () { files.push("a*b/", "a*b/ooo") } - , ["a\\*b/*", ["a*b/ooo"]] - , ["a\\*?/*", ["a*b/ooo"]] - , ["*\\\\!*", [], {null: true}, ["echo !7"]] - , ["*\\!*", ["echo !7"], null, ["echo !7"]] - , ["*.\\*", ["r.*"], null, ["r.*"]] - , ["a[b]c", ["abc"]] - , ["a[\\b]c", ["abc"]] - , ["a?c", ["abc"]] - , ["a\\*c", [], {null: true}, ["abc"]] - , ["", [""], { null: true }, [""]] - - , "http://www.opensource.apple.com/source/bash/bash-23/" + - "bash/tests/glob-test" - , function () { files.push("man/", "man/man1/", "man/man1/bash.1") } - , ["*/man*/bash.*", ["man/man1/bash.1"]] - , ["man/man1/bash.1", ["man/man1/bash.1"]] - , ["a***c", ["abc"], null, ["abc"]] - , ["a*****?c", ["abc"], null, ["abc"]] - , ["?*****??", ["abc"], null, ["abc"]] - , ["*****??", ["abc"], null, ["abc"]] - , ["?*****?c", ["abc"], null, ["abc"]] - , ["?***?****c", ["abc"], null, ["abc"]] - , ["?***?****?", ["abc"], null, ["abc"]] - , ["?***?****", ["abc"], null, ["abc"]] - , ["*******c", ["abc"], null, ["abc"]] - , ["*******?", ["abc"], null, ["abc"]] - , ["a*cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a**?**cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a**?**cd**?**??k***", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a**?**cd**?**??***k", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a**?**cd**?**??***k**", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a****c**?**??*****", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["[-abc]", ["-"], null, ["-"]] - , ["[abc-]", ["-"], null, ["-"]] - , ["\\", ["\\"], null, ["\\"]] - , ["[\\\\]", ["\\"], null, ["\\"]] - , ["[[]", ["["], null, ["["]] - , ["[", ["["], null, ["["]] - , ["[*", ["[abc"], null, ["[abc"]] - , "a right bracket shall lose its special meaning and\n" + - "represent itself in a bracket expression if it occurs\n" + - "first in the list. -- POSIX.2 2.8.3.2" - , ["[]]", ["]"], null, ["]"]] - , ["[]-]", ["]"], null, ["]"]] - , ["[a-\z]", ["p"], null, ["p"]] - , ["??**********?****?", [], { null: true }, ["abc"]] - , ["??**********?****c", [], { null: true }, ["abc"]] - , ["?************c****?****", [], { null: true }, ["abc"]] - , ["*c*?**", [], { null: true }, ["abc"]] - , ["a*****c*?**", [], { null: true }, ["abc"]] - , ["a********???*******", [], { null: true }, ["abc"]] - , ["[]", [], { null: true }, ["a"]] - , ["[abc", [], { null: true }, ["["]] - - , "nocase tests" - , ["XYZ", ["xYz"], { nocase: true, null: true } - , ["xYz", "ABC", "IjK"]] - , ["ab*", ["ABC"], { nocase: true, null: true } - , ["xYz", "ABC", "IjK"]] - , ["[ia]?[ck]", ["ABC", "IjK"], { nocase: true, null: true } - , ["xYz", "ABC", "IjK"]] - - // [ pattern, [matches], MM opts, files, TAP opts] - , "onestar/twostar" - , ["{/*,*}", [], {null: true}, ["/asdf/asdf/asdf"]] - , ["{/?,*}", ["/a", "bb"], {null: true} - , ["/a", "/b/b", "/a/b/c", "bb"]] - - , "dots should not match unless requested" - , ["**", ["a/b"], {}, ["a/b", "a/.d", ".a/.d"]] - - // .. and . can only match patterns starting with ., - // even when options.dot is set. - , function () { - files = ["a/./b", "a/../b", "a/c/b", "a/.d/b"] - } - , ["a/*/b", ["a/c/b", "a/.d/b"], {dot: true}] - , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: true}] - , ["a/*/b", ["a/c/b"], {dot:false}] - , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: false}] - - - // this also tests that changing the options needs - // to change the cache key, even if the pattern is - // the same! - , ["**", ["a/b","a/.d",".a/.d"], { dot: true } - , [ ".a/.d", "a/.d", "a/b"]] - - , "paren sets cannot contain slashes" - , ["*(a/b)", ["*(a/b)"], {nonull: true}, ["a/b"]] - - // brace sets trump all else. - // - // invalid glob pattern. fails on bash4 and bsdglob. - // however, in this implementation, it's easier just - // to do the intuitive thing, and let brace-expansion - // actually come before parsing any extglob patterns, - // like the documentation seems to say. - // - // XXX: if anyone complains about this, either fix it - // or tell them to grow up and stop complaining. - // - // bash/bsdglob says this: - // , ["*(a|{b),c)}", ["*(a|{b),c)}"], {}, ["a", "ab", "ac", "ad"]] - // but we do this instead: - , ["*(a|{b),c)}", ["a", "ab", "ac"], {}, ["a", "ab", "ac", "ad"]] - - // test partial parsing in the presence of comment/negation chars - , ["[!a*", ["[!ab"], {}, ["[!ab", "[ab"]] - , ["[#a*", ["[#ab"], {}, ["[#ab", "[ab"]] - - // like: {a,b|c\\,d\\\|e} except it's unclosed, so it has to be escaped. - , ["+(a|*\\|c\\\\|d\\\\\\|e\\\\\\\\|f\\\\\\\\\\|g" - , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g"] - , {} - , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g", "a", "b\\c"]] - - - // crazy nested {,,} and *(||) tests. - , function () { - files = [ "a", "b", "c", "d" - , "ab", "ac", "ad" - , "bc", "cb" - , "bc,d", "c,db", "c,d" - , "d)", "(b|c", "*(b|c" - , "b|c", "b|cc", "cb|c" - , "x(a|b|c)", "x(a|c)" - , "(a|b|c)", "(a|c)"] - } - , ["*(a|{b,c})", ["a", "b", "c", "ab", "ac"]] - , ["{a,*(b|c,d)}", ["a","(b|c", "*(b|c", "d)"]] - // a - // *(b|c) - // *(b|d) - , ["{a,*(b|{c,d})}", ["a","b", "bc", "cb", "c", "d"]] - , ["*(a|{b|c,c})", ["a", "b", "c", "ab", "ac", "bc", "cb"]] - - - // test various flag settings. - , [ "*(a|{b|c,c})", ["x(a|b|c)", "x(a|c)", "(a|b|c)", "(a|c)"] - , { noext: true } ] - , ["a?b", ["x/y/acb", "acb/"], {matchBase: true} - , ["x/y/acb", "acb/", "acb/d/e", "x/y/acb/d"] ] - , ["#*", ["#a", "#b"], {nocomment: true}, ["#a", "#b", "c#d"]] - - - // begin channelling Boole and deMorgan... - , "negation tests" - , function () { - files = ["d", "e", "!ab", "!abc", "a!b", "\\!a"] - } - - // anything that is NOT a* matches. - , ["!a*", ["\\!a", "d", "e", "!ab", "!abc"]] - - // anything that IS !a* matches. - , ["!a*", ["!ab", "!abc"], {nonegate: true}] - - // anything that IS a* matches - , ["!!a*", ["a!b"]] - - // anything that is NOT !a* matches - , ["!\\!a*", ["a!b", "d", "e", "\\!a"]] - - // negation nestled within a pattern - , function () { - files = [ "foo.js" - , "foo.bar" - // can't match this one without negative lookbehind. - , "foo.js.js" - , "blar.js" - , "foo." - , "boo.js.boo" ] - } - , ["*.!(js)", ["foo.bar", "foo.", "boo.js.boo"] ] - - // https://github.com/isaacs/minimatch/issues/5 - , function () { - files = [ 'a/b/.x/c' - , 'a/b/.x/c/d' - , 'a/b/.x/c/d/e' - , 'a/b/.x' - , 'a/b/.x/' - , 'a/.x/b' - , '.x' - , '.x/' - , '.x/a' - , '.x/a/b' - , 'a/.x/b/.x/c' - , '.x/.x' ] - } - , ["**/.x/**", [ '.x/' - , '.x/a' - , '.x/a/b' - , 'a/.x/b' - , 'a/b/.x/' - , 'a/b/.x/c' - , 'a/b/.x/c/d' - , 'a/b/.x/c/d/e' ] ] - - ] - -var regexps = - [ '/^(?:(?=.)a[^/]*?)$/', - '/^(?:(?=.)X[^/]*?)$/', - '/^(?:(?=.)X[^/]*?)$/', - '/^(?:\\*)$/', - '/^(?:(?=.)\\*[^/]*?)$/', - '/^(?:\\*\\*)$/', - '/^(?:(?=.)b[^/]*?\\/)$/', - '/^(?:(?=.)c[^/]*?)$/', - '/^(?:(?:(?!(?:\\/|^)\\.).)*?)$/', - '/^(?:\\.\\.\\/(?!\\.)(?=.)[^/]*?\\/)$/', - '/^(?:s\\/(?=.)\\.\\.[^/]*?\\/)$/', - '/^(?:\\/\\^root:\\/\\{s\\/(?=.)\\^[^:][^/]*?:[^:][^/]*?:\\([^:]\\)[^/]*?\\.[^/]*?\\$\\/1\\/)$/', - '/^(?:\\/\\^root:\\/\\{s\\/(?=.)\\^[^:][^/]*?:[^:][^/]*?:\\([^:]\\)[^/]*?\\.[^/]*?\\$\\/\u0001\\/)$/', - '/^(?:(?!\\.)(?=.)[a-c]b[^/]*?)$/', - '/^(?:(?!\\.)(?=.)[a-y][^/]*?[^c])$/', - '/^(?:(?=.)a[^/]*?[^c])$/', - '/^(?:(?=.)a[X-]b)$/', - '/^(?:(?!\\.)(?=.)[^a-c][^/]*?)$/', - '/^(?:a\\*b\\/(?!\\.)(?=.)[^/]*?)$/', - '/^(?:(?=.)a\\*[^/]\\/(?!\\.)(?=.)[^/]*?)$/', - '/^(?:(?!\\.)(?=.)[^/]*?\\\\\\![^/]*?)$/', - '/^(?:(?!\\.)(?=.)[^/]*?\\![^/]*?)$/', - '/^(?:(?!\\.)(?=.)[^/]*?\\.\\*)$/', - '/^(?:(?=.)a[b]c)$/', - '/^(?:(?=.)a[b]c)$/', - '/^(?:(?=.)a[^/]c)$/', - '/^(?:a\\*c)$/', - 'false', - '/^(?:(?!\\.)(?=.)[^/]*?\\/(?=.)man[^/]*?\\/(?=.)bash\\.[^/]*?)$/', - '/^(?:man\\/man1\\/bash\\.1)$/', - '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?c)$/', - '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]c)$/', - '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/])$/', - '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/])$/', - '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]c)$/', - '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?c)$/', - '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/])$/', - '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?)$/', - '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c)$/', - '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/])$/', - '/^(?:(?=.)a[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k)$/', - '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k)$/', - '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k[^/]*?[^/]*?[^/]*?)$/', - '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?k)$/', - '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?k[^/]*?[^/]*?)$/', - '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?)$/', - '/^(?:(?!\\.)(?=.)[-abc])$/', - '/^(?:(?!\\.)(?=.)[abc-])$/', - '/^(?:\\\\)$/', - '/^(?:(?!\\.)(?=.)[\\\\])$/', - '/^(?:(?!\\.)(?=.)[\\[])$/', - '/^(?:\\[)$/', - '/^(?:(?=.)\\[(?!\\.)(?=.)[^/]*?)$/', - '/^(?:(?!\\.)(?=.)[\\]])$/', - '/^(?:(?!\\.)(?=.)[\\]-])$/', - '/^(?:(?!\\.)(?=.)[a-z])$/', - '/^(?:(?!\\.)(?=.)[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/])$/', - '/^(?:(?!\\.)(?=.)[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?c)$/', - '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?)$/', - '/^(?:(?!\\.)(?=.)[^/]*?c[^/]*?[^/][^/]*?[^/]*?)$/', - '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/][^/]*?[^/]*?)$/', - '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?)$/', - '/^(?:\\[\\])$/', - '/^(?:\\[abc)$/', - '/^(?:(?=.)XYZ)$/i', - '/^(?:(?=.)ab[^/]*?)$/i', - '/^(?:(?!\\.)(?=.)[ia][^/][ck])$/i', - '/^(?:\\/(?!\\.)(?=.)[^/]*?|(?!\\.)(?=.)[^/]*?)$/', - '/^(?:\\/(?!\\.)(?=.)[^/]|(?!\\.)(?=.)[^/]*?)$/', - '/^(?:(?:(?!(?:\\/|^)\\.).)*?)$/', - '/^(?:a\\/(?!(?:^|\\/)\\.{1,2}(?:$|\\/))(?=.)[^/]*?\\/b)$/', - '/^(?:a\\/(?=.)\\.[^/]*?\\/b)$/', - '/^(?:a\\/(?!\\.)(?=.)[^/]*?\\/b)$/', - '/^(?:a\\/(?=.)\\.[^/]*?\\/b)$/', - '/^(?:(?:(?!(?:\\/|^)(?:\\.{1,2})($|\\/)).)*?)$/', - '/^(?:(?!\\.)(?=.)[^/]*?\\(a\\/b\\))$/', - '/^(?:(?!\\.)(?=.)(?:a|b)*|(?!\\.)(?=.)(?:a|c)*)$/', - '/^(?:(?=.)\\[(?=.)\\!a[^/]*?)$/', - '/^(?:(?=.)\\[(?=.)#a[^/]*?)$/', - '/^(?:(?=.)\\+\\(a\\|[^/]*?\\|c\\\\\\\\\\|d\\\\\\\\\\|e\\\\\\\\\\\\\\\\\\|f\\\\\\\\\\\\\\\\\\|g)$/', - '/^(?:(?!\\.)(?=.)(?:a|b)*|(?!\\.)(?=.)(?:a|c)*)$/', - '/^(?:a|(?!\\.)(?=.)[^/]*?\\(b\\|c|d\\))$/', - '/^(?:a|(?!\\.)(?=.)(?:b|c)*|(?!\\.)(?=.)(?:b|d)*)$/', - '/^(?:(?!\\.)(?=.)(?:a|b|c)*|(?!\\.)(?=.)(?:a|c)*)$/', - '/^(?:(?!\\.)(?=.)[^/]*?\\(a\\|b\\|c\\)|(?!\\.)(?=.)[^/]*?\\(a\\|c\\))$/', - '/^(?:(?=.)a[^/]b)$/', - '/^(?:(?=.)#[^/]*?)$/', - '/^(?!^(?:(?=.)a[^/]*?)$).*$/', - '/^(?:(?=.)\\!a[^/]*?)$/', - '/^(?:(?=.)a[^/]*?)$/', - '/^(?!^(?:(?=.)\\!a[^/]*?)$).*$/', - '/^(?:(?!\\.)(?=.)[^/]*?\\.(?:(?!js)[^/]*?))$/', - '/^(?:(?:(?!(?:\\/|^)\\.).)*?\\/\\.x\\/(?:(?!(?:\\/|^)\\.).)*?)$/' ] -var re = 0; - -tap.test("basic tests", function (t) { - var start = Date.now() - - // [ pattern, [matches], MM opts, files, TAP opts] - patterns.forEach(function (c) { - if (typeof c === "function") return c() - if (typeof c === "string") return t.comment(c) - - var pattern = c[0] - , expect = c[1].sort(alpha) - , options = c[2] || {} - , f = c[3] || files - , tapOpts = c[4] || {} - - // options.debug = true - var m = new mm.Minimatch(pattern, options) - var r = m.makeRe() - var expectRe = regexps[re++] - tapOpts.re = String(r) || JSON.stringify(r) - tapOpts.files = JSON.stringify(f) - tapOpts.pattern = pattern - tapOpts.set = m.set - tapOpts.negated = m.negate - - var actual = mm.match(f, pattern, options) - actual.sort(alpha) - - t.equivalent( actual, expect - , JSON.stringify(pattern) + " " + JSON.stringify(expect) - , tapOpts ) - - t.equal(tapOpts.re, expectRe, tapOpts) - }) - - t.comment("time=" + (Date.now() - start) + "ms") - t.end() -}) - -tap.test("global leak test", function (t) { - var globalAfter = Object.keys(global) - t.equivalent(globalAfter, globalBefore, "no new globals, please") - t.end() -}) - -function alpha (a, b) { - return a > b ? 1 : -1 -} diff --git a/node_modules/minimatch/test/brace-expand.js b/node_modules/minimatch/test/brace-expand.js deleted file mode 100644 index 7ee278a..0000000 --- a/node_modules/minimatch/test/brace-expand.js +++ /dev/null @@ -1,33 +0,0 @@ -var tap = require("tap") - , minimatch = require("../") - -tap.test("brace expansion", function (t) { - // [ pattern, [expanded] ] - ; [ [ "a{b,c{d,e},{f,g}h}x{y,z}" - , [ "abxy" - , "abxz" - , "acdxy" - , "acdxz" - , "acexy" - , "acexz" - , "afhxy" - , "afhxz" - , "aghxy" - , "aghxz" ] ] - , [ "a{1..5}b" - , [ "a1b" - , "a2b" - , "a3b" - , "a4b" - , "a5b" ] ] - , [ "a{b}c", ["a{b}c"] ] - ].forEach(function (tc) { - var p = tc[0] - , expect = tc[1] - t.equivalent(minimatch.braceExpand(p), expect, p) - }) - console.error("ending") - t.end() -}) - - diff --git a/node_modules/minimatch/test/caching.js b/node_modules/minimatch/test/caching.js deleted file mode 100644 index 0fec4b0..0000000 --- a/node_modules/minimatch/test/caching.js +++ /dev/null @@ -1,14 +0,0 @@ -var Minimatch = require("../minimatch.js").Minimatch -var tap = require("tap") -tap.test("cache test", function (t) { - var mm1 = new Minimatch("a?b") - var mm2 = new Minimatch("a?b") - t.equal(mm1, mm2, "should get the same object") - // the lru should drop it after 100 entries - for (var i = 0; i < 100; i ++) { - new Minimatch("a"+i) - } - mm2 = new Minimatch("a?b") - t.notEqual(mm1, mm2, "cache should have dropped") - t.end() -}) diff --git a/node_modules/minimatch/test/defaults.js b/node_modules/minimatch/test/defaults.js deleted file mode 100644 index 25f1f60..0000000 --- a/node_modules/minimatch/test/defaults.js +++ /dev/null @@ -1,274 +0,0 @@ -// http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test -// -// TODO: Some of these tests do very bad things with backslashes, and will -// most likely fail badly on windows. They should probably be skipped. - -var tap = require("tap") - , globalBefore = Object.keys(global) - , mm = require("../") - , files = [ "a", "b", "c", "d", "abc" - , "abd", "abe", "bb", "bcd" - , "ca", "cb", "dd", "de" - , "bdir/", "bdir/cfile"] - , next = files.concat([ "a-b", "aXb" - , ".x", ".y" ]) - -tap.test("basic tests", function (t) { - var start = Date.now() - - // [ pattern, [matches], MM opts, files, TAP opts] - ; [ "http://www.bashcookbook.com/bashinfo" + - "/source/bash-1.14.7/tests/glob-test" - , ["a*", ["a", "abc", "abd", "abe"]] - , ["X*", ["X*"], {nonull: true}] - - // allow null glob expansion - , ["X*", []] - - // isaacs: Slightly different than bash/sh/ksh - // \\* is not un-escaped to literal "*" in a failed match, - // but it does make it get treated as a literal star - , ["\\*", ["\\*"], {nonull: true}] - , ["\\**", ["\\**"], {nonull: true}] - , ["\\*\\*", ["\\*\\*"], {nonull: true}] - - , ["b*/", ["bdir/"]] - , ["c*", ["c", "ca", "cb"]] - , ["**", files] - - , ["\\.\\./*/", ["\\.\\./*/"], {nonull: true}] - , ["s/\\..*//", ["s/\\..*//"], {nonull: true}] - - , "legendary larry crashes bashes" - , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/" - , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"], {nonull: true}] - , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/" - , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"], {nonull: true}] - - , "character classes" - , ["[a-c]b*", ["abc", "abd", "abe", "bb", "cb"]] - , ["[a-y]*[^c]", ["abd", "abe", "bb", "bcd", - "bdir/", "ca", "cb", "dd", "de"]] - , ["a*[^c]", ["abd", "abe"]] - , function () { files.push("a-b", "aXb") } - , ["a[X-]b", ["a-b", "aXb"]] - , function () { files.push(".x", ".y") } - , ["[^a-c]*", ["d", "dd", "de"]] - , function () { files.push("a*b/", "a*b/ooo") } - , ["a\\*b/*", ["a*b/ooo"]] - , ["a\\*?/*", ["a*b/ooo"]] - , ["*\\\\!*", [], {null: true}, ["echo !7"]] - , ["*\\!*", ["echo !7"], null, ["echo !7"]] - , ["*.\\*", ["r.*"], null, ["r.*"]] - , ["a[b]c", ["abc"]] - , ["a[\\b]c", ["abc"]] - , ["a?c", ["abc"]] - , ["a\\*c", [], {null: true}, ["abc"]] - , ["", [""], { null: true }, [""]] - - , "http://www.opensource.apple.com/source/bash/bash-23/" + - "bash/tests/glob-test" - , function () { files.push("man/", "man/man1/", "man/man1/bash.1") } - , ["*/man*/bash.*", ["man/man1/bash.1"]] - , ["man/man1/bash.1", ["man/man1/bash.1"]] - , ["a***c", ["abc"], null, ["abc"]] - , ["a*****?c", ["abc"], null, ["abc"]] - , ["?*****??", ["abc"], null, ["abc"]] - , ["*****??", ["abc"], null, ["abc"]] - , ["?*****?c", ["abc"], null, ["abc"]] - , ["?***?****c", ["abc"], null, ["abc"]] - , ["?***?****?", ["abc"], null, ["abc"]] - , ["?***?****", ["abc"], null, ["abc"]] - , ["*******c", ["abc"], null, ["abc"]] - , ["*******?", ["abc"], null, ["abc"]] - , ["a*cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a**?**cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a**?**cd**?**??k***", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a**?**cd**?**??***k", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a**?**cd**?**??***k**", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["a****c**?**??*****", ["abcdecdhjk"], null, ["abcdecdhjk"]] - , ["[-abc]", ["-"], null, ["-"]] - , ["[abc-]", ["-"], null, ["-"]] - , ["\\", ["\\"], null, ["\\"]] - , ["[\\\\]", ["\\"], null, ["\\"]] - , ["[[]", ["["], null, ["["]] - , ["[", ["["], null, ["["]] - , ["[*", ["[abc"], null, ["[abc"]] - , "a right bracket shall lose its special meaning and\n" + - "represent itself in a bracket expression if it occurs\n" + - "first in the list. -- POSIX.2 2.8.3.2" - , ["[]]", ["]"], null, ["]"]] - , ["[]-]", ["]"], null, ["]"]] - , ["[a-\z]", ["p"], null, ["p"]] - , ["??**********?****?", [], { null: true }, ["abc"]] - , ["??**********?****c", [], { null: true }, ["abc"]] - , ["?************c****?****", [], { null: true }, ["abc"]] - , ["*c*?**", [], { null: true }, ["abc"]] - , ["a*****c*?**", [], { null: true }, ["abc"]] - , ["a********???*******", [], { null: true }, ["abc"]] - , ["[]", [], { null: true }, ["a"]] - , ["[abc", [], { null: true }, ["["]] - - , "nocase tests" - , ["XYZ", ["xYz"], { nocase: true, null: true } - , ["xYz", "ABC", "IjK"]] - , ["ab*", ["ABC"], { nocase: true, null: true } - , ["xYz", "ABC", "IjK"]] - , ["[ia]?[ck]", ["ABC", "IjK"], { nocase: true, null: true } - , ["xYz", "ABC", "IjK"]] - - // [ pattern, [matches], MM opts, files, TAP opts] - , "onestar/twostar" - , ["{/*,*}", [], {null: true}, ["/asdf/asdf/asdf"]] - , ["{/?,*}", ["/a", "bb"], {null: true} - , ["/a", "/b/b", "/a/b/c", "bb"]] - - , "dots should not match unless requested" - , ["**", ["a/b"], {}, ["a/b", "a/.d", ".a/.d"]] - - // .. and . can only match patterns starting with ., - // even when options.dot is set. - , function () { - files = ["a/./b", "a/../b", "a/c/b", "a/.d/b"] - } - , ["a/*/b", ["a/c/b", "a/.d/b"], {dot: true}] - , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: true}] - , ["a/*/b", ["a/c/b"], {dot:false}] - , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: false}] - - - // this also tests that changing the options needs - // to change the cache key, even if the pattern is - // the same! - , ["**", ["a/b","a/.d",".a/.d"], { dot: true } - , [ ".a/.d", "a/.d", "a/b"]] - - , "paren sets cannot contain slashes" - , ["*(a/b)", ["*(a/b)"], {nonull: true}, ["a/b"]] - - // brace sets trump all else. - // - // invalid glob pattern. fails on bash4 and bsdglob. - // however, in this implementation, it's easier just - // to do the intuitive thing, and let brace-expansion - // actually come before parsing any extglob patterns, - // like the documentation seems to say. - // - // XXX: if anyone complains about this, either fix it - // or tell them to grow up and stop complaining. - // - // bash/bsdglob says this: - // , ["*(a|{b),c)}", ["*(a|{b),c)}"], {}, ["a", "ab", "ac", "ad"]] - // but we do this instead: - , ["*(a|{b),c)}", ["a", "ab", "ac"], {}, ["a", "ab", "ac", "ad"]] - - // test partial parsing in the presence of comment/negation chars - , ["[!a*", ["[!ab"], {}, ["[!ab", "[ab"]] - , ["[#a*", ["[#ab"], {}, ["[#ab", "[ab"]] - - // like: {a,b|c\\,d\\\|e} except it's unclosed, so it has to be escaped. - , ["+(a|*\\|c\\\\|d\\\\\\|e\\\\\\\\|f\\\\\\\\\\|g" - , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g"] - , {} - , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g", "a", "b\\c"]] - - - // crazy nested {,,} and *(||) tests. - , function () { - files = [ "a", "b", "c", "d" - , "ab", "ac", "ad" - , "bc", "cb" - , "bc,d", "c,db", "c,d" - , "d)", "(b|c", "*(b|c" - , "b|c", "b|cc", "cb|c" - , "x(a|b|c)", "x(a|c)" - , "(a|b|c)", "(a|c)"] - } - , ["*(a|{b,c})", ["a", "b", "c", "ab", "ac"]] - , ["{a,*(b|c,d)}", ["a","(b|c", "*(b|c", "d)"]] - // a - // *(b|c) - // *(b|d) - , ["{a,*(b|{c,d})}", ["a","b", "bc", "cb", "c", "d"]] - , ["*(a|{b|c,c})", ["a", "b", "c", "ab", "ac", "bc", "cb"]] - - - // test various flag settings. - , [ "*(a|{b|c,c})", ["x(a|b|c)", "x(a|c)", "(a|b|c)", "(a|c)"] - , { noext: true } ] - , ["a?b", ["x/y/acb", "acb/"], {matchBase: true} - , ["x/y/acb", "acb/", "acb/d/e", "x/y/acb/d"] ] - , ["#*", ["#a", "#b"], {nocomment: true}, ["#a", "#b", "c#d"]] - - - // begin channelling Boole and deMorgan... - , "negation tests" - , function () { - files = ["d", "e", "!ab", "!abc", "a!b", "\\!a"] - } - - // anything that is NOT a* matches. - , ["!a*", ["\\!a", "d", "e", "!ab", "!abc"]] - - // anything that IS !a* matches. - , ["!a*", ["!ab", "!abc"], {nonegate: true}] - - // anything that IS a* matches - , ["!!a*", ["a!b"]] - - // anything that is NOT !a* matches - , ["!\\!a*", ["a!b", "d", "e", "\\!a"]] - - // negation nestled within a pattern - , function () { - files = [ "foo.js" - , "foo.bar" - // can't match this one without negative lookbehind. - , "foo.js.js" - , "blar.js" - , "foo." - , "boo.js.boo" ] - } - , ["*.!(js)", ["foo.bar", "foo.", "boo.js.boo"] ] - - ].forEach(function (c) { - if (typeof c === "function") return c() - if (typeof c === "string") return t.comment(c) - - var pattern = c[0] - , expect = c[1].sort(alpha) - , options = c[2] || {} - , f = c[3] || files - , tapOpts = c[4] || {} - - // options.debug = true - var Class = mm.defaults(options).Minimatch - var m = new Class(pattern, {}) - var r = m.makeRe() - tapOpts.re = String(r) || JSON.stringify(r) - tapOpts.files = JSON.stringify(f) - tapOpts.pattern = pattern - tapOpts.set = m.set - tapOpts.negated = m.negate - - var actual = mm.match(f, pattern, options) - actual.sort(alpha) - - t.equivalent( actual, expect - , JSON.stringify(pattern) + " " + JSON.stringify(expect) - , tapOpts ) - }) - - t.comment("time=" + (Date.now() - start) + "ms") - t.end() -}) - -tap.test("global leak test", function (t) { - var globalAfter = Object.keys(global) - t.equivalent(globalAfter, globalBefore, "no new globals, please") - t.end() -}) - -function alpha (a, b) { - return a > b ? 1 : -1 -} diff --git a/node_modules/minimatch/test/extglob-ending-with-state-char.js b/node_modules/minimatch/test/extglob-ending-with-state-char.js deleted file mode 100644 index 6676e26..0000000 --- a/node_modules/minimatch/test/extglob-ending-with-state-char.js +++ /dev/null @@ -1,8 +0,0 @@ -var test = require('tap').test -var minimatch = require('../') - -test('extglob ending with statechar', function(t) { - t.notOk(minimatch('ax', 'a?(b*)')) - t.ok(minimatch('ax', '?(a*|b)')) - t.end() -}) diff --git a/node_modules/mkdirp/.npmignore b/node_modules/mkdirp/.npmignore deleted file mode 100644 index 9303c34..0000000 --- a/node_modules/mkdirp/.npmignore +++ /dev/null @@ -1,2 +0,0 @@ -node_modules/ -npm-debug.log \ No newline at end of file diff --git a/node_modules/mkdirp/.travis.yml b/node_modules/mkdirp/.travis.yml deleted file mode 100644 index 84fd7ca..0000000 --- a/node_modules/mkdirp/.travis.yml +++ /dev/null @@ -1,5 +0,0 @@ -language: node_js -node_js: - - 0.6 - - 0.8 - - 0.9 diff --git a/node_modules/mkdirp/LICENSE b/node_modules/mkdirp/LICENSE deleted file mode 100644 index 432d1ae..0000000 --- a/node_modules/mkdirp/LICENSE +++ /dev/null @@ -1,21 +0,0 @@ -Copyright 2010 James Halliday (mail@substack.net) - -This project is free software released under the MIT/X11 license: - -Permission is hereby granted, free of charge, to any person obtaining a copy -of this software and associated documentation files (the "Software"), to deal -in the Software without restriction, including without limitation the rights -to use, copy, modify, merge, publish, distribute, sublicense, and/or sell -copies of the Software, and to permit persons to whom the Software is -furnished to do so, subject to the following conditions: - -The above copyright notice and this permission notice shall be included in -all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR -IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, -FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE -AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, -OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN -THE SOFTWARE. diff --git a/node_modules/mkdirp/examples/pow.js b/node_modules/mkdirp/examples/pow.js deleted file mode 100644 index e692421..0000000 --- a/node_modules/mkdirp/examples/pow.js +++ /dev/null @@ -1,6 +0,0 @@ -var mkdirp = require('mkdirp'); - -mkdirp('/tmp/foo/bar/baz', function (err) { - if (err) console.error(err) - else console.log('pow!') -}); diff --git a/node_modules/mkdirp/index.js b/node_modules/mkdirp/index.js deleted file mode 100644 index fda6de8..0000000 --- a/node_modules/mkdirp/index.js +++ /dev/null @@ -1,82 +0,0 @@ -var path = require('path'); -var fs = require('fs'); - -module.exports = mkdirP.mkdirp = mkdirP.mkdirP = mkdirP; - -function mkdirP (p, mode, f, made) { - if (typeof mode === 'function' || mode === undefined) { - f = mode; - mode = 0777 & (~process.umask()); - } - if (!made) made = null; - - var cb = f || function () {}; - if (typeof mode === 'string') mode = parseInt(mode, 8); - p = path.resolve(p); - - fs.mkdir(p, mode, function (er) { - if (!er) { - made = made || p; - return cb(null, made); - } - switch (er.code) { - case 'ENOENT': - mkdirP(path.dirname(p), mode, function (er, made) { - if (er) cb(er, made); - else mkdirP(p, mode, cb, made); - }); - break; - - // In the case of any other error, just see if there's a dir - // there already. If so, then hooray! If not, then something - // is borked. - default: - fs.stat(p, function (er2, stat) { - // if the stat fails, then that's super weird. - // let the original error be the failure reason. - if (er2 || !stat.isDirectory()) cb(er, made) - else cb(null, made); - }); - break; - } - }); -} - -mkdirP.sync = function sync (p, mode, made) { - if (mode === undefined) { - mode = 0777 & (~process.umask()); - } - if (!made) made = null; - - if (typeof mode === 'string') mode = parseInt(mode, 8); - p = path.resolve(p); - - try { - fs.mkdirSync(p, mode); - made = made || p; - } - catch (err0) { - switch (err0.code) { - case 'ENOENT' : - made = sync(path.dirname(p), mode, made); - sync(p, mode, made); - break; - - // In the case of any other error, just see if there's a dir - // there already. If so, then hooray! If not, then something - // is borked. - default: - var stat; - try { - stat = fs.statSync(p); - } - catch (err1) { - throw err0; - } - if (!stat.isDirectory()) throw err0; - break; - } - } - - return made; -}; diff --git a/node_modules/mkdirp/package.json b/node_modules/mkdirp/package.json deleted file mode 100644 index 8aa64fe..0000000 --- a/node_modules/mkdirp/package.json +++ /dev/null @@ -1,22 +0,0 @@ -{ - "name" : "mkdirp", - "description" : "Recursively mkdir, like `mkdir -p`", - "version" : "0.3.5", - "author" : "James Halliday (http://substack.net)", - "main" : "./index", - "keywords" : [ - "mkdir", - "directory" - ], - "repository" : { - "type" : "git", - "url" : "http://github.com/substack/node-mkdirp.git" - }, - "scripts" : { - "test" : "tap test/*.js" - }, - "devDependencies" : { - "tap" : "~0.4.0" - }, - "license" : "MIT" -} diff --git a/node_modules/mkdirp/readme.markdown b/node_modules/mkdirp/readme.markdown deleted file mode 100644 index 83b0216..0000000 --- a/node_modules/mkdirp/readme.markdown +++ /dev/null @@ -1,63 +0,0 @@ -# mkdirp - -Like `mkdir -p`, but in node.js! - -[![build status](https://secure.travis-ci.org/substack/node-mkdirp.png)](http://travis-ci.org/substack/node-mkdirp) - -# example - -## pow.js - -```js -var mkdirp = require('mkdirp'); - -mkdirp('/tmp/foo/bar/baz', function (err) { - if (err) console.error(err) - else console.log('pow!') -}); -``` - -Output - -``` -pow! -``` - -And now /tmp/foo/bar/baz exists, huzzah! - -# methods - -```js -var mkdirp = require('mkdirp'); -``` - -## mkdirp(dir, mode, cb) - -Create a new directory and any necessary subdirectories at `dir` with octal -permission string `mode`. - -If `mode` isn't specified, it defaults to `0777 & (~process.umask())`. - -`cb(err, made)` fires with the error or the first directory `made` -that had to be created, if any. - -## mkdirp.sync(dir, mode) - -Synchronously create a new directory and any necessary subdirectories at `dir` -with octal permission string `mode`. - -If `mode` isn't specified, it defaults to `0777 & (~process.umask())`. - -Returns the first directory that had to be created, if any. - -# install - -With [npm](http://npmjs.org) do: - -``` -npm install mkdirp -``` - -# license - -MIT diff --git a/node_modules/mkdirp/test/chmod.js b/node_modules/mkdirp/test/chmod.js deleted file mode 100644 index 520dcb8..0000000 --- a/node_modules/mkdirp/test/chmod.js +++ /dev/null @@ -1,38 +0,0 @@ -var mkdirp = require('../').mkdirp; -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -var ps = [ '', 'tmp' ]; - -for (var i = 0; i < 25; i++) { - var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - ps.push(dir); -} - -var file = ps.join('/'); - -test('chmod-pre', function (t) { - var mode = 0744 - mkdirp(file, mode, function (er) { - t.ifError(er, 'should not error'); - fs.stat(file, function (er, stat) { - t.ifError(er, 'should exist'); - t.ok(stat && stat.isDirectory(), 'should be directory'); - t.equal(stat && stat.mode & 0777, mode, 'should be 0744'); - t.end(); - }); - }); -}); - -test('chmod', function (t) { - var mode = 0755 - mkdirp(file, mode, function (er) { - t.ifError(er, 'should not error'); - fs.stat(file, function (er, stat) { - t.ifError(er, 'should exist'); - t.ok(stat && stat.isDirectory(), 'should be directory'); - t.end(); - }); - }); -}); diff --git a/node_modules/mkdirp/test/clobber.js b/node_modules/mkdirp/test/clobber.js deleted file mode 100644 index 0eb7099..0000000 --- a/node_modules/mkdirp/test/clobber.js +++ /dev/null @@ -1,37 +0,0 @@ -var mkdirp = require('../').mkdirp; -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -var ps = [ '', 'tmp' ]; - -for (var i = 0; i < 25; i++) { - var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - ps.push(dir); -} - -var file = ps.join('/'); - -// a file in the way -var itw = ps.slice(0, 3).join('/'); - - -test('clobber-pre', function (t) { - console.error("about to write to "+itw) - fs.writeFileSync(itw, 'I AM IN THE WAY, THE TRUTH, AND THE LIGHT.'); - - fs.stat(itw, function (er, stat) { - t.ifError(er) - t.ok(stat && stat.isFile(), 'should be file') - t.end() - }) -}) - -test('clobber', function (t) { - t.plan(2); - mkdirp(file, 0755, function (err) { - t.ok(err); - t.equal(err.code, 'ENOTDIR'); - t.end(); - }); -}); diff --git a/node_modules/mkdirp/test/mkdirp.js b/node_modules/mkdirp/test/mkdirp.js deleted file mode 100644 index b07cd70..0000000 --- a/node_modules/mkdirp/test/mkdirp.js +++ /dev/null @@ -1,28 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('woo', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - mkdirp(file, 0755, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) - }); -}); diff --git a/node_modules/mkdirp/test/perm.js b/node_modules/mkdirp/test/perm.js deleted file mode 100644 index 23a7abb..0000000 --- a/node_modules/mkdirp/test/perm.js +++ /dev/null @@ -1,32 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('async perm', function (t) { - t.plan(2); - var file = '/tmp/' + (Math.random() * (1<<30)).toString(16); - - mkdirp(file, 0755, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) - }); -}); - -test('async root perm', function (t) { - mkdirp('/tmp', 0755, function (err) { - if (err) t.fail(err); - t.end(); - }); - t.end(); -}); diff --git a/node_modules/mkdirp/test/perm_sync.js b/node_modules/mkdirp/test/perm_sync.js deleted file mode 100644 index f685f60..0000000 --- a/node_modules/mkdirp/test/perm_sync.js +++ /dev/null @@ -1,39 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('sync perm', function (t) { - t.plan(2); - var file = '/tmp/' + (Math.random() * (1<<30)).toString(16) + '.json'; - - mkdirp.sync(file, 0755); - path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }); -}); - -test('sync root perm', function (t) { - t.plan(1); - - var file = '/tmp'; - mkdirp.sync(file, 0755); - path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }); -}); diff --git a/node_modules/mkdirp/test/race.js b/node_modules/mkdirp/test/race.js deleted file mode 100644 index 96a0447..0000000 --- a/node_modules/mkdirp/test/race.js +++ /dev/null @@ -1,41 +0,0 @@ -var mkdirp = require('../').mkdirp; -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('race', function (t) { - t.plan(4); - var ps = [ '', 'tmp' ]; - - for (var i = 0; i < 25; i++) { - var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - ps.push(dir); - } - var file = ps.join('/'); - - var res = 2; - mk(file, function () { - if (--res === 0) t.end(); - }); - - mk(file, function () { - if (--res === 0) t.end(); - }); - - function mk (file, cb) { - mkdirp(file, 0755, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - if (cb) cb(); - } - }) - }) - }); - } -}); diff --git a/node_modules/mkdirp/test/rel.js b/node_modules/mkdirp/test/rel.js deleted file mode 100644 index 7985824..0000000 --- a/node_modules/mkdirp/test/rel.js +++ /dev/null @@ -1,32 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('rel', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var cwd = process.cwd(); - process.chdir('/tmp'); - - var file = [x,y,z].join('/'); - - mkdirp(file, 0755, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - process.chdir(cwd); - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) - }); -}); diff --git a/node_modules/mkdirp/test/return.js b/node_modules/mkdirp/test/return.js deleted file mode 100644 index bce68e5..0000000 --- a/node_modules/mkdirp/test/return.js +++ /dev/null @@ -1,25 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('return value', function (t) { - t.plan(4); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - // should return the first dir created. - // By this point, it would be profoundly surprising if /tmp didn't - // already exist, since every other test makes things in there. - mkdirp(file, function (err, made) { - t.ifError(err); - t.equal(made, '/tmp/' + x); - mkdirp(file, function (err, made) { - t.ifError(err); - t.equal(made, null); - }); - }); -}); diff --git a/node_modules/mkdirp/test/return_sync.js b/node_modules/mkdirp/test/return_sync.js deleted file mode 100644 index 7c222d3..0000000 --- a/node_modules/mkdirp/test/return_sync.js +++ /dev/null @@ -1,24 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('return value', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - // should return the first dir created. - // By this point, it would be profoundly surprising if /tmp didn't - // already exist, since every other test makes things in there. - // Note that this will throw on failure, which will fail the test. - var made = mkdirp.sync(file); - t.equal(made, '/tmp/' + x); - - // making the same file again should have no effect. - made = mkdirp.sync(file); - t.equal(made, null); -}); diff --git a/node_modules/mkdirp/test/root.js b/node_modules/mkdirp/test/root.js deleted file mode 100644 index 97ad7a2..0000000 --- a/node_modules/mkdirp/test/root.js +++ /dev/null @@ -1,18 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('root', function (t) { - // '/' on unix, 'c:/' on windows. - var file = path.resolve('/'); - - mkdirp(file, 0755, function (err) { - if (err) throw err - fs.stat(file, function (er, stat) { - if (er) throw er - t.ok(stat.isDirectory(), 'target is a directory'); - t.end(); - }) - }); -}); diff --git a/node_modules/mkdirp/test/sync.js b/node_modules/mkdirp/test/sync.js deleted file mode 100644 index 7530cad..0000000 --- a/node_modules/mkdirp/test/sync.js +++ /dev/null @@ -1,32 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('sync', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - try { - mkdirp.sync(file, 0755); - } catch (err) { - t.fail(err); - return t.end(); - } - - path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0755); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }); - }); -}); diff --git a/node_modules/mkdirp/test/umask.js b/node_modules/mkdirp/test/umask.js deleted file mode 100644 index 64ccafe..0000000 --- a/node_modules/mkdirp/test/umask.js +++ /dev/null @@ -1,28 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('implicit mode from umask', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - mkdirp(file, function (err) { - if (err) t.fail(err); - else path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, 0777 & (~process.umask())); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }) - }) - }); -}); diff --git a/node_modules/mkdirp/test/umask_sync.js b/node_modules/mkdirp/test/umask_sync.js deleted file mode 100644 index 35bd5cb..0000000 --- a/node_modules/mkdirp/test/umask_sync.js +++ /dev/null @@ -1,32 +0,0 @@ -var mkdirp = require('../'); -var path = require('path'); -var fs = require('fs'); -var test = require('tap').test; - -test('umask sync modes', function (t) { - t.plan(2); - var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16); - - var file = '/tmp/' + [x,y,z].join('/'); - - try { - mkdirp.sync(file); - } catch (err) { - t.fail(err); - return t.end(); - } - - path.exists(file, function (ex) { - if (!ex) t.fail('file not created') - else fs.stat(file, function (err, stat) { - if (err) t.fail(err) - else { - t.equal(stat.mode & 0777, (0777 & (~process.umask()))); - t.ok(stat.isDirectory(), 'target not a directory'); - t.end(); - } - }); - }); -}); diff --git a/node_modules/mocha/Readme.md b/node_modules/mocha/Readme.md deleted file mode 100644 index 9340cac..0000000 --- a/node_modules/mocha/Readme.md +++ /dev/null @@ -1,172 +0,0 @@ - [![Build Status](https://secure.travis-ci.org/visionmedia/mocha.png)](http://travis-ci.org/visionmedia/mocha) - - [![Mocha test framework](http://f.cl.ly/items/3l1k0n2A1U3M1I1L210p/Screen%20Shot%202012-02-24%20at%202.21.43%20PM.png)](http://visionmedia.github.io/mocha) - - Mocha is a simple, flexible, fun JavaScript test framework for node.js and the browser. For more information view the [documentation](http://visionmedia.github.io/mocha). - -## Contributors - -``` - - project : mocha - repo age : 2 years, 4 months ago - commits : 1314 - active : 372 days - files : 141 - authors : - 582 TJ Holowaychuk 44.3% - 389 Tj Holowaychuk 29.6% - 46 Travis Jeffery 3.5% - 31 Guillermo Rauch 2.4% - 13 Attila Domokos 1.0% - 10 John Firebaugh 0.8% - 8 Jo Liss 0.6% - 7 Nathan Rajlich 0.5% - 6 Mike Pennisi 0.5% - 6 James Carr 0.5% - 6 Brendan Nee 0.5% - 5 Aaron Heckmann 0.4% - 5 Ryunosuke SATO 0.4% - 4 hokaccha 0.3% - 4 Joshua Krall 0.3% - 4 Xavier Antoviaque 0.3% - 3 Jesse Dailey 0.2% - 3 Forbes Lindesay 0.2% - 3 Sindre Sorhus 0.2% - 3 Cory Thomas 0.2% - 3 Fredrik Enestad 0.2% - 3 Ben Lindsey 0.2% - 3 Tyson Tate 0.2% - 3 Mathieu Desvé 0.2% - 3 Valentin Agachi 0.2% - 3 Wil Moore III 0.2% - 3 Merrick Christensen 0.2% - 3 eiji.ienaga 0.2% - 3 fool2fish 0.2% - 3 Nathan Bowser 0.2% - 3 Paul Miller 0.2% - 2 Juzer Ali 0.2% - 2 Pete Hawkins 0.2% - 2 Jonas Westerlund 0.2% - 2 Arian Stolwijk 0.2% - 2 Quang Van 0.2% - 2 Glen Mailer 0.2% - 2 Justin DuJardin 0.2% - 2 FARKAS Máté 0.2% - 2 Raynos 0.2% - 2 Michael Riley 0.2% - 2 Michael Schoonmaker 0.2% - 2 Domenic Denicola 0.2% - 2 Simon Gaeremynck 0.2% - 2 Konstantin Käfer 0.2% - 2 domenic 0.2% - 2 Paul Armstrong 0.2% - 2 fcrisci 0.2% - 2 Alexander Early 0.2% - 2 Shawn Krisman 0.2% - 2 Brian Beck 0.2% - 2 Nathan Alderson 0.2% - 2 David Henderson 0.2% - 2 Timo Tijhof 0.2% - 2 Ian Storm Taylor 0.2% - 2 travis jeffery 0.2% - 1 Matt Smith 0.1% - 1 Matthew Shanley 0.1% - 1 Nathan Black 0.1% - 1 Phil Sung 0.1% - 1 R56 0.1% - 1 Refael Ackermann 0.1% - 1 Richard Dingwall 0.1% - 1 Romain Prieto 0.1% - 1 Roman Neuhauser 0.1% - 1 Roman Shtylman 0.1% - 1 Russ Bradberry 0.1% - 1 Russell Munson 0.1% - 1 Rustem Mustafin 0.1% - 1 Salehen Shovon Rahman 0.1% - 1 Sasha Koss 0.1% - 1 Seiya Konno 0.1% - 1 Simon Goumaz 0.1% - 1 Standa Opichal 0.1% - 1 Stephen Mathieson 0.1% - 1 Steve Mason 0.1% - 1 Tapiwa Kelvin 0.1% - 1 Teddy Zeenny 0.1% - 1 Tim Ehat 0.1% - 1 Vadim Nikitin 0.1% - 1 Victor Costan 0.1% - 1 Will Langstroth 0.1% - 1 Yanis Wang 0.1% - 1 Yuest Wang 0.1% - 1 abrkn 0.1% - 1 airportyh 0.1% - 1 badunk 0.1% - 1 fengmk2 0.1% - 1 grasGendarme 0.1% - 1 lodr 0.1% - 1 tgautier@yahoo.com 0.1% - 1 traleig1 0.1% - 1 vlad 0.1% - 1 yuitest 0.1% - 1 Adam Crabtree 0.1% - 1 Andreas Brekken 0.1% - 1 Andreas Lind Petersen 0.1% - 1 Andrew Nesbitt 0.1% - 1 Andrey Popp 0.1% - 1 Arnaud Brousseau 0.1% - 1 Atsuya Takagi 0.1% - 1 Austin Birch 0.1% - 1 Bjørge Næss 0.1% - 1 Brian Lalor 0.1% - 1 Brian M. Carlson 0.1% - 1 Brian Moore 0.1% - 1 Bryan Donovan 0.1% - 1 Casey Foster 0.1% - 1 ChrisWren 0.1% - 1 Corey Butler 0.1% - 1 Daniel Stockman 0.1% - 1 Dave McKenna 0.1% - 1 Di Wu 0.1% - 1 Dmitry Shirokov 0.1% - 1 Fedor Indutny 0.1% - 1 Florian Margaine 0.1% - 1 Frederico Silva 0.1% - 1 Fredrik Lindin 0.1% - 1 Gareth Murphy 0.1% - 1 Gavin Mogan 0.1% - 1 Glen Huang 0.1% - 1 Greg Perkins 0.1% - 1 Harry Brundage 0.1% - 1 Herman Junge 0.1% - 1 Ian Young 0.1% - 1 Ivan 0.1% - 1 JP Bochi 0.1% - 1 Jaakko Salonen 0.1% - 1 Jakub Nešetřil 0.1% - 1 James Bowes 0.1% - 1 James Lal 0.1% - 1 Jason Barry 0.1% - 1 Javier Aranda 0.1% - 1 Jeff Kunkle 0.1% - 1 Jeremy Martin 0.1% - 1 Jimmy Cuadra 0.1% - 1 Jonathan Creamer 0.1% - 1 Jussi Virtanen 0.1% - 1 Katie Gengler 0.1% - 1 Kazuhito Hokamura 0.1% - 1 Kirill Korolyov 0.1% - 1 Koen Punt 0.1% - 1 Laszlo Bacsi 0.1% - 1 Liam Newman 0.1% - 1 László Bácsi 0.1% - 1 Maciej Małecki 0.1% - 1 Mal Graty 0.1% - 1 Marc Kuo 0.1% - 1 Matt Robenolt 0.1% -``` - -## Links - - - [Google Group](http://groups.google.com/group/mochajs) - - [Wiki](https://github.com/visionmedia/mocha/wiki) - - Mocha [Extensions and reporters](https://github.com/visionmedia/mocha/wiki) diff --git a/node_modules/mocha/bin/_mocha b/node_modules/mocha/bin/_mocha deleted file mode 100755 index bea6df8..0000000 --- a/node_modules/mocha/bin/_mocha +++ /dev/null @@ -1,467 +0,0 @@ -#!/usr/bin/env node - -/** - * Module dependencies. - */ - -var program = require('commander') - , sprintf = require('util').format - , path = require('path') - , fs = require('fs') - , glob = require('glob') - , resolve = path.resolve - , exists = fs.existsSync || path.existsSync - , Mocha = require('../') - , utils = Mocha.utils - , interfaces = Mocha.interfaces - , join = path.join - , basename = path.basename - , cwd = process.cwd() - , mocha = new Mocha; - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date - , setTimeout = global.setTimeout - , setInterval = global.setInterval - , clearTimeout = global.clearTimeout - , clearInterval = global.clearInterval; - -/** - * Files. - */ - -var files = []; - -/** - * Globals. - */ - -var globals = []; - -/** - * Requires. - */ - -var requires = []; - -/** - * Images. - */ - -var images = { - fail: __dirname + '/../images/error.png' - , pass: __dirname + '/../images/ok.png' -}; - -// options - -program - .version(JSON.parse(fs.readFileSync(__dirname + '/../package.json', 'utf8')).version) - .usage('[debug] [options] [files]') - .option('-r, --require ', 'require the given module') - .option('-R, --reporter ', 'specify the reporter to use', 'dot') - .option('-u, --ui ', 'specify user-interface (bdd|tdd|exports)', 'bdd') - .option('-g, --grep ', 'only run tests matching ') - .option('-i, --invert', 'inverts --grep matches') - .option('-t, --timeout ', 'set test-case timeout in milliseconds [2000]') - .option('-s, --slow ', '"slow" test threshold in milliseconds [75]') - .option('-w, --watch', 'watch files for changes') - .option('-c, --colors', 'force enabling of colors') - .option('-C, --no-colors', 'force disabling of colors') - .option('-G, --growl', 'enable growl notification support') - .option('-d, --debug', "enable node's debugger, synonym for node --debug") - .option('-b, --bail', "bail after first test failure") - .option('-A, --async-only', "force all tests to take a callback (async)") - .option('-S, --sort', "sort test files") - .option('--recursive', 'include sub directories') - .option('--debug-brk', "enable node's debugger breaking on the first line") - .option('--globals ', 'allow the given comma-delimited global [names]', list, []) - .option('--check-leaks', 'check for global variable leaks') - .option('--interfaces', 'display available interfaces') - .option('--reporters', 'display available reporters') - .option('--compilers :,...', 'use the given module(s) to compile files', list, []) - .option('--inline-diffs', 'display actual/expected differences inline within each string') - .option('--no-exit', 'require a clean shutdown of the event loop: mocha will not call process.exit') - -program.name = 'mocha'; - -// init command - -program - .command('init ') - .description('initialize a client-side mocha setup at ') - .action(function(path){ - var mkdir = require('mkdirp'); - mkdir.sync(path); - var css = fs.readFileSync(join(__dirname, '..', 'mocha.css')); - var js = fs.readFileSync(join(__dirname, '..', 'mocha.js')); - var tmpl = fs.readFileSync(join(__dirname, '..', 'lib/template.html')); - fs.writeFileSync(join(path, 'mocha.css'), css); - fs.writeFileSync(join(path, 'mocha.js'), js); - fs.writeFileSync(join(path, 'tests.js'), ''); - fs.writeFileSync(join(path, 'index.html'), tmpl); - process.exit(0); - }); - -// --globals - -program.on('globals', function(val){ - globals = globals.concat(list(val)); -}); - -// --reporters - -program.on('reporters', function(){ - console.log(); - console.log(' dot - dot matrix'); - console.log(' doc - html documentation'); - console.log(' spec - hierarchical spec list'); - console.log(' json - single json object'); - console.log(' progress - progress bar'); - console.log(' list - spec-style listing'); - console.log(' tap - test-anything-protocol'); - console.log(' landing - unicode landing strip'); - console.log(' xunit - xunit reporter'); - console.log(' html-cov - HTML test coverage'); - console.log(' json-cov - JSON test coverage'); - console.log(' min - minimal reporter (great with --watch)'); - console.log(' json-stream - newline delimited json events'); - console.log(' markdown - markdown documentation (github flavour)'); - console.log(' nyan - nyan cat!'); - console.log(); - process.exit(); -}); - -// --interfaces - -program.on('interfaces', function(){ - console.log(''); - console.log(' bdd'); - console.log(' tdd'); - console.log(' qunit'); - console.log(' exports'); - console.log(''); - process.exit(); -}); - -// -r, --require - -module.paths.push(cwd, join(cwd, 'node_modules')); - -program.on('require', function(mod){ - var abs = exists(mod) || exists(mod + '.js'); - if (abs) mod = resolve(mod); - requires.push(mod); -}); - -// mocha.opts support - -try { - var opts = fs.readFileSync('test/mocha.opts', 'utf8') - .trim() - .split(/\s+/); - - process.argv = process.argv - .slice(0, 2) - .concat(opts.concat(process.argv.slice(2))); -} catch (err) { - // ignore -} - -// parse args - -program.parse(process.argv); - -// infinite stack traces - -Error.stackTraceLimit = Infinity; // TODO: config - -// reporter - -mocha.reporter(program.reporter); - -// interface - -mocha.ui(program.ui); - -// load reporter - -try { - Reporter = require('../lib/reporters/' + program.reporter); -} catch (err) { - try { - Reporter = require(program.reporter); - } catch (err) { - throw new Error('reporter "' + program.reporter + '" does not exist'); - } -} - -// --no-colors - -if (!program.colors) mocha.useColors(false); - -// --colors - -if (~process.argv.indexOf('--colors') || - ~process.argv.indexOf('-c')) { - mocha.useColors(true); -} - -// --inline-diffs - -if (program.inlineDiffs) mocha.useInlineDiffs(true); - -// --slow - -if (program.slow) mocha.suite.slow(program.slow); - -// --timeout - -if (program.timeout) mocha.suite.timeout(program.timeout); - -// --bail - -mocha.suite.bail(program.bail); - -// --grep - -if (program.grep) mocha.grep(new RegExp(program.grep)); - -// --invert - -if (program.invert) mocha.invert(); - -// --check-leaks - -if (program.checkLeaks) mocha.checkLeaks(); - -// --growl - -if (program.growl) mocha.growl(); - -// --async-only - -if (program.asyncOnly) mocha.asyncOnly(); - -// --globals - -mocha.globals(globals); - -// custom compiler support - -var extensions = ['js']; -program.compilers.forEach(function(c) { - var compiler = c.split(':') - , ext = compiler[0] - , mod = compiler[1]; - - if (mod[0] == '.') mod = join(process.cwd(), mod); - require(mod); - extensions.push(ext); -}); - -var re = new RegExp('\\.(' + extensions.join('|') + ')$'); - -// requires - -requires.forEach(function(mod) { - require(mod); -}); - -// files - -var files = [] - , args = program.args; - -// default files to test/*.{js,coffee} - -if (!args.length) args.push('test'); - -args.forEach(function(arg){ - files = files.concat(lookupFiles(arg, program.recursive)); -}); - -// resolve - -files = files.map(function(path){ - return resolve(path); -}); - -if (program.sort) { - files.sort(); -} - -// --watch - -var runner; -if (program.watch) { - console.log(); - hideCursor(); - process.on('SIGINT', function(){ - showCursor(); - console.log('\n'); - process.exit(); - }); - - var watchFiles = utils.files(cwd); - var runAgain = false; - - function loadAndRun() { - try { - mocha.files = files; - runAgain = false; - runner = mocha.run(function(){ - runner = null; - if (runAgain) { - rerun(); - } - }); - } catch(e) { - console.log(e.stack); - } - } - - function purge() { - watchFiles.forEach(function(file){ - delete require.cache[file]; - }); - } - - loadAndRun(); - - function rerun() { - purge(); - stop() - mocha.suite = mocha.suite.clone(); - mocha.suite.ctx = new Mocha.Context; - mocha.ui(program.ui); - loadAndRun(); - } - - utils.watch(watchFiles, function(){ - runAgain = true; - if (runner) { - runner.abort(); - } else { - rerun(); - } - }); - - return; -} - -// load - -mocha.files = files; -runner = mocha.run(program.exit ? process.exit : exitLater); - -function exitLater(code) { - process.on('exit', function() { process.exit(code) }) -} - -process.on('SIGINT', function() { runner.abort(); }) - -// enable growl notifications - -function growl(runner, reporter) { - var notify = require('growl'); - - runner.on('end', function(){ - var stats = reporter.stats; - if (stats.failures) { - var msg = stats.failures + ' of ' + runner.total + ' tests failed'; - notify(msg, { name: 'mocha', title: 'Failed', image: images.fail }); - } else { - notify(stats.passes + ' tests passed in ' + stats.duration + 'ms', { - name: 'mocha' - , title: 'Passed' - , image: images.pass - }); - } - }); -} - -/** - * Parse list. - */ - -function list(str) { - return str.split(/ *, */); -} - -/** - * Hide the cursor. - */ - -function hideCursor(){ - process.stdout.write('\u001b[?25l'); -}; - -/** - * Show the cursor. - */ - -function showCursor(){ - process.stdout.write('\u001b[?25h'); -}; - -/** - * Stop play()ing. - */ - -function stop() { - process.stdout.write('\u001b[2K'); - clearInterval(play.timer); -} - -/** - * Lookup file names at the given `path`. - */ - -function lookupFiles(path, recursive) { - var files = []; - - if (!exists(path)) { - if (exists(path + '.js')) { - path += '.js' - } else { - files = glob.sync(path); - if (!files.length) throw new Error("cannot resolve path (or pattern) '" + path + "'"); - return files; - } - } - - var stat = fs.statSync(path); - if (stat.isFile()) return path; - - fs.readdirSync(path).forEach(function(file){ - file = join(path, file); - var stat = fs.statSync(file); - if (stat.isDirectory()) { - if (recursive) files = files.concat(lookupFiles(file, recursive)); - return - } - if (!stat.isFile() || !re.test(file) || basename(file)[0] == '.') return; - files.push(file); - }); - - return files; -} - -/** - * Play the given array of strings. - */ - -function play(arr, interval) { - var len = arr.length - , interval = interval || 100 - , i = 0; - - play.timer = setInterval(function(){ - var str = arr[i++ % len]; - process.stdout.write('\u001b[0G' + str); - }, interval); -} diff --git a/node_modules/mocha/bin/mocha b/node_modules/mocha/bin/mocha deleted file mode 100755 index 742d607..0000000 --- a/node_modules/mocha/bin/mocha +++ /dev/null @@ -1,51 +0,0 @@ -#!