diff --git a/1.1.0/404.html b/1.1.0/404.html new file mode 100644 index 0000000..5948d47 --- /dev/null +++ b/1.1.0/404.html @@ -0,0 +1,384 @@ + + + + + + + + + + + + + + + + + + + Smallrye Mutiny Zero + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ +
+ + + + + + + + +
+ + +
+ +
+ + + + + + +
+
+ + + +
+
+
+ + + + + +
+
+
+ + + +
+
+
+ + + +
+
+
+ + + +
+
+ +

404 - Not found

+ +
+
+ + + +
+ +
+ + + +
+
+
+
+ + + + + + + + + + \ No newline at end of file diff --git a/1.1.0/apidocs/allclasses-index.html b/1.1.0/apidocs/allclasses-index.html new file mode 100644 index 0000000..f3f2501 --- /dev/null +++ b/1.1.0/apidocs/allclasses-index.html @@ -0,0 +1,124 @@ + + + + +All Classes and Interfaces (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

All Classes and Interfaces

+
+
+
+
+
+
Class
+
Description
+
AdaptersToFlow
+
+
Adapters from Reactive Streams types to Flow types.
+
+
AdaptersToReactiveStreams
+
+
Adapters from Flow types to Reactive Streams types.
+
+
AsyncHelpers
+
 
+
BackpressureStrategy
+
+
Define a Tube back-pressure management strategy.
+
+
Concatenate<T>
+
+
A Flow.Publisher that is the concatenation of several ones.
+
+
PublisherHelpers
+
 
+
Recover<T>
+
+
A Flow.Publisher that recovers from failure using a Function.
+
+
Retry<T>
+
+
A Flow.Publisher that retries on failure by re-subscribing to its upstream.
+
+
Select<T>
+
+
A Flow.Publisher that selects elements matching a Predicate.
+
+
Transform<I,O>
+
+
A Flow.Publisher that transforms elements using a Function.
+
+
Tube<T>
+
+
A Tube is a general-purpose abstraction for creating Flow.Publisher.
+
+
TubeConfiguration
+
+
Configuration object for creating Tube through ZeroPublisher.create(TubeConfiguration, Consumer).
+
+
VertxPublisher
+
+
Expose Vert.x streams as Reactive Streams compliant publishers.
+
+
ZeroPublisher
+
+
Factory methods to simplify the creation of reactive streams compliant Flow.Publisher.
+
+
+
+
+
+ +
+
+ + diff --git a/1.1.0/apidocs/allpackages-index.html b/1.1.0/apidocs/allpackages-index.html new file mode 100644 index 0000000..41fc4b3 --- /dev/null +++ b/1.1.0/apidocs/allpackages-index.html @@ -0,0 +1,83 @@ + + + + +All Packages (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

All Packages

+
+
Package Summary
+
+
Package
+
Description
+
mutiny.zero
+
+
Mutiny Zero is minimal API for creating reactive streams compliant Flow.Publisher objects.
+
+
mutiny.zero.flow.adapters
+
+
A set of adapters from Reactive Streams to/from Flow.
+
+
mutiny.zero.operators
+
+
This package contains a set of simple operator classes that can be useful when working with + Flow.Publisher streams.
+
+
mutiny.zero.vertxpublishers
+
 
+
+
+ +
+
+ + diff --git a/1.1.0/apidocs/copy.svg b/1.1.0/apidocs/copy.svg new file mode 100644 index 0000000..7c46ab1 --- /dev/null +++ b/1.1.0/apidocs/copy.svg @@ -0,0 +1,33 @@ + + + + + + + + diff --git a/1.1.0/apidocs/element-list b/1.1.0/apidocs/element-list new file mode 100644 index 0000000..01f318c --- /dev/null +++ b/1.1.0/apidocs/element-list @@ -0,0 +1,7 @@ +module:mutiny.zero +mutiny.zero +mutiny.zero.operators +module:mutiny.zero.flow.adapters +mutiny.zero.flow.adapters +module:mutiny.zero.vertxpublishers +mutiny.zero.vertxpublishers diff --git a/1.1.0/apidocs/help-doc.html b/1.1.0/apidocs/help-doc.html new file mode 100644 index 0000000..77c46ae --- /dev/null +++ b/1.1.0/apidocs/help-doc.html @@ -0,0 +1,204 @@ + + + + +API Help (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+

JavaDoc Help

+ +
+
+

Navigation

+Starting from the Overview page, you can browse the documentation using the links in each page, and in the navigation bar at the top of each page. The Index and Search box allow you to navigate to specific declarations and summary pages, including: All Packages, All Classes and Interfaces + +
+
+
+

Kinds of Pages

+The following sections describe the different kinds of pages in this collection. +
+

Overview

+

The Overview page is the front page of this API document and provides a list of all modules with a summary for each. This page can also contain an overall description of the set of modules.

+
+
+

Module

+

Each module has a page that contains a list of its packages, dependencies on other modules, and services, with a summary for each. These pages may contain the following categories:

+
    +
  • Packages
    • +
  • Modules
    • +
  • Services
    • +
+
+
+

Package

+

Each package has a page that contains a list of its classes and interfaces, with a summary for each. These pages may contain the following categories:

+
    +
  • Interfaces
    • +
  • Classes
    • +
  • Enums
    • +
  • Exception Classes
    • +
  • Annotation Types
    • +
+
+
+

Class or Interface

+

Each class, interface, nested class and nested interface has its own separate page. Each of these pages has three sections consisting of a declaration and description, member summary tables, and detailed member descriptions. Entries in each of these sections are omitted if they are empty or not applicable.

+
    +
  • Class Inheritance Diagram
    • +
  • Direct Subclasses
    • +
  • All Known Subinterfaces
    • +
  • All Known Implementing Classes
    • +
  • Class or Interface Declaration
    • +
  • Class or Interface Description
    • +
+
+
    +
  • Nested Class Summary
    • +
  • Enum Constant Summary
    • +
  • Field Summary
    • +
  • Property Summary
    • +
  • Constructor Summary
    • +
  • Method Summary
    • +
  • Required Element Summary
    • +
  • Optional Element Summary
    • +
+
+
    +
  • Enum Constant Details
    • +
  • Field Details
    • +
  • Property Details
    • +
  • Constructor Details
    • +
  • Method Details
    • +
  • Element Details
    • +
+

Note: Annotation interfaces have required and optional elements, but not methods. Only enum classes have enum constants. The components of a record class are displayed as part of the declaration of the record class. Properties are a feature of JavaFX.

+

The summary entries are alphabetical, while the detailed descriptions are in the order they appear in the source code. This preserves the logical groupings established by the programmer.

+
+
+

Other Files

+

Packages and modules may contain pages with additional information related to the declarations nearby.

+
+
+

Use

+

Each documented package, class and interface has its own Use page. This page describes what packages, classes, methods, constructors and fields use any part of the given class or package. Given a class or interface A, its Use page includes subclasses of A, fields declared as A, methods that return A, and methods and constructors with parameters of type A. You can access this page by first going to the package, class or interface, then clicking on the USE link in the navigation bar.

+
+
+

Tree (Class Hierarchy)

+

There is a Class Hierarchy page for all packages, plus a hierarchy for each package. Each hierarchy page contains a list of classes and a list of interfaces. Classes are organized by inheritance structure starting with java.lang.Object. Interfaces do not inherit from java.lang.Object.

+
    +
  • When viewing the Overview page, clicking on TREE displays the hierarchy for all packages.
    • +
  • When viewing a particular package, class or interface page, clicking on TREE displays the hierarchy for only that package.
    • +
+
+
+

All Packages

+

The All Packages page contains an alphabetic index of all packages contained in the documentation.

+
+
+

All Classes and Interfaces

+

The All Classes and Interfaces page contains an alphabetic index of all classes and interfaces contained in the documentation, including annotation interfaces, enum classes, and record classes.

+
+
+

Index

+

The Index contains an alphabetic index of all classes, interfaces, constructors, methods, and fields in the documentation, as well as summary pages such as All Packages, All Classes and Interfaces.

+
+
+
+This help file applies to API documentation generated by the standard doclet.
+ +
+
+ + diff --git a/1.1.0/apidocs/index-all.html b/1.1.0/apidocs/index-all.html new file mode 100644 index 0000000..9effd98 --- /dev/null +++ b/1.1.0/apidocs/index-all.html @@ -0,0 +1,401 @@ + + + + +Index (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Index

+
+A B C D E F G I L M O P R S T U V W Z 
All Classes and Interfaces|All Packages +

A

+
+
AdaptersToFlow - Interface in mutiny.zero.flow.adapters
+
+
Adapters from Reactive Streams types to Flow types.
+
+
AdaptersToReactiveStreams - Interface in mutiny.zero.flow.adapters
+
+
Adapters from Flow types to Reactive Streams types.
+
+
always() - Static method in class mutiny.zero.operators.Retry
+
 
+
applyExceptionally(CompletionStage<T>, Function<Throwable, Throwable>) - Static method in interface mutiny.zero.AsyncHelpers
+
+
Applies a function on failure to produce another failure.
+
+
AsyncHelpers - Interface in mutiny.zero
+
 
+
atMost(int) - Static method in class mutiny.zero.operators.Retry
+
 
+
+

B

+
+
BackpressureStrategy - Enum in mutiny.zero
+
+
Define a Tube back-pressure management strategy.
+
+
BUFFER - Enum constant in enum mutiny.zero.BackpressureStrategy
+
+
Buffer overflowing items until more items are being requested.
+
+
+

C

+
+
cancelled() - Method in interface mutiny.zero.Tube
+
+
Check if the subscription has been cancelled.
+
+
collectToList(Flow.Publisher<T>) - Static method in interface mutiny.zero.PublisherHelpers
+
+
Collect all items as a list.
+
+
complete() - Method in interface mutiny.zero.Tube
+
+
Signal completion and that no more items will be sent.
+
+
composeExceptionally(CompletionStage<T>, Function<Throwable, CompletionStage<T>>) - Static method in interface mutiny.zero.AsyncHelpers
+
+
Composes the given completion stage on failure.
+
+
Concatenate<T> - Class in mutiny.zero.operators
+
+
A Flow.Publisher that is the concatenation of several ones.
+
+
Concatenate(List<Flow.Publisher<T>>) - Constructor for class mutiny.zero.operators.Concatenate
+
+
Create a new concatenation publisher.
+
+
create(TubeConfiguration, Consumer<Tube<T>>) - Static method in interface mutiny.zero.ZeroPublisher
+
+
Create a new Flow.Publisher with the general-purpose Tube API.
+
+
+

D

+
+
DROP - Enum constant in enum mutiny.zero.BackpressureStrategy
+
+
Drop items in case of a lack of outstanding requests.
+
+
+

E

+
+
empty() - Static method in interface mutiny.zero.ZeroPublisher
+
+
Create an empty Flow.Publisher that completes upon subscription without ever sending any item.
+
+
ERROR - Enum constant in enum mutiny.zero.BackpressureStrategy
+
+
Signal a terminal IllegalStateException as soon as an item is being sent while there is no outstanding + request.
+
+
+

F

+
+
fail(Throwable) - Method in interface mutiny.zero.Tube
+
+
Terminally signal an error.
+
+
fromCompletionStage(Supplier<CompletionStage<T>>) - Static method in interface mutiny.zero.ZeroPublisher
+
+
Create a Flow.Publisher from a CompletionStage.
+
+
fromFailure(Throwable) - Static method in interface mutiny.zero.ZeroPublisher
+
+
Create a Flow.Publisher from a known failure.
+
+
fromFuture(Supplier<Future<? extends ReadStream<T>>>) - Static method in interface mutiny.zero.vertxpublishers.VertxPublisher
+
+
Create a publisher from a Vert.x future stream supplier.
+
+
fromGenerator(Supplier<S>, Function<S, Iterator<T>>) - Static method in interface mutiny.zero.ZeroPublisher
+
+
Create a Flow.Publisher from a generator over some state.
+
+
fromItems(T...) - Static method in interface mutiny.zero.ZeroPublisher
+
+
Create a Flow.Publisher from existing items.
+
+
fromIterable(Iterable<T>) - Static method in interface mutiny.zero.ZeroPublisher
+
+
Create a Flow.Publisher from an iterable object.
+
+
fromStream(Supplier<Stream<T>>) - Static method in interface mutiny.zero.ZeroPublisher
+
+
Create a Flow.Publisher from a Stream.
+
+
fromSupplier(Supplier<ReadStream<T>>) - Static method in interface mutiny.zero.vertxpublishers.VertxPublisher
+
+
Create a publisher from a Vert.x stream supplier.
+
+
+

G

+
+
getBackpressureStrategy() - Method in class mutiny.zero.TubeConfiguration
+
+
Get the back-pressure strategy.
+
+
getBufferSize() - Method in class mutiny.zero.TubeConfiguration
+
+
Get the buffer size.
+
+
+

I

+
+
IGNORE - Enum constant in enum mutiny.zero.BackpressureStrategy
+
+
Ignore back-pressure and still send items to the Tube consumer.
+
+
+

L

+
+
LATEST - Enum constant in enum mutiny.zero.BackpressureStrategy
+
+
Buffer overflowing items in a bounded buffer, but only keep the last values.
+
+
+

M

+
+
mutiny.zero - module mutiny.zero
+
 
+
mutiny.zero - package mutiny.zero
+
+
Mutiny Zero is minimal API for creating reactive streams compliant Flow.Publisher objects.
+
+
mutiny.zero.flow.adapters - module mutiny.zero.flow.adapters
+
 
+
mutiny.zero.flow.adapters - package mutiny.zero.flow.adapters
+
+
A set of adapters from Reactive Streams to/from Flow.
+
+
mutiny.zero.operators - package mutiny.zero.operators
+
+
This package contains a set of simple operator classes that can be useful when working with + Flow.Publisher streams.
+
+
mutiny.zero.vertxpublishers - module mutiny.zero.vertxpublishers
+
 
+
mutiny.zero.vertxpublishers - package mutiny.zero.vertxpublishers
+
 
+
+

O

+
+
outstandingRequests() - Method in interface mutiny.zero.Tube
+
+
Check the number of outstanding requests.
+
+
+

P

+
+
processor(Flow.Processor<T, R>) - Static method in interface mutiny.zero.flow.adapters.AdaptersToReactiveStreams
+
+
Convert a Flow.Processor to a Processor.
+
+
processor(Processor<T, R>) - Static method in interface mutiny.zero.flow.adapters.AdaptersToFlow
+
+
Convert a Processor to a Flow.Processor.
+
+
publisher(Flow.Publisher<T>) - Static method in interface mutiny.zero.flow.adapters.AdaptersToReactiveStreams
+
+
Convert a Flow.Publisher to a Publisher.
+
+
publisher(Publisher<T>) - Static method in interface mutiny.zero.flow.adapters.AdaptersToFlow
+
+
Convert a Publisher to a Flow.Publisher.
+
+
PublisherHelpers - Interface in mutiny.zero
+
 
+
+

R

+
+
Recover<T> - Class in mutiny.zero.operators
+
+
A Flow.Publisher that recovers from failure using a Function.
+
+
Recover(Flow.Publisher<T>, Function<Throwable, T>) - Constructor for class mutiny.zero.operators.Recover
+
+
Build a new recovery publisher.
+
+
Retry<T> - Class in mutiny.zero.operators
+
+
A Flow.Publisher that retries on failure by re-subscribing to its upstream.
+
+
Retry(Flow.Publisher<T>, Predicate<Throwable>) - Constructor for class mutiny.zero.operators.Retry
+
+
Build a new retry publisher.
+
+
+

