notebooks/6_eda_NCI_dataset.ipynb

{
 "cells": [
  {
   "cell_type": "markdown",
   "metadata": {},
   "source": [
    "# NCI Open Database Compounds\n",
    "\n",
    "https://cactus.nci.nih.gov/download/nci/"
   ]
  },
  {
   "cell_type": "markdown",
   "metadata": {},
   "source": [
    "## Summary\n",
    "\n",
    "1. There are 98% NA values for experimantal logP\n",
    "\n",
    "2. There are 2534 unique molecules with experimental logP value\n",
    "\n",
    "3. There is no Temperature and pH columns"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 1,
   "metadata": {},
   "outputs": [],
   "source": [
    "from rdkit.Chem import PandasTools\n",
    "import pandas as pd\n",
    "import os\n",
    "from rdkit import RDConfig"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 4,
   "metadata": {},
   "outputs": [],
   "source": [
    "DATASET_PATH = '../data/raw'\n",
    "DATASET_FILENAME = 'NCIdb.sdf'"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 5,
   "metadata": {
    "scrolled": true
   },
   "outputs": [
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:50:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:00] Explicit valence for atom # 7 Sb, 9, is greater than permitted\n",
      "RDKit ERROR: [18:51:00] ERROR: Could not sanitize molecule ending on line 178060\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:00] ERROR: Explicit valence for atom # 7 Sb, 9, is greater than permitted\n",
      "RDKit ERROR: [18:51:01] Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:01] ERROR: Could not sanitize molecule ending on line 281736\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:01] ERROR: Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:01] Explicit valence for atom # 8 Al, 9, is greater than permitted\n",
      "RDKit ERROR: [18:51:01] ERROR: Could not sanitize molecule ending on line 316367\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:01] ERROR: Explicit valence for atom # 8 Al, 9, is greater than permitted\n",
      "RDKit ERROR: [18:51:01] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:01] ERROR: Could not sanitize molecule ending on line 335217\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:01] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:02] Explicit valence for atom # 2 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:02] ERROR: Could not sanitize molecule ending on line 445463\n",
      "RDKit ERROR: [18:51:02] ERROR: Explicit valence for atom # 2 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:02] Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:02] ERROR: Could not sanitize molecule ending on line 453746\n",
      "RDKit ERROR: [18:51:02] ERROR: Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:02] Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:02] ERROR: Could not sanitize molecule ending on line 453843\n",
      "RDKit ERROR: [18:51:02] ERROR: Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:02] Explicit valence for atom # 4 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:02] ERROR: Could not sanitize molecule ending on line 454280\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:02] ERROR: Explicit valence for atom # 4 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] Explicit valence for atom # 6 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] ERROR: Could not sanitize molecule ending on line 511387\n",
      "RDKit ERROR: [18:51:03] ERROR: Explicit valence for atom # 6 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] ERROR: Could not sanitize molecule ending on line 514436\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:03] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] ERROR: Could not sanitize molecule ending on line 520196\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:03] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] Explicit valence for atom # 0 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] ERROR: Could not sanitize molecule ending on line 573269\n",
      "RDKit ERROR: [18:51:03] ERROR: Explicit valence for atom # 0 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] Explicit valence for atom # 0 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] ERROR: Could not sanitize molecule ending on line 587209\n",
      "RDKit ERROR: [18:51:03] ERROR: Explicit valence for atom # 0 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] Explicit valence for atom # 0 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:03] ERROR: Could not sanitize molecule ending on line 587286\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:03] ERROR: Explicit valence for atom # 0 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:05] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:05] ERROR: Could not sanitize molecule ending on line 774656\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:05] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:08] Explicit valence for atom # 17 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:08] ERROR: Could not sanitize molecule ending on line 1192738\n",
      "RDKit ERROR: [18:51:08] ERROR: Explicit valence for atom # 17 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:08] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:08] ERROR: Could not sanitize molecule ending on line 1192945\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:08] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1386301\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1386385\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1386476\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1386567\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1386654\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1386815\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1386904\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1386999\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387083\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387180\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387277\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387363\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387456\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387546\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387640\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387738\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387828\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1387921\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1388011\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1388114\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1388210\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1388309\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1388407\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1388515\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1388620\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:10] ERROR: Could not sanitize molecule ending on line 1388725\n",
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:10] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:11] Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:11] ERROR: Could not sanitize molecule ending on line 1526860\n",
      "RDKit ERROR: [18:51:11] ERROR: Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:11] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:11] ERROR: Could not sanitize molecule ending on line 1544275\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:11] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:11] Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:11] ERROR: Could not sanitize molecule ending on line 1544645\n",
      "RDKit ERROR: [18:51:11] ERROR: Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:11] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:11] ERROR: Could not sanitize molecule ending on line 1546086\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:11] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:12] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:12] ERROR: Could not sanitize molecule ending on line 1647348\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:12] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:13] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:13] ERROR: Could not sanitize molecule ending on line 1798183\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:13] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:18] Explicit valence for atom # 7 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:18] ERROR: Could not sanitize molecule ending on line 2404286\n",
      "RDKit WARNING: [18:51:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:18] ERROR: Explicit valence for atom # 7 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:19] Explicit valence for atom # 13 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:19] ERROR: Could not sanitize molecule ending on line 2453764\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:19] ERROR: Explicit valence for atom # 13 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:19] Explicit valence for atom # 1 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:19] ERROR: Could not sanitize molecule ending on line 2522493\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:19] ERROR: Explicit valence for atom # 1 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:20] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:20] ERROR: Could not sanitize molecule ending on line 2571355\n",
      "RDKit WARNING: [18:51:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:20] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:21] Explicit valence for atom # 13 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:21] ERROR: Could not sanitize molecule ending on line 2742392\n",
      "RDKit WARNING: [18:51:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:21] ERROR: Explicit valence for atom # 13 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:24] Explicit valence for atom # 4 Ca, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:24] ERROR: Could not sanitize molecule ending on line 3143617\n",
      "RDKit WARNING: [18:51:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:25] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:25] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:25] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:25] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:25] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:25] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:24] ERROR: Explicit valence for atom # 4 Ca, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:28] Explicit valence for atom # 1 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:28] ERROR: Could not sanitize molecule ending on line 3580491\n",
      "RDKit WARNING: [18:51:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:28] ERROR: Explicit valence for atom # 1 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:28] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:28] ERROR: Could not sanitize molecule ending on line 3645744\n",
      "RDKit WARNING: [18:51:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:28] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:30] Explicit valence for atom # 0 Cl, 9, is greater than permitted\n",
      "RDKit ERROR: [18:51:30] ERROR: Could not sanitize molecule ending on line 3840967\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:30] ERROR: Explicit valence for atom # 0 Cl, 9, is greater than permitted\n",
      "RDKit ERROR: [18:51:30] Explicit valence for atom # 4 Cl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:51:30] ERROR: Could not sanitize molecule ending on line 3841374\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:30] ERROR: Explicit valence for atom # 4 Cl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:51:31] Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:31] ERROR: Could not sanitize molecule ending on line 4001820\n",
      "RDKit ERROR: [18:51:31] ERROR: Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:31] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:31] ERROR: Could not sanitize molecule ending on line 4002219\n",
      "RDKit ERROR: [18:51:31] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:31] Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:31] ERROR: Could not sanitize molecule ending on line 4003377\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:31] ERROR: Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:35] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:35] ERROR: Could not sanitize molecule ending on line 4482506\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:35] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:37] Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:37] ERROR: Could not sanitize molecule ending on line 4701130\n",
      "RDKit ERROR: [18:51:37] ERROR: Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:37] Explicit valence for atom # 4 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:37] ERROR: Could not sanitize molecule ending on line 4701355\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:37] ERROR: Explicit valence for atom # 4 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:38] Explicit valence for atom # 1 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:38] ERROR: Could not sanitize molecule ending on line 4822941\n",
      "RDKit ERROR: [18:51:38] ERROR: Explicit valence for atom # 1 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:38] Explicit valence for atom # 6 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:38] ERROR: Could not sanitize molecule ending on line 4823050\n",
      "RDKit ERROR: [18:51:38] ERROR: Explicit valence for atom # 6 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:38] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:38] ERROR: Could not sanitize molecule ending on line 4825572\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:38] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:38] Explicit valence for atom # 0 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:38] ERROR: Could not sanitize molecule ending on line 4839572\n",
      "RDKit ERROR: [18:51:38] ERROR: Explicit valence for atom # 0 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:38] Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:38] ERROR: Could not sanitize molecule ending on line 4841963\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:38] ERROR: Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:51:39] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] ERROR: Could not sanitize molecule ending on line 4881379\n",
      "RDKit ERROR: [18:51:39] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] ERROR: Could not sanitize molecule ending on line 4881595\n",
      "RDKit ERROR: [18:51:39] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] ERROR: Could not sanitize molecule ending on line 4881905\n",
      "RDKit ERROR: [18:51:39] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] Explicit valence for atom # 1 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] ERROR: Could not sanitize molecule ending on line 4885903\n",
      "RDKit ERROR: [18:51:39] ERROR: Explicit valence for atom # 1 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] Explicit valence for atom # 6 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] ERROR: Could not sanitize molecule ending on line 4914209\n",
      "RDKit ERROR: [18:51:39] ERROR: Explicit valence for atom # 6 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] Explicit valence for atom # 8 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:39] ERROR: Could not sanitize molecule ending on line 4914358\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:39] ERROR: Explicit valence for atom # 8 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:40] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:40] ERROR: Could not sanitize molecule ending on line 5100492\n",
      "RDKit WARNING: [18:51:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:40] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5169608\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5169673\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 7 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5169830\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 7 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 18 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5169977\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 18 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 8 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5170055\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 8 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 11 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5170145\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 11 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5170466\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5170600\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5170732\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5170795\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 8 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5170943\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 8 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 14 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5183536\n",
      "RDKit WARNING: [18:51:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 14 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] Explicit valence for atom # 15 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:41] ERROR: Could not sanitize molecule ending on line 5225749\n",
      "RDKit WARNING: [18:51:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:41] ERROR: Explicit valence for atom # 15 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:42] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:42] ERROR: Could not sanitize molecule ending on line 5274291\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:42] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] ERROR: Could not sanitize molecule ending on line 5384787\n",
      "RDKit ERROR: [18:51:43] ERROR: Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] Explicit valence for atom # 7 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] ERROR: Could not sanitize molecule ending on line 5392658\n",
      "RDKit ERROR: [18:51:43] ERROR: Explicit valence for atom # 7 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] Explicit valence for atom # 7 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] ERROR: Could not sanitize molecule ending on line 5392897\n",
      "RDKit ERROR: [18:51:43] ERROR: Explicit valence for atom # 7 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] Explicit valence for atom # 6 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] ERROR: Could not sanitize molecule ending on line 5393736\n",
      "RDKit ERROR: [18:51:43] ERROR: Explicit valence for atom # 6 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] Explicit valence for atom # 6 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] ERROR: Could not sanitize molecule ending on line 5395117\n",
      "RDKit ERROR: [18:51:43] ERROR: Explicit valence for atom # 6 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] Explicit valence for atom # 7 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] ERROR: Could not sanitize molecule ending on line 5395175\n",
      "RDKit WARNING: [18:51:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:43] ERROR: Explicit valence for atom # 7 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] Explicit valence for atom # 20 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:43] ERROR: Could not sanitize molecule ending on line 5427357\n",
      "RDKit WARNING: [18:51:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:43] ERROR: Explicit valence for atom # 20 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] ERROR: Could not sanitize molecule ending on line 5510508\n",
      "RDKit ERROR: [18:51:44] ERROR: Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] ERROR: Could not sanitize molecule ending on line 5510604\n",
      "RDKit ERROR: [18:51:44] ERROR: Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] Explicit valence for atom # 9 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] ERROR: Could not sanitize molecule ending on line 5510712\n",
      "RDKit ERROR: [18:51:44] ERROR: Explicit valence for atom # 9 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] Explicit valence for atom # 10 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] ERROR: Could not sanitize molecule ending on line 5510824\n",
      "RDKit ERROR: [18:51:44] ERROR: Explicit valence for atom # 10 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] Explicit valence for atom # 9 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] ERROR: Could not sanitize molecule ending on line 5510920\n",
      "RDKit ERROR: [18:51:44] ERROR: Explicit valence for atom # 9 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] ERROR: Could not sanitize molecule ending on line 5511008\n",
      "RDKit WARNING: [18:51:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:44] ERROR: Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:44] ERROR: Could not sanitize molecule ending on line 5553851\n",
      "RDKit WARNING: [18:51:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:44] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:45] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:45] ERROR: Could not sanitize molecule ending on line 5671356\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:45] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:46] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:46] ERROR: Could not sanitize molecule ending on line 5729388\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:46] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:46] Explicit valence for atom # 38 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:46] ERROR: Could not sanitize molecule ending on line 5740376\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:46] ERROR: Explicit valence for atom # 38 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:47] Explicit valence for atom # 3 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:47] ERROR: Could not sanitize molecule ending on line 5876723\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:47] ERROR: Explicit valence for atom # 3 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:48] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:48] ERROR: Could not sanitize molecule ending on line 5977819\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:48] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:50] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:50] ERROR: Could not sanitize molecule ending on line 6286020\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:50] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] ERROR: Could not sanitize molecule ending on line 6347717\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:51] ERROR: Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] ERROR: Could not sanitize molecule ending on line 6448580\n",
      "RDKit ERROR: [18:51:51] ERROR: Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] ERROR: Could not sanitize molecule ending on line 6448652\n",
      "RDKit ERROR: [18:51:51] ERROR: Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] Explicit valence for atom # 8 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] ERROR: Could not sanitize molecule ending on line 6448731\n",
      "RDKit ERROR: [18:51:51] ERROR: Explicit valence for atom # 8 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] Explicit valence for atom # 11 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] ERROR: Could not sanitize molecule ending on line 6449240\n",
      "RDKit ERROR: [18:51:51] ERROR: Explicit valence for atom # 11 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] Explicit valence for atom # 10 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:51] ERROR: Could not sanitize molecule ending on line 6449775\n",
      "RDKit WARNING: [18:51:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:51] ERROR: Explicit valence for atom # 10 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:52] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:52] ERROR: Could not sanitize molecule ending on line 6493738\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:52] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] Explicit valence for atom # 4 Ba, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] ERROR: Could not sanitize molecule ending on line 6583592\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:53] ERROR: Explicit valence for atom # 4 Ba, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] ERROR: Could not sanitize molecule ending on line 6598367\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:53] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] ERROR: Could not sanitize molecule ending on line 6619360\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:53] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] ERROR: Could not sanitize molecule ending on line 6651630\n",
      "RDKit ERROR: [18:51:53] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] ERROR: Could not sanitize molecule ending on line 6651749\n",
      "RDKit ERROR: [18:51:53] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] ERROR: Could not sanitize molecule ending on line 6651868\n",
      "RDKit ERROR: [18:51:53] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] ERROR: Could not sanitize molecule ending on line 6651971\n",
      "RDKit ERROR: [18:51:53] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] ERROR: Could not sanitize molecule ending on line 6652061\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:53] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] Explicit valence for atom # 4 Sn, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:53] ERROR: Could not sanitize molecule ending on line 6668575\n",
      "RDKit WARNING: [18:51:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:53] ERROR: Explicit valence for atom # 4 Sn, 8, is greater than permitted\n",
      "RDKit ERROR: [18:51:54] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:54] ERROR: Could not sanitize molecule ending on line 6763096\n",
      "RDKit WARNING: [18:51:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:54] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:56] Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:56] ERROR: Could not sanitize molecule ending on line 6988647\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:56] ERROR: Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:51:58] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:58] ERROR: Could not sanitize molecule ending on line 7224649\n",
      "RDKit ERROR: [18:51:58] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:58] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:51:58] ERROR: Could not sanitize molecule ending on line 7224787\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:51:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:51:58] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:00] Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:00] ERROR: Could not sanitize molecule ending on line 7399823\n",
      "RDKit WARNING: [18:52:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:00] ERROR: Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:04] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:04] ERROR: Could not sanitize molecule ending on line 7786097\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:04] Conflicting single bond directions around double bond at index 6.\n",
      "RDKit WARNING: [18:52:04]   BondStereo set to STEREONONE and single bond directions set to NONE.\n",
      "RDKit WARNING: [18:52:04] Conflicting single bond directions around double bond at index 4.\n",
      "RDKit WARNING: [18:52:04]   BondStereo set to STEREONONE and single bond directions set to NONE.\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:04] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:04] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:04] ERROR: Could not sanitize molecule ending on line 7861924\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:04] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] Explicit valence for atom # 0 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] ERROR: Could not sanitize molecule ending on line 7897877\n",
      "RDKit ERROR: [18:52:05] ERROR: Explicit valence for atom # 0 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] Explicit valence for atom # 0 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] ERROR: Could not sanitize molecule ending on line 7897923\n",
      "RDKit WARNING: [18:52:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:52:05] ERROR: Explicit valence for atom # 0 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] Explicit valence for atom # 11 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] ERROR: Could not sanitize molecule ending on line 7912916\n",
      "RDKit WARNING: [18:52:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:05] ERROR: Explicit valence for atom # 11 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] Explicit valence for atom # 3 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] ERROR: Could not sanitize molecule ending on line 7956328\n",
      "RDKit ERROR: [18:52:05] ERROR: Explicit valence for atom # 3 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] Explicit valence for atom # 3 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:05] ERROR: Could not sanitize molecule ending on line 7956407\n",
      "RDKit WARNING: [18:52:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:05] ERROR: Explicit valence for atom # 3 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:06] Explicit valence for atom # 0 B greater than permitted\n",
      "RDKit ERROR: [18:52:06] ERROR: Could not sanitize molecule ending on line 8127371\n",
      "RDKit ERROR: [18:52:06] ERROR: Explicit valence for atom # 0 B greater than permitted\n",
      "RDKit ERROR: [18:52:06] Explicit valence for atom # 0 B greater than permitted\n",
      "RDKit ERROR: [18:52:06] ERROR: Could not sanitize molecule ending on line 8127588\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:06] ERROR: Explicit valence for atom # 0 B greater than permitted\n",
      "RDKit ERROR: [18:52:07] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] ERROR: Could not sanitize molecule ending on line 8168840\n",
      "RDKit ERROR: [18:52:07] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] ERROR: Could not sanitize molecule ending on line 8175704\n",
      "RDKit ERROR: [18:52:07] ERROR: Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] ERROR: Could not sanitize molecule ending on line 8176435\n",
      "RDKit ERROR: [18:52:07] ERROR: Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] ERROR: Could not sanitize molecule ending on line 8176589\n",
      "RDKit WARNING: [18:52:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:07] ERROR: Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] ERROR: Could not sanitize molecule ending on line 8186013\n",
      "RDKit WARNING: [18:52:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:07] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] Explicit valence for atom # 18 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:07] ERROR: Could not sanitize molecule ending on line 8236821\n",
      "RDKit WARNING: [18:52:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:07] ERROR: Explicit valence for atom # 18 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8311859\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8311938\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8312031\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8312121\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8312203\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8312385\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8312463\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8312556\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 2 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8312645\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 2 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8339613\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8339706\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8339799\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8340084\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8340177\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8340276\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:08] ERROR: Could not sanitize molecule ending on line 8340375\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:52:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:08] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] ERROR: Could not sanitize molecule ending on line 8401876\n",
      "RDKit ERROR: [18:52:09] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] ERROR: Could not sanitize molecule ending on line 8401945\n",
      "RDKit ERROR: [18:52:09] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] ERROR: Could not sanitize molecule ending on line 8402014\n",
      "RDKit ERROR: [18:52:09] ERROR: Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] ERROR: Could not sanitize molecule ending on line 8402079\n",
      "RDKit ERROR: [18:52:09] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] ERROR: Could not sanitize molecule ending on line 8402148\n",
      "RDKit WARNING: [18:52:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:09] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] ERROR: Could not sanitize molecule ending on line 8457281\n",
      "RDKit ERROR: [18:52:09] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:09] ERROR: Could not sanitize molecule ending on line 8475763\n",
      "RDKit WARNING: [18:52:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:09] ERROR: Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] ERROR: Could not sanitize molecule ending on line 8631168\n",
      "RDKit ERROR: [18:52:11] ERROR: Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] ERROR: Could not sanitize molecule ending on line 8631239\n",
      "RDKit ERROR: [18:52:11] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] ERROR: Could not sanitize molecule ending on line 8631316\n",
      "RDKit ERROR: [18:52:11] ERROR: Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] ERROR: Could not sanitize molecule ending on line 8642046\n",
      "RDKit WARNING: [18:52:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:11] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] ERROR: Could not sanitize molecule ending on line 8701990\n",
      "RDKit WARNING: [18:52:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:11] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] Explicit valence for atom # 17 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:11] ERROR: Could not sanitize molecule ending on line 8707111\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:11] ERROR: Explicit valence for atom # 17 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:13] Explicit valence for atom # 0 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:13] ERROR: Could not sanitize molecule ending on line 8877280\n",
      "RDKit WARNING: [18:52:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:13] ERROR: Explicit valence for atom # 0 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] Explicit valence for atom # 34 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] ERROR: Could not sanitize molecule ending on line 9033482\n",
      "RDKit ERROR: [18:52:14] ERROR: Explicit valence for atom # 34 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] Explicit valence for atom # 18 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] ERROR: Could not sanitize molecule ending on line 9033703\n",
      "RDKit ERROR: [18:52:14] ERROR: Explicit valence for atom # 18 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] Explicit valence for atom # 12 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] ERROR: Could not sanitize molecule ending on line 9033910\n",
      "RDKit ERROR: [18:52:14] ERROR: Explicit valence for atom # 12 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] Explicit valence for atom # 18 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] ERROR: Could not sanitize molecule ending on line 9034103\n",
      "RDKit ERROR: [18:52:14] ERROR: Explicit valence for atom # 18 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] Explicit valence for atom # 34 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] ERROR: Could not sanitize molecule ending on line 9034285\n",
      "RDKit WARNING: [18:52:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:52:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:14] ERROR: Explicit valence for atom # 34 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:14] ERROR: Could not sanitize molecule ending on line 9040694\n",
      "RDKit WARNING: [18:52:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:14] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:15] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:15] ERROR: Could not sanitize molecule ending on line 9195132\n",