/usr/bin/env node - -/** - * This tiny wrapper file checks for known node flags and appends them - * when found, before invoking the "real" _mocha(1) executable. - */ - -var spawn = require('child_process').spawn - , args = [ __dirname + '/_mocha' ]; - -process.argv.slice(2).forEach(function(arg){ - var flag = arg.split('=')[0]; - - switch (flag) { - case '-d': - args.unshift('--debug'); - break; - case 'debug': - case '--debug': - case '--debug-brk': - args.unshift(arg); - break; - case '-gc': - case '--expose-gc': - args.unshift('--expose-gc'); - break; - case '--gc-global': - case '--harmony': - case '--harmony-proxies': - case '--harmony-collections': - case '--harmony-generators': - case '--prof': - args.unshift(arg); - break; - default: - if (0 == arg.indexOf('--trace')) args.unshift(arg); - else args.push(arg); - break; - } -}); - -var proc = spawn(process.argv[0], args, { customFds: [0,1,2] }); -proc.on('exit', function (code, signal) { - process.on('exit', function(){ - if (signal) { - process.kill(process.pid, signal); - } else { - process.exit(code); - } - }); -}); diff --git a/node_modules/mocha/images/error.png b/node_modules/mocha/images/error.png deleted file mode 100644 index a07a1ba5efef3e4be01383485cdd59d87691ae7c..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 412 zcmeAS@N?(olHy`uVBq!ia0vp^5+KaM3?#3wJbMaAB?S0{xB}@#3=H#t6a&Ky28IX* zhDI;bT+N zJ_d#}3=HROY~H+F81S@RY}C7)_Aw#d|MtVb_a~h&)Rp4=QT2WP6Q!Vh`Tbw)C0L`Hjr0=~ z9$q`dGMD9A%ZpEiDeV&BjQ7mTJ@UL?o6p#BvCvJTmtn!~Z$T%V*(ZO9v7FD-TxB)0 zdg`1chBG#&VzR#-Sg`Tz{B++v?;f1y-of{vSo8emT75L`U_{(iyq;*ak qoLzkFu?=s{K4<0MJ2ut-SB-zNMaS1nOp+JqO9oF@KbLh*2~7Z$dY*9r diff --git a/node_modules/mocha/images/ok.png b/node_modules/mocha/images/ok.png deleted file mode 100644 index b3623a59946024c48067d73d664e070dbc2d8a32..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 388 zcmeAS@N?(olHy`uVBq!ia0vp^5+KaM3?#3wJbMaAB?S0{xJIori(YS*wAUIaKoBJF zvj!rdveN6mWw-t6ABLwLvMapgS$QL{=59##Dd*y=UgdZE^Uk|v9Cc`W76(-P|8)8t zpa!9mAiv!{OM$WnJzX3_DsF8(b5f{TLBu6cm|clU zs#od6hyV36>l!DuJ~i6gRJ|(h>%N=uiCw`>-uwaww$}4;Jh;`b%=GEzCGjs473QC< zoj;vb)**hkbI|rOH-CY(cRg0*&vrd;aO|w5Y!c5c%l3JVM=TdRUpN+^&tQ1$_04MM zy$qe->%PkEb(kh#O!>DBXDc!!9W;kOl4QpsMNCpniSgx7V=EJjg/g, '>'); - n = n.replace(/"/g, '"'); - - return n; - } - - var Diff = function(ignoreWhitespace) { - this.ignoreWhitespace = ignoreWhitespace; - }; - Diff.prototype = { - diff: function(oldString, newString) { - // Handle the identity case (this is due to unrolling editLength == 0 - if (newString === oldString) { - return [{ value: newString }]; - } - if (!newString) { - return [{ value: oldString, removed: true }]; - } - if (!oldString) { - return [{ value: newString, added: true }]; - } - - newString = this.tokenize(newString); - oldString = this.tokenize(oldString); - - var newLen = newString.length, oldLen = oldString.length; - var maxEditLength = newLen + oldLen; - var bestPath = [{ newPos: -1, components: [] }]; - - // Seed editLength = 0 - var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0); - if (bestPath[0].newPos+1 >= newLen && oldPos+1 >= oldLen) { - return bestPath[0].components; - } - - for (var editLength = 1; editLength <= maxEditLength; editLength++) { - for (var diagonalPath = -1*editLength; diagonalPath <= editLength; diagonalPath+=2) { - var basePath; - var addPath = bestPath[diagonalPath-1], - removePath = bestPath[diagonalPath+1]; - oldPos = (removePath ? removePath.newPos : 0) - diagonalPath; - if (addPath) { - // No one else is going to attempt to use this value, clear it - bestPath[diagonalPath-1] = undefined; - } - - var canAdd = addPath && addPath.newPos+1 < newLen; - var canRemove = removePath && 0 <= oldPos && oldPos < oldLen; - if (!canAdd && !canRemove) { - bestPath[diagonalPath] = undefined; - continue; - } - - // Select the diagonal that we want to branch from. We select the prior - // path whose position in the new string is the farthest from the origin - // and does not pass the bounds of the diff graph - if (!canAdd || (canRemove && addPath.newPos < removePath.newPos)) { - basePath = clonePath(removePath); - this.pushComponent(basePath.components, oldString[oldPos], undefined, true); - } else { - basePath = clonePath(addPath); - basePath.newPos++; - this.pushComponent(basePath.components, newString[basePath.newPos], true, undefined); - } - - var oldPos = this.extractCommon(basePath, newString, oldString, diagonalPath); - - if (basePath.newPos+1 >= newLen && oldPos+1 >= oldLen) { - return basePath.components; - } else { - bestPath[diagonalPath] = basePath; - } - } - } - }, - - pushComponent: function(components, value, added, removed) { - var last = components[components.length-1]; - if (last && last.added === added && last.removed === removed) { - // We need to clone here as the component clone operation is just - // as shallow array clone - components[components.length-1] = - {value: this.join(last.value, value), added: added, removed: removed }; - } else { - components.push({value: value, added: added, removed: removed }); - } - }, - extractCommon: function(basePath, newString, oldString, diagonalPath) { - var newLen = newString.length, - oldLen = oldString.length, - newPos = basePath.newPos, - oldPos = newPos - diagonalPath; - while (newPos+1 < newLen && oldPos+1 < oldLen && this.equals(newString[newPos+1], oldString[oldPos+1])) { - newPos++; - oldPos++; - - this.pushComponent(basePath.components, newString[newPos], undefined, undefined); - } - basePath.newPos = newPos; - return oldPos; - }, - - equals: function(left, right) { - var reWhitespace = /\S/; - if (this.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right)) { - return true; - } else { - return left === right; - } - }, - join: function(left, right) { - return left + right; - }, - tokenize: function(value) { - return value; - } - }; - - var CharDiff = new Diff(); - - var WordDiff = new Diff(true); - var WordWithSpaceDiff = new Diff(); - WordDiff.tokenize = WordWithSpaceDiff.tokenize = function(value) { - return removeEmpty(value.split(/(\s+|\b)/)); - }; - - var CssDiff = new Diff(true); - CssDiff.tokenize = function(value) { - return removeEmpty(value.split(/([{}:;,]|\s+)/)); - }; - - var LineDiff = new Diff(); - LineDiff.tokenize = function(value) { - return value.split(/^/m); - }; - - return { - Diff: Diff, - - diffChars: function(oldStr, newStr) { return CharDiff.diff(oldStr, newStr); }, - diffWords: function(oldStr, newStr) { return WordDiff.diff(oldStr, newStr); }, - diffWordsWithSpace: function(oldStr, newStr) { return WordWithSpaceDiff.diff(oldStr, newStr); }, - diffLines: function(oldStr, newStr) { return LineDiff.diff(oldStr, newStr); }, - - diffCss: function(oldStr, newStr) { return CssDiff.diff(oldStr, newStr); }, - - createPatch: function(fileName, oldStr, newStr, oldHeader, newHeader) { - var ret = []; - - ret.push('Index: ' + fileName); - ret.push('==================================================================='); - ret.push('--- ' + fileName + (typeof oldHeader === 'undefined' ? '' : '\t' + oldHeader)); - ret.push('+++ ' + fileName + (typeof newHeader === 'undefined' ? '' : '\t' + newHeader)); - - var diff = LineDiff.diff(oldStr, newStr); - if (!diff[diff.length-1].value) { - diff.pop(); // Remove trailing newline add - } - diff.push({value: '', lines: []}); // Append an empty value to make cleanup easier - - function contextLines(lines) { - return lines.map(function(entry) { return ' ' + entry; }); - } - function eofNL(curRange, i, current) { - var last = diff[diff.length-2], - isLast = i === diff.length-2, - isLastOfType = i === diff.length-3 && (current.added !== last.added || current.removed !== last.removed); - - // Figure out if this is the last line for the given file and missing NL - if (!/\n$/.test(current.value) && (isLast || isLastOfType)) { - curRange.push('\\ No newline at end of file'); - } - } - - var oldRangeStart = 0, newRangeStart = 0, curRange = [], - oldLine = 1, newLine = 1; - for (var i = 0; i < diff.length; i++) { - var current = diff[i], - lines = current.lines || current.value.replace(/\n$/, '').split('\n'); - current.lines = lines; - - if (current.added || current.removed) { - if (!oldRangeStart) { - var prev = diff[i-1]; - oldRangeStart = oldLine; - newRangeStart = newLine; - - if (prev) { - curRange = contextLines(prev.lines.slice(-4)); - oldRangeStart -= curRange.length; - newRangeStart -= curRange.length; - } - } - curRange.push.apply(curRange, lines.map(function(entry) { return (current.added?'+':'-') + entry; })); - eofNL(curRange, i, current); - - if (current.added) { - newLine += lines.length; - } else { - oldLine += lines.length; - } - } else { - if (oldRangeStart) { - // Close out any changes that have been output (or join overlapping) - if (lines.length <= 8 && i < diff.length-2) { - // Overlapping - curRange.push.apply(curRange, contextLines(lines)); - } else { - // end the range and output - var contextSize = Math.min(lines.length, 4); - ret.push( - '@@ -' + oldRangeStart + ',' + (oldLine-oldRangeStart+contextSize) - + ' +' + newRangeStart + ',' + (newLine-newRangeStart+contextSize) - + ' @@'); - ret.push.apply(ret, curRange); - ret.push.apply(ret, contextLines(lines.slice(0, contextSize))); - if (lines.length <= 4) { - eofNL(ret, i, current); - } - - oldRangeStart = 0; newRangeStart = 0; curRange = []; - } - } - oldLine += lines.length; - newLine += lines.length; - } - } - - return ret.join('\n') + '\n'; - }, - - applyPatch: function(oldStr, uniDiff) { - var diffstr = uniDiff.split('\n'); - var diff = []; - var remEOFNL = false, - addEOFNL = false; - - for (var i = (diffstr[0][0]==='I'?4:0); i < diffstr.length; i++) { - if(diffstr[i][0] === '@') { - var meh = diffstr[i].split(/@@ -(\d+),(\d+) \+(\d+),(\d+) @@/); - diff.unshift({ - start:meh[3], - oldlength:meh[2], - oldlines:[], - newlength:meh[4], - newlines:[] - }); - } else if(diffstr[i][0] === '+') { - diff[0].newlines.push(diffstr[i].substr(1)); - } else if(diffstr[i][0] === '-') { - diff[0].oldlines.push(diffstr[i].substr(1)); - } else if(diffstr[i][0] === ' ') { - diff[0].newlines.push(diffstr[i].substr(1)); - diff[0].oldlines.push(diffstr[i].substr(1)); - } else if(diffstr[i][0] === '\\') { - if (diffstr[i-1][0] === '+') { - remEOFNL = true; - } else if(diffstr[i-1][0] === '-') { - addEOFNL = true; - } - } - } - - var str = oldStr.split('\n'); - for (var i = diff.length - 1; i >= 0; i--) { - var d = diff[i]; - for (var j = 0; j < d.oldlength; j++) { - if(str[d.start-1+j] !== d.oldlines[j]) { - return false; - } - } - Array.prototype.splice.apply(str,[d.start-1,+d.oldlength].concat(d.newlines)); - } - - if (remEOFNL) { - while (!str[str.length-1]) { - str.pop(); - } - } else if (addEOFNL) { - str.push(''); - } - return str.join('\n'); - }, - - convertChangesToXML: function(changes){ - var ret = []; - for ( var i = 0; i < changes.length; i++) { - var change = changes[i]; - if (change.added) { - ret.push(''); - } else if (change.removed) { - ret.push(''); - } - - ret.push(escapeHTML(change.value)); - - if (change.added) { - ret.push(''); - } else if (change.removed) { - ret.push(''); - } - } - return ret.join(''); - }, - - // See: http://code.google.com/p/google-diff-match-patch/wiki/API - convertChangesToDMP: function(changes){ - var ret = [], change; - for ( var i = 0; i < changes.length; i++) { - change = changes[i]; - ret.push([(change.added ? 1 : change.removed ? -1 : 0), change.value]); - } - return ret; - } - }; -})(); - -if (typeof module !== 'undefined') { - module.exports = JsDiff; -} diff --git a/node_modules/mocha/lib/browser/events.js b/node_modules/mocha/lib/browser/events.js deleted file mode 100644 index cfbd072..0000000 --- a/node_modules/mocha/lib/browser/events.js +++ /dev/null @@ -1,178 +0,0 @@ - -/** - * Module exports. - */ - -exports.EventEmitter = EventEmitter; - -/** - * Check if `obj` is an array. - */ - -function isArray(obj) { - return '[object Array]' == {}.toString.call(obj); -} - -/** - * Event emitter constructor. - * - * @api public - */ - -function EventEmitter(){}; - -/** - * Adds a listener. - * - * @api public - */ - -EventEmitter.prototype.on = function (name, fn) { - if (!this.$events) { - this.$events = {}; - } - - if (!this.$events[name]) { - this.$events[name] = fn; - } else if (isArray(this.$events[name])) { - this.$events[name].push(fn); - } else { - this.$events[name] = [this.$events[name], fn]; - } - - return this; -}; - -EventEmitter.prototype.addListener = EventEmitter.prototype.on; - -/** - * Adds a volatile listener. - * - * @api public - */ - -EventEmitter.prototype.once = function (name, fn) { - var self = this; - - function on () { - self.removeListener(name, on); - fn.apply(this, arguments); - }; - - on.listener = fn; - this.on(name, on); - - return this; -}; - -/** - * Removes a listener. - * - * @api public - */ - -EventEmitter.prototype.removeListener = function (name, fn) { - if (this.$events && this.$events[name]) { - var list = this.$events[name]; - - if (isArray(list)) { - var pos = -1; - - for (var i = 0, l = list.length; i < l; i++) { - if (list[i] === fn || (list[i].listener && list[i].listener === fn)) { - pos = i; - break; - } - } - - if (pos < 0) { - return this; - } - - list.splice(pos, 1); - - if (!list.length) { - delete this.$events[name]; - } - } else if (list === fn || (list.listener && list.listener === fn)) { - delete this.$events[name]; - } - } - - return this; -}; - -/** - * Removes all listeners for an event. - * - * @api public - */ - -EventEmitter.prototype.removeAllListeners = function (name) { - if (name === undefined) { - this.$events = {}; - return this; - } - - if (this.$events && this.$events[name]) { - this.$events[name] = null; - } - - return this; -}; - -/** - * Gets all listeners for a certain event. - * - * @api public - */ - -EventEmitter.prototype.listeners = function (name) { - if (!this.$events) { - this.$events = {}; - } - - if (!this.$events[name]) { - this.$events[name] = []; - } - - if (!isArray(this.$events[name])) { - this.$events[name] = [this.$events[name]]; - } - - return this.$events[name]; -}; - -/** - * Emits an event. - * - * @api public - */ - -EventEmitter.prototype.emit = function (name) { - if (!this.$events) { - return false; - } - - var handler = this.$events[name]; - - if (!handler) { - return false; - } - - var args = [].slice.call(arguments, 1); - - if ('function' == typeof handler) { - handler.apply(this, args); - } else if (isArray(handler)) { - var listeners = handler.slice(); - - for (var i = 0, l = listeners.length; i < l; i++) { - listeners[i].apply(this, args); - } - } else { - return false; - } - - return true; -}; \ No newline at end of file diff --git a/node_modules/mocha/lib/browser/fs.js b/node_modules/mocha/lib/browser/fs.js deleted file mode 100644 index e69de29..0000000 diff --git a/node_modules/mocha/lib/browser/path.js b/node_modules/mocha/lib/browser/path.js deleted file mode 100644 index e69de29..0000000 diff --git a/node_modules/mocha/lib/browser/progress.js b/node_modules/mocha/lib/browser/progress.js deleted file mode 100644 index 90526f7..0000000 --- a/node_modules/mocha/lib/browser/progress.js +++ /dev/null @@ -1,125 +0,0 @@ -/** - * Expose `Progress`. - */ - -module.exports = Progress; - -/** - * Initialize a new `Progress` indicator. - */ - -function Progress() { - this.percent = 0; - this.size(0); - this.fontSize(11); - this.font('helvetica, arial, sans-serif'); -} - -/** - * Set progress size to `n`. - * - * @param {Number} n - * @return {Progress} for chaining - * @api public - */ - -Progress.prototype.size = function(n){ - this._size = n; - return this; -}; - -/** - * Set text to `str`. - * - * @param {String} str - * @return {Progress} for chaining - * @api public - */ - -Progress.prototype.text = function(str){ - this._text = str; - return this; -}; - -/** - * Set font size to `n`. - * - * @param {Number} n - * @return {Progress} for chaining - * @api public - */ - -Progress.prototype.fontSize = function(n){ - this._fontSize = n; - return this; -}; - -/** - * Set font `family`. - * - * @param {String} family - * @return {Progress} for chaining - */ - -Progress.prototype.font = function(family){ - this._font = family; - return this; -}; - -/** - * Update percentage to `n`. - * - * @param {Number} n - * @return {Progress} for chaining - */ - -Progress.prototype.update = function(n){ - this.percent = n; - return this; -}; - -/** - * Draw on `ctx`. - * - * @param {CanvasRenderingContext2d} ctx - * @return {Progress} for chaining - */ - -Progress.prototype.draw = function(ctx){ - try { - var percent = Math.min(this.percent, 100) - , size = this._size - , half = size / 2 - , x = half - , y = half - , rad = half - 1 - , fontSize = this._fontSize; - - ctx.font = fontSize + 'px ' + this._font; - - var angle = Math.PI * 2 * (percent / 100); - ctx.clearRect(0, 0, size, size); - - // outer circle - ctx.strokeStyle = '#9f9f9f'; - ctx.beginPath(); - ctx.arc(x, y, rad, 0, angle, false); - ctx.stroke(); - - // inner circle - ctx.strokeStyle = '#eee'; - ctx.beginPath(); - ctx.arc(x, y, rad - 1, 0, angle, true); - ctx.stroke(); - - // text - var text = this._text || (percent | 0) + '%' - , w = ctx.measureText(text).width; - - ctx.fillText( - text - , x - w / 2 + 1 - , y + fontSize / 2 - 1); - } catch (ex) {} //don't fail if we can't render progress - return this; -}; diff --git a/node_modules/mocha/lib/browser/tty.js b/node_modules/mocha/lib/browser/tty.js deleted file mode 100644 index 6f5f079..0000000 --- a/node_modules/mocha/lib/browser/tty.js +++ /dev/null @@ -1,13 +0,0 @@ - -exports.isatty = function(){ - return true; -}; - -exports.getWindowSize = function(){ - if ('innerHeight' in global) { - return [global.innerHeight, global.innerWidth]; - } else { - // In a Web Worker, the DOM Window is not available. - return [640, 480]; - } -}; diff --git a/node_modules/mocha/lib/context.js b/node_modules/mocha/lib/context.js deleted file mode 100644 index 6d6422a..0000000 --- a/node_modules/mocha/lib/context.js +++ /dev/null @@ -1,69 +0,0 @@ - -/** - * Expose `Context`. - */ - -module.exports = Context; - -/** - * Initialize a new `Context`. - * - * @api private - */ - -function Context(){} - -/** - * Set or get the context `Runnable` to `runnable`. - * - * @param {Runnable} runnable - * @return {Context} - * @api private - */ - -Context.prototype.runnable = function(runnable){ - if (0 == arguments.length) return this._runnable; - this.test = this._runnable = runnable; - return this; -}; - -/** - * Set test timeout `ms`. - * - * @param {Number} ms - * @return {Context} self - * @api private - */ - -Context.prototype.timeout = function(ms){ - this.runnable().timeout(ms); - return this; -}; - -/** - * Set test slowness threshold `ms`. - * - * @param {Number} ms - * @return {Context} self - * @api private - */ - -Context.prototype.slow = function(ms){ - this.runnable().slow(ms); - return this; -}; - -/** - * Inspect the context void of `._runnable`. - * - * @return {String} - * @api private - */ - -Context.prototype.inspect = function(){ - return JSON.stringify(this, function(key, val){ - if ('_runnable' == key) return; - if ('test' == key) return; - return val; - }, 2); -}; diff --git a/node_modules/mocha/lib/hook.js b/node_modules/mocha/lib/hook.js deleted file mode 100644 index 814e7b6..0000000 --- a/node_modules/mocha/lib/hook.js +++ /dev/null @@ -1,49 +0,0 @@ - -/** - * Module dependencies. - */ - -var Runnable = require('./runnable'); - -/** - * Expose `Hook`. - */ - -module.exports = Hook; - -/** - * Initialize a new `Hook` with the given `title` and callback `fn`. - * - * @param {String} title - * @param {Function} fn - * @api private - */ - -function Hook(title, fn) { - Runnable.call(this, title, fn); - this.type = 'hook'; -} - -/** - * Inherit from `Runnable.prototype`. - */ - -Hook.prototype.__proto__ = Runnable.prototype; - -/** - * Get or set the test `err`. - * - * @param {Error} err - * @return {Error} - * @api public - */ - -Hook.prototype.error = function(err){ - if (0 == arguments.length) { - var err = this._error; - this._error = null; - return err; - } - - this._error = err; -}; diff --git a/node_modules/mocha/lib/interfaces/bdd.js b/node_modules/mocha/lib/interfaces/bdd.js deleted file mode 100644 index 3a5b1ed..0000000 --- a/node_modules/mocha/lib/interfaces/bdd.js +++ /dev/null @@ -1,137 +0,0 @@ - -/** - * Module dependencies. - */ - -var Suite = require('../suite') - , Test = require('../test') - , utils = require('../utils'); - -/** - * BDD-style interface: - * - * describe('Array', function(){ - * describe('#indexOf()', function(){ - * it('should return -1 when not present', function(){ - * - * }); - * - * it('should return the index when present', function(){ - * - * }); - * }); - * }); - * - */ - -module.exports = function(suite){ - var suites = [suite]; - - suite.on('pre-require', function(context, file, mocha){ - - /** - * Execute before running tests. - */ - - context.before = function(fn){ - suites[0].beforeAll(fn); - }; - - /** - * Execute after running tests. - */ - - context.after = function(fn){ - suites[0].afterAll(fn); - }; - - /** - * Execute before each test case. - */ - - context.beforeEach = function(fn){ - suites[0].beforeEach(fn); - }; - - /** - * Execute after each test case. - */ - - context.afterEach = function(fn){ - suites[0].afterEach(fn); - }; - - /** - * Describe a "suite" with the given `title` - * and callback `fn` containing nested suites - * and/or tests. - */ - - context.describe = context.context = function(title, fn){ - var suite = Suite.create(suites[0], title); - suites.unshift(suite); - fn.call(suite); - suites.shift(); - return suite; - }; - - /** - * Pending describe. - */ - - context.xdescribe = - context.xcontext = - context.describe.skip = function(title, fn){ - var suite = Suite.create(suites[0], title); - suite.pending = true; - suites.unshift(suite); - fn.call(suite); - suites.shift(); - }; - - /** - * Exclusive suite. - */ - - context.describe.only = function(title, fn){ - var suite = context.describe(title, fn); - mocha.grep(suite.fullTitle()); - return suite; - }; - - /** - * Describe a specification or test-case - * with the given `title` and callback `fn` - * acting as a thunk. - */ - - context.it = context.specify = function(title, fn){ - var suite = suites[0]; - if (suite.pending) var fn = null; - var test = new Test(title, fn); - suite.addTest(test); - return test; - }; - - /** - * Exclusive test-case. - */ - - context.it.only = function(title, fn){ - var test = context.it(title, fn); - var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; - mocha.grep(new RegExp(reString)); - return test; - }; - - /** - * Pending test case. - */ - - context.xit = - context.xspecify = - context.it.skip = function(title){ - context.it(title); - }; - }); -}; diff --git a/node_modules/mocha/lib/interfaces/exports.js b/node_modules/mocha/lib/interfaces/exports.js deleted file mode 100644 index 6b229c0..0000000 --- a/node_modules/mocha/lib/interfaces/exports.js +++ /dev/null @@ -1,60 +0,0 @@ - -/** - * Module dependencies. - */ - -var Suite = require('../suite') - , Test = require('../test'); - -/** - * TDD-style interface: - * - * exports.Array = { - * '#indexOf()': { - * 'should return -1 when the value is not present': function(){ - * - * }, - * - * 'should return the correct index when the value is present': function(){ - * - * } - * } - * }; - * - */ - -module.exports = function(suite){ - var suites = [suite]; - - suite.on('require', visit); - - function visit(obj) { - var suite; - for (var key in obj) { - if ('function' == typeof obj[key]) { - var fn = obj[key]; - switch (key) { - case 'before': - suites[0].beforeAll(fn); - break; - case 'after': - suites[0].afterAll(fn); - break; - case 'beforeEach': - suites[0].beforeEach(fn); - break; - case 'afterEach': - suites[0].afterEach(fn); - break; - default: - suites[0].addTest(new Test(key, fn)); - } - } else { - var suite = Suite.create(suites[0], key); - suites.unshift(suite); - visit(obj[key]); - suites.shift(); - } - } - } -}; diff --git a/node_modules/mocha/lib/interfaces/index.js b/node_modules/mocha/lib/interfaces/index.js deleted file mode 100644 index f7b2655..0000000 --- a/node_modules/mocha/lib/interfaces/index.js +++ /dev/null @@ -1,5 +0,0 @@ - -exports.bdd = require('./bdd'); -exports.tdd = require('./tdd'); -exports.qunit = require('./qunit'); -exports.exports = require('./exports'); diff --git a/node_modules/mocha/lib/interfaces/qunit.js b/node_modules/mocha/lib/interfaces/qunit.js deleted file mode 100644 index 30f6748..0000000 --- a/node_modules/mocha/lib/interfaces/qunit.js +++ /dev/null @@ -1,122 +0,0 @@ - -/** - * Module dependencies. - */ - -var Suite = require('../suite') - , Test = require('../test') - , utils = require('../utils'); - -/** - * QUnit-style interface: - * - * suite('Array'); - * - * test('#length', function(){ - * var arr = [1,2,3]; - * ok(arr.length == 3); - * }); - * - * test('#indexOf()', function(){ - * var arr = [1,2,3]; - * ok(arr.indexOf(1) == 0); - * ok(arr.indexOf(2) == 1); - * ok(arr.indexOf(3) == 2); - * }); - * - * suite('String'); - * - * test('#length', function(){ - * ok('foo'.length == 3); - * }); - * - */ - -module.exports = function(suite){ - var suites = [suite]; - - suite.on('pre-require', function(context, file, mocha){ - - /** - * Execute before running tests. - */ - - context.before = function(fn){ - suites[0].beforeAll(fn); - }; - - /** - * Execute after running tests. - */ - - context.after = function(fn){ - suites[0].afterAll(fn); - }; - - /** - * Execute before each test case. - */ - - context.beforeEach = function(fn){ - suites[0].beforeEach(fn); - }; - - /** - * Execute after each test case. - */ - - context.afterEach = function(fn){ - suites[0].afterEach(fn); - }; - - /** - * Describe a "suite" with the given `title`. - */ - - context.suite = function(title){ - if (suites.length > 1) suites.shift(); - var suite = Suite.create(suites[0], title); - suites.unshift(suite); - return suite; - }; - - /** - * Exclusive test-case. - */ - - context.suite.only = function(title, fn){ - var suite = context.suite(title, fn); - mocha.grep(suite.fullTitle()); - }; - - /** - * Describe a specification or test-case - * with the given `title` and callback `fn` - * acting as a thunk. - */ - - context.test = function(title, fn){ - var test = new Test(title, fn); - suites[0].addTest(test); - return test; - }; - - /** - * Exclusive test-case. - */ - - context.test.only = function(title, fn){ - var test = context.test(title, fn); - var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; - mocha.grep(new RegExp(reString)); - }; - - /** - * Pending test case. - */ - - context.test.skip = function(title){ - context.test(title); - }; - }); -}; diff --git a/node_modules/mocha/lib/interfaces/tdd.js b/node_modules/mocha/lib/interfaces/tdd.js deleted file mode 100644 index da5ca2c..0000000 --- a/node_modules/mocha/lib/interfaces/tdd.js +++ /dev/null @@ -1,138 +0,0 @@ - -/** - * Module dependencies. - */ - -var Suite = require('../suite') - , Test = require('../test') - , utils = require('../utils');; - -/** - * TDD-style interface: - * - * suite('Array', function(){ - * suite('#indexOf()', function(){ - * suiteSetup(function(){ - * - * }); - * - * test('should return -1 when not present', function(){ - * - * }); - * - * test('should return the index when present', function(){ - * - * }); - * - * suiteTeardown(function(){ - * - * }); - * }); - * }); - * - */ - -module.exports = function(suite){ - var suites = [suite]; - - suite.on('pre-require', function(context, file, mocha){ - - /** - * Execute before each test case. - */ - - context.setup = function(fn){ - suites[0].beforeEach(fn); - }; - - /** - * Execute after each test case. - */ - - context.teardown = function(fn){ - suites[0].afterEach(fn); - }; - - /** - * Execute before the suite. - */ - - context.suiteSetup = function(fn){ - suites[0].beforeAll(fn); - }; - - /** - * Execute after the suite. - */ - - context.suiteTeardown = function(fn){ - suites[0].afterAll(fn); - }; - - /** - * Describe a "suite" with the given `title` - * and callback `fn` containing nested suites - * and/or tests. - */ - - context.suite = function(title, fn){ - var suite = Suite.create(suites[0], title); - suites.unshift(suite); - fn.call(suite); - suites.shift(); - return suite; - }; - - /** - * Pending suite. - */ - context.suite.skip = function(title, fn) { - var suite = Suite.create(suites[0], title); - suite.pending = true; - suites.unshift(suite); - fn.call(suite); - suites.shift(); - }; - - /** - * Exclusive test-case. - */ - - context.suite.only = function(title, fn){ - var suite = context.suite(title, fn); - mocha.grep(suite.fullTitle()); - }; - - /** - * Describe a specification or test-case - * with the given `title` and callback `fn` - * acting as a thunk. - */ - - context.test = function(title, fn){ - var suite = suites[0]; - if (suite.pending) var fn = null; - var test = new Test(title, fn); - suite.addTest(test); - return test; - }; - - /** - * Exclusive test-case. - */ - - context.test.only = function(title, fn){ - var test = context.test(title, fn); - var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; - mocha.grep(new RegExp(reString)); - }; - - /** - * Pending test case. - */ - - context.test.skip = function(title){ - context.test(title); - }; - }); -}; diff --git a/node_modules/mocha/lib/mocha.js b/node_modules/mocha/lib/mocha.js deleted file mode 100644 index 3bc9bd5..0000000 --- a/node_modules/mocha/lib/mocha.js +++ /dev/null @@ -1,369 +0,0 @@ -/*! - * mocha - * Copyright(c) 2011 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var path = require('path') - , utils = require('./utils'); - -/** - * Expose `Mocha`. - */ - -exports = module.exports = Mocha; - -/** - * Expose internals. - */ - -exports.utils = utils; -exports.interfaces = require('./interfaces'); -exports.reporters = require('./reporters'); -exports.Runnable = require('./runnable'); -exports.Context = require('./context'); -exports.Runner = require('./runner'); -exports.Suite = require('./suite'); -exports.Hook = require('./hook'); -exports.Test = require('./test'); - -/** - * Return image `name` path. - * - * @param {String} name - * @return {String} - * @api private - */ - -function image(name) { - return __dirname + '/../images/' + name + '.png'; -} - -/** - * Setup mocha with `options`. - * - * Options: - * - * - `ui` name "bdd", "tdd", "exports" etc - * - `reporter` reporter instance, defaults to `mocha.reporters.Dot` - * - `globals` array of accepted globals - * - `timeout` timeout in milliseconds - * - `bail` bail on the first test failure - * - `slow` milliseconds to wait before considering a test slow - * - `ignoreLeaks` ignore global leaks - * - `grep` string or regexp to filter tests with - * - * @param {Object} options - * @api public - */ - -function Mocha(options) { - options = options || {}; - this.files = []; - this.options = options; - this.grep(options.grep); - this.suite = new exports.Suite('', new exports.Context); - this.ui(options.ui); - this.bail(options.bail); - this.reporter(options.reporter); - if (null != options.timeout) this.timeout(options.timeout); - this.useColors(options.useColors) - if (options.slow) this.slow(options.slow); - - this.suite.on('pre-require', function (context) { - exports.afterEach = context.afterEach || context.teardown; - exports.after = context.after || context.suiteTeardown; - exports.beforeEach = context.beforeEach || context.setup; - exports.before = context.before || context.suiteSetup; - exports.describe = context.describe || context.suite; - exports.it = context.it || context.test; - exports.setup = context.setup || context.beforeEach; - exports.suiteSetup = context.suiteSetup || context.before; - exports.suiteTeardown = context.suiteTeardown || context.after; - exports.suite = context.suite || context.describe; - exports.teardown = context.teardown || context.afterEach; - exports.test = context.test || context.it; - }); -} - -/** - * Enable or disable bailing on the first failure. - * - * @param {Boolean} [bail] - * @api public - */ - -Mocha.prototype.bail = function(bail){ - if (0 == arguments.length) bail = true; - this.suite.bail(bail); - return this; -}; - -/** - * Add test `file`. - * - * @param {String} file - * @api public - */ - -Mocha.prototype.addFile = function(file){ - this.files.push(file); - return this; -}; - -/** - * Set reporter to `reporter`, defaults to "dot". - * - * @param {String|Function} reporter name or constructor - * @api public - */ - -Mocha.prototype.reporter = function(reporter){ - if ('function' == typeof reporter) { - this._reporter = reporter; - } else { - reporter = reporter || 'dot'; - var _reporter; - try { _reporter = require('./reporters/' + reporter); } catch (err) {}; - if (!_reporter) try { _reporter = require(reporter); } catch (err) {}; - if (!_reporter && reporter === 'teamcity') - console.warn('The Teamcity reporter was moved to a package named ' + - 'mocha-teamcity-reporter ' + - '(https://npmjs.org/package/mocha-teamcity-reporter).'); - if (!_reporter) throw new Error('invalid reporter "' + reporter + '"'); - this._reporter = _reporter; - } - return this; -}; - -/** - * Set test UI `name`, defaults to "bdd". - * - * @param {String} bdd - * @api public - */ - -Mocha.prototype.ui = function(name){ - name = name || 'bdd'; - this._ui = exports.interfaces[name]; - if (!this._ui) try { this._ui = require(name); } catch (err) {}; - if (!this._ui) throw new Error('invalid interface "' + name + '"'); - this._ui = this._ui(this.suite); - return this; -}; - -/** - * Load registered files. - * - * @api private - */ - -Mocha.prototype.loadFiles = function(fn){ - var self = this; - var suite = this.suite; - var pending = this.files.length; - this.files.forEach(function(file){ - file = path.resolve(file); - suite.emit('pre-require', global, file, self); - suite.emit('require', require(file), file, self); - suite.emit('post-require', global, file, self); - --pending || (fn && fn()); - }); -}; - -/** - * Enable growl support. - * - * @api private - */ - -Mocha.prototype._growl = function(runner, reporter) { - var notify = require('growl'); - - runner.on('end', function(){ - var stats = reporter.stats; - if (stats.failures) { - var msg = stats.failures + ' of ' + runner.total + ' tests failed'; - notify(msg, { name: 'mocha', title: 'Failed', image: image('error') }); - } else { - notify(stats.passes + ' tests passed in ' + stats.duration + 'ms', { - name: 'mocha' - , title: 'Passed' - , image: image('ok') - }); - } - }); -}; - -/** - * Add regexp to grep, if `re` is a string it is escaped. - * - * @param {RegExp|String} re - * @return {Mocha} - * @api public - */ - -Mocha.prototype.grep = function(re){ - this.options.grep = 'string' == typeof re - ? new RegExp(utils.escapeRegexp(re)) - : re; - return this; -}; - -/** - * Invert `.grep()` matches. - * - * @return {Mocha} - * @api public - */ - -Mocha.prototype.invert = function(){ - this.options.invert = true; - return this; -}; - -/** - * Ignore global leaks. - * - * @param {Boolean} ignore - * @return {Mocha} - * @api public - */ - -Mocha.prototype.ignoreLeaks = function(ignore){ - this.options.ignoreLeaks = !!ignore; - return this; -}; - -/** - * Enable global leak checking. - * - * @return {Mocha} - * @api public - */ - -Mocha.prototype.checkLeaks = function(){ - this.options.ignoreLeaks = false; - return this; -}; - -/** - * Enable growl support. - * - * @return {Mocha} - * @api public - */ - -Mocha.prototype.growl = function(){ - this.options.growl = true; - return this; -}; - -/** - * Ignore `globals` array or string. - * - * @param {Array|String} globals - * @return {Mocha} - * @api public - */ - -Mocha.prototype.globals = function(globals){ - this.options.globals = (this.options.globals || []).concat(globals); - return this; -}; - -/** - * Emit color output. - * - * @param {Boolean} colors - * @return {Mocha} - * @api public - */ - -Mocha.prototype.useColors = function(colors){ - this.options.useColors = arguments.length && colors != undefined - ? colors - : true; - return this; -}; - -/** - * Use inline diffs rather than +/-. - * - * @param {Boolean} inlineDiffs - * @return {Mocha} - * @api public - */ - -Mocha.prototype.useInlineDiffs = function(inlineDiffs) { - this.options.useInlineDiffs = arguments.length && inlineDiffs != undefined - ? inlineDiffs - : false; - return this; -}; - -/** - * Set the timeout in milliseconds. - * - * @param {Number} timeout - * @return {Mocha} - * @api public - */ - -Mocha.prototype.timeout = function(timeout){ - this.suite.timeout(timeout); - return this; -}; - -/** - * Set slowness threshold in milliseconds. - * - * @param {Number} slow - * @return {Mocha} - * @api public - */ - -Mocha.prototype.slow = function(slow){ - this.suite.slow(slow); - return this; -}; - -/** - * Makes all tests async (accepting a callback) - * - * @return {Mocha} - * @api public - */ - -Mocha.prototype.asyncOnly = function(){ - this.options.asyncOnly = true; - return this; -}; - -/** - * Run tests and invoke `fn()` when complete. - * - * @param {Function} fn - * @return {Runner} - * @api public - */ - -Mocha.prototype.run = function(fn){ - if (this.files.length) this.loadFiles(); - var suite = this.suite; - var options = this.options; - var runner = new exports.Runner(suite); - var reporter = new this._reporter(runner); - runner.ignoreLeaks = false !== options.ignoreLeaks; - runner.asyncOnly = options.asyncOnly; - if (options.grep) runner.grep(options.grep, options.invert); - if (options.globals) runner.globals(options.globals); - if (options.growl) this._growl(runner, reporter); - exports.reporters.Base.useColors = options.useColors; - exports.reporters.Base.inlineDiffs = options.useInlineDiffs; - return runner.run(fn); -}; diff --git a/node_modules/mocha/lib/ms.js b/node_modules/mocha/lib/ms.js deleted file mode 100644 index 4096637..0000000 --- a/node_modules/mocha/lib/ms.js +++ /dev/null @@ -1,109 +0,0 @@ -/** - * Helpers. - */ - -var s = 1000; -var m = s * 60; -var h = m * 60; -var d = h * 24; -var y = d * 365.25; - -/** - * Parse or format the given `val`. - * - * Options: - * - * - `long` verbose formatting [false] - * - * @param {String|Number} val - * @param {Object} options - * @return {String|Number} - * @api public - */ - -module.exports = function(val, options){ - options = options || {}; - if ('string' == typeof val) return parse(val); - return options.long ? longFormat(val) : shortFormat(val); -}; - -/** - * Parse the given `str` and return milliseconds. - * - * @param {String} str - * @return {Number} - * @api private - */ - -function parse(str) { - var match = /^((?:\d+)?\.?\d+) *(ms|seconds?|s|minutes?|m|hours?|h|days?|d|years?|y)?$/i.exec(str); - if (!match) return; - var n = parseFloat(match[1]); - var type = (match[2] || 'ms').toLowerCase(); - switch (type) { - case 'years': - case 'year': - case 'y': - return n * y; - case 'days': - case 'day': - case 'd': - return n * d; - case 'hours': - case 'hour': - case 'h': - return n * h; - case 'minutes': - case 'minute': - case 'm': - return n * m; - case 'seconds': - case 'second': - case 's': - return n * s; - case 'ms': - return n; - } -} - -/** - * Short format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function shortFormat(ms) { - if (ms >= d) return Math.round(ms / d) + 'd'; - if (ms >= h) return Math.round(ms / h) + 'h'; - if (ms >= m) return Math.round(ms / m) + 'm'; - if (ms >= s) return Math.round(ms / s) + 's'; - return ms + 'ms'; -} - -/** - * Long format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function longFormat(ms) { - return plural(ms, d, 'day') - || plural(ms, h, 'hour') - || plural(ms, m, 'minute') - || plural(ms, s, 'second') - || ms + ' ms'; -} - -/** - * Pluralization helper. - */ - -function plural(ms, n, name) { - if (ms < n) return; - if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name; - return Math.ceil(ms / n) + ' ' + name + 's'; -} diff --git a/node_modules/mocha/lib/reporters/base.js b/node_modules/mocha/lib/reporters/base.js deleted file mode 100644 index 0754fe1..0000000 --- a/node_modules/mocha/lib/reporters/base.js +++ /dev/null @@ -1,507 +0,0 @@ - -/** - * Module dependencies. - */ - -var tty = require('tty') - , diff = require('diff') - , ms = require('../ms') - , utils = require('../utils'); - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date - , setTimeout = global.setTimeout - , setInterval = global.setInterval - , clearTimeout = global.clearTimeout - , clearInterval = global.clearInterval; - -/** - * Check if both stdio streams are associated with a tty. - */ - -var isatty = tty.isatty(1) && tty.isatty(2); - -/** - * Expose `Base`. - */ - -exports = module.exports = Base; - -/** - * Enable coloring by default. - */ - -exports.useColors = isatty || (process.env.MOCHA_COLORS !== undefined); - -/** - * Inline diffs instead of +/- - */ - -exports.inlineDiffs = false; - -/** - * Default color map. - */ - -exports.colors = { - 'pass': 90 - , 'fail': 31 - , 'bright pass': 92 - , 'bright fail': 91 - , 'bright yellow': 93 - , 'pending': 36 - , 'suite': 0 - , 'error title': 0 - , 'error message': 31 - , 'error stack': 90 - , 'checkmark': 32 - , 'fast': 90 - , 'medium': 33 - , 'slow': 31 - , 'green': 32 - , 'light': 90 - , 'diff gutter': 90 - , 'diff added': 42 - , 'diff removed': 41 -}; - -/** - * Default symbol map. - */ - -exports.symbols = { - ok: '✓', - err: '✖', - dot: '․' -}; - -// With node.js on Windows: use symbols available in terminal default fonts -if ('win32' == process.platform) { - exports.symbols.ok = '\u221A'; - exports.symbols.err = '\u00D7'; - exports.symbols.dot = '.'; -} - -/** - * Color `str` with the given `type`, - * allowing colors to be disabled, - * as well as user-defined color - * schemes. - * - * @param {String} type - * @param {String} str - * @return {String} - * @api private - */ - -var color = exports.color = function(type, str) { - if (!exports.useColors) return str; - return '\u001b[' + exports.colors[type] + 'm' + str + '\u001b[0m'; -}; - -/** - * Expose term window size, with some - * defaults for when stderr is not a tty. - */ - -exports.window = { - width: isatty - ? process.stdout.getWindowSize - ? process.stdout.getWindowSize(1)[0] - : tty.getWindowSize()[1] - : 75 -}; - -/** - * Expose some basic cursor interactions - * that are common among reporters. - */ - -exports.cursor = { - hide: function(){ - isatty && process.stdout.write('\u001b[?25l'); - }, - - show: function(){ - isatty && process.stdout.write('\u001b[?25h'); - }, - - deleteLine: function(){ - isatty && process.stdout.write('\u001b[2K'); - }, - - beginningOfLine: function(){ - isatty && process.stdout.write('\u001b[0G'); - }, - - CR: function(){ - if (isatty) { - exports.cursor.deleteLine(); - exports.cursor.beginningOfLine(); - } else { - process.stdout.write('\r'); - } - } -}; - -/** - * Outut the given `failures` as a list. - * - * @param {Array} failures - * @api public - */ - -exports.list = function(failures){ - console.error(); - failures.forEach(function(test, i){ - // format - var fmt = color('error title', ' %s) %s:\n') - + color('error message', ' %s') - + color('error stack', '\n%s\n'); - - // msg - var err = test.err - , message = err.message || '' - , stack = err.stack || message - , index = stack.indexOf(message) + message.length - , msg = stack.slice(0, index) - , actual = err.actual - , expected = err.expected - , escape = true; - - // uncaught - if (err.uncaught) { - msg = 'Uncaught ' + msg; - } - - // explicitly show diff - if (err.showDiff && sameType(actual, expected)) { - escape = false; - err.actual = actual = stringify(canonicalize(actual)); - err.expected = expected = stringify(canonicalize(expected)); - } - - // actual / expected diff - if ('string' == typeof actual && 'string' == typeof expected) { - fmt = color('error title', ' %s) %s:\n%s') + color('error stack', '\n%s\n'); - var match = message.match(/^([^:]+): expected/); - msg = '\n ' + color('error message', match ? match[1] : msg); - - if (exports.inlineDiffs) { - msg += inlineDiff(err, escape); - } else { - msg += unifiedDiff(err, escape); - } - } - - // indent stack trace without msg - stack = stack.slice(index ? index + 1 : index) - .replace(/^/gm, ' '); - - console.error(fmt, (i + 1), test.fullTitle(), msg, stack); - }); -}; - -/** - * Initialize a new `Base` reporter. - * - * All other reporters generally - * inherit from this reporter, providing - * stats such as test duration, number - * of tests passed / failed etc. - * - * @param {Runner} runner - * @api public - */ - -function Base(runner) { - var self = this - , stats = this.stats = { suites: 0, tests: 0, passes: 0, pending: 0, failures: 0 } - , failures = this.failures = []; - - if (!runner) return; - this.runner = runner; - - runner.stats = stats; - - runner.on('start', function(){ - stats.start = new Date; - }); - - runner.on('suite', function(suite){ - stats.suites = stats.suites || 0; - suite.root || stats.suites++; - }); - - runner.on('test end', function(test){ - stats.tests = stats.tests || 0; - stats.tests++; - }); - - runner.on('pass', function(test){ - stats.passes = stats.passes || 0; - - var medium = test.slow() / 2; - test.speed = test.duration > test.slow() - ? 'slow' - : test.duration > medium - ? 'medium' - : 'fast'; - - stats.passes++; - }); - - runner.on('fail', function(test, err){ - stats.failures = stats.failures || 0; - stats.failures++; - test.err = err; - failures.push(test); - }); - - runner.on('end', function(){ - stats.end = new Date; - stats.duration = new Date - stats.start; - }); - - runner.on('pending', function(){ - stats.pending++; - }); -} - -/** - * Output common epilogue used by many of - * the bundled reporters. - * - * @api public - */ - -Base.prototype.epilogue = function(){ - var stats = this.stats; - var tests; - var fmt; - - console.log(); - - // passes - fmt = color('bright pass', ' ') - + color('green', ' %d passing') - + color('light', ' (%s)'); - - console.log(fmt, - stats.passes || 0, - ms(stats.duration)); - - // pending - if (stats.pending) { - fmt = color('pending', ' ') - + color('pending', ' %d pending'); - - console.log(fmt, stats.pending); - } - - // failures - if (stats.failures) { - fmt = color('fail', ' %d failing'); - - console.error(fmt, - stats.failures); - - Base.list(this.failures); - console.error(); - } - - console.log(); -}; - -/** - * Pad the given `str` to `len`. - * - * @param {String} str - * @param {String} len - * @return {String} - * @api private - */ - -function pad(str, len) { - str = String(str); - return Array(len - str.length + 1).join(' ') + str; -} - - -/** - * Returns an inline diff between 2 strings with coloured ANSI output - * - * @param {Error} Error with actual/expected - * @return {String} Diff - * @api private - */ - -function inlineDiff(err, escape) { - var msg = errorDiff(err, 'WordsWithSpace', escape); - - // linenos - var lines = msg.split('\n'); - if (lines.length > 4) { - var width = String(lines.length).length; - msg = lines.map(function(str, i){ - return pad(++i, width) + ' |' + ' ' + str; - }).join('\n'); - } - - // legend - msg = '\n' - + color('diff removed', 'actual') - + ' ' - + color('diff added', 'expected') - + '\n\n' - + msg - + '\n'; - - // indent - msg = msg.replace(/^/gm, ' '); - return msg; -} - -/** - * Returns a unified diff between 2 strings - * - * @param {Error} Error with actual/expected - * @return {String} Diff - * @api private - */ - -function unifiedDiff(err, escape) { - var indent = ' '; - function cleanUp(line) { - if (escape) { - line = escapeInvisibles(line); - } - if (line[0] === '+') return indent + colorLines('diff added', line); - if (line[0] === '-') return indent + colorLines('diff removed', line); - if (line.match(/\@\@/)) return null; - if (line.match(/\\ No newline/)) return null; - else return indent + line; - } - function notBlank(line) { - return line != null; - } - msg = diff.createPatch('string', err.actual, err.expected); - var lines = msg.split('\n').splice(4); - return '\n ' - + colorLines('diff added', '+ expected') + ' ' - + colorLines('diff removed', '- actual') - + '\n\n' - + lines.map(cleanUp).filter(notBlank).join('\n'); -} - -/** - * Return a character diff for `err`. - * - * @param {Error} err - * @return {String} - * @api private - */ - -function errorDiff(err, type, escape) { - var actual = escape ? escapeInvisibles(err.actual) : err.actual; - var expected = escape ? escapeInvisibles(err.expected) : err.expected; - return diff['diff' + type](actual, expected).map(function(str){ - if (str.added) return colorLines('diff added', str.value); - if (str.removed) return colorLines('diff removed', str.value); - return str.value; - }).join(''); -} - -/** - * Returns a string with all invisible characters in plain text - * - * @param {String} line - * @return {String} - * @api private - */ -function escapeInvisibles(line) { - return line.replace(/\t/g, '') - .replace(/\r/g, '') - .replace(/\n/g, '\n'); -} - -/** - * Color lines for `str`, using the color `name`. - * - * @param {String} name - * @param {String} str - * @return {String} - * @api private - */ - -function colorLines(name, str) { - return str.split('\n').map(function(str){ - return color(name, str); - }).join('\n'); -} - -/** - * Stringify `obj`. - * - * @param {Object} obj - * @return {String} - * @api private - */ - -function stringify(obj) { - if (obj instanceof RegExp) return obj.toString(); - return JSON.stringify(obj, null, 2); -} - -/** - * Return a new object that has the keys in sorted order. - * @param {Object} obj - * @return {Object} - * @api private - */ - - function canonicalize(obj, stack) { - stack = stack || []; - - if (utils.indexOf(stack, obj) !== -1) return obj; - - var canonicalizedObj; - - if ('[object Array]' == {}.toString.call(obj)) { - stack.push(obj); - canonicalizedObj = utils.map(obj, function(item) { - return canonicalize(item, stack); - }); - stack.pop(); - } else if (typeof obj === 'object' && obj !== null) { - stack.push(obj); - canonicalizedObj = {}; - utils.forEach(utils.keys(obj).sort(), function(key) { - canonicalizedObj[key] = canonicalize(obj[key], stack); - }); - stack.pop(); - } else { - canonicalizedObj = obj; - } - - return canonicalizedObj; - } - -/** - * Check that a / b have the same type. - * - * @param {Object} a - * @param {Object} b - * @return {Boolean} - * @api private - */ - -function sameType(a, b) { - a = Object.prototype.toString.call(a); - b = Object.prototype.toString.call(b); - return a == b; -} - diff --git a/node_modules/mocha/lib/reporters/doc.js b/node_modules/mocha/lib/reporters/doc.js deleted file mode 100644 index 2e5bf57..0000000 --- a/node_modules/mocha/lib/reporters/doc.js +++ /dev/null @@ -1,56 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , utils = require('../utils'); - -/** - * Expose `Doc`. - */ - -exports = module.exports = Doc; - -/** - * Initialize a new `Doc` reporter. - * - * @param {Runner} runner - * @api public - */ - -function Doc(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , total = runner.total - , indents = 2; - - function indent() { - return Array(indents).join(' '); - } - - runner.on('suite', function(suite){ - if (suite.root) return; - ++indents; - console.log('%s
      ', indent()); - ++indents; - console.log('%s