S

+
+
Select<T> - Class in mutiny.zero.operators
+
+
A Flow.Publisher that selects elements matching a Predicate.
+
+
Select(Flow.Publisher<T>, Predicate<T>) - Constructor for class mutiny.zero.operators.Select
+
+
Build a new selection publisher.
+
+
send(T) - Method in interface mutiny.zero.Tube
+
+
Send an item.
+
+
subscribe(Flow.Subscriber<? super O>) - Method in class mutiny.zero.operators.Transform
+
 
+
subscribe(Flow.Subscriber<? super T>) - Method in class mutiny.zero.operators.Concatenate
+
 
+
subscribe(Flow.Subscriber<? super T>) - Method in class mutiny.zero.operators.Recover
+
 
+
subscribe(Flow.Subscriber<? super T>) - Method in class mutiny.zero.operators.Retry
+
 
+
subscribe(Flow.Subscriber<? super T>) - Method in class mutiny.zero.operators.Select
+
 
+
subscriber(Flow.Subscriber<T>) - Static method in interface mutiny.zero.flow.adapters.AdaptersToReactiveStreams
+
+
Convert a Flow.Subscriber to a Subscriber.
+
+
subscriber(Subscriber<T>) - Static method in interface mutiny.zero.flow.adapters.AdaptersToFlow
+
+
Convert a Subscriber to a Flow.Subscriber.
+
+
subscription(Flow.Subscription) - Static method in interface mutiny.zero.flow.adapters.AdaptersToReactiveStreams
+
+
Convert a Flow.Subscription to a Subscription.
+
+
subscription(Subscription) - Static method in interface mutiny.zero.flow.adapters.AdaptersToFlow
+
+
Convert a Subscription to a Flow.Subscription.
+
+
+

T

+
+
toCompletionStage(Flow.Publisher<T>) - Static method in interface mutiny.zero.ZeroPublisher
+
+
Create a CompletionStage from a Flow.Publisher.
+
+
Transform<I,O> - Class in mutiny.zero.operators
+
+
A Flow.Publisher that transforms elements using a Function.
+
+
Transform(Flow.Publisher<I>, Function<I, O>) - Constructor for class mutiny.zero.operators.Transform
+
+
Build a new transformation publisher.
+
+
Tube<T> - Interface in mutiny.zero
+
+
A Tube is a general-purpose abstraction for creating Flow.Publisher.
+
+
TubeConfiguration - Class in mutiny.zero
+
+
Configuration object for creating Tube through ZeroPublisher.create(TubeConfiguration, Consumer).
+
+
TubeConfiguration() - Constructor for class mutiny.zero.TubeConfiguration
+
 
+
+

U

+
+
UNBOUNDED_BUFFER - Enum constant in enum mutiny.zero.BackpressureStrategy
+
+
Buffer overflowing items until more items are being requested.
+
+
+

V

+
+
valueOf(String) - Static method in enum mutiny.zero.BackpressureStrategy
+
+
Returns the enum constant of this type with the specified name.
+
+
values() - Static method in enum mutiny.zero.BackpressureStrategy
+
+
Returns an array containing the constants of this enum type, in +the order they are declared.
+
+
VertxPublisher - Interface in mutiny.zero.vertxpublishers
+
+
Expose Vert.x streams as Reactive Streams compliant publishers.
+
+
+

W

+
+
whenCancelled(Runnable) - Method in interface mutiny.zero.Tube
+
+
Define an action when the subscription is cancelled.
+
+
whenRequested(LongConsumer) - Method in interface mutiny.zero.Tube
+
+
Define an action when items are being requested.
+
+
whenTerminates(Runnable) - Method in interface mutiny.zero.Tube
+
+
Define an action on termination (completion, error or cancellation), typically for cleanup purposes.
+
+
withBackpressureStrategy(BackpressureStrategy) - Method in class mutiny.zero.TubeConfiguration
+
+
Specify the back-pressure strategy, cannot be null.
+
+
withBufferSize(int) - Method in class mutiny.zero.TubeConfiguration
+
+
Specify the buffer size must be strictly positive when backpressureStrategy is one of + BackpressureStrategy.BUFFER and BackpressureStrategy.LATEST.
+
+
+

Z

+
+
ZeroPublisher - Interface in mutiny.zero
+
+
Factory methods to simplify the creation of reactive streams compliant Flow.Publisher.
+
+
+A B C D E F G I L M O P R S T U V W Z 
All Classes and Interfaces|All Packages
+ +
+
+ + diff --git a/1.1.0/apidocs/index.html b/1.1.0/apidocs/index.html new file mode 100644 index 0000000..61ab1c0 --- /dev/null +++ b/1.1.0/apidocs/index.html @@ -0,0 +1,76 @@ + + + + +Overview (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API

+
+
+
Modules
+
+
Module
+
Description
+
mutiny.zero
+
 
+
mutiny.zero.flow.adapters
+
 
+
mutiny.zero.vertxpublishers
+
 
+
+
+
+ +
+
+ + diff --git a/1.1.0/apidocs/legal/ADDITIONAL_LICENSE_INFO b/1.1.0/apidocs/legal/ADDITIONAL_LICENSE_INFO new file mode 100644 index 0000000..ff700cd --- /dev/null +++ b/1.1.0/apidocs/legal/ADDITIONAL_LICENSE_INFO @@ -0,0 +1,37 @@ + ADDITIONAL INFORMATION ABOUT LICENSING + +Certain files distributed by Oracle America, Inc. and/or its affiliates are +subject to the following clarification and special exception to the GPLv2, +based on the GNU Project exception for its Classpath libraries, known as the +GNU Classpath Exception. + +Note that Oracle includes multiple, independent programs in this software +package. Some of those programs are provided under licenses deemed +incompatible with the GPLv2 by the Free Software Foundation and others. +For example, the package includes programs licensed under the Apache +License, Version 2.0 and may include FreeType. Such programs are licensed +to you under their original licenses. + +Oracle facilitates your further distribution of this package by adding the +Classpath Exception to the necessary parts of its GPLv2 code, which permits +you to use that code in combination with other independent modules not +licensed under the GPLv2. However, note that this would not permit you to +commingle code under an incompatible license with Oracle's GPLv2 licensed +code by, for example, cutting and pasting such code into a file also +containing Oracle's GPLv2 licensed code and then distributing the result. + +Additionally, if you were to remove the Classpath Exception from any of the +files to which it applies and distribute the result, you would likely be +required to license some or all of the other code in that distribution under +the GPLv2 as well, and since the GPLv2 is incompatible with the license terms +of some items included in the distribution by Oracle, removing the Classpath +Exception could therefore effectively compromise your ability to further +distribute the package. + +Failing to distribute notices associated with some files may also create +unexpected legal consequences. + +Proceed with caution and we recommend that you obtain the advice of a lawyer +skilled in open source matters before removing the Classpath Exception or +making modifications to this package which may subsequently be redistributed +and/or involve the use of third party software. diff --git a/1.1.0/apidocs/legal/ASSEMBLY_EXCEPTION b/1.1.0/apidocs/legal/ASSEMBLY_EXCEPTION new file mode 100644 index 0000000..4296666 --- /dev/null +++ b/1.1.0/apidocs/legal/ASSEMBLY_EXCEPTION @@ -0,0 +1,27 @@ + +OPENJDK ASSEMBLY EXCEPTION + +The OpenJDK source code made available by Oracle America, Inc. (Oracle) at +openjdk.org ("OpenJDK Code") is distributed under the terms of the GNU +General Public License version 2 +only ("GPL2"), with the following clarification and special exception. + + Linking this OpenJDK Code statically or dynamically with other code + is making a combined work based on this library. Thus, the terms + and conditions of GPL2 cover the whole combination. + + As a special exception, Oracle gives you permission to link this + OpenJDK Code with certain code licensed by Oracle as indicated at + https://openjdk.org/legal/exception-modules-2007-05-08.html + ("Designated Exception Modules") to produce an executable, + regardless of the license terms of the Designated Exception Modules, + and to copy and distribute the resulting executable under GPL2, + provided that the Designated Exception Modules continue to be + governed by the licenses under which they were offered by Oracle. + +As such, it allows licensees and sublicensees of Oracle's GPL2 OpenJDK Code +to build an executable that includes those portions of necessary code that +Oracle could not provide under GPL2 (or that Oracle has provided under GPL2 +with the Classpath exception). If you modify or add to the OpenJDK code, +that new GPL2 code may still be combined with Designated Exception Modules +if the new code is made subject to this exception by its copyright holder. diff --git a/1.1.0/apidocs/legal/LICENSE b/1.1.0/apidocs/legal/LICENSE new file mode 100644 index 0000000..8b400c7 --- /dev/null +++ b/1.1.0/apidocs/legal/LICENSE @@ -0,0 +1,347 @@ +The GNU General Public License (GPL) + +Version 2, June 1991 + +Copyright (C) 1989, 1991 Free Software Foundation, Inc. +51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + +Everyone is permitted to copy and distribute verbatim copies of this license +document, but changing it is not allowed. + +Preamble + +The licenses for most software are designed to take away your freedom to share +and change it. By contrast, the GNU General Public License is intended to +guarantee your freedom to share and change free software--to make sure the +software is free for all its users. This General Public License applies to +most of the Free Software Foundation's software and to any other program whose +authors commit to using it. (Some other Free Software Foundation software is +covered by the GNU Library General Public License instead.) You can apply it to +your programs, too. + +When we speak of free software, we are referring to freedom, not price. Our +General Public Licenses are designed to make sure that you have the freedom to +distribute copies of free software (and charge for this service if you wish), +that you receive source code or can get it if you want it, that you can change +the software or use pieces of it in new free programs; and that you know you +can do these things. + +To protect your rights, we need to make restrictions that forbid anyone to deny +you these rights or to ask you to surrender the rights. These restrictions +translate to certain responsibilities for you if you distribute copies of the +software, or if you modify it. + +For example, if you distribute copies of such a program, whether gratis or for +a fee, you must give the recipients all the rights that you have. You must +make sure that they, too, receive or can get the source code. And you must +show them these terms so they know their rights. + +We protect your rights with two steps: (1) copyright the software, and (2) +offer you this license which gives you legal permission to copy, distribute +and/or modify the software. + +Also, for each author's protection and ours, we want to make certain that +everyone understands that there is no warranty for this free software. If the +software is modified by someone else and passed on, we want its recipients to +know that what they have is not the original, so that any problems introduced +by others will not reflect on the original authors' reputations. + +Finally, any free program is threatened constantly by software patents. We +wish to avoid the danger that redistributors of a free program will +individually obtain patent licenses, in effect making the program proprietary. +To prevent this, we have made it clear that any patent must be licensed for +everyone's free use or not licensed at all. + +The precise terms and conditions for copying, distribution and modification +follow. + +TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION + +0. This License applies to any program or other work which contains a notice +placed by the copyright holder saying it may be distributed under the terms of +this General Public License. The "Program", below, refers to any such program +or work, and a "work based on the Program" means either the Program or any +derivative work under copyright law: that is to say, a work containing the +Program or a portion of it, either verbatim or with modifications and/or +translated into another language. (Hereinafter, translation is included +without limitation in the term "modification".) Each licensee is addressed as +"you". + +Activities other than copying, distribution and modification are not covered by +this License; they are outside its scope. The act of running the Program is +not restricted, and the output from the Program is covered only if its contents +constitute a work based on the Program (independent of having been made by +running the Program). Whether that is true depends on what the Program does. + +1. You may copy and distribute verbatim copies of the Program's source code as +you receive it, in any medium, provided that you conspicuously and +appropriately publish on each copy an appropriate copyright notice and +disclaimer of warranty; keep intact all the notices that refer to this License +and to the absence of any warranty; and give any other recipients of the +Program a copy of this License along with the Program. + +You may charge a fee for the physical act of transferring a copy, and you may +at your option offer warranty protection in exchange for a fee. + +2. You may modify your copy or copies of the Program or any portion of it, thus +forming a work based on the Program, and copy and distribute such modifications +or work under the terms of Section 1 above, provided that you also meet all of +these conditions: + + a) You must cause the modified files to carry prominent notices stating + that you changed the files and the date of any change. + + b) You must cause any work that you distribute or publish, that in whole or + in part contains or is derived from the Program or any part thereof, to be + licensed as a whole at no charge to all third parties under the terms of + this License. + + c) If the modified program normally reads commands interactively when run, + you must cause it, when started running for such interactive use in the + most ordinary way, to print or display an announcement including an + appropriate copyright notice and a notice that there is no warranty (or + else, saying that you provide a warranty) and that users may redistribute + the program under these conditions, and telling the user how to view a copy + of this License. (Exception: if the Program itself is interactive but does + not normally print such an announcement, your work based on the Program is + not required to print an announcement.) + +These requirements apply to the modified work as a whole. If identifiable +sections of that work are not derived from the Program, and can be reasonably +considered independent and separate works in themselves, then this License, and +its terms, do not apply to those sections when you distribute them as separate +works. But when you distribute the same sections as part of a whole which is a +work based on the Program, the distribution of the whole must be on the terms +of this License, whose permissions for other licensees extend to the entire +whole, and thus to each and every part regardless of who wrote it. + +Thus, it is not the intent of this section to claim rights or contest your +rights to work written entirely by you; rather, the intent is to exercise the +right to control the distribution of derivative or collective works based on +the Program. + +In addition, mere aggregation of another work not based on the Program with the +Program (or with a work based on the Program) on a volume of a storage or +distribution medium does not bring the other work under the scope of this +License. + +3. You may copy and distribute the Program (or a work based on it, under +Section 2) in object code or executable form under the terms of Sections 1 and +2 above provided that you also do one of the following: + + a) Accompany it with the complete corresponding machine-readable source + code, which must be distributed under the terms of Sections 1 and 2 above + on a medium customarily used for software interchange; or, + + b) Accompany it with a written offer, valid for at least three years, to + give any third party, for a charge no more than your cost of physically + performing source distribution, a complete machine-readable copy of the + corresponding source code, to be distributed under the terms of Sections 1 + and 2 above on a medium customarily used for software interchange; or, + + c) Accompany it with the information you received as to the offer to + distribute corresponding source code. (This alternative is allowed only + for noncommercial distribution and only if you received the program in + object code or executable form with such an offer, in accord with + Subsection b above.) + +The source code for a work means the preferred form of the work for making +modifications to it. For an executable work, complete source code means all +the source code for all modules it contains, plus any associated interface +definition files, plus the scripts used to control compilation and installation +of the executable. However, as a special exception, the source code +distributed need not include anything that is normally distributed (in either +source or binary form) with the major components (compiler, kernel, and so on) +of the operating system on which the executable runs, unless that component +itself accompanies the executable. + +If distribution of executable or object code is made by offering access to copy +from a designated place, then offering equivalent access to copy the source +code from the same place counts as distribution of the source code, even though +third parties are not compelled to copy the source along with the object code. + +4. You may not copy, modify, sublicense, or distribute the Program except as +expressly provided under this License. Any attempt otherwise to copy, modify, +sublicense or distribute the Program is void, and will automatically terminate +your rights under this License. However, parties who have received copies, or +rights, from you under this License will not have their licenses terminated so +long as such parties remain in full compliance. + +5. You are not required to accept this License, since you have not signed it. +However, nothing else grants you permission to modify or distribute the Program +or its derivative works. These actions are prohibited by law if you do not +accept this License. Therefore, by modifying or distributing the Program (or +any work based on the Program), you indicate your acceptance of this License to +do so, and all its terms and conditions for copying, distributing or modifying +the Program or works based on it. + +6. Each time you redistribute the Program (or any work based on the Program), +the recipient automatically receives a license from the original licensor to +copy, distribute or modify the Program subject to these terms and conditions. +You may not impose any further restrictions on the recipients' exercise of the +rights granted herein. You are not responsible for enforcing compliance by +third parties to this License. + +7. If, as a consequence of a court judgment or allegation of patent +infringement or for any other reason (not limited to patent issues), conditions +are imposed on you (whether by court order, agreement or otherwise) that +contradict the conditions of this License, they do not excuse you from the +conditions of this License. If you cannot distribute so as to satisfy +simultaneously your obligations under this License and any other pertinent +obligations, then as a consequence you may not distribute the Program at all. +For example, if a patent license would not permit royalty-free redistribution +of the Program by all those who receive copies directly or indirectly through +you, then the only way you could satisfy both it and this License would be to +refrain entirely from distribution of the Program. + +If any portion of this section is held invalid or unenforceable under any +particular circumstance, the balance of the section is intended to apply and +the section as a whole is intended to apply in other circumstances. + +It is not the purpose of this section to induce you to infringe any patents or +other property right claims or to contest validity of any such claims; this +section has the sole purpose of protecting the integrity of the free software +distribution system, which is implemented by public license practices. Many +people have made generous contributions to the wide range of software +distributed through that system in reliance on consistent application of that +system; it is up to the author/donor to decide if he or she is willing to +distribute software through any other system and a licensee cannot impose that +choice. + +This section is intended to make thoroughly clear what is believed to be a +consequence of the rest of this License. + +8. If the distribution and/or use of the Program is restricted in certain +countries either by patents or by copyrighted interfaces, the original +copyright holder who places the Program under this License may add an explicit +geographical distribution limitation excluding those countries, so that +distribution is permitted only in or among countries not thus excluded. In +such case, this License incorporates the limitation as if written in the body +of this License. + +9. The Free Software Foundation may publish revised and/or new versions of the +General Public License from time to time. Such new versions will be similar in +spirit to the present version, but may differ in detail to address new problems +or concerns. + +Each version is given a distinguishing version number. If the Program +specifies a version number of this License which applies to it and "any later +version", you have the option of following the terms and conditions either of +that version or of any later version published by the Free Software Foundation. +If the Program does not specify a version number of this License, you may +choose any version ever published by the Free Software Foundation. + +10. If you wish to incorporate parts of the Program into other free programs +whose distribution conditions are different, write to the author to ask for +permission. For software which is copyrighted by the Free Software Foundation, +write to the Free Software Foundation; we sometimes make exceptions for this. +Our decision will be guided by the two goals of preserving the free status of +all derivatives of our free software and of promoting the sharing and reuse of +software generally. + +NO WARRANTY + +11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY FOR +THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN OTHERWISE +STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES PROVIDE THE +PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED OR IMPLIED, +INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND +PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, +YOU ASSUME THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + +12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING WILL +ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR REDISTRIBUTE THE +PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY +GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR +INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA +BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A +FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), EVEN IF SUCH HOLDER +OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGES. + +END OF TERMS AND CONDITIONS + +How to Apply These Terms to Your New Programs + +If you develop a new program, and you want it to be of the greatest possible +use to the public, the best way to achieve this is to make it free software +which everyone can redistribute and change under these terms. + +To do so, attach the following notices to the program. It is safest to attach +them to the start of each source file to most effectively convey the exclusion +of warranty; and each file should have at least the "copyright" line and a +pointer to where the full notice is found. + + One line to give the program's name and a brief idea of what it does. + + Copyright (C) + + This program is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the Free + Software Foundation; either version 2 of the License, or (at your option) + any later version. + + This program is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for + more details. + + You should have received a copy of the GNU General Public License along + with this program; if not, write to the Free Software Foundation, Inc., + 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. + +Also add information on how to contact you by electronic and paper mail. + +If the program is interactive, make it output a short notice like this when it +starts in an interactive mode: + + Gnomovision version 69, Copyright (C) year name of author Gnomovision comes + with ABSOLUTELY NO WARRANTY; for details type 'show w'. This is free + software, and you are welcome to redistribute it under certain conditions; + type 'show c' for details. + +The hypothetical commands 'show w' and 'show c' should show the appropriate +parts of the General Public License. Of course, the commands you use may be +called something other than 'show w' and 'show c'; they could even be +mouse-clicks or menu items--whatever suits your program. + +You should also get your employer (if you work as a programmer) or your school, +if any, to sign a "copyright disclaimer" for the program, if necessary. Here +is a sample; alter the names: + + Yoyodyne, Inc., hereby disclaims all copyright interest in the program + 'Gnomovision' (which makes passes at compilers) written by James Hacker. + + signature of Ty Coon, 1 April 1989 + + Ty Coon, President of Vice + +This General Public License does not permit incorporating your program into +proprietary programs. If your program is a subroutine library, you may +consider it more useful to permit linking proprietary applications with the +library. If this is what you want to do, use the GNU Library General Public +License instead of this License. + + +"CLASSPATH" EXCEPTION TO THE GPL + +Certain source files distributed by Oracle America and/or its affiliates are +subject to the following clarification and special exception to the GPL, but +only where Oracle has expressly included in the particular source file's header +the words "Oracle designates this particular file as subject to the "Classpath" +exception as provided by Oracle in the LICENSE file that accompanied this code." + + Linking this library statically or dynamically with other modules is making + a combined work based on this library. Thus, the terms and conditions of + the GNU General Public License cover the whole combination. + + As a special exception, the copyright holders of this library give you + permission to link this library with independent modules to produce an + executable, regardless of the license terms of these independent modules, + and to copy and distribute the resulting executable under terms of your + choice, provided that you also meet, for each linked independent module, + the terms and conditions of the license of that module. An independent + module is a module which is not derived from or based on this library. If + you modify this library, you may extend this exception to your version of + the library, but you are not obligated to do so. If you do not wish to do + so, delete this exception statement from your version. diff --git a/1.1.0/apidocs/legal/jquery/index.html b/1.1.0/apidocs/legal/jquery/index.html new file mode 100644 index 0000000..d4bac60 --- /dev/null +++ b/1.1.0/apidocs/legal/jquery/index.html @@ -0,0 +1,509 @@ + + + + + + + + + + + + + + + + + + + Jquery - Smallrye Mutiny Zero + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + Skip to content + + +
+
+ +
+ + + + + + + + +
+ + +
+ +
+ + + + + + +
+
+ + + +
+
+
+ + + + + +
+
+
+ + + +
+
+
+ + + +
+
+
+ + + +
+
+ + + + + + + +