      "RDKit ERROR: [18:52:15] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:15] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:15] ERROR: Could not sanitize molecule ending on line 9199283\n",
      "RDKit WARNING: [18:52:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:15] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:17] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:17] ERROR: Could not sanitize molecule ending on line 9339933\n",
      "RDKit ERROR: [18:52:17] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:17] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:17] ERROR: Could not sanitize molecule ending on line 9340120\n",
      "RDKit WARNING: [18:52:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:17] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] ERROR: Could not sanitize molecule ending on line 9531551\n",
      "RDKit ERROR: [18:52:18] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] Explicit valence for atom # 7 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] ERROR: Could not sanitize molecule ending on line 9531738\n",
      "RDKit ERROR: [18:52:18] ERROR: Explicit valence for atom # 7 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] Explicit valence for atom # 7 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] ERROR: Could not sanitize molecule ending on line 9531834\n",
      "RDKit ERROR: [18:52:18] ERROR: Explicit valence for atom # 7 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] Explicit valence for atom # 7 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] ERROR: Could not sanitize molecule ending on line 9532032\n",
      "RDKit ERROR: [18:52:18] ERROR: Explicit valence for atom # 7 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] Explicit valence for atom # 7 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:18] ERROR: Could not sanitize molecule ending on line 9532131\n",
      "RDKit ERROR: [18:52:18] ERROR: Explicit valence for atom # 7 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] ERROR: Could not sanitize molecule ending on line 9567489\n",
      "RDKit ERROR: [18:52:19] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] ERROR: Could not sanitize molecule ending on line 9567720\n",
      "RDKit ERROR: [18:52:19] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] ERROR: Could not sanitize molecule ending on line 9567838\n",
      "RDKit ERROR: [18:52:19] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] ERROR: Could not sanitize molecule ending on line 9567915\n",
      "RDKit ERROR: [18:52:19] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] ERROR: Could not sanitize molecule ending on line 9568006\n",
      "RDKit ERROR: [18:52:19] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] ERROR: Could not sanitize molecule ending on line 9568120\n",
      "RDKit ERROR: [18:52:19] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] ERROR: Could not sanitize molecule ending on line 9570422\n",
      "RDKit WARNING: [18:52:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:52:19] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] Explicit valence for atom # 11 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:19] ERROR: Could not sanitize molecule ending on line 9618228\n",
      "RDKit ERROR: [18:52:19] ERROR: Explicit valence for atom # 11 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:20] Explicit valence for atom # 7 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:20] ERROR: Could not sanitize molecule ending on line 9689151\n",
      "RDKit WARNING: [18:52:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:20] ERROR: Explicit valence for atom # 7 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:20] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:20] ERROR: Could not sanitize molecule ending on line 9690786\n",
      "RDKit ERROR: [18:52:20] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9791606\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9855990\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9857614\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9857856\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9857986\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 12 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9858128\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 12 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9858442\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 0 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9859199\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 0 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9859671\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9860797\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9860993\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9861090\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:21] ERROR: Could not sanitize molecule ending on line 9861341\n",
      "RDKit ERROR: [18:52:21] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:22] Explicit valence for atom # 11 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:22] ERROR: Could not sanitize molecule ending on line 9980845\n",
      "RDKit ERROR: [18:52:22] ERROR: Explicit valence for atom # 11 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:22] Explicit valence for atom # 8 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:22] ERROR: Could not sanitize molecule ending on line 9994169\n",
      "RDKit WARNING: [18:52:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:22] ERROR: Explicit valence for atom # 8 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:23] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:23] ERROR: Could not sanitize molecule ending on line 10134746\n",
      "RDKit ERROR: [18:52:23] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] ERROR: Could not sanitize molecule ending on line 10159621\n",
      "RDKit ERROR: [18:52:24] ERROR: Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] ERROR: Could not sanitize molecule ending on line 10159760\n",
      "RDKit ERROR: [18:52:24] ERROR: Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] ERROR: Could not sanitize molecule ending on line 10195429\n",
      "RDKit ERROR: [18:52:24] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] ERROR: Could not sanitize molecule ending on line 10195553\n",
      "RDKit ERROR: [18:52:24] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] ERROR: Could not sanitize molecule ending on line 10195677\n",
      "RDKit ERROR: [18:52:24] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] ERROR: Could not sanitize molecule ending on line 10195825\n",
      "RDKit ERROR: [18:52:24] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:24] ERROR: Could not sanitize molecule ending on line 10195973\n",
      "RDKit ERROR: [18:52:24] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:25] Explicit valence for atom # 9 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:25] ERROR: Could not sanitize molecule ending on line 10386514\n",
      "RDKit ERROR: [18:52:25] ERROR: Explicit valence for atom # 9 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:25] Explicit valence for atom # 8 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:25] ERROR: Could not sanitize molecule ending on line 10386674\n",
      "RDKit ERROR: [18:52:25] ERROR: Explicit valence for atom # 8 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:26] Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:26] ERROR: Could not sanitize molecule ending on line 10421584\n",
      "RDKit WARNING: [18:52:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:26] ERROR: Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:27] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:27] ERROR: Could not sanitize molecule ending on line 10620401\n",
      "RDKit ERROR: [18:52:27] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:27] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:27] ERROR: Could not sanitize molecule ending on line 10620481\n",
      "RDKit ERROR: [18:52:27] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:27] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:27] ERROR: Could not sanitize molecule ending on line 10620565\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:52:27] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] ERROR: Could not sanitize molecule ending on line 10652704\n",
      "RDKit ERROR: [18:52:28] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] ERROR: Could not sanitize molecule ending on line 10652807\n",
      "RDKit ERROR: [18:52:28] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] ERROR: Could not sanitize molecule ending on line 10652902\n",
      "RDKit ERROR: [18:52:28] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] ERROR: Could not sanitize molecule ending on line 10652997\n",
      "RDKit ERROR: [18:52:28] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:28] ERROR: Could not sanitize molecule ending on line 10662750\n",
      "RDKit ERROR: [18:52:28] ERROR: Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:29] Explicit valence for atom # 0 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:29] ERROR: Could not sanitize molecule ending on line 10810518\n",
      "RDKit WARNING: [18:52:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:29] ERROR: Explicit valence for atom # 0 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:29] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:29] ERROR: Could not sanitize molecule ending on line 10862026\n",
      "RDKit WARNING: [18:52:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:29] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:30] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:30] ERROR: Could not sanitize molecule ending on line 10944575\n",
      "RDKit WARNING: [18:52:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:30] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:30] Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:30] ERROR: Could not sanitize molecule ending on line 10976054\n",
      "RDKit ERROR: [18:52:30] ERROR: Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:30] Explicit valence for atom # 16 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:30] ERROR: Could not sanitize molecule ending on line 10976175\n",
      "RDKit ERROR: [18:52:30] ERROR: Explicit valence for atom # 16 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:30] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:30] ERROR: Could not sanitize molecule ending on line 10982134\n",
      "RDKit WARNING: [18:52:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:30] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:31] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:31] ERROR: Could not sanitize molecule ending on line 11030542\n",
      "RDKit ERROR: [18:52:31] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:31] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:31] ERROR: Could not sanitize molecule ending on line 11030641\n",
      "RDKit WARNING: [18:52:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:31] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:32] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:32] ERROR: Could not sanitize molecule ending on line 11177244\n",
      "RDKit WARNING: [18:52:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:32] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:32] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:32] ERROR: Could not sanitize molecule ending on line 11225914\n",
      "RDKit WARNING: [18:52:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:32] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:33] Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:33] ERROR: Could not sanitize molecule ending on line 11345419\n",
      "RDKit ERROR: [18:52:33] ERROR: Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:34] Explicit valence for atom # 4 Sr, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:34] ERROR: Could not sanitize molecule ending on line 11404386\n",
      "RDKit WARNING: [18:52:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:34] ERROR: Explicit valence for atom # 4 Sr, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:34] Explicit valence for atom # 12 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:34] ERROR: Could not sanitize molecule ending on line 11464777\n",
      "RDKit ERROR: [18:52:34] ERROR: Explicit valence for atom # 12 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] ERROR: Could not sanitize molecule ending on line 11504973\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:35] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] ERROR: Could not sanitize molecule ending on line 11565522\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:35] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] ERROR: Could not sanitize molecule ending on line 11586664\n",
      "RDKit ERROR: [18:52:35] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] ERROR: Could not sanitize molecule ending on line 11590463\n",
      "RDKit ERROR: [18:52:35] ERROR: Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:35] ERROR: Could not sanitize molecule ending on line 11590557\n",
      "RDKit WARNING: [18:52:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:35] ERROR: Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:36] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:36] ERROR: Could not sanitize molecule ending on line 11626739\n",
      "RDKit WARNING: [18:52:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:36] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:36] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:36] ERROR: Could not sanitize molecule ending on line 11651721\n",
      "RDKit WARNING: [18:52:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:36] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:37] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:37] ERROR: Could not sanitize molecule ending on line 11783693\n",
      "RDKit ERROR: [18:52:37] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:37] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:37] ERROR: Could not sanitize molecule ending on line 11784694\n",
      "RDKit WARNING: [18:52:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:37] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:37] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:37] ERROR: Could not sanitize molecule ending on line 11825733\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:37] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 16 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12125652\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 16 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12125759\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 14 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12125866\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 14 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12125958\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12126070\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 16 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12126185\n",
      "RDKit WARNING: [18:52:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 16 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12162669\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12163272\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12163567\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12164041\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12164540\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:40] ERROR: Could not sanitize molecule ending on line 12173350\n",
      "RDKit WARNING: [18:52:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:40] ERROR: Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 2 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12243077\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 2 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12243187\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 10 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12243504\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 10 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12243620\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12244171\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12245062\n",
      "RDKit WARNING: [18:52:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12287670\n",
      "RDKit WARNING: [18:52:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12323653\n",
      "RDKit WARNING: [18:52:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12324211\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:41] ERROR: Could not sanitize molecule ending on line 12324482\n",
      "RDKit ERROR: [18:52:41] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:42] Explicit valence for atom # 12 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:42] ERROR: Could not sanitize molecule ending on line 12383059\n",
      "RDKit WARNING: [18:52:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:42] ERROR: Explicit valence for atom # 12 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:42] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:42] ERROR: Could not sanitize molecule ending on line 12405625\n",
      "RDKit ERROR: [18:52:42] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:42] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:42] ERROR: Could not sanitize molecule ending on line 12405702\n",
      "RDKit WARNING: [18:52:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:42] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12588661\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12632195\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12636537\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12636623\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12636711\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12636811\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12636889\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12636968\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12638580\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12647571\n",
      "RDKit WARNING: [18:52:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:44] ERROR: Could not sanitize molecule ending on line 12649674\n",
      "RDKit WARNING: [18:52:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:44] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12716323\n",
      "RDKit WARNING: [18:52:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12724309\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 0 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12754905\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 0 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 0 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12755018\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 0 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 1 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12755145\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 1 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12755313\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 1 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12755393\n",
      "RDKit WARNING: [18:52:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 1 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12771939\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12772013\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 20 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12793227\n",
      "RDKit WARNING: [18:52:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 20 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:45] ERROR: Could not sanitize molecule ending on line 12812363\n",
      "RDKit WARNING: [18:52:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:45] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] ERROR: Could not sanitize molecule ending on line 12826294\n",
      "RDKit ERROR: [18:52:46] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] ERROR: Could not sanitize molecule ending on line 12826493\n",
      "RDKit ERROR: [18:52:46] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] ERROR: Could not sanitize molecule ending on line 12826821\n",
      "RDKit ERROR: [18:52:46] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] ERROR: Could not sanitize molecule ending on line 12826920\n",
      "RDKit ERROR: [18:52:46] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] ERROR: Could not sanitize molecule ending on line 12827002\n",
      "RDKit WARNING: [18:52:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:46] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] ERROR: Could not sanitize molecule ending on line 12891251\n",
      "RDKit WARNING: [18:52:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:46] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] ERROR: Could not sanitize molecule ending on line 12901748\n",
      "RDKit ERROR: [18:52:46] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] Explicit valence for atom # 41 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] ERROR: Could not sanitize molecule ending on line 12934441\n",
      "RDKit ERROR: [18:52:46] ERROR: Explicit valence for atom # 41 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:46] ERROR: Could not sanitize molecule ending on line 12934822\n",
      "RDKit WARNING: [18:52:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:46] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:47] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:47] ERROR: Could not sanitize molecule ending on line 13013849\n",
      "RDKit ERROR: [18:52:47] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:47] Explicit valence for atom # 12 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:47] ERROR: Could not sanitize molecule ending on line 13046263\n",
      "RDKit ERROR: [18:52:47] ERROR: Explicit valence for atom # 12 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:47] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:47] ERROR: Could not sanitize molecule ending on line 13054161\n",
      "RDKit ERROR: [18:52:47] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:47] Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:47] ERROR: Could not sanitize molecule ending on line 13058452\n",
      "RDKit ERROR: [18:52:47] ERROR: Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13060803\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 0 Sn, 8, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13065108\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 0 Sn, 8, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 4 Sn, 8, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13065536\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 4 Sn, 8, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13065648\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13065742\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13065923\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13066051\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13066161\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 4 Be, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13066277\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13068262\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13068396\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13068545\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13068922\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13069083\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13069208\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13069339\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 4 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13069498\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 4 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13071206\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13071386\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13071614\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13071812\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13071970\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13076871\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13076929\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13077356\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13078140\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 21 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13088351\n",
      "RDKit WARNING: [18:52:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 21 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 17 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13100052\n",
      "RDKit WARNING: [18:52:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 17 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13133083\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:48] ERROR: Could not sanitize molecule ending on line 13157025\n",
      "RDKit WARNING: [18:52:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:48] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:49] Explicit valence for atom # 1 Al greater than permitted\n",
      "RDKit ERROR: [18:52:49] ERROR: Could not sanitize molecule ending on line 13251008\n",
      "RDKit WARNING: [18:52:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:49] ERROR: Explicit valence for atom # 1 Al greater than permitted\n",
      "RDKit ERROR: [18:52:49] Explicit valence for atom # 4 Ca, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:49] ERROR: Could not sanitize molecule ending on line 13252374\n",
      "RDKit WARNING: [18:52:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:49] ERROR: Explicit valence for atom # 4 Ca, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13311903\n",
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13311993\n",
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 4 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13313417\n",
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 4 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 1 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13313484\n",
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 1 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 1 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13313564\n",
      "RDKit WARNING: [18:52:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 1 Ga, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13340938\n",
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13341684\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13375572\n",
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13375664\n",
      "RDKit WARNING: [18:52:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:50] ERROR: Could not sanitize molecule ending on line 13383360\n",
      "RDKit ERROR: [18:52:50] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:51] Explicit valence for atom # 4 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:51] ERROR: Could not sanitize molecule ending on line 13423629\n",
      "RDKit ERROR: [18:52:51] ERROR: Explicit valence for atom # 4 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:51] Explicit valence for atom # 4 In, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:51] ERROR: Could not sanitize molecule ending on line 13423758\n",
      "RDKit ERROR: [18:52:51] ERROR: Explicit valence for atom # 4 In, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:51] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:51] ERROR: Could not sanitize molecule ending on line 13514733\n",
      "RDKit WARNING: [18:52:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:51] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:51] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:51] ERROR: Could not sanitize molecule ending on line 13540247\n",
      "RDKit ERROR: [18:52:52] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:52] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:52] ERROR: Could not sanitize molecule ending on line 13546790\n",
      "RDKit WARNING: [18:52:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:52] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] Explicit valence for atom # 5 Ca, 3, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] ERROR: Could not sanitize molecule ending on line 13680012\n",
      "RDKit ERROR: [18:52:53] ERROR: Explicit valence for atom # 5 Ca, 3, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] Explicit valence for atom # 10 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] ERROR: Could not sanitize molecule ending on line 13680324\n",
      "RDKit ERROR: [18:52:53] ERROR: Explicit valence for atom # 10 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] ERROR: Could not sanitize molecule ending on line 13684624\n",
      "RDKit ERROR: [18:52:53] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] ERROR: Could not sanitize molecule ending on line 13684732\n",
      "RDKit ERROR: [18:52:53] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] Explicit valence for atom # 5 Ba, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] ERROR: Could not sanitize molecule ending on line 13684990\n",
      "RDKit ERROR: [18:52:53] ERROR: Explicit valence for atom # 5 Ba, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] ERROR: Could not sanitize molecule ending on line 13685248\n",
      "RDKit ERROR: [18:52:53] ERROR: Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] ERROR: Could not sanitize molecule ending on line 13696746\n",
      "RDKit ERROR: [18:52:53] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] ERROR: Could not sanitize molecule ending on line 13700455\n",
      "RDKit WARNING: [18:52:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:53] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] Explicit valence for atom # 0 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:53] ERROR: Could not sanitize molecule ending on line 13741148\n",
      "RDKit WARNING: [18:52:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:53] ERROR: Explicit valence for atom # 0 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:54] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:54] ERROR: Could not sanitize molecule ending on line 13899765\n",
      "RDKit WARNING: [18:52:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:54] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] ERROR: Could not sanitize molecule ending on line 13982192\n",
      "RDKit ERROR: [18:52:55] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] ERROR: Could not sanitize molecule ending on line 13982325\n",
      "RDKit ERROR: [18:52:55] ERROR: Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] ERROR: Could not sanitize molecule ending on line 13989580\n",
      "RDKit ERROR: [18:52:55] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] ERROR: Could not sanitize molecule ending on line 13994873\n",
      "RDKit ERROR: [18:52:55] ERROR: Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] Explicit valence for atom # 15 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] ERROR: Could not sanitize molecule ending on line 13997389\n",
      "RDKit ERROR: [18:52:55] ERROR: Explicit valence for atom # 15 H, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:55] ERROR: Could not sanitize molecule ending on line 13998056\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:55] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14034930\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14035007\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14035080\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14035147\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 4 Ba, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14048372\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 4 Ba, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 13 In, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14050952\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 13 In, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 13 Al greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14051159\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 13 Al greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 7 Al greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14095197\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 7 Al greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 7 Al greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14096147\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 7 Al greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14115989\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14122877\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14127107\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:56] ERROR: Could not sanitize molecule ending on line 14133486\n",
      "RDKit WARNING: [18:52:56] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:56] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14183966\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14184124\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14184552\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14184656\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14184744\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14184853\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14184932\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185011\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185129\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185190\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185435\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185637\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185698\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185766\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185860\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185921\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14185991\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14186088\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14186243\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14186304\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14186399\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14186500\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14186598\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14186735\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14186954\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14187063\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14187320\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14187584\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14187691\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14187792\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14187920\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14188878\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14188988\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14189092\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14189171\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14189393\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14189535\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14189969\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14190241\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14190436\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14190554\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14190776\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14190952\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14191205\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14191293\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14191585\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14192214\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14192367\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14192619\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14192937\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14193445\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14193532\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14208678\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14209019\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14209368\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14209737\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14210076\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14210439\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14210785\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14211123\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14211454\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14211804\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14212154\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14212504\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14212857\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14213216\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14213702\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14214058\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14214421\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14214940\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14215279\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14215642\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14216019\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14216396\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 12 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:57] ERROR: Could not sanitize molecule ending on line 14224293\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:52:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:57] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 7 Al greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14266862\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 7 Al greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 6 Al greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14267015\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 6 Al greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 0 Al greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14269753\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 0 Al greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14280298\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 10 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14281344\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14282330\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 12 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14282514\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 12 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14282932\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14283298\n",