      %s

      ', indent(), utils.escape(suite.title)); - console.log('%s
      ', indent()); - }); - - runner.on('suite end', function(suite){ - if (suite.root) return; - console.log('%s
      ', indent()); - --indents; - console.log('%s
      ', indent()); - --indents; - }); - - runner.on('pass', function(test){ - console.log('%s
      %s
      ', indent(), utils.escape(test.title)); - var code = utils.escape(utils.clean(test.fn.toString())); - console.log('%s 
      %s
      ', indent(), code); - }); -} diff --git a/node_modules/mocha/lib/reporters/dot.js b/node_modules/mocha/lib/reporters/dot.js deleted file mode 100644 index 0c298ba..0000000 --- a/node_modules/mocha/lib/reporters/dot.js +++ /dev/null @@ -1,62 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , color = Base.color; - -/** - * Expose `Dot`. - */ - -exports = module.exports = Dot; - -/** - * Initialize a new `Dot` matrix test reporter. - * - * @param {Runner} runner - * @api public - */ - -function Dot(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , width = Base.window.width * .75 | 0 - , n = 0; - - runner.on('start', function(){ - process.stdout.write('\n '); - }); - - runner.on('pending', function(test){ - process.stdout.write(color('pending', Base.symbols.dot)); - }); - - runner.on('pass', function(test){ - if (++n % width == 0) process.stdout.write('\n '); - if ('slow' == test.speed) { - process.stdout.write(color('bright yellow', Base.symbols.dot)); - } else { - process.stdout.write(color(test.speed, Base.symbols.dot)); - } - }); - - runner.on('fail', function(test, err){ - if (++n % width == 0) process.stdout.write('\n '); - process.stdout.write(color('fail', Base.symbols.dot)); - }); - - runner.on('end', function(){ - console.log(); - self.epilogue(); - }); -} - -/** - * Inherit from `Base.prototype`. - */ - -Dot.prototype.__proto__ = Base.prototype; \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/html-cov.js b/node_modules/mocha/lib/reporters/html-cov.js deleted file mode 100644 index bfb27ff..0000000 --- a/node_modules/mocha/lib/reporters/html-cov.js +++ /dev/null @@ -1,51 +0,0 @@ - -/** - * Module dependencies. - */ - -var JSONCov = require('./json-cov') - , fs = require('fs'); - -/** - * Expose `HTMLCov`. - */ - -exports = module.exports = HTMLCov; - -/** - * Initialize a new `JsCoverage` reporter. - * - * @param {Runner} runner - * @api public - */ - -function HTMLCov(runner) { - var jade = require('jade') - , file = __dirname + '/templates/coverage.jade' - , str = fs.readFileSync(file, 'utf8') - , fn = jade.compile(str, { filename: file }) - , self = this; - - JSONCov.call(this, runner, false); - - runner.on('end', function(){ - process.stdout.write(fn({ - cov: self.cov - , coverageClass: coverageClass - })); - }); -} - -/** - * Return coverage class for `n`. - * - * @return {String} - * @api private - */ - -function coverageClass(n) { - if (n >= 75) return 'high'; - if (n >= 50) return 'medium'; - if (n >= 25) return 'low'; - return 'terrible'; -} \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/html.js b/node_modules/mocha/lib/reporters/html.js deleted file mode 100644 index 873f024..0000000 --- a/node_modules/mocha/lib/reporters/html.js +++ /dev/null @@ -1,274 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , utils = require('../utils') - , Progress = require('../browser/progress') - , escape = utils.escape; - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date - , setTimeout = global.setTimeout - , setInterval = global.setInterval - , clearTimeout = global.clearTimeout - , clearInterval = global.clearInterval; - -/** - * Expose `HTML`. - */ - -exports = module.exports = HTML; - -/** - * Stats template. - */ - -var statsTemplate = '      '; - -/** - * Initialize a new `HTML` reporter. - * - * @param {Runner} runner - * @api public - */ - -function HTML(runner, root) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , total = runner.total - , stat = fragment(statsTemplate) - , items = stat.getElementsByTagName('li') - , passes = items[1].getElementsByTagName('em')[0] - , passesLink = items[1].getElementsByTagName('a')[0] - , failures = items[2].getElementsByTagName('em')[0] - , failuresLink = items[2].getElementsByTagName('a')[0] - , duration = items[3].getElementsByTagName('em')[0] - , canvas = stat.getElementsByTagName('canvas')[0] - , report = fragment('
        ') - , stack = [report] - , progress - , ctx - - root = root || document.getElementById('mocha'); - - if (canvas.getContext) { - var ratio = window.devicePixelRatio || 1; - canvas.style.width = canvas.width; - canvas.style.height = canvas.height; - canvas.width *= ratio; - canvas.height *= ratio; - ctx = canvas.getContext('2d'); - ctx.scale(ratio, ratio); - progress = new Progress; - } - - if (!root) return error('#mocha div missing, add it to your document'); - - // pass toggle - on(passesLink, 'click', function(){ - unhide(); - var name = /pass/.test(report.className) ? '' : ' pass'; - report.className = report.className.replace(/fail|pass/g, '') + name; - if (report.className.trim()) hideSuitesWithout('test pass'); - }); - - // failure toggle - on(failuresLink, 'click', function(){ - unhide(); - var name = /fail/.test(report.className) ? '' : ' fail'; - report.className = report.className.replace(/fail|pass/g, '') + name; - if (report.className.trim()) hideSuitesWithout('test fail'); - }); - - root.appendChild(stat); - root.appendChild(report); - - if (progress) progress.size(40); - - runner.on('suite', function(suite){ - if (suite.root) return; - - // suite - var url = self.suiteURL(suite); - var el = fragment('

      • %s

        • ', url, escape(suite.title)); - - // container - stack[0].appendChild(el); - stack.unshift(document.createElement('ul')); - el.appendChild(stack[0]); - }); - - runner.on('suite end', function(suite){ - if (suite.root) return; - stack.shift(); - }); - - runner.on('fail', function(test, err){ - if ('hook' == test.type) runner.emit('test end', test); - }); - - runner.on('test end', function(test){ - // TODO: add to stats - var percent = stats.tests / this.total * 100 | 0; - if (progress) progress.update(percent).draw(ctx); - - // update stats - var ms = new Date - stats.start; - text(passes, stats.passes); - text(failures, stats.failures); - text(duration, (ms / 1000).toFixed(2)); - - // test - if ('passed' == test.state) { - var url = self.testURL(test); - var el = fragment('

      • %e%ems ‣

        • ', test.speed, test.title, test.duration, url); - } else if (test.pending) { - var el = fragment('

      • %e

        • ', test.title); - } else { - var el = fragment('