Jquery

+ +

jQuery v3.6.1#

+

jQuery License#

+
jQuery v 3.6.1
+Copyright OpenJS Foundation and other contributors, https://openjsf.org/
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+******************************************
+
+The jQuery JavaScript Library v3.6.1 also includes Sizzle.js
+
+Sizzle.js includes the following license:
+
+Copyright JS Foundation and other contributors, https://js.foundation/
+
+This software consists of voluntary contributions made by many
+individuals. For exact contribution history, see the revision history
+available at https://github.com/jquery/sizzle
+
+The following license applies to all parts of this software except as
+documented below:
+
+====
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+====
+
+All files located in the node_modules and external directories are
+externally maintained libraries used by this software which have their
+own licenses; we recommend you read them, as their terms may differ from
+the terms above.
+
+*********************
+
+ + + + + + + + + + + + + +
+
+ + + +
+ +
+ + + +
+
+
+
+ + + + + + + + + + \ No newline at end of file diff --git a/1.1.0/apidocs/legal/jqueryUI/index.html b/1.1.0/apidocs/legal/jqueryUI/index.html new file mode 100644 index 0000000..ba5e12b --- /dev/null +++ b/1.1.0/apidocs/legal/jqueryUI/index.html @@ -0,0 +1,486 @@ + + + + + + + + + + + + + + + + + + + jqueryUI - Smallrye Mutiny Zero + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + Skip to content + + +
+
+ +
+ + + + + + + + +
+ + +
+ +
+ + + + + + +
+
+ + + +
+
+
+ + + + + +
+
+
+ + + +
+
+
+ + + +
+
+
+ + + +
+
+ + + + + + + +

jqueryUI

+ +

jQuery UI v1.13.2#

+

jQuery UI License#

+
Copyright jQuery Foundation and other contributors, https://jquery.org/
+
+This software consists of voluntary contributions made by many
+individuals. For exact contribution history, see the revision history
+available at https://github.com/jquery/jquery-ui
+
+The following license applies to all parts of this software except as
+documented below:
+
+====
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+====
+
+Copyright and related rights for sample code are waived via CC0. Sample
+code is defined as all source code contained within the demos directory.
+
+CC0: http://creativecommons.org/publicdomain/zero/1.0/
+
+====
+
+All files located in the node_modules and external directories are
+externally maintained libraries used by this software which have their
+own licenses; we recommend you read them, as their terms may differ from
+the terms above.
+
+ + + + + + + + + + + + + +
+
+ + + +
+ +
+ + + +
+
+
+
+ + + + + + + + + + \ No newline at end of file diff --git a/1.1.0/apidocs/link.svg b/1.1.0/apidocs/link.svg new file mode 100644 index 0000000..7ccc5ed --- /dev/null +++ b/1.1.0/apidocs/link.svg @@ -0,0 +1,31 @@ + + + + + + + + diff --git a/1.1.0/apidocs/member-search-index.js b/1.1.0/apidocs/member-search-index.js new file mode 100644 index 0000000..d8b5bc3 --- /dev/null +++ b/1.1.0/apidocs/member-search-index.js @@ -0,0 +1 @@ +memberSearchIndex = [{"p":"mutiny.zero.operators","c":"Retry","l":"always()"},{"p":"mutiny.zero","c":"AsyncHelpers","l":"applyExceptionally(CompletionStage, Function)","u":"applyExceptionally(java.util.concurrent.CompletionStage,java.util.function.Function)"},{"p":"mutiny.zero.operators","c":"Retry","l":"atMost(int)"},{"p":"mutiny.zero","c":"BackpressureStrategy","l":"BUFFER"},{"p":"mutiny.zero","c":"Tube","l":"cancelled()"},{"p":"mutiny.zero","c":"PublisherHelpers","l":"collectToList(Flow.Publisher)","u":"collectToList(java.util.concurrent.Flow.Publisher)"},{"p":"mutiny.zero","c":"Tube","l":"complete()"},{"p":"mutiny.zero","c":"AsyncHelpers","l":"composeExceptionally(CompletionStage, Function>)","u":"composeExceptionally(java.util.concurrent.CompletionStage,java.util.function.Function)"},{"p":"mutiny.zero.operators","c":"Concatenate","l":"Concatenate(List>)","u":"%3Cinit%3E(java.util.List)"},{"p":"mutiny.zero","c":"ZeroPublisher","l":"create(TubeConfiguration, Consumer>)","u":"create(mutiny.zero.TubeConfiguration,java.util.function.Consumer)"},{"p":"mutiny.zero","c":"BackpressureStrategy","l":"DROP"},{"p":"mutiny.zero","c":"ZeroPublisher","l":"empty()"},{"p":"mutiny.zero","c":"BackpressureStrategy","l":"ERROR"},{"p":"mutiny.zero","c":"Tube","l":"fail(Throwable)","u":"fail(java.lang.Throwable)"},{"p":"mutiny.zero","c":"ZeroPublisher","l":"fromCompletionStage(Supplier>)","u":"fromCompletionStage(java.util.function.Supplier)"},{"p":"mutiny.zero","c":"ZeroPublisher","l":"fromFailure(Throwable)","u":"fromFailure(java.lang.Throwable)"},{"p":"mutiny.zero.vertxpublishers","c":"VertxPublisher","l":"fromFuture(Supplier>>)","u":"fromFuture(java.util.function.Supplier)"},{"p":"mutiny.zero","c":"ZeroPublisher","l":"fromGenerator(Supplier, Function>)","u":"fromGenerator(java.util.function.Supplier,java.util.function.Function)"},{"p":"mutiny.zero","c":"ZeroPublisher","l":"fromItems(T...)"},{"p":"mutiny.zero","c":"ZeroPublisher","l":"fromIterable(Iterable)","u":"fromIterable(java.lang.Iterable)"},{"p":"mutiny.zero","c":"ZeroPublisher","l":"fromStream(Supplier>)","u":"fromStream(java.util.function.Supplier)"},{"p":"mutiny.zero.vertxpublishers","c":"VertxPublisher","l":"fromSupplier(Supplier>)","u":"fromSupplier(java.util.function.Supplier)"},{"p":"mutiny.zero","c":"TubeConfiguration","l":"getBackpressureStrategy()"},{"p":"mutiny.zero","c":"TubeConfiguration","l":"getBufferSize()"},{"p":"mutiny.zero","c":"BackpressureStrategy","l":"IGNORE"},{"p":"mutiny.zero","c":"BackpressureStrategy","l":"LATEST"},{"p":"mutiny.zero","c":"Tube","l":"outstandingRequests()"},{"p":"mutiny.zero.flow.adapters","c":"AdaptersToReactiveStreams","l":"processor(Flow.Processor)","u":"processor(java.util.concurrent.Flow.Processor)"},{"p":"mutiny.zero.flow.adapters","c":"AdaptersToFlow","l":"processor(Processor)","u":"processor(org.reactivestreams.Processor)"},{"p":"mutiny.zero.flow.adapters","c":"AdaptersToReactiveStreams","l":"publisher(Flow.Publisher)","u":"publisher(java.util.concurrent.Flow.Publisher)"},{"p":"mutiny.zero.flow.adapters","c":"AdaptersToFlow","l":"publisher(Publisher)","u":"publisher(org.reactivestreams.Publisher)"},{"p":"mutiny.zero.operators","c":"Recover","l":"Recover(Flow.Publisher, Function)","u":"%3Cinit%3E(java.util.concurrent.Flow.Publisher,java.util.function.Function)"},{"p":"mutiny.zero.operators","c":"Retry","l":"Retry(Flow.Publisher, Predicate)","u":"%3Cinit%3E(java.util.concurrent.Flow.Publisher,java.util.function.Predicate)"},{"p":"mutiny.zero.operators","c":"Select","l":"Select(Flow.Publisher, Predicate)","u":"%3Cinit%3E(java.util.concurrent.Flow.Publisher,java.util.function.Predicate)"},{"p":"mutiny.zero","c":"Tube","l":"send(T)"},{"p":"mutiny.zero.operators","c":"Transform","l":"subscribe(Flow.Subscriber)","u":"subscribe(java.util.concurrent.Flow.Subscriber)"},{"p":"mutiny.zero.operators","c":"Concatenate","l":"subscribe(Flow.Subscriber)","u":"subscribe(java.util.concurrent.Flow.Subscriber)"},{"p":"mutiny.zero.operators","c":"Recover","l":"subscribe(Flow.Subscriber)","u":"subscribe(java.util.concurrent.Flow.Subscriber)"},{"p":"mutiny.zero.operators","c":"Retry","l":"subscribe(Flow.Subscriber)","u":"subscribe(java.util.concurrent.Flow.Subscriber)"},{"p":"mutiny.zero.operators","c":"Select","l":"subscribe(Flow.Subscriber)","u":"subscribe(java.util.concurrent.Flow.Subscriber)"},{"p":"mutiny.zero.flow.adapters","c":"AdaptersToReactiveStreams","l":"subscriber(Flow.Subscriber)","u":"subscriber(java.util.concurrent.Flow.Subscriber)"},{"p":"mutiny.zero.flow.adapters","c":"AdaptersToFlow","l":"subscriber(Subscriber)","u":"subscriber(org.reactivestreams.Subscriber)"},{"p":"mutiny.zero.flow.adapters","c":"AdaptersToReactiveStreams","l":"subscription(Flow.Subscription)","u":"subscription(java.util.concurrent.Flow.Subscription)"},{"p":"mutiny.zero.flow.adapters","c":"AdaptersToFlow","l":"subscription(Subscription)","u":"subscription(org.reactivestreams.Subscription)"},{"p":"mutiny.zero","c":"ZeroPublisher","l":"toCompletionStage(Flow.Publisher)","u":"toCompletionStage(java.util.concurrent.Flow.Publisher)"},{"p":"mutiny.zero.operators","c":"Transform","l":"Transform(Flow.Publisher, Function)","u":"%3Cinit%3E(java.util.concurrent.Flow.Publisher,java.util.function.Function)"},{"p":"mutiny.zero","c":"TubeConfiguration","l":"TubeConfiguration()","u":"%3Cinit%3E()"},{"p":"mutiny.zero","c":"BackpressureStrategy","l":"UNBOUNDED_BUFFER"},{"p":"mutiny.zero","c":"BackpressureStrategy","l":"valueOf(String)","u":"valueOf(java.lang.String)"},{"p":"mutiny.zero","c":"BackpressureStrategy","l":"values()"},{"p":"mutiny.zero","c":"Tube","l":"whenCancelled(Runnable)","u":"whenCancelled(java.lang.Runnable)"},{"p":"mutiny.zero","c":"Tube","l":"whenRequested(LongConsumer)","u":"whenRequested(java.util.function.LongConsumer)"},{"p":"mutiny.zero","c":"Tube","l":"whenTerminates(Runnable)","u":"whenTerminates(java.lang.Runnable)"},{"p":"mutiny.zero","c":"TubeConfiguration","l":"withBackpressureStrategy(BackpressureStrategy)","u":"withBackpressureStrategy(mutiny.zero.BackpressureStrategy)"},{"p":"mutiny.zero","c":"TubeConfiguration","l":"withBufferSize(int)"}];updateSearchResults(); \ No newline at end of file diff --git a/1.1.0/apidocs/module-search-index.js b/1.1.0/apidocs/module-search-index.js new file mode 100644 index 0000000..06e6daa --- /dev/null +++ b/1.1.0/apidocs/module-search-index.js @@ -0,0 +1 @@ +moduleSearchIndex = [{"l":"mutiny.zero"},{"l":"mutiny.zero.flow.adapters"},{"l":"mutiny.zero.vertxpublishers"}];updateSearchResults(); \ No newline at end of file diff --git a/1.1.0/apidocs/mutiny.zero.flow.adapters/module-summary.html b/1.1.0/apidocs/mutiny.zero.flow.adapters/module-summary.html new file mode 100644 index 0000000..c10a581 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.flow.adapters/module-summary.html @@ -0,0 +1,105 @@ + + + + +mutiny.zero.flow.adapters (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Module mutiny.zero.flow.adapters