      "RDKit WARNING: [18:52:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] Explicit valence for atom # 12 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:58] ERROR: Could not sanitize molecule ending on line 14337080\n",
      "RDKit WARNING: [18:52:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:58] ERROR: Explicit valence for atom # 12 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:52:59] Explicit valence for atom # 13 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:52:59] ERROR: Could not sanitize molecule ending on line 14412525\n",
      "RDKit WARNING: [18:52:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:52:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:52:59] ERROR: Explicit valence for atom # 13 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] ERROR: Could not sanitize molecule ending on line 14520701\n",
      "RDKit ERROR: [18:53:00] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] ERROR: Could not sanitize molecule ending on line 14529369\n",
      "RDKit ERROR: [18:53:00] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] ERROR: Could not sanitize molecule ending on line 14529470\n",
      "RDKit ERROR: [18:53:00] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] ERROR: Could not sanitize molecule ending on line 14531217\n",
      "RDKit WARNING: [18:53:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:00] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] ERROR: Could not sanitize molecule ending on line 14532455\n",
      "RDKit ERROR: [18:53:00] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] Explicit valence for atom # 0 Tl, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:00] ERROR: Could not sanitize molecule ending on line 14532918\n",
      "RDKit WARNING: [18:53:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:00] ERROR: Explicit valence for atom # 0 Tl, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] ERROR: Could not sanitize molecule ending on line 14619961\n",
      "RDKit ERROR: [18:53:01] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] Explicit valence for atom # 7 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] ERROR: Could not sanitize molecule ending on line 14620050\n",
      "RDKit ERROR: [18:53:01] ERROR: Explicit valence for atom # 7 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] ERROR: Could not sanitize molecule ending on line 14620139\n",
      "RDKit ERROR: [18:53:01] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] ERROR: Could not sanitize molecule ending on line 14620297\n",
      "RDKit ERROR: [18:53:01] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] ERROR: Could not sanitize molecule ending on line 14620455\n",
      "RDKit WARNING: [18:53:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:01] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] ERROR: Could not sanitize molecule ending on line 14720701\n",
      "RDKit ERROR: [18:53:01] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] ERROR: Could not sanitize molecule ending on line 14721844\n",
      "RDKit ERROR: [18:53:01] ERROR: Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:01] ERROR: Could not sanitize molecule ending on line 14722486\n",
      "RDKit WARNING: [18:53:01] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:01] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:02] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:02] ERROR: Could not sanitize molecule ending on line 14733061\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:02] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:03] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:02] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:04] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:04] ERROR: Could not sanitize molecule ending on line 15048261\n",
      "RDKit ERROR: [18:53:04] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:04] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:04] ERROR: Could not sanitize molecule ending on line 15049209\n",
      "RDKit WARNING: [18:53:04] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:04] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:05] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:05] ERROR: Could not sanitize molecule ending on line 15181375\n",
      "RDKit ERROR: [18:53:05] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:05] Explicit valence for atom # 4 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:05] ERROR: Could not sanitize molecule ending on line 15181455\n",
      "RDKit WARNING: [18:53:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:05] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:05] ERROR: Explicit valence for atom # 4 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] Explicit valence for atom # 6 Mg, 7, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] ERROR: Could not sanitize molecule ending on line 15354752\n",
      "RDKit ERROR: [18:53:07] ERROR: Explicit valence for atom # 6 Mg, 7, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] Explicit valence for atom # 0 Ca, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] ERROR: Could not sanitize molecule ending on line 15355265\n",
      "RDKit ERROR: [18:53:07] ERROR: Explicit valence for atom # 0 Ca, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] Explicit valence for atom # 1 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] ERROR: Could not sanitize molecule ending on line 15362089\n",
      "RDKit ERROR: [18:53:07] ERROR: Explicit valence for atom # 1 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] ERROR: Could not sanitize molecule ending on line 15362427\n",
      "RDKit ERROR: [18:53:07] ERROR: Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] Explicit valence for atom # 1 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] ERROR: Could not sanitize molecule ending on line 15362680\n",
      "RDKit ERROR: [18:53:07] ERROR: Explicit valence for atom # 1 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:07] Explicit valence for atom # 0 Al greater than permitted\n",
      "RDKit ERROR: [18:53:07] ERROR: Could not sanitize molecule ending on line 15363141\n",
      "RDKit WARNING: [18:53:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:07] ERROR: Explicit valence for atom # 0 Al greater than permitted\n",
      "RDKit ERROR: [18:53:11] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:11] ERROR: Could not sanitize molecule ending on line 15846318\n",
      "RDKit WARNING: [18:53:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:11] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:11] Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:11] ERROR: Could not sanitize molecule ending on line 15909084\n",
      "RDKit ERROR: [18:53:11] ERROR: Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:11] Explicit valence for atom # 5 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:11] ERROR: Could not sanitize molecule ending on line 15921963\n",
      "RDKit WARNING: [18:53:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:11] ERROR: Explicit valence for atom # 5 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:12] Explicit valence for atom # 2 Br, 3, is greater than permitted\n",
      "RDKit ERROR: [18:53:12] ERROR: Could not sanitize molecule ending on line 15933288\n",
      "RDKit ERROR: [18:53:12] ERROR: Explicit valence for atom # 2 Br, 3, is greater than permitted\n",
      "RDKit ERROR: [18:53:12] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:12] ERROR: Could not sanitize molecule ending on line 15945667\n",
      "RDKit WARNING: [18:53:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:12] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:12] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:12] ERROR: Could not sanitize molecule ending on line 16006388\n",
      "RDKit ERROR: [18:53:12] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:12] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:12] ERROR: Could not sanitize molecule ending on line 16006502\n",
      "RDKit WARNING: [18:53:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:12] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] Explicit valence for atom # 26 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] ERROR: Could not sanitize molecule ending on line 16016224\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:13] ERROR: Explicit valence for atom # 26 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] ERROR: Could not sanitize molecule ending on line 16035353\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:13] ERROR: Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] Explicit valence for atom # 18 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] ERROR: Could not sanitize molecule ending on line 16092100\n",
      "RDKit ERROR: [18:53:13] ERROR: Explicit valence for atom # 18 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] Explicit valence for atom # 5 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] ERROR: Could not sanitize molecule ending on line 16099605\n",
      "RDKit ERROR: [18:53:13] ERROR: Explicit valence for atom # 5 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] Explicit valence for atom # 5 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] ERROR: Could not sanitize molecule ending on line 16099824\n",
      "RDKit ERROR: [18:53:13] ERROR: Explicit valence for atom # 5 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] ERROR: Could not sanitize molecule ending on line 16099889\n",
      "RDKit ERROR: [18:53:13] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] Explicit valence for atom # 5 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] ERROR: Could not sanitize molecule ending on line 16101506\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:13] ERROR: Explicit valence for atom # 5 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] Explicit valence for atom # 26 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:13] ERROR: Could not sanitize molecule ending on line 16103418\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:13] ERROR: Explicit valence for atom # 26 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:14] Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:14] ERROR: Could not sanitize molecule ending on line 16172755\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:14] ERROR: Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:14] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:14] ERROR: Could not sanitize molecule ending on line 16244086\n",
      "RDKit ERROR: [18:53:14] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:14] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:14] ERROR: Could not sanitize molecule ending on line 16244232\n",
      "RDKit WARNING: [18:53:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:14] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:15] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:15] ERROR: Could not sanitize molecule ending on line 16262565\n",
      "RDKit ERROR: [18:53:15] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:15] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:15] ERROR: Could not sanitize molecule ending on line 16264436\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:15] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:15] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:15] ERROR: Could not sanitize molecule ending on line 16289359\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:15] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:15] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:15] ERROR: Could not sanitize molecule ending on line 16372922\n",
      "RDKit WARNING: [18:53:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:15] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:16] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:16] ERROR: Could not sanitize molecule ending on line 16410640\n",
      "RDKit ERROR: [18:53:16] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:16] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:16] ERROR: Could not sanitize molecule ending on line 16422658\n",
      "RDKit ERROR: [18:53:16] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:16] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:16] ERROR: Could not sanitize molecule ending on line 16422819\n",
      "RDKit WARNING: [18:53:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:16] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16746691\n",
      "RDKit WARNING: [18:53:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16748549\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16748682\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16748808\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16748958\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16749099\n",
      "RDKit WARNING: [18:53:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16825969\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 18 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16826743\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 18 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16826849\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16827049\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16827160\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 17 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16827252\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 17 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16827352\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16827509\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16828023\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16828112\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16833903\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16833982\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16834593\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:19] ERROR: Could not sanitize molecule ending on line 16834765\n",
      "RDKit ERROR: [18:53:19] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] ERROR: Could not sanitize molecule ending on line 16862713\n",
      "RDKit WARNING: [18:53:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:20] ERROR: Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] Explicit valence for atom # 7 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] ERROR: Could not sanitize molecule ending on line 16899599\n",
      "RDKit WARNING: [18:53:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:20] ERROR: Explicit valence for atom # 7 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] ERROR: Could not sanitize molecule ending on line 16912323\n",
      "RDKit ERROR: [18:53:20] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] ERROR: Could not sanitize molecule ending on line 16912439\n",
      "RDKit ERROR: [18:53:20] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] ERROR: Could not sanitize molecule ending on line 16912712\n",
      "RDKit ERROR: [18:53:20] ERROR: Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] Explicit valence for atom # 17 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] ERROR: Could not sanitize molecule ending on line 16912823\n",
      "RDKit ERROR: [18:53:20] ERROR: Explicit valence for atom # 17 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:20] ERROR: Could not sanitize molecule ending on line 16913023\n",
      "RDKit WARNING: [18:53:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:20] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 0 Ba, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16976291\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 0 Ba, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16976372\n",
      "RDKit WARNING: [18:53:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 0 K, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16987017\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 0 K, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 4 K, 7, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16987237\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 4 K, 7, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16993563\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16993670\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16993770\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16993898\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16994015\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16994150\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16994249\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16994354\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16994533\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 4 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16994670\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 4 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16994814\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16994939\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16995037\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] Explicit valence for atom # 4 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:21] ERROR: Could not sanitize molecule ending on line 16995223\n",
      "RDKit WARNING: [18:53:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:21] ERROR: Explicit valence for atom # 4 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] ERROR: Could not sanitize molecule ending on line 17103001\n",
      "RDKit ERROR: [18:53:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] ERROR: Could not sanitize molecule ending on line 17103099\n",
      "RDKit ERROR: [18:53:22] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] ERROR: Could not sanitize molecule ending on line 17103197\n",
      "RDKit ERROR: [18:53:22] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] ERROR: Could not sanitize molecule ending on line 17103382\n",
      "RDKit ERROR: [18:53:22] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] ERROR: Could not sanitize molecule ending on line 17103566\n",
      "RDKit ERROR: [18:53:22] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] ERROR: Could not sanitize molecule ending on line 17103688\n",
      "RDKit ERROR: [18:53:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:22] ERROR: Could not sanitize molecule ending on line 17103810\n",
      "RDKit WARNING: [18:53:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:22] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17248753\n",
      "RDKit WARNING: [18:53:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17292911\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17292987\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17293236\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17293311\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17293449\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17293516\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17293608\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17293927\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17294476\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17294542\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:23] ERROR: Could not sanitize molecule ending on line 17294682\n",
      "RDKit WARNING: [18:53:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:23] ERROR: Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:24] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:24] ERROR: Could not sanitize molecule ending on line 17390370\n",
      "RDKit ERROR: [18:53:24] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:24] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:24] ERROR: Could not sanitize molecule ending on line 17390504\n",
      "RDKit ERROR: [18:53:24] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:24] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:24] ERROR: Could not sanitize molecule ending on line 17390576\n",
      "RDKit ERROR: [18:53:24] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] ERROR: Could not sanitize molecule ending on line 17436492\n",
      "RDKit ERROR: [18:53:25] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] ERROR: Could not sanitize molecule ending on line 17466106\n",
      "RDKit ERROR: [18:53:25] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] ERROR: Could not sanitize molecule ending on line 17466402\n",
      "RDKit ERROR: [18:53:25] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] ERROR: Could not sanitize molecule ending on line 17467009\n",
      "RDKit WARNING: [18:53:25] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:25] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:25] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:25] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] ERROR: Could not sanitize molecule ending on line 17542002\n",
      "RDKit ERROR: [18:53:25] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] ERROR: Could not sanitize molecule ending on line 17542076\n",
      "RDKit ERROR: [18:53:25] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:25] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17542192\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17542327\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17542435\n",
      "RDKit WARNING: [18:53:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 26 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17622988\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 26 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 4 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17637856\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 4 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 15 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17649266\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 15 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17650419\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17650494\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17650564\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17650642\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17650714\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17650790\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17650869\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17650948\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17651015\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17651079\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17651148\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:26] ERROR: Could not sanitize molecule ending on line 17651211\n",
      "RDKit WARNING: [18:53:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:26] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:27] Explicit valence for atom # 1 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:53:27] ERROR: Could not sanitize molecule ending on line 17680909\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:27] ERROR: Explicit valence for atom # 1 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:53:27] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:27] ERROR: Could not sanitize molecule ending on line 17733875\n",
      "RDKit ERROR: [18:53:27] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:27] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:27] ERROR: Could not sanitize molecule ending on line 17734555\n",
      "RDKit WARNING: [18:53:27] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:27] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] ERROR: Could not sanitize molecule ending on line 17821519\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:28] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] ERROR: Could not sanitize molecule ending on line 17863222\n",
      "RDKit ERROR: [18:53:28] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] ERROR: Could not sanitize molecule ending on line 17863331\n",
      "RDKit ERROR: [18:53:28] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] ERROR: Could not sanitize molecule ending on line 17863453\n",
      "RDKit ERROR: [18:53:28] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] ERROR: Could not sanitize molecule ending on line 17863543\n",
      "RDKit ERROR: [18:53:28] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] ERROR: Could not sanitize molecule ending on line 17863633\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:28] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:28] ERROR: Could not sanitize molecule ending on line 17886422\n",
      "RDKit ERROR: [18:53:28] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17899975\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17900067\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 17 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17900166\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 17 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 18 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17900269\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 18 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 18 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17900372\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 18 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17901794\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17904758\n",
      "RDKit WARNING: [18:53:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17911158\n",
      "RDKit WARNING: [18:53:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 2 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17938969\n",
      "RDKit WARNING: [18:53:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 2 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17951826\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:29] ERROR: Could not sanitize molecule ending on line 17969274\n",
      "RDKit WARNING: [18:53:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:29] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:29] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 26 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18048825\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 26 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 25 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18049205\n",
      "RDKit WARNING: [18:53:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 25 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 5 Al, 9, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18063069\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 5 Al, 9, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18084316\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18087145\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18103967\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18108763\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 5 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18113984\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 5 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18114371\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18115257\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18115758\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18115867\n",
      "RDKit WARNING: [18:53:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:30] ERROR: Could not sanitize molecule ending on line 18131055\n",
      "RDKit WARNING: [18:53:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:30] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:30] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18153106\n",
      "RDKit WARNING: [18:53:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18181143\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18181233\n",
      "RDKit WARNING: [18:53:31] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18213143\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18213246\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18213361\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18213479\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18213597\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18213736\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18213878\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18214014\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18214156\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18214502\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18214616\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18214734\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18214860\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18215005\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18215155\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18215282\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18215385\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18215497\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18215606\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18215742\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18215851\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:31] ERROR: Could not sanitize molecule ending on line 18215969\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:31] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:32] Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:32] ERROR: Could not sanitize molecule ending on line 18370256\n",
      "RDKit ERROR: [18:53:32] ERROR: Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:32] Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:32] ERROR: Could not sanitize molecule ending on line 18370386\n",
      "RDKit ERROR: [18:53:32] ERROR: Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:32] Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:32] ERROR: Could not sanitize molecule ending on line 18370525\n",
      "RDKit WARNING: [18:53:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:32] ERROR: Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18442097\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18442263\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18450166\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18450265\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18450382\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18450499\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18450637\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18450730\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18450823\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18450922\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18451256\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18451363\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18451632\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18451820\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18451905\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18459789\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18460011\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 9 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18463970\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 9 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] Explicit valence for atom # 5 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:33] ERROR: Could not sanitize molecule ending on line 18464263\n",
      "RDKit WARNING: [18:53:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:33] ERROR: Explicit valence for atom # 5 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] Explicit valence for atom # 17 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] ERROR: Could not sanitize molecule ending on line 18534420\n",
      "RDKit WARNING: [18:53:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:34] ERROR: Explicit valence for atom # 17 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] ERROR: Could not sanitize molecule ending on line 18559544\n",
      "RDKit ERROR: [18:53:34] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] ERROR: Could not sanitize molecule ending on line 18559678\n",
      "RDKit ERROR: [18:53:34] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] ERROR: Could not sanitize molecule ending on line 18560036\n",
      "RDKit ERROR: [18:53:34] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] ERROR: Could not sanitize molecule ending on line 18564230\n",
      "RDKit ERROR: [18:53:34] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] ERROR: Could not sanitize molecule ending on line 18564325\n",
      "RDKit WARNING: [18:53:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:53:34] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] ERROR: Could not sanitize molecule ending on line 18581074\n",
      "RDKit ERROR: [18:53:34] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:34] ERROR: Could not sanitize molecule ending on line 18581155\n",
      "RDKit WARNING: [18:53:34] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:35] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:34] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18633807\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18633934\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18634073\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18634171\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18634272\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18634385\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18634492\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18634596\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18634727\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18634864\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18634983\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18635102\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18635206\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18635428\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18635641\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18663783\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18663876\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18675039\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18675143\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18675270\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18675404\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18675508\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18675606\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18675728\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18675867\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18675976\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18676115\n",
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:35] ERROR: Could not sanitize molecule ending on line 18676218\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:53:35] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18740095\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 5 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 10 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18740747\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 10 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 5 Mg, 8, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18742682\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 5 Mg, 8, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18792315\n",
      "RDKit WARNING: [18:53:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 4 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18810347\n",
      "RDKit WARNING: [18:53:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 4 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18819472\n",
      "RDKit WARNING: [18:53:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18831819\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18831990\n",