      • %e ‣

        • ', test.title, encodeURIComponent(test.fullTitle())); - var str = test.err.stack || test.err.toString(); - - // FF / Opera do not add the message - if (!~str.indexOf(test.err.message)) { - str = test.err.message + '\n' + str; - } - - // <=IE7 stringifies to [Object Error]. Since it can be overloaded, we - // check for the result of the stringifying. - if ('[object Error]' == str) str = test.err.message; - - // Safari doesn't give you a stack. Let's at least provide a source line. - if (!test.err.stack && test.err.sourceURL && test.err.line !== undefined) { - str += "\n(" + test.err.sourceURL + ":" + test.err.line + ")"; - } - - el.appendChild(fragment('
        %e
        ', str)); - } - - // toggle code - // TODO: defer - if (!test.pending) { - var h2 = el.getElementsByTagName('h2')[0]; - - on(h2, 'click', function(){ - pre.style.display = 'none' == pre.style.display - ? 'block' - : 'none'; - }); - - var pre = fragment('
        %e
        ', utils.clean(test.fn.toString())); - el.appendChild(pre); - pre.style.display = 'none'; - } - - // Don't call .appendChild if #mocha-report was already .shift()'ed off the stack. - if (stack[0]) stack[0].appendChild(el); - }); -} - -/** - * Provide suite URL - * - * @param {Object} [suite] - */ - -HTML.prototype.suiteURL = function(suite){ - return '?grep=' + encodeURIComponent(suite.fullTitle()); -}; - -/** - * Provide test URL - * - * @param {Object} [test] - */ - -HTML.prototype.testURL = function(test){ - return '?grep=' + encodeURIComponent(test.fullTitle()); -}; - -/** - * Display error `msg`. - */ - -function error(msg) { - document.body.appendChild(fragment('
        %s
        ', msg)); -} - -/** - * Return a DOM fragment from `html`. - */ - -function fragment(html) { - var args = arguments - , div = document.createElement('div') - , i = 1; - - div.innerHTML = html.replace(/%([se])/g, function(_, type){ - switch (type) { - case 's': return String(args[i++]); - case 'e': return escape(args[i++]); - } - }); - - return div.firstChild; -} - -/** - * Check for suites that do not have elements - * with `classname`, and hide them. - */ - -function hideSuitesWithout(classname) { - var suites = document.getElementsByClassName('suite'); - for (var i = 0; i < suites.length; i++) { - var els = suites[i].getElementsByClassName(classname); - if (0 == els.length) suites[i].className += ' hidden'; - } -} - -/** - * Unhide .hidden suites. - */ - -function unhide() { - var els = document.getElementsByClassName('suite hidden'); - for (var i = 0; i < els.length; ++i) { - els[i].className = els[i].className.replace('suite hidden', 'suite'); - } -} - -/** - * Set `el` text to `str`. - */ - -function text(el, str) { - if (el.textContent) { - el.textContent = str; - } else { - el.innerText = str; - } -} - -/** - * Listen on `event` with callback `fn`. - */ - -function on(el, event, fn) { - if (el.addEventListener) { - el.addEventListener(event, fn, false); - } else { - el.attachEvent('on' + event, fn); - } -} diff --git a/node_modules/mocha/lib/reporters/index.js b/node_modules/mocha/lib/reporters/index.js deleted file mode 100644 index 1c4fccf..0000000 --- a/node_modules/mocha/lib/reporters/index.js +++ /dev/null @@ -1,18 +0,0 @@ - -exports.Base = require('./base'); -exports.Dot = require('./dot'); -exports.Doc = require('./doc'); -exports.TAP = require('./tap'); -exports.JSON = require('./json'); -exports.HTML = require('./html'); -exports.List = require('./list'); -exports.Min = require('./min'); -exports.Spec = require('./spec'); -exports.Nyan = require('./nyan'); -exports.XUnit = require('./xunit'); -exports.Markdown = require('./markdown'); -exports.Progress = require('./progress'); -exports.Landing = require('./landing'); -exports.JSONCov = require('./json-cov'); -exports.HTMLCov = require('./html-cov'); -exports.JSONStream = require('./json-stream'); diff --git a/node_modules/mocha/lib/reporters/json-cov.js b/node_modules/mocha/lib/reporters/json-cov.js deleted file mode 100644 index 73d0009..0000000 --- a/node_modules/mocha/lib/reporters/json-cov.js +++ /dev/null @@ -1,153 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base'); - -/** - * Expose `JSONCov`. - */ - -exports = module.exports = JSONCov; - -/** - * Initialize a new `JsCoverage` reporter. - * - * @param {Runner} runner - * @param {Boolean} output - * @api public - */ - -function JSONCov(runner, output) { - var self = this - , output = 1 == arguments.length ? true : output; - - Base.call(this, runner); - - var tests = [] - , failures = [] - , passes = []; - - runner.on('test end', function(test){ - tests.push(test); - }); - - runner.on('pass', function(test){ - passes.push(test); - }); - - runner.on('fail', function(test){ - failures.push(test); - }); - - runner.on('end', function(){ - var cov = global._$jscoverage || {}; - var result = self.cov = map(cov); - result.stats = self.stats; - result.tests = tests.map(clean); - result.failures = failures.map(clean); - result.passes = passes.map(clean); - if (!output) return; - process.stdout.write(JSON.stringify(result, null, 2 )); - }); -} - -/** - * Map jscoverage data to a JSON structure - * suitable for reporting. - * - * @param {Object} cov - * @return {Object} - * @api private - */ - -function map(cov) { - var ret = { - instrumentation: 'node-jscoverage' - , sloc: 0 - , hits: 0 - , misses: 0 - , coverage: 0 - , files: [] - }; - - for (var filename in cov) { - var data = coverage(filename, cov[filename]); - ret.files.push(data); - ret.hits += data.hits; - ret.misses += data.misses; - ret.sloc += data.sloc; - } - - ret.files.sort(function(a, b) { - return a.filename.localeCompare(b.filename); - }); - - if (ret.sloc > 0) { - ret.coverage = (ret.hits / ret.sloc) * 100; - } - - return ret; -}; - -/** - * Map jscoverage data for a single source file - * to a JSON structure suitable for reporting. - * - * @param {String} filename name of the source file - * @param {Object} data jscoverage coverage data - * @return {Object} - * @api private - */ - -function coverage(filename, data) { - var ret = { - filename: filename, - coverage: 0, - hits: 0, - misses: 0, - sloc: 0, - source: {} - }; - - data.source.forEach(function(line, num){ - num++; - - if (data[num] === 0) { - ret.misses++; - ret.sloc++; - } else if (data[num] !== undefined) { - ret.hits++; - ret.sloc++; - } - - ret.source[num] = { - source: line - , coverage: data[num] === undefined - ? '' - : data[num] - }; - }); - - ret.coverage = ret.hits / ret.sloc * 100; - - return ret; -} - -/** - * Return a plain-object representation of `test` - * free of cyclic properties etc. - * - * @param {Object} test - * @return {Object} - * @api private - */ - -function clean(test) { - return { - title: test.title - , fullTitle: test.fullTitle() - , duration: test.duration - } -} diff --git a/node_modules/mocha/lib/reporters/json-stream.js b/node_modules/mocha/lib/reporters/json-stream.js deleted file mode 100644 index 7cb8fbe..0000000 --- a/node_modules/mocha/lib/reporters/json-stream.js +++ /dev/null @@ -1,61 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , color = Base.color; - -/** - * Expose `List`. - */ - -exports = module.exports = List; - -/** - * Initialize a new `List` test reporter. - * - * @param {Runner} runner - * @api public - */ - -function List(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , total = runner.total; - - runner.on('start', function(){ - console.log(JSON.stringify(['start', { total: total }])); - }); - - runner.on('pass', function(test){ - console.log(JSON.stringify(['pass', clean(test)])); - }); - - runner.on('fail', function(test, err){ - console.log(JSON.stringify(['fail', clean(test)])); - }); - - runner.on('end', function(){ - process.stdout.write(JSON.stringify(['end', self.stats])); - }); -} - -/** - * Return a plain-object representation of `test` - * free of cyclic properties etc. - * - * @param {Object} test - * @return {Object} - * @api private - */ - -function clean(test) { - return { - title: test.title - , fullTitle: test.fullTitle() - , duration: test.duration - } -} \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/json.js b/node_modules/mocha/lib/reporters/json.js deleted file mode 100644 index a699f50..0000000 --- a/node_modules/mocha/lib/reporters/json.js +++ /dev/null @@ -1,70 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `JSON`. - */ - -exports = module.exports = JSONReporter; - -/** - * Initialize a new `JSON` reporter. - * - * @param {Runner} runner - * @api public - */ - -function JSONReporter(runner) { - var self = this; - Base.call(this, runner); - - var tests = [] - , failures = [] - , passes = []; - - runner.on('test end', function(test){ - tests.push(test); - }); - - runner.on('pass', function(test){ - passes.push(test); - }); - - runner.on('fail', function(test){ - failures.push(test); - }); - - runner.on('end', function(){ - var obj = { - stats: self.stats - , tests: tests.map(clean) - , failures: failures.map(clean) - , passes: passes.map(clean) - }; - - process.stdout.write(JSON.stringify(obj, null, 2)); - }); -} - -/** - * Return a plain-object representation of `test` - * free of cyclic properties etc. - * - * @param {Object} test - * @return {Object} - * @api private - */ - -function clean(test) { - return { - title: test.title - , fullTitle: test.fullTitle() - , duration: test.duration - } -} \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/landing.js b/node_modules/mocha/lib/reporters/landing.js deleted file mode 100644 index bf064f6..0000000 --- a/node_modules/mocha/lib/reporters/landing.js +++ /dev/null @@ -1,97 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `Landing`. - */ - -exports = module.exports = Landing; - -/** - * Airplane color. - */ - -Base.colors.plane = 0; - -/** - * Airplane crash color. - */ - -Base.colors['plane crash'] = 31; - -/** - * Runway color. - */ - -Base.colors.runway = 90; - -/** - * Initialize a new `Landing` reporter. - * - * @param {Runner} runner - * @api public - */ - -function Landing(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , width = Base.window.width * .75 | 0 - , total = runner.total - , stream = process.stdout - , plane = color('plane', '✈') - , crashed = -1 - , n = 0; - - function runway() { - var buf = Array(width).join('-'); - return ' ' + color('runway', buf); - } - - runner.on('start', function(){ - stream.write('\n '); - cursor.hide(); - }); - - runner.on('test end', function(test){ - // check if the plane crashed - var col = -1 == crashed - ? width * ++n / total | 0 - : crashed; - - // show the crash - if ('failed' == test.state) { - plane = color('plane crash', '✈'); - crashed = col; - } - - // render landing strip - stream.write('\u001b[4F\n\n'); - stream.write(runway()); - stream.write('\n '); - stream.write(color('runway', Array(col).join('⋅'))); - stream.write(plane) - stream.write(color('runway', Array(width - col).join('⋅') + '\n')); - stream.write(runway()); - stream.write('\u001b[0m'); - }); - - runner.on('end', function(){ - cursor.show(); - console.log(); - self.epilogue(); - }); -} - -/** - * Inherit from `Base.prototype`. - */ - -Landing.prototype.__proto__ = Base.prototype; \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/list.js b/node_modules/mocha/lib/reporters/list.js deleted file mode 100644 index 3328e15..0000000 --- a/node_modules/mocha/lib/reporters/list.js +++ /dev/null @@ -1,64 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `List`. - */ - -exports = module.exports = List; - -/** - * Initialize a new `List` test reporter. - * - * @param {Runner} runner - * @api public - */ - -function List(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , n = 0; - - runner.on('start', function(){ - console.log(); - }); - - runner.on('test', function(test){ - process.stdout.write(color('pass', ' ' + test.fullTitle() + ': ')); - }); - - runner.on('pending', function(test){ - var fmt = color('checkmark', ' -') - + color('pending', ' %s'); - console.log(fmt, test.fullTitle()); - }); - - runner.on('pass', function(test){ - var fmt = color('checkmark', ' '+Base.symbols.dot) - + color('pass', ' %s: ') - + color(test.speed, '%dms'); - cursor.CR(); - console.log(fmt, test.fullTitle(), test.duration); - }); - - runner.on('fail', function(test, err){ - cursor.CR(); - console.log(color('fail', ' %d) %s'), ++n, test.fullTitle()); - }); - - runner.on('end', self.epilogue.bind(self)); -} - -/** - * Inherit from `Base.prototype`. - */ - -List.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/markdown.js b/node_modules/mocha/lib/reporters/markdown.js deleted file mode 100644 index 6383a64..0000000 --- a/node_modules/mocha/lib/reporters/markdown.js +++ /dev/null @@ -1,91 +0,0 @@ -/** - * Module dependencies. - */ - -var Base = require('./base') - , utils = require('../utils'); - -/** - * Expose `Markdown`. - */ - -exports = module.exports = Markdown; - -/** - * Initialize a new `Markdown` reporter. - * - * @param {Runner} runner - * @api public - */ - -function Markdown(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , level = 0 - , buf = ''; - - function title(str) { - return Array(level).join('#') + ' ' + str; - } - - function indent() { - return Array(level).join(' '); - } - - function mapTOC(suite, obj) { - var ret = obj; - obj = obj[suite.title] = obj[suite.title] || { suite: suite }; - suite.suites.forEach(function(suite){ - mapTOC(suite, obj); - }); - return ret; - } - - function stringifyTOC(obj, level) { - ++level; - var buf = ''; - var link; - for (var key in obj) { - if ('suite' == key) continue; - if (key) link = ' - [' + key + '](#' + utils.slug(obj[key].suite.fullTitle()) + ')\n'; - if (key) buf += Array(level).join(' ') + link; - buf += stringifyTOC(obj[key], level); - } - --level; - return buf; - } - - function generateTOC(suite) { - var obj = mapTOC(suite, {}); - return stringifyTOC(obj, 0); - } - - generateTOC(runner.suite); - - runner.on('suite', function(suite){ - ++level; - var slug = utils.slug(suite.fullTitle()); - buf += '' + '\n'; - buf += title(suite.title) + '\n'; - }); - - runner.on('suite end', function(suite){ - --level; - }); - - runner.on('pass', function(test){ - var code = utils.clean(test.fn.toString()); - buf += test.title + '.\n'; - buf += '\n```js\n'; - buf += code + '\n'; - buf += '```\n\n'; - }); - - runner.on('end', function(){ - process.stdout.write('# TOC\n'); - process.stdout.write(generateTOC(runner.suite)); - process.stdout.write(buf); - }); -} \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/min.js b/node_modules/mocha/lib/reporters/min.js deleted file mode 100644 index 1b6117d..0000000 --- a/node_modules/mocha/lib/reporters/min.js +++ /dev/null @@ -1,38 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base'); - -/** - * Expose `Min`. - */ - -exports = module.exports = Min; - -/** - * Initialize a new `Min` minimal test reporter (best used with --watch). - * - * @param {Runner} runner - * @api public - */ - -function Min(runner) { - Base.call(this, runner); - - runner.on('start', function(){ - // clear screen - process.stdout.write('\u001b[2J'); - // set cursor position - process.stdout.write('\u001b[1;3H'); - }); - - runner.on('end', this.epilogue.bind(this)); -} - -/** - * Inherit from `Base.prototype`. - */ - -Min.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/nyan.js b/node_modules/mocha/lib/reporters/nyan.js deleted file mode 100644 index 4501f6b..0000000 --- a/node_modules/mocha/lib/reporters/nyan.js +++ /dev/null @@ -1,260 +0,0 @@ -/** - * Module dependencies. - */ - -var Base = require('./base') - , color = Base.color; - -/** - * Expose `Dot`. - */ - -exports = module.exports = NyanCat; - -/** - * Initialize a new `Dot` matrix test reporter. - * - * @param {Runner} runner - * @api public - */ - -function NyanCat(runner) { - Base.call(this, runner); - var self = this - , stats = this.stats - , width = Base.window.width * .75 | 0 - , rainbowColors = this.rainbowColors = self.generateColors() - , colorIndex = this.colorIndex = 0 - , numerOfLines = this.numberOfLines = 4 - , trajectories = this.trajectories = [[], [], [], []] - , nyanCatWidth = this.nyanCatWidth = 11 - , trajectoryWidthMax = this.trajectoryWidthMax = (width - nyanCatWidth) - , scoreboardWidth = this.scoreboardWidth = 5 - , tick = this.tick = 0 - , n = 0; - - runner.on('start', function(){ - Base.cursor.hide(); - self.draw(); - }); - - runner.on('pending', function(test){ - self.draw(); - }); - - runner.on('pass', function(test){ - self.draw(); - }); - - runner.on('fail', function(test, err){ - self.draw(); - }); - - runner.on('end', function(){ - Base.cursor.show(); - for (var i = 0; i < self.numberOfLines; i++) write('\n'); - self.epilogue(); - }); -} - -/** - * Draw the nyan cat - * - * @api private - */ - -NyanCat.prototype.draw = function(){ - this.appendRainbow(); - this.drawScoreboard(); - this.drawRainbow(); - this.drawNyanCat(); - this.tick = !this.tick; -}; - -/** - * Draw the "scoreboard" showing the number - * of passes, failures and pending tests. - * - * @api private - */ - -NyanCat.prototype.drawScoreboard = function(){ - var stats = this.stats; - var colors = Base.colors; - - function draw(color, n) { - write(' '); - write('\u001b[' + color + 'm' + n + '\u001b[0m'); - write('\n'); - } - - draw(colors.green, stats.passes); - draw(colors.fail, stats.failures); - draw(colors.pending, stats.pending); - write('\n'); - - this.cursorUp(this.numberOfLines); -}; - -/** - * Append the rainbow. - * - * @api private - */ - -NyanCat.prototype.appendRainbow = function(){ - var segment = this.tick ? '_' : '-'; - var rainbowified = this.rainbowify(segment); - - for (var index = 0; index < this.numberOfLines; index++) { - var trajectory = this.trajectories[index]; - if (trajectory.length >= this.trajectoryWidthMax) trajectory.shift(); - trajectory.push(rainbowified); - } -}; - -/** - * Draw the rainbow. - * - * @api private - */ - -NyanCat.prototype.drawRainbow = function(){ - var self = this; - - this.trajectories.forEach(function(line, index) { - write('\u001b[' + self.scoreboardWidth + 'C'); - write(line.join('')); - write('\n'); - }); - - this.cursorUp(this.numberOfLines); -}; - -/** - * Draw the nyan cat - * - * @api private - */ - -NyanCat.prototype.drawNyanCat = function() { - var self = this; - var startWidth = this.scoreboardWidth + this.trajectories[0].length; - var color = '\u001b[' + startWidth + 'C'; - var padding = ''; - - write(color); - write('_,------,'); - write('\n'); - - write(color); - padding = self.tick ? ' ' : ' '; - write('_|' + padding + '/\\_/\\ '); - write('\n'); - - write(color); - padding = self.tick ? '_' : '__'; - var tail = self.tick ? '~' : '^'; - var face; - write(tail + '|' + padding + this.face() + ' '); - write('\n'); - - write(color); - padding = self.tick ? ' ' : ' '; - write(padding + '"" "" '); - write('\n'); - - this.cursorUp(this.numberOfLines); -}; - -/** - * Draw nyan cat face. - * - * @return {String} - * @api private - */ - -NyanCat.prototype.face = function() { - var stats = this.stats; - if (stats.failures) { - return '( x .x)'; - } else if (stats.pending) { - return '( o .o)'; - } else if(stats.passes) { - return '( ^ .^)'; - } else { - return '( - .-)'; - } -} - -/** - * Move cursor up `n`. - * - * @param {Number} n - * @api private - */ - -NyanCat.prototype.cursorUp = function(n) { - write('\u001b[' + n + 'A'); -}; - -/** - * Move cursor down `n`. - * - * @param {Number} n - * @api private - */ - -NyanCat.prototype.cursorDown = function(n) { - write('\u001b[' + n + 'B'); -}; - -/** - * Generate rainbow colors. - * - * @return {Array} - * @api private - */ - -NyanCat.prototype.generateColors = function(){ - var colors = []; - - for (var i = 0; i < (6 * 7); i++) { - var pi3 = Math.floor(Math.PI / 3); - var n = (i * (1.0 / 6)); - var r = Math.floor(3 * Math.sin(n) + 3); - var g = Math.floor(3 * Math.sin(n + 2 * pi3) + 3); - var b = Math.floor(3 * Math.sin(n + 4 * pi3) + 3); - colors.push(36 * r + 6 * g + b + 16); - } - - return colors; -}; - -/** - * Apply rainbow to the given `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -NyanCat.prototype.rainbowify = function(str){ - var color = this.rainbowColors[this.colorIndex % this.rainbowColors.length]; - this.colorIndex += 1; - return '\u001b[38;5;' + color + 'm' + str + '\u001b[0m'; -}; - -/** - * Stdout helper. - */ - -function write(string) { - process.stdout.write(string); -} - -/** - * Inherit from `Base.prototype`. - */ - -NyanCat.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/progress.js b/node_modules/mocha/lib/reporters/progress.js deleted file mode 100644 index 5953638..0000000 --- a/node_modules/mocha/lib/reporters/progress.js +++ /dev/null @@ -1,86 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `Progress`. - */ - -exports = module.exports = Progress; - -/** - * General progress bar color. - */ - -Base.colors.progress = 90; - -/** - * Initialize a new `Progress` bar test reporter. - * - * @param {Runner} runner - * @param {Object} options - * @api public - */ - -function Progress(runner, options) { - Base.call(this, runner); - - var self = this - , options = options || {} - , stats = this.stats - , width = Base.window.width * .50 | 0 - , total = runner.total - , complete = 0 - , max = Math.max; - - // default chars - options.open = options.open || '['; - options.complete = options.complete || '▬'; - options.incomplete = options.incomplete || Base.symbols.dot; - options.close = options.close || ']'; - options.verbose = false; - - // tests started - runner.on('start', function(){ - console.log(); - cursor.hide(); - }); - - // tests complete - runner.on('test end', function(){ - complete++; - var incomplete = total - complete - , percent = complete / total - , n = width * percent | 0 - , i = width - n; - - cursor.CR(); - process.stdout.write('\u001b[J'); - process.stdout.write(color('progress', ' ' + options.open)); - process.stdout.write(Array(n).join(options.complete)); - process.stdout.write(Array(i).join(options.incomplete)); - process.stdout.write(color('progress', options.close)); - if (options.verbose) { - process.stdout.write(color('progress', ' ' + complete + ' of ' + total)); - } - }); - - // tests are complete, output some stats - // and the failures if any - runner.on('end', function(){ - cursor.show(); - console.log(); - self.epilogue(); - }); -} - -/** - * Inherit from `Base.prototype`. - */ - -Progress.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/spec.js b/node_modules/mocha/lib/reporters/spec.js deleted file mode 100644 index ada25c3..0000000 --- a/node_modules/mocha/lib/reporters/spec.js +++ /dev/null @@ -1,83 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `Spec`. - */ - -exports = module.exports = Spec; - -/** - * Initialize a new `Spec` test reporter. - * - * @param {Runner} runner - * @api public - */ - -function Spec(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , indents = 0 - , n = 0; - - function indent() { - return Array(indents).join(' ') - } - - runner.on('start', function(){ - console.log(); - }); - - runner.on('suite', function(suite){ - ++indents; - console.log(color('suite', '%s%s'), indent(), suite.title); - }); - - runner.on('suite end', function(suite){ - --indents; - if (1 == indents) console.log(); - }); - - runner.on('pending', function(test){ - var fmt = indent() + color('pending', ' - %s'); - console.log(fmt, test.title); - }); - - runner.on('pass', function(test){ - if ('fast' == test.speed) { - var fmt = indent() - + color('checkmark', ' ' + Base.symbols.ok) - + color('pass', ' %s '); - cursor.CR(); - console.log(fmt, test.title); - } else { - var fmt = indent() - + color('checkmark', ' ' + Base.symbols.ok) - + color('pass', ' %s ') - + color(test.speed, '(%dms)'); - cursor.CR(); - console.log(fmt, test.title, test.duration); - } - }); - - runner.on('fail', function(test, err){ - cursor.CR(); - console.log(indent() + color('fail', ' %d) %s'), ++n, test.title); - }); - - runner.on('end', self.epilogue.bind(self)); -} - -/** - * Inherit from `Base.prototype`. - */ - -Spec.prototype.__proto__ = Base.prototype; diff --git a/node_modules/mocha/lib/reporters/tap.js b/node_modules/mocha/lib/reporters/tap.js deleted file mode 100644 index 2bcd995..0000000 --- a/node_modules/mocha/lib/reporters/tap.js +++ /dev/null @@ -1,73 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `TAP`. - */ - -exports = module.exports = TAP; - -/** - * Initialize a new `TAP` reporter. - * - * @param {Runner} runner - * @api public - */ - -function TAP(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , n = 1 - , passes = 0 - , failures = 0; - - runner.on('start', function(){ - var total = runner.grepTotal(runner.suite); - console.log('%d..%d', 1, total); - }); - - runner.on('test end', function(){ - ++n; - }); - - runner.on('pending', function(test){ - console.log('ok %d %s # SKIP -', n, title(test)); - }); - - runner.on('pass', function(test){ - passes++; - console.log('ok %d %s', n, title(test)); - }); - - runner.on('fail', function(test, err){ - failures++; - console.log('not ok %d %s', n, title(test)); - if (err.stack) console.log(err.stack.replace(/^/gm, ' ')); - }); - - runner.on('end', function(){ - console.log('# tests ' + (passes + failures)); - console.log('# pass ' + passes); - console.log('# fail ' + failures); - }); -} - -/** - * Return a TAP-safe title of `test` - * - * @param {Object} test - * @return {String} - * @api private - */ - -function title(test) { - return test.fullTitle().replace(/#/g, ''); -} diff --git a/node_modules/mocha/lib/reporters/templates/coverage.jade b/node_modules/mocha/lib/reporters/templates/coverage.jade deleted file mode 100644 index b78119f..0000000 --- a/node_modules/mocha/lib/reporters/templates/coverage.jade +++ /dev/null @@ -1,50 +0,0 @@ -!!! 5 -html - head - title Coverage - include script.html - include style.html - body - #coverage - h1#overview Coverage - include menu - - #stats(class=coverageClass(cov.coverage)) - .percentage #{cov.coverage | 0}% - .sloc= cov.sloc - .hits= cov.hits - .misses= cov.misses - - #files - for file in cov.files - .file - h2(id=file.filename)= file.filename - #stats(class=coverageClass(file.coverage)) - .percentage #{file.coverage | 0}% - .sloc= file.sloc - .hits= file.hits - .misses= file.misses - - table#source - thead - tr - th Line - th Hits - th Source - tbody - for line, number in file.source - if line.coverage > 0 - tr.hit - td.line= number - td.hits= line.coverage - td.source= line.source - else if 0 === line.coverage - tr.miss - td.line= number - td.hits 0 - td.source= line.source - else - tr - td.line= number - td.hits - td.source= line.source || ' ' diff --git a/node_modules/mocha/lib/reporters/templates/menu.jade b/node_modules/mocha/lib/reporters/templates/menu.jade deleted file mode 100644 index e9ba464..0000000 --- a/node_modules/mocha/lib/reporters/templates/menu.jade +++ /dev/null @@ -1,13 +0,0 @@ -#menu - li - a(href='#overview') overview - for file in cov.files - li - span.cov(class=coverageClass(file.coverage)) #{file.coverage | 0} - a(href='##{file.filename}') - segments = file.filename.split('/') - basename = segments.pop() - if segments.length - span.dirname= segments.join('/') + '/' - span.basename= basename - a#logo(href='http://visionmedia.github.io/mocha/') m diff --git a/node_modules/mocha/lib/reporters/templates/script.html b/node_modules/mocha/lib/reporters/templates/script.html deleted file mode 100644 index 073cf79..0000000 --- a/node_modules/mocha/lib/reporters/templates/script.html +++ /dev/null @@ -1,34 +0,0 @@ - diff --git a/node_modules/mocha/lib/reporters/templates/style.html b/node_modules/mocha/lib/reporters/templates/style.html deleted file mode 100644 index 643c0ab..0000000 --- a/node_modules/mocha/lib/reporters/templates/style.html +++ /dev/null @@ -1,320 +0,0 @@ - \ No newline at end of file diff --git a/node_modules/mocha/lib/reporters/xunit.js b/node_modules/mocha/lib/reporters/xunit.js deleted file mode 100644 index e956380..0000000 --- a/node_modules/mocha/lib/reporters/xunit.js +++ /dev/null @@ -1,119 +0,0 @@ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , utils = require('../utils') - , escape = utils.escape; - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date - , setTimeout = global.setTimeout - , setInterval = global.setInterval - , clearTimeout = global.clearTimeout - , clearInterval = global.clearInterval; - -/** - * Expose `XUnit`. - */ - -exports = module.exports = XUnit; - -/** - * Initialize a new `XUnit` reporter. - * - * @param {Runner} runner - * @api public - */ - -function XUnit(runner) { - Base.call(this, runner); - var stats = this.stats - , tests = [] - , self = this; - - runner.on('pending', function(test){ - tests.push(test); - }); - - runner.on('pass', function(test){ - tests.push(test); - }); - - runner.on('fail', function(test){ - tests.push(test); - }); - - runner.on('end', function(){ - console.log(tag('testsuite', { - name: 'Mocha Tests' - , tests: stats.tests - , failures: stats.failures - , errors: stats.failures - , skipped: stats.tests - stats.failures - stats.passes - , timestamp: (new Date).toUTCString() - , time: (stats.duration / 1000) || 0 - }, false)); - - tests.forEach(test); - console.log(''); - }); -} - -/** - * Inherit from `Base.prototype`. - */ - -XUnit.prototype.__proto__ = Base.prototype; - -/** - * Output tag for the given `test.` - */ - -function test(test) { - var attrs = { - classname: test.parent.fullTitle() - , name: test.title - , time: (test.duration / 1000) || 0 - }; - - if ('failed' == test.state) { - var err = test.err; - attrs.message = escape(err.message); - console.log(tag('testcase', attrs, false, tag('failure', attrs, false, cdata(err.stack)))); - } else if (test.pending) { - console.log(tag('testcase', attrs, false, tag('skipped', {}, true))); - } else { - console.log(tag('testcase', attrs, true) ); - } -} - -/** - * HTML tag helper. - */ - -function tag(name, attrs, close, content) { - var end = close ? '/>' : '>' - , pairs = [] - , tag; - - for (var key in attrs) { - pairs.push(key + '="' + escape(attrs[key]) + '"'); - } - - tag = '<' + name + (pairs.length ? ' ' + pairs.join(' ') : '') + end; - if (content) tag += content + ''; -} diff --git a/node_modules/mocha/lib/runnable.js b/node_modules/mocha/lib/runnable.js deleted file mode 100644 index 03b8792..0000000 --- a/node_modules/mocha/lib/runnable.js +++ /dev/null @@ -1,227 +0,0 @@ - -/** - * Module dependencies. - */ - -var EventEmitter = require('events').EventEmitter - , debug = require('debug')('mocha:runnable') - , milliseconds = require('./ms'); - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date - , setTimeout = global.setTimeout - , setInterval = global.setInterval - , clearTimeout = global.clearTimeout - , clearInterval = global.clearInterval; - -/** - * Object#toString(). - */ - -var toString = Object.prototype.toString; - -/** - * Expose `Runnable`. - */ - -module.exports = Runnable; - -/** - * Initialize a new `Runnable` with the given `title` and callback `fn`. - * - * @param {String} title - * @param {Function} fn - * @api private - */ - -function Runnable(title, fn) { - this.title = title; - this.fn = fn; - this.async = fn && fn.length; - this.sync = ! this.async; - this._timeout = 2000; - this._slow = 75; - this.timedOut = false; -} - -/** - * Inherit from `EventEmitter.prototype`. - */ - -Runnable.prototype.__proto__ = EventEmitter.prototype; - -/** - * Set & get timeout `ms`. - * - * @param {Number|String} ms - * @return {Runnable|Number} ms or self - * @api private - */ - -Runnable.prototype.timeout = function(ms){ - if (0 == arguments.length) return this._timeout; - if ('string' == typeof ms) ms = milliseconds(ms); - debug('timeout %d', ms); - this._timeout = ms; - if (this.timer) this.resetTimeout(); - return this; -}; - -/** - * Set & get slow `ms`. - * - * @param {Number|String} ms - * @return {Runnable|Number} ms or self - * @api private - */ - -Runnable.prototype.slow = function(ms){ - if (0 === arguments.length) return this._slow; - if ('string' == typeof ms) ms = milliseconds(ms); - debug('timeout %d', ms); - this._slow = ms; - return this; -}; - -/** - * Return the full title generated by recursively - * concatenating the parent's full title. - * - * @return {String} - * @api public - */ - -Runnable.prototype.fullTitle = function(){ - return this.parent.fullTitle() + ' ' + this.title; -}; - -/** - * Clear the timeout. - * - * @api private - */ - -Runnable.prototype.clearTimeout = function(){ - clearTimeout(this.timer); -}; - -/** - * Inspect the runnable void of private properties. - * - * @return {String} - * @api private - */ - -Runnable.prototype.inspect = function(){ - return JSON.stringify(this, function(key, val){ - if ('_' == key[0]) return; - if ('parent' == key) return '#'; - if ('ctx' == key) return '#'; - return val; - }, 2); -}; - -/** - * Reset the timeout. - * - * @api private - */ - -Runnable.prototype.resetTimeout = function(){ - var self = this; - var ms = this.timeout() || 1e9; - - this.clearTimeout(); - this.timer = setTimeout(function(){ - self.callback(new Error('timeout of ' + ms + 'ms exceeded')); - self.timedOut = true; - }, ms); -}; - -/** - * Whitelist these globals for this test run - * - * @api private - */ -Runnable.prototype.globals = function(arr){ - var self = this; - this._allowedGlobals = arr; -}; - -/** - * Run the test and invoke `fn(err)`. - * - * @param {Function} fn - * @api private - */ - -Runnable.prototype.run = function(fn){ - var self = this - , ms = this.timeout() - , start = new Date - , ctx = this.ctx - , finished - , emitted; - - if (ctx) ctx.runnable(this); - - // timeout - if (this.async) { - if (ms) { - this.timer = setTimeout(function(){ - done(new Error('timeout of ' + ms + 'ms exceeded')); - self.timedOut = true; - }, ms); - } - } - - // called multiple times - function multiple(err) { - if (emitted) return; - emitted = true; - self.emit('error', err || new Error('done() called multiple times')); - } - - // finished - function done(err) { - if (self.timedOut) return; - if (finished) return multiple(err); - self.clearTimeout(); - self.duration = new Date - start; - finished = true; - fn(err); - } - - // for .resetTimeout() - this.callback = done; - - // async - if (this.async) { - try { - this.fn.call(ctx, function(err){ - if (err instanceof Error || toString.call(err) === "[object Error]") return done(err); - if (null != err) return done(new Error('done() invoked with non-Error: ' + err)); - done(); - }); - } catch (err) { - done(err); - } - return; - } - - if (this.asyncOnly) { - return done(new Error('--async-only option in use without declaring `done()`')); - } - - // sync - try { - if (!this.pending) this.fn.call(ctx); - this.duration = new Date - start; - fn(); - } catch (err) { - fn(err); - } -}; diff --git a/node_modules/mocha/lib/runner.js b/node_modules/mocha/lib/runner.js deleted file mode 100644 index deb442e..0000000 --- a/node_modules/mocha/lib/runner.js +++ /dev/null @@ -1,661 +0,0 @@ -/** - * Module dependencies. - */ - -var EventEmitter = require('events').EventEmitter - , debug = require('debug')('mocha:runner') - , Test = require('./test') - , utils = require('./utils') - , filter = utils.filter - , keys = utils.keys; - -/** - * Non-enumerable globals. - */ - -var globals = [ - 'setTimeout', - 'clearTimeout', - 'setInterval', - 'clearInterval', - 'XMLHttpRequest', - 'Date' -]; - -/** - * Expose `Runner`. - */ - -module.exports = Runner; - -/** - * Initialize a `Runner` for the given `suite`. - * - * Events: - * - * - `start` execution started - * - `end` execution complete - * - `suite` (suite) test suite execution started - * - `suite end` (suite) all tests (and sub-suites) have finished - * - `test` (test) test execution started - * - `test end` (test) test completed - * - `hook` (hook) hook execution started - * - `hook end` (hook) hook complete - * - `pass` (test) test passed - * - `fail` (test, err) test failed - * - `pending` (test) test pending - * - * @api public - */ - -function Runner(suite) { - var self = this; - this._globals = []; - this._abort = false; - this.suite = suite; - this.total = suite.total(); - this.failures = 0; - this.on('test end', function(test){ self.checkGlobals(test); }); - this.on('hook end', function(hook){ self.checkGlobals(hook); }); - this.grep(/.*/); - this.globals(this.globalProps().concat(extraGlobals())); -} - -/** - * Wrapper for setImmediate, process.nextTick, or browser polyfill. - * - * @param {Function} fn - * @api private - */ - -Runner.immediately = global.setImmediate || process.nextTick; - -/** - * Inherit from `EventEmitter.prototype`. - */ - -Runner.prototype.__proto__ = EventEmitter.prototype; - -/** - * Run tests with full titles matching `re`. Updates runner.total - * with number of tests matched. - * - * @param {RegExp} re - * @param {Boolean} invert - * @return {Runner} for chaining - * @api public - */ - -Runner.prototype.grep = function(re, invert){ - debug('grep %s', re); - this._grep = re; - this._invert = invert; - this.total = this.grepTotal(this.suite); - return this; -}; - -/** - * Returns the number of tests matching the grep search for the - * given suite. - * - * @param {Suite} suite - * @return {Number} - * @api public - */ - -Runner.prototype.grepTotal = function(suite) { - var self = this; - var total = 0; - - suite.eachTest(function(test){ - var match = self._grep.test(test.fullTitle()); - if (self._invert) match = !match; - if (match) total++; - }); - - return total; -}; - -/** - * Return a list of global properties. - * - * @return {Array} - * @api private - */ - -Runner.prototype.globalProps = function() { - var props = utils.keys(global); - - // non-enumerables - for (var i = 0; i < globals.length; ++i) { - if (~utils.indexOf(props, globals[i])) continue; - props.push(globals[i]); - } - - return props; -}; - -/** - * Allow the given `arr` of globals. - * - * @param {Array} arr - * @return {Runner} for chaining - * @api public - */ - -Runner.prototype.globals = function(arr){ - if (0 == arguments.length) return this._globals; - debug('globals %j', arr); - this._globals = this._globals.concat(arr); - return this; -}; - -/** - * Check for global variable leaks. - * - * @api private - */ - -Runner.prototype.checkGlobals = function(test){ - if (this.ignoreLeaks) return; - var ok = this._globals; - - var globals = this.globalProps(); - var isNode = process.kill; - var leaks; - - if (test) { - ok = ok.concat(test._allowedGlobals || []); - } - - if(this.prevGlobalsLength == globals.length) return; - this.prevGlobalsLength = globals.length; - - leaks = filterLeaks(ok, globals); - this._globals = this._globals.concat(leaks); - - if (leaks.length > 1) { - this.fail(test, new Error('global leaks detected: ' + leaks.join(', ') + '')); - } else if (leaks.length) { - this.fail(test, new Error('global leak detected: ' + leaks[0])); - } -}; - -/** - * Fail the given `test`. - * - * @param {Test} test - * @param {Error} err - * @api private - */ - -Runner.prototype.fail = function(test, err){ - ++this.failures; - test.state = 'failed'; - - if ('string' == typeof err) { - err = new Error('the string "' + err + '" was thrown, throw an Error :)'); - } - - this.emit('fail', test, err); -}; - -/** - * Fail the given `hook` with `err`. - * - * Hook failures work in the following pattern: - * - If bail, then exit - * - Failed `before` hook skips all tests in a suite and subsuites, - * but jumps to corresponding `after` hook - * - Failed `before each` hook skips remaining tests in a - * suite and jumps to corresponding `after each` hook, - * which is run only once - * - Failed `after` hook does not alter - * execution order - * - Failed `after each` hook skips remaining tests in a - * suite and subsuites, but executes other `after each` - * hooks - * - * @param {Hook} hook - * @param {Error} err - * @api private - */ - -Runner.prototype.failHook = function(hook, err){ - this.fail(hook, err); - if (this.suite.bail()) { - this.emit('end'); - } -}; - -/** - * Run hook `name` callbacks and then invoke `fn()`. - * - * @param {String} name - * @param {Function} function - * @api private - */ - -Runner.prototype.hook = function(name, fn){ - var suite = this.suite - , hooks = suite['_' + name] - , self = this - , timer; - - function next(i) { - var hook = hooks[i]; - if (!hook) return fn(); - if (self.failures && suite.bail()) return fn(); - self.currentRunnable = hook; - - hook.ctx.currentTest = self.test; - - self.emit('hook', hook); - - hook.on('error', function(err){ - self.failHook(hook, err); - }); - - hook.run(function(err){ - hook.removeAllListeners('error'); - var testError = hook.error(); - if (testError) self.fail(self.test, testError); - if (err) { - self.failHook(hook, err); - - // stop executing hooks, notify callee of hook err - return fn(err); - } - self.emit('hook end', hook); - delete hook.ctx.currentTest; - next(++i); - }); - } - - Runner.immediately(function(){ - next(0); - }); -}; - -/** - * Run hook `name` for the given array of `suites` - * in order, and callback `fn(err, errSuite)`. - * - * @param {String} name - * @param {Array} suites - * @param {Function} fn - * @api private - */ - -Runner.prototype.hooks = function(name, suites, fn){ - var self = this - , orig = this.suite; - - function next(suite) { - self.suite = suite; - - if (!suite) { - self.suite = orig; - return fn(); - } - - self.hook(name, function(err){ - if (err) { - var errSuite = self.suite; - self.suite = orig; - return fn(err, errSuite); - } - - next(suites.pop()); - }); - } - - next(suites.pop()); -}; - -/** - * Run hooks from the top level down. - * - * @param {String} name - * @param {Function} fn - * @api private - */ - -Runner.prototype.hookUp = function(name, fn){ - var suites = [this.suite].concat(this.parents()).reverse(); - this.hooks(name, suites, fn); -}; - -/** - * Run hooks from the bottom up. - * - * @param {String} name - * @param {Function} fn - * @api private - */ - -Runner.prototype.hookDown = function(name, fn){ - var suites = [this.suite].concat(this.parents()); - this.hooks(name, suites, fn); -}; - -/** - * Return an array of parent Suites from - * closest to furthest. - * - * @return {Array} - * @api private - */ - -Runner.prototype.parents = function(){ - var suite = this.suite - , suites = []; - while (suite = suite.parent) suites.push(suite); - return suites; -}; - -/** - * Run the current test and callback `fn(err)`. - * - * @param {Function} fn - * @api private - */ - -Runner.prototype.runTest = function(fn){ - var test = this.test - , self = this; - - if (this.asyncOnly) test.asyncOnly = true; - - try { - test.on('error', function(err){ - self.fail(test, err); - }); - test.run(fn); - } catch (err) { - fn(err); - } -}; - -/** - * Run tests in the given `suite` and invoke - * the callback `fn()` when complete. - * - * @param {Suite} suite - * @param {Function} fn - * @api private - */ - -Runner.prototype.runTests = function(suite, fn){ - var self = this - , tests = suite.tests.slice() - , test; - - - function hookErr(err, errSuite, after) { - // before/after Each hook for errSuite failed: - var orig = self.suite; - - // for failed 'after each' hook start from errSuite parent, - // otherwise start from errSuite itself - self.suite = after ? errSuite.parent : errSuite; - - if (self.suite) { - // call hookUp afterEach - self.hookUp('afterEach', function(err2, errSuite2) { - self.suite = orig; - // some hooks may fail even now - if (err2) return hookErr(err2, errSuite2, true); - // report error suite - fn(errSuite); - }); - } else { - // there is no need calling other 'after each' hooks - self.suite = orig; - fn(errSuite); - } - } - - function next(err, errSuite) { - // if we bail after first err - if (self.failures && suite._bail) return fn(); - - if (self._abort) return fn(); - - if (err) return hookErr(err, errSuite, true); - - // next test - test = tests.shift(); - - // all done - if (!test) return fn(); - - // grep - var match = self._grep.test(test.fullTitle()); - if (self._invert) match = !match; - if (!match) return next(); - - // pending - if (test.pending) { - self.emit('pending', test); - self.emit('test end', test); - return next(); - } - - // execute test and hook(s) - self.emit('test', self.test = test); - self.hookDown('beforeEach', function(err, errSuite){ - - if (err) return hookErr(err, errSuite, false); - - self.currentRunnable = self.test; - self.runTest(function(err){ - test = self.test; - - if (err) { - self.fail(test, err); - self.emit('test end', test); - return self.hookUp('afterEach', next); - } - - test.state = 'passed'; - self.emit('pass', test); - self.emit('test end', test); - self.hookUp('afterEach', next); - }); - }); - } - - this.next = next; - next(); -}; - -/** - * Run the given `suite` and invoke the - * callback `fn()` when complete. - * - * @param {Suite} suite - * @param {Function} fn - * @api private - */ - -Runner.prototype.runSuite = function(suite, fn){ - var total = this.grepTotal(suite) - , self = this - , i = 0; - - debug('run suite %s', suite.fullTitle()); - - if (!total) return fn(); - - this.emit('suite', this.suite = suite); - - function next(errSuite) { - if (errSuite) { - // current suite failed on a hook from errSuite - if (errSuite == suite) { - // if errSuite is current suite - // continue to the next sibling suite - return done(); - } else { - // errSuite is among the parents of current suite - // stop execution of errSuite and all sub-suites - return done(errSuite); - } - } - - if (self._abort) return done(); - - var curr = suite.suites[i++]; - if (!curr) return done(); - self.runSuite(curr, next); - } - - function done(errSuite) { - self.suite = suite; - self.hook('afterAll', function(){ - self.emit('suite end', suite); - fn(errSuite); - }); - } - - this.hook('beforeAll', function(err){ - if (err) return done(); - self.runTests(suite, next); - }); -}; - -/** - * Handle uncaught exceptions. - * - * @param {Error} err - * @api private - */ - -Runner.prototype.uncaught = function(err){ - debug('uncaught exception %s', err.message); - var runnable = this.currentRunnable; - if (!runnable || 'failed' == runnable.state) return; - runnable.clearTimeout(); - err.uncaught = true; - this.fail(runnable, err); - - // recover from test - if ('test' == runnable.type) { - this.emit('test end', runnable); - this.hookUp('afterEach', this.next); - return; - } - - // bail on hooks - this.emit('end'); -}; - -/** - * Run the root suite and invoke `fn(failures)` - * on completion. - * - * @param {Function} fn - * @return {Runner} for chaining - * @api public - */ - -Runner.prototype.run = function(fn){ - var self = this - , fn = fn || function(){}; - - function uncaught(err){ - self.uncaught(err); - } - - debug('start'); - - // callback - this.on('end', function(){ - debug('end'); - process.removeListener('uncaughtException', uncaught); - fn(self.failures); - }); - - // run suites - this.emit('start'); - this.runSuite(this.suite, function(){ - debug('finished running'); - self.emit('end'); - }); - - // uncaught exception - process.on('uncaughtException', uncaught); - - return this; -}; - -/** - * Cleanly abort execution - * - * @return {Runner} for chaining - * @api public - */ -Runner.prototype.abort = function(){ - debug('aborting'); - this._abort = true; -} - -/** - * Filter leaks with the given globals flagged as `ok`. - * - * @param {Array} ok - * @param {Array} globals - * @return {Array} - * @api private - */ - -function filterLeaks(ok, globals) { - return filter(globals, function(key){ - // Firefox and Chrome exposes iframes as index inside the window object - if (/^d+/.test(key)) return false; - - // in firefox - // if runner runs in an iframe, this iframe's window.getInterface method not init at first - // it is assigned in some seconds - if (global.navigator && /^getInterface/.test(key)) return false; - - // an iframe could be approached by window[iframeIndex] - // in ie6,7,8 and opera, iframeIndex is enumerable, this could cause leak - if (global.navigator && /^\d+/.test(key)) return false; - - // Opera and IE expose global variables for HTML element IDs (issue #243) - if (/^mocha-/.test(key)) return false; - - var matched = filter(ok, function(ok){ - if (~ok.indexOf('*')) return 0 == key.indexOf(ok.split('*')[0]); - return key == ok; - }); - return matched.length == 0 && (!global.navigator || 'onerror' !== key); - }); -} - -/** - * Array of globals dependent on the environment. - * - * @return {Array} - * @api private - */ - - function extraGlobals() { - if (typeof(process) === 'object' && - typeof(process.version) === 'string') { - - var nodeVersion = process.version.split('.').reduce(function(a, v) { - return a << 8 | v; - }); - - // 'errno' was renamed to process._errno in v0.9.11. - - if (nodeVersion < 0x00090B) { - return ['errno']; - } - } - - return []; - } diff --git a/node_modules/mocha/lib/suite.js b/node_modules/mocha/lib/suite.js deleted file mode 100644 index 869bb88..0000000 --- a/node_modules/mocha/lib/suite.js +++ /dev/null @@ -1,296 +0,0 @@ - -/** - * Module dependencies. - */ - -var EventEmitter = require('events').EventEmitter - , debug = require('debug')('mocha:suite') - , milliseconds = require('./ms') - , utils = require('./utils') - , Hook = require('./hook'); - -/** - * Expose `Suite`. - */ - -exports = module.exports = Suite; - -/** - * Create a new `Suite` with the given `title` - * and parent `Suite`. When a suite with the - * same title is already present, that suite - * is returned to provide nicer reporter - * and more flexible meta-testing. - * - * @param {Suite} parent - * @param {String} title - * @return {Suite} - * @api public - */ - -exports.create = function(parent, title){ - var suite = new Suite(title, parent.ctx); - suite.parent = parent; - if (parent.pending) suite.pending = true; - title = suite.fullTitle(); - parent.addSuite(suite); - return suite; -}; - -/** - * Initialize a new `Suite` with the given - * `title` and `ctx`. - * - * @param {String} title - * @param {Context} ctx - * @api private - */ - -function Suite(title, ctx) { - this.title = title; - this.ctx = ctx; - this.suites = []; - this.tests = []; - this.pending = false; - this._beforeEach = []; - this._beforeAll = []; - this._afterEach = []; - this._afterAll = []; - this.root = !title; - this._timeout = 2000; - this._slow = 75; - this._bail = false; -} - -/** - * Inherit from `EventEmitter.prototype`. - */ - -Suite.prototype.__proto__ = EventEmitter.prototype; - -/** - * Return a clone of this `Suite`. - * - * @return {Suite} - * @api private - */ - -Suite.prototype.clone = function(){ - var suite = new Suite(this.title); - debug('clone'); - suite.ctx = this.ctx; - suite.timeout(this.timeout()); - suite.slow(this.slow()); - suite.bail(this.bail()); - return suite; -}; - -/** - * Set timeout `ms` or short-hand such as "2s". - * - * @param {Number|String} ms - * @return {Suite|Number} for chaining - * @api private - */ - -Suite.prototype.timeout = function(ms){ - if (0 == arguments.length) return this._timeout; - if ('string' == typeof ms) ms = milliseconds(ms); - debug('timeout %d', ms); - this._timeout = parseInt(ms, 10); - return this; -}; - -/** - * Set slow `ms` or short-hand such as "2s". - * - * @param {Number|String} ms - * @return {Suite|Number} for chaining - * @api private - */ - -Suite.prototype.slow = function(ms){ - if (0 === arguments.length) return this._slow; - if ('string' == typeof ms) ms = milliseconds(ms); - debug('slow %d', ms); - this._slow = ms; - return this; -}; - -/** - * Sets whether to bail after first error. - * - * @parma {Boolean} bail - * @return {Suite|Number} for chaining - * @api private - */ - -Suite.prototype.bail = function(bail){ - if (0 == arguments.length) return this._bail; - debug('bail %s', bail); - this._bail = bail; - return this; -}; - -/** - * Run `fn(test[, done])` before running tests. - * - * @param {Function} fn - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.beforeAll = function(fn){ - if (this.pending) return this; - var hook = new Hook('"before all" hook', fn); - hook.parent = this; - hook.timeout(this.timeout()); - hook.slow(this.slow()); - hook.ctx = this.ctx; - this._beforeAll.push(hook); - this.emit('beforeAll', hook); - return this; -}; - -/** - * Run `fn(test[, done])` after running tests. - * - * @param {Function} fn - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.afterAll = function(fn){ - if (this.pending) return this; - var hook = new Hook('"after all" hook', fn); - hook.parent = this; - hook.timeout(this.timeout()); - hook.slow(this.slow()); - hook.ctx = this.ctx; - this._afterAll.push(hook); - this.emit('afterAll', hook); - return this; -}; - -/** - * Run `fn(test[, done])` before each test case. - * - * @param {Function} fn - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.beforeEach = function(fn){ - if (this.pending) return this; - var hook = new Hook('"before each" hook', fn); - hook.parent = this; - hook.timeout(this.timeout()); - hook.slow(this.slow()); - hook.ctx = this.ctx; - this._beforeEach.push(hook); - this.emit('beforeEach', hook); - return this; -}; - -/** - * Run `fn(test[, done])` after each test case. - * - * @param {Function} fn - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.afterEach = function(fn){ - if (this.pending) return this; - var hook = new Hook('"after each" hook', fn); - hook.parent = this; - hook.timeout(this.timeout()); - hook.slow(this.slow()); - hook.ctx = this.ctx; - this._afterEach.push(hook); - this.emit('afterEach', hook); - return this; -}; - -/** - * Add a test `suite`. - * - * @param {Suite} suite - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.addSuite = function(suite){ - suite.parent = this; - suite.timeout(this.timeout()); - suite.slow(this.slow()); - suite.bail(this.bail()); - this.suites.push(suite); - this.emit('suite', suite); - return this; -}; - -/** - * Add a `test` to this suite. - * - * @param {Test} test - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.addTest = function(test){ - test.parent = this; - test.timeout(this.timeout()); - test.slow(this.slow()); - test.ctx = this.ctx; - this.tests.push(test); - this.emit('test', test); - return this; -}; - -/** - * Return the full title generated by recursively - * concatenating the parent's full title. - * - * @return {String} - * @api public - */ - -Suite.prototype.fullTitle = function(){ - if (this.parent) { - var full = this.parent.fullTitle(); - if (full) return full + ' ' + this.title; - } - return this.title; -}; - -/** - * Return the total number of tests. - * - * @return {Number} - * @api public - */ - -Suite.prototype.total = function(){ - return utils.reduce(this.suites, function(sum, suite){ - return sum + suite.total(); - }, 0) + this.tests.length; -}; - -/** - * Iterates through each suite recursively to find - * all tests. Applies a function in the format - * `fn(test)`. - * - * @param {Function} fn - * @return {Suite} - * @api private - */ - -Suite.prototype.eachTest = function(fn){ - utils.forEach(this.tests, fn); - utils.forEach(this.suites, function(suite){ - suite.eachTest(fn); - }); - return this; -}; diff --git a/node_modules/mocha/lib/template.html b/node_modules/mocha/lib/template.html deleted file mode 100644 index 0590d4a..0000000 --- a/node_modules/mocha/lib/template.html +++ /dev/null @@ -1,18 +0,0 @@ - - - - Mocha - - - - - -