+
+
+
module mutiny.zero.flow.adapters
+
+
    +
  • +
    + +

    Packages

    +
    +
    Exports
    +
    +
    Package
    +
    Description
    +
    mutiny.zero.flow.adapters
    +
    +
    A set of adapters from Reactive Streams to/from Flow.
    +
    +
    +
    +
    +
    • +
+
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/AdaptersToFlow.html b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/AdaptersToFlow.html new file mode 100644 index 0000000..4b4737b --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/AdaptersToFlow.html @@ -0,0 +1,216 @@ + + + + +AdaptersToFlow (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero.flow.adapters
+
Package mutiny.zero.flow.adapters
+

Interface AdaptersToFlow

+
+
+
+
public interface AdaptersToFlow
+
Adapters from Reactive Streams types to Flow types.
+
+
+ +
+
+
    + +
  • +
    +

    Method Details

    +
      +
    • +
      +

      publisher

      +
      static <T> Flow.Publisher<T> publisher(org.reactivestreams.Publisher<T> publisher)
      +
      Convert a Publisher to a Flow.Publisher.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Parameters:
      +
      publisher - the publisher
      +
      Returns:
      +
      the wrapped publisher
      +
      +
      +
      • +
    • +
      +

      subscriber

      +
      static <T> Flow.Subscriber<T> subscriber(org.reactivestreams.Subscriber<T> subscriber)
      +
      Convert a Subscriber to a Flow.Subscriber.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Parameters:
      +
      subscriber - the subscriber
      +
      Returns:
      +
      the wrapped subscriber
      +
      +
      +
      • +
    • +
      +

      subscription

      +
      static Flow.Subscription subscription(org.reactivestreams.Subscription subscription)
      +
      Convert a Subscription to a Flow.Subscription.
      +
      +
      Parameters:
      +
      subscription - the subscription
      +
      Returns:
      +
      the wrapped subscription
      +
      +
      +
      • +
    • +
      +

      processor

      +
      static <T, +R> Flow.Processor<T,R> processor(org.reactivestreams.Processor<T,R> processor)
      +
      Convert a Processor to a Flow.Processor.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      R - the output items type
      +
      Parameters:
      +
      processor - the processor
      +
      Returns:
      +
      the wrapped processor
      +
      +
      +
      • +
    +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/AdaptersToReactiveStreams.html b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/AdaptersToReactiveStreams.html new file mode 100644 index 0000000..d642309 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/AdaptersToReactiveStreams.html @@ -0,0 +1,216 @@ + + + + +AdaptersToReactiveStreams (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero.flow.adapters
+
Package mutiny.zero.flow.adapters
+

Interface AdaptersToReactiveStreams

+
+
+
+
public interface AdaptersToReactiveStreams
+
Adapters from Flow types to Reactive Streams types.
+
+
+ +
+
+
    + +
  • +
    +

    Method Details

    +
      +
    • +
      +

      publisher

      +
      static <T> org.reactivestreams.Publisher<T> publisher(Flow.Publisher<T> publisher)
      +
      Convert a Flow.Publisher to a Publisher.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Parameters:
      +
      publisher - the publisher
      +
      Returns:
      +
      the wrapped publisher
      +
      +
      +
      • +
    • +
      +

      subscriber

      +
      static <T> org.reactivestreams.Subscriber<T> subscriber(Flow.Subscriber<T> subscriber)
      +
      Convert a Flow.Subscriber to a Subscriber.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Parameters:
      +
      subscriber - the subscriber
      +
      Returns:
      +
      the wrapped subscriber
      +
      +
      +
      • +
    • +
      +

      subscription

      +
      static org.reactivestreams.Subscription subscription(Flow.Subscription subscription)
      +
      Convert a Flow.Subscription to a Subscription.
      +
      +
      Parameters:
      +
      subscription - the subscription
      +
      Returns:
      +
      the wrapped subscription
      +
      +
      +
      • +
    • +
      +

      processor

      +
      static <T, +R> org.reactivestreams.Processor<T,R> processor(Flow.Processor<T,R> processor)
      +
      Convert a Flow.Processor to a Processor.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      R - the output items type
      +
      Parameters:
      +
      processor - the processor
      +
      Returns:
      +
      the wrapped processor
      +
      +
      +
      • +
    +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/class-use/AdaptersToFlow.html b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/class-use/AdaptersToFlow.html new file mode 100644 index 0000000..d44b196 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/class-use/AdaptersToFlow.html @@ -0,0 +1,63 @@ + + + + +Uses of Interface mutiny.zero.flow.adapters.AdaptersToFlow (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Interface
mutiny.zero.flow.adapters.AdaptersToFlow

+
+No usage of mutiny.zero.flow.adapters.AdaptersToFlow
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/class-use/AdaptersToReactiveStreams.html b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/class-use/AdaptersToReactiveStreams.html new file mode 100644 index 0000000..154097f --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/class-use/AdaptersToReactiveStreams.html @@ -0,0 +1,63 @@ + + + + +Uses of Interface mutiny.zero.flow.adapters.AdaptersToReactiveStreams (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Interface
mutiny.zero.flow.adapters.AdaptersToReactiveStreams

+
+No usage of mutiny.zero.flow.adapters.AdaptersToReactiveStreams
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/package-summary.html b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/package-summary.html new file mode 100644 index 0000000..ed7195b --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/package-summary.html @@ -0,0 +1,113 @@ + + + + +mutiny.zero.flow.adapters (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+
Module mutiny.zero.flow.adapters
+

Package mutiny.zero.flow.adapters

+
+
+
package mutiny.zero.flow.adapters
+
+
A set of adapters from Reactive Streams to/from Flow. +

+ The methods found in AdaptersToFlow and + AdaptersToReactiveStreams + avoid excessive wrapping when possible. + For instance wrapping a flow publisher p1 to a reactive streams publisher p2 and back to a flow + publisher p3 yields the original flow publisher where p1 == p3.

+
+
+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/package-tree.html b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/package-tree.html new file mode 100644 index 0000000..0a45816 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/package-tree.html @@ -0,0 +1,74 @@ + + + + +mutiny.zero.flow.adapters Class Hierarchy (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Hierarchy For Package mutiny.zero.flow.adapters

+
+Package Hierarchies: + +
+

Interface Hierarchy

+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/package-use.html b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/package-use.html new file mode 100644 index 0000000..0611ca9 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.flow.adapters/mutiny/zero/flow/adapters/package-use.html @@ -0,0 +1,63 @@ + + + + +Uses of Package mutiny.zero.flow.adapters (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Package
mutiny.zero.flow.adapters

+
+No usage of mutiny.zero.flow.adapters
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.vertxpublishers/module-summary.html b/1.1.0/apidocs/mutiny.zero.vertxpublishers/module-summary.html new file mode 100644 index 0000000..6b9f960 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.vertxpublishers/module-summary.html @@ -0,0 +1,103 @@ + + + + +mutiny.zero.vertxpublishers (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Module mutiny.zero.vertxpublishers

+
+
+
module mutiny.zero.vertxpublishers
+
+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/VertxPublisher.html b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/VertxPublisher.html new file mode 100644 index 0000000..9d41b6f --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/VertxPublisher.html @@ -0,0 +1,179 @@ + + + + +VertxPublisher (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero.vertxpublishers
+
Package mutiny.zero.vertxpublishers
+

Interface VertxPublisher

+
+
+
+
public interface VertxPublisher
+
Expose Vert.x streams as Reactive Streams compliant publishers.
+
+
+
    + +
  • +
    +

    Method Summary

    +
    +
    Static Methods
    +
    +
    Modifier and Type
    +
    Method
    +
    Description
    +
    static <T> Flow.Publisher<T>
    +
    fromFuture(Supplier<io.vertx.core.Future<? extends io.vertx.core.streams.ReadStream<T>>> futureStreamSupplier)
    +
    +
    Create a publisher from a Vert.x future stream supplier.
    +
    +
    static <T> Flow.Publisher<T>
    +
    fromSupplier(Supplier<io.vertx.core.streams.ReadStream<T>> streamSupplier)
    +
    +
    Create a publisher from a Vert.x stream supplier.
    +
    +
    +
    +
    +
    • +
+
+
+
    + +
  • +
    +

    Method Details

    +
      +
    • +
      +

      fromSupplier

      +
      static <T> Flow.Publisher<T> fromSupplier(Supplier<io.vertx.core.streams.ReadStream<T>> streamSupplier)
      +
      Create a publisher from a Vert.x stream supplier. + The supplier is called for each new publisher subscription.
      +
      +
      Type Parameters:
      +
      T - the elements type
      +
      Parameters:
      +
      streamSupplier - the ReadStream supplier, cannot be null, cannot return null, must not throw + an exception
      +
      Returns:
      +
      the new Flow.Publisher
      +
      +
      +
      • +
    • +
      +

      fromFuture

      +
      static <T> Flow.Publisher<T> fromFuture(Supplier<io.vertx.core.Future<? extends io.vertx.core.streams.ReadStream<T>>> futureStreamSupplier)
      +
      Create a publisher from a Vert.x future stream supplier. + The supplier is called for each new publisher subscription.
      +
      +
      Type Parameters:
      +
      T - the elements type
      +
      Parameters:
      +
      futureStreamSupplier - the Future ReadStream supplier, cannot be null, cannot return + null, must not throw an exception
      +
      Returns:
      +
      the new Flow.Publisher
      +
      +
      +
      • +
    +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/class-use/VertxPublisher.html b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/class-use/VertxPublisher.html new file mode 100644 index 0000000..e165b19 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/class-use/VertxPublisher.html @@ -0,0 +1,63 @@ + + + + +Uses of Interface mutiny.zero.vertxpublishers.VertxPublisher (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Interface
mutiny.zero.vertxpublishers.VertxPublisher

+
+No usage of mutiny.zero.vertxpublishers.VertxPublisher
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/package-summary.html b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/package-summary.html new file mode 100644 index 0000000..83efc55 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/package-summary.html @@ -0,0 +1,121 @@ + + + + +mutiny.zero.vertxpublishers (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+
Module mutiny.zero.vertxpublishers
+

Package mutiny.zero.vertxpublishers

+
+
+
package mutiny.zero.vertxpublishers
+
+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/package-tree.html b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/package-tree.html new file mode 100644 index 0000000..74ccdbf --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/package-tree.html @@ -0,0 +1,73 @@ + + + + +mutiny.zero.vertxpublishers Class Hierarchy (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Hierarchy For Package mutiny.zero.vertxpublishers

+
+Package Hierarchies: + +
+

Interface Hierarchy

+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/package-use.html b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/package-use.html new file mode 100644 index 0000000..9d4f91b --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero.vertxpublishers/mutiny/zero/vertxpublishers/package-use.html @@ -0,0 +1,63 @@ + + + + +Uses of Package mutiny.zero.vertxpublishers (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Package
mutiny.zero.vertxpublishers

+
+No usage of mutiny.zero.vertxpublishers
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/module-summary.html b/1.1.0/apidocs/mutiny.zero/module-summary.html new file mode 100644 index 0000000..7419252 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/module-summary.html @@ -0,0 +1,110 @@ + + + + +mutiny.zero (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Module mutiny.zero

+
+
+
module mutiny.zero
+
+
    +
  • +
    + +

    Packages

    +
    +
    Exports
    +
    +
    Package
    +
    Description
    +
    mutiny.zero
    +
    +
    Mutiny Zero is minimal API for creating reactive streams compliant Flow.Publisher objects.
    +
    +
    mutiny.zero.operators
    +
    +
    This package contains a set of simple operator classes that can be useful when working with + Flow.Publisher streams.
    +
    +
    +
    +
    +
    • +
+
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/AsyncHelpers.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/AsyncHelpers.html new file mode 100644 index 0000000..bfaa430 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/AsyncHelpers.html @@ -0,0 +1,180 @@ + + + + +AsyncHelpers (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero
+

Interface AsyncHelpers

+
+
+
+
public interface AsyncHelpers
+
+
+ +
+
+
    + +
  • +
    +

    Method Details

    +
      +
    • +
      +

      applyExceptionally

      +
      static <T> CompletionStage<T> applyExceptionally(CompletionStage<T> upstream, + Function<Throwable,Throwable> mapper)
      +
      Applies a function on failure to produce another failure.
      +
      +
      Type Parameters:
      +
      T - the type of emitted item
      +
      Parameters:
      +
      upstream - the upstream stage.
      +
      mapper - the mapper
      +
      Returns:
      +
      the mapped completion stage.
      +
      +
      +
      • +
    • +
      +

      composeExceptionally

      +
      static <T> CompletionStage<T> composeExceptionally(CompletionStage<T> upstream, + Function<Throwable,CompletionStage<T>> mapper)
      +
      Composes the given completion stage on failure.
      +
      +
      Type Parameters:
      +
      T - the type of emitted item
      +
      Parameters:
      +
      upstream - the upstream stage
      +
      mapper - the mapper
      +
      Returns:
      +
      the composed completion stage.
      +
      +
      +
      • +
    +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/BackpressureStrategy.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/BackpressureStrategy.html new file mode 100644 index 0000000..b31cfb8 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/BackpressureStrategy.html @@ -0,0 +1,291 @@ + + + + +BackpressureStrategy (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero
+

Enum BackpressureStrategy

+
+
java.lang.Object +
java.lang.Enum<BackpressureStrategy> +
mutiny.zero.BackpressureStrategy
+
+
+
+
+
All Implemented Interfaces:
+
Serializable, Comparable<BackpressureStrategy>
+
+
+
public enum BackpressureStrategy +extends Enum<BackpressureStrategy>
+
Define a Tube back-pressure management strategy. +

+ A Tube back-pressure management is required when an item is sent to a Tube while there are no + outstanding items being requested.