      "RDKit WARNING: [18:53:36] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18848626\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:36] ERROR: Could not sanitize molecule ending on line 18850638\n",
      "RDKit ERROR: [18:53:36] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 9 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18889879\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 9 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18891850\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18894020\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18894161\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18894300\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18894437\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18895533\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18907640\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 0 Al greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18922147\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 0 Al greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 10 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18922589\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 10 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 20 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18922895\n",
      "RDKit WARNING: [18:53:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 20 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18930486\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 4 Al greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 4 Ba, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18930590\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 4 Ba, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 4 Ca, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18930688\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 4 Ca, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 4 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18933107\n",
      "RDKit WARNING: [18:53:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 4 Mg, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] Explicit valence for atom # 4 Pb, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:37] ERROR: Could not sanitize molecule ending on line 18936612\n",
      "RDKit WARNING: [18:53:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:37] ERROR: Explicit valence for atom # 4 Pb, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 18991864\n",
      "RDKit WARNING: [18:53:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:38] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 19039487\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 19039574\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 19060888\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 19061007\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 19061152\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 19061309\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 19061430\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 19061569\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:38] ERROR: Could not sanitize molecule ending on line 19061615\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:38] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:39] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:39] ERROR: Could not sanitize molecule ending on line 19108355\n",
      "RDKit ERROR: [18:53:39] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] ERROR: Could not sanitize molecule ending on line 19235271\n",
      "RDKit ERROR: [18:53:40] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] ERROR: Could not sanitize molecule ending on line 19235375\n",
      "RDKit ERROR: [18:53:40] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] ERROR: Could not sanitize molecule ending on line 19235461\n",
      "RDKit ERROR: [18:53:40] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] ERROR: Could not sanitize molecule ending on line 19235553\n",
      "RDKit ERROR: [18:53:40] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] ERROR: Could not sanitize molecule ending on line 19239592\n",
      "RDKit WARNING: [18:53:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:40] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] Explicit valence for atom # 43 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] ERROR: Could not sanitize molecule ending on line 19285959\n",
      "RDKit ERROR: [18:53:40] ERROR: Explicit valence for atom # 43 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] Explicit valence for atom # 39 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] ERROR: Could not sanitize molecule ending on line 19286150\n",
      "RDKit ERROR: [18:53:40] ERROR: Explicit valence for atom # 39 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:40] ERROR: Could not sanitize molecule ending on line 19315185\n",
      "RDKit ERROR: [18:53:40] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19370947\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19371077\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19371199\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19390931\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19405822\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19405965\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19406046\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19406163\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19406328\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 4 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19406439\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 4 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] Explicit valence for atom # 9 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:41] ERROR: Could not sanitize molecule ending on line 19407912\n",
      "RDKit WARNING: [18:53:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:41] ERROR: Explicit valence for atom # 9 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 41 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19467315\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 41 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 42 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19467496\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 42 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 42 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19467677\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 42 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 43 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19467860\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 43 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19469430\n",
      "RDKit WARNING: [18:53:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 38 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19482479\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 38 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 1 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19484687\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:42] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 1 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19543432\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19543550\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:42] ERROR: Could not sanitize molecule ending on line 19543650\n",
      "RDKit WARNING: [18:53:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:43] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:42] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19642919\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19643055\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19683976\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19684105\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19684240\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19684455\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19684661\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19684873\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 8 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19685035\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 8 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:43] ERROR: Could not sanitize molecule ending on line 19696760\n",
      "RDKit WARNING: [18:53:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:43] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] ERROR: Could not sanitize molecule ending on line 19743586\n",
      "RDKit ERROR: [18:53:44] ERROR: Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] ERROR: Could not sanitize molecule ending on line 19743779\n",
      "RDKit ERROR: [18:53:44] ERROR: Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] ERROR: Could not sanitize molecule ending on line 19743900\n",
      "RDKit ERROR: [18:53:44] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] ERROR: Could not sanitize molecule ending on line 19744021\n",
      "RDKit WARNING: [18:53:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:44] ERROR: Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] ERROR: Could not sanitize molecule ending on line 19775391\n",
      "RDKit ERROR: [18:53:44] ERROR: Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:44] ERROR: Could not sanitize molecule ending on line 19775465\n",
      "RDKit WARNING: [18:53:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:44] ERROR: Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] ERROR: Could not sanitize molecule ending on line 19914658\n",
      "RDKit WARNING: [18:53:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:45] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] ERROR: Could not sanitize molecule ending on line 19938462\n",
      "RDKit ERROR: [18:53:45] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] ERROR: Could not sanitize molecule ending on line 19938581\n",
      "RDKit ERROR: [18:53:45] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] ERROR: Could not sanitize molecule ending on line 19938718\n",
      "RDKit ERROR: [18:53:45] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] ERROR: Could not sanitize molecule ending on line 19938863\n",
      "RDKit ERROR: [18:53:45] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] ERROR: Could not sanitize molecule ending on line 19939000\n",
      "RDKit ERROR: [18:53:45] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] ERROR: Could not sanitize molecule ending on line 19939125\n",
      "RDKit ERROR: [18:53:45] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:45] ERROR: Could not sanitize molecule ending on line 19939270\n",
      "RDKit WARNING: [18:53:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:45] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] ERROR: Could not sanitize molecule ending on line 19948646\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:46] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:46] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] Explicit valence for atom # 5 Bi greater than permitted\n",
      "RDKit ERROR: [18:53:46] ERROR: Could not sanitize molecule ending on line 19985468\n",
      "RDKit ERROR: [18:53:46] ERROR: Explicit valence for atom # 5 Bi greater than permitted\n",
      "RDKit ERROR: [18:53:46] Explicit valence for atom # 5 Bi greater than permitted\n",
      "RDKit ERROR: [18:53:46] ERROR: Could not sanitize molecule ending on line 19986502\n",
      "RDKit ERROR: [18:53:46] ERROR: Explicit valence for atom # 5 Bi greater than permitted\n",
      "RDKit ERROR: [18:53:46] Explicit valence for atom # 13 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] ERROR: Could not sanitize molecule ending on line 19998763\n",
      "RDKit ERROR: [18:53:46] ERROR: Explicit valence for atom # 13 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] ERROR: Could not sanitize molecule ending on line 20031794\n",
      "RDKit ERROR: [18:53:46] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] Explicit valence for atom # 7 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] ERROR: Could not sanitize molecule ending on line 20040537\n",
      "RDKit ERROR: [18:53:46] ERROR: Explicit valence for atom # 7 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:46] ERROR: Could not sanitize molecule ending on line 20059390\n",
      "RDKit WARNING: [18:53:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:46] ERROR: Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20125074\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20125143\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20125218\n",
      "RDKit WARNING: [18:53:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20152729\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20152798\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20152873\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20152962\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20153051\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20174822\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20174961\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20175088\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20175233\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:47] ERROR: Could not sanitize molecule ending on line 20175396\n",
      "RDKit WARNING: [18:53:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:47] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20198640\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20198850\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20214351\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20230706\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20236342\n",
      "RDKit WARNING: [18:53:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20237515\n",
      "RDKit WARNING: [18:53:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20256706\n",
      "RDKit WARNING: [18:53:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20260090\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20260252\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20260417\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20260621\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20260825\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20261032\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 5 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20261258\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 5 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20261406\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20261571\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20261742\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20261922\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20262089\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20262262\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20262450\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20262632\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20262937\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20263122\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20263319\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20263495\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20263673\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20263858\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20264049\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20264238\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20264437\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20264619\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20265030\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20265175\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20265320\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20265448\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20265576\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20265704\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20265832\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20266375\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20266563\n",
      "RDKit WARNING: [18:53:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20286149\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:48] ERROR: Could not sanitize molecule ending on line 20287554\n",
      "RDKit WARNING: [18:53:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:48] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] ERROR: Could not sanitize molecule ending on line 20323405\n",
      "RDKit ERROR: [18:53:49] ERROR: Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] Explicit valence for atom # 7 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] ERROR: Could not sanitize molecule ending on line 20323564\n",
      "RDKit ERROR: [18:53:49] ERROR: Explicit valence for atom # 7 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] ERROR: Could not sanitize molecule ending on line 20323725\n",
      "RDKit ERROR: [18:53:49] ERROR: Explicit valence for atom # 9 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] Explicit valence for atom # 20 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] ERROR: Could not sanitize molecule ending on line 20323906\n",
      "RDKit ERROR: [18:53:49] ERROR: Explicit valence for atom # 20 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] ERROR: Could not sanitize molecule ending on line 20363949\n",
      "RDKit ERROR: [18:53:49] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] ERROR: Could not sanitize molecule ending on line 20364114\n",
      "RDKit ERROR: [18:53:49] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] ERROR: Could not sanitize molecule ending on line 20364222\n",
      "RDKit ERROR: [18:53:49] ERROR: Explicit valence for atom # 7 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] ERROR: Could not sanitize molecule ending on line 20364351\n",
      "RDKit WARNING: [18:53:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:49] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] Explicit valence for atom # 7 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:49] ERROR: Could not sanitize molecule ending on line 20394193\n",
      "RDKit ERROR: [18:53:49] ERROR: Explicit valence for atom # 7 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] ERROR: Could not sanitize molecule ending on line 20428657\n",
      "RDKit ERROR: [18:53:50] ERROR: Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] ERROR: Could not sanitize molecule ending on line 20428777\n",
      "RDKit ERROR: [18:53:50] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] Explicit valence for atom # 5 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] ERROR: Could not sanitize molecule ending on line 20428891\n",
      "RDKit ERROR: [18:53:50] ERROR: Explicit valence for atom # 5 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] ERROR: Could not sanitize molecule ending on line 20429027\n",
      "RDKit ERROR: [18:53:50] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] Explicit valence for atom # 4 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] ERROR: Could not sanitize molecule ending on line 20429123\n",
      "RDKit ERROR: [18:53:50] ERROR: Explicit valence for atom # 4 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] ERROR: Could not sanitize molecule ending on line 20429224\n",
      "RDKit ERROR: [18:53:50] ERROR: Explicit valence for atom # 1 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] ERROR: Could not sanitize molecule ending on line 20429358\n",
      "RDKit ERROR: [18:53:50] ERROR: Explicit valence for atom # 2 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] Explicit valence for atom # 10 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:50] ERROR: Could not sanitize molecule ending on line 20431192\n",
      "RDKit WARNING: [18:53:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:50] ERROR: Explicit valence for atom # 10 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20532295\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20535611\n",
      "RDKit WARNING: [18:53:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20547595\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20547713\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20555203\n",
      "RDKit WARNING: [18:53:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20576683\n",
      "RDKit WARNING: [18:53:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 3 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20623869\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 3 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 3 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20623970\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 3 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 3 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20624085\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 3 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 3 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20624187\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 3 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] Explicit valence for atom # 1 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:51] ERROR: Could not sanitize molecule ending on line 20639525\n",
      "RDKit ERROR: [18:53:51] ERROR: Explicit valence for atom # 1 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 1 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20650762\n",
      "RDKit WARNING: [18:53:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 1 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 1 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20707209\n",
      "RDKit WARNING: [18:53:52] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 1 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 11 Ca, 3, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20725963\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 11 Ca, 3, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 7 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20737495\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 7 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20750980\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751080\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751160\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751243\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751334\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751422\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751513\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751600\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751687\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751774\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751866\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20751958\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:52] ERROR: Could not sanitize molecule ending on line 20752050\n",
      "RDKit ERROR: [18:53:52] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:53] Explicit valence for atom # 0 Bi, 8, is greater than permitted\n",
      "RDKit ERROR: [18:53:53] ERROR: Could not sanitize molecule ending on line 20782022\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:53] ERROR: Explicit valence for atom # 0 Bi, 8, is greater than permitted\n",
      "RDKit ERROR: [18:53:53] Explicit valence for atom # 24 H, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:53] ERROR: Could not sanitize molecule ending on line 20832802\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:53] ERROR: Explicit valence for atom # 24 H, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:54] Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:54] ERROR: Could not sanitize molecule ending on line 20952034\n",
      "RDKit WARNING: [18:53:54] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:54] ERROR: Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] Explicit valence for atom # 9 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] ERROR: Could not sanitize molecule ending on line 21023355\n",
      "RDKit ERROR: [18:53:55] ERROR: Explicit valence for atom # 9 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] Explicit valence for atom # 0 B greater than permitted\n",
      "RDKit ERROR: [18:53:55] ERROR: Could not sanitize molecule ending on line 21037183\n",
      "RDKit ERROR: [18:53:55] ERROR: Explicit valence for atom # 0 B greater than permitted\n",
      "RDKit ERROR: [18:53:55] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] ERROR: Could not sanitize molecule ending on line 21037283\n",
      "RDKit ERROR: [18:53:55] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] Explicit valence for atom # 0 B greater than permitted\n",
      "RDKit ERROR: [18:53:55] ERROR: Could not sanitize molecule ending on line 21038064\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:55] ERROR: Explicit valence for atom # 0 B greater than permitted\n",
      "RDKit ERROR: [18:53:55] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] ERROR: Could not sanitize molecule ending on line 21082460\n",
      "RDKit ERROR: [18:53:55] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] ERROR: Could not sanitize molecule ending on line 21082635\n",
      "RDKit ERROR: [18:53:55] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] ERROR: Could not sanitize molecule ending on line 21082943\n",
      "RDKit ERROR: [18:53:55] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:55] ERROR: Could not sanitize molecule ending on line 21083118\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:53:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:55] ERROR: Explicit valence for atom # 2 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] Explicit valence for atom # 4 B greater than permitted\n",
      "RDKit ERROR: [18:53:56] ERROR: Could not sanitize molecule ending on line 21126113\n",
      "RDKit ERROR: [18:53:56] ERROR: Explicit valence for atom # 4 B greater than permitted\n",
      "RDKit ERROR: [18:53:56] Explicit valence for atom # 0 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] ERROR: Could not sanitize molecule ending on line 21127041\n",
      "RDKit ERROR: [18:53:56] ERROR: Explicit valence for atom # 0 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] ERROR: Could not sanitize molecule ending on line 21145349\n",
      "RDKit ERROR: [18:53:56] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] Explicit valence for atom # 43 Ca, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] ERROR: Could not sanitize molecule ending on line 21146501\n",
      "RDKit ERROR: [18:53:56] ERROR: Explicit valence for atom # 43 Ca, 6, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] ERROR: Could not sanitize molecule ending on line 21148759\n",
      "RDKit ERROR: [18:53:56] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] ERROR: Could not sanitize molecule ending on line 21150645\n",
      "RDKit ERROR: [18:53:56] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] ERROR: Could not sanitize molecule ending on line 21218752\n",
      "RDKit ERROR: [18:53:56] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:53:56] ERROR: Could not sanitize molecule ending on line 21228315\n",
      "RDKit WARNING: [18:53:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:53:56] ERROR: Explicit valence for atom # 1 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:00] Explicit valence for atom # 1 Pb, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:00] ERROR: Could not sanitize molecule ending on line 21646660\n",
      "RDKit WARNING: [18:54:00] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:00] ERROR: Explicit valence for atom # 1 Pb, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:01] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:01] ERROR: Could not sanitize molecule ending on line 21770179\n",
      "RDKit ERROR: [18:54:01] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:01] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:01] ERROR: Could not sanitize molecule ending on line 21770302\n",
      "RDKit ERROR: [18:54:01] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:02] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:02] ERROR: Could not sanitize molecule ending on line 21878165\n",
      "RDKit ERROR: [18:54:02] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:02] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:02] ERROR: Could not sanitize molecule ending on line 21953488\n",
      "RDKit ERROR: [18:54:02] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] Explicit valence for atom # 0 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] ERROR: Could not sanitize molecule ending on line 21962223\n",
      "RDKit ERROR: [18:54:03] ERROR: Explicit valence for atom # 0 S, 8, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] ERROR: Could not sanitize molecule ending on line 22021889\n",
      "RDKit ERROR: [18:54:03] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] ERROR: Could not sanitize molecule ending on line 22022146\n",
      "RDKit ERROR: [18:54:03] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] ERROR: Could not sanitize molecule ending on line 22022267\n",
      "RDKit ERROR: [18:54:03] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:03] ERROR: Could not sanitize molecule ending on line 22035662\n",
      "RDKit ERROR: [18:54:03] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:04] Explicit valence for atom # 21 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:04] ERROR: Could not sanitize molecule ending on line 22127895\n",
      "RDKit ERROR: [18:54:04] ERROR: Explicit valence for atom # 21 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:05] Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:05] ERROR: Could not sanitize molecule ending on line 22234299\n",
      "RDKit ERROR: [18:54:05] ERROR: Explicit valence for atom # 1 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:05] Explicit valence for atom # 8 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:05] ERROR: Could not sanitize molecule ending on line 22311813\n",
      "RDKit ERROR: [18:54:05] ERROR: Explicit valence for atom # 8 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:05] Explicit valence for atom # 8 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:05] ERROR: Could not sanitize molecule ending on line 22312774\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:05] ERROR: Explicit valence for atom # 8 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 2 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22336551\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 2 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 6 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22337444\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 6 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 15 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22337599\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 15 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 13 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22337780\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 13 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 3 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22343275\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 3 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 6 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22386578\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 6 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22388589\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 8 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22388678\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 8 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22393598\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22395371\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 11 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22395425\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 11 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 6 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22395902\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 6 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22396194\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22396273\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 2 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22397309\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 2 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 10 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22397371\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 10 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22397452\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 3 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22402739\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 3 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22402806\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 12 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22402882\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 12 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 12 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22402962\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 12 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22403079\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 19 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22403159\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 19 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 4 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22403218\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 4 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 8 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22403292\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 8 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 4 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22403426\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 4 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] Explicit valence for atom # 0 Ca, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:06] ERROR: Could not sanitize molecule ending on line 22412795\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:06] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:06] ERROR: Explicit valence for atom # 0 Ca, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22424667\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 6 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22424934\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 6 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22425222\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 10 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22426121\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 10 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22426231\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 0 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22427734\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 0 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 0 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22427800\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 0 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 4 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22428990\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 4 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22429937\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 15 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22435501\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 15 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] Explicit valence for atom # 3 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:07] ERROR: Could not sanitize molecule ending on line 22435783\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:07] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:08] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:09] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:07] ERROR: Explicit valence for atom # 3 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] ERROR: Could not sanitize molecule ending on line 22790234\n",
      "RDKit ERROR: [18:54:10] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] ERROR: Could not sanitize molecule ending on line 22790361\n",
      "RDKit ERROR: [18:54:10] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] ERROR: Could not sanitize molecule ending on line 22802391\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:10] ERROR: Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] ERROR: Could not sanitize molecule ending on line 22809385\n",
      "RDKit ERROR: [18:54:10] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] ERROR: Could not sanitize molecule ending on line 22817114\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:10] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:10] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] Explicit valence for atom # 29 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:10] ERROR: Could not sanitize molecule ending on line 22862140\n",
      "RDKit ERROR: [18:54:10] ERROR: Explicit valence for atom # 29 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:11] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:11] ERROR: Could not sanitize molecule ending on line 22890105\n",