        - - - - - - diff --git a/node_modules/mocha/lib/test.js b/node_modules/mocha/lib/test.js deleted file mode 100644 index 11773e0..0000000 --- a/node_modules/mocha/lib/test.js +++ /dev/null @@ -1,32 +0,0 @@ - -/** - * Module dependencies. - */ - -var Runnable = require('./runnable'); - -/** - * Expose `Test`. - */ - -module.exports = Test; - -/** - * Initialize a new `Test` with the given `title` and callback `fn`. - * - * @param {String} title - * @param {Function} fn - * @api private - */ - -function Test(title, fn) { - Runnable.call(this, title, fn); - this.pending = !fn; - this.type = 'test'; -} - -/** - * Inherit from `Runnable.prototype`. - */ - -Test.prototype.__proto__ = Runnable.prototype; diff --git a/node_modules/mocha/lib/utils.js b/node_modules/mocha/lib/utils.js deleted file mode 100644 index 37fd5d7..0000000 --- a/node_modules/mocha/lib/utils.js +++ /dev/null @@ -1,299 +0,0 @@ -/** - * Module dependencies. - */ - -var fs = require('fs') - , path = require('path') - , join = path.join - , debug = require('debug')('mocha:watch'); - -/** - * Ignored directories. - */ - -var ignore = ['node_modules', '.git']; - -/** - * Escape special characters in the given string of html. - * - * @param {String} html - * @return {String} - * @api private - */ - -exports.escape = function(html){ - return String(html) - .replace(/&/g, '&') - .replace(/"/g, '"') - .replace(//g, '>'); -}; - -/** - * Array#forEach (<=IE8) - * - * @param {Array} array - * @param {Function} fn - * @param {Object} scope - * @api private - */ - -exports.forEach = function(arr, fn, scope){ - for (var i = 0, l = arr.length; i < l; i++) - fn.call(scope, arr[i], i); -}; - -/** - * Array#map (<=IE8) - * - * @param {Array} array - * @param {Function} fn - * @param {Object} scope - * @api private - */ - -exports.map = function(arr, fn, scope){ - var result = []; - for (var i = 0, l = arr.length; i < l; i++) - result.push(fn.call(scope, arr[i], i)); - return result; -}; - -/** - * Array#indexOf (<=IE8) - * - * @parma {Array} arr - * @param {Object} obj to find index of - * @param {Number} start - * @api private - */ - -exports.indexOf = function(arr, obj, start){ - for (var i = start || 0, l = arr.length; i < l; i++) { - if (arr[i] === obj) - return i; - } - return -1; -}; - -/** - * Array#reduce (<=IE8) - * - * @param {Array} array - * @param {Function} fn - * @param {Object} initial value - * @api private - */ - -exports.reduce = function(arr, fn, val){ - var rval = val; - - for (var i = 0, l = arr.length; i < l; i++) { - rval = fn(rval, arr[i], i, arr); - } - - return rval; -}; - -/** - * Array#filter (<=IE8) - * - * @param {Array} array - * @param {Function} fn - * @api private - */ - -exports.filter = function(arr, fn){ - var ret = []; - - for (var i = 0, l = arr.length; i < l; i++) { - var val = arr[i]; - if (fn(val, i, arr)) ret.push(val); - } - - return ret; -}; - -/** - * Object.keys (<=IE8) - * - * @param {Object} obj - * @return {Array} keys - * @api private - */ - -exports.keys = Object.keys || function(obj) { - var keys = [] - , has = Object.prototype.hasOwnProperty // for `window` on <=IE8 - - for (var key in obj) { - if (has.call(obj, key)) { - keys.push(key); - } - } - - return keys; -}; - -/** - * Watch the given `files` for changes - * and invoke `fn(file)` on modification. - * - * @param {Array} files - * @param {Function} fn - * @api private - */ - -exports.watch = function(files, fn){ - var options = { interval: 100 }; - files.forEach(function(file){ - debug('file %s', file); - fs.watchFile(file, options, function(curr, prev){ - if (prev.mtime < curr.mtime) fn(file); - }); - }); -}; - -/** - * Ignored files. - */ - -function ignored(path){ - return !~ignore.indexOf(path); -} - -/** - * Lookup files in the given `dir`. - * - * @return {Array} - * @api private - */ - -exports.files = function(dir, ret){ - ret = ret || []; - - fs.readdirSync(dir) - .filter(ignored) - .forEach(function(path){ - path = join(dir, path); - if (fs.statSync(path).isDirectory()) { - exports.files(path, ret); - } else if (path.match(/\.(js|coffee|litcoffee|coffee.md)$/)) { - ret.push(path); - } - }); - - return ret; -}; - -/** - * Compute a slug from the given `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -exports.slug = function(str){ - return str - .toLowerCase() - .replace(/ +/g, '-') - .replace(/[^-\w]/g, ''); -}; - -/** - * Strip the function definition from `str`, - * and re-indent for pre whitespace. - */ - -exports.clean = function(str) { - str = str - .replace(/\r\n?|[\n\u2028\u2029]/g, "\n").replace(/^\uFEFF/, '') - .replace(/^function *\(.*\) *{/, '') - .replace(/\s+\}$/, ''); - - var spaces = str.match(/^\n?( *)/)[1].length - , tabs = str.match(/^\n?(\t*)/)[1].length - , re = new RegExp('^\n?' + (tabs ? '\t' : ' ') + '{' + (tabs ? tabs : spaces) + '}', 'gm'); - - str = str.replace(re, ''); - - return exports.trim(str); -}; - -/** - * Escape regular expression characters in `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -exports.escapeRegexp = function(str){ - return str.replace(/[-\\^$*+?.()|[\]{}]/g, "\\$&"); -}; - -/** - * Trim the given `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -exports.trim = function(str){ - return str.replace(/^\s+|\s+$/g, ''); -}; - -/** - * Parse the given `qs`. - * - * @param {String} qs - * @return {Object} - * @api private - */ - -exports.parseQuery = function(qs){ - return exports.reduce(qs.replace('?', '').split('&'), function(obj, pair){ - var i = pair.indexOf('=') - , key = pair.slice(0, i) - , val = pair.slice(++i); - - obj[key] = decodeURIComponent(val); - return obj; - }, {}); -}; - -/** - * Highlight the given string of `js`. - * - * @param {String} js - * @return {String} - * @api private - */ - -function highlight(js) { - return js - .replace(//g, '>') - .replace(/\/\/(.*)/gm, '//$1') - .replace(/('.*?')/gm, '$1') - .replace(/(\d+\.\d+)/gm, '$1') - .replace(/(\d+)/gm, '$1') - .replace(/\bnew *(\w+)/gm, 'new $1') - .replace(/\b(function|new|throw|return|var|if|else)\b/gm, '$1') -} - -/** - * Highlight the contents of tag `name`. - * - * @param {String} name - * @api private - */ - -exports.highlightTags = function(name) { - var code = document.getElementsByTagName(name); - for (var i = 0, len = code.length; i < len; ++i) { - code[i].innerHTML = highlight(code[i].innerHTML); - } -}; diff --git a/node_modules/mocha/mocha.css b/node_modules/mocha/mocha.css deleted file mode 100644 index 42b9798..0000000 --- a/node_modules/mocha/mocha.css +++ /dev/null @@ -1,270 +0,0 @@ -@charset "utf-8"; - -body { - margin:0; -} - -#mocha { - font: 20px/1.5 "Helvetica Neue", Helvetica, Arial, sans-serif; - margin: 60px 50px; -} - -#mocha ul, -#mocha li { - margin: 0; - padding: 0; -} - -#mocha ul { - list-style: none; -} - -#mocha h1, -#mocha h2 { - margin: 0; -} - -#mocha h1 { - margin-top: 15px; - font-size: 1em; - font-weight: 200; -} - -#mocha h1 a { - text-decoration: none; - color: inherit; -} - -#mocha h1 a:hover { - text-decoration: underline; -} - -#mocha .suite .suite h1 { - margin-top: 0; - font-size: .8em; -} - -#mocha .hidden { - display: none; -} - -#mocha h2 { - font-size: 12px; - font-weight: normal; - cursor: pointer; -} - -#mocha .suite { - margin-left: 15px; -} - -#mocha .test { - margin-left: 15px; - overflow: hidden; -} - -#mocha .test.pending:hover h2::after { - content: '(pending)'; - font-family: arial, sans-serif; -} - -#mocha .test.pass.medium .duration { - background: #c09853; -} - -#mocha .test.pass.slow .duration { - background: #b94a48; -} - -#mocha .test.pass::before { - content: '✓'; - font-size: 12px; - display: block; - float: left; - margin-right: 5px; - color: #00d6b2; -} - -#mocha .test.pass .duration { - font-size: 9px; - margin-left: 5px; - padding: 2px 5px; - color: #fff; - -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.2); - -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,.2); - box-shadow: inset 0 1px 1px rgba(0,0,0,.2); - -webkit-border-radius: 5px; - -moz-border-radius: 5px; - -ms-border-radius: 5px; - -o-border-radius: 5px; - border-radius: 5px; -} - -#mocha .test.pass.fast .duration { - display: none; -} - -#mocha .test.pending { - color: #0b97c4; -} - -#mocha .test.pending::before { - content: '◦'; - color: #0b97c4; -} - -#mocha .test.fail { - color: #c00; -} - -#mocha .test.fail pre { - color: black; -} - -#mocha .test.fail::before { - content: '✖'; - font-size: 12px; - display: block; - float: left; - margin-right: 5px; - color: #c00; -} - -#mocha .test pre.error { - color: #c00; - max-height: 300px; - overflow: auto; -} - -/** - * (1): approximate for browsers not supporting calc - * (2): 42 = 2*15 + 2*10 + 2*1 (padding + margin + border) - * ^^ seriously - */ -#mocha .test pre { - display: block; - float: left; - clear: left; - font: 12px/1.5 monaco, monospace; - margin: 5px; - padding: 15px; - border: 1px solid #eee; - max-width: 85%; /*(1)*/ - max-width: calc(100% - 42px); /*(2)*/ - word-wrap: break-word; - border-bottom-color: #ddd; - -webkit-border-radius: 3px; - -webkit-box-shadow: 0 1px 3px #eee; - -moz-border-radius: 3px; - -moz-box-shadow: 0 1px 3px #eee; - border-radius: 3px; -} - -#mocha .test h2 { - position: relative; -} - -#mocha .test a.replay { - position: absolute; - top: 3px; - right: 0; - text-decoration: none; - vertical-align: middle; - display: block; - width: 15px; - height: 15px; - line-height: 15px; - text-align: center; - background: #eee; - font-size: 15px; - -moz-border-radius: 15px; - border-radius: 15px; - -webkit-transition: opacity 200ms; - -moz-transition: opacity 200ms; - transition: opacity 200ms; - opacity: 0.3; - color: #888; -} - -#mocha .test:hover a.replay { - opacity: 1; -} - -#mocha-report.pass .test.fail { - display: none; -} - -#mocha-report.fail .test.pass { - display: none; -} - -#mocha-report.pending .test.pass, -#mocha-report.pending .test.fail { - display: none; -} -#mocha-report.pending .test.pass.pending { - display: block; -} - -#mocha-error { - color: #c00; - font-size: 1.5em; - font-weight: 100; - letter-spacing: 1px; -} - -#mocha-stats { - position: fixed; - top: 15px; - right: 10px; - font-size: 12px; - margin: 0; - color: #888; - z-index: 1; -} - -#mocha-stats .progress { - float: right; - padding-top: 0; -} - -#mocha-stats em { - color: black; -} - -#mocha-stats a { - text-decoration: none; - color: inherit; -} - -#mocha-stats a:hover { - border-bottom: 1px solid #eee; -} - -#mocha-stats li { - display: inline-block; - margin: 0 5px; - list-style: none; - padding-top: 11px; -} - -#mocha-stats canvas { - width: 40px; - height: 40px; -} - -#mocha code .comment { color: #ddd; } -#mocha code .init { color: #2f6fad; } -#mocha code .string { color: #5890ad; } -#mocha code .keyword { color: #8a6343; } -#mocha code .number { color: #2f6fad; } - -@media screen and (max-device-width: 480px) { - #mocha { - margin: 60px 0px; - } - - #mocha #stats { - position: absolute; - } -} diff --git a/node_modules/mocha/mocha.js b/node_modules/mocha/mocha.js deleted file mode 100644 index 3dcdae6..0000000 --- a/node_modules/mocha/mocha.js +++ /dev/null @@ -1,5812 +0,0 @@ -;(function(){ - -// CommonJS require() - -function require(p){ - var path = require.resolve(p) - , mod = require.modules[path]; - if (!mod) throw new Error('failed to require "' + p + '"'); - if (!mod.exports) { - mod.exports = {}; - mod.call(mod.exports, mod, mod.exports, require.relative(path)); - } - return mod.exports; - } - -require.modules = {}; - -require.resolve = function (path){ - var orig = path - , reg = path + '.js' - , index = path + '/index.js'; - return require.modules[reg] && reg - || require.modules[index] && index - || orig; - }; - -require.register = function (path, fn){ - require.modules[path] = fn; - }; - -require.relative = function (parent) { - return function(p){ - if ('.' != p.charAt(0)) return require(p); - - var path = parent.split('/') - , segs = p.split('/'); - path.pop(); - - for (var i = 0; i < segs.length; i++) { - var seg = segs[i]; - if ('..' == seg) path.pop(); - else if ('.' != seg) path.push(seg); - } - - return require(path.join('/')); - }; - }; - - -require.register("browser/debug.js", function(module, exports, require){ - -module.exports = function(type){ - return function(){ - } -}; - -}); // module: browser/debug.js - -require.register("browser/diff.js", function(module, exports, require){ -/* See LICENSE file for terms of use */ - -/* - * Text diff implementation. - * - * This library supports the following APIS: - * JsDiff.diffChars: Character by character diff - * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace - * JsDiff.diffLines: Line based diff - * - * JsDiff.diffCss: Diff targeted at CSS content - * - * These methods are based on the implementation proposed in - * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986). - * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927 - */ -var JsDiff = (function() { - /*jshint maxparams: 5*/ - function clonePath(path) { - return { newPos: path.newPos, components: path.components.slice(0) }; - } - function removeEmpty(array) { - var ret = []; - for (var i = 0; i < array.length; i++) { - if (array[i]) { - ret.push(array[i]); - } - } - return ret; - } - function escapeHTML(s) { - var n = s; - n = n.replace(/&/g, '&'); - n = n.replace(//g, '>'); - n = n.replace(/"/g, '"'); - - return n; - } - - var Diff = function(ignoreWhitespace) { - this.ignoreWhitespace = ignoreWhitespace; - }; - Diff.prototype = { - diff: function(oldString, newString) { - // Handle the identity case (this is due to unrolling editLength == 0 - if (newString === oldString) { - return [{ value: newString }]; - } - if (!newString) { - return [{ value: oldString, removed: true }]; - } - if (!oldString) { - return [{ value: newString, added: true }]; - } - - newString = this.tokenize(newString); - oldString = this.tokenize(oldString); - - var newLen = newString.length, oldLen = oldString.length; - var maxEditLength = newLen + oldLen; - var bestPath = [{ newPos: -1, components: [] }]; - - // Seed editLength = 0 - var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0); - if (bestPath[0].newPos+1 >= newLen && oldPos+1 >= oldLen) { - return bestPath[0].components; - } - - for (var editLength = 1; editLength <= maxEditLength; editLength++) { - for (var diagonalPath = -1*editLength; diagonalPath <= editLength; diagonalPath+=2) { - var basePath; - var addPath = bestPath[diagonalPath-1], - removePath = bestPath[diagonalPath+1]; - oldPos = (removePath ? removePath.newPos : 0) - diagonalPath; - if (addPath) { - // No one else is going to attempt to use this value, clear it - bestPath[diagonalPath-1] = undefined; - } - - var canAdd = addPath && addPath.newPos+1 < newLen; - var canRemove = removePath && 0 <= oldPos && oldPos < oldLen; - if (!canAdd && !canRemove) { - bestPath[diagonalPath] = undefined; - continue; - } - - // Select the diagonal that we want to branch from. We select the prior - // path whose position in the new string is the farthest from the origin - // and does not pass the bounds of the diff graph - if (!canAdd || (canRemove && addPath.newPos < removePath.newPos)) { - basePath = clonePath(removePath); - this.pushComponent(basePath.components, oldString[oldPos], undefined, true); - } else { - basePath = clonePath(addPath); - basePath.newPos++; - this.pushComponent(basePath.components, newString[basePath.newPos], true, undefined); - } - - var oldPos = this.extractCommon(basePath, newString, oldString, diagonalPath); - - if (basePath.newPos+1 >= newLen && oldPos+1 >= oldLen) { - return basePath.components; - } else { - bestPath[diagonalPath] = basePath; - } - } - } - }, - - pushComponent: function(components, value, added, removed) { - var last = components[components.length-1]; - if (last && last.added === added && last.removed === removed) { - // We need to clone here as the component clone operation is just - // as shallow array clone - components[components.length-1] = - {value: this.join(last.value, value), added: added, removed: removed }; - } else { - components.push({value: value, added: added, removed: removed }); - } - }, - extractCommon: function(basePath, newString, oldString, diagonalPath) { - var newLen = newString.length, - oldLen = oldString.length, - newPos = basePath.newPos, - oldPos = newPos - diagonalPath; - while (newPos+1 < newLen && oldPos+1 < oldLen && this.equals(newString[newPos+1], oldString[oldPos+1])) { - newPos++; - oldPos++; - - this.pushComponent(basePath.components, newString[newPos], undefined, undefined); - } - basePath.newPos = newPos; - return oldPos; - }, - - equals: function(left, right) { - var reWhitespace = /\S/; - if (this.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right)) { - return true; - } else { - return left === right; - } - }, - join: function(left, right) { - return left + right; - }, - tokenize: function(value) { - return value; - } - }; - - var CharDiff = new Diff(); - - var WordDiff = new Diff(true); - var WordWithSpaceDiff = new Diff(); - WordDiff.tokenize = WordWithSpaceDiff.tokenize = function(value) { - return removeEmpty(value.split(/(\s+|\b)/)); - }; - - var CssDiff = new Diff(true); - CssDiff.tokenize = function(value) { - return removeEmpty(value.split(/([{}:;,]|\s+)/)); - }; - - var LineDiff = new Diff(); - LineDiff.tokenize = function(value) { - return value.split(/^/m); - }; - - return { - Diff: Diff, - - diffChars: function(oldStr, newStr) { return CharDiff.diff(oldStr, newStr); }, - diffWords: function(oldStr, newStr) { return WordDiff.diff(oldStr, newStr); }, - diffWordsWithSpace: function(oldStr, newStr) { return WordWithSpaceDiff.diff(oldStr, newStr); }, - diffLines: function(oldStr, newStr) { return LineDiff.diff(oldStr, newStr); }, - - diffCss: function(oldStr, newStr) { return CssDiff.diff(oldStr, newStr); }, - - createPatch: function(fileName, oldStr, newStr, oldHeader, newHeader) { - var ret = []; - - ret.push('Index: ' + fileName); - ret.push('==================================================================='); - ret.push('--- ' + fileName + (typeof oldHeader === 'undefined' ? '' : '\t' + oldHeader)); - ret.push('+++ ' + fileName + (typeof newHeader === 'undefined' ? '' : '\t' + newHeader)); - - var diff = LineDiff.diff(oldStr, newStr); - if (!diff[diff.length-1].value) { - diff.pop(); // Remove trailing newline add - } - diff.push({value: '', lines: []}); // Append an empty value to make cleanup easier - - function contextLines(lines) { - return lines.map(function(entry) { return ' ' + entry; }); - } - function eofNL(curRange, i, current) { - var last = diff[diff.length-2], - isLast = i === diff.length-2, - isLastOfType = i === diff.length-3 && (current.added !== last.added || current.removed !== last.removed); - - // Figure out if this is the last line for the given file and missing NL - if (!/\n$/.test(current.value) && (isLast || isLastOfType)) { - curRange.push('\\ No newline at end of file'); - } - } - - var oldRangeStart = 0, newRangeStart = 0, curRange = [], - oldLine = 1, newLine = 1; - for (var i = 0; i < diff.length; i++) { - var current = diff[i], - lines = current.lines || current.value.replace(/\n$/, '').split('\n'); - current.lines = lines; - - if (current.added || current.removed) { - if (!oldRangeStart) { - var prev = diff[i-1]; - oldRangeStart = oldLine; - newRangeStart = newLine; - - if (prev) { - curRange = contextLines(prev.lines.slice(-4)); - oldRangeStart -= curRange.length; - newRangeStart -= curRange.length; - } - } - curRange.push.apply(curRange, lines.map(function(entry) { return (current.added?'+':'-') + entry; })); - eofNL(curRange, i, current); - - if (current.added) { - newLine += lines.length; - } else { - oldLine += lines.length; - } - } else { - if (oldRangeStart) { - // Close out any changes that have been output (or join overlapping) - if (lines.length <= 8 && i < diff.length-2) { - // Overlapping - curRange.push.apply(curRange, contextLines(lines)); - } else { - // end the range and output - var contextSize = Math.min(lines.length, 4); - ret.push( - '@@ -' + oldRangeStart + ',' + (oldLine-oldRangeStart+contextSize) - + ' +' + newRangeStart + ',' + (newLine-newRangeStart+contextSize) - + ' @@'); - ret.push.apply(ret, curRange); - ret.push.apply(ret, contextLines(lines.slice(0, contextSize))); - if (lines.length <= 4) { - eofNL(ret, i, current); - } - - oldRangeStart = 0; newRangeStart = 0; curRange = []; - } - } - oldLine += lines.length; - newLine += lines.length; - } - } - - return ret.join('\n') + '\n'; - }, - - applyPatch: function(oldStr, uniDiff) { - var diffstr = uniDiff.split('\n'); - var diff = []; - var remEOFNL = false, - addEOFNL = false; - - for (var i = (diffstr[0][0]==='I'?4:0); i < diffstr.length; i++) { - if(diffstr[i][0] === '@') { - var meh = diffstr[i].split(/@@ -(\d+),(\d+) \+(\d+),(\d+) @@/); - diff.unshift({ - start:meh[3], - oldlength:meh[2], - oldlines:[], - newlength:meh[4], - newlines:[] - }); - } else if(diffstr[i][0] === '+') { - diff[0].newlines.push(diffstr[i].substr(1)); - } else if(diffstr[i][0] === '-') { - diff[0].oldlines.push(diffstr[i].substr(1)); - } else if(diffstr[i][0] === ' ') { - diff[0].newlines.push(diffstr[i].substr(1)); - diff[0].oldlines.push(diffstr[i].substr(1)); - } else if(diffstr[i][0] === '\\') { - if (diffstr[i-1][0] === '+') { - remEOFNL = true; - } else if(diffstr[i-1][0] === '-') { - addEOFNL = true; - } - } - } - - var str = oldStr.split('\n'); - for (var i = diff.length - 1; i >= 0; i--) { - var d = diff[i]; - for (var j = 0; j < d.oldlength; j++) { - if(str[d.start-1+j] !== d.oldlines[j]) { - return false; - } - } - Array.prototype.splice.apply(str,[d.start-1,+d.oldlength].concat(d.newlines)); - } - - if (remEOFNL) { - while (!str[str.length-1]) { - str.pop(); - } - } else if (addEOFNL) { - str.push(''); - } - return str.join('\n'); - }, - - convertChangesToXML: function(changes){ - var ret = []; - for ( var i = 0; i < changes.length; i++) { - var change = changes[i]; - if (change.added) { - ret.push(''); - } else if (change.removed) { - ret.push(''); - } - - ret.push(escapeHTML(change.value)); - - if (change.added) { - ret.push(''); - } else if (change.removed) { - ret.push(''); - } - } - return ret.join(''); - }, - - // See: http://code.google.com/p/google-diff-match-patch/wiki/API - convertChangesToDMP: function(changes){ - var ret = [], change; - for ( var i = 0; i < changes.length; i++) { - change = changes[i]; - ret.push([(change.added ? 1 : change.removed ? -1 : 0), change.value]); - } - return ret; - } - }; -})(); - -if (typeof module !== 'undefined') { - module.exports = JsDiff; -} - -}); // module: browser/diff.js - -require.register("browser/events.js", function(module, exports, require){ - -/** - * Module exports. - */ - -exports.EventEmitter = EventEmitter; - -/** - * Check if `obj` is an array. - */ - -function isArray(obj) { - return '[object Array]' == {}.toString.call(obj); -} - -/** - * Event emitter constructor. - * - * @api public - */ - -function EventEmitter(){}; - -/** - * Adds a listener. - * - * @api public - */ - -EventEmitter.prototype.on = function (name, fn) { - if (!this.$events) { - this.$events = {}; - } - - if (!this.$events[name]) { - this.$events[name] = fn; - } else if (isArray(this.$events[name])) { - this.$events[name].push(fn); - } else { - this.$events[name] = [this.$events[name], fn]; - } - - return this; -}; - -EventEmitter.prototype.addListener = EventEmitter.prototype.on; - -/** - * Adds a volatile listener. - * - * @api public - */ - -EventEmitter.prototype.once = function (name, fn) { - var self = this; - - function on () { - self.removeListener(name, on); - fn.apply(this, arguments); - }; - - on.listener = fn; - this.on(name, on); - - return this; -}; - -/** - * Removes a listener. - * - * @api public - */ - -EventEmitter.prototype.removeListener = function (name, fn) { - if (this.$events && this.$events[name]) { - var list = this.$events[name]; - - if (isArray(list)) { - var pos = -1; - - for (var i = 0, l = list.length; i < l; i++) { - if (list[i] === fn || (list[i].listener && list[i].listener === fn)) { - pos = i; - break; - } - } - - if (pos < 0) { - return this; - } - - list.splice(pos, 1); - - if (!list.length) { - delete this.$events[name]; - } - } else if (list === fn || (list.listener && list.listener === fn)) { - delete this.$events[name]; - } - } - - return this; -}; - -/** - * Removes all listeners for an event. - * - * @api public - */ - -EventEmitter.prototype.removeAllListeners = function (name) { - if (name === undefined) { - this.$events = {}; - return this; - } - - if (this.$events && this.$events[name]) { - this.$events[name] = null; - } - - return this; -}; - -/** - * Gets all listeners for a certain event. - * - * @api public - */ - -EventEmitter.prototype.listeners = function (name) { - if (!this.$events) { - this.$events = {}; - } - - if (!this.$events[name]) { - this.$events[name] = []; - } - - if (!isArray(this.$events[name])) { - this.$events[name] = [this.$events[name]]; - } - - return this.$events[name]; -}; - -/** - * Emits an event. - * - * @api public - */ - -EventEmitter.prototype.emit = function (name) { - if (!this.$events) { - return false; - } - - var handler = this.$events[name]; - - if (!handler) { - return false; - } - - var args = [].slice.call(arguments, 1); - - if ('function' == typeof handler) { - handler.apply(this, args); - } else if (isArray(handler)) { - var listeners = handler.slice(); - - for (var i = 0, l = listeners.length; i < l; i++) { - listeners[i].apply(this, args); - } - } else { - return false; - } - - return true; -}; -}); // module: browser/events.js - -require.register("browser/fs.js", function(module, exports, require){ - -}); // module: browser/fs.js - -require.register("browser/path.js", function(module, exports, require){ - -}); // module: browser/path.js - -require.register("browser/progress.js", function(module, exports, require){ -/** - * Expose `Progress`. - */ - -module.exports = Progress; - -/** - * Initialize a new `Progress` indicator. - */ - -function Progress() { - this.percent = 0; - this.size(0); - this.fontSize(11); - this.font('helvetica, arial, sans-serif'); -} - -/** - * Set progress size to `n`. - * - * @param {Number} n - * @return {Progress} for chaining - * @api public - */ - -Progress.prototype.size = function(n){ - this._size = n; - return this; -}; - -/** - * Set text to `str`. - * - * @param {String} str - * @return {Progress} for chaining - * @api public - */ - -Progress.prototype.text = function(str){ - this._text = str; - return this; -}; - -/** - * Set font size to `n`. - * - * @param {Number} n - * @return {Progress} for chaining - * @api public - */ - -Progress.prototype.fontSize = function(n){ - this._fontSize = n; - return this; -}; - -/** - * Set font `family`. - * - * @param {String} family - * @return {Progress} for chaining - */ - -Progress.prototype.font = function(family){ - this._font = family; - return this; -}; - -/** - * Update percentage to `n`. - * - * @param {Number} n - * @return {Progress} for chaining - */ - -Progress.prototype.update = function(n){ - this.percent = n; - return this; -}; - -/** - * Draw on `ctx`. - * - * @param {CanvasRenderingContext2d} ctx - * @return {Progress} for chaining - */ - -Progress.prototype.draw = function(ctx){ - try { - var percent = Math.min(this.percent, 100) - , size = this._size - , half = size / 2 - , x = half - , y = half - , rad = half - 1 - , fontSize = this._fontSize; - - ctx.font = fontSize + 'px ' + this._font; - - var angle = Math.PI * 2 * (percent / 100); - ctx.clearRect(0, 0, size, size); - - // outer circle - ctx.strokeStyle = '#9f9f9f'; - ctx.beginPath(); - ctx.arc(x, y, rad, 0, angle, false); - ctx.stroke(); - - // inner circle - ctx.strokeStyle = '#eee'; - ctx.beginPath(); - ctx.arc(x, y, rad - 1, 0, angle, true); - ctx.stroke(); - - // text - var text = this._text || (percent | 0) + '%' - , w = ctx.measureText(text).width; - - ctx.fillText( - text - , x - w / 2 + 1 - , y + fontSize / 2 - 1); - } catch (ex) {} //don't fail if we can't render progress - return this; -}; - -}); // module: browser/progress.js - -require.register("browser/tty.js", function(module, exports, require){ - -exports.isatty = function(){ - return true; -}; - -exports.getWindowSize = function(){ - if ('innerHeight' in global) { - return [global.innerHeight, global.innerWidth]; - } else { - // In a Web Worker, the DOM Window is not available. - return [640, 480]; - } -}; - -}); // module: browser/tty.js - -require.register("context.js", function(module, exports, require){ - -/** - * Expose `Context`. - */ - -module.exports = Context; - -/** - * Initialize a new `Context`. - * - * @api private - */ - -function Context(){} - -/** - * Set or get the context `Runnable` to `runnable`. - * - * @param {Runnable} runnable - * @return {Context} - * @api private - */ - -Context.prototype.runnable = function(runnable){ - if (0 == arguments.length) return this._runnable; - this.test = this._runnable = runnable; - return this; -}; - -/** - * Set test timeout `ms`. - * - * @param {Number} ms - * @return {Context} self - * @api private - */ - -Context.prototype.timeout = function(ms){ - this.runnable().timeout(ms); - return this; -}; - -/** - * Set test slowness threshold `ms`. - * - * @param {Number} ms - * @return {Context} self - * @api private - */ - -Context.prototype.slow = function(ms){ - this.runnable().slow(ms); - return this; -}; - -/** - * Inspect the context void of `._runnable`. - * - * @return {String} - * @api private - */ - -Context.prototype.inspect = function(){ - return JSON.stringify(this, function(key, val){ - if ('_runnable' == key) return; - if ('test' == key) return; - return val; - }, 2); -}; - -}); // module: context.js - -require.register("hook.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Runnable = require('./runnable'); - -/** - * Expose `Hook`. - */ - -module.exports = Hook; - -/** - * Initialize a new `Hook` with the given `title` and callback `fn`. - * - * @param {String} title - * @param {Function} fn - * @api private - */ - -function Hook(title, fn) { - Runnable.call(this, title, fn); - this.type = 'hook'; -} - -/** - * Inherit from `Runnable.prototype`. - */ - -function F(){}; -F.prototype = Runnable.prototype; -Hook.prototype = new F; -Hook.prototype.constructor = Hook; - - -/** - * Get or set the test `err`. - * - * @param {Error} err - * @return {Error} - * @api public - */ - -Hook.prototype.error = function(err){ - if (0 == arguments.length) { - var err = this._error; - this._error = null; - return err; - } - - this._error = err; -}; - -}); // module: hook.js - -require.register("interfaces/bdd.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Suite = require('../suite') - , Test = require('../test') - , utils = require('../utils'); - -/** - * BDD-style interface: - * - * describe('Array', function(){ - * describe('#indexOf()', function(){ - * it('should return -1 when not present', function(){ - * - * }); - * - * it('should return the index when present', function(){ - * - * }); - * }); - * }); - * - */ - -module.exports = function(suite){ - var suites = [suite]; - - suite.on('pre-require', function(context, file, mocha){ - - /** - * Execute before running tests. - */ - - context.before = function(fn){ - suites[0].beforeAll(fn); - }; - - /** - * Execute after running tests. - */ - - context.after = function(fn){ - suites[0].afterAll(fn); - }; - - /** - * Execute before each test case. - */ - - context.beforeEach = function(fn){ - suites[0].beforeEach(fn); - }; - - /** - * Execute after each test case. - */ - - context.afterEach = function(fn){ - suites[0].afterEach(fn); - }; - - /** - * Describe a "suite" with the given `title` - * and callback `fn` containing nested suites - * and/or tests. - */ - - context.describe = context.context = function(title, fn){ - var suite = Suite.create(suites[0], title); - suites.unshift(suite); - fn.call(suite); - suites.shift(); - return suite; - }; - - /** - * Pending describe. - */ - - context.xdescribe = - context.xcontext = - context.describe.skip = function(title, fn){ - var suite = Suite.create(suites[0], title); - suite.pending = true; - suites.unshift(suite); - fn.call(suite); - suites.shift(); - }; - - /** - * Exclusive suite. - */ - - context.describe.only = function(title, fn){ - var suite = context.describe(title, fn); - mocha.grep(suite.fullTitle()); - return suite; - }; - - /** - * Describe a specification or test-case - * with the given `title` and callback `fn` - * acting as a thunk. - */ - - context.it = context.specify = function(title, fn){ - var suite = suites[0]; - if (suite.pending) var fn = null; - var test = new Test(title, fn); - suite.addTest(test); - return test; - }; - - /** - * Exclusive test-case. - */ - - context.it.only = function(title, fn){ - var test = context.it(title, fn); - var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; - mocha.grep(new RegExp(reString)); - return test; - }; - - /** - * Pending test case. - */ - - context.xit = - context.xspecify = - context.it.skip = function(title){ - context.it(title); - }; - }); -}; - -}); // module: interfaces/bdd.js - -require.register("interfaces/exports.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Suite = require('../suite') - , Test = require('../test'); - -/** - * TDD-style interface: - * - * exports.Array = { - * '#indexOf()': { - * 'should return -1 when the value is not present': function(){ - * - * }, - * - * 'should return the correct index when the value is present': function(){ - * - * } - * } - * }; - * - */ - -module.exports = function(suite){ - var suites = [suite]; - - suite.on('require', visit); - - function visit(obj) { - var suite; - for (var key in obj) { - if ('function' == typeof obj[key]) { - var fn = obj[key]; - switch (key) { - case 'before': - suites[0].beforeAll(fn); - break; - case 'after': - suites[0].afterAll(fn); - break; - case 'beforeEach': - suites[0].beforeEach(fn); - break; - case 'afterEach': - suites[0].afterEach(fn); - break; - default: - suites[0].addTest(new Test(key, fn)); - } - } else { - var suite = Suite.create(suites[0], key); - suites.unshift(suite); - visit(obj[key]); - suites.shift(); - } - } - } -}; - -}); // module: interfaces/exports.js - -require.register("interfaces/index.js", function(module, exports, require){ - -exports.bdd = require('./bdd'); -exports.tdd = require('./tdd'); -exports.qunit = require('./qunit'); -exports.exports = require('./exports'); - -}); // module: interfaces/index.js - -require.register("interfaces/qunit.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Suite = require('../suite') - , Test = require('../test') - , utils = require('../utils'); - -/** - * QUnit-style interface: - * - * suite('Array'); - * - * test('#length', function(){ - * var arr = [1,2,3]; - * ok(arr.length == 3); - * }); - * - * test('#indexOf()', function(){ - * var arr = [1,2,3]; - * ok(arr.indexOf(1) == 0); - * ok(arr.indexOf(2) == 1); - * ok(arr.indexOf(3) == 2); - * }); - * - * suite('String'); - * - * test('#length', function(){ - * ok('foo'.length == 3); - * }); - * - */ - -module.exports = function(suite){ - var suites = [suite]; - - suite.on('pre-require', function(context, file, mocha){ - - /** - * Execute before running tests. - */ - - context.before = function(fn){ - suites[0].beforeAll(fn); - }; - - /** - * Execute after running tests. - */ - - context.after = function(fn){ - suites[0].afterAll(fn); - }; - - /** - * Execute before each test case. - */ - - context.beforeEach = function(fn){ - suites[0].beforeEach(fn); - }; - - /** - * Execute after each test case. - */ - - context.afterEach = function(fn){ - suites[0].afterEach(fn); - }; - - /** - * Describe a "suite" with the given `title`. - */ - - context.suite = function(title){ - if (suites.length > 1) suites.shift(); - var suite = Suite.create(suites[0], title); - suites.unshift(suite); - return suite; - }; - - /** - * Exclusive test-case. - */ - - context.suite.only = function(title, fn){ - var suite = context.suite(title, fn); - mocha.grep(suite.fullTitle()); - }; - - /** - * Describe a specification or test-case - * with the given `title` and callback `fn` - * acting as a thunk. - */ - - context.test = function(title, fn){ - var test = new Test(title, fn); - suites[0].addTest(test); - return test; - }; - - /** - * Exclusive test-case. - */ - - context.test.only = function(title, fn){ - var test = context.test(title, fn); - var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; - mocha.grep(new RegExp(reString)); - }; - - /** - * Pending test case. - */ - - context.test.skip = function(title){ - context.test(title); - }; - }); -}; - -}); // module: interfaces/qunit.js - -require.register("interfaces/tdd.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Suite = require('../suite') - , Test = require('../test') - , utils = require('../utils');; - -/** - * TDD-style interface: - * - * suite('Array', function(){ - * suite('#indexOf()', function(){ - * suiteSetup(function(){ - * - * }); - * - * test('should return -1 when not present', function(){ - * - * }); - * - * test('should return the index when present', function(){ - * - * }); - * - * suiteTeardown(function(){ - * - * }); - * }); - * }); - * - */ - -module.exports = function(suite){ - var suites = [suite]; - - suite.on('pre-require', function(context, file, mocha){ - - /** - * Execute before each test case. - */ - - context.setup = function(fn){ - suites[0].beforeEach(fn); - }; - - /** - * Execute after each test case. - */ - - context.teardown = function(fn){ - suites[0].afterEach(fn); - }; - - /** - * Execute before the suite. - */ - - context.suiteSetup = function(fn){ - suites[0].beforeAll(fn); - }; - - /** - * Execute after the suite. - */ - - context.suiteTeardown = function(fn){ - suites[0].afterAll(fn); - }; - - /** - * Describe a "suite" with the given `title` - * and callback `fn` containing nested suites - * and/or tests. - */ - - context.suite = function(title, fn){ - var suite = Suite.create(suites[0], title); - suites.unshift(suite); - fn.call(suite); - suites.shift(); - return suite; - }; - - /** - * Pending suite. - */ - context.suite.skip = function(title, fn) { - var suite = Suite.create(suites[0], title); - suite.pending = true; - suites.unshift(suite); - fn.call(suite); - suites.shift(); - }; - - /** - * Exclusive test-case. - */ - - context.suite.only = function(title, fn){ - var suite = context.suite(title, fn); - mocha.grep(suite.fullTitle()); - }; - - /** - * Describe a specification or test-case - * with the given `title` and callback `fn` - * acting as a thunk. - */ - - context.test = function(title, fn){ - var suite = suites[0]; - if (suite.pending) var fn = null; - var test = new Test(title, fn); - suite.addTest(test); - return test; - }; - - /** - * Exclusive test-case. - */ - - context.test.only = function(title, fn){ - var test = context.test(title, fn); - var reString = '^' + utils.escapeRegexp(test.fullTitle()) + '$'; - mocha.grep(new RegExp(reString)); - }; - - /** - * Pending test case. - */ - - context.test.skip = function(title){ - context.test(title); - }; - }); -}; - -}); // module: interfaces/tdd.js - -require.register("mocha.js", function(module, exports, require){ -/*! - * mocha - * Copyright(c) 2011 TJ Holowaychuk - * MIT Licensed - */ - -/** - * Module dependencies. - */ - -var path = require('browser/path') - , utils = require('./utils'); - -/** - * Expose `Mocha`. - */ - -exports = module.exports = Mocha; - -/** - * Expose internals. - */ - -exports.utils = utils; -exports.interfaces = require('./interfaces'); -exports.reporters = require('./reporters'); -exports.Runnable = require('./runnable'); -exports.Context = require('./context'); -exports.Runner = require('./runner'); -exports.Suite = require('./suite'); -exports.Hook = require('./hook'); -exports.Test = require('./test'); - -/** - * Return image `name` path. - * - * @param {String} name - * @return {String} - * @api private - */ - -function image(name) { - return __dirname + '/../images/' + name + '.png'; -} - -/** - * Setup mocha with `options`. - * - * Options: - * - * - `ui` name "bdd", "tdd", "exports" etc - * - `reporter` reporter instance, defaults to `mocha.reporters.Dot` - * - `globals` array of accepted globals - * - `timeout` timeout in milliseconds - * - `bail` bail on the first test failure - * - `slow` milliseconds to wait before considering a test slow - * - `ignoreLeaks` ignore global leaks - * - `grep` string or regexp to filter tests with - * - * @param {Object} options - * @api public - */ - -function Mocha(options) { - options = options || {}; - this.files = []; - this.options = options; - this.grep(options.grep); - this.suite = new exports.Suite('', new exports.Context); - this.ui(options.ui); - this.bail(options.bail); - this.reporter(options.reporter); - if (null != options.timeout) this.timeout(options.timeout); - this.useColors(options.useColors) - if (options.slow) this.slow(options.slow); - - this.suite.on('pre-require', function (context) { - exports.afterEach = context.afterEach || context.teardown; - exports.after = context.after || context.suiteTeardown; - exports.beforeEach = context.beforeEach || context.setup; - exports.before = context.before || context.suiteSetup; - exports.describe = context.describe || context.suite; - exports.it = context.it || context.test; - exports.setup = context.setup || context.beforeEach; - exports.suiteSetup = context.suiteSetup || context.before; - exports.suiteTeardown = context.suiteTeardown || context.after; - exports.suite = context.suite || context.describe; - exports.teardown = context.teardown || context.afterEach; - exports.test = context.test || context.it; - }); -} - -/** - * Enable or disable bailing on the first failure. - * - * @param {Boolean} [bail] - * @api public - */ - -Mocha.prototype.bail = function(bail){ - if (0 == arguments.length) bail = true; - this.suite.bail(bail); - return this; -}; - -/** - * Add test `file`. - * - * @param {String} file - * @api public - */ - -Mocha.prototype.addFile = function(file){ - this.files.push(file); - return this; -}; - -/** - * Set reporter to `reporter`, defaults to "dot". - * - * @param {String|Function} reporter name or constructor - * @api public - */ - -Mocha.prototype.reporter = function(reporter){ - if ('function' == typeof reporter) { - this._reporter = reporter; - } else { - reporter = reporter || 'dot'; - var _reporter; - try { _reporter = require('./reporters/' + reporter); } catch (err) {}; - if (!_reporter) try { _reporter = require(reporter); } catch (err) {}; - if (!_reporter && reporter === 'teamcity') - console.warn('The Teamcity reporter was moved to a package named ' + - 'mocha-teamcity-reporter ' + - '(https://npmjs.org/package/mocha-teamcity-reporter).'); - if (!_reporter) throw new Error('invalid reporter "' + reporter + '"'); - this._reporter = _reporter; - } - return this; -}; - -/** - * Set test UI `name`, defaults to "bdd". - * - * @param {String} bdd - * @api public - */ - -Mocha.prototype.ui = function(name){ - name = name || 'bdd'; - this._ui = exports.interfaces[name]; - if (!this._ui) try { this._ui = require(name); } catch (err) {}; - if (!this._ui) throw new Error('invalid interface "' + name + '"'); - this._ui = this._ui(this.suite); - return this; -}; - -/** - * Load registered files. - * - * @api private - */ - -Mocha.prototype.loadFiles = function(fn){ - var self = this; - var suite = this.suite; - var pending = this.files.length; - this.files.forEach(function(file){ - file = path.resolve(file); - suite.emit('pre-require', global, file, self); - suite.emit('require', require(file), file, self); - suite.emit('post-require', global, file, self); - --pending || (fn && fn()); - }); -}; - -/** - * Enable growl support. - * - * @api private - */ - -Mocha.prototype._growl = function(runner, reporter) { - var notify = require('growl'); - - runner.on('end', function(){ - var stats = reporter.stats; - if (stats.failures) { - var msg = stats.failures + ' of ' + runner.total + ' tests failed'; - notify(msg, { name: 'mocha', title: 'Failed', image: image('error') }); - } else { - notify(stats.passes + ' tests passed in ' + stats.duration + 'ms', { - name: 'mocha' - , title: 'Passed' - , image: image('ok') - }); - } - }); -}; - -/** - * Add regexp to grep, if `re` is a string it is escaped. - * - * @param {RegExp|String} re - * @return {Mocha} - * @api public - */ - -Mocha.prototype.grep = function(re){ - this.options.grep = 'string' == typeof re - ? new RegExp(utils.escapeRegexp(re)) - : re; - return this; -}; - -/** - * Invert `.grep()` matches. - * - * @return {Mocha} - * @api public - */ - -Mocha.prototype.invert = function(){ - this.options.invert = true; - return this; -}; - -/** - * Ignore global leaks. - * - * @param {Boolean} ignore - * @return {Mocha} - * @api public - */ - -Mocha.prototype.ignoreLeaks = function(ignore){ - this.options.ignoreLeaks = !!ignore; - return this; -}; - -/** - * Enable global leak checking. - * - * @return {Mocha} - * @api public - */ - -Mocha.prototype.checkLeaks = function(){ - this.options.ignoreLeaks = false; - return this; -}; - -/** - * Enable growl support. - * - * @return {Mocha} - * @api public - */ - -Mocha.prototype.growl = function(){ - this.options.growl = true; - return this; -}; - -/** - * Ignore `globals` array or string. - * - * @param {Array|String} globals - * @return {Mocha} - * @api public - */ - -Mocha.prototype.globals = function(globals){ - this.options.globals = (this.options.globals || []).concat(globals); - return this; -}; - -/** - * Emit color output. - * - * @param {Boolean} colors - * @return {Mocha} - * @api public - */ - -Mocha.prototype.useColors = function(colors){ - this.options.useColors = arguments.length && colors != undefined - ? colors - : true; - return this; -}; - -/** - * Use inline diffs rather than +/-. - * - * @param {Boolean} inlineDiffs - * @return {Mocha} - * @api public - */ - -Mocha.prototype.useInlineDiffs = function(inlineDiffs) { - this.options.useInlineDiffs = arguments.length && inlineDiffs != undefined - ? inlineDiffs - : false; - return this; -}; - -/** - * Set the timeout in milliseconds. - * - * @param {Number} timeout - * @return {Mocha} - * @api public - */ - -Mocha.prototype.timeout = function(timeout){ - this.suite.timeout(timeout); - return this; -}; - -/** - * Set slowness threshold in milliseconds. - * - * @param {Number} slow - * @return {Mocha} - * @api public - */ - -Mocha.prototype.slow = function(slow){ - this.suite.slow(slow); - return this; -}; - -/** - * Makes all tests async (accepting a callback) - * - * @return {Mocha} - * @api public - */ - -Mocha.prototype.asyncOnly = function(){ - this.options.asyncOnly = true; - return this; -}; - -/** - * Run tests and invoke `fn()` when complete. - * - * @param {Function} fn - * @return {Runner} - * @api public - */ - -Mocha.prototype.run = function(fn){ - if (this.files.length) this.loadFiles(); - var suite = this.suite; - var options = this.options; - var runner = new exports.Runner(suite); - var reporter = new this._reporter(runner); - runner.ignoreLeaks = false !== options.ignoreLeaks; - runner.asyncOnly = options.asyncOnly; - if (options.grep) runner.grep(options.grep, options.invert); - if (options.globals) runner.globals(options.globals); - if (options.growl) this._growl(runner, reporter); - exports.reporters.Base.useColors = options.useColors; - exports.reporters.Base.inlineDiffs = options.useInlineDiffs; - return runner.run(fn); -}; - -}); // module: mocha.js - -require.register("ms.js", function(module, exports, require){ -/** - * Helpers. - */ - -var s = 1000; -var m = s * 60; -var h = m * 60; -var d = h * 24; -var y = d * 365.25; - -/** - * Parse or format the given `val`. - * - * Options: - * - * - `long` verbose formatting [false] - * - * @param {String|Number} val - * @param {Object} options - * @return {String|Number} - * @api public - */ - -module.exports = function(val, options){ - options = options || {}; - if ('string' == typeof val) return parse(val); - return options.long ? longFormat(val) : shortFormat(val); -}; - -/** - * Parse the given `str` and return milliseconds. - * - * @param {String} str - * @return {Number} - * @api private - */ - -function parse(str) { - var match = /^((?:\d+)?\.?\d+) *(ms|seconds?|s|minutes?|m|hours?|h|days?|d|years?|y)?$/i.exec(str); - if (!match) return; - var n = parseFloat(match[1]); - var type = (match[2] || 'ms').toLowerCase(); - switch (type) { - case 'years': - case 'year': - case 'y': - return n * y; - case 'days': - case 'day': - case 'd': - return n * d; - case 'hours': - case 'hour': - case 'h': - return n * h; - case 'minutes': - case 'minute': - case 'm': - return n * m; - case 'seconds': - case 'second': - case 's': - return n * s; - case 'ms': - return n; - } -} - -/** - * Short format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function shortFormat(ms) { - if (ms >= d) return Math.round(ms / d) + 'd'; - if (ms >= h) return Math.round(ms / h) + 'h'; - if (ms >= m) return Math.round(ms / m) + 'm'; - if (ms >= s) return Math.round(ms / s) + 's'; - return ms + 'ms'; -} - -/** - * Long format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function longFormat(ms) { - return plural(ms, d, 'day') - || plural(ms, h, 'hour') - || plural(ms, m, 'minute') - || plural(ms, s, 'second') - || ms + ' ms'; -} - -/** - * Pluralization helper. - */ - -function plural(ms, n, name) { - if (ms < n) return; - if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name; - return Math.ceil(ms / n) + ' ' + name + 's'; -} - -}); // module: ms.js - -require.register("reporters/base.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var tty = require('browser/tty') - , diff = require('browser/diff') - , ms = require('../ms') - , utils = require('../utils'); - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date - , setTimeout = global.setTimeout - , setInterval = global.setInterval - , clearTimeout = global.clearTimeout - , clearInterval = global.clearInterval; - -/** - * Check if both stdio streams are associated with a tty. - */ - -var isatty = tty.isatty(1) && tty.isatty(2); - -/** - * Expose `Base`. - */ - -exports = module.exports = Base; - -/** - * Enable coloring by default. - */ - -exports.useColors = isatty || (process.env.MOCHA_COLORS !== undefined); - -/** - * Inline diffs instead of +/- - */ - -exports.inlineDiffs = false; - -/** - * Default color map. - */ - -exports.colors = { - 'pass': 90 - , 'fail': 31 - , 'bright pass': 92 - , 'bright fail': 91 - , 'bright yellow': 93 - , 'pending': 36 - , 'suite': 0 - , 'error title': 0 - , 'error message': 31 - , 'error stack': 90 - , 'checkmark': 32 - , 'fast': 90 - , 'medium': 33 - , 'slow': 31 - , 'green': 32 - , 'light': 90 - , 'diff gutter': 90 - , 'diff added': 42 - , 'diff removed': 41 -}; - -/** - * Default symbol map. - */ - -exports.symbols = { - ok: '✓', - err: '✖', - dot: '․' -}; - -// With node.js on Windows: use symbols available in terminal default fonts -if ('win32' == process.platform) { - exports.symbols.ok = '\u221A'; - exports.symbols.err = '\u00D7'; - exports.symbols.dot = '.'; -} - -/** - * Color `str` with the given `type`, - * allowing colors to be disabled, - * as well as user-defined color - * schemes. - * - * @param {String} type - * @param {String} str - * @return {String} - * @api private - */ - -var color = exports.color = function(type, str) { - if (!exports.useColors) return str; - return '\u001b[' + exports.colors[type] + 'm' + str + '\u001b[0m'; -}; - -/** - * Expose term window size, with some - * defaults for when stderr is not a tty. - */ - -exports.window = { - width: isatty - ? process.stdout.getWindowSize - ? process.stdout.getWindowSize(1)[0] - : tty.getWindowSize()[1] - : 75 -}; - -/** - * Expose some basic cursor interactions - * that are common among reporters. - */ - -exports.cursor = { - hide: function(){ - isatty && process.stdout.write('\u001b[?25l'); - }, - - show: function(){ - isatty && process.stdout.write('\u001b[?25h'); - }, - - deleteLine: function(){ - isatty && process.stdout.write('\u001b[2K'); - }, - - beginningOfLine: function(){ - isatty && process.stdout.write('\u001b[0G'); - }, - - CR: function(){ - if (isatty) { - exports.cursor.deleteLine(); - exports.cursor.beginningOfLine(); - } else { - process.stdout.write('\r'); - } - } -}; - -/** - * Outut the given `failures` as a list. - * - * @param {Array} failures - * @api public - */ - -exports.list = function(failures){ - console.error(); - failures.forEach(function(test, i){ - // format - var fmt = color('error title', ' %s) %s:\n') - + color('error message', ' %s') - + color('error stack', '\n%s\n'); - - // msg - var err = test.err - , message = err.message || '' - , stack = err.stack || message - , index = stack.indexOf(message) + message.length - , msg = stack.slice(0, index) - , actual = err.actual - , expected = err.expected - , escape = true; - - // uncaught - if (err.uncaught) { - msg = 'Uncaught ' + msg; - } - - // explicitly show diff - if (err.showDiff && sameType(actual, expected)) { - escape = false; - err.actual = actual = stringify(canonicalize(actual)); - err.expected = expected = stringify(canonicalize(expected)); - } - - // actual / expected diff - if ('string' == typeof actual && 'string' == typeof expected) { - fmt = color('error title', ' %s) %s:\n%s') + color('error stack', '\n%s\n'); - var match = message.match(/^([^:]+): expected/); - msg = '\n ' + color('error message', match ? match[1] : msg); - - if (exports.inlineDiffs) { - msg += inlineDiff(err, escape); - } else { - msg += unifiedDiff(err, escape); - } - } - - // indent stack trace without msg - stack = stack.slice(index ? index + 1 : index) - .replace(/^/gm, ' '); - - console.error(fmt, (i + 1), test.fullTitle(), msg, stack); - }); -}; - -/** - * Initialize a new `Base` reporter. - * - * All other reporters generally - * inherit from this reporter, providing - * stats such as test duration, number - * of tests passed / failed etc. - * - * @param {Runner} runner - * @api public - */ - -function Base(runner) { - var self = this - , stats = this.stats = { suites: 0, tests: 0, passes: 0, pending: 0, failures: 0 } - , failures = this.failures = []; - - if (!runner) return; - this.runner = runner; - - runner.stats = stats; - - runner.on('start', function(){ - stats.start = new Date; - }); - - runner.on('suite', function(suite){ - stats.suites = stats.suites || 0; - suite.root || stats.suites++; - }); - - runner.on('test end', function(test){ - stats.tests = stats.tests || 0; - stats.tests++; - }); - - runner.on('pass', function(test){ - stats.passes = stats.passes || 0; - - var medium = test.slow() / 2; - test.speed = test.duration > test.slow() - ? 'slow' - : test.duration > medium - ? 'medium' - : 'fast'; - - stats.passes++; - }); - - runner.on('fail', function(test, err){ - stats.failures = stats.failures || 0; - stats.failures++; - test.err = err; - failures.push(test); - }); - - runner.on('end', function(){ - stats.end = new Date; - stats.duration = new Date - stats.start; - }); - - runner.on('pending', function(){ - stats.pending++; - }); -} - -/** - * Output common epilogue used by many of - * the bundled reporters. - * - * @api public - */ - -Base.prototype.epilogue = function(){ - var stats = this.stats; - var tests; - var fmt; - - console.log(); - - // passes - fmt = color('bright pass', ' ') - + color('green', ' %d passing') - + color('light', ' (%s)'); - - console.log(fmt, - stats.passes || 0, - ms(stats.duration)); - - // pending - if (stats.pending) { - fmt = color('pending', ' ') - + color('pending', ' %d pending'); - - console.log(fmt, stats.pending); - } - - // failures - if (stats.failures) { - fmt = color('fail', ' %d failing'); - - console.error(fmt, - stats.failures); - - Base.list(this.failures); - console.error(); - } - - console.log(); -}; - -/** - * Pad the given `str` to `len`. - * - * @param {String} str - * @param {String} len - * @return {String} - * @api private - */ - -function pad(str, len) { - str = String(str); - return Array(len - str.length + 1).join(' ') + str; -} - - -/** - * Returns an inline diff between 2 strings with coloured ANSI output - * - * @param {Error} Error with actual/expected - * @return {String} Diff - * @api private - */ - -function inlineDiff(err, escape) { - var msg = errorDiff(err, 'WordsWithSpace', escape); - - // linenos - var lines = msg.split('\n'); - if (lines.length > 4) { - var width = String(lines.length).length; - msg = lines.map(function(str, i){ - return pad(++i, width) + ' |' + ' ' + str; - }).join('\n'); - } - - // legend - msg = '\n' - + color('diff removed', 'actual') - + ' ' - + color('diff added', 'expected') - + '\n\n' - + msg - + '\n'; - - // indent - msg = msg.replace(/^/gm, ' '); - return msg; -} - -/** - * Returns a unified diff between 2 strings - * - * @param {Error} Error with actual/expected - * @return {String} Diff - * @api private - */ - -function unifiedDiff(err, escape) { - var indent = ' '; - function cleanUp(line) { - if (escape) { - line = escapeInvisibles(line); - } - if (line[0] === '+') return indent + colorLines('diff added', line); - if (line[0] === '-') return indent + colorLines('diff removed', line); - if (line.match(/\@\@/)) return null; - if (line.match(/\\ No newline/)) return null; - else return indent + line; - } - function notBlank(line) { - return line != null; - } - msg = diff.createPatch('string', err.actual, err.expected); - var lines = msg.split('\n').splice(4); - return '\n ' - + colorLines('diff added', '+ expected') + ' ' - + colorLines('diff removed', '- actual') - + '\n\n' - + lines.map(cleanUp).filter(notBlank).join('\n'); -} - -/** - * Return a character diff for `err`. - * - * @param {Error} err - * @return {String} - * @api private - */ - -function errorDiff(err, type, escape) { - var actual = escape ? escapeInvisibles(err.actual) : err.actual; - var expected = escape ? escapeInvisibles(err.expected) : err.expected; - return diff['diff' + type](actual, expected).map(function(str){ - if (str.added) return colorLines('diff added', str.value); - if (str.removed) return colorLines('diff removed', str.value); - return str.value; - }).join(''); -} - -/** - * Returns a string with all invisible characters in plain text - * - * @param {String} line - * @return {String} - * @api private - */ -function escapeInvisibles(line) { - return line.replace(/\t/g, '') - .replace(/\r/g, '') - .replace(/\n/g, '\n'); -} - -/** - * Color lines for `str`, using the color `name`. - * - * @param {String} name - * @param {String} str - * @return {String} - * @api private - */ - -function colorLines(name, str) { - return str.split('\n').map(function(str){ - return color(name, str); - }).join('\n'); -} - -/** - * Stringify `obj`. - * - * @param {Object} obj - * @return {String} - * @api private - */ - -function stringify(obj) { - if (obj instanceof RegExp) return obj.toString(); - return JSON.stringify(obj, null, 2); -} - -/** - * Return a new object that has the keys in sorted order. - * @param {Object} obj - * @return {Object} - * @api private - */ - - function canonicalize(obj, stack) { - stack = stack || []; - - if (utils.indexOf(stack, obj) !== -1) return obj; - - var canonicalizedObj; - - if ('[object Array]' == {}.toString.call(obj)) { - stack.push(obj); - canonicalizedObj = utils.map(obj, function(item) { - return canonicalize(item, stack); - }); - stack.pop(); - } else if (typeof obj === 'object' && obj !== null) { - stack.push(obj); - canonicalizedObj = {}; - utils.forEach(utils.keys(obj).sort(), function(key) { - canonicalizedObj[key] = canonicalize(obj[key], stack); - }); - stack.pop(); - } else { - canonicalizedObj = obj; - } - - return canonicalizedObj; - } - -/** - * Check that a / b have the same type. - * - * @param {Object} a - * @param {Object} b - * @return {Boolean} - * @api private - */ - -function sameType(a, b) { - a = Object.prototype.toString.call(a); - b = Object.prototype.toString.call(b); - return a == b; -} - - -}); // module: reporters/base.js - -require.register("reporters/doc.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , utils = require('../utils'); - -/** - * Expose `Doc`. - */ - -exports = module.exports = Doc; - -/** - * Initialize a new `Doc` reporter. - * - * @param {Runner} runner - * @api public - */ - -function Doc(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , total = runner.total - , indents = 2; - - function indent() { - return Array(indents).join(' '); - } - - runner.on('suite', function(suite){ - if (suite.root) return; - ++indents; - console.log('%s
        ', indent()); - ++indents; - console.log('%s