+
+
+ +
+
+
    + +
  • +
    +

    Enum Constant Details

    +
      +
    • +
      +

      BUFFER

      +
      public static final BackpressureStrategy BUFFER
      +
      Buffer overflowing items until more items are being requested. + The buffer is bounded, and an IllegalStateException will be thrown if it becomes full due to a lack of + requests.
      +
      +
      • +
    • +
      +

      UNBOUNDED_BUFFER

      +
      public static final BackpressureStrategy UNBOUNDED_BUFFER
      +
      Buffer overflowing items until more items are being requested. + The buffer is unbounded, so available memory is the limit, meaning that an OutOfMemoryError is possible + if items are being pushed faster than they are being consumed.
      +
      +
      • +
    • +
      +

      DROP

      +
      public static final BackpressureStrategy DROP
      +
      Drop items in case of a lack of outstanding requests.
      +
      +
      • +
    • +
      +

      ERROR

      +
      public static final BackpressureStrategy ERROR
      +
      Signal a terminal IllegalStateException as soon as an item is being sent while there is no outstanding + request.
      +
      +
      • +
    • +
      +

      IGNORE

      +
      public static final BackpressureStrategy IGNORE
      +
      Ignore back-pressure and still send items to the Tube consumer. + This may result in errors in the subscriber(s) depending on what it means for back-pressure to be ignored.
      +
      +
      • +
    • +
      +

      LATEST

      +
      public static final BackpressureStrategy LATEST
      +
      Buffer overflowing items in a bounded buffer, but only keep the last values. + This means that if the overflow buffer becomes full then the oldest item is discarded to make space for a new one.
      +
      +
      • +
    +
    +
    • + +
  • +
    +

    Method Details

    +
      +
    • +
      +

      values

      +
      public static BackpressureStrategy[] values()
      +
      Returns an array containing the constants of this enum type, in +the order they are declared.
      +
      +
      Returns:
      +
      an array containing the constants of this enum type, in the order they are declared
      +
      +
      +
      • +
    • +
      +

      valueOf

      +
      public static BackpressureStrategy valueOf(String name)
      +
      Returns the enum constant of this type with the specified name. +The string must match exactly an identifier used to declare an +enum constant in this type. (Extraneous whitespace characters are +not permitted.)
      +
      +
      Parameters:
      +
      name - the name of the enum constant to be returned.
      +
      Returns:
      +
      the enum constant with the specified name
      +
      Throws:
      +
      IllegalArgumentException - if this enum type has no constant with the specified name
      +
      NullPointerException - if the argument is null
      +
      +
      +
      • +
    +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/PublisherHelpers.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/PublisherHelpers.html new file mode 100644 index 0000000..1d21269 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/PublisherHelpers.html @@ -0,0 +1,154 @@ + + + + +PublisherHelpers (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero
+

Interface PublisherHelpers

+
+
+
+
public interface PublisherHelpers
+
+
+ +
+
+
    + +
  • +
    +

    Method Details

    +
      +
    • +
      +

      collectToList

      +
      static <T> CompletionStage<List<T>> collectToList(Flow.Publisher<T> publisher)
      +
      Collect all items as a list.
      +
      +
      Type Parameters:
      +
      T - the emitted type
      +
      Parameters:
      +
      publisher - the publisher
      +
      Returns:
      +
      the future accumulating the items into a list.
      +
      +
      +
      • +
    +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/Tube.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/Tube.html new file mode 100644 index 0000000..899b998 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/Tube.html @@ -0,0 +1,282 @@ + + + + +Tube (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero
+

Interface Tube<T>

+
+
+
+
Type Parameters:
+
T - the items type
+
+
+
public interface Tube<T>
+
A Tube is a general-purpose abstraction for creating Flow.Publisher. +

+ Items, errors and completion signals can be sent using this interface. + It is possible to be notified of requests, cancellations and termination. +

+ A Tube can be shared between multiple threads, and sending items from concurrent threads is done serially as + per reactive stream semantics. +

+ If in doubt about which abstraction to use for creating a Flow.Publisher with + ZeroPublisher then choose a Tube.

+
+
+
    + +
  • +
    +

    Method Summary

    +
    +
    +
    +
    +
    Modifier and Type
    +
    Method
    +
    Description
    +
    boolean
    +
    cancelled()
    +
    +
    Check if the subscription has been cancelled.
    +
    +
    void
    +
    complete()
    +
    +
    Signal completion and that no more items will be sent.
    +
    +
    void
    +
    fail(Throwable err)
    +
    +
    Terminally signal an error.
    +
    +
    long
    +
    outstandingRequests()
    +
    +
    Check the number of outstanding requests.
    +
    +
    Tube<T>
    +
    send(T item)
    +
    +
    Send an item.
    +
    +
    Tube<T>
    +
    whenCancelled(Runnable action)
    +
    +
    Define an action when the subscription is cancelled.
    +
    +
    Tube<T>
    +
    whenRequested(LongConsumer consumer)
    +
    +
    Define an action when items are being requested.
    +
    +
    Tube<T>
    +
    whenTerminates(Runnable action)
    +
    +
    Define an action on termination (completion, error or cancellation), typically for cleanup purposes.
    +
    +
    +
    +
    +
    +
    • +
+
+
+
    + +
  • +
    +

    Method Details

    +
      +
    • +
      +

      send

      +
      Tube<T> send(T item)
      +
      Send an item.
      +
      +
      Parameters:
      +
      item - the item
      +
      Returns:
      +
      this Tube instance
      +
      +
      +
      • +
    • +
      +

      fail

      +
      void fail(Throwable err)
      +
      Terminally signal an error.
      +
      +
      Parameters:
      +
      err - the error
      +
      +
      +
      • +
    • +
      +

      complete

      +
      void complete()
      +
      Signal completion and that no more items will be sent.
      +
      +
      • +
    • +
      +

      cancelled

      +
      boolean cancelled()
      +
      Check if the subscription has been cancelled.
      +
      +
      Returns:
      +
      true if the subscriber has cancelled its subscription, false otherwise
      +
      +
      +
      • +
    • +
      +

      outstandingRequests

      +
      long outstandingRequests()
      +
      Check the number of outstanding requests.
      +
      +
      Returns:
      +
      the number of outstanding requests.
      +
      +
      +
      • +
    • +
      +

      whenCancelled

      +
      Tube<T> whenCancelled(Runnable action)
      +
      Define an action when the subscription is cancelled.
      +
      +
      Parameters:
      +
      action - the action
      +
      Returns:
      +
      this Tube
      +
      +
      +
      • +
    • +
      +

      whenTerminates

      +
      Tube<T> whenTerminates(Runnable action)
      +
      Define an action on termination (completion, error or cancellation), typically for cleanup purposes.
      +
      +
      Parameters:
      +
      action - the action
      +
      Returns:
      +
      this Tube
      +
      +
      +
      • +
    • +
      +

      whenRequested

      +
      Tube<T> whenRequested(LongConsumer consumer)
      +
      Define an action when items are being requested.
      +
      +
      Parameters:
      +
      consumer - the action, consuming the number of items for this request
      +
      Returns:
      +
      this Tube
      +
      +
      +
      • +
    +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/TubeConfiguration.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/TubeConfiguration.html new file mode 100644 index 0000000..03048dc --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/TubeConfiguration.html @@ -0,0 +1,243 @@ + + + + +TubeConfiguration (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero
+

Class TubeConfiguration

+
+
java.lang.Object +
mutiny.zero.TubeConfiguration
+
+
+
+
public final class TubeConfiguration +extends Object
+
Configuration object for creating Tube through ZeroPublisher.create(TubeConfiguration, Consumer).
+
+
+ +
+
+
    + +
  • +
    +

    Constructor Details

    +
      +
    • +
      +

      TubeConfiguration

      +
      public TubeConfiguration()
      +
      +
      • +
    +
    +
    • + +
  • +
    +

    Method Details

    +
      +
    • +
      +

      withBackpressureStrategy

      +
      public TubeConfiguration withBackpressureStrategy(BackpressureStrategy strategy)
      +
      Specify the back-pressure strategy, cannot be null. + The default is BackpressureStrategy.DROP.
      +
      +
      Parameters:
      +
      strategy - the back-pressure strategy
      +
      Returns:
      +
      this configuration
      +
      +
      +
      • +
    • +
      +

      withBufferSize

      +
      public TubeConfiguration withBufferSize(int bufferSize)
      +
      Specify the buffer size must be strictly positive when backpressureStrategy is one of + BackpressureStrategy.BUFFER and BackpressureStrategy.LATEST. + The default is -1.
      +
      +
      Parameters:
      +
      bufferSize - the buffer size
      +
      Returns:
      +
      this configuration
      +
      +
      +
      • +
    • +
      +

      getBackpressureStrategy

      +
      public BackpressureStrategy getBackpressureStrategy()
      +
      Get the back-pressure strategy.
      +
      +
      Returns:
      +
      the back-pressure strategy
      +
      +
      +
      • +
    • +
      +

      getBufferSize

      +
      public int getBufferSize()
      +
      Get the buffer size.
      +
      +
      Returns:
      +
      the buffer size
      +
      +
      +
      • +
    +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/ZeroPublisher.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/ZeroPublisher.html new file mode 100644 index 0000000..9feb0a3 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/ZeroPublisher.html @@ -0,0 +1,341 @@ + + + + +ZeroPublisher (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero
+

Interface ZeroPublisher

+
+
+
+
public interface ZeroPublisher
+
Factory methods to simplify the creation of reactive streams compliant Flow.Publisher. +

+ There are convenience methods for creating Flow.Publisher from in-memory data. +

+ The general-purpose abstraction is to use a Tube and the create(TubeConfiguration, Consumer) + factory method.

+
+
+ +
+
+
    + +
  • +
    +

    Method Details

    +
      +
    • +
      +

      fromItems

      +
      @SafeVarargs +static <T> Flow.Publisher<T> fromItems(T... items)
      +
      Create a Flow.Publisher from existing items.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Parameters:
      +
      items - the existing items, cannot be a null array
      +
      Returns:
      +
      a new Flow.Publisher
      +
      +
      +
      • +
    • +
      +

      fromIterable

      +
      static <T> Flow.Publisher<T> fromIterable(Iterable<T> iterable)
      +
      Create a Flow.Publisher from an iterable object. +

      + Note that this assumes an in-memory, non-blocking Iterator. + Do not try to force an iterator as a way to bridge an API with Flow.Publisher as it does not behave like an + in-memory data structure.

      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Parameters:
      +
      iterable - the iterable object, cannot be null
      +
      Returns:
      +
      a nes Flow.Publisher
      +
      +
      +
      • +
    • +
      +

      fromStream

      +
      static <T> Flow.Publisher<T> fromStream(Supplier<Stream<T>> supplier)
      +
      Create a Flow.Publisher from a Stream. +

      + Note that this assumes an in-memory, non-blocking data structure, just like fromIterable(Iterable). + Also note that a Stream can only be traversed once, hence the use of a supplier because + multiple subscriptions would fail.

      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Parameters:
      +
      supplier - the stream supplier, cannot be null
      +
      Returns:
      +
      a new Flow.Publisher
      +
      +
      +
      • +
    • +
      +

      fromGenerator

      +
      static <S, +T> Flow.Publisher<T> fromGenerator(Supplier<S> stateSupplier, + Function<S,Iterator<T>> generator)
      +
      Create a Flow.Publisher from a generator over some state. +

      + Note that this assumes an in-memory, non-blocking data structure, just like fromIterable(Iterable).

      +
      +
      Type Parameters:
      +
      S - the initial state type
      +
      T - the items type
      +
      Parameters:
      +
      stateSupplier - the initial state supplier, cannot be null but can supply null
      +
      generator - a generator function over the initial state and an iterator, cannot be null, cannot yield + null
      +
      Returns:
      +
      a new Flow.Publisher
      +
      +
      +
      • +
    • +
      +

      fromCompletionStage

      +
      static <T> Flow.Publisher<T> fromCompletionStage(Supplier<CompletionStage<T>> completionStageSupplier)
      +
      Create a Flow.Publisher from a CompletionStage.
      +
      +
      Type Parameters:
      +
      T - the item type
      +
      Parameters:
      +
      completionStageSupplier - the completion stage supplier, cannot be null, cannot yield null
      +
      Returns:
      +
      a new Flow.Publisher
      +
      +
      +
      • +
    • +
      +

      toCompletionStage

      +
      static <T> CompletionStage<Optional<T>> toCompletionStage(Flow.Publisher<T> publisher)
      +
      Create a CompletionStage from a Flow.Publisher. +

      + The Flow.Publisher is requested exactly 1 element and the subscription is cancelled after it has been received.

      +
      +
      Type Parameters:
      +
      T - the item type
      +
      Parameters:
      +
      publisher - the publisher, cannot be null
      +
      Returns:
      +
      a new CompletionStage
      +
      +
      +
      • +
    • +
      +

      fromFailure

      +
      static <T> Flow.Publisher<T> fromFailure(Throwable failure)
      +
      Create a Flow.Publisher from a known failure.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Parameters:
      +
      failure - the failure, cannot be null
      +
      Returns:
      +
      a new Flow.Publisher
      +
      +
      +
      • +
    • +
      +

      empty

      +
      static <T> Flow.Publisher<T> empty()
      +
      Create an empty Flow.Publisher that completes upon subscription without ever sending any item.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Returns:
      +
      a new Flow.Publisher
      +
      +
      +
      • +
    • +
      +

      create

      +
      static <T> Flow.Publisher<T> create(TubeConfiguration configuration, + Consumer<Tube<T>> tubeConsumer)
      +
      Create a new Flow.Publisher with the general-purpose Tube API.
      +
      +
      Type Parameters:
      +
      T - the items type
      +
      Parameters:
      +
      configuration - the tube configuration
      +
      tubeConsumer - the tube consumer, cannot be null
      +
      Returns:
      +
      a new Flow.Publisher
      +
      +
      +
      • +
    +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/AsyncHelpers.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/AsyncHelpers.html new file mode 100644 index 0000000..2052e5e --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/AsyncHelpers.html @@ -0,0 +1,63 @@ + + + + +Uses of Interface mutiny.zero.AsyncHelpers (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Interface
mutiny.zero.AsyncHelpers

+
+No usage of mutiny.zero.AsyncHelpers
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/BackpressureStrategy.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/BackpressureStrategy.html new file mode 100644 index 0000000..3a7abc2 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/BackpressureStrategy.html @@ -0,0 +1,114 @@ + + + + +Uses of Enum mutiny.zero.BackpressureStrategy (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Enum
mutiny.zero.BackpressureStrategy

+
+
Packages that use BackpressureStrategy
+
+
Package
+
Description
+
mutiny.zero
+
+
Mutiny Zero is minimal API for creating reactive streams compliant Flow.Publisher objects.
+
+
+
+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/PublisherHelpers.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/PublisherHelpers.html new file mode 100644 index 0000000..4ef5307 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/PublisherHelpers.html @@ -0,0 +1,63 @@ + + + + +Uses of Interface mutiny.zero.PublisherHelpers (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Interface
mutiny.zero.PublisherHelpers

+
+No usage of mutiny.zero.PublisherHelpers
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/Tube.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/Tube.html new file mode 100644 index 0000000..e0692a9 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/Tube.html @@ -0,0 +1,119 @@ + + + + +Uses of Interface mutiny.zero.Tube (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Interface
mutiny.zero.Tube

+
+
Packages that use Tube
+
+
Package
+
Description
+
mutiny.zero
+
+
Mutiny Zero is minimal API for creating reactive streams compliant Flow.Publisher objects.
+
+
+
+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/TubeConfiguration.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/TubeConfiguration.html new file mode 100644 index 0000000..13c3074 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/TubeConfiguration.html @@ -0,0 +1,110 @@ + + + + +Uses of Class mutiny.zero.TubeConfiguration (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Class
mutiny.zero.TubeConfiguration

+
+
Packages that use TubeConfiguration
+
+
Package
+
Description
+
mutiny.zero
+
+
Mutiny Zero is minimal API for creating reactive streams compliant Flow.Publisher objects.
+
+
+
+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/ZeroPublisher.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/ZeroPublisher.html new file mode 100644 index 0000000..9795cae --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/class-use/ZeroPublisher.html @@ -0,0 +1,63 @@ + + + + +Uses of Interface mutiny.zero.ZeroPublisher (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Interface
mutiny.zero.ZeroPublisher

+
+No usage of mutiny.zero.ZeroPublisher
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Concatenate.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Concatenate.html new file mode 100644 index 0000000..adc3088 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Concatenate.html @@ -0,0 +1,205 @@ + + + + +Concatenate (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero.operators
+

Class Concatenate<T>

+
+
java.lang.Object +
mutiny.zero.operators.Concatenate<T>
+
+
+
+
Type Parameters:
+
T - the elements type
+
+
+
All Implemented Interfaces:
+
Flow.Publisher<T>
+
+
+
public class Concatenate<T> +extends Object +implements Flow.Publisher<T>
+
A Flow.Publisher that is the concatenation of several ones. +

+ The first publisher in the list is the first to be subscribed. + Once it completes the next one is subscribed and so on, up to the completion of the last one. +

+ If any publisher sends an error signal then the concatenation stream ends with that error.