      "RDKit WARNING: [18:54:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:11] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:11] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:11] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:11] ERROR: Could not sanitize molecule ending on line 22897527\n",
      "RDKit ERROR: [18:54:11] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 22923240\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 22936591\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 22938716\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 22938845\n",
      "RDKit WARNING: [18:54:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:54:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:12] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 0 Al, 8, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 22999340\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 0 Al, 8, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 23000496\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 23000629\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 23000767\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 23000903\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 23001046\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:12] ERROR: Could not sanitize molecule ending on line 23001193\n",
      "RDKit WARNING: [18:54:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:12] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23052991\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23053108\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23053225\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23053363\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23053483\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23053603\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23053740\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23053871\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23054002\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23074189\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23074267\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23074357\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23074432\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 7 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23074528\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 15 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23079098\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 15 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23079185\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23079271\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23079340\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23079501\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:13] ERROR: Could not sanitize molecule ending on line 23079583\n",
      "RDKit WARNING: [18:54:13] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:13] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] Explicit valence for atom # 22 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] ERROR: Could not sanitize molecule ending on line 23149036\n",
      "RDKit ERROR: [18:54:14] ERROR: Explicit valence for atom # 22 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] Explicit valence for atom # 22 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] ERROR: Could not sanitize molecule ending on line 23149372\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:14] ERROR: Explicit valence for atom # 22 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] ERROR: Could not sanitize molecule ending on line 23191826\n",
      "RDKit ERROR: [18:54:14] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] Explicit valence for atom # 20 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] ERROR: Could not sanitize molecule ending on line 23192155\n",
      "RDKit ERROR: [18:54:14] ERROR: Explicit valence for atom # 20 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] Explicit valence for atom # 14 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:14] ERROR: Could not sanitize molecule ending on line 23192272\n",
      "RDKit WARNING: [18:54:14] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:14] ERROR: Explicit valence for atom # 14 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23262282\n",
      "RDKit WARNING: [18:54:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:15] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23274956\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23275084\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 21 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23295642\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 21 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23301154\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23301295\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23301448\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23301565\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23301706\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23333502\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23333644\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23333750\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23339786\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23339984\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:15] ERROR: Could not sanitize molecule ending on line 23340175\n",
      "RDKit ERROR: [18:54:15] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] Explicit valence for atom # 22 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] ERROR: Could not sanitize molecule ending on line 23359811\n",
      "RDKit ERROR: [18:54:16] ERROR: Explicit valence for atom # 22 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] Explicit valence for atom # 7 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] ERROR: Could not sanitize molecule ending on line 23360148\n",
      "RDKit ERROR: [18:54:16] ERROR: Explicit valence for atom # 7 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] Explicit valence for atom # 35 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] ERROR: Could not sanitize molecule ending on line 23425373\n",
      "RDKit ERROR: [18:54:16] ERROR: Explicit valence for atom # 35 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] Explicit valence for atom # 36 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] ERROR: Could not sanitize molecule ending on line 23425534\n",
      "RDKit ERROR: [18:54:16] ERROR: Explicit valence for atom # 36 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] Explicit valence for atom # 34 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:16] ERROR: Could not sanitize molecule ending on line 23425691\n",
      "RDKit WARNING: [18:54:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:16] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:17] WARNING: not removing hydrogen atom without neighbors\n",
      "RDKit ERROR: [18:54:16] ERROR: Explicit valence for atom # 34 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23496130\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23518752\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23518877\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23518966\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23519054\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23519151\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23519287\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23519381\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23519490\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23519578\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23519693\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23519775\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23520025\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23520108\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23520188\n",
      "RDKit WARNING: [18:54:17] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23535799\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 0 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23553161\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 0 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 0 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23553250\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 0 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 13 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23553330\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 13 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 23 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23553440\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 23 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 35 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23553592\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 35 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:17] Explicit valence for atom # 43 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:17] ERROR: Could not sanitize molecule ending on line 23564175\n",
      "RDKit ERROR: [18:54:17] ERROR: Explicit valence for atom # 43 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 27 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23584152\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 27 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 16 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23599857\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 16 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 14 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23599945\n",
      "RDKit WARNING: [18:54:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 14 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23646226\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 27 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23647125\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 27 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23647321\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23647517\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23647668\n",
      "RDKit WARNING: [18:54:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:18] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23681245\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 1 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23681654\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 1 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23686227\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23686376\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23686503\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23686652\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23686761\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:18] ERROR: Could not sanitize molecule ending on line 23686910\n",
      "RDKit ERROR: [18:54:18] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 21 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23691039\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 21 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23692015\n",
      "RDKit WARNING: [18:54:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23708861\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 39 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23709004\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 39 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23709825\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 24 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23709927\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 24 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23778107\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23778218\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23778335\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23778454\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23778571\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23778690\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23778809\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23778934\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23779061\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23779186\n",
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 6 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:19] ERROR: Could not sanitize molecule ending on line 23790932\n",
      "RDKit WARNING: [18:54:19] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:19] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] Explicit valence for atom # 27 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:20] ERROR: Could not sanitize molecule ending on line 23850570\n",
      "RDKit WARNING: [18:54:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:20] ERROR: Explicit valence for atom # 27 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:20] Explicit valence for atom # 0 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] ERROR: Could not sanitize molecule ending on line 23870336\n",
      "RDKit ERROR: [18:54:20] ERROR: Explicit valence for atom # 0 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] ERROR: Could not sanitize molecule ending on line 23870447\n",
      "RDKit ERROR: [18:54:20] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] ERROR: Could not sanitize molecule ending on line 23870558\n",
      "RDKit WARNING: [18:54:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:20] ERROR: Explicit valence for atom # 0 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] ERROR: Could not sanitize molecule ending on line 23905096\n",
      "RDKit WARNING: [18:54:20] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:20] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] ERROR: Could not sanitize molecule ending on line 23911743\n",
      "RDKit ERROR: [18:54:20] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:20] ERROR: Could not sanitize molecule ending on line 23914534\n",
      "RDKit ERROR: [18:54:20] ERROR: Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 25 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 23931840\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 25 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 18 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 23941474\n",
      "RDKit WARNING: [18:54:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 18 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 1 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 23983514\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 1 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 0 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 23983626\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 0 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 23985247\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 0 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 23985323\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 0 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 23985437\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 0 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 23985535\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 0 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 23985700\n",
      "RDKit WARNING: [18:54:21] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 0 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] Explicit valence for atom # 60 Al, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:21] ERROR: Could not sanitize molecule ending on line 24016369\n",
      "RDKit ERROR: [18:54:21] ERROR: Explicit valence for atom # 60 Al, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 8 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24053988\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 8 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24067444\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Mg, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 8 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24082636\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 8 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 8 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24082748\n",
      "RDKit WARNING: [18:54:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 8 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 29 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24104329\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 29 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 43 F, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24133658\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 43 F, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24136925\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24137048\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24137219\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24137342\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24137513\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24137626\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24137747\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24137889\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24138089\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24138210\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24138379\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24138464\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24138607\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24138749\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24138856\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 8 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24138968\n",
      "RDKit WARNING: [18:54:22] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 8 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24150245\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24150458\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24150635\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24150824\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24150969\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24151122\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24151266\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24151434\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24151584\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24151740\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24151874\n",
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:22] ERROR: Could not sanitize molecule ending on line 24152012\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:22] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 9 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24225122\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 9 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 10 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24225217\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 10 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 5 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24225301\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 5 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 5 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24225379\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 5 Ga, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24227825\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24227955\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24228124\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24228269\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24228469\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24228560\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24228662\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24228795\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24228964\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24229089\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 16 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 32 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24229224\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 32 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24229387\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24229636\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24229767\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24230147\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24230292\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24230406\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24230587\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24230725\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24230840\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24231118\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24231229\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 14 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24231401\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24231531\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24251255\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24251413\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24251597\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24251823\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24251993\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24252199\n",
      "RDKit WARNING: [18:54:23] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:23] ERROR: Could not sanitize molecule ending on line 24269846\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:54:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:23] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24313755\n",
      "RDKit WARNING: [18:54:24] WARNING: not removing hydrogen atom without neighbors\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 25 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24315586\n",
      "RDKit WARNING: [18:54:24] WARNING: not removing hydrogen atom without neighbors\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 25 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24316138\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24316228\n",
      "RDKit WARNING: [18:54:24] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24351051\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24351863\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 5 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24355269\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 5 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24382118\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24382213\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24382532\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 20 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24383126\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 20 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 35 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24383291\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 35 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 50 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24383629\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 50 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24383784\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24383909\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24384064\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24384198\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 32 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24384626\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 32 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 35 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24384791\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 35 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 20 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24384911\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 20 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24385036\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 3 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24385161\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 3 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24385256\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24385351\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24385518\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24385643\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24386173\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24386336\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24386543\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24386702\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:24] ERROR: Could not sanitize molecule ending on line 24386849\n",
      "RDKit ERROR: [18:54:24] ERROR: Explicit valence for atom # 1 C greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24389413\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24389486\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24389632\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24389763\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24389895\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24390018\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 Ge, 8, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24393155\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 Ge, 8, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 18 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24393250\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 18 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24394841\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24395259\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 2 Br, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24395849\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 2 Br, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 2 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24396010\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 2 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24396493\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24396810\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 2 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24397197\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 2 Ga, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 26 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24403333\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 26 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24403420\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24405322\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 28 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24420955\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 28 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24446761\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 16 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24446861\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 16 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 30 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24447027\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 30 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24447086\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24448452\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24448857\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 18 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24449978\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 18 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 96 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24458801\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 96 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 7 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24463362\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 7 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24463482\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 19 C greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24470587\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 19 C greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 33 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24471023\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 33 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 36 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24471172\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 36 In, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24471966\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24472062\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24472182\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24472299\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24472410\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24472600\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24472778\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24472943\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24473099\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 5 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24474012\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 5 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24474107\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24474213\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24474370\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24474527\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24474634\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24474793\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 20 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24475189\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 20 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 36 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24485082\n",
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 36 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:25] ERROR: Could not sanitize molecule ending on line 24485451\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:25] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24504827\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 79 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24505590\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 79 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24506170\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24506340\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24506540\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 41 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24506724\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 41 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 35 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24506900\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 35 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24507251\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24507420\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 34 C greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24508058\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 34 C greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24510360\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24510548\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 34 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24512876\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 22 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24513753\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 52 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24514130\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 52 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24515021\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24515178\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24516136\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24537877\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24538093\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 27 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24538221\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 27 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 39 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24538388\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 39 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24538766\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24538969\n",
      "RDKit WARNING: [18:54:26] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24587572\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24587659\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24588339\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24588486\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24588632\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24588778\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24588924\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24589070\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 10 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 36 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24590329\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 36 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 14 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24590565\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 14 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24591151\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24591922\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24592037\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 70 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24592669\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 70 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24592849\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24593023\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24593185\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 19 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24593600\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 19 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 39 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24593847\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 39 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24594036\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24594166\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 16 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24595623\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 16 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24595943\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24596656\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24596812\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 3 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24597289\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24597392\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24597543\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 23 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24598100\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 23 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 14 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24599628\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 14 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 31 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24605975\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 31 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24610510\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24610583\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24610652\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 23 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24610743\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 23 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24610874\n",