        %s

        ', indent(), utils.escape(suite.title)); - console.log('%s
        ', indent()); - }); - - runner.on('suite end', function(suite){ - if (suite.root) return; - console.log('%s
        ', indent()); - --indents; - console.log('%s
        ', indent()); - --indents; - }); - - runner.on('pass', function(test){ - console.log('%s
        %s
        ', indent(), utils.escape(test.title)); - var code = utils.escape(utils.clean(test.fn.toString())); - console.log('%s 
        %s
        ', indent(), code); - }); -} - -}); // module: reporters/doc.js - -require.register("reporters/dot.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , color = Base.color; - -/** - * Expose `Dot`. - */ - -exports = module.exports = Dot; - -/** - * Initialize a new `Dot` matrix test reporter. - * - * @param {Runner} runner - * @api public - */ - -function Dot(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , width = Base.window.width * .75 | 0 - , n = 0; - - runner.on('start', function(){ - process.stdout.write('\n '); - }); - - runner.on('pending', function(test){ - process.stdout.write(color('pending', Base.symbols.dot)); - }); - - runner.on('pass', function(test){ - if (++n % width == 0) process.stdout.write('\n '); - if ('slow' == test.speed) { - process.stdout.write(color('bright yellow', Base.symbols.dot)); - } else { - process.stdout.write(color(test.speed, Base.symbols.dot)); - } - }); - - runner.on('fail', function(test, err){ - if (++n % width == 0) process.stdout.write('\n '); - process.stdout.write(color('fail', Base.symbols.dot)); - }); - - runner.on('end', function(){ - console.log(); - self.epilogue(); - }); -} - -/** - * Inherit from `Base.prototype`. - */ - -function F(){}; -F.prototype = Base.prototype; -Dot.prototype = new F; -Dot.prototype.constructor = Dot; - -}); // module: reporters/dot.js - -require.register("reporters/html-cov.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var JSONCov = require('./json-cov') - , fs = require('browser/fs'); - -/** - * Expose `HTMLCov`. - */ - -exports = module.exports = HTMLCov; - -/** - * Initialize a new `JsCoverage` reporter. - * - * @param {Runner} runner - * @api public - */ - -function HTMLCov(runner) { - var jade = require('jade') - , file = __dirname + '/templates/coverage.jade' - , str = fs.readFileSync(file, 'utf8') - , fn = jade.compile(str, { filename: file }) - , self = this; - - JSONCov.call(this, runner, false); - - runner.on('end', function(){ - process.stdout.write(fn({ - cov: self.cov - , coverageClass: coverageClass - })); - }); -} - -/** - * Return coverage class for `n`. - * - * @return {String} - * @api private - */ - -function coverageClass(n) { - if (n >= 75) return 'high'; - if (n >= 50) return 'medium'; - if (n >= 25) return 'low'; - return 'terrible'; -} -}); // module: reporters/html-cov.js - -require.register("reporters/html.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , utils = require('../utils') - , Progress = require('../browser/progress') - , escape = utils.escape; - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date - , setTimeout = global.setTimeout - , setInterval = global.setInterval - , clearTimeout = global.clearTimeout - , clearInterval = global.clearInterval; - -/** - * Expose `HTML`. - */ - -exports = module.exports = HTML; - -/** - * Stats template. - */ - -var statsTemplate = ''; - -/** - * Initialize a new `HTML` reporter. - * - * @param {Runner} runner - * @api public - */ - -function HTML(runner, root) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , total = runner.total - , stat = fragment(statsTemplate) - , items = stat.getElementsByTagName('li') - , passes = items[1].getElementsByTagName('em')[0] - , passesLink = items[1].getElementsByTagName('a')[0] - , failures = items[2].getElementsByTagName('em')[0] - , failuresLink = items[2].getElementsByTagName('a')[0] - , duration = items[3].getElementsByTagName('em')[0] - , canvas = stat.getElementsByTagName('canvas')[0] - , report = fragment('
          ') - , stack = [report] - , progress - , ctx - - root = root || document.getElementById('mocha'); - - if (canvas.getContext) { - var ratio = window.devicePixelRatio || 1; - canvas.style.width = canvas.width; - canvas.style.height = canvas.height; - canvas.width *= ratio; - canvas.height *= ratio; - ctx = canvas.getContext('2d'); - ctx.scale(ratio, ratio); - progress = new Progress; - } - - if (!root) return error('#mocha div missing, add it to your document'); - - // pass toggle - on(passesLink, 'click', function(){ - unhide(); - var name = /pass/.test(report.className) ? '' : ' pass'; - report.className = report.className.replace(/fail|pass/g, '') + name; - if (report.className.trim()) hideSuitesWithout('test pass'); - }); - - // failure toggle - on(failuresLink, 'click', function(){ - unhide(); - var name = /fail/.test(report.className) ? '' : ' fail'; - report.className = report.className.replace(/fail|pass/g, '') + name; - if (report.className.trim()) hideSuitesWithout('test fail'); - }); - - root.appendChild(stat); - root.appendChild(report); - - if (progress) progress.size(40); - - runner.on('suite', function(suite){ - if (suite.root) return; - - // suite - var url = self.suiteURL(suite); - var el = fragment('

        • %s

          • ', url, escape(suite.title)); - - // container - stack[0].appendChild(el); - stack.unshift(document.createElement('ul')); - el.appendChild(stack[0]); - }); - - runner.on('suite end', function(suite){ - if (suite.root) return; - stack.shift(); - }); - - runner.on('fail', function(test, err){ - if ('hook' == test.type) runner.emit('test end', test); - }); - - runner.on('test end', function(test){ - // TODO: add to stats - var percent = stats.tests / this.total * 100 | 0; - if (progress) progress.update(percent).draw(ctx); - - // update stats - var ms = new Date - stats.start; - text(passes, stats.passes); - text(failures, stats.failures); - text(duration, (ms / 1000).toFixed(2)); - - // test - if ('passed' == test.state) { - var url = self.testURL(test); - var el = fragment('

        • %e%ems ‣

          • ', test.speed, test.title, test.duration, url); - } else if (test.pending) { - var el = fragment('

        • %e

          • ', test.title); - } else { - var el = fragment('