+
+
+ +
+
+
    + +
  • +
    +

    Constructor Details

    +
      +
    • +
      +

      Concatenate

      +
      public Concatenate(List<Flow.Publisher<T>> publishers)
      +
      Create a new concatenation publisher.
      +
      +
      Parameters:
      +
      publishers - the list of publishers, must not be null, must not contain null
      +
      +
      +
      • +
    +
    +
    • + +
  • +
    +

    Method Details

    + +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Recover.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Recover.html new file mode 100644 index 0000000..8563b36 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Recover.html @@ -0,0 +1,212 @@ + + + + +Recover (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero.operators
+

Class Recover<T>

+
+
java.lang.Object +
mutiny.zero.operators.Recover<T>
+
+
+
+
Type Parameters:
+
T - the elements type
+
+
+
All Implemented Interfaces:
+
Flow.Publisher<T>
+
+
+
public class Recover<T> +extends Object +implements Flow.Publisher<T>
+
A Flow.Publisher that recovers from failure using a Function. +

+ The provided function accepts an error that would normally trigger an + Flow.Subscriber.onError(Throwable) signal. +

+ The function returns a recovery value of type T, then the stream terminates with an + Flow.Subscriber.onComplete() signal. + If the function returns null then the stream terminates directly with a completion event. +

+ The stream ends with an error if the function throws an exception.

+
+
+ +
+
+
    + +
  • +
    +

    Constructor Details

    +
      +
    • +
      +

      Recover

      +
      public Recover(Flow.Publisher<T> upstream, + Function<Throwable,T> function)
      +
      Build a new recovery publisher.
      +
      +
      Parameters:
      +
      upstream - the upstream publisher
      +
      function - the recovery function, must not return null values
      +
      +
      +
      • +
    +
    +
    • + +
  • +
    +

    Method Details

    + +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Retry.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Retry.html new file mode 100644 index 0000000..97d3d66 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Retry.html @@ -0,0 +1,225 @@ + + + + +Retry (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero.operators
+

Class Retry<T>

+
+
java.lang.Object +
mutiny.zero.operators.Retry<T>
+
+
+
+
Type Parameters:
+
T - the elements type
+
+
+
All Implemented Interfaces:
+
Flow.Publisher<T>
+
+
+
public class Retry<T> +extends Object +implements Flow.Publisher<T>
+
A Flow.Publisher that retries on failure by re-subscribing to its upstream. + A Predicate controls when to retry, and when to stop retrying. +

+

+ Note: this retry operator does not perform advanced time-based re-subscriptions (e.g., exponential back-off).

+
+
+ +
+
+
    + +
  • +
    +

    Constructor Details

    +
      +
    • +
      +

      Retry

      +
      public Retry(Flow.Publisher<T> upstream, + Predicate<Throwable> retryPredicate)
      +
      Build a new retry publisher.
      +
      +
      Parameters:
      +
      upstream - the upstream publisher
      +
      retryPredicate - the retry predicate
      +
      +
      +
      • +
    +
    +
    • + +
  • +
    +

    Method Details

    + +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Select.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Select.html new file mode 100644 index 0000000..6fd24f8 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Select.html @@ -0,0 +1,203 @@ + + + + +Select (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero.operators
+

Class Select<T>

+
+
java.lang.Object +
mutiny.zero.operators.Select<T>
+
+
+
+
Type Parameters:
+
T - the elements type
+
+
+
All Implemented Interfaces:
+
Flow.Publisher<T>
+
+
+
public class Select<T> +extends Object +implements Flow.Publisher<T>
+
A Flow.Publisher that selects elements matching a Predicate.
+
+
+ +
+
+
    + +
  • +
    +

    Constructor Details

    +
      +
    • +
      +

      Select

      +
      public Select(Flow.Publisher<T> upstream, + Predicate<T> predicate)
      +
      Build a new selection publisher.
      +
      +
      Parameters:
      +
      upstream - the upstream publisher
      +
      predicate - the predicate to select the elements forwarded to subscribers, must not throw exceptions
      +
      +
      +
      • +
    +
    +
    • + +
  • +
    +

    Method Details

    + +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Transform.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Transform.html new file mode 100644 index 0000000..59adadc --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/Transform.html @@ -0,0 +1,204 @@ + + + + +Transform (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+ +
+
Module mutiny.zero
+
Package mutiny.zero.operators
+

Class Transform<I,O>

+
+
java.lang.Object +
mutiny.zero.operators.Transform<I,O>
+
+
+
+
Type Parameters:
+
I - the input elements type
+
O - the output elements type
+
+
+
All Implemented Interfaces:
+
Flow.Publisher<O>
+
+
+
public class Transform<I,O> +extends Object +implements Flow.Publisher<O>
+
A Flow.Publisher that transforms elements using a Function.
+
+
+ +
+
+
    + +
  • +
    +

    Constructor Details

    +
      +
    • +
      +

      Transform

      +
      public Transform(Flow.Publisher<I> upstream, + Function<I,O> function)
      +
      Build a new transformation publisher.
      +
      +
      Parameters:
      +
      upstream - the upstream publisher
      +
      function - the transformation function, must not throw exceptions, must not return null values
      +
      +
      +
      • +
    +
    +
    • + +
  • +
    +

    Method Details

    + +
    +
    • +
+
+ +
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Concatenate.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Concatenate.html new file mode 100644 index 0000000..4ec6403 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Concatenate.html @@ -0,0 +1,63 @@ + + + + +Uses of Class mutiny.zero.operators.Concatenate (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Class
mutiny.zero.operators.Concatenate

+
+No usage of mutiny.zero.operators.Concatenate
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Recover.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Recover.html new file mode 100644 index 0000000..92c4f0d --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Recover.html @@ -0,0 +1,63 @@ + + + + +Uses of Class mutiny.zero.operators.Recover (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Class
mutiny.zero.operators.Recover

+
+No usage of mutiny.zero.operators.Recover
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Retry.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Retry.html new file mode 100644 index 0000000..7b271cf --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Retry.html @@ -0,0 +1,63 @@ + + + + +Uses of Class mutiny.zero.operators.Retry (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Class
mutiny.zero.operators.Retry

+
+No usage of mutiny.zero.operators.Retry
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Select.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Select.html new file mode 100644 index 0000000..25079de --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Select.html @@ -0,0 +1,63 @@ + + + + +Uses of Class mutiny.zero.operators.Select (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Class
mutiny.zero.operators.Select

+
+No usage of mutiny.zero.operators.Select
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Transform.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Transform.html new file mode 100644 index 0000000..01617b9 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/class-use/Transform.html @@ -0,0 +1,63 @@ + + + + +Uses of Class mutiny.zero.operators.Transform (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Class
mutiny.zero.operators.Transform

+
+No usage of mutiny.zero.operators.Transform
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/package-summary.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/package-summary.html new file mode 100644 index 0000000..1f7b8b4 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/package-summary.html @@ -0,0 +1,141 @@ + + + + +mutiny.zero.operators (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+
Module mutiny.zero
+

Package mutiny.zero.operators

+
+
+
package mutiny.zero.operators
+
+
This package contains a set of simple operator classes that can be useful when working with + Flow.Publisher streams. +

+ Each operator class is a Flow.Publisher that accepts an upstream + Flow.Publisher and parameters.

+
+
+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/package-tree.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/package-tree.html new file mode 100644 index 0000000..5032bf9 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/package-tree.html @@ -0,0 +1,81 @@ + + + + +mutiny.zero.operators Class Hierarchy (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Hierarchy For Package mutiny.zero.operators

+
+Package Hierarchies: + +
+

Class Hierarchy

+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/package-use.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/package-use.html new file mode 100644 index 0000000..ed47c52 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/operators/package-use.html @@ -0,0 +1,63 @@ + + + + +Uses of Package mutiny.zero.operators (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Package
mutiny.zero.operators

+
+No usage of mutiny.zero.operators
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/package-summary.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/package-summary.html new file mode 100644 index 0000000..e249922 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/package-summary.html @@ -0,0 +1,148 @@ + + + + +mutiny.zero (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+
Module mutiny.zero
+

Package mutiny.zero

+
+
+
package mutiny.zero
+
+
Mutiny Zero is minimal API for creating reactive streams compliant Flow.Publisher objects. +

+ ZeroPublisher offers factory methods for creating Flow.Publisher, + with the Tube API and the + create(mutiny.zero.TubeConfiguration, java.util.function.Consumer) + factory method being the safe, general-purpose choice. +

+ Other factory methods provide simple abstractions over in-memory data structures and special cases. + There is also a bridge with the CompletionStage APIs.

+
+
+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/package-tree.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/package-tree.html new file mode 100644 index 0000000..0b3d05c --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/package-tree.html @@ -0,0 +1,100 @@ + + + + +mutiny.zero Class Hierarchy (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Hierarchy For Package mutiny.zero

+
+Package Hierarchies: + +
+

Class Hierarchy

+ +
+
+

Interface Hierarchy

+ +
+
+

Enum Hierarchy

+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/mutiny.zero/mutiny/zero/package-use.html b/1.1.0/apidocs/mutiny.zero/mutiny/zero/package-use.html new file mode 100644 index 0000000..f4e5603 --- /dev/null +++ b/1.1.0/apidocs/mutiny.zero/mutiny/zero/package-use.html @@ -0,0 +1,97 @@ + + + + +Uses of Package mutiny.zero (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Uses of Package
mutiny.zero

+
+
Packages that use mutiny.zero
+
+
Package
+
Description
+
mutiny.zero
+
+
Mutiny Zero is minimal API for creating reactive streams compliant Flow.Publisher objects.
+
+
+
+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/overview-summary.html b/1.1.0/apidocs/overview-summary.html new file mode 100644 index 0000000..46e4574 --- /dev/null +++ b/1.1.0/apidocs/overview-summary.html @@ -0,0 +1,26 @@ + + + + +SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API + + + + + + + + + + + +
+ +

index.html

+
+ + diff --git a/1.1.0/apidocs/overview-tree.html b/1.1.0/apidocs/overview-tree.html new file mode 100644 index 0000000..be3d2e6 --- /dev/null +++ b/1.1.0/apidocs/overview-tree.html @@ -0,0 +1,111 @@ + + + + +Class Hierarchy (SmallRye Mutiny Zero Parent 1.1.1-SNAPSHOT API) + + + + + + + + + + + + + + +
+ +
+
+
+

Hierarchy For All Packages

+
+Package Hierarchies: + +
+

Class Hierarchy

+ +
+
+

Interface Hierarchy

+ +
+
+

Enum Hierarchy

+ +
+
+
+
+

Copyright © 2021–2024 SmallRye. All rights reserved.