      "RDKit ERROR: [18:54:26] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:26] ERROR: Could not sanitize molecule ending on line 24611382\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24611458\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24612249\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 56 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24612627\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 56 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 1 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24613079\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 1 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 22 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24614049\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 22 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 52 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24614946\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 52 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 12 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24615714\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 12 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24615863\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 24 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24616028\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 24 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24616204\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24620952\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24621047\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 15 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24621142\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 15 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 11 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24621807\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 11 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 15 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24621902\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 15 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 11 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24622179\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 11 Br, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24622452\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 11 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24658444\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24658525\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24658612\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 35 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24662069\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 35 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24662767\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24663232\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24664126\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 12 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24664567\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 12 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24664719\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 12 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24690395\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 23 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24690556\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 23 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24690681\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 21 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24690794\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 21 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 29 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24690928\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 29 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24691062\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 21 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24691175\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 21 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 29 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24691318\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 29 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24691485\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] Explicit valence for atom # 23 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:27] ERROR: Could not sanitize molecule ending on line 24691643\n",
      "RDKit ERROR: [18:54:27] ERROR: Explicit valence for atom # 23 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24724051\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24724173\n",
      "RDKit WARNING: [18:54:28] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24730893\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24731036\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24731185\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24731340\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24731469\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24731604\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24731745\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24731892\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24739764\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24739935\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24740285\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24740770\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24740904\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24741253\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24741420\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24741557\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24742042\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24742179\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 5 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 0 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24742570\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 0 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 27 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24742701\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 27 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 6 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24764883\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 6 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 2 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24774020\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 2 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24784750\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 30 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24785084\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 30 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 8 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24785183\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 8 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 8 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24785311\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 8 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 8 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24785428\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 8 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 8 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24785554\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 8 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 30 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24785725\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 30 Ga, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 27 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24785887\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 27 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 35 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24786946\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 35 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 37 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24787101\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 37 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24787682\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24787761\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24791616\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24812876\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24813032\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24813176\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 1 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24813347\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 1 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24813437\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24813525\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24813598\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24813660\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 26 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24822375\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 26 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24823172\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 28 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24823518\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 28 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 25 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24823828\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 25 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:28] ERROR: Could not sanitize molecule ending on line 24825732\n",
      "RDKit ERROR: [18:54:28] ERROR: Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24853037\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 13 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24853890\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 13 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24855550\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 23 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 24 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24856414\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 24 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 37 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24863251\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 37 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 27 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24863377\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 27 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24863449\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 15 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24863521\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 13 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 38 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24864475\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 38 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 70 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24864738\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 70 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24864834\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 20 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 24 Al, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24866309\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 24 Al, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 26 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24868492\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 26 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 31 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24868636\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 31 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 7 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24869154\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 7 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24886249\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 33 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24886404\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 33 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 7 In, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24888772\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 7 In, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 32 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24888939\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 32 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 25 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24889773\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 25 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24922810\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:29] ERROR: Could not sanitize molecule ending on line 24946830\n",
      "RDKit ERROR: [18:54:29] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] ERROR: Could not sanitize molecule ending on line 24975925\n",
      "RDKit ERROR: [18:54:30] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] ERROR: Could not sanitize molecule ending on line 24991658\n",
      "RDKit ERROR: [18:54:30] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] ERROR: Could not sanitize molecule ending on line 24991763\n",
      "RDKit ERROR: [18:54:30] ERROR: Explicit valence for atom # 5 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] ERROR: Could not sanitize molecule ending on line 24997320\n",
      "RDKit ERROR: [18:54:30] ERROR: Explicit valence for atom # 4 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] Explicit valence for atom # 6 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] ERROR: Could not sanitize molecule ending on line 24997413\n",
      "RDKit ERROR: [18:54:30] ERROR: Explicit valence for atom # 6 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] Explicit valence for atom # 0 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:30] ERROR: Could not sanitize molecule ending on line 25027234\n",
      "RDKit ERROR: [18:54:30] ERROR: Explicit valence for atom # 0 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] Explicit valence for atom # 0 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] ERROR: Could not sanitize molecule ending on line 25077261\n",
      "RDKit ERROR: [18:54:31] ERROR: Explicit valence for atom # 0 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] ERROR: Could not sanitize molecule ending on line 25130354\n",
      "RDKit ERROR: [18:54:31] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] ERROR: Could not sanitize molecule ending on line 25130709\n",
      "RDKit ERROR: [18:54:31] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] Explicit valence for atom # 31 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] ERROR: Could not sanitize molecule ending on line 25168644\n",
      "RDKit ERROR: [18:54:31] ERROR: Explicit valence for atom # 31 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] ERROR: Could not sanitize molecule ending on line 25168867\n",
      "RDKit ERROR: [18:54:31] ERROR: Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] ERROR: Could not sanitize molecule ending on line 25169090\n",
      "RDKit ERROR: [18:54:31] ERROR: Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] ERROR: Could not sanitize molecule ending on line 25186113\n",
      "RDKit ERROR: [18:54:31] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:31] ERROR: Could not sanitize molecule ending on line 25186285\n",
      "RDKit ERROR: [18:54:31] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 34 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25225783\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 34 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25225914\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Pb, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25226069\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Pb, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25226201\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 34 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25226598\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 34 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25226871\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25226941\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25227046\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25227178\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 21 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25227340\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 21 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25227468\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25227572\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 36 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25227721\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 36 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25227830\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 17 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25228015\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 17 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25228092\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 26 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25228230\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 26 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25228367\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 27 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25228525\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 27 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25228620\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 9 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25228748\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 9 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25228995\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 35 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25229144\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 35 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 11 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25229223\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 11 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 27 Tl, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25229382\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 27 Tl, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 12 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25229479\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 12 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 31 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25229629\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 31 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25229815\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 0 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25261178\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25261357\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 9 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25261548\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 10 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:32] ERROR: Could not sanitize molecule ending on line 25288457\n",
      "RDKit WARNING: [18:54:32] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:32] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] Explicit valence for atom # 21 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] ERROR: Could not sanitize molecule ending on line 25342523\n",
      "RDKit ERROR: [18:54:33] ERROR: Explicit valence for atom # 21 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] Explicit valence for atom # 14 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] ERROR: Could not sanitize molecule ending on line 25352327\n",
      "RDKit ERROR: [18:54:33] ERROR: Explicit valence for atom # 14 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] ERROR: Could not sanitize molecule ending on line 25352476\n",
      "RDKit WARNING: [18:54:33] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:33] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] ERROR: Could not sanitize molecule ending on line 25376535\n",
      "RDKit ERROR: [18:54:33] ERROR: Explicit valence for atom # 3 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] Explicit valence for atom # 24 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] ERROR: Could not sanitize molecule ending on line 25377075\n",
      "RDKit ERROR: [18:54:33] ERROR: Explicit valence for atom # 24 Ga, 9, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] ERROR: Could not sanitize molecule ending on line 25393065\n",
      "RDKit ERROR: [18:54:33] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:33] ERROR: Could not sanitize molecule ending on line 25420279\n",
      "RDKit ERROR: [18:54:33] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25450671\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25450745\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25450831\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25450905\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25451028\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25451141\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 0 Ge, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25488211\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25488299\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25488375\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25488471\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25493402\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25493509\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25493610\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 6 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25516636\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25516761\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 6 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] Explicit valence for atom # 25 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:34] ERROR: Could not sanitize molecule ending on line 25516937\n",
      "RDKit ERROR: [18:54:34] ERROR: Explicit valence for atom # 25 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 48 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25558469\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 48 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25560940\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25561071\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25561300\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25561431\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25561672\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25561809\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25562056\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25562196\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 34 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25605747\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 34 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 35 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25605883\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 35 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25637020\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25637209\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25637416\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 57 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25637629\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 57 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:35] ERROR: Could not sanitize molecule ending on line 25648275\n",
      "RDKit ERROR: [18:54:35] ERROR: Explicit valence for atom # 19 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] Explicit valence for atom # 0 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:36] ERROR: Could not sanitize molecule ending on line 25707306\n",
      "RDKit ERROR: [18:54:36] ERROR: Explicit valence for atom # 0 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:36] Explicit valence for atom # 0 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:36] ERROR: Could not sanitize molecule ending on line 25707454\n",
      "RDKit ERROR: [18:54:36] ERROR: Explicit valence for atom # 0 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:36] Explicit valence for atom # 0 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:36] ERROR: Could not sanitize molecule ending on line 25707602\n",
      "RDKit ERROR: [18:54:36] ERROR: Explicit valence for atom # 0 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:36] Explicit valence for atom # 8 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] ERROR: Could not sanitize molecule ending on line 25713642\n",
      "RDKit ERROR: [18:54:36] ERROR: Explicit valence for atom # 8 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] Explicit valence for atom # 34 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] ERROR: Could not sanitize molecule ending on line 25733637\n",
      "RDKit ERROR: [18:54:36] ERROR: Explicit valence for atom # 34 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] Explicit valence for atom # 25 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] ERROR: Could not sanitize molecule ending on line 25773079\n",
      "RDKit ERROR: [18:54:36] ERROR: Explicit valence for atom # 25 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] Explicit valence for atom # 36 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] ERROR: Could not sanitize molecule ending on line 25773238\n",
      "RDKit ERROR: [18:54:36] ERROR: Explicit valence for atom # 36 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] Explicit valence for atom # 20 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] ERROR: Could not sanitize molecule ending on line 25773431\n",
      "RDKit ERROR: [18:54:36] ERROR: Explicit valence for atom # 20 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] Explicit valence for atom # 32 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:36] ERROR: Could not sanitize molecule ending on line 25774049\n",
      "RDKit ERROR: [18:54:36] ERROR: Explicit valence for atom # 32 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:37] Explicit valence for atom # 61 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:37] ERROR: Could not sanitize molecule ending on line 25851405\n",
      "RDKit WARNING: [18:54:37] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:37] ERROR: Explicit valence for atom # 61 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:37] Explicit valence for atom # 0 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:37] ERROR: Could not sanitize molecule ending on line 25898812\n",
      "RDKit ERROR: [18:54:37] ERROR: Explicit valence for atom # 0 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:37] Explicit valence for atom # 13 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:37] ERROR: Could not sanitize molecule ending on line 25899144\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 13 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 6 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25899606\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 6 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 6 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25899716\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 6 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 2 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25899821\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 2 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 2 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25899938\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 2 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 2 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25900046\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 2 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25957132\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25957221\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25958686\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25959735\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 24 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25974478\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 24 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25974666\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25974860\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25975060\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25975266\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25975460\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25975642\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25975830\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25976018\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25976212\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25976409\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25976588\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25976779\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25976970\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25977167\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25977346\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25977528\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25977716\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25977904\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25978098\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25978292\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25978498\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25978698\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25978892\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25979080\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:38] ERROR: Could not sanitize molecule ending on line 25979262\n",
      "RDKit ERROR: [18:54:38] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:39] Explicit valence for atom # 9 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:39] ERROR: Could not sanitize molecule ending on line 26013121\n",
      "RDKit WARNING: [18:54:39] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:39] ERROR: Explicit valence for atom # 9 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:39] Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:39] ERROR: Could not sanitize molecule ending on line 26112785\n",
      "RDKit ERROR: [18:54:39] ERROR: Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:39] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:39] ERROR: Could not sanitize molecule ending on line 26112886\n",
      "RDKit ERROR: [18:54:39] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26153342\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 48 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26163404\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 48 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 3 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26171340\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 3 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26174144\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26174344\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26174527\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26174697\n",
      "RDKit WARNING: [18:54:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26212778\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26212857\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26213247\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 2 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 10 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26213348\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 10 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 9 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26213461\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 9 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 7 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26213567\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 7 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 51 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26215579\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 51 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 57 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26215840\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 57 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26216226\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:40] ERROR: Could not sanitize molecule ending on line 26218838\n",
      "RDKit WARNING: [18:54:40] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:40] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:41] Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:41] ERROR: Could not sanitize molecule ending on line 26281333\n",
      "RDKit ERROR: [18:54:41] ERROR: Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:41] Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:41] ERROR: Could not sanitize molecule ending on line 26281554\n",
      "RDKit WARNING: [18:54:41] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:41] ERROR: Explicit valence for atom # 10 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:41] Explicit valence for atom # 43 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:41] ERROR: Could not sanitize molecule ending on line 26345925\n",
      "RDKit ERROR: [18:54:41] ERROR: Explicit valence for atom # 43 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] ERROR: Could not sanitize molecule ending on line 26372705\n",
      "RDKit ERROR: [18:54:42] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] ERROR: Could not sanitize molecule ending on line 26372831\n",
      "RDKit ERROR: [18:54:42] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] ERROR: Could not sanitize molecule ending on line 26373208\n",
      "RDKit ERROR: [18:54:42] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] ERROR: Could not sanitize molecule ending on line 26380869\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:54:42] WARNING: not removing hydrogen atom without neighbors\n",
      "RDKit ERROR: [18:54:42] ERROR: Explicit valence for atom # 0 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] ERROR: Could not sanitize molecule ending on line 26423401\n",
      "RDKit ERROR: [18:54:42] ERROR: Explicit valence for atom # 8 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] Explicit valence for atom # 7 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:42] ERROR: Could not sanitize molecule ending on line 26423606\n",
      "RDKit ERROR: [18:54:42] ERROR: Explicit valence for atom # 7 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:42] Explicit valence for atom # 6 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:42] ERROR: Could not sanitize molecule ending on line 26423805\n",
      "RDKit ERROR: [18:54:42] ERROR: Explicit valence for atom # 6 Bi greater than permitted\n",
      "RDKit ERROR: [18:54:42] Explicit valence for atom # 18 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] ERROR: Could not sanitize molecule ending on line 26446733\n",
      "RDKit ERROR: [18:54:42] ERROR: Explicit valence for atom # 18 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:42] ERROR: Could not sanitize molecule ending on line 26469070\n",
      "RDKit ERROR: [18:54:42] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 3 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26532345\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 3 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 6 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26532455\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 6 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 3 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26532589\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 3 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 0 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26532835\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 0 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 3 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26532961\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 3 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 3 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26533095\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 3 B, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 1 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26559283\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 1 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26559459\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 1 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26559645\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 1 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26559827\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 1 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 1 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26560025\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 1 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] Explicit valence for atom # 36 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:43] ERROR: Could not sanitize molecule ending on line 26588218\n",
      "RDKit WARNING: [18:54:44] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:43] ERROR: Explicit valence for atom # 36 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26801983\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26802114\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26802255\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26802363\n",
      "RDKit WARNING: [18:54:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 0 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 2 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26828336\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 2 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 2 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26828459\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 2 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 20 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26828562\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 20 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 20 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26828661\n",