        • %e ‣

          • ', test.title, encodeURIComponent(test.fullTitle())); - var str = test.err.stack || test.err.toString(); - - // FF / Opera do not add the message - if (!~str.indexOf(test.err.message)) { - str = test.err.message + '\n' + str; - } - - // <=IE7 stringifies to [Object Error]. Since it can be overloaded, we - // check for the result of the stringifying. - if ('[object Error]' == str) str = test.err.message; - - // Safari doesn't give you a stack. Let's at least provide a source line. - if (!test.err.stack && test.err.sourceURL && test.err.line !== undefined) { - str += "\n(" + test.err.sourceURL + ":" + test.err.line + ")"; - } - - el.appendChild(fragment('
          %e
          ', str)); - } - - // toggle code - // TODO: defer - if (!test.pending) { - var h2 = el.getElementsByTagName('h2')[0]; - - on(h2, 'click', function(){ - pre.style.display = 'none' == pre.style.display - ? 'block' - : 'none'; - }); - - var pre = fragment('
          %e
          ', utils.clean(test.fn.toString())); - el.appendChild(pre); - pre.style.display = 'none'; - } - - // Don't call .appendChild if #mocha-report was already .shift()'ed off the stack. - if (stack[0]) stack[0].appendChild(el); - }); -} - -/** - * Provide suite URL - * - * @param {Object} [suite] - */ - -HTML.prototype.suiteURL = function(suite){ - return '?grep=' + encodeURIComponent(suite.fullTitle()); -}; - -/** - * Provide test URL - * - * @param {Object} [test] - */ - -HTML.prototype.testURL = function(test){ - return '?grep=' + encodeURIComponent(test.fullTitle()); -}; - -/** - * Display error `msg`. - */ - -function error(msg) { - document.body.appendChild(fragment('
          %s
          ', msg)); -} - -/** - * Return a DOM fragment from `html`. - */ - -function fragment(html) { - var args = arguments - , div = document.createElement('div') - , i = 1; - - div.innerHTML = html.replace(/%([se])/g, function(_, type){ - switch (type) { - case 's': return String(args[i++]); - case 'e': return escape(args[i++]); - } - }); - - return div.firstChild; -} - -/** - * Check for suites that do not have elements - * with `classname`, and hide them. - */ - -function hideSuitesWithout(classname) { - var suites = document.getElementsByClassName('suite'); - for (var i = 0; i < suites.length; i++) { - var els = suites[i].getElementsByClassName(classname); - if (0 == els.length) suites[i].className += ' hidden'; - } -} - -/** - * Unhide .hidden suites. - */ - -function unhide() { - var els = document.getElementsByClassName('suite hidden'); - for (var i = 0; i < els.length; ++i) { - els[i].className = els[i].className.replace('suite hidden', 'suite'); - } -} - -/** - * Set `el` text to `str`. - */ - -function text(el, str) { - if (el.textContent) { - el.textContent = str; - } else { - el.innerText = str; - } -} - -/** - * Listen on `event` with callback `fn`. - */ - -function on(el, event, fn) { - if (el.addEventListener) { - el.addEventListener(event, fn, false); - } else { - el.attachEvent('on' + event, fn); - } -} - -}); // module: reporters/html.js - -require.register("reporters/index.js", function(module, exports, require){ - -exports.Base = require('./base'); -exports.Dot = require('./dot'); -exports.Doc = require('./doc'); -exports.TAP = require('./tap'); -exports.JSON = require('./json'); -exports.HTML = require('./html'); -exports.List = require('./list'); -exports.Min = require('./min'); -exports.Spec = require('./spec'); -exports.Nyan = require('./nyan'); -exports.XUnit = require('./xunit'); -exports.Markdown = require('./markdown'); -exports.Progress = require('./progress'); -exports.Landing = require('./landing'); -exports.JSONCov = require('./json-cov'); -exports.HTMLCov = require('./html-cov'); -exports.JSONStream = require('./json-stream'); - -}); // module: reporters/index.js - -require.register("reporters/json-cov.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base'); - -/** - * Expose `JSONCov`. - */ - -exports = module.exports = JSONCov; - -/** - * Initialize a new `JsCoverage` reporter. - * - * @param {Runner} runner - * @param {Boolean} output - * @api public - */ - -function JSONCov(runner, output) { - var self = this - , output = 1 == arguments.length ? true : output; - - Base.call(this, runner); - - var tests = [] - , failures = [] - , passes = []; - - runner.on('test end', function(test){ - tests.push(test); - }); - - runner.on('pass', function(test){ - passes.push(test); - }); - - runner.on('fail', function(test){ - failures.push(test); - }); - - runner.on('end', function(){ - var cov = global._$jscoverage || {}; - var result = self.cov = map(cov); - result.stats = self.stats; - result.tests = tests.map(clean); - result.failures = failures.map(clean); - result.passes = passes.map(clean); - if (!output) return; - process.stdout.write(JSON.stringify(result, null, 2 )); - }); -} - -/** - * Map jscoverage data to a JSON structure - * suitable for reporting. - * - * @param {Object} cov - * @return {Object} - * @api private - */ - -function map(cov) { - var ret = { - instrumentation: 'node-jscoverage' - , sloc: 0 - , hits: 0 - , misses: 0 - , coverage: 0 - , files: [] - }; - - for (var filename in cov) { - var data = coverage(filename, cov[filename]); - ret.files.push(data); - ret.hits += data.hits; - ret.misses += data.misses; - ret.sloc += data.sloc; - } - - ret.files.sort(function(a, b) { - return a.filename.localeCompare(b.filename); - }); - - if (ret.sloc > 0) { - ret.coverage = (ret.hits / ret.sloc) * 100; - } - - return ret; -}; - -/** - * Map jscoverage data for a single source file - * to a JSON structure suitable for reporting. - * - * @param {String} filename name of the source file - * @param {Object} data jscoverage coverage data - * @return {Object} - * @api private - */ - -function coverage(filename, data) { - var ret = { - filename: filename, - coverage: 0, - hits: 0, - misses: 0, - sloc: 0, - source: {} - }; - - data.source.forEach(function(line, num){ - num++; - - if (data[num] === 0) { - ret.misses++; - ret.sloc++; - } else if (data[num] !== undefined) { - ret.hits++; - ret.sloc++; - } - - ret.source[num] = { - source: line - , coverage: data[num] === undefined - ? '' - : data[num] - }; - }); - - ret.coverage = ret.hits / ret.sloc * 100; - - return ret; -} - -/** - * Return a plain-object representation of `test` - * free of cyclic properties etc. - * - * @param {Object} test - * @return {Object} - * @api private - */ - -function clean(test) { - return { - title: test.title - , fullTitle: test.fullTitle() - , duration: test.duration - } -} - -}); // module: reporters/json-cov.js - -require.register("reporters/json-stream.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , color = Base.color; - -/** - * Expose `List`. - */ - -exports = module.exports = List; - -/** - * Initialize a new `List` test reporter. - * - * @param {Runner} runner - * @api public - */ - -function List(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , total = runner.total; - - runner.on('start', function(){ - console.log(JSON.stringify(['start', { total: total }])); - }); - - runner.on('pass', function(test){ - console.log(JSON.stringify(['pass', clean(test)])); - }); - - runner.on('fail', function(test, err){ - console.log(JSON.stringify(['fail', clean(test)])); - }); - - runner.on('end', function(){ - process.stdout.write(JSON.stringify(['end', self.stats])); - }); -} - -/** - * Return a plain-object representation of `test` - * free of cyclic properties etc. - * - * @param {Object} test - * @return {Object} - * @api private - */ - -function clean(test) { - return { - title: test.title - , fullTitle: test.fullTitle() - , duration: test.duration - } -} -}); // module: reporters/json-stream.js - -require.register("reporters/json.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `JSON`. - */ - -exports = module.exports = JSONReporter; - -/** - * Initialize a new `JSON` reporter. - * - * @param {Runner} runner - * @api public - */ - -function JSONReporter(runner) { - var self = this; - Base.call(this, runner); - - var tests = [] - , failures = [] - , passes = []; - - runner.on('test end', function(test){ - tests.push(test); - }); - - runner.on('pass', function(test){ - passes.push(test); - }); - - runner.on('fail', function(test){ - failures.push(test); - }); - - runner.on('end', function(){ - var obj = { - stats: self.stats - , tests: tests.map(clean) - , failures: failures.map(clean) - , passes: passes.map(clean) - }; - - process.stdout.write(JSON.stringify(obj, null, 2)); - }); -} - -/** - * Return a plain-object representation of `test` - * free of cyclic properties etc. - * - * @param {Object} test - * @return {Object} - * @api private - */ - -function clean(test) { - return { - title: test.title - , fullTitle: test.fullTitle() - , duration: test.duration - } -} -}); // module: reporters/json.js - -require.register("reporters/landing.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `Landing`. - */ - -exports = module.exports = Landing; - -/** - * Airplane color. - */ - -Base.colors.plane = 0; - -/** - * Airplane crash color. - */ - -Base.colors['plane crash'] = 31; - -/** - * Runway color. - */ - -Base.colors.runway = 90; - -/** - * Initialize a new `Landing` reporter. - * - * @param {Runner} runner - * @api public - */ - -function Landing(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , width = Base.window.width * .75 | 0 - , total = runner.total - , stream = process.stdout - , plane = color('plane', '✈') - , crashed = -1 - , n = 0; - - function runway() { - var buf = Array(width).join('-'); - return ' ' + color('runway', buf); - } - - runner.on('start', function(){ - stream.write('\n '); - cursor.hide(); - }); - - runner.on('test end', function(test){ - // check if the plane crashed - var col = -1 == crashed - ? width * ++n / total | 0 - : crashed; - - // show the crash - if ('failed' == test.state) { - plane = color('plane crash', '✈'); - crashed = col; - } - - // render landing strip - stream.write('\u001b[4F\n\n'); - stream.write(runway()); - stream.write('\n '); - stream.write(color('runway', Array(col).join('⋅'))); - stream.write(plane) - stream.write(color('runway', Array(width - col).join('⋅') + '\n')); - stream.write(runway()); - stream.write('\u001b[0m'); - }); - - runner.on('end', function(){ - cursor.show(); - console.log(); - self.epilogue(); - }); -} - -/** - * Inherit from `Base.prototype`. - */ - -function F(){}; -F.prototype = Base.prototype; -Landing.prototype = new F; -Landing.prototype.constructor = Landing; - -}); // module: reporters/landing.js - -require.register("reporters/list.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `List`. - */ - -exports = module.exports = List; - -/** - * Initialize a new `List` test reporter. - * - * @param {Runner} runner - * @api public - */ - -function List(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , n = 0; - - runner.on('start', function(){ - console.log(); - }); - - runner.on('test', function(test){ - process.stdout.write(color('pass', ' ' + test.fullTitle() + ': ')); - }); - - runner.on('pending', function(test){ - var fmt = color('checkmark', ' -') - + color('pending', ' %s'); - console.log(fmt, test.fullTitle()); - }); - - runner.on('pass', function(test){ - var fmt = color('checkmark', ' '+Base.symbols.dot) - + color('pass', ' %s: ') - + color(test.speed, '%dms'); - cursor.CR(); - console.log(fmt, test.fullTitle(), test.duration); - }); - - runner.on('fail', function(test, err){ - cursor.CR(); - console.log(color('fail', ' %d) %s'), ++n, test.fullTitle()); - }); - - runner.on('end', self.epilogue.bind(self)); -} - -/** - * Inherit from `Base.prototype`. - */ - -function F(){}; -F.prototype = Base.prototype; -List.prototype = new F; -List.prototype.constructor = List; - - -}); // module: reporters/list.js - -require.register("reporters/markdown.js", function(module, exports, require){ -/** - * Module dependencies. - */ - -var Base = require('./base') - , utils = require('../utils'); - -/** - * Expose `Markdown`. - */ - -exports = module.exports = Markdown; - -/** - * Initialize a new `Markdown` reporter. - * - * @param {Runner} runner - * @api public - */ - -function Markdown(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , level = 0 - , buf = ''; - - function title(str) { - return Array(level).join('#') + ' ' + str; - } - - function indent() { - return Array(level).join(' '); - } - - function mapTOC(suite, obj) { - var ret = obj; - obj = obj[suite.title] = obj[suite.title] || { suite: suite }; - suite.suites.forEach(function(suite){ - mapTOC(suite, obj); - }); - return ret; - } - - function stringifyTOC(obj, level) { - ++level; - var buf = ''; - var link; - for (var key in obj) { - if ('suite' == key) continue; - if (key) link = ' - [' + key + '](#' + utils.slug(obj[key].suite.fullTitle()) + ')\n'; - if (key) buf += Array(level).join(' ') + link; - buf += stringifyTOC(obj[key], level); - } - --level; - return buf; - } - - function generateTOC(suite) { - var obj = mapTOC(suite, {}); - return stringifyTOC(obj, 0); - } - - generateTOC(runner.suite); - - runner.on('suite', function(suite){ - ++level; - var slug = utils.slug(suite.fullTitle()); - buf += '' + '\n'; - buf += title(suite.title) + '\n'; - }); - - runner.on('suite end', function(suite){ - --level; - }); - - runner.on('pass', function(test){ - var code = utils.clean(test.fn.toString()); - buf += test.title + '.\n'; - buf += '\n```js\n'; - buf += code + '\n'; - buf += '```\n\n'; - }); - - runner.on('end', function(){ - process.stdout.write('# TOC\n'); - process.stdout.write(generateTOC(runner.suite)); - process.stdout.write(buf); - }); -} -}); // module: reporters/markdown.js - -require.register("reporters/min.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base'); - -/** - * Expose `Min`. - */ - -exports = module.exports = Min; - -/** - * Initialize a new `Min` minimal test reporter (best used with --watch). - * - * @param {Runner} runner - * @api public - */ - -function Min(runner) { - Base.call(this, runner); - - runner.on('start', function(){ - // clear screen - process.stdout.write('\u001b[2J'); - // set cursor position - process.stdout.write('\u001b[1;3H'); - }); - - runner.on('end', this.epilogue.bind(this)); -} - -/** - * Inherit from `Base.prototype`. - */ - -function F(){}; -F.prototype = Base.prototype; -Min.prototype = new F; -Min.prototype.constructor = Min; - - -}); // module: reporters/min.js - -require.register("reporters/nyan.js", function(module, exports, require){ -/** - * Module dependencies. - */ - -var Base = require('./base') - , color = Base.color; - -/** - * Expose `Dot`. - */ - -exports = module.exports = NyanCat; - -/** - * Initialize a new `Dot` matrix test reporter. - * - * @param {Runner} runner - * @api public - */ - -function NyanCat(runner) { - Base.call(this, runner); - var self = this - , stats = this.stats - , width = Base.window.width * .75 | 0 - , rainbowColors = this.rainbowColors = self.generateColors() - , colorIndex = this.colorIndex = 0 - , numerOfLines = this.numberOfLines = 4 - , trajectories = this.trajectories = [[], [], [], []] - , nyanCatWidth = this.nyanCatWidth = 11 - , trajectoryWidthMax = this.trajectoryWidthMax = (width - nyanCatWidth) - , scoreboardWidth = this.scoreboardWidth = 5 - , tick = this.tick = 0 - , n = 0; - - runner.on('start', function(){ - Base.cursor.hide(); - self.draw(); - }); - - runner.on('pending', function(test){ - self.draw(); - }); - - runner.on('pass', function(test){ - self.draw(); - }); - - runner.on('fail', function(test, err){ - self.draw(); - }); - - runner.on('end', function(){ - Base.cursor.show(); - for (var i = 0; i < self.numberOfLines; i++) write('\n'); - self.epilogue(); - }); -} - -/** - * Draw the nyan cat - * - * @api private - */ - -NyanCat.prototype.draw = function(){ - this.appendRainbow(); - this.drawScoreboard(); - this.drawRainbow(); - this.drawNyanCat(); - this.tick = !this.tick; -}; - -/** - * Draw the "scoreboard" showing the number - * of passes, failures and pending tests. - * - * @api private - */ - -NyanCat.prototype.drawScoreboard = function(){ - var stats = this.stats; - var colors = Base.colors; - - function draw(color, n) { - write(' '); - write('\u001b[' + color + 'm' + n + '\u001b[0m'); - write('\n'); - } - - draw(colors.green, stats.passes); - draw(colors.fail, stats.failures); - draw(colors.pending, stats.pending); - write('\n'); - - this.cursorUp(this.numberOfLines); -}; - -/** - * Append the rainbow. - * - * @api private - */ - -NyanCat.prototype.appendRainbow = function(){ - var segment = this.tick ? '_' : '-'; - var rainbowified = this.rainbowify(segment); - - for (var index = 0; index < this.numberOfLines; index++) { - var trajectory = this.trajectories[index]; - if (trajectory.length >= this.trajectoryWidthMax) trajectory.shift(); - trajectory.push(rainbowified); - } -}; - -/** - * Draw the rainbow. - * - * @api private - */ - -NyanCat.prototype.drawRainbow = function(){ - var self = this; - - this.trajectories.forEach(function(line, index) { - write('\u001b[' + self.scoreboardWidth + 'C'); - write(line.join('')); - write('\n'); - }); - - this.cursorUp(this.numberOfLines); -}; - -/** - * Draw the nyan cat - * - * @api private - */ - -NyanCat.prototype.drawNyanCat = function() { - var self = this; - var startWidth = this.scoreboardWidth + this.trajectories[0].length; - var color = '\u001b[' + startWidth + 'C'; - var padding = ''; - - write(color); - write('_,------,'); - write('\n'); - - write(color); - padding = self.tick ? ' ' : ' '; - write('_|' + padding + '/\\_/\\ '); - write('\n'); - - write(color); - padding = self.tick ? '_' : '__'; - var tail = self.tick ? '~' : '^'; - var face; - write(tail + '|' + padding + this.face() + ' '); - write('\n'); - - write(color); - padding = self.tick ? ' ' : ' '; - write(padding + '"" "" '); - write('\n'); - - this.cursorUp(this.numberOfLines); -}; - -/** - * Draw nyan cat face. - * - * @return {String} - * @api private - */ - -NyanCat.prototype.face = function() { - var stats = this.stats; - if (stats.failures) { - return '( x .x)'; - } else if (stats.pending) { - return '( o .o)'; - } else if(stats.passes) { - return '( ^ .^)'; - } else { - return '( - .-)'; - } -} - -/** - * Move cursor up `n`. - * - * @param {Number} n - * @api private - */ - -NyanCat.prototype.cursorUp = function(n) { - write('\u001b[' + n + 'A'); -}; - -/** - * Move cursor down `n`. - * - * @param {Number} n - * @api private - */ - -NyanCat.prototype.cursorDown = function(n) { - write('\u001b[' + n + 'B'); -}; - -/** - * Generate rainbow colors. - * - * @return {Array} - * @api private - */ - -NyanCat.prototype.generateColors = function(){ - var colors = []; - - for (var i = 0; i < (6 * 7); i++) { - var pi3 = Math.floor(Math.PI / 3); - var n = (i * (1.0 / 6)); - var r = Math.floor(3 * Math.sin(n) + 3); - var g = Math.floor(3 * Math.sin(n + 2 * pi3) + 3); - var b = Math.floor(3 * Math.sin(n + 4 * pi3) + 3); - colors.push(36 * r + 6 * g + b + 16); - } - - return colors; -}; - -/** - * Apply rainbow to the given `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -NyanCat.prototype.rainbowify = function(str){ - var color = this.rainbowColors[this.colorIndex % this.rainbowColors.length]; - this.colorIndex += 1; - return '\u001b[38;5;' + color + 'm' + str + '\u001b[0m'; -}; - -/** - * Stdout helper. - */ - -function write(string) { - process.stdout.write(string); -} - -/** - * Inherit from `Base.prototype`. - */ - -function F(){}; -F.prototype = Base.prototype; -NyanCat.prototype = new F; -NyanCat.prototype.constructor = NyanCat; - - -}); // module: reporters/nyan.js - -require.register("reporters/progress.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `Progress`. - */ - -exports = module.exports = Progress; - -/** - * General progress bar color. - */ - -Base.colors.progress = 90; - -/** - * Initialize a new `Progress` bar test reporter. - * - * @param {Runner} runner - * @param {Object} options - * @api public - */ - -function Progress(runner, options) { - Base.call(this, runner); - - var self = this - , options = options || {} - , stats = this.stats - , width = Base.window.width * .50 | 0 - , total = runner.total - , complete = 0 - , max = Math.max; - - // default chars - options.open = options.open || '['; - options.complete = options.complete || '▬'; - options.incomplete = options.incomplete || Base.symbols.dot; - options.close = options.close || ']'; - options.verbose = false; - - // tests started - runner.on('start', function(){ - console.log(); - cursor.hide(); - }); - - // tests complete - runner.on('test end', function(){ - complete++; - var incomplete = total - complete - , percent = complete / total - , n = width * percent | 0 - , i = width - n; - - cursor.CR(); - process.stdout.write('\u001b[J'); - process.stdout.write(color('progress', ' ' + options.open)); - process.stdout.write(Array(n).join(options.complete)); - process.stdout.write(Array(i).join(options.incomplete)); - process.stdout.write(color('progress', options.close)); - if (options.verbose) { - process.stdout.write(color('progress', ' ' + complete + ' of ' + total)); - } - }); - - // tests are complete, output some stats - // and the failures if any - runner.on('end', function(){ - cursor.show(); - console.log(); - self.epilogue(); - }); -} - -/** - * Inherit from `Base.prototype`. - */ - -function F(){}; -F.prototype = Base.prototype; -Progress.prototype = new F; -Progress.prototype.constructor = Progress; - - -}); // module: reporters/progress.js - -require.register("reporters/spec.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `Spec`. - */ - -exports = module.exports = Spec; - -/** - * Initialize a new `Spec` test reporter. - * - * @param {Runner} runner - * @api public - */ - -function Spec(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , indents = 0 - , n = 0; - - function indent() { - return Array(indents).join(' ') - } - - runner.on('start', function(){ - console.log(); - }); - - runner.on('suite', function(suite){ - ++indents; - console.log(color('suite', '%s%s'), indent(), suite.title); - }); - - runner.on('suite end', function(suite){ - --indents; - if (1 == indents) console.log(); - }); - - runner.on('pending', function(test){ - var fmt = indent() + color('pending', ' - %s'); - console.log(fmt, test.title); - }); - - runner.on('pass', function(test){ - if ('fast' == test.speed) { - var fmt = indent() - + color('checkmark', ' ' + Base.symbols.ok) - + color('pass', ' %s '); - cursor.CR(); - console.log(fmt, test.title); - } else { - var fmt = indent() - + color('checkmark', ' ' + Base.symbols.ok) - + color('pass', ' %s ') - + color(test.speed, '(%dms)'); - cursor.CR(); - console.log(fmt, test.title, test.duration); - } - }); - - runner.on('fail', function(test, err){ - cursor.CR(); - console.log(indent() + color('fail', ' %d) %s'), ++n, test.title); - }); - - runner.on('end', self.epilogue.bind(self)); -} - -/** - * Inherit from `Base.prototype`. - */ - -function F(){}; -F.prototype = Base.prototype; -Spec.prototype = new F; -Spec.prototype.constructor = Spec; - - -}); // module: reporters/spec.js - -require.register("reporters/tap.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , cursor = Base.cursor - , color = Base.color; - -/** - * Expose `TAP`. - */ - -exports = module.exports = TAP; - -/** - * Initialize a new `TAP` reporter. - * - * @param {Runner} runner - * @api public - */ - -function TAP(runner) { - Base.call(this, runner); - - var self = this - , stats = this.stats - , n = 1 - , passes = 0 - , failures = 0; - - runner.on('start', function(){ - var total = runner.grepTotal(runner.suite); - console.log('%d..%d', 1, total); - }); - - runner.on('test end', function(){ - ++n; - }); - - runner.on('pending', function(test){ - console.log('ok %d %s # SKIP -', n, title(test)); - }); - - runner.on('pass', function(test){ - passes++; - console.log('ok %d %s', n, title(test)); - }); - - runner.on('fail', function(test, err){ - failures++; - console.log('not ok %d %s', n, title(test)); - if (err.stack) console.log(err.stack.replace(/^/gm, ' ')); - }); - - runner.on('end', function(){ - console.log('# tests ' + (passes + failures)); - console.log('# pass ' + passes); - console.log('# fail ' + failures); - }); -} - -/** - * Return a TAP-safe title of `test` - * - * @param {Object} test - * @return {String} - * @api private - */ - -function title(test) { - return test.fullTitle().replace(/#/g, ''); -} - -}); // module: reporters/tap.js - -require.register("reporters/xunit.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Base = require('./base') - , utils = require('../utils') - , escape = utils.escape; - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date - , setTimeout = global.setTimeout - , setInterval = global.setInterval - , clearTimeout = global.clearTimeout - , clearInterval = global.clearInterval; - -/** - * Expose `XUnit`. - */ - -exports = module.exports = XUnit; - -/** - * Initialize a new `XUnit` reporter. - * - * @param {Runner} runner - * @api public - */ - -function XUnit(runner) { - Base.call(this, runner); - var stats = this.stats - , tests = [] - , self = this; - - runner.on('pending', function(test){ - tests.push(test); - }); - - runner.on('pass', function(test){ - tests.push(test); - }); - - runner.on('fail', function(test){ - tests.push(test); - }); - - runner.on('end', function(){ - console.log(tag('testsuite', { - name: 'Mocha Tests' - , tests: stats.tests - , failures: stats.failures - , errors: stats.failures - , skipped: stats.tests - stats.failures - stats.passes - , timestamp: (new Date).toUTCString() - , time: (stats.duration / 1000) || 0 - }, false)); - - tests.forEach(test); - console.log(''); - }); -} - -/** - * Inherit from `Base.prototype`. - */ - -function F(){}; -F.prototype = Base.prototype; -XUnit.prototype = new F; -XUnit.prototype.constructor = XUnit; - - -/** - * Output tag for the given `test.` - */ - -function test(test) { - var attrs = { - classname: test.parent.fullTitle() - , name: test.title - , time: (test.duration / 1000) || 0 - }; - - if ('failed' == test.state) { - var err = test.err; - attrs.message = escape(err.message); - console.log(tag('testcase', attrs, false, tag('failure', attrs, false, cdata(err.stack)))); - } else if (test.pending) { - console.log(tag('testcase', attrs, false, tag('skipped', {}, true))); - } else { - console.log(tag('testcase', attrs, true) ); - } -} - -/** - * HTML tag helper. - */ - -function tag(name, attrs, close, content) { - var end = close ? '/>' : '>' - , pairs = [] - , tag; - - for (var key in attrs) { - pairs.push(key + '="' + escape(attrs[key]) + '"'); - } - - tag = '<' + name + (pairs.length ? ' ' + pairs.join(' ') : '') + end; - if (content) tag += content + ''; -} - -}); // module: reporters/xunit.js - -require.register("runnable.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var EventEmitter = require('browser/events').EventEmitter - , debug = require('browser/debug')('mocha:runnable') - , milliseconds = require('./ms'); - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date - , setTimeout = global.setTimeout - , setInterval = global.setInterval - , clearTimeout = global.clearTimeout - , clearInterval = global.clearInterval; - -/** - * Object#toString(). - */ - -var toString = Object.prototype.toString; - -/** - * Expose `Runnable`. - */ - -module.exports = Runnable; - -/** - * Initialize a new `Runnable` with the given `title` and callback `fn`. - * - * @param {String} title - * @param {Function} fn - * @api private - */ - -function Runnable(title, fn) { - this.title = title; - this.fn = fn; - this.async = fn && fn.length; - this.sync = ! this.async; - this._timeout = 2000; - this._slow = 75; - this.timedOut = false; -} - -/** - * Inherit from `EventEmitter.prototype`. - */ - -function F(){}; -F.prototype = EventEmitter.prototype; -Runnable.prototype = new F; -Runnable.prototype.constructor = Runnable; - - -/** - * Set & get timeout `ms`. - * - * @param {Number|String} ms - * @return {Runnable|Number} ms or self - * @api private - */ - -Runnable.prototype.timeout = function(ms){ - if (0 == arguments.length) return this._timeout; - if ('string' == typeof ms) ms = milliseconds(ms); - debug('timeout %d', ms); - this._timeout = ms; - if (this.timer) this.resetTimeout(); - return this; -}; - -/** - * Set & get slow `ms`. - * - * @param {Number|String} ms - * @return {Runnable|Number} ms or self - * @api private - */ - -Runnable.prototype.slow = function(ms){ - if (0 === arguments.length) return this._slow; - if ('string' == typeof ms) ms = milliseconds(ms); - debug('timeout %d', ms); - this._slow = ms; - return this; -}; - -/** - * Return the full title generated by recursively - * concatenating the parent's full title. - * - * @return {String} - * @api public - */ - -Runnable.prototype.fullTitle = function(){ - return this.parent.fullTitle() + ' ' + this.title; -}; - -/** - * Clear the timeout. - * - * @api private - */ - -Runnable.prototype.clearTimeout = function(){ - clearTimeout(this.timer); -}; - -/** - * Inspect the runnable void of private properties. - * - * @return {String} - * @api private - */ - -Runnable.prototype.inspect = function(){ - return JSON.stringify(this, function(key, val){ - if ('_' == key[0]) return; - if ('parent' == key) return '#'; - if ('ctx' == key) return '#'; - return val; - }, 2); -}; - -/** - * Reset the timeout. - * - * @api private - */ - -Runnable.prototype.resetTimeout = function(){ - var self = this; - var ms = this.timeout() || 1e9; - - this.clearTimeout(); - this.timer = setTimeout(function(){ - self.callback(new Error('timeout of ' + ms + 'ms exceeded')); - self.timedOut = true; - }, ms); -}; - -/** - * Whitelist these globals for this test run - * - * @api private - */ -Runnable.prototype.globals = function(arr){ - var self = this; - this._allowedGlobals = arr; -}; - -/** - * Run the test and invoke `fn(err)`. - * - * @param {Function} fn - * @api private - */ - -Runnable.prototype.run = function(fn){ - var self = this - , ms = this.timeout() - , start = new Date - , ctx = this.ctx - , finished - , emitted; - - if (ctx) ctx.runnable(this); - - // timeout - if (this.async) { - if (ms) { - this.timer = setTimeout(function(){ - done(new Error('timeout of ' + ms + 'ms exceeded')); - self.timedOut = true; - }, ms); - } - } - - // called multiple times - function multiple(err) { - if (emitted) return; - emitted = true; - self.emit('error', err || new Error('done() called multiple times')); - } - - // finished - function done(err) { - if (self.timedOut) return; - if (finished) return multiple(err); - self.clearTimeout(); - self.duration = new Date - start; - finished = true; - fn(err); - } - - // for .resetTimeout() - this.callback = done; - - // async - if (this.async) { - try { - this.fn.call(ctx, function(err){ - if (err instanceof Error || toString.call(err) === "[object Error]") return done(err); - if (null != err) return done(new Error('done() invoked with non-Error: ' + err)); - done(); - }); - } catch (err) { - done(err); - } - return; - } - - if (this.asyncOnly) { - return done(new Error('--async-only option in use without declaring `done()`')); - } - - // sync - try { - if (!this.pending) this.fn.call(ctx); - this.duration = new Date - start; - fn(); - } catch (err) { - fn(err); - } -}; - -}); // module: runnable.js - -require.register("runner.js", function(module, exports, require){ -/** - * Module dependencies. - */ - -var EventEmitter = require('browser/events').EventEmitter - , debug = require('browser/debug')('mocha:runner') - , Test = require('./test') - , utils = require('./utils') - , filter = utils.filter - , keys = utils.keys; - -/** - * Non-enumerable globals. - */ - -var globals = [ - 'setTimeout', - 'clearTimeout', - 'setInterval', - 'clearInterval', - 'XMLHttpRequest', - 'Date' -]; - -/** - * Expose `Runner`. - */ - -module.exports = Runner; - -/** - * Initialize a `Runner` for the given `suite`. - * - * Events: - * - * - `start` execution started - * - `end` execution complete - * - `suite` (suite) test suite execution started - * - `suite end` (suite) all tests (and sub-suites) have finished - * - `test` (test) test execution started - * - `test end` (test) test completed - * - `hook` (hook) hook execution started - * - `hook end` (hook) hook complete - * - `pass` (test) test passed - * - `fail` (test, err) test failed - * - `pending` (test) test pending - * - * @api public - */ - -function Runner(suite) { - var self = this; - this._globals = []; - this._abort = false; - this.suite = suite; - this.total = suite.total(); - this.failures = 0; - this.on('test end', function(test){ self.checkGlobals(test); }); - this.on('hook end', function(hook){ self.checkGlobals(hook); }); - this.grep(/.*/); - this.globals(this.globalProps().concat(extraGlobals())); -} - -/** - * Wrapper for setImmediate, process.nextTick, or browser polyfill. - * - * @param {Function} fn - * @api private - */ - -Runner.immediately = global.setImmediate || process.nextTick; - -/** - * Inherit from `EventEmitter.prototype`. - */ - -function F(){}; -F.prototype = EventEmitter.prototype; -Runner.prototype = new F; -Runner.prototype.constructor = Runner; - - -/** - * Run tests with full titles matching `re`. Updates runner.total - * with number of tests matched. - * - * @param {RegExp} re - * @param {Boolean} invert - * @return {Runner} for chaining - * @api public - */ - -Runner.prototype.grep = function(re, invert){ - debug('grep %s', re); - this._grep = re; - this._invert = invert; - this.total = this.grepTotal(this.suite); - return this; -}; - -/** - * Returns the number of tests matching the grep search for the - * given suite. - * - * @param {Suite} suite - * @return {Number} - * @api public - */ - -Runner.prototype.grepTotal = function(suite) { - var self = this; - var total = 0; - - suite.eachTest(function(test){ - var match = self._grep.test(test.fullTitle()); - if (self._invert) match = !match; - if (match) total++; - }); - - return total; -}; - -/** - * Return a list of global properties. - * - * @return {Array} - * @api private - */ - -Runner.prototype.globalProps = function() { - var props = utils.keys(global); - - // non-enumerables - for (var i = 0; i < globals.length; ++i) { - if (~utils.indexOf(props, globals[i])) continue; - props.push(globals[i]); - } - - return props; -}; - -/** - * Allow the given `arr` of globals. - * - * @param {Array} arr - * @return {Runner} for chaining - * @api public - */ - -Runner.prototype.globals = function(arr){ - if (0 == arguments.length) return this._globals; - debug('globals %j', arr); - this._globals = this._globals.concat(arr); - return this; -}; - -/** - * Check for global variable leaks. - * - * @api private - */ - -Runner.prototype.checkGlobals = function(test){ - if (this.ignoreLeaks) return; - var ok = this._globals; - - var globals = this.globalProps(); - var isNode = process.kill; - var leaks; - - if (test) { - ok = ok.concat(test._allowedGlobals || []); - } - - if(this.prevGlobalsLength == globals.length) return; - this.prevGlobalsLength = globals.length; - - leaks = filterLeaks(ok, globals); - this._globals = this._globals.concat(leaks); - - if (leaks.length > 1) { - this.fail(test, new Error('global leaks detected: ' + leaks.join(', ') + '')); - } else if (leaks.length) { - this.fail(test, new Error('global leak detected: ' + leaks[0])); - } -}; - -/** - * Fail the given `test`. - * - * @param {Test} test - * @param {Error} err - * @api private - */ - -Runner.prototype.fail = function(test, err){ - ++this.failures; - test.state = 'failed'; - - if ('string' == typeof err) { - err = new Error('the string "' + err + '" was thrown, throw an Error :)'); - } - - this.emit('fail', test, err); -}; - -/** - * Fail the given `hook` with `err`. - * - * Hook failures work in the following pattern: - * - If bail, then exit - * - Failed `before` hook skips all tests in a suite and subsuites, - * but jumps to corresponding `after` hook - * - Failed `before each` hook skips remaining tests in a - * suite and jumps to corresponding `after each` hook, - * which is run only once - * - Failed `after` hook does not alter - * execution order - * - Failed `after each` hook skips remaining tests in a - * suite and subsuites, but executes other `after each` - * hooks - * - * @param {Hook} hook - * @param {Error} err - * @api private - */ - -Runner.prototype.failHook = function(hook, err){ - this.fail(hook, err); - if (this.suite.bail()) { - this.emit('end'); - } -}; - -/** - * Run hook `name` callbacks and then invoke `fn()`. - * - * @param {String} name - * @param {Function} function - * @api private - */ - -Runner.prototype.hook = function(name, fn){ - var suite = this.suite - , hooks = suite['_' + name] - , self = this - , timer; - - function next(i) { - var hook = hooks[i]; - if (!hook) return fn(); - if (self.failures && suite.bail()) return fn(); - self.currentRunnable = hook; - - hook.ctx.currentTest = self.test; - - self.emit('hook', hook); - - hook.on('error', function(err){ - self.failHook(hook, err); - }); - - hook.run(function(err){ - hook.removeAllListeners('error'); - var testError = hook.error(); - if (testError) self.fail(self.test, testError); - if (err) { - self.failHook(hook, err); - - // stop executing hooks, notify callee of hook err - return fn(err); - } - self.emit('hook end', hook); - delete hook.ctx.currentTest; - next(++i); - }); - } - - Runner.immediately(function(){ - next(0); - }); -}; - -/** - * Run hook `name` for the given array of `suites` - * in order, and callback `fn(err, errSuite)`. - * - * @param {String} name - * @param {Array} suites - * @param {Function} fn - * @api private - */ - -Runner.prototype.hooks = function(name, suites, fn){ - var self = this - , orig = this.suite; - - function next(suite) { - self.suite = suite; - - if (!suite) { - self.suite = orig; - return fn(); - } - - self.hook(name, function(err){ - if (err) { - var errSuite = self.suite; - self.suite = orig; - return fn(err, errSuite); - } - - next(suites.pop()); - }); - } - - next(suites.pop()); -}; - -/** - * Run hooks from the top level down. - * - * @param {String} name - * @param {Function} fn - * @api private - */ - -Runner.prototype.hookUp = function(name, fn){ - var suites = [this.suite].concat(this.parents()).reverse(); - this.hooks(name, suites, fn); -}; - -/** - * Run hooks from the bottom up. - * - * @param {String} name - * @param {Function} fn - * @api private - */ - -Runner.prototype.hookDown = function(name, fn){ - var suites = [this.suite].concat(this.parents()); - this.hooks(name, suites, fn); -}; - -/** - * Return an array of parent Suites from - * closest to furthest. - * - * @return {Array} - * @api private - */ - -Runner.prototype.parents = function(){ - var suite = this.suite - , suites = []; - while (suite = suite.parent) suites.push(suite); - return suites; -}; - -/** - * Run the current test and callback `fn(err)`. - * - * @param {Function} fn - * @api private - */ - -Runner.prototype.runTest = function(fn){ - var test = this.test - , self = this; - - if (this.asyncOnly) test.asyncOnly = true; - - try { - test.on('error', function(err){ - self.fail(test, err); - }); - test.run(fn); - } catch (err) { - fn(err); - } -}; - -/** - * Run tests in the given `suite` and invoke - * the callback `fn()` when complete. - * - * @param {Suite} suite - * @param {Function} fn - * @api private - */ - -Runner.prototype.runTests = function(suite, fn){ - var self = this - , tests = suite.tests.slice() - , test; - - - function hookErr(err, errSuite, after) { - // before/after Each hook for errSuite failed: - var orig = self.suite; - - // for failed 'after each' hook start from errSuite parent, - // otherwise start from errSuite itself - self.suite = after ? errSuite.parent : errSuite; - - if (self.suite) { - // call hookUp afterEach - self.hookUp('afterEach', function(err2, errSuite2) { - self.suite = orig; - // some hooks may fail even now - if (err2) return hookErr(err2, errSuite2, true); - // report error suite - fn(errSuite); - }); - } else { - // there is no need calling other 'after each' hooks - self.suite = orig; - fn(errSuite); - } - } - - function next(err, errSuite) { - // if we bail after first err - if (self.failures && suite._bail) return fn(); - - if (self._abort) return fn(); - - if (err) return hookErr(err, errSuite, true); - - // next test - test = tests.shift(); - - // all done - if (!test) return fn(); - - // grep - var match = self._grep.test(test.fullTitle()); - if (self._invert) match = !match; - if (!match) return next(); - - // pending - if (test.pending) { - self.emit('pending', test); - self.emit('test end', test); - return next(); - } - - // execute test and hook(s) - self.emit('test', self.test = test); - self.hookDown('beforeEach', function(err, errSuite){ - - if (err) return hookErr(err, errSuite, false); - - self.currentRunnable = self.test; - self.runTest(function(err){ - test = self.test; - - if (err) { - self.fail(test, err); - self.emit('test end', test); - return self.hookUp('afterEach', next); - } - - test.state = 'passed'; - self.emit('pass', test); - self.emit('test end', test); - self.hookUp('afterEach', next); - }); - }); - } - - this.next = next; - next(); -}; - -/** - * Run the given `suite` and invoke the - * callback `fn()` when complete. - * - * @param {Suite} suite - * @param {Function} fn - * @api private - */ - -Runner.prototype.runSuite = function(suite, fn){ - var total = this.grepTotal(suite) - , self = this - , i = 0; - - debug('run suite %s', suite.fullTitle()); - - if (!total) return fn(); - - this.emit('suite', this.suite = suite); - - function next(errSuite) { - if (errSuite) { - // current suite failed on a hook from errSuite - if (errSuite == suite) { - // if errSuite is current suite - // continue to the next sibling suite - return done(); - } else { - // errSuite is among the parents of current suite - // stop execution of errSuite and all sub-suites - return done(errSuite); - } - } - - if (self._abort) return done(); - - var curr = suite.suites[i++]; - if (!curr) return done(); - self.runSuite(curr, next); - } - - function done(errSuite) { - self.suite = suite; - self.hook('afterAll', function(){ - self.emit('suite end', suite); - fn(errSuite); - }); - } - - this.hook('beforeAll', function(err){ - if (err) return done(); - self.runTests(suite, next); - }); -}; - -/** - * Handle uncaught exceptions. - * - * @param {Error} err - * @api private - */ - -Runner.prototype.uncaught = function(err){ - debug('uncaught exception %s', err.message); - var runnable = this.currentRunnable; - if (!runnable || 'failed' == runnable.state) return; - runnable.clearTimeout(); - err.uncaught = true; - this.fail(runnable, err); - - // recover from test - if ('test' == runnable.type) { - this.emit('test end', runnable); - this.hookUp('afterEach', this.next); - return; - } - - // bail on hooks - this.emit('end'); -}; - -/** - * Run the root suite and invoke `fn(failures)` - * on completion. - * - * @param {Function} fn - * @return {Runner} for chaining - * @api public - */ - -Runner.prototype.run = function(fn){ - var self = this - , fn = fn || function(){}; - - function uncaught(err){ - self.uncaught(err); - } - - debug('start'); - - // callback - this.on('end', function(){ - debug('end'); - process.removeListener('uncaughtException', uncaught); - fn(self.failures); - }); - - // run suites - this.emit('start'); - this.runSuite(this.suite, function(){ - debug('finished running'); - self.emit('end'); - }); - - // uncaught exception - process.on('uncaughtException', uncaught); - - return this; -}; - -/** - * Cleanly abort execution - * - * @return {Runner} for chaining - * @api public - */ -Runner.prototype.abort = function(){ - debug('aborting'); - this._abort = true; -} - -/** - * Filter leaks with the given globals flagged as `ok`. - * - * @param {Array} ok - * @param {Array} globals - * @return {Array} - * @api private - */ - -function filterLeaks(ok, globals) { - return filter(globals, function(key){ - // Firefox and Chrome exposes iframes as index inside the window object - if (/^d+/.test(key)) return false; - - // in firefox - // if runner runs in an iframe, this iframe's window.getInterface method not init at first - // it is assigned in some seconds - if (global.navigator && /^getInterface/.test(key)) return false; - - // an iframe could be approached by window[iframeIndex] - // in ie6,7,8 and opera, iframeIndex is enumerable, this could cause leak - if (global.navigator && /^\d+/.test(key)) return false; - - // Opera and IE expose global variables for HTML element IDs (issue #243) - if (/^mocha-/.test(key)) return false; - - var matched = filter(ok, function(ok){ - if (~ok.indexOf('*')) return 0 == key.indexOf(ok.split('*')[0]); - return key == ok; - }); - return matched.length == 0 && (!global.navigator || 'onerror' !