+
+
+
+ + diff --git a/1.1.0/apidocs/package-search-index.js b/1.1.0/apidocs/package-search-index.js new file mode 100644 index 0000000..ffa74e6 --- /dev/null +++ b/1.1.0/apidocs/package-search-index.js @@ -0,0 +1 @@ +packageSearchIndex = [{"l":"All Packages","u":"allpackages-index.html"},{"m":"mutiny.zero","l":"mutiny.zero"},{"m":"mutiny.zero.flow.adapters","l":"mutiny.zero.flow.adapters"},{"m":"mutiny.zero","l":"mutiny.zero.operators"},{"m":"mutiny.zero.vertxpublishers","l":"mutiny.zero.vertxpublishers"}];updateSearchResults(); \ No newline at end of file diff --git a/1.1.0/apidocs/resources/glass.png b/1.1.0/apidocs/resources/glass.png new file mode 100644 index 0000000..a7f591f Binary files /dev/null and b/1.1.0/apidocs/resources/glass.png differ diff --git a/1.1.0/apidocs/resources/x.png b/1.1.0/apidocs/resources/x.png new file mode 100644 index 0000000..30548a7 Binary files /dev/null and b/1.1.0/apidocs/resources/x.png differ diff --git a/1.1.0/apidocs/script-dir/jquery-3.6.1.min.js b/1.1.0/apidocs/script-dir/jquery-3.6.1.min.js new file mode 100644 index 0000000..2c69bc9 --- /dev/null +++ b/1.1.0/apidocs/script-dir/jquery-3.6.1.min.js @@ -0,0 +1,2 @@ +/*! jQuery v3.6.1 | (c) OpenJS Foundation and other contributors | jquery.org/license */ +!function(e,t){"use strict";"object"==typeof module&&"object"==typeof module.exports?module.exports=e.document?t(e,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return t(e)}:t(e)}("undefined"!=typeof window?window:this,function(C,e){"use strict";var t=[],r=Object.getPrototypeOf,s=t.slice,g=t.flat?function(e){return t.flat.call(e)}:function(e){return t.concat.apply([],e)},u=t.push,i=t.indexOf,n={},o=n.toString,y=n.hasOwnProperty,a=y.toString,l=a.call(Object),v={},m=function(e){return"function"==typeof e&&"number"!=typeof e.nodeType&&"function"!=typeof e.item},x=function(e){return null!=e&&e===e.window},E=C.document,c={type:!0,src:!0,nonce:!0,noModule:!0};function b(e,t,n){var r,i,o=(n=n||E).createElement("script");if(o.text=e,t)for(r in c)(i=t[r]||t.getAttribute&&t.getAttribute(r))&&o.setAttribute(r,i);n.head.appendChild(o).parentNode.removeChild(o)}function w(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[o.call(e)]||"object":typeof e}var f="3.6.1",S=function(e,t){return new S.fn.init(e,t)};function p(e){var t=!!e&&"length"in e&&e.length,n=w(e);return!m(e)&&!x(e)&&("array"===n||0===t||"number"==typeof t&&0+~]|"+M+")"+M+"*"),U=new RegExp(M+"|>"),X=new RegExp(F),V=new RegExp("^"+I+"$"),G={ID:new RegExp("^#("+I+")"),CLASS:new RegExp("^\\.("+I+")"),TAG:new RegExp("^("+I+"|[*])"),ATTR:new RegExp("^"+W),PSEUDO:new RegExp("^"+F),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+M+"*(even|odd|(([+-]|)(\\d*)n|)"+M+"*(?:([+-]|)"+M+"*(\\d+)|))"+M+"*\\)|)","i"),bool:new RegExp("^(?:"+R+")$","i"),needsContext:new RegExp("^"+M+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+M+"*((?:-\\d)?\\d*)"+M+"*\\)|)(?=[^-]|$)","i")},Y=/HTML$/i,Q=/^(?:input|select|textarea|button)$/i,J=/^h\d$/i,K=/^[^{]+\{\s*\[native \w/,Z=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,ee=/[+~]/,te=new RegExp("\\\\[\\da-fA-F]{1,6}"+M+"?|\\\\([^\\r\\n\\f])","g"),ne=function(e,t){var n="0x"+e.slice(1)-65536;return t||(n<0?String.fromCharCode(n+65536):String.fromCharCode(n>>10|55296,1023&n|56320))},re=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ie=function(e,t){return t?"\0"===e?"\ufffd":e.slice(0,-1)+"\\"+e.charCodeAt(e.length-1).toString(16)+" ":"\\"+e},oe=function(){T()},ae=be(function(e){return!0===e.disabled&&"fieldset"===e.nodeName.toLowerCase()},{dir:"parentNode",next:"legend"});try{H.apply(t=O.call(p.childNodes),p.childNodes),t[p.childNodes.length].nodeType}catch(e){H={apply:t.length?function(e,t){L.apply(e,O.call(t))}:function(e,t){var n=e.length,r=0;while(e[n++]=t[r++]);e.length=n-1}}}function se(t,e,n,r){var i,o,a,s,u,l,c,f=e&&e.ownerDocument,p=e?e.nodeType:9;if(n=n||[],"string"!=typeof t||!t||1!==p&&9!==p&&11!==p)return n;if(!r&&(T(e),e=e||C,E)){if(11!==p&&(u=Z.exec(t)))if(i=u[1]){if(9===p){if(!(a=e.getElementById(i)))return n;if(a.id===i)return n.push(a),n}else if(f&&(a=f.getElementById(i))&&v(e,a)&&a.id===i)return n.push(a),n}else{if(u[2])return H.apply(n,e.getElementsByTagName(t)),n;if((i=u[3])&&d.getElementsByClassName&&e.getElementsByClassName)return H.apply(n,e.getElementsByClassName(i)),n}if(d.qsa&&!N[t+" "]&&(!y||!y.test(t))&&(1!==p||"object"!==e.nodeName.toLowerCase())){if(c=t,f=e,1===p&&(U.test(t)||z.test(t))){(f=ee.test(t)&&ve(e.parentNode)||e)===e&&d.scope||((s=e.getAttribute("id"))?s=s.replace(re,ie):e.setAttribute("id",s=S)),o=(l=h(t)).length;while(o--)l[o]=(s?"#"+s:":scope")+" "+xe(l[o]);c=l.join(",")}try{return H.apply(n,f.querySelectorAll(c)),n}catch(e){N(t,!0)}finally{s===S&&e.removeAttribute("id")}}}return g(t.replace(B,"$1"),e,n,r)}function ue(){var r=[];return function e(t,n){return r.push(t+" ")>b.cacheLength&&delete e[r.shift()],e[t+" "]=n}}function le(e){return e[S]=!0,e}function ce(e){var t=C.createElement("fieldset");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function fe(e,t){var n=e.split("|"),r=n.length;while(r--)b.attrHandle[n[r]]=t}function pe(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&e.sourceIndex-t.sourceIndex;if(r)return r;if(n)while(n=n.nextSibling)if(n===t)return-1;return e?1:-1}function de(t){return function(e){return"input"===e.nodeName.toLowerCase()&&e.type===t}}function he(n){return function(e){var t=e.nodeName.toLowerCase();return("input"===t||"button"===t)&&e.type===n}}function ge(t){return function(e){return"form"in e?e.parentNode&&!1===e.disabled?"label"in e?"label"in e.parentNode?e.parentNode.disabled===t:e.disabled===t:e.isDisabled===t||e.isDisabled!==!t&&ae(e)===t:e.disabled===t:"label"in e&&e.disabled===t}}function ye(a){return le(function(o){return o=+o,le(function(e,t){var n,r=a([],e.length,o),i=r.length;while(i--)e[n=r[i]]&&(e[n]=!(t[n]=e[n]))})})}function ve(e){return e&&"undefined"!=typeof e.getElementsByTagName&&e}for(e in d=se.support={},i=se.isXML=function(e){var t=e&&e.namespaceURI,n=e&&(e.ownerDocument||e).documentElement;return!Y.test(t||n&&n.nodeName||"HTML")},T=se.setDocument=function(e){var t,n,r=e?e.ownerDocument||e:p;return r!=C&&9===r.nodeType&&r.documentElement&&(a=(C=r).documentElement,E=!i(C),p!=C&&(n=C.defaultView)&&n.top!==n&&(n.addEventListener?n.addEventListener("unload",oe,!1):n.attachEvent&&n.attachEvent("onunload",oe)),d.scope=ce(function(e){return a.appendChild(e).appendChild(C.createElement("div")),"undefined"!=typeof e.querySelectorAll&&!e.querySelectorAll(":scope fieldset div").length}),d.attributes=ce(function(e){return e.className="i",!e.getAttribute("className")}),d.getElementsByTagName=ce(function(e){return e.appendChild(C.createComment("")),!e.getElementsByTagName("*").length}),d.getElementsByClassName=K.test(C.getElementsByClassName),d.getById=ce(function(e){return a.appendChild(e).id=S,!C.getElementsByName||!C.getElementsByName(S).length}),d.getById?(b.filter.ID=function(e){var t=e.replace(te,ne);return function(e){return e.getAttribute("id")===t}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n=t.getElementById(e);return n?[n]:[]}}):(b.filter.ID=function(e){var n=e.replace(te,ne);return function(e){var t="undefined"!=typeof e.getAttributeNode&&e.getAttributeNode("id");return t&&t.value===n}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n,r,i,o=t.getElementById(e);if(o){if((n=o.getAttributeNode("id"))&&n.value===e)return[o];i=t.getElementsByName(e),r=0;while(o=i[r++])if((n=o.getAttributeNode("id"))&&n.value===e)return[o]}return[]}}),b.find.TAG=d.getElementsByTagName?function(e,t){return"undefined"!=typeof t.getElementsByTagName?t.getElementsByTagName(e):d.qsa?t.querySelectorAll(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){while(n=o[i++])1===n.nodeType&&r.push(n);return r}return o},b.find.CLASS=d.getElementsByClassName&&function(e,t){if("undefined"!=typeof t.getElementsByClassName&&E)return t.getElementsByClassName(e)},s=[],y=[],(d.qsa=K.test(C.querySelectorAll))&&(ce(function(e){var t;a.appendChild(e).innerHTML="",e.querySelectorAll("[msallowcapture^='']").length&&y.push("[*^$]="+M+"*(?:''|\"\")"),e.querySelectorAll("[selected]").length||y.push("\\["+M+"*(?:value|"+R+")"),e.querySelectorAll("[id~="+S+"-]").length||y.push("~="),(t=C.createElement("input")).setAttribute("name",""),e.appendChild(t),e.querySelectorAll("[name='']").length||y.push("\\["+M+"*name"+M+"*="+M+"*(?:''|\"\")"),e.querySelectorAll(":checked").length||y.push(":checked"),e.querySelectorAll("a#"+S+"+*").length||y.push(".#.+[+~]"),e.querySelectorAll("\\\f"),y.push("[\\r\\n\\f]")}),ce(function(e){e.innerHTML="";var t=C.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),e.querySelectorAll("[name=d]").length&&y.push("name"+M+"*[*^$|!~]?="),2!==e.querySelectorAll(":enabled").length&&y.push(":enabled",":disabled"),a.appendChild(e).disabled=!0,2!==e.querySelectorAll(":disabled").length&&y.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),y.push(",.*:")})),(d.matchesSelector=K.test(c=a.matches||a.webkitMatchesSelector||a.mozMatchesSelector||a.oMatchesSelector||a.msMatchesSelector))&&ce(function(e){d.disconnectedMatch=c.call(e,"*"),c.call(e,"[s!='']:x"),s.push("!=",F)}),y=y.length&&new RegExp(y.join("|")),s=s.length&&new RegExp(s.join("|")),t=K.test(a.compareDocumentPosition),v=t||K.test(a.contains)?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)while(t=t.parentNode)if(t===e)return!0;return!1},j=t?function(e,t){if(e===t)return l=!0,0;var n=!e.compareDocumentPosition-!t.compareDocumentPosition;return n||(1&(n=(e.ownerDocument||e)==(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!d.sortDetached&&t.compareDocumentPosition(e)===n?e==C||e.ownerDocument==p&&v(p,e)?-1:t==C||t.ownerDocument==p&&v(p,t)?1:u?P(u,e)-P(u,t):0:4&n?-1:1)}:function(e,t){if(e===t)return l=!0,0;var n,r=0,i=e.parentNode,o=t.parentNode,a=[e],s=[t];if(!i||!o)return e==C?-1:t==C?1:i?-1:o?1:u?P(u,e)-P(u,t):0;if(i===o)return pe(e,t);n=e;while(n=n.parentNode)a.unshift(n);n=t;while(n=n.parentNode)s.unshift(n);while(a[r]===s[r])r++;return r?pe(a[r],s[r]):a[r]==p?-1:s[r]==p?1:0}),C},se.matches=function(e,t){return se(e,null,null,t)},se.matchesSelector=function(e,t){if(T(e),d.matchesSelector&&E&&!N[t+" "]&&(!s||!s.test(t))&&(!y||!y.test(t)))try{var n=c.call(e,t);if(n||d.disconnectedMatch||e.document&&11!==e.document.nodeType)return n}catch(e){N(t,!0)}return 0":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(te,ne),e[3]=(e[3]||e[4]||e[5]||"").replace(te,ne),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||se.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&se.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return G.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&X.test(n)&&(t=h(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(te,ne).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=m[e+" "];return t||(t=new RegExp("(^|"+M+")"+e+"("+M+"|$)"))&&m(e,function(e){return t.test("string"==typeof e.className&&e.className||"undefined"!=typeof e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(n,r,i){return function(e){var t=se.attr(e,n);return null==t?"!="===r:!r||(t+="","="===r?t===i:"!="===r?t!==i:"^="===r?i&&0===t.indexOf(i):"*="===r?i&&-1:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;function j(e,n,r){return m(n)?S.grep(e,function(e,t){return!!n.call(e,t,e)!==r}):n.nodeType?S.grep(e,function(e){return e===n!==r}):"string"!=typeof n?S.grep(e,function(e){return-1)[^>]*|#([\w-]+))$/;(S.fn.init=function(e,t,n){var r,i;if(!e)return this;if(n=n||D,"string"==typeof e){if(!(r="<"===e[0]&&">"===e[e.length-1]&&3<=e.length?[null,e,null]:q.exec(e))||!r[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(r[1]){if(t=t instanceof S?t[0]:t,S.merge(this,S.parseHTML(r[1],t&&t.nodeType?t.ownerDocument||t:E,!0)),N.test(r[1])&&S.isPlainObject(t))for(r in t)m(this[r])?this[r](t[r]):this.attr(r,t[r]);return this}return(i=E.getElementById(r[2]))&&(this[0]=i,this.length=1),this}return e.nodeType?(this[0]=e,this.length=1,this):m(e)?void 0!==n.ready?n.ready(e):e(S):S.makeArray(e,this)}).prototype=S.fn,D=S(E);var L=/^(?:parents|prev(?:Until|All))/,H={children:!0,contents:!0,next:!0,prev:!0};function O(e,t){while((e=e[t])&&1!==e.nodeType);return e}S.fn.extend({has:function(e){var t=S(e,this),n=t.length;return this.filter(function(){for(var e=0;e\x20\t\r\n\f]*)/i,he=/^$|^module$|\/(?:java|ecma)script/i;ce=E.createDocumentFragment().appendChild(E.createElement("div")),(fe=E.createElement("input")).setAttribute("type","radio"),fe.setAttribute("checked","checked"),fe.setAttribute("name","t"),ce.appendChild(fe),v.checkClone=ce.cloneNode(!0).cloneNode(!0).lastChild.checked,ce.innerHTML="",v.noCloneChecked=!!ce.cloneNode(!0).lastChild.defaultValue,ce.innerHTML="",v.option=!!ce.lastChild;var ge={thead:[1,"","
"],col:[2,"","
"],tr:[2,"","
"],td:[3,"","
"],_default:[0,"",""]};function ye(e,t){var n;return n="undefined"!=typeof e.getElementsByTagName?e.getElementsByTagName(t||"*"):"undefined"!=typeof e.querySelectorAll?e.querySelectorAll(t||"*"):[],void 0===t||t&&A(e,t)?S.merge([e],n):n}function ve(e,t){for(var n=0,r=e.length;n",""]);var me=/<|&#?\w+;/;function xe(e,t,n,r,i){for(var o,a,s,u,l,c,f=t.createDocumentFragment(),p=[],d=0,h=e.length;d\s*$/g;function je(e,t){return A(e,"table")&&A(11!==t.nodeType?t:t.firstChild,"tr")&&S(e).children("tbody")[0]||e}function De(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function qe(e){return"true/"===(e.type||"").slice(0,5)?e.type=e.type.slice(5):e.removeAttribute("type"),e}function Le(e,t){var n,r,i,o,a,s;if(1===t.nodeType){if(Y.hasData(e)&&(s=Y.get(e).events))for(i in Y.remove(t,"handle events"),s)for(n=0,r=s[i].length;n").attr(n.scriptAttrs||{}).prop({charset:n.scriptCharset,src:n.url}).on("load error",i=function(e){r.remove(),i=null,e&&t("error"===e.type?404:200,e.type)}),E.head.appendChild(r[0])},abort:function(){i&&i()}}});var Ut,Xt=[],Vt=/(=)\?(?=&|$)|\?\?/;S.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Xt.pop()||S.expando+"_"+Ct.guid++;return this[e]=!0,e}}),S.ajaxPrefilter("json jsonp",function(e,t,n){var r,i,o,a=!1!==e.jsonp&&(Vt.test(e.url)?"url":"string"==typeof e.data&&0===(e.contentType||"").indexOf("application/x-www-form-urlencoded")&&Vt.test(e.data)&&"data");if(a||"jsonp"===e.dataTypes[0])return r=e.jsonpCallback=m(e.jsonpCallback)?e.jsonpCallback():e.jsonpCallback,a?e[a]=e[a].replace(Vt,"$1"+r):!1!==e.jsonp&&(e.url+=(Et.test(e.url)?"&":"?")+e.jsonp+"="+r),e.converters["script json"]=function(){return o||S.error(r+" was not called"),o[0]},e.dataTypes[0]="json",i=C[r],C[r]=function(){o=arguments},n.always(function(){void 0===i?S(C).removeProp(r):C[r]=i,e[r]&&(e.jsonpCallback=t.jsonpCallback,Xt.push(r)),o&&m(i)&&i(o[0]),o=i=void 0}),"script"}),v.createHTMLDocument=((Ut=E.implementation.createHTMLDocument("").body).innerHTML="