      "RDKit WARNING: [18:54:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 20 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 2 Al, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26831207\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 2 Al, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] Explicit valence for atom # 2 Al, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:45] ERROR: Could not sanitize molecule ending on line 26831313\n",
      "RDKit WARNING: [18:54:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:45] ERROR: Explicit valence for atom # 2 Al, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26864052\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26910562\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 7 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26929534\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 7 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26933712\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26933805\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26933906\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26933987\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26934050\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26934121\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26934231\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26934323\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:46] ERROR: Could not sanitize molecule ending on line 26934423\n",
      "RDKit WARNING: [18:54:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:47] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:46] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27072273\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27072355\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27072431\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27072547\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27072658\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27072797\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27072879\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 13 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27078213\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 13 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 13 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27078376\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 13 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 41 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27078546\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 41 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 40 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27078714\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 40 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 49 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27113538\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 49 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 3 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27125025\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 3 Sn, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] Explicit valence for atom # 18 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:48] ERROR: Could not sanitize molecule ending on line 27125177\n",
      "RDKit WARNING: [18:54:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:48] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:48] ERROR: Explicit valence for atom # 18 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27194421\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27194581\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27194765\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27194942\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 18 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27195132\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 18 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 18 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27195315\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 18 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27195593\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 33 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27195895\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 33 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27232014\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27232219\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27232445\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27232648\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27232853\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27233064\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27233281\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27233509\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27233725\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27233947\n",
      "RDKit WARNING: [18:54:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 20 N, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 8 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27246178\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 8 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 8 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27246391\n",
      "RDKit WARNING: [18:54:49] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 8 B, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 32 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27291519\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 32 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 30 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27291686\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 30 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 23 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27291858\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 23 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 23 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27292032\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 23 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] Explicit valence for atom # 24 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:49] ERROR: Could not sanitize molecule ending on line 27292212\n",
      "RDKit ERROR: [18:54:49] ERROR: Explicit valence for atom # 24 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] ERROR: Could not sanitize molecule ending on line 27312940\n",
      "RDKit ERROR: [18:54:50] ERROR: Explicit valence for atom # 0 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] ERROR: Could not sanitize molecule ending on line 27313030\n",
      "RDKit ERROR: [18:54:50] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] Explicit valence for atom # 2 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] ERROR: Could not sanitize molecule ending on line 27313124\n",
      "RDKit ERROR: [18:54:50] ERROR: Explicit valence for atom # 2 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] ERROR: Could not sanitize molecule ending on line 27335539\n",
      "RDKit ERROR: [18:54:50] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] Explicit valence for atom # 0 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] ERROR: Could not sanitize molecule ending on line 27339195\n",
      "RDKit WARNING: [18:54:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:50] ERROR: Explicit valence for atom # 0 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] ERROR: Could not sanitize molecule ending on line 27379638\n",
      "RDKit WARNING: [18:54:50] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:50] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] Explicit valence for atom # 37 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:50] ERROR: Could not sanitize molecule ending on line 27414069\n",
      "RDKit WARNING: [18:54:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:50] ERROR: Explicit valence for atom # 37 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:51] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:51] ERROR: Could not sanitize molecule ending on line 27467674\n",
      "RDKit ERROR: [18:54:51] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:51] Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:51] ERROR: Could not sanitize molecule ending on line 27467776\n",
      "RDKit ERROR: [18:54:51] ERROR: Explicit valence for atom # 7 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:51] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:51] ERROR: Could not sanitize molecule ending on line 27467931\n",
      "RDKit WARNING: [18:54:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:51] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:51] Explicit valence for atom # 13 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:51] ERROR: Could not sanitize molecule ending on line 27497400\n",
      "RDKit WARNING: [18:54:51] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:51] WARNING: not removing hydrogen atom without neighbors\n",
      "RDKit WARNING: [18:54:51] WARNING: not removing hydrogen atom without neighbors\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:51] ERROR: Explicit valence for atom # 13 O, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 33 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27548157\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 33 Cl, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 0 Sb greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27613186\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 0 Sb greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 8 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27613306\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 8 Ge greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27613423\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 0 Ge, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27613566\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 0 Tl, 7, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 0 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27613653\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 0 Sn greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 0 Pb greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27613740\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 0 Pb greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27640458\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27640556\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27640773\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:52] ERROR: Could not sanitize molecule ending on line 27640875\n",
      "RDKit ERROR: [18:54:52] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] Explicit valence for atom # 8 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] ERROR: Could not sanitize molecule ending on line 27666659\n",
      "RDKit ERROR: [18:54:53] ERROR: Explicit valence for atom # 8 B, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] Explicit valence for atom # 28 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] ERROR: Could not sanitize molecule ending on line 27681059\n",
      "RDKit WARNING: [18:54:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:53] ERROR: Explicit valence for atom # 28 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] ERROR: Could not sanitize molecule ending on line 27721677\n",
      "RDKit ERROR: [18:54:53] ERROR: Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] ERROR: Could not sanitize molecule ending on line 27721852\n",
      "RDKit ERROR: [18:54:53] ERROR: Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] ERROR: Could not sanitize molecule ending on line 27721987\n",
      "RDKit ERROR: [18:54:53] ERROR: Explicit valence for atom # 4 F, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] ERROR: Could not sanitize molecule ending on line 27722082\n",
      "RDKit ERROR: [18:54:53] ERROR: Explicit valence for atom # 9 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] ERROR: Could not sanitize molecule ending on line 27722233\n",
      "RDKit ERROR: [18:54:53] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] ERROR: Could not sanitize molecule ending on line 27722408\n",
      "RDKit ERROR: [18:54:53] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:53] ERROR: Could not sanitize molecule ending on line 27722558\n",
      "RDKit WARNING: [18:54:53] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:54] WARNING: not removing hydrogen atom without neighbors\n",
      "RDKit ERROR: [18:54:53] ERROR: Explicit valence for atom # 2 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 22 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27772776\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 22 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27805334\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27831210\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27831355\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27831500\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27831645\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27831790\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27831934\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 7 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832063\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832163\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832270\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 13 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832385\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 13 C, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 21 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832493\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 21 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 19 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832593\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 19 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832685\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832781\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832889\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 15 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27832989\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27833105\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 13 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27833205\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27833307\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27833393\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27833479\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27833580\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27833666\n",
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 5 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:54] ERROR: Could not sanitize molecule ending on line 27833756\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:54] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:55] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:55] ERROR: Could not sanitize molecule ending on line 27875869\n",
      "RDKit ERROR: [18:54:55] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:55] Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:55] ERROR: Could not sanitize molecule ending on line 27875957\n",
      "RDKit ERROR: [18:54:55] ERROR: Explicit valence for atom # 1 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:55] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:55] ERROR: Could not sanitize molecule ending on line 27876080\n",
      "RDKit ERROR: [18:54:55] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:55] Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:55] ERROR: Could not sanitize molecule ending on line 27893149\n",
      "RDKit WARNING: [18:54:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit WARNING: [18:54:55] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:55] ERROR: Explicit valence for atom # 11 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 7 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28003338\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 7 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28003516\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28003644\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28043321\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28043407\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28043510\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28043638\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28043762\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 14 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28043882\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 14 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:56] ERROR: Could not sanitize molecule ending on line 28044017\n",
      "RDKit ERROR: [18:54:56] ERROR: Explicit valence for atom # 12 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28099047\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28099174\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28099306\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28099401\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28099504\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28099774\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28099929\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28100019\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28100201\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28100372\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28100459\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28100823\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28100990\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28101163\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28101555\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28101669\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28101776\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28101895\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28101978\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28102652\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit WARNING: [18:54:57] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28167622\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 1 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28167775\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 Cl, 2, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 28 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28167920\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 28 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 34 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28168080\n",
      "RDKit WARNING: [18:54:57] WARNING: not removing hydrogen atom without neighbors\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 34 Sn, 6, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28192616\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28192714\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28194167\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28194364\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28194573\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28194774\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 8 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28194969\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28195166\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28195365\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28195566\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28195655\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 4 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28195780\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28195909\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28196038\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28196167\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28197966\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 0 B, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28212777\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28212937\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28213089\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28213245\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28213420\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:57] ERROR: Could not sanitize molecule ending on line 28213569\n",
      "RDKit ERROR: [18:54:57] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28226077\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28226266\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28226467\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28232113\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28232280\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28232453\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28233166\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28235269\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28235372\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28235475\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28235594\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28235691\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28235788\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28235901\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 34 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28240689\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 34 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28247818\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28247952\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 39 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28248151\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 39 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 42 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28248338\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 42 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28253069\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28253514\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28254233\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28254366\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28254862\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28255043\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 53 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28258130\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 53 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 49 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28258404\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 49 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 60 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28258662\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 60 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 53 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28258931\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 53 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28259563\n",
      "RDKit WARNING: [18:54:58] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28262218\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28262522\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 24 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28264110\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 24 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28265306\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 30 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28265673\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 30 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 24 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28274806\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 24 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28274945\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28275036\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 40 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28276360\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 40 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28276810\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28277831\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 19 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28283171\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28284939\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28285007\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28285334\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 14 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28285419\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 14 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 30 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28286192\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 30 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28286787\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28288701\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28295980\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28296168\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28296289\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28296370\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28296525\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 6 O, 3, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28296846\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28297047\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28297640\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28303470\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 3 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28303535\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28303597\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28303698\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28305857\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28305960\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 35 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28308557\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 35 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28310754\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28310919\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28311001\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28311089\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28311159\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 2 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28311223\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 1 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28311323\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28313324\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 25 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28313633\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 25 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28313824\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28314382\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 67 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28316036\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 67 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 63 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28316421\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 63 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 81 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28316806\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 81 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] Explicit valence for atom # 81 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:58] ERROR: Could not sanitize molecule ending on line 28317191\n",
      "RDKit ERROR: [18:54:58] ERROR: Explicit valence for atom # 81 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28323185\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28324388\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28326395\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28326741\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28327691\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28327783\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28329683\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 31 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28333560\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 31 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28335290\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28336750\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 34 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28338246\n",
      "RDKit WARNING: [18:54:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 34 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28347790\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 8 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28350929\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28351039\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28352023\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28360244\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28361233\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 34 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28361622\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 34 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 60 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28362193\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 60 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 60 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28362515\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 60 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 60 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28362834\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 60 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28363507\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28364384\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28364695\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 25 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28364822\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 25 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28364955\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 20 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28365116\n",
      "RDKit WARNING: [18:54:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 17 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28366048\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28367990\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28368164\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28368326\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28368522\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28369359\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 4 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28369621\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28369968\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28370131\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 14 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28370215\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 14 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28370395\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28371035\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28371209\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28371315\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28371402\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28371510\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28371618\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 0 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28372400\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28372702\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 14 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28372791\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 14 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28373078\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28373356\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28373989\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 13 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28374504\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28376641\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 50 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28380880\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 50 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28382620\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28382747\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28382876\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28383007\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28383440\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28383516\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28383604\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28383692\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28383774\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 12 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28383862\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 11 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28384536\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28392238\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 6 C, 5, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28395279\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28395330\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28395390\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28395454\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28395524\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 10 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28395571\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 6 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 9 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28395662\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 9 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28403287\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 31 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28407627\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 31 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28409003\n",
      "RDKit WARNING: [18:54:59] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28410887\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28412095\n"
     ]
    },
    {
     "name": "stderr",
     "output_type": "stream",
     "text": [
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 5 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 25 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28416779\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 25 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28419599\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28419710\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28419927\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 22 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28424030\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 27 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28426047\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 28 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:54:59] ERROR: Could not sanitize molecule ending on line 28427982\n",
      "RDKit ERROR: [18:54:59] ERROR: Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28437654\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28437856\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28438029\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28438177\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 15 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28438478\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 21 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 38 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28449719\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 38 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 51 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28450122\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 51 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 51 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28450469\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 51 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28457058\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 26 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28457911\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 33 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 23 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28461109\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 23 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 23 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28461233\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 23 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28466952\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 32 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 23 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28468130\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 23 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28468344\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 16 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28468826\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 18 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 35 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28470474\n",