== key); - }); -} - -/** - * Array of globals dependent on the environment. - * - * @return {Array} - * @api private - */ - - function extraGlobals() { - if (typeof(process) === 'object' && - typeof(process.version) === 'string') { - - var nodeVersion = process.version.split('.').reduce(function(a, v) { - return a << 8 | v; - }); - - // 'errno' was renamed to process._errno in v0.9.11. - - if (nodeVersion < 0x00090B) { - return ['errno']; - } - } - - return []; - } - -}); // module: runner.js - -require.register("suite.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var EventEmitter = require('browser/events').EventEmitter - , debug = require('browser/debug')('mocha:suite') - , milliseconds = require('./ms') - , utils = require('./utils') - , Hook = require('./hook'); - -/** - * Expose `Suite`. - */ - -exports = module.exports = Suite; - -/** - * Create a new `Suite` with the given `title` - * and parent `Suite`. When a suite with the - * same title is already present, that suite - * is returned to provide nicer reporter - * and more flexible meta-testing. - * - * @param {Suite} parent - * @param {String} title - * @return {Suite} - * @api public - */ - -exports.create = function(parent, title){ - var suite = new Suite(title, parent.ctx); - suite.parent = parent; - if (parent.pending) suite.pending = true; - title = suite.fullTitle(); - parent.addSuite(suite); - return suite; -}; - -/** - * Initialize a new `Suite` with the given - * `title` and `ctx`. - * - * @param {String} title - * @param {Context} ctx - * @api private - */ - -function Suite(title, ctx) { - this.title = title; - this.ctx = ctx; - this.suites = []; - this.tests = []; - this.pending = false; - this._beforeEach = []; - this._beforeAll = []; - this._afterEach = []; - this._afterAll = []; - this.root = !title; - this._timeout = 2000; - this._slow = 75; - this._bail = false; -} - -/** - * Inherit from `EventEmitter.prototype`. - */ - -function F(){}; -F.prototype = EventEmitter.prototype; -Suite.prototype = new F; -Suite.prototype.constructor = Suite; - - -/** - * Return a clone of this `Suite`. - * - * @return {Suite} - * @api private - */ - -Suite.prototype.clone = function(){ - var suite = new Suite(this.title); - debug('clone'); - suite.ctx = this.ctx; - suite.timeout(this.timeout()); - suite.slow(this.slow()); - suite.bail(this.bail()); - return suite; -}; - -/** - * Set timeout `ms` or short-hand such as "2s". - * - * @param {Number|String} ms - * @return {Suite|Number} for chaining - * @api private - */ - -Suite.prototype.timeout = function(ms){ - if (0 == arguments.length) return this._timeout; - if ('string' == typeof ms) ms = milliseconds(ms); - debug('timeout %d', ms); - this._timeout = parseInt(ms, 10); - return this; -}; - -/** - * Set slow `ms` or short-hand such as "2s". - * - * @param {Number|String} ms - * @return {Suite|Number} for chaining - * @api private - */ - -Suite.prototype.slow = function(ms){ - if (0 === arguments.length) return this._slow; - if ('string' == typeof ms) ms = milliseconds(ms); - debug('slow %d', ms); - this._slow = ms; - return this; -}; - -/** - * Sets whether to bail after first error. - * - * @parma {Boolean} bail - * @return {Suite|Number} for chaining - * @api private - */ - -Suite.prototype.bail = function(bail){ - if (0 == arguments.length) return this._bail; - debug('bail %s', bail); - this._bail = bail; - return this; -}; - -/** - * Run `fn(test[, done])` before running tests. - * - * @param {Function} fn - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.beforeAll = function(fn){ - if (this.pending) return this; - var hook = new Hook('"before all" hook', fn); - hook.parent = this; - hook.timeout(this.timeout()); - hook.slow(this.slow()); - hook.ctx = this.ctx; - this._beforeAll.push(hook); - this.emit('beforeAll', hook); - return this; -}; - -/** - * Run `fn(test[, done])` after running tests. - * - * @param {Function} fn - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.afterAll = function(fn){ - if (this.pending) return this; - var hook = new Hook('"after all" hook', fn); - hook.parent = this; - hook.timeout(this.timeout()); - hook.slow(this.slow()); - hook.ctx = this.ctx; - this._afterAll.push(hook); - this.emit('afterAll', hook); - return this; -}; - -/** - * Run `fn(test[, done])` before each test case. - * - * @param {Function} fn - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.beforeEach = function(fn){ - if (this.pending) return this; - var hook = new Hook('"before each" hook', fn); - hook.parent = this; - hook.timeout(this.timeout()); - hook.slow(this.slow()); - hook.ctx = this.ctx; - this._beforeEach.push(hook); - this.emit('beforeEach', hook); - return this; -}; - -/** - * Run `fn(test[, done])` after each test case. - * - * @param {Function} fn - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.afterEach = function(fn){ - if (this.pending) return this; - var hook = new Hook('"after each" hook', fn); - hook.parent = this; - hook.timeout(this.timeout()); - hook.slow(this.slow()); - hook.ctx = this.ctx; - this._afterEach.push(hook); - this.emit('afterEach', hook); - return this; -}; - -/** - * Add a test `suite`. - * - * @param {Suite} suite - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.addSuite = function(suite){ - suite.parent = this; - suite.timeout(this.timeout()); - suite.slow(this.slow()); - suite.bail(this.bail()); - this.suites.push(suite); - this.emit('suite', suite); - return this; -}; - -/** - * Add a `test` to this suite. - * - * @param {Test} test - * @return {Suite} for chaining - * @api private - */ - -Suite.prototype.addTest = function(test){ - test.parent = this; - test.timeout(this.timeout()); - test.slow(this.slow()); - test.ctx = this.ctx; - this.tests.push(test); - this.emit('test', test); - return this; -}; - -/** - * Return the full title generated by recursively - * concatenating the parent's full title. - * - * @return {String} - * @api public - */ - -Suite.prototype.fullTitle = function(){ - if (this.parent) { - var full = this.parent.fullTitle(); - if (full) return full + ' ' + this.title; - } - return this.title; -}; - -/** - * Return the total number of tests. - * - * @return {Number} - * @api public - */ - -Suite.prototype.total = function(){ - return utils.reduce(this.suites, function(sum, suite){ - return sum + suite.total(); - }, 0) + this.tests.length; -}; - -/** - * Iterates through each suite recursively to find - * all tests. Applies a function in the format - * `fn(test)`. - * - * @param {Function} fn - * @return {Suite} - * @api private - */ - -Suite.prototype.eachTest = function(fn){ - utils.forEach(this.tests, fn); - utils.forEach(this.suites, function(suite){ - suite.eachTest(fn); - }); - return this; -}; - -}); // module: suite.js - -require.register("test.js", function(module, exports, require){ - -/** - * Module dependencies. - */ - -var Runnable = require('./runnable'); - -/** - * Expose `Test`. - */ - -module.exports = Test; - -/** - * Initialize a new `Test` with the given `title` and callback `fn`. - * - * @param {String} title - * @param {Function} fn - * @api private - */ - -function Test(title, fn) { - Runnable.call(this, title, fn); - this.pending = !fn; - this.type = 'test'; -} - -/** - * Inherit from `Runnable.prototype`. - */ - -function F(){}; -F.prototype = Runnable.prototype; -Test.prototype = new F; -Test.prototype.constructor = Test; - - -}); // module: test.js - -require.register("utils.js", function(module, exports, require){ -/** - * Module dependencies. - */ - -var fs = require('browser/fs') - , path = require('browser/path') - , join = path.join - , debug = require('browser/debug')('mocha:watch'); - -/** - * Ignored directories. - */ - -var ignore = ['node_modules', '.git']; - -/** - * Escape special characters in the given string of html. - * - * @param {String} html - * @return {String} - * @api private - */ - -exports.escape = function(html){ - return String(html) - .replace(/&/g, '&') - .replace(/"/g, '"') - .replace(//g, '>'); -}; - -/** - * Array#forEach (<=IE8) - * - * @param {Array} array - * @param {Function} fn - * @param {Object} scope - * @api private - */ - -exports.forEach = function(arr, fn, scope){ - for (var i = 0, l = arr.length; i < l; i++) - fn.call(scope, arr[i], i); -}; - -/** - * Array#map (<=IE8) - * - * @param {Array} array - * @param {Function} fn - * @param {Object} scope - * @api private - */ - -exports.map = function(arr, fn, scope){ - var result = []; - for (var i = 0, l = arr.length; i < l; i++) - result.push(fn.call(scope, arr[i], i)); - return result; -}; - -/** - * Array#indexOf (<=IE8) - * - * @parma {Array} arr - * @param {Object} obj to find index of - * @param {Number} start - * @api private - */ - -exports.indexOf = function(arr, obj, start){ - for (var i = start || 0, l = arr.length; i < l; i++) { - if (arr[i] === obj) - return i; - } - return -1; -}; - -/** - * Array#reduce (<=IE8) - * - * @param {Array} array - * @param {Function} fn - * @param {Object} initial value - * @api private - */ - -exports.reduce = function(arr, fn, val){ - var rval = val; - - for (var i = 0, l = arr.length; i < l; i++) { - rval = fn(rval, arr[i], i, arr); - } - - return rval; -}; - -/** - * Array#filter (<=IE8) - * - * @param {Array} array - * @param {Function} fn - * @api private - */ - -exports.filter = function(arr, fn){ - var ret = []; - - for (var i = 0, l = arr.length; i < l; i++) { - var val = arr[i]; - if (fn(val, i, arr)) ret.push(val); - } - - return ret; -}; - -/** - * Object.keys (<=IE8) - * - * @param {Object} obj - * @return {Array} keys - * @api private - */ - -exports.keys = Object.keys || function(obj) { - var keys = [] - , has = Object.prototype.hasOwnProperty // for `window` on <=IE8 - - for (var key in obj) { - if (has.call(obj, key)) { - keys.push(key); - } - } - - return keys; -}; - -/** - * Watch the given `files` for changes - * and invoke `fn(file)` on modification. - * - * @param {Array} files - * @param {Function} fn - * @api private - */ - -exports.watch = function(files, fn){ - var options = { interval: 100 }; - files.forEach(function(file){ - debug('file %s', file); - fs.watchFile(file, options, function(curr, prev){ - if (prev.mtime < curr.mtime) fn(file); - }); - }); -}; - -/** - * Ignored files. - */ - -function ignored(path){ - return !~ignore.indexOf(path); -} - -/** - * Lookup files in the given `dir`. - * - * @return {Array} - * @api private - */ - -exports.files = function(dir, ret){ - ret = ret || []; - - fs.readdirSync(dir) - .filter(ignored) - .forEach(function(path){ - path = join(dir, path); - if (fs.statSync(path).isDirectory()) { - exports.files(path, ret); - } else if (path.match(/\.(js|coffee|litcoffee|coffee.md)$/)) { - ret.push(path); - } - }); - - return ret; -}; - -/** - * Compute a slug from the given `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -exports.slug = function(str){ - return str - .toLowerCase() - .replace(/ +/g, '-') - .replace(/[^-\w]/g, ''); -}; - -/** - * Strip the function definition from `str`, - * and re-indent for pre whitespace. - */ - -exports.clean = function(str) { - str = str - .replace(/\r\n?|[\n\u2028\u2029]/g, "\n").replace(/^\uFEFF/, '') - .replace(/^function *\(.*\) *{/, '') - .replace(/\s+\}$/, ''); - - var spaces = str.match(/^\n?( *)/)[1].length - , tabs = str.match(/^\n?(\t*)/)[1].length - , re = new RegExp('^\n?' + (tabs ? '\t' : ' ') + '{' + (tabs ? tabs : spaces) + '}', 'gm'); - - str = str.replace(re, ''); - - return exports.trim(str); -}; - -/** - * Escape regular expression characters in `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -exports.escapeRegexp = function(str){ - return str.replace(/[-\\^$*+?.()|[\]{}]/g, "\\$&"); -}; - -/** - * Trim the given `str`. - * - * @param {String} str - * @return {String} - * @api private - */ - -exports.trim = function(str){ - return str.replace(/^\s+|\s+$/g, ''); -}; - -/** - * Parse the given `qs`. - * - * @param {String} qs - * @return {Object} - * @api private - */ - -exports.parseQuery = function(qs){ - return exports.reduce(qs.replace('?', '').split('&'), function(obj, pair){ - var i = pair.indexOf('=') - , key = pair.slice(0, i) - , val = pair.slice(++i); - - obj[key] = decodeURIComponent(val); - return obj; - }, {}); -}; - -/** - * Highlight the given string of `js`. - * - * @param {String} js - * @return {String} - * @api private - */ - -function highlight(js) { - return js - .replace(//g, '>') - .replace(/\/\/(.*)/gm, '//$1') - .replace(/('.*?')/gm, '$1') - .replace(/(\d+\.\d+)/gm, '$1') - .replace(/(\d+)/gm, '$1') - .replace(/\bnew *(\w+)/gm, 'new $1') - .replace(/\b(function|new|throw|return|var|if|else)\b/gm, '$1') -} - -/** - * Highlight the contents of tag `name`. - * - * @param {String} name - * @api private - */ - -exports.highlightTags = function(name) { - var code = document.getElementsByTagName(name); - for (var i = 0, len = code.length; i < len; ++i) { - code[i].innerHTML = highlight(code[i].innerHTML); - } -}; - -}); // module: utils.js -// The global object is "self" in Web Workers. -global = (function() { return this; })(); - -/** - * Save timer references to avoid Sinon interfering (see GH-237). - */ - -var Date = global.Date; -var setTimeout = global.setTimeout; -var setInterval = global.setInterval; -var clearTimeout = global.clearTimeout; -var clearInterval = global.clearInterval; - -/** - * Node shims. - * - * These are meant only to allow - * mocha.js to run untouched, not - * to allow running node code in - * the browser. - */ - -var process = {}; -process.exit = function(status){}; -process.stdout = {}; - -var uncaughtExceptionHandlers = []; - -/** - * Remove uncaughtException listener. - */ - -process.removeListener = function(e, fn){ - if ('uncaughtException' == e) { - global.onerror = function() {}; - var i = Mocha.utils.indexOf(uncaughtExceptionHandlers, fn); - if (i != -1) { uncaughtExceptionHandlers.splice(i, 1); } - } -}; - -/** - * Implements uncaughtException listener. - */ - -process.on = function(e, fn){ - if ('uncaughtException' == e) { - global.onerror = function(err, url, line){ - fn(new Error(err + ' (' + url + ':' + line + ')')); - return true; - }; - uncaughtExceptionHandlers.push(fn); - } -}; - -/** - * Expose mocha. - */ - -var Mocha = global.Mocha = require('mocha'), - mocha = global.mocha = new Mocha({ reporter: 'html' }); - -// The BDD UI is registered by default, but no UI will be functional in the -// browser without an explicit call to the overridden `mocha.ui` (see below). -// Ensure that this default UI does not expose its methods to the global scope. -mocha.suite.removeAllListeners('pre-require'); - -var immediateQueue = [] - , immediateTimeout; - -function timeslice() { - var immediateStart = new Date().getTime(); - while (immediateQueue.length && (new Date().getTime() - immediateStart) < 100) { - immediateQueue.shift()(); - } - if (immediateQueue.length) { - immediateTimeout = setTimeout(timeslice, 0); - } else { - immediateTimeout = null; - } -} - -/** - * High-performance override of Runner.immediately. - */ - -Mocha.Runner.immediately = function(callback) { - immediateQueue.push(callback); - if (!immediateTimeout) { - immediateTimeout = setTimeout(timeslice, 0); - } -}; - -/** - * Function to allow assertion libraries to throw errors directly into mocha. - * This is useful when running tests in a browser because window.onerror will - * only receive the 'message' attribute of the Error. - */ -mocha.throwError = function(err) { - Mocha.utils.forEach(uncaughtExceptionHandlers, function (fn) { - fn(err); - }); - throw err; -}; - -/** - * Override ui to ensure that the ui functions are initialized. - * Normally this would happen in Mocha.prototype.loadFiles. - */ - -mocha.ui = function(ui){ - Mocha.prototype.ui.call(this, ui); - this.suite.emit('pre-require', global, null, this); - return this; -}; - -/** - * Setup mocha with the given setting options. - */ - -mocha.setup = function(opts){ - if ('string' == typeof opts) opts = { ui: opts }; - for (var opt in opts) this[opt](opts[opt]); - return this; -}; - -/** - * Run mocha, returning the Runner. - */ - -mocha.run = function(fn){ - var options = mocha.options; - mocha.globals('location'); - - var query = Mocha.utils.parseQuery(global.location.search || ''); - if (query.grep) mocha.grep(query.grep); - if (query.invert) mocha.invert(); - - return Mocha.prototype.run.call(mocha, function(){ - // The DOM Document is not available in Web Workers. - if (global.document) { - Mocha.utils.highlightTags('code'); - } - if (fn) fn(); - }); -}; - -/** - * Expose the process shim. - */ - -Mocha.process = process; -})(); \ No newline at end of file diff --git a/node_modules/mocha/node_modules/.bin/jade b/node_modules/mocha/node_modules/.bin/jade deleted file mode 120000 index 2d08320..0000000 --- a/node_modules/mocha/node_modules/.bin/jade +++ /dev/null @@ -1 +0,0 @@ -../../../jade/bin/jade \ No newline at end of file diff --git a/node_modules/mocha/package.json b/node_modules/mocha/package.json deleted file mode 100644 index 2f5f07a..0000000 --- a/node_modules/mocha/package.json +++ /dev/null @@ -1,49 +0,0 @@ -{ - "name": "mocha", - "version": "1.17.1", - "description": "simple, flexible, fun test framework", - "keywords": [ - "mocha", - "test", - "bdd", - "tdd", - "tap" - ], - "author": "TJ Holowaychuk ", - "repository": { - "type": "git", - "url": "git://github.com/visionmedia/mocha.git" - }, - "main": "./index", - "bin": { - "mocha": "./bin/mocha", - "_mocha": "./bin/_mocha" - }, - "engines": { - "node": ">= 0.4.x" - }, - "scripts": { - "test": "make test-all" - }, - "dependencies": { - "commander": "2.0.0", - "growl": "1.7.x", - "jade": "0.26.3", - "diff": "1.0.7", - "debug": "*", - "mkdirp": "0.3.5", - "glob": "3.2.3" - }, - "devDependencies": { - "should": ">= 2.0.x", - "coffee-script": "1.2" - }, - "files": [ - "bin", - "images", - "lib", - "index.js", - "mocha.css", - "mocha.js" - ] -} diff --git a/node_modules/ms/index.js b/node_modules/ms/index.js deleted file mode 100644 index 6a522b1..0000000 --- a/node_modules/ms/index.js +++ /dev/null @@ -1,152 +0,0 @@ -/** - * Helpers. - */ - -var s = 1000; -var m = s * 60; -var h = m * 60; -var d = h * 24; -var y = d * 365.25; - -/** - * Parse or format the given `val`. - * - * Options: - * - * - `long` verbose formatting [false] - * - * @param {String|Number} val - * @param {Object} [options] - * @throws {Error} throw an error if val is not a non-empty string or a number - * @return {String|Number} - * @api public - */ - -module.exports = function(val, options) { - options = options || {}; - var type = typeof val; - if (type === 'string' && val.length > 0) { - return parse(val); - } else if (type === 'number' && isNaN(val) === false) { - return options.long ? fmtLong(val) : fmtShort(val); - } - throw new Error( - 'val is not a non-empty string or a valid number. val=' + - JSON.stringify(val) - ); -}; - -/** - * Parse the given `str` and return milliseconds. - * - * @param {String} str - * @return {Number} - * @api private - */ - -function parse(str) { - str = String(str); - if (str.length > 100) { - return; - } - var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( - str - ); - if (!match) { - return; - } - var n = parseFloat(match[1]); - var type = (match[2] || 'ms').toLowerCase(); - switch (type) { - case 'years': - case 'year': - case 'yrs': - case 'yr': - case 'y': - return n * y; - case 'days': - case 'day': - case 'd': - return n * d; - case 'hours': - case 'hour': - case 'hrs': - case 'hr': - case 'h': - return n * h; - case 'minutes': - case 'minute': - case 'mins': - case 'min': - case 'm': - return n * m; - case 'seconds': - case 'second': - case 'secs': - case 'sec': - case 's': - return n * s; - case 'milliseconds': - case 'millisecond': - case 'msecs': - case 'msec': - case 'ms': - return n; - default: - return undefined; - } -} - -/** - * Short format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function fmtShort(ms) { - if (ms >= d) { - return Math.round(ms / d) + 'd'; - } - if (ms >= h) { - return Math.round(ms / h) + 'h'; - } - if (ms >= m) { - return Math.round(ms / m) + 'm'; - } - if (ms >= s) { - return Math.round(ms / s) + 's'; - } - return ms + 'ms'; -} - -/** - * Long format for `ms`. - * - * @param {Number} ms - * @return {String} - * @api private - */ - -function fmtLong(ms) { - return plural(ms, d, 'day') || - plural(ms, h, 'hour') || - plural(ms, m, 'minute') || - plural(ms, s, 'second') || - ms + ' ms'; -} - -/** - * Pluralization helper. - */ - -function plural(ms, n, name) { - if (ms < n) { - return; - } - if (ms < n * 1.5) { - return Math.floor(ms / n) + ' ' + name; - } - return Math.ceil(ms / n) + ' ' + name + 's'; -} diff --git a/node_modules/ms/license.md b/node_modules/ms/license.md deleted file mode 100644 index 69b6125..0000000 --- a/node_modules/ms/license.md +++ /dev/null @@ -1,21 +0,0 @@ -The MIT License (MIT) - -Copyright (c) 2016 Zeit, Inc. - -Permission is hereby granted, free of charge, to any person obtaining a copy -of this software and associated documentation files (the "Software"), to deal -in the Software without restriction, including without limitation the rights -to use, copy, modify, merge, publish, distribute, sublicense, and/or sell -copies of the Software, and to permit persons to whom the Software is -furnished to do so, subject to the following conditions: - -The above copyright notice and this permission notice shall be included in all -copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR -IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, -FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE -AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, -OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE -SOFTWARE. diff --git a/node_modules/ms/package.json b/node_modules/ms/package.json deleted file mode 100644 index 6a31c81..0000000 --- a/node_modules/ms/package.json +++ /dev/null @@ -1,37 +0,0 @@ -{ - "name": "ms", - "version": "2.0.0", - "description": "Tiny milisecond conversion utility", - "repository": "zeit/ms", - "main": "./index", - "files": [ - "index.js" - ], - "scripts": { - "precommit": "lint-staged", - "lint": "eslint lib/* bin/*", - "test": "mocha tests.js" - }, - "eslintConfig": { - "extends": "eslint:recommended", - "env": { - "node": true, - "es6": true - } - }, - "lint-staged": { - "*.js": [ - "npm run lint", - "prettier --single-quote --write", - "git add" - ] - }, - "license": "MIT", - "devDependencies": { - "eslint": "3.19.0", - "expect.js": "0.3.1", - "husky": "0.13.3", - "lint-staged": "3.4.1", - "mocha": "3.4.1" - } -} diff --git a/node_modules/ms/readme.md b/node_modules/ms/readme.md deleted file mode 100644 index 84a9974..0000000 --- a/node_modules/ms/readme.md +++ /dev/null @@ -1,51 +0,0 @@ -# ms - -[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) -[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/) - -Use this package to easily convert various time formats to milliseconds. - -## Examples - -```js -ms('2 days') // 172800000 -ms('1d') // 86400000 -ms('10h') // 36000000 -ms('2.5 hrs') // 9000000 -ms('2h') // 7200000 -ms('1m') // 60000 -ms('5s') // 5000 -ms('1y') // 31557600000 -ms('100') // 100 -``` - -### Convert from milliseconds - -```js -ms(60000) // "1m" -ms(2 * 60000) // "2m" -ms(ms('10 hours')) // "10h" -``` - -### Time format written-out - -```js -ms(60000, { long: true }) // "1 minute" -ms(2 * 60000, { long: true }) // "2 minutes" -ms(ms('10 hours'), { long: true }) // "10 hours" -``` - -## Features - -- Works both in [node](https://nodejs.org) and in the browser. -- If a number is supplied to `ms`, a string with a unit is returned. -- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). -- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. - -## Caught a bug? - -1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device -2. Link the package to the global module directory: `npm link` -3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! - -As always, you can run the tests using: `npm test` diff --git a/node_modules/sigmund/LICENSE b/node_modules/sigmund/LICENSE deleted file mode 100644 index 19129e3..0000000 --- a/node_modules/sigmund/LICENSE +++ /dev/null @@ -1,15 +0,0 @@ -The ISC License - -Copyright (c) Isaac Z. Schlueter and Contributors - -Permission to use, copy, modify, and/or distribute this software for any -purpose with or without fee is hereby granted, provided that the above -copyright notice and this permission notice appear in all copies. - -THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES -WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF -MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR -ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES -WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN -ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR -IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/sigmund/README.md b/node_modules/sigmund/README.md deleted file mode 100644 index 25a38a5..0000000 --- a/node_modules/sigmund/README.md +++ /dev/null @@ -1,53 +0,0 @@ -# sigmund - -Quick and dirty signatures for Objects. - -This is like a much faster `deepEquals` comparison, which returns a -string key suitable for caches and the like. - -## Usage - -```javascript -function doSomething (someObj) { - var key = sigmund(someObj, maxDepth) // max depth defaults to 10 - var cached = cache.get(key) - if (cached) return cached - - var result = expensiveCalculation(someObj) - cache.set(key, result) - return result -} -``` - -The resulting key will be as unique and reproducible as calling -`JSON.stringify` or `util.inspect` on the object, but is much faster. -In order to achieve this speed, some differences are glossed over. -For example, the object `{0:'foo'}` will be treated identically to the -array `['foo']`. - -Also, just as there is no way to summon the soul from the scribblings -of a cocaine-addled psychoanalyst, there is no way to revive the object -from the signature string that sigmund gives you. In fact, it's -barely even readable. - -As with `util.inspect` and `JSON.stringify`, larger objects will -produce larger signature strings. - -Because sigmund is a bit less strict than the more thorough -alternatives, the strings will be shorter, and also there is a -slightly higher chance for collisions. For example, these objects -have the same signature: - - var obj1 = {a:'b',c:/def/,g:['h','i',{j:'',k:'l'}]} - var obj2 = {a:'b',c:'/def/',g:['h','i','{jkl']} - -Like a good Freudian, sigmund is most effective when you already have -some understanding of what you're looking for. It can help you help -yourself, but you must be willing to do some work as well. - -Cycles are handled, and cyclical objects are silently omitted (though -the key is included in the signature output.) - -The second argument is the maximum depth, which defaults to 10, -because that is the maximum object traversal depth covered by most -insurance carriers. diff --git a/node_modules/sigmund/bench.js b/node_modules/sigmund/bench.js deleted file mode 100644 index 5acfd6d..0000000 --- a/node_modules/sigmund/bench.js +++ /dev/null @@ -1,283 +0,0 @@ -// different ways to id objects -// use a req/res pair, since it's crazy deep and cyclical - -// sparseFE10 and sigmund are usually pretty close, which is to be expected, -// since they are essentially the same algorithm, except that sigmund handles -// regular expression objects properly. - - -var http = require('http') -var util = require('util') -var sigmund = require('./sigmund.js') -var sreq, sres, creq, cres, test - -http.createServer(function (q, s) { - sreq = q - sres = s - sres.end('ok') - this.close(function () { setTimeout(function () { - start() - }, 200) }) -}).listen(1337, function () { - creq = http.get({ port: 1337 }) - creq.on('response', function (s) { cres = s }) -}) - -function start () { - test = [sreq, sres, creq, cres] - // test = sreq - // sreq.sres = sres - // sreq.creq = creq - // sreq.cres = cres - - for (var i in exports.compare) { - console.log(i) - var hash = exports.compare[i]() - console.log(hash) - console.log(hash.length) - console.log('') - } - - require('bench').runMain() -} - -function customWs (obj, md, d) { - d = d || 0 - var to = typeof obj - if (to === 'undefined' || to === 'function' || to === null) return '' - if (d > md || !obj || to !== 'object') return ('' + obj).replace(/[\n ]+/g, '') - - if (Array.isArray(obj)) { - return obj.map(function (i, _, __) { - return customWs(i, md, d + 1) - }).reduce(function (a, b) { return a + b }, '') - } - - var keys = Object.keys(obj) - return keys.map(function (k, _, __) { - return k + ':' + customWs(obj[k], md, d + 1) - }).reduce(function (a, b) { return a + b }, '') -} - -function custom (obj, md, d) { - d = d || 0 - var to = typeof obj - if (to === 'undefined' || to === 'function' || to === null) return '' - if (d > md || !obj || to !== 'object') return '' + obj - - if (Array.isArray(obj)) { - return obj.map(function (i, _, __) { - return custom(i, md, d + 1) - }).reduce(function (a, b) { return a + b }, '') - } - - var keys = Object.keys(obj) - return keys.map(function (k, _, __) { - return k + ':' + custom(obj[k], md, d + 1) - }).reduce(function (a, b) { return a + b }, '') -} - -function sparseFE2 (obj, maxDepth) { - var seen = [] - var soFar = '' - function ch (v, depth) { - if (depth > maxDepth) return - if (typeof v === 'function' || typeof v === 'undefined') return - if (typeof v !== 'object' || !v) { - soFar += v - return - } - if (seen.indexOf(v) !== -1 || depth === maxDepth) return - seen.push(v) - soFar += '{' - Object.keys(v).forEach(function (k, _, __) { - // pseudo-private values. skip those. - if (k.charAt(0) === '_') return - var to = typeof v[k] - if (to === 'function' || to === 'undefined') return - soFar += k + ':' - ch(v[k], depth + 1) - }) - soFar += '}' - } - ch(obj, 0) - return soFar -} - -function sparseFE (obj, maxDepth) { - var seen = [] - var soFar = '' - function ch (v, depth) { - if (depth > maxDepth) return - if (typeof v === 'function' || typeof v === 'undefined') return - if (typeof v !== 'object' || !v) { - soFar += v - return - } - if (seen.indexOf(v) !== -1 || depth === maxDepth) return - seen.push(v) - soFar += '{' - Object.keys(v).forEach(function (k, _, __) { - // pseudo-private values. skip those. - if (k.charAt(0) === '_') return - var to = typeof v[k] - if (to === 'function' || to === 'undefined') return - soFar += k - ch(v[k], depth + 1) - }) - } - ch(obj, 0) - return soFar -} - -function sparse (obj, maxDepth) { - var seen = [] - var soFar = '' - function ch (v, depth) { - if (depth > maxDepth) return - if (typeof v === 'function' || typeof v === 'undefined') return - if (typeof v !== 'object' || !v) { - soFar += v - return - } - if (seen.indexOf(v) !== -1 || depth === maxDepth) return - seen.push(v) - soFar += '{' - for (var k in v) { - // pseudo-private values. skip those. - if (k.charAt(0) === '_') continue - var to = typeof v[k] - if (to === 'function' || to === 'undefined') continue - soFar += k - ch(v[k], depth + 1) - } - } - ch(obj, 0) - return soFar -} - -function noCommas (obj, maxDepth) { - var seen = [] - var soFar = '' - function ch (v, depth) { - if (depth > maxDepth) return - if (typeof v === 'function' || typeof v === 'undefined') return - if (typeof v !== 'object' || !v) { - soFar += v - return - } - if (seen.indexOf(v) !== -1 || depth === maxDepth) return - seen.push(v) - soFar += '{' - for (var k in v) { - // pseudo-private values. skip those. - if (k.charAt(0) === '_') continue - var to = typeof v[k] - if (to === 'function' || to === 'undefined') continue - soFar += k + ':' - ch(v[k], depth + 1) - } - soFar += '}' - } - ch(obj, 0) - return soFar -} - - -function flatten (obj, maxDepth) { - var seen = [] - var soFar = '' - function ch (v, depth) { - if (depth > maxDepth) return - if (typeof v === 'function' || typeof v === 'undefined') return - if (typeof v !== 'object' || !v) { - soFar += v - return - } - if (seen.indexOf(v) !== -1 || depth === maxDepth) return - seen.push(v) - soFar += '{' - for (var k in v) { - // pseudo-private values. skip those. - if (k.charAt(0) === '_') continue - var to = typeof v[k] - if (to === 'function' || to === 'undefined') continue - soFar += k + ':' - ch(v[k], depth + 1) - soFar += ',' - } - soFar += '}' - } - ch(obj, 0) - return soFar -} - -exports.compare = -{ - // 'custom 2': function () { - // return custom(test, 2, 0) - // }, - // 'customWs 2': function () { - // return customWs(test, 2, 0) - // }, - 'JSON.stringify (guarded)': function () { - var seen = [] - return JSON.stringify(test, function (k, v) { - if (typeof v !== 'object' || !v) return v - if (seen.indexOf(v) !== -1) return undefined - seen.push(v) - return v - }) - }, - - 'flatten 10': function () { - return flatten(test, 10) - }, - - // 'flattenFE 10': function () { - // return flattenFE(test, 10) - // }, - - 'noCommas 10': function () { - return noCommas(test, 10) - }, - - 'sparse 10': function () { - return sparse(test, 10) - }, - - 'sparseFE 10': function () { - return sparseFE(test, 10) - }, - - 'sparseFE2 10': function () { - return sparseFE2(test, 10) - }, - - sigmund: function() { - return sigmund(test, 10) - }, - - - // 'util.inspect 1': function () { - // return util.inspect(test, false, 1, false) - // }, - // 'util.inspect undefined': function () { - // util.inspect(test) - // }, - // 'util.inspect 2': function () { - // util.inspect(test, false, 2, false) - // }, - // 'util.inspect 3': function () { - // util.inspect(test, false, 3, false) - // }, - // 'util.inspect 4': function () { - // util.inspect(test, false, 4, false) - // }, - // 'util.inspect Infinity': function () { - // util.inspect(test, false, Infinity, false) - // } -} - -/** results -**/ diff --git a/node_modules/sigmund/package.json b/node_modules/sigmund/package.json deleted file mode 100644 index d69a8e2..0000000 --- a/node_modules/sigmund/package.json +++ /dev/null @@ -1,30 +0,0 @@ -{ - "name": "sigmund", - "version": "1.0.1", - "description": "Quick and dirty signatures for Objects.", - "main": "sigmund.js", - "directories": { - "test": "test" - }, - "dependencies": {}, - "devDependencies": { - "tap": "~0.3.0" - }, - "scripts": { - "test": "tap test/*.js", - "bench": "node bench.js" - }, - "repository": { - "type": "git", - "url": "git://github.com/isaacs/sigmund" - }, - "keywords": [ - "object", - "signature", - "key", - "data", - "psychoanalysis" - ], - "author": "Isaac Z. Schlueter (http://blog.izs.me/)", - "license": "ISC" -} diff --git a/node_modules/sigmund/sigmund.js b/node_modules/sigmund/sigmund.js deleted file mode 100644 index 82c7ab8..0000000 --- a/node_modules/sigmund/sigmund.js +++ /dev/null @@ -1,39 +0,0 @@ -module.exports = sigmund -function sigmund (subject, maxSessions) { - maxSessions = maxSessions || 10; - var notes = []; - var analysis = ''; - var RE = RegExp; - - function psychoAnalyze (subject, session) { - if (session > maxSessions) return; - - if (typeof subject === 'function' || - typeof subject === 'undefined') { - return; - } - - if (typeof subject !== 'object' || !subject || - (subject instanceof RE)) { - analysis += subject; - return; - } - - if (notes.indexOf(subject) !== -1 || session === maxSessions) return; - - notes.push(subject); - analysis += '{'; - Object.keys(subject).forEach(function (issue, _, __) { - // pseudo-private values. skip those. - if (issue.charAt(0) === '_') return; - var to = typeof subject[issue]; - if (to === 'function' || to === 'undefined') return; - analysis += issue; - psychoAnalyze(subject[issue], session + 1); - }); - } - psychoAnalyze(subject, 0); - return analysis; -} - -// vim: set softtabstop=4 shiftwidth=4: diff --git a/node_modules/sigmund/test/basic.js b/node_modules/sigmund/test/basic.js deleted file mode 100644 index 50c53a1..0000000 --- a/node_modules/sigmund/test/basic.js +++ /dev/null @@ -1,24 +0,0 @@ -var test = require('tap').test -var sigmund = require('../sigmund.js') - - -// occasionally there are duplicates -// that's an acceptable edge-case. JSON.stringify and util.inspect -// have some collision potential as well, though less, and collision -// detection is expensive. -var hash = '{abc/def/g{0h1i2{jkl' -var obj1 = {a:'b',c:/def/,g:['h','i',{j:'',k:'l'}]} -var obj2 = {a:'b',c:'/def/',g:['h','i','{jkl']} - -var obj3 = JSON.parse(JSON.stringify(obj1)) -obj3.c = /def/ -obj3.g[2].cycle = obj3 -var cycleHash = '{abc/def/g{0h1i2{jklcycle' - -test('basic', function (t) { - t.equal(sigmund(obj1), hash) - t.equal(sigmund(obj2), hash) - t.equal(sigmund(obj3), cycleHash) - t.end() -}) - From 9b8cc031ecbff14118fb3e9158361562c5af0758 Mon Sep 17 00:00:00 2001 From: Francisco Madeira Date: Wed, 20 Sep 2017 12:30:34 +0100 Subject: [PATCH 3/6] remove yarn.lock --- .gitignore | 0 yarn.lock | 101 ----------------------------------------------------- 2 files changed, 101 deletions(-) create mode 100644 .gitignore delete mode 100644 yarn.lock diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..e69de29 diff --git a/yarn.lock b/yarn.lock deleted file mode 100644 index f184724..0000000 --- a/yarn.lock +++ /dev/null @@ -1,101 +0,0 @@ -# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. -# yarn lockfile v1 - - -better-assert@~1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/better-assert/-/better-assert-1.0.2.tgz#40866b9e1b9e0b55b481894311e68faffaebc522" - dependencies: - callsite "1.0.0" - -callsite@1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/callsite/-/callsite-1.0.0.tgz#280398e5d664bd74038b6f0905153e6e8af1bc20" - -commander@0.6.1: - version "0.6.1" - resolved "https://registry.yarnpkg.com/commander/-/commander-0.6.1.tgz#fa68a14f6a945d54dbbe50d8cdb3320e9e3b1a06" - -commander@2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/commander/-/commander-2.0.0.tgz#d1b86f901f8b64bd941bdeadaf924530393be928" - -debug@*: - version "3.0.1" - resolved "https://registry.yarnpkg.com/debug/-/debug-3.0.1.tgz#0564c612b521dc92d9f2988f0549e34f9c98db64" - dependencies: - ms "2.0.0" - -diff@1.0.7: - version "1.0.7" - resolved "https://registry.yarnpkg.com/diff/-/diff-1.0.7.tgz#24bbb001c4a7d5522169e7cabdb2c2814ed91cf4" - -expect.js@^0.3.1: - version "0.3.1" - resolved "https://registry.yarnpkg.com/expect.js/-/expect.js-0.3.1.tgz#b0a59a0d2eff5437544ebf0ceaa6015841d09b5b" - -glob@3.2.3: - version "3.2.3" - resolved "https://registry.yarnpkg.com/glob/-/glob-3.2.3.tgz#e313eeb249c7affaa5c475286b0e115b59839467" - dependencies: - graceful-fs "~2.0.0" - inherits "2" - minimatch "~0.2.11" - -graceful-fs@~2.0.0: - version "2.0.3" - resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-2.0.3.tgz#7cd2cdb228a4a3f36e95efa6cc142de7d1a136d0" - -growl@1.7.x: - version "1.7.0" - resolved "https://registry.yarnpkg.com/growl/-/growl-1.7.0.tgz#de2d66136d002e112ba70f3f10c31cf7c350b2da" - -inherits@2: - version "2.0.3" - resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de" - -jade@0.26.3: - version "0.26.3" - resolved "https://registry.yarnpkg.com/jade/-/jade-0.26.3.tgz#8f10d7977d8d79f2f6ff862a81b0513ccb25686c" - dependencies: - commander "0.6.1" - mkdirp "0.3.0" - -lru-cache@2: - version "2.7.3" - resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-2.7.3.tgz#6d4524e8b955f95d4f5b58851ce21dd72fb4e952" - -minimatch@~0.2.11: - version "0.2.14" - resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-0.2.14.tgz#c74e780574f63c6f9a090e90efbe6ef53a6a756a" - dependencies: - lru-cache "2" - sigmund "~1.0.0" - -mkdirp@0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.0.tgz#1bbf5ab1ba827af23575143490426455f481fe1e" - -mkdirp@0.3.5: - version "0.3.5" - resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.5.tgz#de3e5f8961c88c787ee1368df849ac4413eca8d7" - -mocha@1.17.1: - version "1.17.1" - resolved "https://registry.yarnpkg.com/mocha/-/mocha-1.17.1.tgz#7f7671d68526d074b7bae660c9099f87e0ea1ccb" - dependencies: - commander "2.0.0" - debug "*" - diff "1.0.7" - glob "3.2.3" - growl "1.7.x" - jade "0.26.3" - mkdirp "0.3.5" - -ms@2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" - -sigmund@~1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/sigmund/-/sigmund-1.0.1.tgz#3ff21f198cad2175f9f3b781853fd94d0d19b590" From ba4312282aab280c6eb50d6d49a9c00e6f8d03c1 Mon Sep 17 00:00:00 2001 From: Francisco Madeira Date: Wed, 20 Sep 2017 12:30:51 +0100 Subject: [PATCH 4/6] add .gitignore --- .gitignore | 2 ++ 1 file changed, 2 insertions(+) diff --git a/.gitignore b/.gitignore index e69de29..23d67fc 100644 --- a/.gitignore +++ b/.gitignore @@ -0,0 +1,2 @@ +node_modules/ +yarn.lock From 09e850d58f47dbf983caaa200f85b010b036e1c2 Mon Sep 17 00:00:00 2001 From: Francisco Madeira Date: Wed, 20 Sep 2017 12:31:58 +0100 Subject: [PATCH 5/6] remove dependency and move it to dev dependencies --- package.json | 7 ++----- 1 file changed, 2 insertions(+), 5 deletions(-) diff --git a/package.json b/package.json index 1f3d7b9..07ed1e8 100644 --- a/package.json +++ b/package.json @@ -12,12 +12,9 @@ }, "devDependencies": { "better-assert": "~1.0.0", - "mocha": "1.17.1" + "mocha": "1.17.1", + "expect.js": "^0.3.1" }, "author": "Gal Koren", "license": "MIT", - "dependencies": { - "better-assert": "~1.0.0", - "expect.js": "^0.3.1" - } } From f33ac5a926ec6ce099a89f32a9c8b7f6dd6e31be Mon Sep 17 00:00:00 2001 From: Francisco Madeira Date: Wed, 20 Sep 2017 12:53:50 +0100 Subject: [PATCH 6/6] fix , --- package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/package.json b/package.json index 07ed1e8..67e9ef1 100644 --- a/package.json +++ b/package.json @@ -16,5 +16,5 @@ "expect.js": "^0.3.1" }, "author": "Gal Koren", - "license": "MIT", + "license": "MIT" }