",2===Ut.childNodes.length),S.parseHTML=function(e,t,n){return"string"!=typeof e?[]:("boolean"==typeof t&&(n=t,t=!1),t||(v.createHTMLDocument?((r=(t=E.implementation.createHTMLDocument("")).createElement("base")).href=E.location.href,t.head.appendChild(r)):t=E),o=!n&&[],(i=N.exec(e))?[t.createElement(i[1])]:(i=xe([e],t,o),o&&o.length&&S(o).remove(),S.merge([],i.childNodes)));var r,i,o},S.fn.load=function(e,t,n){var r,i,o,a=this,s=e.indexOf(" ");return-1").append(S.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},S.expr.pseudos.animated=function(t){return S.grep(S.timers,function(e){return t===e.elem}).length},S.offset={setOffset:function(e,t,n){var r,i,o,a,s,u,l=S.css(e,"position"),c=S(e),f={};"static"===l&&(e.style.position="relative"),s=c.offset(),o=S.css(e,"top"),u=S.css(e,"left"),("absolute"===l||"fixed"===l)&&-1<(o+u).indexOf("auto")?(a=(r=c.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(u)||0),m(t)&&(t=t.call(e,n,S.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):c.css(f)}},S.fn.extend({offset:function(t){if(arguments.length)return void 0===t?this:this.each(function(e){S.offset.setOffset(this,t,e)});var e,n,r=this[0];return r?r.getClientRects().length?(e=r.getBoundingClientRect(),n=r.ownerDocument.defaultView,{top:e.top+n.pageYOffset,left:e.left+n.pageXOffset}):{top:0,left:0}:void 0},position:function(){if(this[0]){var e,t,n,r=this[0],i={top:0,left:0};if("fixed"===S.css(r,"position"))t=r.getBoundingClientRect();else{t=this.offset(),n=r.ownerDocument,e=r.offsetParent||n.documentElement;while(e&&(e===n.body||e===n.documentElement)&&"static"===S.css(e,"position"))e=e.parentNode;e&&e!==r&&1===e.nodeType&&((i=S(e).offset()).top+=S.css(e,"borderTopWidth",!0),i.left+=S.css(e,"borderLeftWidth",!0))}return{top:t.top-i.top-S.css(r,"marginTop",!0),left:t.left-i.left-S.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var e=this.offsetParent;while(e&&"static"===S.css(e,"position"))e=e.offsetParent;return e||re})}}),S.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(t,i){var o="pageYOffset"===i;S.fn[t]=function(e){return B(this,function(e,t,n){var r;if(x(e)?r=e:9===e.nodeType&&(r=e.defaultView),void 0===n)return r?r[i]:e[t];r?r.scrollTo(o?r.pageXOffset:n,o?n:r.pageYOffset):e[t]=n},t,e,arguments.length)}}),S.each(["top","left"],function(e,n){S.cssHooks[n]=_e(v.pixelPosition,function(e,t){if(t)return t=Be(e,n),Pe.test(t)?S(e).position()[n]+"px":t})}),S.each({Height:"height",Width:"width"},function(a,s){S.each({padding:"inner"+a,content:s,"":"outer"+a},function(r,o){S.fn[o]=function(e,t){var n=arguments.length&&(r||"boolean"!=typeof e),i=r||(!0===e||!0===t?"margin":"border");return B(this,function(e,t,n){var r;return x(e)?0===o.indexOf("outer")?e["inner"+a]:e.document.documentElement["client"+a]:9===e.nodeType?(r=e.documentElement,Math.max(e.body["scroll"+a],r["scroll"+a],e.body["offset"+a],r["offset"+a],r["client"+a])):void 0===n?S.css(e,t,i):S.style(e,t,n,i)},s,n?e:void 0,n)}})}),S.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){S.fn[t]=function(e){return this.on(t,e)}}),S.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)},hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)}}),S.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(e,n){S.fn[n]=function(e,t){return 0",options:{classes:{},disabled:!1,create:null},_createWidget:function(t,e){e=x(e||this.defaultElement||this)[0],this.element=x(e),this.uuid=i++,this.eventNamespace="."+this.widgetName+this.uuid,this.bindings=x(),this.hoverable=x(),this.focusable=x(),this.classesElementLookup={},e!==this&&(x.data(e,this.widgetFullName,this),this._on(!0,this.element,{remove:function(t){t.target===e&&this.destroy()}}),this.document=x(e.style?e.ownerDocument:e.document||e),this.window=x(this.document[0].defaultView||this.document[0].parentWindow)),this.options=x.widget.extend({},this.options,this._getCreateOptions(),t),this._create(),this.options.disabled&&this._setOptionDisabled(this.options.disabled),this._trigger("create",null,this._getCreateEventData()),this._init()},_getCreateOptions:function(){return{}},_getCreateEventData:x.noop,_create:x.noop,_init:x.noop,destroy:function(){var i=this;this._destroy(),x.each(this.classesElementLookup,function(t,e){i._removeClass(e,t)}),this.element.off(this.eventNamespace).removeData(this.widgetFullName),this.widget().off(this.eventNamespace).removeAttr("aria-disabled"),this.bindings.off(this.eventNamespace)},_destroy:x.noop,widget:function(){return this.element},option:function(t,e){var i,s,n,o=t;if(0===arguments.length)return x.widget.extend({},this.options);if("string"==typeof t)if(o={},t=(i=t.split(".")).shift(),i.length){for(s=o[t]=x.widget.extend({},this.options[t]),n=0;n
"),i=e.children()[0];return x("body").append(e),t=i.offsetWidth,e.css("overflow","scroll"),t===(i=i.offsetWidth)&&(i=e[0].clientWidth),e.remove(),s=t-i},getScrollInfo:function(t){var e=t.isWindow||t.isDocument?"":t.element.css("overflow-x"),i=t.isWindow||t.isDocument?"":t.element.css("overflow-y"),e="scroll"===e||"auto"===e&&t.widthC(E(s),E(n))?o.important="horizontal":o.important="vertical",c.using.call(this,t,o)}),l.offset(x.extend(u,{using:t}))})},x.ui.position={fit:{left:function(t,e){var i=e.within,s=i.isWindow?i.scrollLeft:i.offset.left,n=i.width,o=t.left-e.collisionPosition.marginLeft,l=s-o,a=o+e.collisionWidth-n-s;e.collisionWidth>n?0n?0",delay:300,options:{icons:{submenu:"ui-icon-caret-1-e"},items:"> *",menus:"ul",position:{my:"left top",at:"right top"},role:"menu",blur:null,focus:null,select:null},_create:function(){this.activeMenu=this.element,this.mouseHandled=!1,this.lastMousePosition={x:null,y:null},this.element.uniqueId().attr({role:this.options.role,tabIndex:0}),this._addClass("ui-menu","ui-widget ui-widget-content"),this._on({"mousedown .ui-menu-item":function(t){t.preventDefault(),this._activateItem(t)},"click .ui-menu-item":function(t){var e=x(t.target),i=x(x.ui.safeActiveElement(this.document[0]));!this.mouseHandled&&e.not(".ui-state-disabled").length&&(this.select(t),t.isPropagationStopped()||(this.mouseHandled=!0),e.has(".ui-menu").length?this.expand(t):!this.element.is(":focus")&&i.closest(".ui-menu").length&&(this.element.trigger("focus",[!0]),this.active&&1===this.active.parents(".ui-menu").length&&clearTimeout(this.timer)))},"mouseenter .ui-menu-item":"_activateItem","mousemove .ui-menu-item":"_activateItem",mouseleave:"collapseAll","mouseleave .ui-menu":"collapseAll",focus:function(t,e){var i=this.active||this._menuItems().first();e||this.focus(t,i)},blur:function(t){this._delay(function(){x.contains(this.element[0],x.ui.safeActiveElement(this.document[0]))||this.collapseAll(t)})},keydown:"_keydown"}),this.refresh(),this._on(this.document,{click:function(t){this._closeOnDocumentClick(t)&&this.collapseAll(t,!0),this.mouseHandled=!1}})},_activateItem:function(t){var e,i;this.previousFilter||t.clientX===this.lastMousePosition.x&&t.clientY===this.lastMousePosition.y||(this.lastMousePosition={x:t.clientX,y:t.clientY},e=x(t.target).closest(".ui-menu-item"),i=x(t.currentTarget),e[0]===i[0]&&(i.is(".ui-state-active")||(this._removeClass(i.siblings().children(".ui-state-active"),null,"ui-state-active"),this.focus(t,i))))},_destroy:function(){var t=this.element.find(".ui-menu-item").removeAttr("role aria-disabled").children(".ui-menu-item-wrapper").removeUniqueId().removeAttr("tabIndex role aria-haspopup");this.element.removeAttr("aria-activedescendant").find(".ui-menu").addBack().removeAttr("role aria-labelledby aria-expanded aria-hidden aria-disabled tabIndex").removeUniqueId().show(),t.children().each(function(){var t=x(this);t.data("ui-menu-submenu-caret")&&t.remove()})},_keydown:function(t){var e,i,s,n=!0;switch(t.keyCode){case x.ui.keyCode.PAGE_UP:this.previousPage(t);break;case x.ui.keyCode.PAGE_DOWN:this.nextPage(t);break;case x.ui.keyCode.HOME:this._move("first","first",t);break;case x.ui.keyCode.END:this._move("last","last",t);break;case x.ui.keyCode.UP:this.previous(t);break;case x.ui.keyCode.DOWN:this.next(t);break;case x.ui.keyCode.LEFT:this.collapse(t);break;case x.ui.keyCode.RIGHT:this.active&&!this.active.is(".ui-state-disabled")&&this.expand(t);break;case x.ui.keyCode.ENTER:case x.ui.keyCode.SPACE:this._activate(t);break;case x.ui.keyCode.ESCAPE:this.collapse(t);break;default:e=this.previousFilter||"",s=n=!1,i=96<=t.keyCode&&t.keyCode<=105?(t.keyCode-96).toString():String.fromCharCode(t.keyCode),clearTimeout(this.filterTimer),i===e?s=!0:i=e+i,e=this._filterMenuItems(i),(e=s&&-1!==e.index(this.active.next())?this.active.nextAll(".ui-menu-item"):e).length||(i=String.fromCharCode(t.keyCode),e=this._filterMenuItems(i)),e.length?(this.focus(t,e),this.previousFilter=i,this.filterTimer=this._delay(function(){delete this.previousFilter},1e3)):delete this.previousFilter}n&&t.preventDefault()},_activate:function(t){this.active&&!this.active.is(".ui-state-disabled")&&(this.active.children("[aria-haspopup='true']").length?this.expand(t):this.select(t))},refresh:function(){var t,e,s=this,n=this.options.icons.submenu,i=this.element.find(this.options.menus);this._toggleClass("ui-menu-icons",null,!!this.element.find(".ui-icon").length),e=i.filter(":not(.ui-menu)").hide().attr({role:this.options.role,"aria-hidden":"true","aria-expanded":"false"}).each(function(){var t=x(this),e=t.prev(),i=x("").data("ui-menu-submenu-caret",!0);s._addClass(i,"ui-menu-icon","ui-icon "+n),e.attr("aria-haspopup","true").prepend(i),t.attr("aria-labelledby",e.attr("id"))}),this._addClass(e,"ui-menu","ui-widget ui-widget-content ui-front"),(t=i.add(this.element).find(this.options.items)).not(".ui-menu-item").each(function(){var t=x(this);s._isDivider(t)&&s._addClass(t,"ui-menu-divider","ui-widget-content")}),i=(e=t.not(".ui-menu-item, .ui-menu-divider")).children().not(".ui-menu").uniqueId().attr({tabIndex:-1,role:this._itemRole()}),this._addClass(e,"ui-menu-item")._addClass(i,"ui-menu-item-wrapper"),t.filter(".ui-state-disabled").attr("aria-disabled","true"),this.active&&!x.contains(this.element[0],this.active[0])&&this.blur()},_itemRole:function(){return{menu:"menuitem",listbox:"option"}[this.options.role]},_setOption:function(t,e){var i;"icons"===t&&(i=this.element.find(".ui-menu-icon"),this._removeClass(i,null,this.options.icons.submenu)._addClass(i,null,e.submenu)),this._super(t,e)},_setOptionDisabled:function(t){this._super(t),this.element.attr("aria-disabled",String(t)),this._toggleClass(null,"ui-state-disabled",!!t)},focus:function(t,e){var i;this.blur(t,t&&"focus"===t.type),this._scrollIntoView(e),this.active=e.first(),i=this.active.children(".ui-menu-item-wrapper"),this._addClass(i,null,"ui-state-active"),this.options.role&&this.element.attr("aria-activedescendant",i.attr("id")),i=this.active.parent().closest(".ui-menu-item").children(".ui-menu-item-wrapper"),this._addClass(i,null,"ui-state-active"),t&&"keydown"===t.type?this._close():this.timer=this._delay(function(){this._close()},this.delay),(i=e.children(".ui-menu")).length&&t&&/^mouse/.test(t.type)&&this._startOpening(i),this.activeMenu=e.parent(),this._trigger("focus",t,{item:e})},_scrollIntoView:function(t){var e,i,s;this._hasScroll()&&(i=parseFloat(x.css(this.activeMenu[0],"borderTopWidth"))||0,s=parseFloat(x.css(this.activeMenu[0],"paddingTop"))||0,e=t.offset().top-this.activeMenu.offset().top-i-s,i=this.activeMenu.scrollTop(),s=this.activeMenu.height(),t=t.outerHeight(),e<0?this.activeMenu.scrollTop(i+e):s",options:{appendTo:null,autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null,change:null,close:null,focus:null,open:null,response:null,search:null,select:null},requestIndex:0,pending:0,liveRegionTimer:null,_create:function(){var i,s,n,t=this.element[0].nodeName.toLowerCase(),e="textarea"===t,t="input"===t;this.isMultiLine=e||!t&&this._isContentEditable(this.element),this.valueMethod=this.element[e||t?"val":"text"],this.isNewMenu=!0,this._addClass("ui-autocomplete-input"),this.element.attr("autocomplete","off"),this._on(this.element,{keydown:function(t){if(this.element.prop("readOnly"))s=n=i=!0;else{s=n=i=!1;var e=x.ui.keyCode;switch(t.keyCode){case e.PAGE_UP:i=!0,this._move("previousPage",t);break;case e.PAGE_DOWN:i=!0,this._move("nextPage",t);break;case e.UP:i=!0,this._keyEvent("previous",t);break;case e.DOWN:i=!0,this._keyEvent("next",t);break;case e.ENTER:this.menu.active&&(i=!0,t.preventDefault(),this.menu.select(t));break;case e.TAB:this.menu.active&&this.menu.select(t);break;case e.ESCAPE:this.menu.element.is(":visible")&&(this.isMultiLine||this._value(this.term),this.close(t),t.preventDefault());break;default:s=!0,this._searchTimeout(t)}}},keypress:function(t){if(i)return i=!1,void(this.isMultiLine&&!this.menu.element.is(":visible")||t.preventDefault());if(!s){var e=x.ui.keyCode;switch(t.keyCode){case e.PAGE_UP:this._move("previousPage",t);break;case e.PAGE_DOWN:this._move("nextPage",t);break;case e.UP:this._keyEvent("previous",t);break;case e.DOWN:this._keyEvent("next",t)}}},input:function(t){if(n)return n=!1,void t.preventDefault();this._searchTimeout(t)},focus:function(){this.selectedItem=null,this.previous=this._value()},blur:function(t){clearTimeout(this.searching),this.close(t),this._change(t)}}),this._initSource(),this.menu=x("