      "RDKit ERROR: [18:55:00] ERROR: Explicit valence for atom # 35 N, 4, is greater than permitted\n",
      "RDKit ERROR: [18:55:00] Explicit valence for atom # 31 Na greater than permitted\n",
      "RDKit ERROR: [18:55:00] ERROR: Could not sanitize molecule ending on line 28519301\n"
     ]
    }
   ],
   "source": [
    "sdfFile = os.path.join(DATASET_PATH ,DATASET_FILENAME)\n",
    "frame = PandasTools.LoadSDF(sdfFile,smilesName='SMILES',molColName='Molecule',\n",
    "           includeFingerprints=False)\n"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 6,
   "metadata": {},
   "outputs": [
    {
     "name": "stdout",
     "output_type": "stream",
     "text": [
      "<class 'pandas.core.frame.DataFrame'>\n",
      "Int64Index: 248251 entries, 0 to 250249\n",
      "Data columns (total 14 columns):\n",
      " #   Column             Non-Null Count   Dtype \n",
      "---  ------             --------------   ----- \n",
      " 0   NSC Number         248251 non-null  object\n",
      " 1   Molecular Weight   248251 non-null  object\n",
      " 2   ACD Name           225562 non-null  object\n",
      " 3   Availabe Name Set  225562 non-null  object\n",
      " 4   CAS Number         126910 non-null  object\n",
      " 5   Formula            248251 non-null  object\n",
      " 6   SMILES             248251 non-null  object\n",
      " 7   KOW logP           214648 non-null  object\n",
      " 8   Experimental logP  3576 non-null    object\n",
      " 9   ID                 248251 non-null  object\n",
      " 10  Molecule           248251 non-null  object\n",
      " 11  Drug Likeness std  230014 non-null  object\n",
      " 12  Drug Likeness neg  230014 non-null  object\n",
      " 13  ACD logP           8913 non-null    object\n",
      "dtypes: object(14)\n",
      "memory usage: 28.4+ MB\n"
     ]
    }
   ],
   "source": [
    "frame.info()"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 7,
   "metadata": {},
   "outputs": [],
   "source": [
    "frame = frame.drop(columns = list(set(list(frame))-set(['SMILES','Experimental logP'])))"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 8,
   "metadata": {},
   "outputs": [
    {
     "name": "stdout",
     "output_type": "stream",
     "text": [
      "<class 'pandas.core.frame.DataFrame'>\n",
      "Int64Index: 248251 entries, 0 to 250249\n",
      "Data columns (total 2 columns):\n",
      " #   Column             Non-Null Count   Dtype \n",
      "---  ------             --------------   ----- \n",
      " 0   SMILES             248251 non-null  object\n",
      " 1   Experimental logP  3576 non-null    object\n",
      "dtypes: object(2)\n",
      "memory usage: 5.7+ MB\n"
     ]
    }
   ],
   "source": [
    "frame.info()"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 11,
   "metadata": {},
   "outputs": [],
   "source": [
    "frame['logP'] = pd.to_numeric(frame['Experimental logP'])\n",
    "frame['smiles'] = frame['SMILES']\n",
    "\n",
    "PROCESSED_PATH = '../data/1_filtering/'\n",
    "\n",
    "frame[['smiles','logP']].to_csv(os.path.join(PROCESSED_PATH,'NCIDataset.csv'))"
   ]
  },
  {
   "cell_type": "markdown",
   "metadata": {},
   "source": [
    "## Getting info about dataset"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 1,
   "metadata": {},
   "outputs": [],
   "source": [
    "import pandas as pd\n",
    "import os\n",
    "import seaborn as sns"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 2,
   "metadata": {},
   "outputs": [],
   "source": [
    "DATASET_PATH = '../data/1_filtering/'\n",
    "DATASET_FILENAME = 'NCIDataset.csv'"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 3,
   "metadata": {},
   "outputs": [],
   "source": [
    "logp_data = pd.read_csv(os.path.join(DATASET_PATH,DATASET_FILENAME), index_col = 0)"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 4,
   "metadata": {},
   "outputs": [],
   "source": [
    "VALUE_COLUMN = \"logP\"\n",
    "\n",
    "SMILES_COLUMN = \"smiles\"\n",
    "\n",
    "n = logp_data.shape[0]"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 5,
   "metadata": {},
   "outputs": [
    {
     "name": "stdout",
     "output_type": "stream",
     "text": [
      "# of NA values logP = 244675, 98%\n"
     ]
    },
    {
     "data": {
      "text/html": [
       "<div>\n",
       "<style scoped>\n",
       "    .dataframe tbody tr th:only-of-type {\n",
       "        vertical-align: middle;\n",
       "    }\n",
       "\n",
       "    .dataframe tbody tr th {\n",
       "        vertical-align: top;\n",
       "    }\n",
       "\n",
       "    .dataframe thead th {\n",
       "        text-align: right;\n",
       "    }\n",
       "</style>\n",
       "<table border=\"1\" class=\"dataframe\">\n",
       "  <thead>\n",
       "    <tr style=\"text-align: right;\">\n",
       "      <th></th>\n",
       "      <th>smiles</th>\n",
       "      <th>logP</th>\n",
       "    </tr>\n",
       "  </thead>\n",
       "  <tbody>\n",
       "    <tr>\n",
       "      <th>1</th>\n",
       "      <td>c1ccc2sc(SSc3nc4ccccc4s3)nc2c1</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>2</th>\n",
       "      <td>O=[N+]([O-])c1cc(Cl)c(O)c([N+](=O)[O-])c1</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>3</th>\n",
       "      <td>N=c1[nH]cc([N+](=O)[O-])s1</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>4</th>\n",
       "      <td>Nc1ccc2c(c1)C(=O)c1ccccc1C2=O</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>5</th>\n",
       "      <td>O=C(O)c1ccccc1-c1c2ccc(=O)c(Br)c-2oc2c(Br)c(O)...</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>...</th>\n",
       "      <td>...</td>\n",
       "      <td>...</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>250245</th>\n",
       "      <td>CC1=C(C)C2(C)OC2(C)OC2(C)OC12C</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>250246</th>\n",
       "      <td>CC12OC3(C)OC3(C)C3(C)OC3(C)C1(C)O2</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>250247</th>\n",
       "      <td>O1C2C1C1OC1C1OC1C1OC21</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>250248</th>\n",
       "      <td>O1C2C1C1OC1C1OC1C1OC21</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>250249</th>\n",
       "      <td>O=C1Cc2c([nH]c3ccc([N+](=O)[O-])cc23)-c2ccccc2N1</td>\n",
       "      <td>NaN</td>\n",
       "    </tr>\n",
       "  </tbody>\n",
       "</table>\n",
       "<p>244675 rows × 2 columns</p>\n",
       "</div>"
      ],
      "text/plain": [
       "                                                   smiles  logP\n",
       "1                          c1ccc2sc(SSc3nc4ccccc4s3)nc2c1   NaN\n",
       "2               O=[N+]([O-])c1cc(Cl)c(O)c([N+](=O)[O-])c1   NaN\n",
       "3                              N=c1[nH]cc([N+](=O)[O-])s1   NaN\n",
       "4                           Nc1ccc2c(c1)C(=O)c1ccccc1C2=O   NaN\n",
       "5       O=C(O)c1ccccc1-c1c2ccc(=O)c(Br)c-2oc2c(Br)c(O)...   NaN\n",
       "...                                                   ...   ...\n",
       "250245                     CC1=C(C)C2(C)OC2(C)OC2(C)OC12C   NaN\n",
       "250246                 CC12OC3(C)OC3(C)C3(C)OC3(C)C1(C)O2   NaN\n",
       "250247                             O1C2C1C1OC1C1OC1C1OC21   NaN\n",
       "250248                             O1C2C1C1OC1C1OC1C1OC21   NaN\n",
       "250249   O=C1Cc2c([nH]c3ccc([N+](=O)[O-])cc23)-c2ccccc2N1   NaN\n",
       "\n",
       "[244675 rows x 2 columns]"
      ]
     },
     "execution_count": 5,
     "metadata": {},
     "output_type": "execute_result"
    }
   ],
   "source": [
    "# check NA values\n",
    "num_of_na_value = logp_data[VALUE_COLUMN].isna().sum()\n",
    "frac_of_na_value = int(100.0*(num_of_na_value / n))\n",
    "print(\"# of NA values logP = \" + str(num_of_na_value) + \", \" + str(frac_of_na_value) + \"%\")\n",
    "logp_data[logp_data[VALUE_COLUMN].isna()]"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 6,
   "metadata": {},
   "outputs": [],
   "source": [
    "# drop NA values\n",
    "logp_data = logp_data[logp_data[VALUE_COLUMN].notna()]"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 7,
   "metadata": {},
   "outputs": [
    {
     "data": {
      "text/html": [
       "<div>\n",
       "<style scoped>\n",
       "    .dataframe tbody tr th:only-of-type {\n",
       "        vertical-align: middle;\n",
       "    }\n",
       "\n",
       "    .dataframe tbody tr th {\n",
       "        vertical-align: top;\n",
       "    }\n",
       "\n",
       "    .dataframe thead th {\n",
       "        text-align: right;\n",
       "    }\n",
       "</style>\n",
       "<table border=\"1\" class=\"dataframe\">\n",
       "  <thead>\n",
       "    <tr style=\"text-align: right;\">\n",
       "      <th></th>\n",
       "      <th>logP</th>\n",
       "    </tr>\n",
       "  </thead>\n",
       "  <tbody>\n",
       "    <tr>\n",
       "      <th>count</th>\n",
       "      <td>3576.000000</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>mean</th>\n",
       "      <td>1.663588</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>std</th>\n",
       "      <td>1.983118</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>min</th>\n",
       "      <td>-5.080000</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>25%</th>\n",
       "      <td>0.517500</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>50%</th>\n",
       "      <td>1.760000</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>75%</th>\n",
       "      <td>2.840000</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>max</th>\n",
       "      <td>10.200000</td>\n",
       "    </tr>\n",
       "  </tbody>\n",
       "</table>\n",
       "</div>"
      ],
      "text/plain": [
       "              logP\n",
       "count  3576.000000\n",
       "mean      1.663588\n",
       "std       1.983118\n",
       "min      -5.080000\n",
       "25%       0.517500\n",
       "50%       1.760000\n",
       "75%       2.840000\n",
       "max      10.200000"
      ]
     },
     "execution_count": 7,
     "metadata": {},
     "output_type": "execute_result"
    }
   ],
   "source": [
    "logp_data.describe()"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 8,
   "metadata": {},
   "outputs": [
    {
     "data": {
      "text/plain": [
       "<matplotlib.axes._subplots.AxesSubplot at 0x7fed143c7e90>"
      ]
     },
     "execution_count": 8,
     "metadata": {},
     "output_type": "execute_result"
    },
    {
     "data": {
      "image/png": "iVBORw0KGgoAAAANSUhEUgAAAXoAAAEGCAYAAABrQF4qAAAABHNCSVQICAgIfAhkiAAAAAlwSFlzAAALEgAACxIB0t1+/AAAADh0RVh0U29mdHdhcmUAbWF0cGxvdGxpYiB2ZXJzaW9uMy4xLjMsIGh0dHA6Ly9tYXRwbG90bGliLm9yZy+AADFEAAAgAElEQVR4nO3deXRc5Z3n//e3Svtq7ZYl2/K+YcBYtiG4A8GEOHSAJNANIQuZpA+d7mSm8+vT00NOZpIeMv37JZ3TPT3966QDCUx3aAgEyOIhTgwYs4Nt2Rgb27IteZFkW5slWftaz/xRpSALySpbUt2q0ud1jo6q7n1u6euS9PGj5977POacQ0RE4pfP6wJERGR6KehFROKcgl5EJM4p6EVE4pyCXkQkziV4XcBo+fn5rqyszOsyRERiyp49e5qdcwVj7Yu6oC8rK6OiosLrMkREYoqZnRpvn4ZuRETinIJeRCTOKehFROKcgl5EJM4p6EVE4pyCXkQkzinoRUTinIJeRCTOKehFROJc1N0ZKzKdnthZ84Ft926Y50ElIpGjHr2ISJxT0IuIxDkFvYhInFPQi4jEOQW9iEicU9CLiMQ5Bb2ISJxT0IuIxDkFvYhInFPQi4jEOQW9iEicU9CLiMS5sILezDab2REzqzKzB8bY/5dmdsjM9pvZdjObP2LfkJntC31smcriRURkYhPOXmlmfuAHwEeBOmC3mW1xzh0a0ewdoNw5121mfwb8HXB3aF+Pc+7qKa5bRETCFE6Pfj1Q5Zw77pzrB54E7hjZwDm3wznXHXr6NlA6tWWKiMjlCifoS4DaEc/rQtvG82XgtyOep5hZhZm9bWafHOsAM7s/1KaiqakpjJJERCRc4Sw8YmNsc2M2NPscUA7cMGLzPOfcGTNbCLxkZgecc9UXvJhzDwMPA5SXl4/52iIicnnC6dHXAXNHPC8FzoxuZGY3A98EbnfO9Q1vd86dCX0+DrwMrJlEvSKTNhRwvFndTG1L98SNReJAOD363cASM1sAnAbuAe4d2cDM1gAPAZudc40jtucA3c65PjPLB64neKJWxBMB53h6Ty37684DsLQogzXzZrGiOMvjykSmz4Q9eufcIPA1YBtwGPi5c+6gmT1oZreHmn0fyACeHnUZ5QqgwszeBXYA3x11tY5IxAQCjmf31LG/7jw3ryjiY6tmU9faw+cf2UXvwJDX5YlMm7AWB3fObQW2jtr2rRGPbx7nuDeB1ZMpUGSq/Pi147xT28bNKwq5aXkhAHNzU/nJayd4anct932ozNsCRaZJWEEvEuv6Bof48WsnWFyYwU3Li36/fUFeOvPz0viHF45iBgm+9//IvXfDPC9KFZlyCnqJS0/srLngecXJFpo7+7j9qjkXbDczPrKskH998yT7atooL8uNZJkiEaG5biTuBZzjtapmirNTWFSQ/oH9SwozKJmVystHmxgK6OpeiT8Keol7Rxs6aOro4w+W5GP2wdtCzIwblhbQ0tVPVWOnBxWKTC8FvcS91481k52ayOqSWeO2WTY7kyS/j8P17RGsTCQyFPQS19q6+zne3MW6shz8vrFu8g5K9PtYUpRB5dl2Ak7DNxJfFPQS1947E+yhX1k6fm9+2IriLNp7BznT1jPdZYlElIJe4tqBujbmZKeQn5E8YdtlRZkYcPishm8kvijoJW61dvVT29rD6pLssNqnJycwPy+dw2c7prkykchS0EvcOnA6OJ/N6jCGbYatKM6kvr2Xlq7+6SpLJOIU9BK3Dpw+T8msVHLTk8I+ZmVocjMN30g8UdBLXGrp6ud0W/jDNsPyMpIpyEjmaIOGbyR+KOglLg33yFfNufTphxcXZnDyXJdmtJS4oaCXuHSkvoOCjGTywrjaZrTFhRkMDDn21rROQ2Uikaegl7jT2TfIieYuls3OvKzjF+Sn47PgHbUi8UBBL3Hnjapmhpy77KBPSfQzNyeN16sU9BIfFPQSd3ZUNpKc4KMs74MzVYZrcWEGB06fp61bl1lK7FPQS1xxzrHjSCOLCzMuOrfNRBYXZuAcvFl9bgqrE/GGgl7iysEz7TS097H8ModthpXmpJGRnMBrGqeXOKCgl7jy8pFGAJYWTS7o/T7j2oV5vF7VNBVliXhKQS9x5aXKRq4szSYzJXHSr/UHS/Kpbemh5lz3FFQm4h0FvcSNlq5+3qlt48ZlhVPyetcvzgfgNfXqJcYp6CVuvHK0EefgpuVTE/SLCtIpzk7R9fQS8xT0Ejd2VDaRn5HElZc4v814zIyNi/N5s/qcFg2XmKagl7gwOBTglaNN3LC0EN8kLqscbeOSfM73DPBeaMpjkVikoJe48E5tG+d7BvjI8oIpfd3hcXrdJSuxTEEvceGlykb8PuMPlkxt0OdnJLOiOIvXjumErMQuBb3EhR2VjZTPzyE7dfKXVY62cXEee0+10d0/OOWvLRIJCnqJeWfaeqis75iyq21G27ikgP6hALtOtEzL64tMt7CC3sw2m9kRM6syswfG2P+XZnbIzPab2XYzmz9i331mdiz0cd9UFi8CsCN0N+x0Bf36slySE3y8fETDNxKbJgx6M/MDPwA+DqwEPmNmK0c1ewcod85dCTwD/F3o2Fzg28AGYD3wbTPLmbryRYLDNiWzUllcmDEtr5+a5Gfj4nxePNyAc7rMUmJPQhht1gNVzrnjAGb2JHAHcGi4gXNux4j2bwOfCz3+GPCCc64ldOwLwGbgZ5MvXQR6B4Z4o+ocd60txWzqLqscbdOKIrZXNvI/XzzG7KyUC/bdu2HetH1dkakQztBNCVA74nldaNt4vgz89lKONbP7zazCzCqamvTnsYRv54kWegaGpm3YZtjw61eG1qIViSXh9OjH6iaN+fermX0OKAduuJRjnXMPAw8DlJeX629jCduOykYSfEZNSzdP7KyZtq8zOzuFK0qyqKzvmLK5dEQiJZygrwPmjnheCpwZ3cjMbga+CdzgnOsbceyNo459+XIKFQEuCHPnHFvePcOiggwS/VN/Adno/zgKM1M4eLqRzr5BMpLD+dURiQ7h/HbsBpaY2QIzSwLuAbaMbGBma4CHgNudc40jdm0DbjGznNBJ2FtC20Qmramzj5au/steG/ZSrZidhQOO1ndE5OuJTJUJg945Nwh8jWBAHwZ+7pw7aGYPmtntoWbfBzKAp81sn5ltCR3bAnyH4H8Wu4EHh0/MikzWkVDgLpvkIiPhmjMrhayUBA7Xa5xeYktYf38657YCW0dt+9aIxzdf5NhHgUcvt0CR8Rw6087srBRy0pMi8vXMjOXFWeyraWNgKDAtw0Ui00E/qRKTOnoHqGnpZuWcrIh+3ZXFWfQPBahu7Izo1xWZDAW9xKTDZztwwKoIB/3CgnSSE3wc0mWWEkMU9BKTDp09T05a4gduXppuCT4fy2ZncvhsOwHdJSsxQkEvMad3YIjqpi5Wzcme1rthx7OyOIuu/iFOadFwiREKeok5Rxo6GAo4VhZHdthm2LKiTPw+49AZrTolsUFBLzHn0Jl20pMTmJeX5snXT070s7ggg0Nn2zXJmcQEBb3ElIGhAEcaOlhZnInPg2GbYSuLs2jtHqC+vdezGkTCpaCXmFLd1En/YICVxdme1rG8OBMj+NeFSLRT0EtMOXSmneQEH4sK0j2tIzMlkXm5abrMUmKCgl5ixlDAcfhsO8tmZ5IQBXelrpyTxdnzvdS26OobiW7e/7aIhKniZAtd/UOeXW0z2nAd2w7We1yJyMUp6CVmbDvYQILPIjaJ2UTyMpKZnZXC84cavC5F5KIU9BITnHNsO1jPooIMkhP9XpfzeyuKs6g42cK5zr6JG4t4REEvMeHgmXZOt/VEfG6biayck0XAwfbDjRM3FvGIgl5iwvMH6/EZLI+S8flhc7JTmJOdwouHNXwj0UvroUlM2HawgfKy3Khbws/MmDMrlVeONvHYW6fw+96/ieveDfM8rEzkferRS9Q72dzFkYYOPrZqtteljGlJUSZ9gwHqWnWZpUQnBb1EveHLF29ZWeRxJWNbXJCBAce0GIlEKQW9RL3nDzWwak4Wc3O9mcRsIqlJfkpzUjnWoEXDJTop6CWqNXb0sremNWqHbYYtKcqkrrWH7v5Br0sR+QAFvUS1Fw414BzRH/SFGTiguqnL61JEPkBBL1Ht+YMNzM9LY2lRhtelXFRpThrJCT4N30hUUtBL1OrqG+St6nPcvKLIkyUDL4XfZywqyOBYY6cWI5Goo6CXqPXasWb6hwJsWlHodSlhWVyYwfmeAVq6+r0uReQCCnqJWtsPN5CVksC6slyvSwnLgvzgHPknz2mcXqKLgl6iUiDg2HGkkRuXFZIYBXPPh6MwM5m0JD8nmhX0El1i4zdIZpx9dW00d/bHzLANBKdDWJCfrqCXqKOgl6j04qEG/D7jxqWxE/QQHL5p7R6grVvj9BI9FPQSlbYfbmRdWQ7ZaYlel3JJhsfp1auXaBLWVIBmthn4X4Af+Ilz7ruj9n8Y+EfgSuAe59wzI/YNAQdCT2ucc7dPReESP57YWXPB87bufo40dPDNW1d4VNHlK8pKISXRp6CXqDJh0JuZH/gB8FGgDthtZlucc4dGNKsBvgj81Rgv0eOcu3oKapUZ4mhDcHKwjywv8LiSS+czoyxP4/QSXcIZulkPVDnnjjvn+oEngTtGNnDOnXTO7QcC01CjzDBHGzoomZXKooLovht2PAvy0znX1U9je6/XpYgA4Q3dlAC1I57XARsu4WukmFkFMAh81zn3q0s4VmaYwUCA6qZOriqdxc921U58QBQaHqd/+0QLt181x+NqRMLr0Y917/ml3OM9zzlXDtwL/KOZLfrAFzC738wqzKyiqanpEl5a4k3NuW76BgMsLcr0upTLVpydSpLfR8XJFq9LEQHCC/o6YO6I56XAmXC/gHPuTOjzceBlYM0YbR52zpU758oLCmJvXFamztGGTvxmLCpI97qUy+b3GfNy06g42ep1KSJAeEG/G1hiZgvMLAm4B9gSzoubWY6ZJYce5wPXA4cufpTMZEcbOpifl0Zyot/rUiZlXl4alfXtdPQOeF2KyMRB75wbBL4GbAMOAz93zh00swfN7HYAM1tnZnXAHwEPmdnB0OErgAozexfYQXCMXkEvY2rvGaC+vTemh22GleWlE3DwTk2b16WIhHcdvXNuK7B11LZvjXi8m+CQzujj3gRWT7JGmSGOhuZyj4egn5uTis+g4lQrH16q4Ujxlu6MlahxtLGTrJQEirKSvS5l0pIT/ayck6UTshIVFPQSFYYCjqrGDpYWZUb9IiPhKp+fy77aNgaGdHuJeEtBL1GhrrWb3oEAS+Jg2GbY2vk5dPcPcfhsu9elyAynoJeocLShA5/B4hi9G3Ys5WU5ALrMUjynoJeocLShk7m5aaQmxfZllSMVZ6dSMiuVilMapxdvKejFc519g5xu62FZHA3bDFtXlkPFyVYtGC6eUtCL546FLquMp/H5YWvLcmns6KO2pcfrUmQGU9CL5442dJCRnEBxdorXpUy5dcPj9Bq+EQ+FdcOUyHQZCjiONXayrCgTX5xcVjnsiZ01BJwjJdHHz3bV0jsQ4N4N87wuS2Yg9ejFU3trWunuH2J5cZbXpUwLnwUnODt1TguRiHcU9OKp7Ycb8RksKYyfyypHm5+XTmNHH939g16XIjOUgl489VJlA2X56aTE+GyVFzM/Nw2AmpZujyuRmUpBL56pbenmaEMny2fH57DNsNKcNHwGp84p6MUbCnrxzPbDDQCsmB1/l1WOlJTgY86sVI3Ti2cU9OKZ7ZWNLCxIJy8j9mernEhZXjp1rT30DQ55XYrMQAp68URn3yA7j7ewaXmh16VExPy8NAYDjgN1570uRWYgBb144pUjTfQPBbhpeZHXpUTEgrx0DHir+pzXpcgMpKAXT/zmwBnyM5JYvyDX61IiIi05gdnZKbx1XEEvkaegl4jr6hvkpcpGPn5FMX5ffN0NezEL89OpONVK74DG6SWyFPQScS9VNtI7EOAPryz2upSIWliQQf9gQAuGS8Qp6CXith44S35GMuvKZsawzbAF+en4DA3fSMQp6CWihodtbl09e0YN2wCkJPpZXZLN2zohKxGm2Ssloh587hB9gwGSE/w8sbPG63Ii7tpFeTz6+gl6+ofiajUtiW7q0UtE7a9tIzMlgfl5aV6X4onrFuYxMOQ0P71ElIJeIqaxvZcjDR2smTsr7uaeD9e6slwSfMabGr6RCFLQS8Q8u/c0AQdr58+sk7AjpScnUF6Ww47KRq9LkRlEQS8R4Zzj6Ypa5uelUZAZ/3PbXMym5UVU1ndQ16rZLCUyFPQSERWnWjne3EX5DO7ND9u0Iji/z0vq1UuEKOglIp7aXUt6kp8rSuJ77vlwLCzIYEF+OtsPK+glMsIKejPbbGZHzKzKzB4YY/+HzWyvmQ2a2V2j9t1nZsdCH/dNVeESO9p7B/jN/rPcdtUckhN0SSHApuWFvFV9jq4+LS8o02/CoDczP/AD4OPASuAzZrZyVLMa4IvAE6OOzQW+DWwA1gPfNrOcyZctseTZPXX0DAzx2Q3zvS4laty0opD+oQCvHWv2uhSZAcLp0a8Hqpxzx51z/cCTwB0jGzjnTjrn9gOBUcd+DHjBOdfinGsFXgA2T0HdEiMCAcdjb51izbxZrC7N9rqcqLGuLJfMlAReqmzwuhSZAcIJ+hKgdsTzutC2cEzmWIkDr1c1c7y5i/uuK/O6lKiS6Pdxw9ICXqpsZHBodP9IZGqFE/Rj3dniwnz9sI41s/vNrMLMKpqamsJ8aYkFP33rJPkZydy6embNVBmOP1xdTHNnP2/o5imZZuEEfR0wd8TzUuBMmK8f1rHOuYedc+XOufKCgoIwX1qiXW1LN9srG7l3/VySEnSB12g3rSgkOzWRZ/fUeV2KxLlwfvt2A0vMbIGZJQH3AFvCfP1twC1mlhM6CXtLaJvMAP++8xQ+M+7VSdgxJSf4ue2qYrYdrKejd8DrciSOTTh7pXNu0My+RjCg/cCjzrmDZvYgUOGc22Jm64BfAjnAbWb2351zq5xzLWb2HYL/WQA86JzTbE5xZqxZKO9cW8LTFXV8dEURs7NTPKgqNtx5TSn//nYNWw+c5e5187wuR+JUWNMUO+e2AltHbfvWiMe7CQ7LjHXso8Cjk6hRYtDv3qunpaufz16r8LqYq+fOYmFBOs/uOa2gl2mjgVOZFk/srGF+XhrXL8r3upSoZmbceU0pu062UHNOc9/I9FDQy5RrbO9l54kW7l0/D98MW0XqcnxqTQl+n/HvO095XYrEKa0wJVNu18kWkvw+7lo75mjejDbW+Yx7N8zjtiuLefztU3z1xsVkpyV6UJnEM/XoZUr1DwbYW9PK5itmk5cxs6cjvhRfuXERXf1DPPb2Sa9LkTikoJcpdeD0eXoHAnx2g04sXorls7P4yLIC/vcbJ+npH/K6HIkzGrqRKbXrxDkKMpOpauykuqnL63Jiyp/duJg/fugtnt5Tyxc0ZYRMIfXoZcqcaeuhtrWHDQtysRm6JuxkrCvLoXx+Dj/YUUV3v6YvlqmjoJcps+tEC4l+Y81czUR9OcyMb9y6nIb2Pn70crXX5UgcUdDLlOgbGGJfXRtXlswiNUmLi1yutfNzue2qOTz06nGtKStTRmP0MiX21bXRPxhg/QKtCTtZD3x8OS8cqufPH9/LPaPulr1XJ7nlMqhHL5PmnGPXiRaKs1MozUn1upyYVzIrlfs/vIj9deepbur0uhyJA+rRy6TVtfZw9nwvd1w9RydhL8NYN1HlpiWRm57EL985zX+6aYmmeZZJ0U+PTNrOEy0kJfi4unSW16XEjaQEH59aU0JLVz/bD2u5QZkcBb1MyvnuAfbXtXH13FkkJ+ok7FRaVJDBurIcXq9q1olZmRQFvUzKs3vrGAw4Nugk7LTYvKqYzJQEfrH3NEOBcFfwFLmQgl4um3OOx3eeYm5OKsXZOgk7HVKT/Nx+VQn17b28ekzrKcvlUdDLZdt5ooXqpi42LMjzupS4tnJOFleUZPNSZSNVjboKRy6dgl4u2+M7a8hKSWB1abbXpcS9264sJsnv44Fn9xPQEI5cIgW9XJbmzj5+995Z7lxbSqJfP0bTLTMlkVtXz6biVCvP7KnzuhyJMbqOXi7L0xV1DAw5PrthHrtOtHpdzoywZl4OFSdb+Zv/c5D23gHSkoK/vrpbViairphcsqGA42e7atiwIJfFhZlelzNj+My4/eo59PQP8fxBXVsv4VPQyyV74VADNS3dmjPdA8XZqVy3KI/dJ1t0bb2ETUEvl8Q5x49eqWZebhqbr5jtdTkz0s0rikhL8rP1QD3O6cSsTExBL5dk98lW9tW28Sd/sAC/T/PaeCEl0c+mFUWcPNdFZX2H1+VIDFDQyyV5+NVqctIS+aO1c70uZUZbV5ZLfkYSv3uvnsGhgNflSJRT0EvYjjV08OLhRr5wXZkWF/GY32dsXlVMU2cfT+6u9bociXIKegnb3z9/lLQkP1+4br7XpQiwojiTsrw0/mn7MXoHhrwuR6KYrqOXsOw8fo7fHazn5hWFbNOlfVHBzNi0oohHXj/Bk7tq+OL1C7wuSaKUevQyoUDA8bdbDzM7K4WNiwu8LkdGWJifzvoFufzLK9Xq1cu4FPQyoS3vnmF/3Xn+88eWaaWjKGNmfH3TEhra+/h5hcbqZWxh/daa2WYzO2JmVWb2wBj7k83sqdD+nWZWFtpeZmY9ZrYv9PGjqS1fpltrVz//79bDXFGSxafWlHhdjozhukV5rCvL4Yc7qukbVK9ePmjCoDczP/AD4OPASuAzZrZyVLMvA63OucXA/wS+N2JftXPu6tDHV6aobokA5xzf/NUBWrv7+e6nr8Sn6+ajkpnxF5uWUt/ey891BY6MIZwe/Xqgyjl33DnXDzwJ3DGqzR3Av4UePwNsMq0SHfN+te80Ww/U8/98dClXlGgq4mh2/eI8yufn8MOX1auXDwrnqpsSYGQ3oQ7YMF4b59ygmZ0HhlejWGBm7wDtwH91zr02+guY2f3A/QDz5mkmPoAndtaMuT1SMxXWnOvmW786SPn8HP70w4si8jXl8pkZf3HzEj7/yC6erqjjc9fqElh5XzhBP1bPfPQEG+O1OQvMc86dM7O1wK/MbJVzrv2Chs49DDwMUF5ersk7PNbZN8hdP3qTwYDjxmWFPKXhgKg23ClwzjEvN43vbztCIOD4wofKvC1MokY4Qzd1wMj73UuBM+O1MbMEIBtocc71OefOATjn9gDVwNLJFi3TJxBwfP3JfTR39vGZ9fPITU/yuiQJk5lx0/JCzvcMsKdGawTI+8IJ+t3AEjNbYGZJwD3AllFttgD3hR7fBbzknHNmVhA6mYuZLQSWAMenpnSZDv/wwlFePNzArauLWVyY4XU5comWFGYwNyeVV482MaA5cCRkwqGb0Jj714BtgB941Dl30MweBCqcc1uAR4DHzKwKaCH4nwHAh4EHzWwQGAK+4pxrmY5/iEze/3n3DP+8o4p71s1ltU6+xiQz48ZlhTz29im+8YsDXDMv54L9Wo1qZgprCgTn3FZg66ht3xrxuBf4ozGOexZ4dpI1SgS8d/o8//mZd1lXlsODd1yhdUlj2PLZmczOSuGVI01cPXcWPl0AN+PpNkehpauf+39aQW5aEv/yubW6+zXGBXv1BTR19nHwTPvEB0jc02/0DBcIOL7+1D6au/p5+Avl5Gcke12STIErSrLJz0ji5SONWoVKFPQz3Q92VPHq0Sa+fdtK3RQVR3xm3LC0kLPneznSoFWoZjpNUzzDjLwRq7qpk0dfP8Enr57Dvet1ki7eXD13FtsrG9hR2ciyokx0s/rMpR79DNXeO8CTu2vJz0zmbz+1WiEQh/w+48NLCqht7eF4c5fX5YiH1KOfgYYCjid31dI/OMSfbFzAr/eNvv9N4sXa+TnsONLIjiONLCrQfREzlXr0M9CLhxs4ea6LT15dQlFWitflyDRK9PvYuDif401dnDqnXv1MpaCfYSrPtvPK0SbWleWyZtTNNBKf1i/IJT05gRcONegKnBlKQT+D1LV28/SeOuZkp/CJK4u9LkciJDnBz0eWFXC8uYvXq5q9Lkc8oKCfIfoGh/jqE+/gcHxm/TwS/frWzyTry3KZlZbI97cdUa9+BtJv+wzgnOMbzx7g3do27rymlDzdFDXjJPh9bFpexP6682w7WO91ORJhCvoYEHCO1u7+y56N8IcvV/OLd07zlx9dyqo5uilqprp67iwWF2bw3d9W0jugVahmEl1eGcUOnWnnlaON1Lf3MjDkSErwsftkC59aU8JNywsveu378I1R79S08vSeOq4qzSZPc8vPaH6f8Te3reJzj+zkR69U8/WbtTTETKGgj0LtvQM8s6eWvTVtFGYms64sl/yMZM6e7+Gt6nM8t/8s6xfk8u3bVo7bQ3fO8crRJp4/1MCC/HQ+fU2pbooSNi7J57ar5vDDl6v55NUllOWne12SRICCPso0dfRxz8NvcaK5i48sK+AjywtJ8L0/wvbH5aU8VVHL3z9/lE/8/69z6+pi/vzGRRcEflVjJ0/vqWNfbRtXlWZz5zWlJOjkq4T8tz9cwcuVjfy3X7/HT7+0Xh2AGUBBH0WaO/u498dvc6atly9dv4CFY9zJmOD38dkN8/nElXN46JVqHnvrFL/Zf5YlhRkUZaXQOzBExalWfAY3LS9k0wRDPDLzFGal8FcfW8a3txzkf79xki9tXOB1STLNFPRRoqWrn8/9ZCe1rd08+sV1nGzuvmj77NRE/nrzcv70hkU8vvMU+2raaOzoY2AowF9vXobfjMyUxAhVL7Hm89fO542qZv5262FWzcliw8I8r0uSaaSgjwJt3cGQP9HcxSP3reNDi/I52Vwz8YEEA//Pb1z8ge0jZ6kUGc3nM/7+j6/ijn9+g68+8Q7P/ceNzM7WdBjxSgO3HjvfM8DnH9lFVWMnD3+hnI1L8r0uSWaIzJREHvr8Wnr6B7n74bc4qRku45Z69B5qaO/lvkd3Ud3UyUOfX8sNSwsmPGasnroWfJbLtaQok8f+ZANf/tfd3Pkvb9y5aogAAAxCSURBVPLoF9dx1dxZ47bXz19sUo/eI1WNnXz6h29S09LNT+5bx03Li7wuSWaoa+bl8MyffYjUJD93/ehN/sdzhzjfM+B1WTKF1KOPsCd21vBuXRu/3ncav8/Hf/jQgrB68iLTaVFBBr/+6vV8f9sRHnnjBL945zR/tLaUT64pYUVxltflySQp6COorbufn1fUsq+2jXm5adxdPpcc3a0qEXSxoZe8jGS+e+eVfO7a+fzji0d55PUTPPTqccry0ti4JJ+Ni/Pp6R8iNckf6bJlkhT0ETA4FODxnTX8wwtH6egdYNPyQm5cVojfp+vbxXtjhf9Ny4v4u7uu4jf7z7DjSBO/2Huaf3+7BgNKclJZVpTJiuIsinWlTkxQ0E+jQMDx3IGz/OOLRzne1MX1i/NYOy93yi9j06WUMh1+9149fp+Pm1cUceOyAupaeqhq6qSqsZOXKhvZXtnIrLREjjV2csuqItaX5V7WHdjj/fzqJO/UUdBPg8GhAL85cJYf7qjmSEMHy4oy+fEXyrl5RSE/21XrdXkilyzB56MsP52y/HRuXlFER+8AR+o7OHS2nSd21fCvb54kOzWRTcsLuW5RHiuKs1hSlEFygoZ5ooGCfgoM90gGhgLsrWnltWPNtHT1s7gwg3/6zBo+sboYn4ZpJI5kpiRSXpZLeVkun1wzh1ePNvP8oXpeqmzkF++c/n275AQfqUl+Enw+fAb5Gckk+A2/z0jwBT+39wySlZpAdmoS+RlJ5Gcka6bVKaagnwIdvQPsrWnjzapmOvoGKc1J5f/79Fo+uqJIAS9xLy0pgc1XzGbzFbMZCjhONHdRWd/Or945TXf/ED39QwwGHAHnKM5OZSgQYDDgGAo4BocczZ19HG/upHfg/fUWDPjJ6ydYWJDOgvx0FhZksCj0uSgrWfM3XSIF/WU63z3AK8ea2Lr/LM8fqifgYHFBBn+8rICF+emc6+znyd3hDdNojF3ihd9nLC7MYHFhBu09g5d0bO/AEM2dfTR39tPc2Udakp8TzV3sOtFCd//7C6Uk+X0UZSdTnJXK7OwUWrv7yc9IpigzmcKsFFISg8NFGuN/X1hBb2abgf8F+IGfOOe+O2p/MvBTYC1wDrjbOXcytO8bwJeBIeA/Oee2TVn108g5R1f/EOdCP3jnOvto7Ojj8Nl23jt9nvfOtDMUcORnJPGhRfmUl+VQmKkrEEQuV0qin9KcNEpz0oD3g9o5R317Lyeaunhydy1t3QO09w7Q1NlHVVMn53sGGAq8vw5udmoihZnJnGjuZGlRJstmZ7KkMHNGXxY6YdCbmR/4AfBRoA7YbWZbnHOHRjT7MtDqnFtsZvcA3wPuNrOVwD3AKmAO8KKZLXXOTes6Zs45Ai44Zj785+FAIEBP/xDnewbo6B2kvXeA9p4BWrv7OdfZHwzzrj7OjQj1wcAHF1HOTE5gVUkWX7lhITctL+LqubN4Ksyeu4iEb6y/dK8dY5bNgHO0dQ/Q0N5LY3svDR19NLb38tO3TtE3GBwOMoOSWakUZaVQkJFMYVYyhZnJzEpLIjXRT2qSn9REPymJfpISDDPDZ4bPwDDMwGfBzzZim4VemwueB88/+Each3j/sw9/6LHPiNgQVDg9+vVAlXPuOICZPQncAYwM+juAvwk9fgb4Zwv+C+4AnnTO9QEnzKwq9HpvTU357zvX2cfG7+1gMBBgYOjSVrlPSvCRn55EXkYyeRlJLC3KpLGjl4zkBNKTE0hPSgg99pOVmogv9M05Ut/BkfqOqf6niMQUr4cefWbkpieRm550wV28d6+by6lzXRxt6OBIfScnmjtp7Aj+FfBmdTPtvZc2tDQdhv8DGM77q0pn8dSfXjf1XyeMNiXAyC5rHbBhvDbOuUEzOw/khba/PerYktFfwMzuB+4PPe00syNhVT+Fjo2/Kx9ojlghkxNLtYLqnW6xVO+U1/rZqXyxD5qW9/YI8POvXPbh88fbEU7Qj/W3xegu83htwjkW59zDwMNh1BJxZlbhnCv3uo5wxFKtoHqnWyzVG0u1QuzVG85tbHXA3BHPS4Ez47UxswQgG2gJ81gREZlG4QT9bmCJmS0wsySCJ1e3jGqzBbgv9Pgu4CXnnAttv8fMks1sAbAE2DU1pYuISDgmHLoJjbl/DdhG8PLKR51zB83sQaDCObcFeAR4LHSytYXgfwaE2v2c4InbQeCr033FzTSIyiGlccRSraB6p1ss1RtLtUKM1WvBjreIiMQrrTAlIhLnFPQiInFOQT+Kmf2NmZ02s32hj1vHabfZzI6YWZWZPRDpOkM1fN/MKs1sv5n90szGXNXZzE6a2YHQv6fCgzov+l6FTtY/Fdq/08zKIl3jiFrmmtkOMztsZgfN7C/GaHOjmZ0f8TPyLS9qDdVy0e+tBf1T6L3db2bXeFFnqJZlI96zfWbWbmZfH9XG0/fWzB41s0Yze2/Etlwze8HMjoU+54xz7H2hNsfM7L6x2njGOaePER8E7/D9qwna+IFqYCGQBLwLrPSg1luAhNDj7wHfG6fdSSDfo/dzwvcK+HPgR6HH9wBPefj9LwauCT3OBI6OUe+NwHNe1Xgp31vgVuC3BO9puRbY6XXNI34u6oH50fTeAh8GrgHeG7Ht74AHQo8fGOv3DMgFjoc+54Qe53j9Pg9/qEd/eX4/LYRzrh8YnhYiopxzzzvnhu/jfpvgfQrRJpz36g7g30KPnwE2mUfz0Drnzjrn9oYedwCHGeNu7hhyB/BTF/Q2MMvMir0uCtgEVDvnTnldyEjOuVcJXjk40sifz38DPjnGoR8DXnDOtTjnWoEXgM3TVuglUtCP7WuhP3MfHefPtLGmhfA6DL5EsOc2Fgc8b2Z7QtNNRFI479UFU2gAw1NoeCo0hLQG2DnG7uvM7F0z+62ZrYpoYRea6HsbjT+rEPzL7Wfj7IuW93ZYkXPuLAQ7AkDhGG2i9X0GZuh89Gb2IjB7jF3fBP4F+A7BX6DvAH9PMEQveIkxjp2W61QvVqtz7tehNt8keJ/C4+O8zPXOuTNmVgi8YGaVoZ5LJExmCg3PmFkG8Czwdedc+6jdewkOOXSGzuH8iuDNgF6Y6Hsbje9tEnA78I0xdkfTe3spou59HmlGBr1z7uZw2pnZj4HnxtgVsakdJqo1dNLnE8AmFxosHOM1zoQ+N5rZLwkOp0Qq6C9lCo26UVNoeMLMEgmG/OPOuV+M3j8y+J1zW83sh2aW75yL+ARiYXxvo3Eako8De51zDaN3RNN7O0KDmRU7586Ghr0ax2hTR/D8wrBS4OUI1BYWDd2MMmr88lPAe2M0C2daiGlnwQVh/gtwu3Oue5w26WaWOfyY4Ancsf5N02UyU2hEXOjcwCPAYefcP4zTZvbwOQQzW0/w9+hc5Kr8fR3hfG+3AF8IXX1zLXB+eBjCQ59hnGGbaHlvRxn583kf8Osx2mwDbjGznNBw7y2hbdHB67PB0fYBPAYcAPYT/AYXh7bPAbaOaHcrwSsyqgkOo3hRaxXBccF9oY8fja6V4NUu74Y+DnpR61jvFfAgwf+gAFKAp0P/nl3AQg+//xsJ/sm9f8T7eivwFeAroTZfC72X7xI8Cf4hj2od83s7qlYjuHBQdejnutyr9zZUTxrB4M4esS1q3luC/wGdBQYI9tK/TPB80XaCs5lvB3JDbcsJrrg3fOyXQj/DVcB/8PJ9Hv2hKRBEROKchm5EROKcgl5EJM4p6EVE4pyCXkQkzinoRUTinIJeBDCzzkkc+3Jods53zewNM1s2lbWJTJaCXmRqfNY5dxXBSa++73UxIiMp6EVGCN1B+n0zey80z/vdoe2+0O34B83sOTPbamZ3jfESrwKLI1u1yMXNyLluRC7i08DVwFVAPrDbzF4FrgfKgNUEZy88DDw6xvG3EbwDVSRqKOhFLrQR+JlzbojgZFavAOtC2592zgWAejPbMeq4x82sh+BCIP8xkgWLTERBL3Kh8RY8mWghlM865yK+TKNIODRGL3KhV4G7zcxvZgUEl5bbBbwO3Bkaqy/iwilpRaKaevQiF/olcB3B2RMd8NfOuXoze5bg8nfvEZyJcyfBlbBEop5mrxQJk5lluODKR3kEe/nXO+fqva5LZCLq0YuE7zkzmwUkAd9RyEusUI9eRCTO6WSsiEicU9CLiMQ5Bb2ISJxT0IuIxDkFvYhInPu/fkW8+CRg9jMAAAAASUVORK5CYII=\n",
      "text/plain": [
       "<Figure size 432x288 with 1 Axes>"
      ]
     },
     "metadata": {
      "needs_background": "light"
     },
     "output_type": "display_data"
    }
   ],
   "source": [
    "sns.distplot(logp_data[VALUE_COLUMN])"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 9,
   "metadata": {},
   "outputs": [
    {
     "data": {
      "text/plain": [
       "2534"
      ]
     },
     "execution_count": 9,
     "metadata": {},
     "output_type": "execute_result"
    }
   ],
   "source": [
    "#Unique values\n",
    "logp_data[SMILES_COLUMN].unique().size"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 10,
   "metadata": {},
   "outputs": [
    {
     "data": {
      "text/html": [
       "<div>\n",
       "<style scoped>\n",
       "    .dataframe tbody tr th:only-of-type {\n",
       "        vertical-align: middle;\n",
       "    }\n",
       "\n",
       "    .dataframe tbody tr th {\n",
       "        vertical-align: top;\n",
       "    }\n",
       "\n",
       "    .dataframe thead th {\n",
       "        text-align: right;\n",
       "    }\n",
       "</style>\n",
       "<table border=\"1\" class=\"dataframe\">\n",
       "  <thead>\n",
       "    <tr style=\"text-align: right;\">\n",
       "      <th></th>\n",
       "      <th>logP</th>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>smiles</th>\n",
       "      <th></th>\n",
       "    </tr>\n",
       "  </thead>\n",
       "  <tbody>\n",
       "    <tr>\n",
       "      <th>BrC(Br)(Br)Br</th>\n",
       "      <td>1</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>BrC(Br)Br</th>\n",
       "      <td>1</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>BrC1CCCCC1</th>\n",
       "      <td>1</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>BrC=C(Br)Br</th>\n",
       "      <td>1</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>BrCBr</th>\n",
       "      <td>1</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>...</th>\n",
       "      <td>...</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>c1cncnc1</th>\n",
       "      <td>1</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>c1nc[nH]n1</th>\n",
       "      <td>1</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>c1ncc2nc[nH]c2n1</th>\n",
       "      <td>1</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>c1ncncn1</th>\n",
       "      <td>2</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>c1nnn[nH]1</th>\n",
       "      <td>2</td>\n",
       "    </tr>\n",
       "  </tbody>\n",
       "</table>\n",
       "<p>2534 rows × 1 columns</p>\n",
       "</div>"
      ],
      "text/plain": [
       "                  logP\n",
       "smiles                \n",
       "BrC(Br)(Br)Br        1\n",
       "BrC(Br)Br            1\n",
       "BrC1CCCCC1           1\n",
       "BrC=C(Br)Br          1\n",
       "BrCBr                1\n",
       "...                ...\n",
       "c1cncnc1             1\n",
       "c1nc[nH]n1           1\n",
       "c1ncc2nc[nH]c2n1     1\n",
       "c1ncncn1             2\n",
       "c1nnn[nH]1           2\n",
       "\n",
       "[2534 rows x 1 columns]"
      ]
     },
     "execution_count": 10,
     "metadata": {},
     "output_type": "execute_result"
    }
   ],
   "source": [
    "logp_data.groupby(SMILES_COLUMN).count()"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 11,
   "metadata": {},
   "outputs": [
    {
     "data": {
      "text/plain": [
       "Index(['Brc1ccccn1', 'C#CC1(O)CCC2C3CCc4cc(O)ccc4C3CCC21C',\n",
       "       'C(=C/c1ccccc1)\\c1ccccc1', 'C/C=C/C=C/C(=O)O', 'C/C=C/c1ccccc1',\n",
       "       'C1=COCCC1', 'C1CC2OC2CC1C1CO1', 'C1CCNC1', 'C1CCNCC1',\n",
       "       'C1CCc2nnnn2CC1',\n",
       "       ...\n",
       "       'c1ccc2cnncc2c1', 'c1ccc2ncccc2c1', 'c1ccn2nnnc2c1', 'c1ccncc1',\n",
       "       'c1ccnnc1', 'c1cn[nH]c1', 'c1cnc2[nH]ccc2c1', 'c1cnc2c(c1)ccc1cccnc12',\n",
       "       'c1ncncn1', 'c1nnn[nH]1'],\n",
       "      dtype='object', name='smiles', length=609)"
      ]
     },
     "execution_count": 11,
     "metadata": {},
     "output_type": "execute_result"
    }
   ],
   "source": [
    "logp_data.groupby(SMILES_COLUMN).count().index[(logp_data.groupby(SMILES_COLUMN).count()[VALUE_COLUMN]>=2).values]"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 12,
   "metadata": {},
   "outputs": [
    {
     "data": {
      "text/html": [
       "<div>\n",
       "<style scoped>\n",
       "    .dataframe tbody tr th:only-of-type {\n",
       "        vertical-align: middle;\n",
       "    }\n",
       "\n",
       "    .dataframe tbody tr th {\n",
       "        vertical-align: top;\n",
       "    }\n",
       "\n",
       "    .dataframe thead th {\n",
       "        text-align: right;\n",
       "    }\n",
       "</style>\n",
       "<table border=\"1\" class=\"dataframe\">\n",
       "  <thead>\n",
       "    <tr style=\"text-align: right;\">\n",
       "      <th></th>\n",
       "      <th>smiles</th>\n",
       "      <th>logP</th>\n",
       "    </tr>\n",
       "  </thead>\n",
       "  <tbody>\n",
       "    <tr>\n",
       "      <th>51693</th>\n",
       "      <td>c1ccc2cnncc2c1</td>\n",
       "      <td>0.57</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>52150</th>\n",
       "      <td>c1ccc2cnncc2c1</td>\n",
       "      <td>0.57</td>\n",
       "    </tr>\n",
       "  </tbody>\n",
       "</table>\n",
       "</div>"
      ],
      "text/plain": [
       "               smiles  logP\n",
       "51693  c1ccc2cnncc2c1  0.57\n",
       "52150  c1ccc2cnncc2c1  0.57"
      ]
     },
     "execution_count": 12,
     "metadata": {},
     "output_type": "execute_result"
    }
   ],
   "source": [
    "logp_data[logp_data[SMILES_COLUMN]=='c1ccc2cnncc2c1']"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 13,
   "metadata": {},
   "outputs": [],
   "source": [
    "logp_data_wo_duplicates = logp_data.drop_duplicates()"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 14,
   "metadata": {},
   "outputs": [
    {
     "name": "stdout",
     "output_type": "stream",
     "text": [
      "<class 'pandas.core.frame.DataFrame'>\n",
      "Int64Index: 2534 entries, 0 to 231141\n",
      "Data columns (total 2 columns):\n",
      " #   Column  Non-Null Count  Dtype  \n",
      "---  ------  --------------  -----  \n",
      " 0   smiles  2534 non-null   object \n",
      " 1   logP    2534 non-null   float64\n",
      "dtypes: float64(1), object(1)\n",
      "memory usage: 59.4+ KB\n"
     ]
    }
   ],
   "source": [
    "logp_data_wo_duplicates.info()"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 16,
   "metadata": {},
   "outputs": [],
   "source": [
    "PROCESSED_PATH = \"../data/1_filtering/NCIDataset.csv\"\n",
    "\n",
    "logp_data_wo_duplicates.to_csv(PROCESSED_PATH)"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": 17,
   "metadata": {},
   "outputs": [
    {
     "data": {
      "text/html": [
       "<div>\n",
       "<style scoped>\n",
       "    .dataframe tbody tr th:only-of-type {\n",
       "        vertical-align: middle;\n",
       "    }\n",
       "\n",
       "    .dataframe tbody tr th {\n",
       "        vertical-align: top;\n",
       "    }\n",
       "\n",
       "    .dataframe thead th {\n",
       "        text-align: right;\n",
       "    }\n",
       "</style>\n",
       "<table border=\"1\" class=\"dataframe\">\n",
       "  <thead>\n",
       "    <tr style=\"text-align: right;\">\n",
       "      <th></th>\n",
       "      <th>smiles</th>\n",
       "      <th>logP</th>\n",
       "    </tr>\n",
       "  </thead>\n",
       "  <tbody>\n",
       "    <tr>\n",
       "      <th>0</th>\n",
       "      <td>CC1=CC(=O)C=CC1=O</td>\n",
       "      <td>0.72</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>9</th>\n",
       "      <td>c1ccc(P(c2ccccc2)c2ccccc2)cc1</td>\n",
       "      <td>5.69</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>54</th>\n",
       "      <td>O=S(Cc1ccccc1)Cc1ccccc1</td>\n",
       "      <td>1.99</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>95</th>\n",
       "      <td>COc1ccc(CC#N)cc1</td>\n",
       "      <td>1.70</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>96</th>\n",
       "      <td>CN(Cc1ccccc1)c1ccccc1</td>\n",
       "      <td>4.22</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>...</th>\n",
       "      <td>...</td>\n",
       "      <td>...</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>225116</th>\n",
       "      <td>CCOc1cccc2cccnc12</td>\n",
       "      <td>2.25</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>226290</th>\n",
       "      <td>O=C1CC(c2ccc(O)c(O)c2)Oc2cc(O)cc(O)c21</td>\n",
       "      <td>2.02</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>229758</th>\n",
       "      <td>CC(CCC(=O)O)C1CCC2C3C(O)C(O)C4CC(O)CCC4(C)C3CC...</td>\n",
       "      <td>2.80</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>229759</th>\n",
       "      <td>CC(CCC(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C</td>\n",
       "      <td>4.15</td>\n",
       "    </tr>\n",
       "    <tr>\n",
       "      <th>231141</th>\n",
       "      <td>Cc1oc2ccccc2c(=O)c1C</td>\n",
       "      <td>2.31</td>\n",
       "    </tr>\n",
       "  </tbody>\n",
       "</table>\n",
       "<p>2534 rows × 2 columns</p>\n",
       "</div>"
      ],
      "text/plain": [
       "                                                   smiles  logP\n",
       "0                                       CC1=CC(=O)C=CC1=O  0.72\n",
       "9                           c1ccc(P(c2ccccc2)c2ccccc2)cc1  5.69\n",
       "54                                O=S(Cc1ccccc1)Cc1ccccc1  1.99\n",
       "95                                       COc1ccc(CC#N)cc1  1.70\n",
       "96                                  CN(Cc1ccccc1)c1ccccc1  4.22\n",
       "...                                                   ...   ...\n",
       "225116                                  CCOc1cccc2cccnc12  2.25\n",
       "226290             O=C1CC(c2ccc(O)c(O)c2)Oc2cc(O)cc(O)c21  2.02\n",
       "229758  CC(CCC(=O)O)C1CCC2C3C(O)C(O)C4CC(O)CCC4(C)C3CC...  2.80\n",
       "229759    CC(CCC(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C  4.15\n",
       "231141                               Cc1oc2ccccc2c(=O)c1C  2.31\n",
       "\n",
       "[2534 rows x 2 columns]"
      ]
     },
     "execution_count": 17,
     "metadata": {},
     "output_type": "execute_result"
    }
   ],
   "source": [
    "pd.read_csv(PROCESSED_PATH, index_col=0)"
   ]
  },
  {
   "cell_type": "code",
   "execution_count": null,
   "metadata": {},
   "outputs": [],
   "source": []
  }
 ],
 "metadata": {
  "kernelspec": {
   "display_name": "Python 3",
   "language": "python",
   "name": "python3"
  },
  "language_info": {
   "codemirror_mode": {
    "name": "ipython",
    "version": 3
   },
   "file_extension": ".py",
   "mimetype": "text/x-python",
   "name": "python",
   "nbconvert_exporter": "python",
   "pygments_lexer": "ipython3",
   "version": "3.7.6"
  }
 },
 "nbformat": 4,
 "nbformat_minor": 4
}